Mercurial > repos > lain > history_metadata_extractor
comparison example/example.html @ 1:c7f4f2ac38f2 draft default tip
" master branch Updating"
author | lain |
---|---|
date | Tue, 09 Aug 2022 15:19:45 +0000 |
parents | |
children |
comparison
equal
deleted
inserted
replaced
0:426b0f85a311 | 1:c7f4f2ac38f2 |
---|---|
1 | |
2 <!doctype HTML> | |
3 <html> | |
4 <style> | |
5 html, body { | |
6 height: 100% ; | |
7 } | |
8 | |
9 .history_metadata_extractor_h2.kawaii:before, | |
10 .history_metadata_extractor_h2.kawaii:after{content:'≧◡≦'} | |
11 .history_metadata_extractor_status.kawaii:after, | |
12 .history_metadata_extractor_status.kawaii:before{content: '(●´ω`●)'} | |
13 .history_metadata_extractor_glitter.kawaii:before{content: '(ノ◕ヮ◕)ノ*:・゚✧'} | |
14 #glitter-generator{cursor: pointer} | |
15 @charset "UTF-8";/*! | |
16 * Bootstrap v5.2.0-beta1 (https://getbootstrap.com/) | |
17 * Copyright 2011-2022 The Bootstrap Authors | |
18 * Copyright 2011-2022 Twitter, Inc. | |
19 * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) | |
20 */:root{--bs-blue:#0d6efd;--bs-indigo:#6610f2;--bs-purple:#6f42c1;--bs-pink:#d63384;--bs-red:#dc3545;--bs-orange:#fd7e14;--bs-yellow:#ffc107;--bs-green:#198754;--bs-teal:#20c997;--bs-cyan:#0dcaf0;--bs-black:#000;--bs-white:#fff;--bs-gray:#6c757d;--bs-gray-dark:#343a40;--bs-gray-100:#f8f9fa;--bs-gray-200:#e9ecef;--bs-gray-300:#dee2e6;--bs-gray-400:#ced4da;--bs-gray-500:#adb5bd;--bs-gray-600:#6c757d;--bs-gray-700:#495057;--bs-gray-800:#343a40;--bs-gray-900:#212529;--bs-primary:#0d6efd;--bs-secondary:#6c757d;--bs-success:#198754;--bs-info:#0dcaf0;--bs-warning:#ffc107;--bs-danger:#dc3545;--bs-light:#f8f9fa;--bs-dark:#212529;--bs-primary-rgb:13,110,253;--bs-secondary-rgb:108,117,125;--bs-success-rgb:25,135,84;--bs-info-rgb:13,202,240;--bs-warning-rgb:255,193,7;--bs-danger-rgb:220,53,69;--bs-light-rgb:248,249,250;--bs-dark-rgb:33,37,41;--bs-white-rgb:255,255,255;--bs-black-rgb:0,0,0;--bs-body-color-rgb:33,37,41;--bs-body-bg-rgb:255,255,255;--bs-font-sans-serif:system-ui,-apple-system,"Segoe UI",Roboto,"Helvetica Neue","Noto Sans","Liberation Sans",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--bs-font-monospace:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;--bs-gradient:linear-gradient(180deg, rgba(255, 255, 255, 0.15), rgba(255, 255, 255, 0));--bs-body-font-family:var(--bs-font-sans-serif);--bs-body-font-size:1rem;--bs-body-font-weight:400;--bs-body-line-height:1.5;--bs-body-color:#212529;--bs-body-bg:#fff;--bs-border-width:1px;--bs-border-style:solid;--bs-border-color:#dee2e6;--bs-border-color-translucent:rgba(0, 0, 0, 0.175);--bs-border-radius:0.375rem;--bs-border-radius-sm:0.25rem;--bs-border-radius-lg:0.5rem;--bs-border-radius-xl:1rem;--bs-border-radius-2xl:2rem;--bs-border-radius-pill:50rem;--bs-heading-color: ;--bs-link-color:#0d6efd;--bs-link-hover-color:#0a58ca;--bs-code-color:#d63384;--bs-highlight-bg:#fff3cd}*,::after,::before{box-sizing:border-box}@media (prefers-reduced-motion:no-preference){:root{scroll-behavior:smooth}}body{margin:0;font-family:var(--bs-body-font-family);font-size:var(--bs-body-font-size);font-weight:var(--bs-body-font-weight);line-height:var(--bs-body-line-height);color:var(--bs-body-color);text-align:var(--bs-body-text-align);background-color:var(--bs-body-bg);-webkit-text-size-adjust:100%;-webkit-tap-highlight-color:transparent}hr{margin:1rem 0;color:inherit;border:0;border-top:1px solid;opacity:.25}.h1,.h2,.h3,.h4,.h5,.h6,h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:.5rem;font-weight:500;line-height:1.2;color:var(--bs-heading-color)}.h1,h1{font-size:calc(1.375rem + 1.5vw)}@media (min-width:1200px){.h1,h1{font-size:2.5rem}}.h2,h2{font-size:calc(1.325rem + .9vw)}@media (min-width:1200px){.h2,h2{font-size:2rem}}.h3,h3{font-size:calc(1.3rem + .6vw)}@media (min-width:1200px){.h3,h3{font-size:1.75rem}}.h4,h4{font-size:calc(1.275rem + .3vw)}@media (min-width:1200px){.h4,h4{font-size:1.5rem}}.h5,h5{font-size:1.25rem}.h6,h6{font-size:1rem}p{margin-top:0;margin-bottom:1rem}abbr[title]{-webkit-text-decoration:underline dotted;text-decoration:underline dotted;cursor:help;-webkit-text-decoration-skip-ink:none;text-decoration-skip-ink:none}address{margin-bottom:1rem;font-style:normal;line-height:inherit}ol,ul{padding-left:2rem}dl,ol,ul{margin-top:0;margin-bottom:1rem}ol ol,ol ul,ul ol,ul ul{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem}b,strong{font-weight:bolder}.small,small{font-size:.875em}.mark,mark{padding:.1875em;background-color:var(--bs-highlight-bg)}sub,sup{position:relative;font-size:.75em;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}a{color:var(--bs-link-color);text-decoration:underline}a:hover{color:var(--bs-link-hover-color)}a:not([href]):not([class]),a:not([href]):not([class]):hover{color:inherit;text-decoration:none}code,kbd,pre,samp{font-family:var(--bs-font-monospace);font-size:1em}pre{display:block;margin-top:0;margin-bottom:1rem;overflow:auto;font-size:.875em}pre code{font-size:inherit;color:inherit;word-break:normal}code{font-size:.875em;color:var(--bs-code-color);word-wrap:break-word}a>code{color:inherit}kbd{padding:.1875rem .375rem;font-size:.875em;color:var(--bs-body-bg);background-color:var(--bs-body-color);border-radius:.25rem}kbd kbd{padding:0;font-size:1em}figure{margin:0 0 1rem}img,svg{vertical-align:middle}table{caption-side:bottom;border-collapse:collapse}caption{padding-top:.5rem;padding-bottom:.5rem;color:rgba(var(--bs-body-color-rgb),.75);text-align:left}th{text-align:inherit;text-align:-webkit-match-parent}tbody,td,tfoot,th,thead,tr{border-color:inherit;border-style:solid;border-width:0}label{display:inline-block}button{border-radius:0}button:focus:not(:focus-visible){outline:0}button,input,optgroup,select,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,select{text-transform:none}[role=button]{cursor:pointer}select{word-wrap:normal}select:disabled{opacity:1}[list]:not([type=date]):not([type=datetime-local]):not([type=month]):not([type=week]):not([type=time])::-webkit-calendar-picker-indicator{display:none!important}[type=button],[type=reset],[type=submit],button{-webkit-appearance:button}[type=button]:not(:disabled),[type=reset]:not(:disabled),[type=submit]:not(:disabled),button:not(:disabled){cursor:pointer}::-moz-focus-inner{padding:0;border-style:none}textarea{resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{float:left;width:100%;padding:0;margin-bottom:.5rem;font-size:calc(1.275rem + .3vw);line-height:inherit}@media (min-width:1200px){legend{font-size:1.5rem}}legend+*{clear:left}::-webkit-datetime-edit-day-field,::-webkit-datetime-edit-fields-wrapper,::-webkit-datetime-edit-hour-field,::-webkit-datetime-edit-minute,::-webkit-datetime-edit-month-field,::-webkit-datetime-edit-text,::-webkit-datetime-edit-year-field{padding:0}::-webkit-inner-spin-button{height:auto}[type=search]{outline-offset:-2px;-webkit-appearance:textfield}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-color-swatch-wrapper{padding:0}::-webkit-file-upload-button{font:inherit;-webkit-appearance:button}::file-selector-button{font:inherit;-webkit-appearance:button}output{display:inline-block}iframe{border:0}summary{display:list-item;cursor:pointer}progress{vertical-align:baseline}[hidden]{display:none!important}.lead{font-size:1.25rem;font-weight:300}.display-1{font-size:calc(1.625rem + 4.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-1{font-size:5rem}}.display-2{font-size:calc(1.575rem + 3.9vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-2{font-size:4.5rem}}.display-3{font-size:calc(1.525rem + 3.3vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-3{font-size:4rem}}.display-4{font-size:calc(1.475rem + 2.7vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-4{font-size:3.5rem}}.display-5{font-size:calc(1.425rem + 2.1vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-5{font-size:3rem}}.display-6{font-size:calc(1.375rem + 1.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-6{font-size:2.5rem}}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:.875em;text-transform:uppercase}.blockquote{margin-bottom:1rem;font-size:1.25rem}.blockquote>:last-child{margin-bottom:0}.blockquote-footer{margin-top:-1rem;margin-bottom:1rem;font-size:.875em;color:#6c757d}.blockquote-footer::before{content:"— "}.img-fluid{max-width:100%;height:auto}.img-thumbnail{padding:.25rem;background-color:#fff;border:1px solid var(--bs-border-color);border-radius:.375rem;max-width:100%;height:auto}.figure{display:inline-block}.figure-img{margin-bottom:.5rem;line-height:1}.figure-caption{font-size:.875em;color:#6c757d}.container,.container-fluid,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{--bs-gutter-x:1.5rem;--bs-gutter-y:0;width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-right:auto;margin-left:auto}@media (min-width:576px){.container,.container-sm{max-width:540px}}@media (min-width:768px){.container,.container-md,.container-sm{max-width:720px}}@media (min-width:992px){.container,.container-lg,.container-md,.container-sm{max-width:960px}}@media (min-width:1200px){.container,.container-lg,.container-md,.container-sm,.container-xl{max-width:1140px}}@media (min-width:1400px){.container,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{max-width:1320px}}.row{--bs-gutter-x:1.5rem;--bs-gutter-y:0;display:flex;flex-wrap:wrap;margin-top:calc(-1 * var(--bs-gutter-y));margin-right:calc(-.5 * var(--bs-gutter-x));margin-left:calc(-.5 * var(--bs-gutter-x))}.row>*{flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-top:var(--bs-gutter-y)}.col{flex:1 0 0%}.row-cols-auto>*{flex:0 0 auto;width:auto}.row-cols-1>*{flex:0 0 auto;width:100%}.row-cols-2>*{flex:0 0 auto;width:50%}.row-cols-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-4>*{flex:0 0 auto;width:25%}.row-cols-5>*{flex:0 0 auto;width:20%}.row-cols-6>*{flex:0 0 auto;width:16.6666666667%}.col-auto{flex:0 0 auto;width:auto}.col-1{flex:0 0 auto;width:8.33333333%}.col-2{flex:0 0 auto;width:16.66666667%}.col-3{flex:0 0 auto;width:25%}.col-4{flex:0 0 auto;width:33.33333333%}.col-5{flex:0 0 auto;width:41.66666667%}.col-6{flex:0 0 auto;width:50%}.col-7{flex:0 0 auto;width:58.33333333%}.col-8{flex:0 0 auto;width:66.66666667%}.col-9{flex:0 0 auto;width:75%}.col-10{flex:0 0 auto;width:83.33333333%}.col-11{flex:0 0 auto;width:91.66666667%}.col-12{flex:0 0 auto;width:100%}.offset-1{margin-left:8.33333333%}.offset-2{margin-left:16.66666667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.33333333%}.offset-5{margin-left:41.66666667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.33333333%}.offset-8{margin-left:66.66666667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.33333333%}.offset-11{margin-left:91.66666667%}.g-0,.gx-0{--bs-gutter-x:0}.g-0,.gy-0{--bs-gutter-y:0}.g-1,.gx-1{--bs-gutter-x:0.25rem}.g-1,.gy-1{--bs-gutter-y:0.25rem}.g-2,.gx-2{--bs-gutter-x:0.5rem}.g-2,.gy-2{--bs-gutter-y:0.5rem}.g-3,.gx-3{--bs-gutter-x:1rem}.g-3,.gy-3{--bs-gutter-y:1rem}.g-4,.gx-4{--bs-gutter-x:1.5rem}.g-4,.gy-4{--bs-gutter-y:1.5rem}.g-5,.gx-5{--bs-gutter-x:3rem}.g-5,.gy-5{--bs-gutter-y:3rem}@media (min-width:576px){.col-sm{flex:1 0 0%}.row-cols-sm-auto>*{flex:0 0 auto;width:auto}.row-cols-sm-1>*{flex:0 0 auto;width:100%}.row-cols-sm-2>*{flex:0 0 auto;width:50%}.row-cols-sm-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-sm-4>*{flex:0 0 auto;width:25%}.row-cols-sm-5>*{flex:0 0 auto;width:20%}.row-cols-sm-6>*{flex:0 0 auto;width:16.6666666667%}.col-sm-auto{flex:0 0 auto;width:auto}.col-sm-1{flex:0 0 auto;width:8.33333333%}.col-sm-2{flex:0 0 auto;width:16.66666667%}.col-sm-3{flex:0 0 auto;width:25%}.col-sm-4{flex:0 0 auto;width:33.33333333%}.col-sm-5{flex:0 0 auto;width:41.66666667%}.col-sm-6{flex:0 0 auto;width:50%}.col-sm-7{flex:0 0 auto;width:58.33333333%}.col-sm-8{flex:0 0 auto;width:66.66666667%}.col-sm-9{flex:0 0 auto;width:75%}.col-sm-10{flex:0 0 auto;width:83.33333333%}.col-sm-11{flex:0 0 auto;width:91.66666667%}.col-sm-12{flex:0 0 auto;width:100%}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.33333333%}.offset-sm-2{margin-left:16.66666667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.33333333%}.offset-sm-5{margin-left:41.66666667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.33333333%}.offset-sm-8{margin-left:66.66666667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.33333333%}.offset-sm-11{margin-left:91.66666667%}.g-sm-0,.gx-sm-0{--bs-gutter-x:0}.g-sm-0,.gy-sm-0{--bs-gutter-y:0}.g-sm-1,.gx-sm-1{--bs-gutter-x:0.25rem}.g-sm-1,.gy-sm-1{--bs-gutter-y:0.25rem}.g-sm-2,.gx-sm-2{--bs-gutter-x:0.5rem}.g-sm-2,.gy-sm-2{--bs-gutter-y:0.5rem}.g-sm-3,.gx-sm-3{--bs-gutter-x:1rem}.g-sm-3,.gy-sm-3{--bs-gutter-y:1rem}.g-sm-4,.gx-sm-4{--bs-gutter-x:1.5rem}.g-sm-4,.gy-sm-4{--bs-gutter-y:1.5rem}.g-sm-5,.gx-sm-5{--bs-gutter-x:3rem}.g-sm-5,.gy-sm-5{--bs-gutter-y:3rem}}@media (min-width:768px){.col-md{flex:1 0 0%}.row-cols-md-auto>*{flex:0 0 auto;width:auto}.row-cols-md-1>*{flex:0 0 auto;width:100%}.row-cols-md-2>*{flex:0 0 auto;width:50%}.row-cols-md-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-md-4>*{flex:0 0 auto;width:25%}.row-cols-md-5>*{flex:0 0 auto;width:20%}.row-cols-md-6>*{flex:0 0 auto;width:16.6666666667%}.col-md-auto{flex:0 0 auto;width:auto}.col-md-1{flex:0 0 auto;width:8.33333333%}.col-md-2{flex:0 0 auto;width:16.66666667%}.col-md-3{flex:0 0 auto;width:25%}.col-md-4{flex:0 0 auto;width:33.33333333%}.col-md-5{flex:0 0 auto;width:41.66666667%}.col-md-6{flex:0 0 auto;width:50%}.col-md-7{flex:0 0 auto;width:58.33333333%}.col-md-8{flex:0 0 auto;width:66.66666667%}.col-md-9{flex:0 0 auto;width:75%}.col-md-10{flex:0 0 auto;width:83.33333333%}.col-md-11{flex:0 0 auto;width:91.66666667%}.col-md-12{flex:0 0 auto;width:100%}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.33333333%}.offset-md-2{margin-left:16.66666667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.33333333%}.offset-md-5{margin-left:41.66666667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.33333333%}.offset-md-8{margin-left:66.66666667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.33333333%}.offset-md-11{margin-left:91.66666667%}.g-md-0,.gx-md-0{--bs-gutter-x:0}.g-md-0,.gy-md-0{--bs-gutter-y:0}.g-md-1,.gx-md-1{--bs-gutter-x:0.25rem}.g-md-1,.gy-md-1{--bs-gutter-y:0.25rem}.g-md-2,.gx-md-2{--bs-gutter-x:0.5rem}.g-md-2,.gy-md-2{--bs-gutter-y:0.5rem}.g-md-3,.gx-md-3{--bs-gutter-x:1rem}.g-md-3,.gy-md-3{--bs-gutter-y:1rem}.g-md-4,.gx-md-4{--bs-gutter-x:1.5rem}.g-md-4,.gy-md-4{--bs-gutter-y:1.5rem}.g-md-5,.gx-md-5{--bs-gutter-x:3rem}.g-md-5,.gy-md-5{--bs-gutter-y:3rem}}@media (min-width:992px){.col-lg{flex:1 0 0%}.row-cols-lg-auto>*{flex:0 0 auto;width:auto}.row-cols-lg-1>*{flex:0 0 auto;width:100%}.row-cols-lg-2>*{flex:0 0 auto;width:50%}.row-cols-lg-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-lg-4>*{flex:0 0 auto;width:25%}.row-cols-lg-5>*{flex:0 0 auto;width:20%}.row-cols-lg-6>*{flex:0 0 auto;width:16.6666666667%}.col-lg-auto{flex:0 0 auto;width:auto}.col-lg-1{flex:0 0 auto;width:8.33333333%}.col-lg-2{flex:0 0 auto;width:16.66666667%}.col-lg-3{flex:0 0 auto;width:25%}.col-lg-4{flex:0 0 auto;width:33.33333333%}.col-lg-5{flex:0 0 auto;width:41.66666667%}.col-lg-6{flex:0 0 auto;width:50%}.col-lg-7{flex:0 0 auto;width:58.33333333%}.col-lg-8{flex:0 0 auto;width:66.66666667%}.col-lg-9{flex:0 0 auto;width:75%}.col-lg-10{flex:0 0 auto;width:83.33333333%}.col-lg-11{flex:0 0 auto;width:91.66666667%}.col-lg-12{flex:0 0 auto;width:100%}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.33333333%}.offset-lg-2{margin-left:16.66666667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.33333333%}.offset-lg-5{margin-left:41.66666667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.33333333%}.offset-lg-8{margin-left:66.66666667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.33333333%}.offset-lg-11{margin-left:91.66666667%}.g-lg-0,.gx-lg-0{--bs-gutter-x:0}.g-lg-0,.gy-lg-0{--bs-gutter-y:0}.g-lg-1,.gx-lg-1{--bs-gutter-x:0.25rem}.g-lg-1,.gy-lg-1{--bs-gutter-y:0.25rem}.g-lg-2,.gx-lg-2{--bs-gutter-x:0.5rem}.g-lg-2,.gy-lg-2{--bs-gutter-y:0.5rem}.g-lg-3,.gx-lg-3{--bs-gutter-x:1rem}.g-lg-3,.gy-lg-3{--bs-gutter-y:1rem}.g-lg-4,.gx-lg-4{--bs-gutter-x:1.5rem}.g-lg-4,.gy-lg-4{--bs-gutter-y:1.5rem}.g-lg-5,.gx-lg-5{--bs-gutter-x:3rem}.g-lg-5,.gy-lg-5{--bs-gutter-y:3rem}}@media (min-width:1200px){.col-xl{flex:1 0 0%}.row-cols-xl-auto>*{flex:0 0 auto;width:auto}.row-cols-xl-1>*{flex:0 0 auto;width:100%}.row-cols-xl-2>*{flex:0 0 auto;width:50%}.row-cols-xl-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-xl-4>*{flex:0 0 auto;width:25%}.row-cols-xl-5>*{flex:0 0 auto;width:20%}.row-cols-xl-6>*{flex:0 0 auto;width:16.6666666667%}.col-xl-auto{flex:0 0 auto;width:auto}.col-xl-1{flex:0 0 auto;width:8.33333333%}.col-xl-2{flex:0 0 auto;width:16.66666667%}.col-xl-3{flex:0 0 auto;width:25%}.col-xl-4{flex:0 0 auto;width:33.33333333%}.col-xl-5{flex:0 0 auto;width:41.66666667%}.col-xl-6{flex:0 0 auto;width:50%}.col-xl-7{flex:0 0 auto;width:58.33333333%}.col-xl-8{flex:0 0 auto;width:66.66666667%}.col-xl-9{flex:0 0 auto;width:75%}.col-xl-10{flex:0 0 auto;width:83.33333333%}.col-xl-11{flex:0 0 auto;width:91.66666667%}.col-xl-12{flex:0 0 auto;width:100%}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.33333333%}.offset-xl-2{margin-left:16.66666667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.33333333%}.offset-xl-5{margin-left:41.66666667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.33333333%}.offset-xl-8{margin-left:66.66666667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.33333333%}.offset-xl-11{margin-left:91.66666667%}.g-xl-0,.gx-xl-0{--bs-gutter-x:0}.g-xl-0,.gy-xl-0{--bs-gutter-y:0}.g-xl-1,.gx-xl-1{--bs-gutter-x:0.25rem}.g-xl-1,.gy-xl-1{--bs-gutter-y:0.25rem}.g-xl-2,.gx-xl-2{--bs-gutter-x:0.5rem}.g-xl-2,.gy-xl-2{--bs-gutter-y:0.5rem}.g-xl-3,.gx-xl-3{--bs-gutter-x:1rem}.g-xl-3,.gy-xl-3{--bs-gutter-y:1rem}.g-xl-4,.gx-xl-4{--bs-gutter-x:1.5rem}.g-xl-4,.gy-xl-4{--bs-gutter-y:1.5rem}.g-xl-5,.gx-xl-5{--bs-gutter-x:3rem}.g-xl-5,.gy-xl-5{--bs-gutter-y:3rem}}@media (min-width:1400px){.col-xxl{flex:1 0 0%}.row-cols-xxl-auto>*{flex:0 0 auto;width:auto}.row-cols-xxl-1>*{flex:0 0 auto;width:100%}.row-cols-xxl-2>*{flex:0 0 auto;width:50%}.row-cols-xxl-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-xxl-4>*{flex:0 0 auto;width:25%}.row-cols-xxl-5>*{flex:0 0 auto;width:20%}.row-cols-xxl-6>*{flex:0 0 auto;width:16.6666666667%}.col-xxl-auto{flex:0 0 auto;width:auto}.col-xxl-1{flex:0 0 auto;width:8.33333333%}.col-xxl-2{flex:0 0 auto;width:16.66666667%}.col-xxl-3{flex:0 0 auto;width:25%}.col-xxl-4{flex:0 0 auto;width:33.33333333%}.col-xxl-5{flex:0 0 auto;width:41.66666667%}.col-xxl-6{flex:0 0 auto;width:50%}.col-xxl-7{flex:0 0 auto;width:58.33333333%}.col-xxl-8{flex:0 0 auto;width:66.66666667%}.col-xxl-9{flex:0 0 auto;width:75%}.col-xxl-10{flex:0 0 auto;width:83.33333333%}.col-xxl-11{flex:0 0 auto;width:91.66666667%}.col-xxl-12{flex:0 0 auto;width:100%}.offset-xxl-0{margin-left:0}.offset-xxl-1{margin-left:8.33333333%}.offset-xxl-2{margin-left:16.66666667%}.offset-xxl-3{margin-left:25%}.offset-xxl-4{margin-left:33.33333333%}.offset-xxl-5{margin-left:41.66666667%}.offset-xxl-6{margin-left:50%}.offset-xxl-7{margin-left:58.33333333%}.offset-xxl-8{margin-left:66.66666667%}.offset-xxl-9{margin-left:75%}.offset-xxl-10{margin-left:83.33333333%}.offset-xxl-11{margin-left:91.66666667%}.g-xxl-0,.gx-xxl-0{--bs-gutter-x:0}.g-xxl-0,.gy-xxl-0{--bs-gutter-y:0}.g-xxl-1,.gx-xxl-1{--bs-gutter-x:0.25rem}.g-xxl-1,.gy-xxl-1{--bs-gutter-y:0.25rem}.g-xxl-2,.gx-xxl-2{--bs-gutter-x:0.5rem}.g-xxl-2,.gy-xxl-2{--bs-gutter-y:0.5rem}.g-xxl-3,.gx-xxl-3{--bs-gutter-x:1rem}.g-xxl-3,.gy-xxl-3{--bs-gutter-y:1rem}.g-xxl-4,.gx-xxl-4{--bs-gutter-x:1.5rem}.g-xxl-4,.gy-xxl-4{--bs-gutter-y:1.5rem}.g-xxl-5,.gx-xxl-5{--bs-gutter-x:3rem}.g-xxl-5,.gy-xxl-5{--bs-gutter-y:3rem}}.table{--bs-table-color:var(--bs-body-color);--bs-table-bg:transparent;--bs-table-border-color:var(--bs-border-color);--bs-table-accent-bg:transparent;--bs-table-striped-color:var(--bs-body-color);--bs-table-striped-bg:rgba(0, 0, 0, 0.05);--bs-table-active-color:var(--bs-body-color);--bs-table-active-bg:rgba(0, 0, 0, 0.1);--bs-table-hover-color:var(--bs-body-color);--bs-table-hover-bg:rgba(0, 0, 0, 0.075);width:100%;margin-bottom:1rem;color:var(--bs-table-color);vertical-align:top;border-color:var(--bs-table-border-color)}.table>:not(caption)>*>*{padding:.5rem .5rem;background-color:var(--bs-table-bg);border-bottom-width:1px;box-shadow:inset 0 0 0 9999px var(--bs-table-accent-bg)}.table>tbody{vertical-align:inherit}.table>thead{vertical-align:bottom}.table-group-divider{border-top:2px solid currentcolor}.caption-top{caption-side:top}.table-sm>:not(caption)>*>*{padding:.25rem .25rem}.table-bordered>:not(caption)>*{border-width:1px 0}.table-bordered>:not(caption)>*>*{border-width:0 1px}.table-borderless>:not(caption)>*>*{border-bottom-width:0}.table-borderless>:not(:first-child){border-top-width:0}.table-striped>tbody>tr:nth-of-type(odd)>*{--bs-table-accent-bg:var(--bs-table-striped-bg);color:var(--bs-table-striped-color)}.table-striped-columns>:not(caption)>tr>:nth-child(2n){--bs-table-accent-bg:var(--bs-table-striped-bg);color:var(--bs-table-striped-color)}.table-active{--bs-table-accent-bg:var(--bs-table-active-bg);color:var(--bs-table-active-color)}.table-hover>tbody>tr:hover>*{--bs-table-accent-bg:var(--bs-table-hover-bg);color:var(--bs-table-hover-color)}.table-primary{--bs-table-color:#000;--bs-table-bg:#cfe2ff;--bs-table-border-color:#bacbe6;--bs-table-striped-bg:#c5d7f2;--bs-table-striped-color:#000;--bs-table-active-bg:#bacbe6;--bs-table-active-color:#000;--bs-table-hover-bg:#bfd1ec;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-secondary{--bs-table-color:#000;--bs-table-bg:#e2e3e5;--bs-table-border-color:#cbccce;--bs-table-striped-bg:#d7d8da;--bs-table-striped-color:#000;--bs-table-active-bg:#cbccce;--bs-table-active-color:#000;--bs-table-hover-bg:#d1d2d4;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-success{--bs-table-color:#000;--bs-table-bg:#d1e7dd;--bs-table-border-color:#bcd0c7;--bs-table-striped-bg:#c7dbd2;--bs-table-striped-color:#000;--bs-table-active-bg:#bcd0c7;--bs-table-active-color:#000;--bs-table-hover-bg:#c1d6cc;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-info{--bs-table-color:#000;--bs-table-bg:#cff4fc;--bs-table-border-color:#badce3;--bs-table-striped-bg:#c5e8ef;--bs-table-striped-color:#000;--bs-table-active-bg:#badce3;--bs-table-active-color:#000;--bs-table-hover-bg:#bfe2e9;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-warning{--bs-table-color:#000;--bs-table-bg:#fff3cd;--bs-table-border-color:#e6dbb9;--bs-table-striped-bg:#f2e7c3;--bs-table-striped-color:#000;--bs-table-active-bg:#e6dbb9;--bs-table-active-color:#000;--bs-table-hover-bg:#ece1be;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-danger{--bs-table-color:#000;--bs-table-bg:#f8d7da;--bs-table-border-color:#dfc2c4;--bs-table-striped-bg:#eccccf;--bs-table-striped-color:#000;--bs-table-active-bg:#dfc2c4;--bs-table-active-color:#000;--bs-table-hover-bg:#e5c7ca;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-light{--bs-table-color:#000;--bs-table-bg:#f8f9fa;--bs-table-border-color:#dfe0e1;--bs-table-striped-bg:#ecedee;--bs-table-striped-color:#000;--bs-table-active-bg:#dfe0e1;--bs-table-active-color:#000;--bs-table-hover-bg:#e5e6e7;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-dark{--bs-table-color:#fff;--bs-table-bg:#212529;--bs-table-border-color:#373b3e;--bs-table-striped-bg:#2c3034;--bs-table-striped-color:#fff;--bs-table-active-bg:#373b3e;--bs-table-active-color:#fff;--bs-table-hover-bg:#323539;--bs-table-hover-color:#fff;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-responsive{overflow-x:auto;-webkit-overflow-scrolling:touch}@media (max-width:575.98px){.table-responsive-sm{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:767.98px){.table-responsive-md{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:991.98px){.table-responsive-lg{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:1199.98px){.table-responsive-xl{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:1399.98px){.table-responsive-xxl{overflow-x:auto;-webkit-overflow-scrolling:touch}}.form-label{margin-bottom:.5rem}.col-form-label{padding-top:calc(.375rem + 1px);padding-bottom:calc(.375rem + 1px);margin-bottom:0;font-size:inherit;line-height:1.5}.col-form-label-lg{padding-top:calc(.5rem + 1px);padding-bottom:calc(.5rem + 1px);font-size:1.25rem}.col-form-label-sm{padding-top:calc(.25rem + 1px);padding-bottom:calc(.25rem + 1px);font-size:.875rem}.form-text{margin-top:.25rem;font-size:.875em;color:rgba(var(--bs-body-color-rgb),.75)}.form-control{display:block;width:100%;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:#212529;background-color:#fff;background-clip:padding-box;border:1px solid #ced4da;-webkit-appearance:none;-moz-appearance:none;appearance:none;border-radius:.375rem;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control{transition:none}}.form-control[type=file]{overflow:hidden}.form-control[type=file]:not(:disabled):not([readonly]){cursor:pointer}.form-control:focus{color:#212529;background-color:#fff;border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-control::-webkit-date-and-time-value{height:1.5em}.form-control::-moz-placeholder{color:#6c757d;opacity:1}.form-control::placeholder{color:#6c757d;opacity:1}.form-control:disabled,.form-control[readonly]{background-color:#e9ecef;opacity:1}.form-control::-webkit-file-upload-button{padding:.375rem .75rem;margin:-.375rem -.75rem;-webkit-margin-end:.75rem;margin-inline-end:.75rem;color:#212529;background-color:#e9ecef;pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:1px;border-radius:0;-webkit-transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}.form-control::file-selector-button{padding:.375rem .75rem;margin:-.375rem -.75rem;-webkit-margin-end:.75rem;margin-inline-end:.75rem;color:#212529;background-color:#e9ecef;pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:1px;border-radius:0;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control::-webkit-file-upload-button{-webkit-transition:none;transition:none}.form-control::file-selector-button{transition:none}}.form-control:hover:not(:disabled):not([readonly])::-webkit-file-upload-button{background-color:#dde0e3}.form-control:hover:not(:disabled):not([readonly])::file-selector-button{background-color:#dde0e3}.form-control-plaintext{display:block;width:100%;padding:.375rem 0;margin-bottom:0;line-height:1.5;color:#212529;background-color:transparent;border:solid transparent;border-width:1px 0}.form-control-plaintext.form-control-lg,.form-control-plaintext.form-control-sm{padding-right:0;padding-left:0}.form-control-sm{min-height:calc(1.5em + .5rem + 2px);padding:.25rem .5rem;font-size:.875rem;border-radius:.25rem}.form-control-sm::-webkit-file-upload-button{padding:.25rem .5rem;margin:-.25rem -.5rem;-webkit-margin-end:.5rem;margin-inline-end:.5rem}.form-control-sm::file-selector-button{padding:.25rem .5rem;margin:-.25rem -.5rem;-webkit-margin-end:.5rem;margin-inline-end:.5rem}.form-control-lg{min-height:calc(1.5em + 1rem + 2px);padding:.5rem 1rem;font-size:1.25rem;border-radius:.5rem}.form-control-lg::-webkit-file-upload-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem}.form-control-lg::file-selector-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem}textarea.form-control{min-height:calc(1.5em + .75rem + 2px)}textarea.form-control-sm{min-height:calc(1.5em + .5rem + 2px)}textarea.form-control-lg{min-height:calc(1.5em + 1rem + 2px)}.form-control-color{width:3rem;height:auto;padding:.375rem}.form-control-color:not(:disabled):not([readonly]){cursor:pointer}.form-control-color::-moz-color-swatch{height:1.5em;border-radius:.375rem}.form-control-color::-webkit-color-swatch{height:1.5em;border-radius:.375rem}.form-select{display:block;width:100%;padding:.375rem 2.25rem .375rem .75rem;-moz-padding-start:calc(0.75rem - 3px);font-size:1rem;font-weight:400;line-height:1.5;color:#212529;background-color:#fff;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right .75rem center;background-size:16px 12px;border:1px solid #ced4da;border-radius:.375rem;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out;-webkit-appearance:none;-moz-appearance:none;appearance:none}@media (prefers-reduced-motion:reduce){.form-select{transition:none}}.form-select:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-select[multiple],.form-select[size]:not([size="1"]){padding-right:.75rem;background-image:none}.form-select:disabled{background-color:#e9ecef}.form-select:-moz-focusring{color:transparent;text-shadow:0 0 0 #212529}.form-select-sm{padding-top:.25rem;padding-bottom:.25rem;padding-left:.5rem;font-size:.875rem;border-radius:.25rem}.form-select-lg{padding-top:.5rem;padding-bottom:.5rem;padding-left:1rem;font-size:1.25rem;border-radius:.5rem}.form-check{display:block;min-height:1.5rem;padding-left:1.5em;margin-bottom:.125rem}.form-check .form-check-input{float:left;margin-left:-1.5em}.form-check-reverse{padding-right:1.5em;padding-left:0;text-align:right}.form-check-reverse .form-check-input{float:right;margin-right:-1.5em;margin-left:0}.form-check-input{width:1em;height:1em;margin-top:.25em;vertical-align:top;background-color:#fff;background-repeat:no-repeat;background-position:center;background-size:contain;border:1px solid rgba(0,0,0,.25);-webkit-appearance:none;-moz-appearance:none;appearance:none;-webkit-print-color-adjust:exact;color-adjust:exact;print-color-adjust:exact}.form-check-input[type=checkbox]{border-radius:.25em}.form-check-input[type=radio]{border-radius:50%}.form-check-input:active{filter:brightness(90%)}.form-check-input:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-check-input:checked{background-color:#0d6efd;border-color:#0d6efd}.form-check-input:checked[type=checkbox]{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e")}.form-check-input:checked[type=radio]{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e")}.form-check-input[type=checkbox]:indeterminate{background-color:#0d6efd;border-color:#0d6efd;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e")}.form-check-input:disabled{pointer-events:none;filter:none;opacity:.5}.form-check-input:disabled~.form-check-label,.form-check-input[disabled]~.form-check-label{cursor:default;opacity:.5}.form-switch{padding-left:2.5em}.form-switch .form-check-input{width:2em;margin-left:-2.5em;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%280, 0, 0, 0.25%29'/%3e%3c/svg%3e");background-position:left center;border-radius:2em;transition:background-position .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-switch .form-check-input{transition:none}}.form-switch .form-check-input:focus{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%2386b7fe'/%3e%3c/svg%3e")}.form-switch .form-check-input:checked{background-position:right center;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e")}.form-switch.form-check-reverse{padding-right:2.5em;padding-left:0}.form-switch.form-check-reverse .form-check-input{margin-right:-2.5em;margin-left:0}.form-check-inline{display:inline-block;margin-right:1rem}.btn-check{position:absolute;clip:rect(0,0,0,0);pointer-events:none}.btn-check:disabled+.btn,.btn-check[disabled]+.btn{pointer-events:none;filter:none;opacity:.65}.form-range{width:100%;height:1.5rem;padding:0;background-color:transparent;-webkit-appearance:none;-moz-appearance:none;appearance:none}.form-range:focus{outline:0}.form-range:focus::-webkit-slider-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range:focus::-moz-range-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range::-moz-focus-outer{border:0}.form-range::-webkit-slider-thumb{width:1rem;height:1rem;margin-top:-.25rem;background-color:#0d6efd;border:0;border-radius:1rem;-webkit-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;-webkit-appearance:none;appearance:none}@media (prefers-reduced-motion:reduce){.form-range::-webkit-slider-thumb{-webkit-transition:none;transition:none}}.form-range::-webkit-slider-thumb:active{background-color:#b6d4fe}.form-range::-webkit-slider-runnable-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:#dee2e6;border-color:transparent;border-radius:1rem}.form-range::-moz-range-thumb{width:1rem;height:1rem;background-color:#0d6efd;border:0;border-radius:1rem;-moz-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;-moz-appearance:none;appearance:none}@media (prefers-reduced-motion:reduce){.form-range::-moz-range-thumb{-moz-transition:none;transition:none}}.form-range::-moz-range-thumb:active{background-color:#b6d4fe}.form-range::-moz-range-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:#dee2e6;border-color:transparent;border-radius:1rem}.form-range:disabled{pointer-events:none}.form-range:disabled::-webkit-slider-thumb{background-color:#adb5bd}.form-range:disabled::-moz-range-thumb{background-color:#adb5bd}.form-floating{position:relative}.form-floating>.form-control,.form-floating>.form-control-plaintext,.form-floating>.form-select{height:calc(3.5rem + 2px);line-height:1.25}.form-floating>label{position:absolute;top:0;left:0;height:100%;padding:1rem .75rem;pointer-events:none;border:1px solid transparent;transform-origin:0 0;transition:opacity .1s ease-in-out,transform .1s ease-in-out}@media (prefers-reduced-motion:reduce){.form-floating>label{transition:none}}.form-floating>.form-control,.form-floating>.form-control-plaintext{padding:1rem .75rem}.form-floating>.form-control-plaintext::-moz-placeholder,.form-floating>.form-control::-moz-placeholder{color:transparent}.form-floating>.form-control-plaintext::placeholder,.form-floating>.form-control::placeholder{color:transparent}.form-floating>.form-control-plaintext:not(:-moz-placeholder-shown),.form-floating>.form-control:not(:-moz-placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control-plaintext:focus,.form-floating>.form-control-plaintext:not(:placeholder-shown),.form-floating>.form-control:focus,.form-floating>.form-control:not(:placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control-plaintext:-webkit-autofill,.form-floating>.form-control:-webkit-autofill{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-select{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control:not(:-moz-placeholder-shown)~label{opacity:.65;transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control-plaintext~label,.form-floating>.form-control:focus~label,.form-floating>.form-control:not(:placeholder-shown)~label,.form-floating>.form-select~label{opacity:.65;transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control:-webkit-autofill~label{opacity:.65;transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control-plaintext~label{border-width:1px 0}.input-group{position:relative;display:flex;flex-wrap:wrap;align-items:stretch;width:100%}.input-group>.form-control,.input-group>.form-select{position:relative;flex:1 1 auto;width:1%;min-width:0}.input-group>.form-control:focus,.input-group>.form-select:focus{z-index:3}.input-group .btn{position:relative;z-index:2}.input-group .btn:focus{z-index:3}.input-group-text{display:flex;align-items:center;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:#212529;text-align:center;white-space:nowrap;background-color:#e9ecef;border:1px solid #ced4da;border-radius:.375rem}.input-group-lg>.btn,.input-group-lg>.form-control,.input-group-lg>.form-select,.input-group-lg>.input-group-text{padding:.5rem 1rem;font-size:1.25rem;border-radius:.5rem}.input-group-sm>.btn,.input-group-sm>.form-control,.input-group-sm>.form-select,.input-group-sm>.input-group-text{padding:.25rem .5rem;font-size:.875rem;border-radius:.25rem}.input-group-lg>.form-select,.input-group-sm>.form-select{padding-right:3rem}.input-group:not(.has-validation)>.dropdown-toggle:nth-last-child(n+3),.input-group:not(.has-validation)>:not(:last-child):not(.dropdown-toggle):not(.dropdown-menu){border-top-right-radius:0;border-bottom-right-radius:0}.input-group.has-validation>.dropdown-toggle:nth-last-child(n+4),.input-group.has-validation>:nth-last-child(n+3):not(.dropdown-toggle):not(.dropdown-menu){border-top-right-radius:0;border-bottom-right-radius:0}.input-group>:not(:first-child):not(.dropdown-menu):not(.valid-tooltip):not(.valid-feedback):not(.invalid-tooltip):not(.invalid-feedback){margin-left:-1px;border-top-left-radius:0;border-bottom-left-radius:0}.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:#198754}.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:rgba(25,135,84,.9);border-radius:.375rem}.is-valid~.valid-feedback,.is-valid~.valid-tooltip,.was-validated :valid~.valid-feedback,.was-validated :valid~.valid-tooltip{display:block}.form-control.is-valid,.was-validated .form-control:valid{border-color:#198754;padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-valid:focus,.was-validated .form-control:valid:focus{border-color:#198754;box-shadow:0 0 0 .25rem rgba(25,135,84,.25)}.was-validated textarea.form-control:valid,textarea.form-control.is-valid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.form-select.is-valid,.was-validated .form-select:valid{border-color:#198754}.form-select.is-valid:not([multiple]):not([size]),.form-select.is-valid:not([multiple])[size="1"],.was-validated .form-select:valid:not([multiple]):not([size]),.was-validated .form-select:valid:not([multiple])[size="1"]{padding-right:4.125rem;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e"),url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}.form-select.is-valid:focus,.was-validated .form-select:valid:focus{border-color:#198754;box-shadow:0 0 0 .25rem rgba(25,135,84,.25)}.form-control-color.is-valid,.was-validated .form-control-color:valid{width:calc(3rem + calc(1.5em + .75rem))}.form-check-input.is-valid,.was-validated .form-check-input:valid{border-color:#198754}.form-check-input.is-valid:checked,.was-validated .form-check-input:valid:checked{background-color:#198754}.form-check-input.is-valid:focus,.was-validated .form-check-input:valid:focus{box-shadow:0 0 0 .25rem rgba(25,135,84,.25)}.form-check-input.is-valid~.form-check-label,.was-validated .form-check-input:valid~.form-check-label{color:#198754}.form-check-inline .form-check-input~.valid-feedback{margin-left:.5em}.input-group .form-control.is-valid,.input-group .form-select.is-valid,.was-validated .input-group .form-control:valid,.was-validated .input-group .form-select:valid{z-index:1}.input-group .form-control.is-valid:focus,.input-group .form-select.is-valid:focus,.was-validated .input-group .form-control:valid:focus,.was-validated .input-group .form-select:valid:focus{z-index:3}.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:#dc3545}.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:rgba(220,53,69,.9);border-radius:.375rem}.is-invalid~.invalid-feedback,.is-invalid~.invalid-tooltip,.was-validated :invalid~.invalid-feedback,.was-validated :invalid~.invalid-tooltip{display:block}.form-control.is-invalid,.was-validated .form-control:invalid{border-color:#dc3545;padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-invalid:focus,.was-validated .form-control:invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .25rem rgba(220,53,69,.25)}.was-validated textarea.form-control:invalid,textarea.form-control.is-invalid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.form-select.is-invalid,.was-validated .form-select:invalid{border-color:#dc3545}.form-select.is-invalid:not([multiple]):not([size]),.form-select.is-invalid:not([multiple])[size="1"],.was-validated .form-select:invalid:not([multiple]):not([size]),.was-validated .form-select:invalid:not([multiple])[size="1"]{padding-right:4.125rem;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e"),url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}.form-select.is-invalid:focus,.was-validated .form-select:invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .25rem rgba(220,53,69,.25)}.form-control-color.is-invalid,.was-validated .form-control-color:invalid{width:calc(3rem + calc(1.5em + .75rem))}.form-check-input.is-invalid,.was-validated .form-check-input:invalid{border-color:#dc3545}.form-check-input.is-invalid:checked,.was-validated .form-check-input:invalid:checked{background-color:#dc3545}.form-check-input.is-invalid:focus,.was-validated .form-check-input:invalid:focus{box-shadow:0 0 0 .25rem rgba(220,53,69,.25)}.form-check-input.is-invalid~.form-check-label,.was-validated .form-check-input:invalid~.form-check-label{color:#dc3545}.form-check-inline .form-check-input~.invalid-feedback{margin-left:.5em}.input-group .form-control.is-invalid,.input-group .form-select.is-invalid,.was-validated .input-group .form-control:invalid,.was-validated .input-group .form-select:invalid{z-index:2}.input-group .form-control.is-invalid:focus,.input-group .form-select.is-invalid:focus,.was-validated .input-group .form-control:invalid:focus,.was-validated .input-group .form-select:invalid:focus{z-index:3}.btn{--bs-btn-padding-x:0.75rem;--bs-btn-padding-y:0.375rem;--bs-btn-font-family: ;--bs-btn-font-size:1rem;--bs-btn-font-weight:400;--bs-btn-line-height:1.5;--bs-btn-color:#212529;--bs-btn-bg:transparent;--bs-btn-border-width:1px;--bs-btn-border-color:transparent;--bs-btn-border-radius:0.375rem;--bs-btn-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.15),0 1px 1px rgba(0, 0, 0, 0.075);--bs-btn-disabled-opacity:0.65;--bs-btn-focus-box-shadow:0 0 0 0.25rem rgba(var(--bs-btn-focus-shadow-rgb), .5);display:inline-block;padding:var(--bs-btn-padding-y) var(--bs-btn-padding-x);font-family:var(--bs-btn-font-family);font-size:var(--bs-btn-font-size);font-weight:var(--bs-btn-font-weight);line-height:var(--bs-btn-line-height);color:var(--bs-btn-color);text-align:center;text-decoration:none;vertical-align:middle;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none;border:var(--bs-btn-border-width) solid var(--bs-btn-border-color);border-radius:var(--bs-btn-border-radius);background-color:var(--bs-btn-bg);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.btn{transition:none}}.btn:hover{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color)}.btn-check:focus+.btn,.btn:focus{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:active+.btn,.btn-check:checked+.btn,.btn.active,.btn.show,.btn:active{color:var(--bs-btn-active-color);background-color:var(--bs-btn-active-bg);border-color:var(--bs-btn-active-border-color)}.btn-check:active+.btn:focus,.btn-check:checked+.btn:focus,.btn.active:focus,.btn.show:focus,.btn:active:focus{box-shadow:var(--bs-btn-focus-box-shadow)}.btn.disabled,.btn:disabled,fieldset:disabled .btn{color:var(--bs-btn-disabled-color);pointer-events:none;background-color:var(--bs-btn-disabled-bg);border-color:var(--bs-btn-disabled-border-color);opacity:var(--bs-btn-disabled-opacity)}.btn-primary{--bs-btn-color:#fff;--bs-btn-bg:#0d6efd;--bs-btn-border-color:#0d6efd;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#0b5ed7;--bs-btn-hover-border-color:#0a58ca;--bs-btn-focus-shadow-rgb:49,132,253;--bs-btn-active-color:#fff;--bs-btn-active-bg:#0a58ca;--bs-btn-active-border-color:#0a53be;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#0d6efd;--bs-btn-disabled-border-color:#0d6efd}.btn-secondary{--bs-btn-color:#fff;--bs-btn-bg:#6c757d;--bs-btn-border-color:#6c757d;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#5c636a;--bs-btn-hover-border-color:#565e64;--bs-btn-focus-shadow-rgb:130,138,145;--bs-btn-active-color:#fff;--bs-btn-active-bg:#565e64;--bs-btn-active-border-color:#51585e;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#6c757d;--bs-btn-disabled-border-color:#6c757d}.btn-success{--bs-btn-color:#fff;--bs-btn-bg:#198754;--bs-btn-border-color:#198754;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#157347;--bs-btn-hover-border-color:#146c43;--bs-btn-focus-shadow-rgb:60,153,110;--bs-btn-active-color:#fff;--bs-btn-active-bg:#146c43;--bs-btn-active-border-color:#13653f;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#198754;--bs-btn-disabled-border-color:#198754}.btn-info{--bs-btn-color:#000;--bs-btn-bg:#0dcaf0;--bs-btn-border-color:#0dcaf0;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#31d2f2;--bs-btn-hover-border-color:#25cff2;--bs-btn-focus-shadow-rgb:11,172,204;--bs-btn-active-color:#000;--bs-btn-active-bg:#3dd5f3;--bs-btn-active-border-color:#25cff2;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#0dcaf0;--bs-btn-disabled-border-color:#0dcaf0}.btn-warning{--bs-btn-color:#000;--bs-btn-bg:#ffc107;--bs-btn-border-color:#ffc107;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#ffca2c;--bs-btn-hover-border-color:#ffc720;--bs-btn-focus-shadow-rgb:217,164,6;--bs-btn-active-color:#000;--bs-btn-active-bg:#ffcd39;--bs-btn-active-border-color:#ffc720;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#ffc107;--bs-btn-disabled-border-color:#ffc107}.btn-danger{--bs-btn-color:#fff;--bs-btn-bg:#dc3545;--bs-btn-border-color:#dc3545;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#bb2d3b;--bs-btn-hover-border-color:#b02a37;--bs-btn-focus-shadow-rgb:225,83,97;--bs-btn-active-color:#fff;--bs-btn-active-bg:#b02a37;--bs-btn-active-border-color:#a52834;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#dc3545;--bs-btn-disabled-border-color:#dc3545}.btn-light{--bs-btn-color:#000;--bs-btn-bg:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#f9fafb;--bs-btn-hover-border-color:#f9fafb;--bs-btn-focus-shadow-rgb:211,212,213;--bs-btn-active-color:#000;--bs-btn-active-bg:#f9fafb;--bs-btn-active-border-color:#f9fafb;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#f8f9fa;--bs-btn-disabled-border-color:#f8f9fa}.btn-dark{--bs-btn-color:#fff;--bs-btn-bg:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#1c1f23;--bs-btn-hover-border-color:#1a1e21;--bs-btn-focus-shadow-rgb:66,70,73;--bs-btn-active-color:#fff;--bs-btn-active-bg:#1a1e21;--bs-btn-active-border-color:#191c1f;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#212529;--bs-btn-disabled-border-color:#212529}.btn-outline-primary{--bs-btn-color:#0d6efd;--bs-btn-border-color:#0d6efd;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#0d6efd;--bs-btn-hover-border-color:#0d6efd;--bs-btn-focus-shadow-rgb:13,110,253;--bs-btn-active-color:#fff;--bs-btn-active-bg:#0d6efd;--bs-btn-active-border-color:#0d6efd;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#0d6efd;--bs-btn-disabled-bg:transparent;--bs-gradient:none}.btn-outline-secondary{--bs-btn-color:#6c757d;--bs-btn-border-color:#6c757d;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#6c757d;--bs-btn-hover-border-color:#6c757d;--bs-btn-focus-shadow-rgb:108,117,125;--bs-btn-active-color:#fff;--bs-btn-active-bg:#6c757d;--bs-btn-active-border-color:#6c757d;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-bg:transparent;--bs-gradient:none}.btn-outline-success{--bs-btn-color:#198754;--bs-btn-border-color:#198754;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#198754;--bs-btn-hover-border-color:#198754;--bs-btn-focus-shadow-rgb:25,135,84;--bs-btn-active-color:#fff;--bs-btn-active-bg:#198754;--bs-btn-active-border-color:#198754;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#198754;--bs-btn-disabled-bg:transparent;--bs-gradient:none}.btn-outline-info{--bs-btn-color:#0dcaf0;--bs-btn-border-color:#0dcaf0;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#0dcaf0;--bs-btn-hover-border-color:#0dcaf0;--bs-btn-focus-shadow-rgb:13,202,240;--bs-btn-active-color:#000;--bs-btn-active-bg:#0dcaf0;--bs-btn-active-border-color:#0dcaf0;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#0dcaf0;--bs-btn-disabled-bg:transparent;--bs-gradient:none}.btn-outline-warning{--bs-btn-color:#ffc107;--bs-btn-border-color:#ffc107;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#ffc107;--bs-btn-hover-border-color:#ffc107;--bs-btn-focus-shadow-rgb:255,193,7;--bs-btn-active-color:#000;--bs-btn-active-bg:#ffc107;--bs-btn-active-border-color:#ffc107;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#ffc107;--bs-btn-disabled-bg:transparent;--bs-gradient:none}.btn-outline-danger{--bs-btn-color:#dc3545;--bs-btn-border-color:#dc3545;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#dc3545;--bs-btn-hover-border-color:#dc3545;--bs-btn-focus-shadow-rgb:220,53,69;--bs-btn-active-color:#fff;--bs-btn-active-bg:#dc3545;--bs-btn-active-border-color:#dc3545;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#dc3545;--bs-btn-disabled-bg:transparent;--bs-gradient:none}.btn-outline-light{--bs-btn-color:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#f8f9fa;--bs-btn-hover-border-color:#f8f9fa;--bs-btn-focus-shadow-rgb:248,249,250;--bs-btn-active-color:#000;--bs-btn-active-bg:#f8f9fa;--bs-btn-active-border-color:#f8f9fa;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#f8f9fa;--bs-btn-disabled-bg:transparent;--bs-gradient:none}.btn-outline-dark{--bs-btn-color:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#212529;--bs-btn-hover-border-color:#212529;--bs-btn-focus-shadow-rgb:33,37,41;--bs-btn-active-color:#fff;--bs-btn-active-bg:#212529;--bs-btn-active-border-color:#212529;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#212529;--bs-btn-disabled-bg:transparent;--bs-gradient:none}.btn-link{--bs-btn-font-weight:400;--bs-btn-color:var(--bs-link-color);--bs-btn-bg:transparent;--bs-btn-border-color:transparent;--bs-btn-hover-color:var(--bs-link-hover-color);--bs-btn-hover-border-color:transparent;--bs-btn-active-border-color:transparent;--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-border-color:transparent;--bs-btn-box-shadow:none;text-decoration:underline}.btn-group-lg>.btn,.btn-lg{--bs-btn-padding-y:0.5rem;--bs-btn-padding-x:1rem;--bs-btn-font-size:1.25rem;--bs-btn-border-radius:0.5rem}.btn-group-sm>.btn,.btn-sm{--bs-btn-padding-y:0.25rem;--bs-btn-padding-x:0.5rem;--bs-btn-font-size:0.875rem;--bs-btn-border-radius:0.25rem}.fade{transition:opacity .15s linear}@media (prefers-reduced-motion:reduce){.fade{transition:none}}.fade:not(.show){opacity:0}.collapse:not(.show){display:none}.collapsing{height:0;overflow:hidden;transition:height .35s ease}@media (prefers-reduced-motion:reduce){.collapsing{transition:none}}.collapsing.collapse-horizontal{width:0;height:auto;transition:width .35s ease}@media (prefers-reduced-motion:reduce){.collapsing.collapse-horizontal{transition:none}}.dropdown,.dropdown-center,.dropend,.dropstart,.dropup,.dropup-center{position:relative}.dropdown-toggle{white-space:nowrap}.dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid transparent;border-bottom:0;border-left:.3em solid transparent}.dropdown-toggle:empty::after{margin-left:0}.dropdown-menu{--bs-dropdown-min-width:10rem;--bs-dropdown-padding-x:0;--bs-dropdown-padding-y:0.5rem;--bs-dropdown-spacer:0.125rem;--bs-dropdown-font-size:1rem;--bs-dropdown-color:#212529;--bs-dropdown-bg:#fff;--bs-dropdown-border-color:var(--bs-border-color-translucent);--bs-dropdown-border-radius:0.375rem;--bs-dropdown-border-width:1px;--bs-dropdown-inner-border-radius:calc(0.375rem - 1px);--bs-dropdown-divider-bg:var(--bs-border-color-translucent);--bs-dropdown-divider-margin-y:0.5rem;--bs-dropdown-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-dropdown-link-color:#212529;--bs-dropdown-link-hover-color:#1e2125;--bs-dropdown-link-hover-bg:#e9ecef;--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#0d6efd;--bs-dropdown-link-disabled-color:#adb5bd;--bs-dropdown-item-padding-x:1rem;--bs-dropdown-item-padding-y:0.25rem;--bs-dropdown-header-color:#6c757d;--bs-dropdown-header-padding-x:1rem;--bs-dropdown-header-padding-y:0.5rem;position:absolute;z-index:1000;display:none;min-width:var(--bs-dropdown-min-width);padding:var(--bs-dropdown-padding-y) var(--bs-dropdown-padding-x);margin:0;font-size:var(--bs-dropdown-font-size);color:var(--bs-dropdown-color);text-align:left;list-style:none;background-color:var(--bs-dropdown-bg);background-clip:padding-box;border:var(--bs-dropdown-border-width) solid var(--bs-dropdown-border-color);border-radius:var(--bs-dropdown-border-radius)}.dropdown-menu[data-bs-popper]{top:100%;left:0;margin-top:var(--bs-dropdown-spacer)}.dropdown-menu-start{--bs-position:start}.dropdown-menu-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-end{--bs-position:end}.dropdown-menu-end[data-bs-popper]{right:0;left:auto}@media (min-width:576px){.dropdown-menu-sm-start{--bs-position:start}.dropdown-menu-sm-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-sm-end{--bs-position:end}.dropdown-menu-sm-end[data-bs-popper]{right:0;left:auto}}@media (min-width:768px){.dropdown-menu-md-start{--bs-position:start}.dropdown-menu-md-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-md-end{--bs-position:end}.dropdown-menu-md-end[data-bs-popper]{right:0;left:auto}}@media (min-width:992px){.dropdown-menu-lg-start{--bs-position:start}.dropdown-menu-lg-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-lg-end{--bs-position:end}.dropdown-menu-lg-end[data-bs-popper]{right:0;left:auto}}@media (min-width:1200px){.dropdown-menu-xl-start{--bs-position:start}.dropdown-menu-xl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xl-end{--bs-position:end}.dropdown-menu-xl-end[data-bs-popper]{right:0;left:auto}}@media (min-width:1400px){.dropdown-menu-xxl-start{--bs-position:start}.dropdown-menu-xxl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xxl-end{--bs-position:end}.dropdown-menu-xxl-end[data-bs-popper]{right:0;left:auto}}.dropup .dropdown-menu[data-bs-popper]{top:auto;bottom:100%;margin-top:0;margin-bottom:var(--bs-dropdown-spacer)}.dropup .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid transparent;border-bottom:.3em solid;border-left:.3em solid transparent}.dropup .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-menu[data-bs-popper]{top:0;right:auto;left:100%;margin-top:0;margin-left:var(--bs-dropdown-spacer)}.dropend .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:0;border-bottom:.3em solid transparent;border-left:.3em solid}.dropend .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-toggle::after{vertical-align:0}.dropstart .dropdown-menu[data-bs-popper]{top:0;right:100%;left:auto;margin-top:0;margin-right:var(--bs-dropdown-spacer)}.dropstart .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:""}.dropstart .dropdown-toggle::after{display:none}.dropstart .dropdown-toggle::before{display:inline-block;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:.3em solid;border-bottom:.3em solid transparent}.dropstart .dropdown-toggle:empty::after{margin-left:0}.dropstart .dropdown-toggle::before{vertical-align:0}.dropdown-divider{height:0;margin:var(--bs-dropdown-divider-margin-y) 0;overflow:hidden;border-top:1px solid var(--bs-dropdown-divider-bg);opacity:1}.dropdown-item{display:block;width:100%;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);clear:both;font-weight:400;color:var(--bs-dropdown-link-color);text-align:inherit;text-decoration:none;white-space:nowrap;background-color:transparent;border:0}.dropdown-item:focus,.dropdown-item:hover{color:var(--bs-dropdown-link-hover-color);background-color:var(--bs-dropdown-link-hover-bg)}.dropdown-item.active,.dropdown-item:active{color:var(--bs-dropdown-link-active-color);text-decoration:none;background-color:var(--bs-dropdown-link-active-bg)}.dropdown-item.disabled,.dropdown-item:disabled{color:var(--bs-dropdown-link-disabled-color);pointer-events:none;background-color:transparent}.dropdown-menu.show{display:block}.dropdown-header{display:block;padding:var(--bs-dropdown-header-padding-y) var(--bs-dropdown-header-padding-x);margin-bottom:0;font-size:.875rem;color:var(--bs-dropdown-header-color);white-space:nowrap}.dropdown-item-text{display:block;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);color:var(--bs-dropdown-link-color)}.dropdown-menu-dark{--bs-dropdown-color:#dee2e6;--bs-dropdown-bg:#343a40;--bs-dropdown-border-color:var(--bs-border-color-translucent);--bs-dropdown-box-shadow: ;--bs-dropdown-link-color:#dee2e6;--bs-dropdown-link-hover-color:#fff;--bs-dropdown-divider-bg:var(--bs-border-color-translucent);--bs-dropdown-link-hover-bg:rgba(255, 255, 255, 0.15);--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#0d6efd;--bs-dropdown-link-disabled-color:#adb5bd;--bs-dropdown-header-color:#adb5bd}.btn-group,.btn-group-vertical{position:relative;display:inline-flex;vertical-align:middle}.btn-group-vertical>.btn,.btn-group>.btn{position:relative;flex:1 1 auto}.btn-group-vertical>.btn-check:checked+.btn,.btn-group-vertical>.btn-check:focus+.btn,.btn-group-vertical>.btn.active,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn:focus,.btn-group-vertical>.btn:hover,.btn-group>.btn-check:checked+.btn,.btn-group>.btn-check:focus+.btn,.btn-group>.btn.active,.btn-group>.btn:active,.btn-group>.btn:focus,.btn-group>.btn:hover{z-index:1}.btn-toolbar{display:flex;flex-wrap:wrap;justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group{border-radius:.375rem}.btn-group>.btn-group:not(:first-child),.btn-group>.btn:not(:first-child){margin-left:-1px}.btn-group>.btn-group:not(:last-child)>.btn,.btn-group>.btn.dropdown-toggle-split:first-child,.btn-group>.btn:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn-group:not(:first-child)>.btn,.btn-group>.btn:nth-child(n+3),.btn-group>:not(.btn-check)+.btn{border-top-left-radius:0;border-bottom-left-radius:0}.dropdown-toggle-split{padding-right:.5625rem;padding-left:.5625rem}.dropdown-toggle-split::after,.dropend .dropdown-toggle-split::after,.dropup .dropdown-toggle-split::after{margin-left:0}.dropstart .dropdown-toggle-split::before{margin-right:0}.btn-group-sm>.btn+.dropdown-toggle-split,.btn-sm+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}.btn-group-lg>.btn+.dropdown-toggle-split,.btn-lg+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.btn-group-vertical{flex-direction:column;align-items:flex-start;justify-content:center}.btn-group-vertical>.btn,.btn-group-vertical>.btn-group{width:100%}.btn-group-vertical>.btn-group:not(:first-child),.btn-group-vertical>.btn:not(:first-child){margin-top:-1px}.btn-group-vertical>.btn-group:not(:last-child)>.btn,.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle){border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn-group:not(:first-child)>.btn,.btn-group-vertical>.btn~.btn{border-top-left-radius:0;border-top-right-radius:0}.nav{--bs-nav-link-padding-x:1rem;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color:var(--bs-link-color);--bs-nav-link-hover-color:var(--bs-link-hover-color);--bs-nav-link-disabled-color:#6c757d;display:flex;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);font-size:var(--bs-nav-link-font-size);font-weight:var(--bs-nav-link-font-weight);color:var(--bs-nav-link-color);text-decoration:none;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out}@media (prefers-reduced-motion:reduce){.nav-link{transition:none}}.nav-link:focus,.nav-link:hover{color:var(--bs-nav-link-hover-color)}.nav-link.disabled{color:var(--bs-nav-link-disabled-color);pointer-events:none;cursor:default}.nav-tabs{--bs-nav-tabs-border-width:1px;--bs-nav-tabs-border-color:#dee2e6;--bs-nav-tabs-border-radius:0.375rem;--bs-nav-tabs-link-hover-border-color:#e9ecef #e9ecef #dee2e6;--bs-nav-tabs-link-active-color:#495057;--bs-nav-tabs-link-active-bg:#fff;--bs-nav-tabs-link-active-border-color:#dee2e6 #dee2e6 #fff;border-bottom:var(--bs-nav-tabs-border-width) solid var(--bs-nav-tabs-border-color)}.nav-tabs .nav-link{margin-bottom:calc(var(--bs-nav-tabs-border-width) * -1);background:0 0;border:var(--bs-nav-tabs-border-width) solid transparent;border-top-left-radius:var(--bs-nav-tabs-border-radius);border-top-right-radius:var(--bs-nav-tabs-border-radius)}.nav-tabs .nav-link:focus,.nav-tabs .nav-link:hover{isolation:isolate;border-color:var(--bs-nav-tabs-link-hover-border-color)}.nav-tabs .nav-link.disabled,.nav-tabs .nav-link:disabled{color:var(--bs-nav-link-disabled-color);background-color:transparent;border-color:transparent}.nav-tabs .nav-item.show .nav-link,.nav-tabs .nav-link.active{color:var(--bs-nav-tabs-link-active-color);background-color:var(--bs-nav-tabs-link-active-bg);border-color:var(--bs-nav-tabs-link-active-border-color)}.nav-tabs .dropdown-menu{margin-top:calc(var(--bs-nav-tabs-border-width) * -1);border-top-left-radius:0;border-top-right-radius:0}.nav-pills{--bs-nav-pills-border-radius:0.375rem;--bs-nav-pills-link-active-color:#fff;--bs-nav-pills-link-active-bg:#0d6efd}.nav-pills .nav-link{background:0 0;border:0;border-radius:var(--bs-nav-pills-border-radius)}.nav-pills .nav-link:disabled{color:var(--bs-nav-link-disabled-color);background-color:transparent;border-color:transparent}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:var(--bs-nav-pills-link-active-color);background-color:var(--bs-nav-pills-link-active-bg)}.nav-fill .nav-item,.nav-fill>.nav-link{flex:1 1 auto;text-align:center}.nav-justified .nav-item,.nav-justified>.nav-link{flex-basis:0;flex-grow:1;text-align:center}.nav-fill .nav-item .nav-link,.nav-justified .nav-item .nav-link{width:100%}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar{--bs-navbar-padding-x:0;--bs-navbar-padding-y:0.5rem;--bs-navbar-color:rgba(0, 0, 0, 0.55);--bs-navbar-hover-color:rgba(0, 0, 0, 0.7);--bs-navbar-disabled-color:rgba(0, 0, 0, 0.3);--bs-navbar-active-color:rgba(0, 0, 0, 0.9);--bs-navbar-brand-padding-y:0.3125rem;--bs-navbar-brand-margin-end:1rem;--bs-navbar-brand-font-size:1.25rem;--bs-navbar-brand-color:rgba(0, 0, 0, 0.9);--bs-navbar-brand-hover-color:rgba(0, 0, 0, 0.9);--bs-navbar-nav-link-padding-x:0.5rem;--bs-navbar-toggler-padding-y:0.25rem;--bs-navbar-toggler-padding-x:0.75rem;--bs-navbar-toggler-font-size:1.25rem;--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%280, 0, 0, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");--bs-navbar-toggler-border-color:rgba(0, 0, 0, 0.1);--bs-navbar-toggler-border-radius:0.375rem;--bs-navbar-toggler-focus-width:0.25rem;--bs-navbar-toggler-transition:box-shadow 0.15s ease-in-out;position:relative;display:flex;flex-wrap:wrap;align-items:center;justify-content:space-between;padding:var(--bs-navbar-padding-y) var(--bs-navbar-padding-x)}.navbar>.container,.navbar>.container-fluid,.navbar>.container-lg,.navbar>.container-md,.navbar>.container-sm,.navbar>.container-xl,.navbar>.container-xxl{display:flex;flex-wrap:inherit;align-items:center;justify-content:space-between}.navbar-brand{padding-top:var(--bs-navbar-brand-padding-y);padding-bottom:var(--bs-navbar-brand-padding-y);margin-right:var(--bs-navbar-brand-margin-end);font-size:var(--bs-navbar-brand-font-size);color:var(--bs-navbar-brand-color);text-decoration:none;white-space:nowrap}.navbar-brand:focus,.navbar-brand:hover{color:var(--bs-navbar-brand-hover-color)}.navbar-nav{--bs-nav-link-padding-x:0;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-color:var(--bs-navbar-color);--bs-nav-link-hover-color:var(--bs-navbar-hover-color);--bs-nav-link-disabled-color:var(--bs-navbar-disabled-color);display:flex;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link.active,.navbar-nav .show>.nav-link{color:var(--bs-navbar-active-color)}.navbar-nav .dropdown-menu{position:static}.navbar-text{padding-top:.5rem;padding-bottom:.5rem;color:var(--bs-navbar-color)}.navbar-text a,.navbar-text a:focus,.navbar-text a:hover{color:var(--bs-navbar-active-color)}.navbar-collapse{flex-basis:100%;flex-grow:1;align-items:center}.navbar-toggler{padding:var(--bs-navbar-toggler-padding-y) var(--bs-navbar-toggler-padding-x);font-size:var(--bs-navbar-toggler-font-size);line-height:1;color:var(--bs-navbar-color);background-color:transparent;border:var(--bs-border-width) solid var(--bs-navbar-toggler-border-color);border-radius:var(--bs-navbar-toggler-border-radius);transition:var(--bs-navbar-toggler-transition)}@media (prefers-reduced-motion:reduce){.navbar-toggler{transition:none}}.navbar-toggler:hover{text-decoration:none}.navbar-toggler:focus{text-decoration:none;outline:0;box-shadow:0 0 0 var(--bs-navbar-toggler-focus-width)}.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;background-image:var(--bs-navbar-toggler-icon-bg);background-repeat:no-repeat;background-position:center;background-size:100%}.navbar-nav-scroll{max-height:var(--bs-scroll-height,75vh);overflow-y:auto}@media (min-width:576px){.navbar-expand-sm{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-sm .navbar-nav{flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-sm .navbar-nav-scroll{overflow:visible}.navbar-expand-sm .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}.navbar-expand-sm .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-sm .offcanvas .offcanvas-header{display:none}.navbar-expand-sm .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:768px){.navbar-expand-md{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-md .navbar-nav{flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-md .navbar-nav-scroll{overflow:visible}.navbar-expand-md .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}.navbar-expand-md .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-md .offcanvas .offcanvas-header{display:none}.navbar-expand-md .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:992px){.navbar-expand-lg{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-lg .navbar-nav{flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-lg .navbar-nav-scroll{overflow:visible}.navbar-expand-lg .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}.navbar-expand-lg .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-lg .offcanvas .offcanvas-header{display:none}.navbar-expand-lg .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:1200px){.navbar-expand-xl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xl .navbar-nav{flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xl .navbar-nav-scroll{overflow:visible}.navbar-expand-xl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}.navbar-expand-xl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-xl .offcanvas .offcanvas-header{display:none}.navbar-expand-xl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:1400px){.navbar-expand-xxl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xxl .navbar-nav{flex-direction:row}.navbar-expand-xxl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xxl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xxl .navbar-nav-scroll{overflow:visible}.navbar-expand-xxl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xxl .navbar-toggler{display:none}.navbar-expand-xxl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-xxl .offcanvas .offcanvas-header{display:none}.navbar-expand-xxl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}.navbar-expand{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand .navbar-nav{flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand .navbar-nav-scroll{overflow:visible}.navbar-expand .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-expand .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand .offcanvas .offcanvas-header{display:none}.navbar-expand .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}.navbar-dark{--bs-navbar-color:rgba(255, 255, 255, 0.55);--bs-navbar-hover-color:rgba(255, 255, 255, 0.75);--bs-navbar-disabled-color:rgba(255, 255, 255, 0.25);--bs-navbar-active-color:#fff;--bs-navbar-brand-color:#fff;--bs-navbar-brand-hover-color:#fff;--bs-navbar-toggler-border-color:rgba(255, 255, 255, 0.1);--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}.card{--bs-card-spacer-y:1rem;--bs-card-spacer-x:1rem;--bs-card-title-spacer-y:0.5rem;--bs-card-border-width:1px;--bs-card-border-color:var(--bs-border-color-translucent);--bs-card-border-radius:0.375rem;--bs-card-box-shadow: ;--bs-card-inner-border-radius:calc(0.375rem - 1px);--bs-card-cap-padding-y:0.5rem;--bs-card-cap-padding-x:1rem;--bs-card-cap-bg:rgba(0, 0, 0, 0.03);--bs-card-cap-color: ;--bs-card-height: ;--bs-card-color: ;--bs-card-bg:#fff;--bs-card-img-overlay-padding:1rem;--bs-card-group-margin:0.75rem;position:relative;display:flex;flex-direction:column;min-width:0;height:var(--bs-card-height);word-wrap:break-word;background-color:var(--bs-card-bg);background-clip:border-box;border:var(--bs-card-border-width) solid var(--bs-card-border-color);border-radius:var(--bs-card-border-radius)}.card>hr{margin-right:0;margin-left:0}.card>.list-group{border-top:inherit;border-bottom:inherit}.card>.list-group:first-child{border-top-width:0;border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card>.list-group:last-child{border-bottom-width:0;border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card>.card-header+.list-group,.card>.list-group+.card-footer{border-top:0}.card-body{flex:1 1 auto;padding:var(--bs-card-spacer-y) var(--bs-card-spacer-x);color:var(--bs-card-color)}.card-title{margin-bottom:var(--bs-card-title-spacer-y)}.card-subtitle{margin-top:calc(-.5 * var(--bs-card-title-spacer-y));margin-bottom:0}.card-text:last-child{margin-bottom:0}.card-link+.card-link{margin-left:var(--bs-card-spacer-x)}.card-header{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);margin-bottom:0;color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-bottom:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-header:first-child{border-radius:var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0}.card-footer{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-top:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-footer:last-child{border-radius:0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius)}.card-header-tabs{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-bottom:calc(-1 * var(--bs-card-cap-padding-y));margin-left:calc(-.5 * var(--bs-card-cap-padding-x));border-bottom:0}.card-header-tabs .nav-link.active{background-color:var(--bs-card-bg);border-bottom-color:var(--bs-card-bg)}.card-header-pills{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-left:calc(-.5 * var(--bs-card-cap-padding-x))}.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:var(--bs-card-img-overlay-padding);border-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom,.card-img-top{width:100%}.card-img,.card-img-top{border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom{border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card-group>.card{margin-bottom:var(--bs-card-group-margin)}@media (min-width:576px){.card-group{display:flex;flex-flow:row wrap}.card-group>.card{flex:1 0 0%;margin-bottom:0}.card-group>.card+.card{margin-left:0;border-left:0}.card-group>.card:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:not(:last-child) .card-header,.card-group>.card:not(:last-child) .card-img-top{border-top-right-radius:0}.card-group>.card:not(:last-child) .card-footer,.card-group>.card:not(:last-child) .card-img-bottom{border-bottom-right-radius:0}.card-group>.card:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:not(:first-child) .card-header,.card-group>.card:not(:first-child) .card-img-top{border-top-left-radius:0}.card-group>.card:not(:first-child) .card-footer,.card-group>.card:not(:first-child) .card-img-bottom{border-bottom-left-radius:0}}.accordion{--bs-accordion-color:#000;--bs-accordion-bg:#fff;--bs-accordion-transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out,border-radius 0.15s ease;--bs-accordion-border-color:var(--bs-border-color);--bs-accordion-border-width:1px;--bs-accordion-border-radius:0.375rem;--bs-accordion-inner-border-radius:calc(0.375rem - 1px);--bs-accordion-btn-padding-x:1.25rem;--bs-accordion-btn-padding-y:1rem;--bs-accordion-btn-color:var(--bs-body-color);--bs-accordion-btn-bg:var(--bs-accordion-bg);--bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='var%28--bs-body-color%29'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-icon-width:1.25rem;--bs-accordion-btn-icon-transform:rotate(-180deg);--bs-accordion-btn-icon-transition:transform 0.2s ease-in-out;--bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%230c63e4'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-focus-border-color:#86b7fe;--bs-accordion-btn-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-accordion-body-padding-x:1.25rem;--bs-accordion-body-padding-y:1rem;--bs-accordion-active-color:#0c63e4;--bs-accordion-active-bg:#e7f1ff}.accordion-button{position:relative;display:flex;align-items:center;width:100%;padding:var(--bs-accordion-btn-padding-y) var(--bs-accordion-btn-padding-x);font-size:1rem;color:var(--bs-accordion-btn-color);text-align:left;background-color:var(--bs-accordion-btn-bg);border:0;border-radius:0;overflow-anchor:none;transition:var(--bs-accordion-transition)}@media (prefers-reduced-motion:reduce){.accordion-button{transition:none}}.accordion-button:not(.collapsed){color:var(--bs-accordion-active-color);background-color:var(--bs-accordion-active-bg);box-shadow:inset 0 calc(var(--bs-accordion-border-width) * -1) 0 var(--bs-accordion-border-color)}.accordion-button:not(.collapsed)::after{background-image:var(--bs-accordion-btn-active-icon);transform:var(--bs-accordion-btn-icon-transform)}.accordion-button::after{flex-shrink:0;width:var(--bs-accordion-btn-icon-width);height:var(--bs-accordion-btn-icon-width);margin-left:auto;content:"";background-image:var(--bs-accordion-btn-icon);background-repeat:no-repeat;background-size:var(--bs-accordion-btn-icon-width);transition:var(--bs-accordion-btn-icon-transition)}@media (prefers-reduced-motion:reduce){.accordion-button::after{transition:none}}.accordion-button:hover{z-index:2}.accordion-button:focus{z-index:3;border-color:var(--bs-accordion-btn-focus-border-color);outline:0;box-shadow:var(--bs-accordion-btn-focus-box-shadow)}.accordion-header{margin-bottom:0}.accordion-item{color:var(--bs-accordion-color);background-color:var(--bs-accordion-bg);border:var(--bs-accordion-border-width) solid var(--bs-accordion-border-color)}.accordion-item:first-of-type{border-top-left-radius:var(--bs-accordion-border-radius);border-top-right-radius:var(--bs-accordion-border-radius)}.accordion-item:first-of-type .accordion-button{border-top-left-radius:var(--bs-accordion-inner-border-radius);border-top-right-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:not(:first-of-type){border-top:0}.accordion-item:last-of-type{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-item:last-of-type .accordion-button.collapsed{border-bottom-right-radius:var(--bs-accordion-inner-border-radius);border-bottom-left-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:last-of-type .accordion-collapse{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-body{padding:var(--bs-accordion-body-padding-y) var(--bs-accordion-body-padding-x)}.accordion-flush .accordion-collapse{border-width:0}.accordion-flush .accordion-item{border-right:0;border-left:0;border-radius:0}.accordion-flush .accordion-item:first-child{border-top:0}.accordion-flush .accordion-item:last-child{border-bottom:0}.accordion-flush .accordion-item .accordion-button{border-radius:0}.breadcrumb{--bs-breadcrumb-padding-x:0;--bs-breadcrumb-padding-y:0;--bs-breadcrumb-margin-bottom:1rem;--bs-breadcrumb-bg: ;--bs-breadcrumb-border-radius: ;--bs-breadcrumb-divider-color:#6c757d;--bs-breadcrumb-item-padding-x:0.5rem;--bs-breadcrumb-item-active-color:#6c757d;display:flex;flex-wrap:wrap;padding:var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x);margin-bottom:var(--bs-breadcrumb-margin-bottom);font-size:var(--bs-breadcrumb-font-size);list-style:none;background-color:var(--bs-breadcrumb-bg);border-radius:var(--bs-breadcrumb-border-radius)}.breadcrumb-item+.breadcrumb-item{padding-left:var(--bs-breadcrumb-item-padding-x)}.breadcrumb-item+.breadcrumb-item::before{float:left;padding-right:var(--bs-breadcrumb-item-padding-x);color:var(--bs-breadcrumb-divider-color);content:var(--bs-breadcrumb-divider, "/")}.breadcrumb-item.active{color:var(--bs-breadcrumb-item-active-color)}.pagination{--bs-pagination-padding-x:0.75rem;--bs-pagination-padding-y:0.375rem;--bs-pagination-font-size:1rem;--bs-pagination-color:var(--bs-link-color);--bs-pagination-bg:#fff;--bs-pagination-border-width:1px;--bs-pagination-border-color:#dee2e6;--bs-pagination-border-radius:0.375rem;--bs-pagination-hover-color:var(--bs-link-hover-color);--bs-pagination-hover-bg:#e9ecef;--bs-pagination-hover-border-color:#dee2e6;--bs-pagination-focus-color:var(--bs-link-hover-color);--bs-pagination-focus-bg:#e9ecef;--bs-pagination-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-pagination-active-color:#fff;--bs-pagination-active-bg:#0d6efd;--bs-pagination-active-border-color:#0d6efd;--bs-pagination-disabled-color:#6c757d;--bs-pagination-disabled-bg:#fff;--bs-pagination-disabled-border-color:#dee2e6;display:flex;padding-left:0;list-style:none}.page-link{position:relative;display:block;padding:var(--bs-pagination-padding-y) var(--bs-pagination-padding-x);font-size:var(--bs-pagination-font-size);color:var(--bs-pagination-color);text-decoration:none;background-color:var(--bs-pagination-bg);border:var(--bs-pagination-border-width) solid var(--bs-pagination-border-color);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.page-link{transition:none}}.page-link:hover{z-index:2;color:var(--bs-pagination-hover-color);background-color:var(--bs-pagination-hover-bg);border-color:var(--bs-pagination-hover-border-color)}.page-link:focus{z-index:3;color:var(--bs-pagination-focus-color);background-color:var(--bs-pagination-focus-bg);outline:0;box-shadow:var(--bs-pagination-focus-box-shadow)}.active>.page-link,.page-link.active{z-index:3;color:var(--bs-pagination-active-color);background-color:var(--bs-pagination-active-bg);border-color:var(--bs-pagination-active-border-color)}.disabled>.page-link,.page-link.disabled{color:var(--bs-pagination-disabled-color);pointer-events:none;background-color:var(--bs-pagination-disabled-bg);border-color:var(--bs-pagination-disabled-border-color)}.page-item:not(:first-child) .page-link{margin-left:-1px}.page-item:first-child .page-link{border-top-left-radius:var(--bs-pagination-border-radius);border-bottom-left-radius:var(--bs-pagination-border-radius)}.page-item:last-child .page-link{border-top-right-radius:var(--bs-pagination-border-radius);border-bottom-right-radius:var(--bs-pagination-border-radius)}.pagination-lg{--bs-pagination-padding-x:1.5rem;--bs-pagination-padding-y:0.75rem;--bs-pagination-font-size:1.25rem;--bs-pagination-border-radius:0.5rem}.pagination-sm{--bs-pagination-padding-x:0.5rem;--bs-pagination-padding-y:0.25rem;--bs-pagination-font-size:0.875rem;--bs-pagination-border-radius:0.25rem}.badge{--bs-badge-padding-x:0.65em;--bs-badge-padding-y:0.35em;--bs-badge-font-size:0.75em;--bs-badge-font-weight:700;--bs-badge-color:#fff;--bs-badge-border-radius:0.375rem;display:inline-block;padding:var(--bs-badge-padding-y) var(--bs-badge-padding-x);font-size:var(--bs-badge-font-size);font-weight:var(--bs-badge-font-weight);line-height:1;color:var(--bs-badge-color);text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:var(--bs-badge-border-radius,0)}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.alert{--bs-alert-bg:transparent;--bs-alert-padding-x:1rem;--bs-alert-padding-y:1rem;--bs-alert-margin-bottom:1rem;--bs-alert-color:inherit;--bs-alert-border-color:transparent;--bs-alert-border:1px solid var(--bs-alert-border-color);--bs-alert-border-radius:0.375rem;position:relative;padding:var(--bs-alert-padding-y) var(--bs-alert-padding-x);margin-bottom:var(--bs-alert-margin-bottom);color:var(--bs-alert-color);background-color:var(--bs-alert-bg);border:var(--bs-alert-border);border-radius:var(--bs-alert-border-radius,0)}.alert-heading{color:inherit}.alert-link{font-weight:700}.alert-dismissible{padding-right:3rem}.alert-dismissible .btn-close{position:absolute;top:0;right:0;z-index:2;padding:1.25rem 1rem}.alert-primary{--bs-alert-color:#084298;--bs-alert-bg:#cfe2ff;--bs-alert-border-color:#b6d4fe}.alert-primary .alert-link{color:#06357a}.alert-secondary{--bs-alert-color:#41464b;--bs-alert-bg:#e2e3e5;--bs-alert-border-color:#d3d6d8}.alert-secondary .alert-link{color:#34383c}.alert-success{--bs-alert-color:#0f5132;--bs-alert-bg:#d1e7dd;--bs-alert-border-color:#badbcc}.alert-success .alert-link{color:#0c4128}.alert-info{--bs-alert-color:#055160;--bs-alert-bg:#cff4fc;--bs-alert-border-color:#b6effb}.alert-info .alert-link{color:#04414d}.alert-warning{--bs-alert-color:#664d03;--bs-alert-bg:#fff3cd;--bs-alert-border-color:#ffecb5}.alert-warning .alert-link{color:#523e02}.alert-danger{--bs-alert-color:#842029;--bs-alert-bg:#f8d7da;--bs-alert-border-color:#f5c2c7}.alert-danger .alert-link{color:#6a1a21}.alert-light{--bs-alert-color:#636464;--bs-alert-bg:#fefefe;--bs-alert-border-color:#fdfdfe}.alert-light .alert-link{color:#4f5050}.alert-dark{--bs-alert-color:#141619;--bs-alert-bg:#d3d3d4;--bs-alert-border-color:#bcbebf}.alert-dark .alert-link{color:#101214}@-webkit-keyframes progress-bar-stripes{0%{background-position-x:1rem}}@keyframes progress-bar-stripes{0%{background-position-x:1rem}}.progress{--bs-progress-height:1rem;--bs-progress-font-size:0.75rem;--bs-progress-bg:#e9ecef;--bs-progress-border-radius:0.375rem;--bs-progress-box-shadow:inset 0 1px 2px rgba(0, 0, 0, 0.075);--bs-progress-bar-color:#fff;--bs-progress-bar-bg:#0d6efd;--bs-progress-bar-transition:width 0.6s ease;display:flex;height:var(--bs-progress-height);overflow:hidden;font-size:var(--bs-progress-font-size);background-color:var(--bs-progress-bg);border-radius:var(--bs-progress-border-radius)}.progress-bar{display:flex;flex-direction:column;justify-content:center;overflow:hidden;color:var(--bs-progress-bar-color);text-align:center;white-space:nowrap;background-color:var(--bs-progress-bar-bg);transition:var(--bs-progress-bar-transition)}@media (prefers-reduced-motion:reduce){.progress-bar{transition:none}}.progress-bar-striped{background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-size:var(--bs-progress-height) var(--bs-progress-height)}.progress-bar-animated{-webkit-animation:1s linear infinite progress-bar-stripes;animation:1s linear infinite progress-bar-stripes}@media (prefers-reduced-motion:reduce){.progress-bar-animated{-webkit-animation:none;animation:none}}.list-group{--bs-list-group-color:#212529;--bs-list-group-bg:#fff;--bs-list-group-border-color:rgba(0, 0, 0, 0.125);--bs-list-group-border-width:1px;--bs-list-group-border-radius:0.375rem;--bs-list-group-item-padding-x:1rem;--bs-list-group-item-padding-y:0.5rem;--bs-list-group-action-color:#495057;--bs-list-group-action-hover-color:#495057;--bs-list-group-action-hover-bg:#f8f9fa;--bs-list-group-action-active-color:#212529;--bs-list-group-action-active-bg:#e9ecef;--bs-list-group-disabled-color:#6c757d;--bs-list-group-disabled-bg:#fff;--bs-list-group-active-color:#fff;--bs-list-group-active-bg:#0d6efd;--bs-list-group-active-border-color:#0d6efd;display:flex;flex-direction:column;padding-left:0;margin-bottom:0;border-radius:var(--bs-list-group-border-radius)}.list-group-numbered{list-style-type:none;counter-reset:section}.list-group-numbered>.list-group-item::before{content:counters(section, ".") ". ";counter-increment:section}.list-group-item-action{width:100%;color:var(--bs-list-group-action-color);text-align:inherit}.list-group-item-action:focus,.list-group-item-action:hover{z-index:1;color:var(--bs-list-group-action-hover-color);text-decoration:none;background-color:var(--bs-list-group-action-hover-bg)}.list-group-item-action:active{color:var(--bs-list-group-action-active-color);background-color:var(--bs-list-group-action-active-bg)}.list-group-item{position:relative;display:block;padding:var(--bs-list-group-item-padding-y) var(--bs-list-group-item-padding-x);color:var(--bs-list-group-color);text-decoration:none;background-color:var(--bs-list-group-bg);border:var(--bs-list-group-border-width) solid var(--bs-list-group-border-color)}.list-group-item:first-child{border-top-left-radius:inherit;border-top-right-radius:inherit}.list-group-item:last-child{border-bottom-right-radius:inherit;border-bottom-left-radius:inherit}.list-group-item.disabled,.list-group-item:disabled{color:var(--bs-list-group-disabled-color);pointer-events:none;background-color:var(--bs-list-group-disabled-bg)}.list-group-item.active{z-index:2;color:var(--bs-list-group-active-color);background-color:var(--bs-list-group-active-bg);border-color:var(--bs-list-group-active-border-color)}.list-group-item+.list-group-item{border-top-width:0}.list-group-item+.list-group-item.active{margin-top:calc(var(--bs-list-group-border-width) * -1);border-top-width:var(--bs-list-group-border-width)}.list-group-horizontal{flex-direction:row}.list-group-horizontal>.list-group-item:first-child{border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal>.list-group-item:last-child{border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal>.list-group-item.active{margin-top:0}.list-group-horizontal>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal>.list-group-item+.list-group-item.active{margin-left:calc(var(--bs-list-group-border-width) * -1);border-left-width:var(--bs-list-group-border-width)}@media (min-width:576px){.list-group-horizontal-sm{flex-direction:row}.list-group-horizontal-sm>.list-group-item:first-child{border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-sm>.list-group-item:last-child{border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-sm>.list-group-item.active{margin-top:0}.list-group-horizontal-sm>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-sm>.list-group-item+.list-group-item.active{margin-left:calc(var(--bs-list-group-border-width) * -1);border-left-width:var(--bs-list-group-border-width)}}@media (min-width:768px){.list-group-horizontal-md{flex-direction:row}.list-group-horizontal-md>.list-group-item:first-child{border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-md>.list-group-item:last-child{border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-md>.list-group-item.active{margin-top:0}.list-group-horizontal-md>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-md>.list-group-item+.list-group-item.active{margin-left:calc(var(--bs-list-group-border-width) * -1);border-left-width:var(--bs-list-group-border-width)}}@media (min-width:992px){.list-group-horizontal-lg{flex-direction:row}.list-group-horizontal-lg>.list-group-item:first-child{border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-lg>.list-group-item:last-child{border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-lg>.list-group-item.active{margin-top:0}.list-group-horizontal-lg>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-lg>.list-group-item+.list-group-item.active{margin-left:calc(var(--bs-list-group-border-width) * -1);border-left-width:var(--bs-list-group-border-width)}}@media (min-width:1200px){.list-group-horizontal-xl{flex-direction:row}.list-group-horizontal-xl>.list-group-item:first-child{border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xl>.list-group-item:last-child{border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xl>.list-group-item.active{margin-top:0}.list-group-horizontal-xl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xl>.list-group-item+.list-group-item.active{margin-left:calc(var(--bs-list-group-border-width) * -1);border-left-width:var(--bs-list-group-border-width)}}@media (min-width:1400px){.list-group-horizontal-xxl{flex-direction:row}.list-group-horizontal-xxl>.list-group-item:first-child{border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xxl>.list-group-item:last-child{border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xxl>.list-group-item.active{margin-top:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item.active{margin-left:calc(var(--bs-list-group-border-width) * -1);border-left-width:var(--bs-list-group-border-width)}}.list-group-flush{border-radius:0}.list-group-flush>.list-group-item{border-width:0 0 var(--bs-list-group-border-width)}.list-group-flush>.list-group-item:last-child{border-bottom-width:0}.list-group-item-primary{color:#084298;background-color:#cfe2ff}.list-group-item-primary.list-group-item-action:focus,.list-group-item-primary.list-group-item-action:hover{color:#084298;background-color:#bacbe6}.list-group-item-primary.list-group-item-action.active{color:#fff;background-color:#084298;border-color:#084298}.list-group-item-secondary{color:#41464b;background-color:#e2e3e5}.list-group-item-secondary.list-group-item-action:focus,.list-group-item-secondary.list-group-item-action:hover{color:#41464b;background-color:#cbccce}.list-group-item-secondary.list-group-item-action.active{color:#fff;background-color:#41464b;border-color:#41464b}.list-group-item-success{color:#0f5132;background-color:#d1e7dd}.list-group-item-success.list-group-item-action:focus,.list-group-item-success.list-group-item-action:hover{color:#0f5132;background-color:#bcd0c7}.list-group-item-success.list-group-item-action.active{color:#fff;background-color:#0f5132;border-color:#0f5132}.list-group-item-info{color:#055160;background-color:#cff4fc}.list-group-item-info.list-group-item-action:focus,.list-group-item-info.list-group-item-action:hover{color:#055160;background-color:#badce3}.list-group-item-info.list-group-item-action.active{color:#fff;background-color:#055160;border-color:#055160}.list-group-item-warning{color:#664d03;background-color:#fff3cd}.list-group-item-warning.list-group-item-action:focus,.list-group-item-warning.list-group-item-action:hover{color:#664d03;background-color:#e6dbb9}.list-group-item-warning.list-group-item-action.active{color:#fff;background-color:#664d03;border-color:#664d03}.list-group-item-danger{color:#842029;background-color:#f8d7da}.list-group-item-danger.list-group-item-action:focus,.list-group-item-danger.list-group-item-action:hover{color:#842029;background-color:#dfc2c4}.list-group-item-danger.list-group-item-action.active{color:#fff;background-color:#842029;border-color:#842029}.list-group-item-light{color:#636464;background-color:#fefefe}.list-group-item-light.list-group-item-action:focus,.list-group-item-light.list-group-item-action:hover{color:#636464;background-color:#e5e5e5}.list-group-item-light.list-group-item-action.active{color:#fff;background-color:#636464;border-color:#636464}.list-group-item-dark{color:#141619;background-color:#d3d3d4}.list-group-item-dark.list-group-item-action:focus,.list-group-item-dark.list-group-item-action:hover{color:#141619;background-color:#bebebf}.list-group-item-dark.list-group-item-action.active{color:#fff;background-color:#141619;border-color:#141619}.btn-close{box-sizing:content-box;width:1em;height:1em;padding:.25em .25em;color:#000;background:transparent url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23000'%3e%3cpath d='M.293.293a1 1 0 0 1 1.414 0L8 6.586 14.293.293a1 1 0 1 1 1.414 1.414L9.414 8l6.293 6.293a1 1 0 0 1-1.414 1.414L8 9.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L6.586 8 .293 1.707a1 1 0 0 1 0-1.414z'/%3e%3c/svg%3e") center/1em auto no-repeat;border:0;border-radius:.375rem;opacity:.5}.btn-close:hover{color:#000;text-decoration:none;opacity:.75}.btn-close:focus{outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25);opacity:1}.btn-close.disabled,.btn-close:disabled{pointer-events:none;-webkit-user-select:none;-moz-user-select:none;user-select:none;opacity:.25}.btn-close-white{filter:invert(1) grayscale(100%) brightness(200%)}.toast{--bs-toast-padding-x:0.75rem;--bs-toast-padding-y:0.5rem;--bs-toast-spacing:1.5rem;--bs-toast-max-width:350px;--bs-toast-font-size:0.875rem;--bs-toast-color: ;--bs-toast-bg:rgba(255, 255, 255, 0.85);--bs-toast-border-width:1px;--bs-toast-border-color:var(--bs-border-color-translucent);--bs-toast-border-radius:0.375rem;--bs-toast-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-toast-header-color:#6c757d;--bs-toast-header-bg:rgba(255, 255, 255, 0.85);--bs-toast-header-border-color:rgba(0, 0, 0, 0.05);width:var(--bs-toast-max-width);max-width:100%;font-size:var(--bs-toast-font-size);color:var(--bs-toast-color);pointer-events:auto;background-color:var(--bs-toast-bg);background-clip:padding-box;border:var(--bs-toast-border-width) solid var(--bs-toast-border-color);box-shadow:var(--bs-toast-box-shadow);border-radius:var(--bs-toast-border-radius)}.toast.showing{opacity:0}.toast:not(.show){display:none}.toast-container{position:absolute;z-index:1090;width:-webkit-max-content;width:-moz-max-content;width:max-content;max-width:100%;pointer-events:none}.toast-container>:not(:last-child){margin-bottom:var(--bs-toast-spacing)}.toast-header{display:flex;align-items:center;padding:var(--bs-toast-padding-y) var(--bs-toast-padding-x);color:var(--bs-toast-header-color);background-color:var(--bs-toast-header-bg);background-clip:padding-box;border-bottom:var(--bs-toast-border-width) solid var(--bs-toast-header-border-color);border-top-left-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));border-top-right-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width))}.toast-header .btn-close{margin-right:calc(var(--bs-toast-padding-x) * -.5);margin-left:var(--bs-toast-padding-x)}.toast-body{padding:var(--bs-toast-padding-x);word-wrap:break-word}.modal{--bs-modal-zindex:1055;--bs-modal-width:500px;--bs-modal-padding:1rem;--bs-modal-margin:0.5rem;--bs-modal-color: ;--bs-modal-bg:#fff;--bs-modal-border-color:var(--bs-border-color-translucent);--bs-modal-border-width:1px;--bs-modal-border-radius:0.5rem;--bs-modal-box-shadow:0 0.125rem 0.25rem rgba(0, 0, 0, 0.075);--bs-modal-inner-border-radius:calc(0.5rem - 1px);--bs-modal-header-padding-x:1rem;--bs-modal-header-padding-y:1rem;--bs-modal-header-padding:1rem 1rem;--bs-modal-header-border-color:var(--bs-border-color);--bs-modal-header-border-width:1px;--bs-modal-title-line-height:1.5;--bs-modal-footer-gap:0.5rem;--bs-modal-footer-bg: ;--bs-modal-footer-border-color:var(--bs-border-color);--bs-modal-footer-border-width:1px;position:fixed;top:0;left:0;z-index:var(--bs-modal-zindex);display:none;width:100%;height:100%;overflow-x:hidden;overflow-y:auto;outline:0}.modal-dialog{position:relative;width:auto;margin:var(--bs-modal-margin);pointer-events:none}.modal.fade .modal-dialog{transition:transform .3s ease-out;transform:translate(0,-50px)}@media (prefers-reduced-motion:reduce){.modal.fade .modal-dialog{transition:none}}.modal.show .modal-dialog{transform:none}.modal.modal-static .modal-dialog{transform:scale(1.02)}.modal-dialog-scrollable{height:calc(100% - var(--bs-modal-margin) * 2)}.modal-dialog-scrollable .modal-content{max-height:100%;overflow:hidden}.modal-dialog-scrollable .modal-body{overflow-y:auto}.modal-dialog-centered{display:flex;align-items:center;min-height:calc(100% - var(--bs-modal-margin) * 2)}.modal-content{position:relative;display:flex;flex-direction:column;width:100%;color:var(--bs-modal-color);pointer-events:auto;background-color:var(--bs-modal-bg);background-clip:padding-box;border:var(--bs-modal-border-width) solid var(--bs-modal-border-color);border-radius:var(--bs-modal-border-radius);outline:0}.modal-backdrop{--bs-backdrop-zindex:1050;--bs-backdrop-bg:#000;--bs-backdrop-opacity:0.5;position:fixed;top:0;left:0;z-index:var(--bs-backdrop-zindex);width:100vw;height:100vh;background-color:var(--bs-backdrop-bg)}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:var(--bs-backdrop-opacity)}.modal-header{display:flex;flex-shrink:0;align-items:center;justify-content:space-between;padding:var(--bs-modal-header-padding);border-bottom:var(--bs-modal-header-border-width) solid var(--bs-modal-header-border-color);border-top-left-radius:var(--bs-modal-inner-border-radius);border-top-right-radius:var(--bs-modal-inner-border-radius)}.modal-header .btn-close{padding:calc(var(--bs-modal-header-padding-y) * .5) calc(var(--bs-modal-header-padding-x) * .5);margin:calc(var(--bs-modal-header-padding-y) * -.5) calc(var(--bs-modal-header-padding-x) * -.5) calc(var(--bs-modal-header-padding-y) * -.5) auto}.modal-title{margin-bottom:0;line-height:var(--bs-modal-title-line-height)}.modal-body{position:relative;flex:1 1 auto;padding:var(--bs-modal-padding)}.modal-footer{display:flex;flex-shrink:0;flex-wrap:wrap;align-items:center;justify-content:flex-end;padding:calc(var(--bs-modal-padding) - var(--bs-modal-footer-gap) * .5);background-color:var(--bs-modal-footer-bg);border-top:var(--bs-modal-footer-border-width) solid var(--bs-modal-footer-border-color);border-bottom-right-radius:var(--bs-modal-inner-border-radius);border-bottom-left-radius:var(--bs-modal-inner-border-radius)}.modal-footer>*{margin:calc(var(--bs-modal-footer-gap) * .5)}@media (min-width:576px){.modal{--bs-modal-margin:1.75rem;--bs-modal-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15)}.modal-dialog{max-width:var(--bs-modal-width);margin-right:auto;margin-left:auto}.modal-sm{--bs-modal-width:300px}}@media (min-width:992px){.modal-lg,.modal-xl{--bs-modal-width:800px}}@media (min-width:1200px){.modal-xl{--bs-modal-width:1140px}}.modal-fullscreen{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen .modal-footer,.modal-fullscreen .modal-header{border-radius:0}.modal-fullscreen .modal-body{overflow-y:auto}@media (max-width:575.98px){.modal-fullscreen-sm-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-sm-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-sm-down .modal-footer,.modal-fullscreen-sm-down .modal-header{border-radius:0}.modal-fullscreen-sm-down .modal-body{overflow-y:auto}}@media (max-width:767.98px){.modal-fullscreen-md-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-md-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-md-down .modal-footer,.modal-fullscreen-md-down .modal-header{border-radius:0}.modal-fullscreen-md-down .modal-body{overflow-y:auto}}@media (max-width:991.98px){.modal-fullscreen-lg-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-lg-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-lg-down .modal-footer,.modal-fullscreen-lg-down .modal-header{border-radius:0}.modal-fullscreen-lg-down .modal-body{overflow-y:auto}}@media (max-width:1199.98px){.modal-fullscreen-xl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xl-down .modal-footer,.modal-fullscreen-xl-down .modal-header{border-radius:0}.modal-fullscreen-xl-down .modal-body{overflow-y:auto}}@media (max-width:1399.98px){.modal-fullscreen-xxl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xxl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xxl-down .modal-footer,.modal-fullscreen-xxl-down .modal-header{border-radius:0}.modal-fullscreen-xxl-down .modal-body{overflow-y:auto}}.tooltip{--bs-tooltip-zindex:1080;--bs-tooltip-max-width:200px;--bs-tooltip-padding-x:0.5rem;--bs-tooltip-padding-y:0.25rem;--bs-tooltip-margin: ;--bs-tooltip-font-size:0.875rem;--bs-tooltip-color:#fff;--bs-tooltip-bg:#000;--bs-tooltip-border-radius:0.375rem;--bs-tooltip-opacity:0.9;--bs-tooltip-arrow-width:0.8rem;--bs-tooltip-arrow-height:0.4rem;z-index:var(--bs-tooltip-zindex);display:block;padding:var(--bs-tooltip-arrow-height);margin:var(--bs-tooltip-margin);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-tooltip-font-size);word-wrap:break-word;opacity:0}.tooltip.show{opacity:var(--bs-tooltip-opacity)}.tooltip .tooltip-arrow{display:block;width:var(--bs-tooltip-arrow-width);height:var(--bs-tooltip-arrow-height)}.tooltip .tooltip-arrow::before{position:absolute;content:"";border-color:transparent;border-style:solid}.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow,.bs-tooltip-top .tooltip-arrow{bottom:0}.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow::before,.bs-tooltip-top .tooltip-arrow::before{top:-1px;border-width:var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-top-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow,.bs-tooltip-end .tooltip-arrow{left:0;width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow::before,.bs-tooltip-end .tooltip-arrow::before{right:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-right-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow,.bs-tooltip-bottom .tooltip-arrow{top:0}.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow::before,.bs-tooltip-bottom .tooltip-arrow::before{bottom:-1px;border-width:0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-bottom-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow,.bs-tooltip-start .tooltip-arrow{right:0;width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow::before,.bs-tooltip-start .tooltip-arrow::before{left:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) 0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-left-color:var(--bs-tooltip-bg)}.tooltip-inner{max-width:var(--bs-tooltip-max-width);padding:var(--bs-tooltip-padding-y) var(--bs-tooltip-padding-x);color:var(--bs-tooltip-color);text-align:center;background-color:var(--bs-tooltip-bg);border-radius:var(--bs-tooltip-border-radius,0)}.popover{--bs-popover-zindex:1070;--bs-popover-max-width:276px;--bs-popover-font-size:0.875rem;--bs-popover-bg:#fff;--bs-popover-border-width:1px;--bs-popover-border-color:var(--bs-border-color-translucent);--bs-popover-border-radius:0.5rem;--bs-popover-inner-border-radius:calc(0.5rem - 1px);--bs-popover-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-popover-header-padding-x:1rem;--bs-popover-header-padding-y:0.5rem;--bs-popover-header-font-size:1rem;--bs-popover-header-color:var(--bs-heading-color);--bs-popover-header-bg:#f0f0f0;--bs-popover-body-padding-x:1rem;--bs-popover-body-padding-y:1rem;--bs-popover-body-color:#212529;--bs-popover-arrow-width:1rem;--bs-popover-arrow-height:0.5rem;--bs-popover-arrow-border:var(--bs-popover-border-color);z-index:var(--bs-popover-zindex);display:block;max-width:var(--bs-popover-max-width);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-popover-font-size);word-wrap:break-word;background-color:var(--bs-popover-bg);background-clip:padding-box;border:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-radius:var(--bs-popover-border-radius)}.popover .popover-arrow{display:block;width:var(--bs-popover-arrow-width);height:var(--bs-popover-arrow-height)}.popover .popover-arrow::after,.popover .popover-arrow::before{position:absolute;display:block;content:"";border-color:transparent;border-style:solid;border-width:0}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow,.bs-popover-top>.popover-arrow{bottom:calc(var(--bs-popover-arrow-height) * -1 - var(--bs-popover-border-width))}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::after,.bs-popover-top>.popover-arrow::before{border-width:var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::before{bottom:0;border-top-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-top>.popover-arrow::after{bottom:var(--bs-popover-border-width);border-top-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow,.bs-popover-end>.popover-arrow{left:calc(var(--bs-popover-arrow-height) * -1 - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::after,.bs-popover-end>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::before{left:0;border-right-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-end>.popover-arrow::after{left:var(--bs-popover-border-width);border-right-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow,.bs-popover-bottom>.popover-arrow{top:calc(var(--bs-popover-arrow-height) * -1 - var(--bs-popover-border-width))}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::before{border-width:0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::before{top:0;border-bottom-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::after{top:var(--bs-popover-border-width);border-bottom-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=bottom] .popover-header::before,.bs-popover-bottom .popover-header::before{position:absolute;top:0;left:50%;display:block;width:var(--bs-popover-arrow-width);margin-left:calc(var(--bs-popover-arrow-width) * -.5);content:"";border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-header-bg)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow,.bs-popover-start>.popover-arrow{right:calc(var(--bs-popover-arrow-height) * -1 - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::after,.bs-popover-start>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) 0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::before{right:0;border-left-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-start>.popover-arrow::after{right:var(--bs-popover-border-width);border-left-color:var(--bs-popover-bg)}.popover-header{padding:var(--bs-popover-header-padding-y) var(--bs-popover-header-padding-x);margin-bottom:0;font-size:var(--bs-popover-header-font-size);color:var(--bs-popover-header-color);background-color:var(--bs-popover-header-bg);border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-top-left-radius:var(--bs-popover-inner-border-radius);border-top-right-radius:var(--bs-popover-inner-border-radius)}.popover-header:empty{display:none}.popover-body{padding:var(--bs-popover-body-padding-y) var(--bs-popover-body-padding-x);color:var(--bs-popover-body-color)}.carousel{position:relative}.carousel.pointer-event{touch-action:pan-y}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-inner::after{display:block;clear:both;content:""}.carousel-item{position:relative;display:none;float:left;width:100%;margin-right:-100%;-webkit-backface-visibility:hidden;backface-visibility:hidden;transition:transform .6s ease-in-out}@media (prefers-reduced-motion:reduce){.carousel-item{transition:none}}.carousel-item-next,.carousel-item-prev,.carousel-item.active{display:block}.active.carousel-item-end,.carousel-item-next:not(.carousel-item-start){transform:translateX(100%)}.active.carousel-item-start,.carousel-item-prev:not(.carousel-item-end){transform:translateX(-100%)}.carousel-fade .carousel-item{opacity:0;transition-property:opacity;transform:none}.carousel-fade .carousel-item-next.carousel-item-start,.carousel-fade .carousel-item-prev.carousel-item-end,.carousel-fade .carousel-item.active{z-index:1;opacity:1}.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{z-index:0;opacity:0;transition:opacity 0s .6s}@media (prefers-reduced-motion:reduce){.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{transition:none}}.carousel-control-next,.carousel-control-prev{position:absolute;top:0;bottom:0;z-index:1;display:flex;align-items:center;justify-content:center;width:15%;padding:0;color:#fff;text-align:center;background:0 0;border:0;opacity:.5;transition:opacity .15s ease}@media (prefers-reduced-motion:reduce){.carousel-control-next,.carousel-control-prev{transition:none}}.carousel-control-next:focus,.carousel-control-next:hover,.carousel-control-prev:focus,.carousel-control-prev:hover{color:#fff;text-decoration:none;outline:0;opacity:.9}.carousel-control-prev{left:0}.carousel-control-next{right:0}.carousel-control-next-icon,.carousel-control-prev-icon{display:inline-block;width:2rem;height:2rem;background-repeat:no-repeat;background-position:50%;background-size:100% 100%}.carousel-control-prev-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z'/%3e%3c/svg%3e")}.carousel-control-next-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")}.carousel-indicators{position:absolute;right:0;bottom:0;left:0;z-index:2;display:flex;justify-content:center;padding:0;margin-right:15%;margin-bottom:1rem;margin-left:15%;list-style:none}.carousel-indicators [data-bs-target]{box-sizing:content-box;flex:0 1 auto;width:30px;height:3px;padding:0;margin-right:3px;margin-left:3px;text-indent:-999px;cursor:pointer;background-color:#fff;background-clip:padding-box;border:0;border-top:10px solid transparent;border-bottom:10px solid transparent;opacity:.5;transition:opacity .6s ease}@media (prefers-reduced-motion:reduce){.carousel-indicators [data-bs-target]{transition:none}}.carousel-indicators .active{opacity:1}.carousel-caption{position:absolute;right:15%;bottom:1.25rem;left:15%;padding-top:1.25rem;padding-bottom:1.25rem;color:#fff;text-align:center}.carousel-dark .carousel-control-next-icon,.carousel-dark .carousel-control-prev-icon{filter:invert(1) grayscale(100)}.carousel-dark .carousel-indicators [data-bs-target]{background-color:#000}.carousel-dark .carousel-caption{color:#000}.spinner-border,.spinner-grow{display:inline-block;width:var(--bs-spinner-width);height:var(--bs-spinner-height);vertical-align:var(--bs-spinner-vertical-align);border-radius:50%;-webkit-animation:var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name);animation:var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name)}@-webkit-keyframes spinner-border{to{transform:rotate(360deg)}}@keyframes spinner-border{to{transform:rotate(360deg)}}.spinner-border{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-border-width:0.25em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-border;border:var(--bs-spinner-border-width) solid currentcolor;border-right-color:transparent}.spinner-border-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem;--bs-spinner-border-width:0.2em}@-webkit-keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}@keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}.spinner-grow{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-grow;background-color:currentcolor;opacity:0}.spinner-grow-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem}@media (prefers-reduced-motion:reduce){.spinner-border,.spinner-grow{--bs-spinner-animation-speed:1.5s}}.offcanvas,.offcanvas-lg,.offcanvas-md,.offcanvas-sm,.offcanvas-xl,.offcanvas-xxl{--bs-offcanvas-width:400px;--bs-offcanvas-height:30vh;--bs-offcanvas-padding-x:1rem;--bs-offcanvas-padding-y:1rem;--bs-offcanvas-color: ;--bs-offcanvas-bg:#fff;--bs-offcanvas-border-width:1px;--bs-offcanvas-border-color:var(--bs-border-color-translucent);--bs-offcanvas-box-shadow:0 0.125rem 0.25rem rgba(0, 0, 0, 0.075)}@media (max-width:575.98px){.offcanvas-sm{position:fixed;bottom:0;z-index:1045;display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:575.98px) and (prefers-reduced-motion:reduce){.offcanvas-sm{transition:none}}@media (max-width:575.98px){.offcanvas-sm.show:not(.hiding),.offcanvas-sm.showing{transform:none}}@media (max-width:575.98px){.offcanvas-sm.hiding,.offcanvas-sm.show,.offcanvas-sm.showing{visibility:visible}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (min-width:576px){.offcanvas-sm{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-sm .offcanvas-header{display:none}.offcanvas-sm .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:767.98px){.offcanvas-md{position:fixed;bottom:0;z-index:1045;display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:767.98px) and (prefers-reduced-motion:reduce){.offcanvas-md{transition:none}}@media (max-width:767.98px){.offcanvas-md.show:not(.hiding),.offcanvas-md.showing{transform:none}}@media (max-width:767.98px){.offcanvas-md.hiding,.offcanvas-md.show,.offcanvas-md.showing{visibility:visible}}@media (max-width:767.98px){.offcanvas-md.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:767.98px){.offcanvas-md.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:767.98px){.offcanvas-md.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:767.98px){.offcanvas-md.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (min-width:768px){.offcanvas-md{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-md .offcanvas-header{display:none}.offcanvas-md .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:991.98px){.offcanvas-lg{position:fixed;bottom:0;z-index:1045;display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:991.98px) and (prefers-reduced-motion:reduce){.offcanvas-lg{transition:none}}@media (max-width:991.98px){.offcanvas-lg.show:not(.hiding),.offcanvas-lg.showing{transform:none}}@media (max-width:991.98px){.offcanvas-lg.hiding,.offcanvas-lg.show,.offcanvas-lg.showing{visibility:visible}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (min-width:992px){.offcanvas-lg{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-lg .offcanvas-header{display:none}.offcanvas-lg .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1199.98px){.offcanvas-xl{position:fixed;bottom:0;z-index:1045;display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:1199.98px) and (prefers-reduced-motion:reduce){.offcanvas-xl{transition:none}}@media (max-width:1199.98px){.offcanvas-xl.show:not(.hiding),.offcanvas-xl.showing{transform:none}}@media (max-width:1199.98px){.offcanvas-xl.hiding,.offcanvas-xl.show,.offcanvas-xl.showing{visibility:visible}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (min-width:1200px){.offcanvas-xl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xl .offcanvas-header{display:none}.offcanvas-xl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1399.98px){.offcanvas-xxl{position:fixed;bottom:0;z-index:1045;display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:1399.98px) and (prefers-reduced-motion:reduce){.offcanvas-xxl{transition:none}}@media (max-width:1399.98px){.offcanvas-xxl.show:not(.hiding),.offcanvas-xxl.showing{transform:none}}@media (max-width:1399.98px){.offcanvas-xxl.hiding,.offcanvas-xxl.show,.offcanvas-xxl.showing{visibility:visible}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (min-width:1400px){.offcanvas-xxl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xxl .offcanvas-header{display:none}.offcanvas-xxl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}.offcanvas{position:fixed;bottom:0;z-index:1045;display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}@media (prefers-reduced-motion:reduce){.offcanvas{transition:none}}.offcanvas.show:not(.hiding),.offcanvas.showing{transform:none}.offcanvas.hiding,.offcanvas.show,.offcanvas.showing{visibility:visible}.offcanvas.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-backdrop{position:fixed;top:0;left:0;z-index:1040;width:100vw;height:100vh;background-color:#000}.offcanvas-backdrop.fade{opacity:0}.offcanvas-backdrop.show{opacity:.5}.offcanvas-header{display:flex;align-items:center;justify-content:space-between;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x)}.offcanvas-header .btn-close{padding:calc(var(--bs-offcanvas-padding-y) * .5) calc(var(--bs-offcanvas-padding-x) * .5);margin-top:calc(var(--bs-offcanvas-padding-y) * -.5);margin-right:calc(var(--bs-offcanvas-padding-x) * -.5);margin-bottom:calc(var(--bs-offcanvas-padding-y) * -.5)}.offcanvas-title{margin-bottom:0;line-height:1.5}.offcanvas-body{flex-grow:1;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);overflow-y:auto}.placeholder{display:inline-block;min-height:1em;vertical-align:middle;cursor:wait;background-color:currentcolor;opacity:.5}.placeholder.btn::before{display:inline-block;content:""}.placeholder-xs{min-height:.6em}.placeholder-sm{min-height:.8em}.placeholder-lg{min-height:1.2em}.placeholder-glow .placeholder{-webkit-animation:placeholder-glow 2s ease-in-out infinite;animation:placeholder-glow 2s ease-in-out infinite}@-webkit-keyframes placeholder-glow{50%{opacity:.2}}@keyframes placeholder-glow{50%{opacity:.2}}.placeholder-wave{-webkit-mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);-webkit-mask-size:200% 100%;mask-size:200% 100%;-webkit-animation:placeholder-wave 2s linear infinite;animation:placeholder-wave 2s linear infinite}@-webkit-keyframes placeholder-wave{100%{-webkit-mask-position:-200% 0%;mask-position:-200% 0%}}@keyframes placeholder-wave{100%{-webkit-mask-position:-200% 0%;mask-position:-200% 0%}}.clearfix::after{display:block;clear:both;content:""}.text-bg-primary{color:#fff!important;background-color:RGBA(13,110,253,var(--bs-bg-opacity,1))!important}.text-bg-secondary{color:#fff!important;background-color:RGBA(108,117,125,var(--bs-bg-opacity,1))!important}.text-bg-success{color:#fff!important;background-color:RGBA(25,135,84,var(--bs-bg-opacity,1))!important}.text-bg-info{color:#000!important;background-color:RGBA(13,202,240,var(--bs-bg-opacity,1))!important}.text-bg-warning{color:#000!important;background-color:RGBA(255,193,7,var(--bs-bg-opacity,1))!important}.text-bg-danger{color:#fff!important;background-color:RGBA(220,53,69,var(--bs-bg-opacity,1))!important}.text-bg-light{color:#000!important;background-color:RGBA(248,249,250,var(--bs-bg-opacity,1))!important}.text-bg-dark{color:#fff!important;background-color:RGBA(33,37,41,var(--bs-bg-opacity,1))!important}.link-primary{color:#0d6efd!important}.link-primary:focus,.link-primary:hover{color:#0a58ca!important}.link-secondary{color:#6c757d!important}.link-secondary:focus,.link-secondary:hover{color:#565e64!important}.link-success{color:#198754!important}.link-success:focus,.link-success:hover{color:#146c43!important}.link-info{color:#0dcaf0!important}.link-info:focus,.link-info:hover{color:#3dd5f3!important}.link-warning{color:#ffc107!important}.link-warning:focus,.link-warning:hover{color:#ffcd39!important}.link-danger{color:#dc3545!important}.link-danger:focus,.link-danger:hover{color:#b02a37!important}.link-light{color:#f8f9fa!important}.link-light:focus,.link-light:hover{color:#f9fafb!important}.link-dark{color:#212529!important}.link-dark:focus,.link-dark:hover{color:#1a1e21!important}.ratio{position:relative;width:100%}.ratio::before{display:block;padding-top:var(--bs-aspect-ratio);content:""}.ratio>*{position:absolute;top:0;left:0;width:100%;height:100%}.ratio-1x1{--bs-aspect-ratio:100%}.ratio-4x3{--bs-aspect-ratio:75%}.ratio-16x9{--bs-aspect-ratio:56.25%}.ratio-21x9{--bs-aspect-ratio:42.8571428571%}.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}.fixed-bottom{position:fixed;right:0;bottom:0;left:0;z-index:1030}.sticky-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}@media (min-width:576px){.sticky-sm-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-sm-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:768px){.sticky-md-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-md-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:992px){.sticky-lg-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-lg-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:1200px){.sticky-xl-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-xl-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:1400px){.sticky-xxl-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-xxl-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}.hstack{display:flex;flex-direction:row;align-items:center;align-self:stretch}.vstack{display:flex;flex:1 1 auto;flex-direction:column;align-self:stretch}.visually-hidden,.visually-hidden-focusable:not(:focus):not(:focus-within){position:absolute!important;width:1px!important;height:1px!important;padding:0!important;margin:-1px!important;overflow:hidden!important;clip:rect(0,0,0,0)!important;white-space:nowrap!important;border:0!important}.stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.vr{display:inline-block;align-self:stretch;width:1px;min-height:1em;background-color:currentcolor;opacity:.25}.align-baseline{vertical-align:baseline!important}.align-top{vertical-align:top!important}.align-middle{vertical-align:middle!important}.align-bottom{vertical-align:bottom!important}.align-text-bottom{vertical-align:text-bottom!important}.align-text-top{vertical-align:text-top!important}.float-start{float:left!important}.float-end{float:right!important}.float-none{float:none!important}.opacity-0{opacity:0!important}.opacity-25{opacity:.25!important}.opacity-50{opacity:.5!important}.opacity-75{opacity:.75!important}.opacity-100{opacity:1!important}.overflow-auto{overflow:auto!important}.overflow-hidden{overflow:hidden!important}.overflow-visible{overflow:visible!important}.overflow-scroll{overflow:scroll!important}.d-inline{display:inline!important}.d-inline-block{display:inline-block!important}.d-block{display:block!important}.d-grid{display:grid!important}.d-table{display:table!important}.d-table-row{display:table-row!important}.d-table-cell{display:table-cell!important}.d-flex{display:flex!important}.d-inline-flex{display:inline-flex!important}.d-none{display:none!important}.shadow{box-shadow:0 .5rem 1rem rgba(0,0,0,.15)!important}.shadow-sm{box-shadow:0 .125rem .25rem rgba(0,0,0,.075)!important}.shadow-lg{box-shadow:0 1rem 3rem rgba(0,0,0,.175)!important}.shadow-none{box-shadow:none!important}.position-static{position:static!important}.position-relative{position:relative!important}.position-absolute{position:absolute!important}.position-fixed{position:fixed!important}.position-sticky{position:-webkit-sticky!important;position:sticky!important}.top-0{top:0!important}.top-50{top:50%!important}.top-100{top:100%!important}.bottom-0{bottom:0!important}.bottom-50{bottom:50%!important}.bottom-100{bottom:100%!important}.start-0{left:0!important}.start-50{left:50%!important}.start-100{left:100%!important}.end-0{right:0!important}.end-50{right:50%!important}.end-100{right:100%!important}.translate-middle{transform:translate(-50%,-50%)!important}.translate-middle-x{transform:translateX(-50%)!important}.translate-middle-y{transform:translateY(-50%)!important}.border{border:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-0{border:0!important}.border-top{border-top:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-top-0{border-top:0!important}.border-end{border-right:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-end-0{border-right:0!important}.border-bottom{border-bottom:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-bottom-0{border-bottom:0!important}.border-start{border-left:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-start-0{border-left:0!important}.border-primary{--bs-border-opacity:1;border-color:rgba(var(--bs-primary-rgb),var(--bs-border-opacity))!important}.border-secondary{--bs-border-opacity:1;border-color:rgba(var(--bs-secondary-rgb),var(--bs-border-opacity))!important}.border-success{--bs-border-opacity:1;border-color:rgba(var(--bs-success-rgb),var(--bs-border-opacity))!important}.border-info{--bs-border-opacity:1;border-color:rgba(var(--bs-info-rgb),var(--bs-border-opacity))!important}.border-warning{--bs-border-opacity:1;border-color:rgba(var(--bs-warning-rgb),var(--bs-border-opacity))!important}.border-danger{--bs-border-opacity:1;border-color:rgba(var(--bs-danger-rgb),var(--bs-border-opacity))!important}.border-light{--bs-border-opacity:1;border-color:rgba(var(--bs-light-rgb),var(--bs-border-opacity))!important}.border-dark{--bs-border-opacity:1;border-color:rgba(var(--bs-dark-rgb),var(--bs-border-opacity))!important}.border-white{--bs-border-opacity:1;border-color:rgba(var(--bs-white-rgb),var(--bs-border-opacity))!important}.border-1{--bs-border-width:1px}.border-2{--bs-border-width:2px}.border-3{--bs-border-width:3px}.border-4{--bs-border-width:4px}.border-5{--bs-border-width:5px}.border-opacity-10{--bs-border-opacity:0.1}.border-opacity-25{--bs-border-opacity:0.25}.border-opacity-50{--bs-border-opacity:0.5}.border-opacity-75{--bs-border-opacity:0.75}.border-opacity-100{--bs-border-opacity:1}.w-25{width:25%!important}.w-50{width:50%!important}.w-75{width:75%!important}.w-100{width:100%!important}.w-auto{width:auto!important}.mw-100{max-width:100%!important}.vw-100{width:100vw!important}.min-vw-100{min-width:100vw!important}.h-25{height:25%!important}.h-50{height:50%!important}.h-75{height:75%!important}.h-100{height:100%!important}.h-auto{height:auto!important}.mh-100{max-height:100%!important}.vh-100{height:100vh!important}.min-vh-100{min-height:100vh!important}.flex-fill{flex:1 1 auto!important}.flex-row{flex-direction:row!important}.flex-column{flex-direction:column!important}.flex-row-reverse{flex-direction:row-reverse!important}.flex-column-reverse{flex-direction:column-reverse!important}.flex-grow-0{flex-grow:0!important}.flex-grow-1{flex-grow:1!important}.flex-shrink-0{flex-shrink:0!important}.flex-shrink-1{flex-shrink:1!important}.flex-wrap{flex-wrap:wrap!important}.flex-nowrap{flex-wrap:nowrap!important}.flex-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-start{justify-content:flex-start!important}.justify-content-end{justify-content:flex-end!important}.justify-content-center{justify-content:center!important}.justify-content-between{justify-content:space-between!important}.justify-content-around{justify-content:space-around!important}.justify-content-evenly{justify-content:space-evenly!important}.align-items-start{align-items:flex-start!important}.align-items-end{align-items:flex-end!important}.align-items-center{align-items:center!important}.align-items-baseline{align-items:baseline!important}.align-items-stretch{align-items:stretch!important}.align-content-start{align-content:flex-start!important}.align-content-end{align-content:flex-end!important}.align-content-center{align-content:center!important}.align-content-between{align-content:space-between!important}.align-content-around{align-content:space-around!important}.align-content-stretch{align-content:stretch!important}.align-self-auto{align-self:auto!important}.align-self-start{align-self:flex-start!important}.align-self-end{align-self:flex-end!important}.align-self-center{align-self:center!important}.align-self-baseline{align-self:baseline!important}.align-self-stretch{align-self:stretch!important}.order-first{order:-1!important}.order-0{order:0!important}.order-1{order:1!important}.order-2{order:2!important}.order-3{order:3!important}.order-4{order:4!important}.order-5{order:5!important}.order-last{order:6!important}.m-0{margin:0!important}.m-1{margin:.25rem!important}.m-2{margin:.5rem!important}.m-3{margin:1rem!important}.m-4{margin:1.5rem!important}.m-5{margin:3rem!important}.m-auto{margin:auto!important}.mx-0{margin-right:0!important;margin-left:0!important}.mx-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-3{margin-right:1rem!important;margin-left:1rem!important}.mx-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-5{margin-right:3rem!important;margin-left:3rem!important}.mx-auto{margin-right:auto!important;margin-left:auto!important}.my-0{margin-top:0!important;margin-bottom:0!important}.my-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-0{margin-top:0!important}.mt-1{margin-top:.25rem!important}.mt-2{margin-top:.5rem!important}.mt-3{margin-top:1rem!important}.mt-4{margin-top:1.5rem!important}.mt-5{margin-top:3rem!important}.mt-auto{margin-top:auto!important}.me-0{margin-right:0!important}.me-1{margin-right:.25rem!important}.me-2{margin-right:.5rem!important}.me-3{margin-right:1rem!important}.me-4{margin-right:1.5rem!important}.me-5{margin-right:3rem!important}.me-auto{margin-right:auto!important}.mb-0{margin-bottom:0!important}.mb-1{margin-bottom:.25rem!important}.mb-2{margin-bottom:.5rem!important}.mb-3{margin-bottom:1rem!important}.mb-4{margin-bottom:1.5rem!important}.mb-5{margin-bottom:3rem!important}.mb-auto{margin-bottom:auto!important}.ms-0{margin-left:0!important}.ms-1{margin-left:.25rem!important}.ms-2{margin-left:.5rem!important}.ms-3{margin-left:1rem!important}.ms-4{margin-left:1.5rem!important}.ms-5{margin-left:3rem!important}.ms-auto{margin-left:auto!important}.p-0{padding:0!important}.p-1{padding:.25rem!important}.p-2{padding:.5rem!important}.p-3{padding:1rem!important}.p-4{padding:1.5rem!important}.p-5{padding:3rem!important}.px-0{padding-right:0!important;padding-left:0!important}.px-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-3{padding-right:1rem!important;padding-left:1rem!important}.px-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-5{padding-right:3rem!important;padding-left:3rem!important}.py-0{padding-top:0!important;padding-bottom:0!important}.py-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-0{padding-top:0!important}.pt-1{padding-top:.25rem!important}.pt-2{padding-top:.5rem!important}.pt-3{padding-top:1rem!important}.pt-4{padding-top:1.5rem!important}.pt-5{padding-top:3rem!important}.pe-0{padding-right:0!important}.pe-1{padding-right:.25rem!important}.pe-2{padding-right:.5rem!important}.pe-3{padding-right:1rem!important}.pe-4{padding-right:1.5rem!important}.pe-5{padding-right:3rem!important}.pb-0{padding-bottom:0!important}.pb-1{padding-bottom:.25rem!important}.pb-2{padding-bottom:.5rem!important}.pb-3{padding-bottom:1rem!important}.pb-4{padding-bottom:1.5rem!important}.pb-5{padding-bottom:3rem!important}.ps-0{padding-left:0!important}.ps-1{padding-left:.25rem!important}.ps-2{padding-left:.5rem!important}.ps-3{padding-left:1rem!important}.ps-4{padding-left:1.5rem!important}.ps-5{padding-left:3rem!important}.gap-0{gap:0!important}.gap-1{gap:.25rem!important}.gap-2{gap:.5rem!important}.gap-3{gap:1rem!important}.gap-4{gap:1.5rem!important}.gap-5{gap:3rem!important}.font-monospace{font-family:var(--bs-font-monospace)!important}.fs-1{font-size:calc(1.375rem + 1.5vw)!important}.fs-2{font-size:calc(1.325rem + .9vw)!important}.fs-3{font-size:calc(1.3rem + .6vw)!important}.fs-4{font-size:calc(1.275rem + .3vw)!important}.fs-5{font-size:1.25rem!important}.fs-6{font-size:1rem!important}.fst-italic{font-style:italic!important}.fst-normal{font-style:normal!important}.fw-light{font-weight:300!important}.fw-lighter{font-weight:lighter!important}.fw-normal{font-weight:400!important}.fw-bold{font-weight:700!important}.fw-semibold{font-weight:600!important}.fw-bolder{font-weight:bolder!important}.lh-1{line-height:1!important}.lh-sm{line-height:1.25!important}.lh-base{line-height:1.5!important}.lh-lg{line-height:2!important}.text-start{text-align:left!important}.text-end{text-align:right!important}.text-center{text-align:center!important}.text-decoration-none{text-decoration:none!important}.text-decoration-underline{text-decoration:underline!important}.text-decoration-line-through{text-decoration:line-through!important}.text-lowercase{text-transform:lowercase!important}.text-uppercase{text-transform:uppercase!important}.text-capitalize{text-transform:capitalize!important}.text-wrap{white-space:normal!important}.text-nowrap{white-space:nowrap!important}.text-break{word-wrap:break-word!important;word-break:break-word!important}.text-primary{--bs-text-opacity:1;color:rgba(var(--bs-primary-rgb),var(--bs-text-opacity))!important}.text-secondary{--bs-text-opacity:1;color:rgba(var(--bs-secondary-rgb),var(--bs-text-opacity))!important}.text-success{--bs-text-opacity:1;color:rgba(var(--bs-success-rgb),var(--bs-text-opacity))!important}.text-info{--bs-text-opacity:1;color:rgba(var(--bs-info-rgb),var(--bs-text-opacity))!important}.text-warning{--bs-text-opacity:1;color:rgba(var(--bs-warning-rgb),var(--bs-text-opacity))!important}.text-danger{--bs-text-opacity:1;color:rgba(var(--bs-danger-rgb),var(--bs-text-opacity))!important}.text-light{--bs-text-opacity:1;color:rgba(var(--bs-light-rgb),var(--bs-text-opacity))!important}.text-dark{--bs-text-opacity:1;color:rgba(var(--bs-dark-rgb),var(--bs-text-opacity))!important}.text-black{--bs-text-opacity:1;color:rgba(var(--bs-black-rgb),var(--bs-text-opacity))!important}.text-white{--bs-text-opacity:1;color:rgba(var(--bs-white-rgb),var(--bs-text-opacity))!important}.text-body{--bs-text-opacity:1;color:rgba(var(--bs-body-color-rgb),var(--bs-text-opacity))!important}.text-muted{--bs-text-opacity:1;color:rgba(var(--bs-body-color-rgb),.75)!important}.text-black-50{--bs-text-opacity:1;color:rgba(0,0,0,.5)!important}.text-white-50{--bs-text-opacity:1;color:rgba(255,255,255,.5)!important}.text-reset{--bs-text-opacity:1;color:inherit!important}.text-opacity-25{--bs-text-opacity:0.25}.text-opacity-50{--bs-text-opacity:0.5}.text-opacity-75{--bs-text-opacity:0.75}.text-opacity-100{--bs-text-opacity:1}.bg-primary{--bs-bg-opacity:1;background-color:rgba(var(--bs-primary-rgb),var(--bs-bg-opacity))!important}.bg-secondary{--bs-bg-opacity:1;background-color:rgba(var(--bs-secondary-rgb),var(--bs-bg-opacity))!important}.bg-success{--bs-bg-opacity:1;background-color:rgba(var(--bs-success-rgb),var(--bs-bg-opacity))!important}.bg-info{--bs-bg-opacity:1;background-color:rgba(var(--bs-info-rgb),var(--bs-bg-opacity))!important}.bg-warning{--bs-bg-opacity:1;background-color:rgba(var(--bs-warning-rgb),var(--bs-bg-opacity))!important}.bg-danger{--bs-bg-opacity:1;background-color:rgba(var(--bs-danger-rgb),var(--bs-bg-opacity))!important}.bg-light{--bs-bg-opacity:1;background-color:rgba(var(--bs-light-rgb),var(--bs-bg-opacity))!important}.bg-dark{--bs-bg-opacity:1;background-color:rgba(var(--bs-dark-rgb),var(--bs-bg-opacity))!important}.bg-black{--bs-bg-opacity:1;background-color:rgba(var(--bs-black-rgb),var(--bs-bg-opacity))!important}.bg-white{--bs-bg-opacity:1;background-color:rgba(var(--bs-white-rgb),var(--bs-bg-opacity))!important}.bg-body{--bs-bg-opacity:1;background-color:rgba(var(--bs-body-bg-rgb),var(--bs-bg-opacity))!important}.bg-transparent{--bs-bg-opacity:1;background-color:transparent!important}.bg-opacity-10{--bs-bg-opacity:0.1}.bg-opacity-25{--bs-bg-opacity:0.25}.bg-opacity-50{--bs-bg-opacity:0.5}.bg-opacity-75{--bs-bg-opacity:0.75}.bg-opacity-100{--bs-bg-opacity:1}.bg-gradient{background-image:var(--bs-gradient)!important}.user-select-all{-webkit-user-select:all!important;-moz-user-select:all!important;user-select:all!important}.user-select-auto{-webkit-user-select:auto!important;-moz-user-select:auto!important;user-select:auto!important}.user-select-none{-webkit-user-select:none!important;-moz-user-select:none!important;user-select:none!important}.pe-none{pointer-events:none!important}.pe-auto{pointer-events:auto!important}.rounded{border-radius:var(--bs-border-radius)!important}.rounded-0{border-radius:0!important}.rounded-1{border-radius:var(--bs-border-radius-sm)!important}.rounded-2{border-radius:var(--bs-border-radius)!important}.rounded-3{border-radius:var(--bs-border-radius-lg)!important}.rounded-4{border-radius:var(--bs-border-radius-xl)!important}.rounded-5{border-radius:var(--bs-border-radius-2xl)!important}.rounded-circle{border-radius:50%!important}.rounded-pill{border-radius:var(--bs-border-radius-pill)!important}.rounded-top{border-top-left-radius:var(--bs-border-radius)!important;border-top-right-radius:var(--bs-border-radius)!important}.rounded-end{border-top-right-radius:var(--bs-border-radius)!important;border-bottom-right-radius:var(--bs-border-radius)!important}.rounded-bottom{border-bottom-right-radius:var(--bs-border-radius)!important;border-bottom-left-radius:var(--bs-border-radius)!important}.rounded-start{border-bottom-left-radius:var(--bs-border-radius)!important;border-top-left-radius:var(--bs-border-radius)!important}.visible{visibility:visible!important}.invisible{visibility:hidden!important}@media (min-width:576px){.float-sm-start{float:left!important}.float-sm-end{float:right!important}.float-sm-none{float:none!important}.d-sm-inline{display:inline!important}.d-sm-inline-block{display:inline-block!important}.d-sm-block{display:block!important}.d-sm-grid{display:grid!important}.d-sm-table{display:table!important}.d-sm-table-row{display:table-row!important}.d-sm-table-cell{display:table-cell!important}.d-sm-flex{display:flex!important}.d-sm-inline-flex{display:inline-flex!important}.d-sm-none{display:none!important}.flex-sm-fill{flex:1 1 auto!important}.flex-sm-row{flex-direction:row!important}.flex-sm-column{flex-direction:column!important}.flex-sm-row-reverse{flex-direction:row-reverse!important}.flex-sm-column-reverse{flex-direction:column-reverse!important}.flex-sm-grow-0{flex-grow:0!important}.flex-sm-grow-1{flex-grow:1!important}.flex-sm-shrink-0{flex-shrink:0!important}.flex-sm-shrink-1{flex-shrink:1!important}.flex-sm-wrap{flex-wrap:wrap!important}.flex-sm-nowrap{flex-wrap:nowrap!important}.flex-sm-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-sm-start{justify-content:flex-start!important}.justify-content-sm-end{justify-content:flex-end!important}.justify-content-sm-center{justify-content:center!important}.justify-content-sm-between{justify-content:space-between!important}.justify-content-sm-around{justify-content:space-around!important}.justify-content-sm-evenly{justify-content:space-evenly!important}.align-items-sm-start{align-items:flex-start!important}.align-items-sm-end{align-items:flex-end!important}.align-items-sm-center{align-items:center!important}.align-items-sm-baseline{align-items:baseline!important}.align-items-sm-stretch{align-items:stretch!important}.align-content-sm-start{align-content:flex-start!important}.align-content-sm-end{align-content:flex-end!important}.align-content-sm-center{align-content:center!important}.align-content-sm-between{align-content:space-between!important}.align-content-sm-around{align-content:space-around!important}.align-content-sm-stretch{align-content:stretch!important}.align-self-sm-auto{align-self:auto!important}.align-self-sm-start{align-self:flex-start!important}.align-self-sm-end{align-self:flex-end!important}.align-self-sm-center{align-self:center!important}.align-self-sm-baseline{align-self:baseline!important}.align-self-sm-stretch{align-self:stretch!important}.order-sm-first{order:-1!important}.order-sm-0{order:0!important}.order-sm-1{order:1!important}.order-sm-2{order:2!important}.order-sm-3{order:3!important}.order-sm-4{order:4!important}.order-sm-5{order:5!important}.order-sm-last{order:6!important}.m-sm-0{margin:0!important}.m-sm-1{margin:.25rem!important}.m-sm-2{margin:.5rem!important}.m-sm-3{margin:1rem!important}.m-sm-4{margin:1.5rem!important}.m-sm-5{margin:3rem!important}.m-sm-auto{margin:auto!important}.mx-sm-0{margin-right:0!important;margin-left:0!important}.mx-sm-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-sm-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-sm-3{margin-right:1rem!important;margin-left:1rem!important}.mx-sm-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-sm-5{margin-right:3rem!important;margin-left:3rem!important}.mx-sm-auto{margin-right:auto!important;margin-left:auto!important}.my-sm-0{margin-top:0!important;margin-bottom:0!important}.my-sm-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-sm-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-sm-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-sm-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-sm-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-sm-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-sm-0{margin-top:0!important}.mt-sm-1{margin-top:.25rem!important}.mt-sm-2{margin-top:.5rem!important}.mt-sm-3{margin-top:1rem!important}.mt-sm-4{margin-top:1.5rem!important}.mt-sm-5{margin-top:3rem!important}.mt-sm-auto{margin-top:auto!important}.me-sm-0{margin-right:0!important}.me-sm-1{margin-right:.25rem!important}.me-sm-2{margin-right:.5rem!important}.me-sm-3{margin-right:1rem!important}.me-sm-4{margin-right:1.5rem!important}.me-sm-5{margin-right:3rem!important}.me-sm-auto{margin-right:auto!important}.mb-sm-0{margin-bottom:0!important}.mb-sm-1{margin-bottom:.25rem!important}.mb-sm-2{margin-bottom:.5rem!important}.mb-sm-3{margin-bottom:1rem!important}.mb-sm-4{margin-bottom:1.5rem!important}.mb-sm-5{margin-bottom:3rem!important}.mb-sm-auto{margin-bottom:auto!important}.ms-sm-0{margin-left:0!important}.ms-sm-1{margin-left:.25rem!important}.ms-sm-2{margin-left:.5rem!important}.ms-sm-3{margin-left:1rem!important}.ms-sm-4{margin-left:1.5rem!important}.ms-sm-5{margin-left:3rem!important}.ms-sm-auto{margin-left:auto!important}.p-sm-0{padding:0!important}.p-sm-1{padding:.25rem!important}.p-sm-2{padding:.5rem!important}.p-sm-3{padding:1rem!important}.p-sm-4{padding:1.5rem!important}.p-sm-5{padding:3rem!important}.px-sm-0{padding-right:0!important;padding-left:0!important}.px-sm-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-sm-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-sm-3{padding-right:1rem!important;padding-left:1rem!important}.px-sm-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-sm-5{padding-right:3rem!important;padding-left:3rem!important}.py-sm-0{padding-top:0!important;padding-bottom:0!important}.py-sm-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-sm-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-sm-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-sm-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-sm-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-sm-0{padding-top:0!important}.pt-sm-1{padding-top:.25rem!important}.pt-sm-2{padding-top:.5rem!important}.pt-sm-3{padding-top:1rem!important}.pt-sm-4{padding-top:1.5rem!important}.pt-sm-5{padding-top:3rem!important}.pe-sm-0{padding-right:0!important}.pe-sm-1{padding-right:.25rem!important}.pe-sm-2{padding-right:.5rem!important}.pe-sm-3{padding-right:1rem!important}.pe-sm-4{padding-right:1.5rem!important}.pe-sm-5{padding-right:3rem!important}.pb-sm-0{padding-bottom:0!important}.pb-sm-1{padding-bottom:.25rem!important}.pb-sm-2{padding-bottom:.5rem!important}.pb-sm-3{padding-bottom:1rem!important}.pb-sm-4{padding-bottom:1.5rem!important}.pb-sm-5{padding-bottom:3rem!important}.ps-sm-0{padding-left:0!important}.ps-sm-1{padding-left:.25rem!important}.ps-sm-2{padding-left:.5rem!important}.ps-sm-3{padding-left:1rem!important}.ps-sm-4{padding-left:1.5rem!important}.ps-sm-5{padding-left:3rem!important}.gap-sm-0{gap:0!important}.gap-sm-1{gap:.25rem!important}.gap-sm-2{gap:.5rem!important}.gap-sm-3{gap:1rem!important}.gap-sm-4{gap:1.5rem!important}.gap-sm-5{gap:3rem!important}.text-sm-start{text-align:left!important}.text-sm-end{text-align:right!important}.text-sm-center{text-align:center!important}}@media (min-width:768px){.float-md-start{float:left!important}.float-md-end{float:right!important}.float-md-none{float:none!important}.d-md-inline{display:inline!important}.d-md-inline-block{display:inline-block!important}.d-md-block{display:block!important}.d-md-grid{display:grid!important}.d-md-table{display:table!important}.d-md-table-row{display:table-row!important}.d-md-table-cell{display:table-cell!important}.d-md-flex{display:flex!important}.d-md-inline-flex{display:inline-flex!important}.d-md-none{display:none!important}.flex-md-fill{flex:1 1 auto!important}.flex-md-row{flex-direction:row!important}.flex-md-column{flex-direction:column!important}.flex-md-row-reverse{flex-direction:row-reverse!important}.flex-md-column-reverse{flex-direction:column-reverse!important}.flex-md-grow-0{flex-grow:0!important}.flex-md-grow-1{flex-grow:1!important}.flex-md-shrink-0{flex-shrink:0!important}.flex-md-shrink-1{flex-shrink:1!important}.flex-md-wrap{flex-wrap:wrap!important}.flex-md-nowrap{flex-wrap:nowrap!important}.flex-md-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-md-start{justify-content:flex-start!important}.justify-content-md-end{justify-content:flex-end!important}.justify-content-md-center{justify-content:center!important}.justify-content-md-between{justify-content:space-between!important}.justify-content-md-around{justify-content:space-around!important}.justify-content-md-evenly{justify-content:space-evenly!important}.align-items-md-start{align-items:flex-start!important}.align-items-md-end{align-items:flex-end!important}.align-items-md-center{align-items:center!important}.align-items-md-baseline{align-items:baseline!important}.align-items-md-stretch{align-items:stretch!important}.align-content-md-start{align-content:flex-start!important}.align-content-md-end{align-content:flex-end!important}.align-content-md-center{align-content:center!important}.align-content-md-between{align-content:space-between!important}.align-content-md-around{align-content:space-around!important}.align-content-md-stretch{align-content:stretch!important}.align-self-md-auto{align-self:auto!important}.align-self-md-start{align-self:flex-start!important}.align-self-md-end{align-self:flex-end!important}.align-self-md-center{align-self:center!important}.align-self-md-baseline{align-self:baseline!important}.align-self-md-stretch{align-self:stretch!important}.order-md-first{order:-1!important}.order-md-0{order:0!important}.order-md-1{order:1!important}.order-md-2{order:2!important}.order-md-3{order:3!important}.order-md-4{order:4!important}.order-md-5{order:5!important}.order-md-last{order:6!important}.m-md-0{margin:0!important}.m-md-1{margin:.25rem!important}.m-md-2{margin:.5rem!important}.m-md-3{margin:1rem!important}.m-md-4{margin:1.5rem!important}.m-md-5{margin:3rem!important}.m-md-auto{margin:auto!important}.mx-md-0{margin-right:0!important;margin-left:0!important}.mx-md-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-md-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-md-3{margin-right:1rem!important;margin-left:1rem!important}.mx-md-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-md-5{margin-right:3rem!important;margin-left:3rem!important}.mx-md-auto{margin-right:auto!important;margin-left:auto!important}.my-md-0{margin-top:0!important;margin-bottom:0!important}.my-md-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-md-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-md-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-md-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-md-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-md-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-md-0{margin-top:0!important}.mt-md-1{margin-top:.25rem!important}.mt-md-2{margin-top:.5rem!important}.mt-md-3{margin-top:1rem!important}.mt-md-4{margin-top:1.5rem!important}.mt-md-5{margin-top:3rem!important}.mt-md-auto{margin-top:auto!important}.me-md-0{margin-right:0!important}.me-md-1{margin-right:.25rem!important}.me-md-2{margin-right:.5rem!important}.me-md-3{margin-right:1rem!important}.me-md-4{margin-right:1.5rem!important}.me-md-5{margin-right:3rem!important}.me-md-auto{margin-right:auto!important}.mb-md-0{margin-bottom:0!important}.mb-md-1{margin-bottom:.25rem!important}.mb-md-2{margin-bottom:.5rem!important}.mb-md-3{margin-bottom:1rem!important}.mb-md-4{margin-bottom:1.5rem!important}.mb-md-5{margin-bottom:3rem!important}.mb-md-auto{margin-bottom:auto!important}.ms-md-0{margin-left:0!important}.ms-md-1{margin-left:.25rem!important}.ms-md-2{margin-left:.5rem!important}.ms-md-3{margin-left:1rem!important}.ms-md-4{margin-left:1.5rem!important}.ms-md-5{margin-left:3rem!important}.ms-md-auto{margin-left:auto!important}.p-md-0{padding:0!important}.p-md-1{padding:.25rem!important}.p-md-2{padding:.5rem!important}.p-md-3{padding:1rem!important}.p-md-4{padding:1.5rem!important}.p-md-5{padding:3rem!important}.px-md-0{padding-right:0!important;padding-left:0!important}.px-md-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-md-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-md-3{padding-right:1rem!important;padding-left:1rem!important}.px-md-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-md-5{padding-right:3rem!important;padding-left:3rem!important}.py-md-0{padding-top:0!important;padding-bottom:0!important}.py-md-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-md-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-md-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-md-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-md-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-md-0{padding-top:0!important}.pt-md-1{padding-top:.25rem!important}.pt-md-2{padding-top:.5rem!important}.pt-md-3{padding-top:1rem!important}.pt-md-4{padding-top:1.5rem!important}.pt-md-5{padding-top:3rem!important}.pe-md-0{padding-right:0!important}.pe-md-1{padding-right:.25rem!important}.pe-md-2{padding-right:.5rem!important}.pe-md-3{padding-right:1rem!important}.pe-md-4{padding-right:1.5rem!important}.pe-md-5{padding-right:3rem!important}.pb-md-0{padding-bottom:0!important}.pb-md-1{padding-bottom:.25rem!important}.pb-md-2{padding-bottom:.5rem!important}.pb-md-3{padding-bottom:1rem!important}.pb-md-4{padding-bottom:1.5rem!important}.pb-md-5{padding-bottom:3rem!important}.ps-md-0{padding-left:0!important}.ps-md-1{padding-left:.25rem!important}.ps-md-2{padding-left:.5rem!important}.ps-md-3{padding-left:1rem!important}.ps-md-4{padding-left:1.5rem!important}.ps-md-5{padding-left:3rem!important}.gap-md-0{gap:0!important}.gap-md-1{gap:.25rem!important}.gap-md-2{gap:.5rem!important}.gap-md-3{gap:1rem!important}.gap-md-4{gap:1.5rem!important}.gap-md-5{gap:3rem!important}.text-md-start{text-align:left!important}.text-md-end{text-align:right!important}.text-md-center{text-align:center!important}}@media (min-width:992px){.float-lg-start{float:left!important}.float-lg-end{float:right!important}.float-lg-none{float:none!important}.d-lg-inline{display:inline!important}.d-lg-inline-block{display:inline-block!important}.d-lg-block{display:block!important}.d-lg-grid{display:grid!important}.d-lg-table{display:table!important}.d-lg-table-row{display:table-row!important}.d-lg-table-cell{display:table-cell!important}.d-lg-flex{display:flex!important}.d-lg-inline-flex{display:inline-flex!important}.d-lg-none{display:none!important}.flex-lg-fill{flex:1 1 auto!important}.flex-lg-row{flex-direction:row!important}.flex-lg-column{flex-direction:column!important}.flex-lg-row-reverse{flex-direction:row-reverse!important}.flex-lg-column-reverse{flex-direction:column-reverse!important}.flex-lg-grow-0{flex-grow:0!important}.flex-lg-grow-1{flex-grow:1!important}.flex-lg-shrink-0{flex-shrink:0!important}.flex-lg-shrink-1{flex-shrink:1!important}.flex-lg-wrap{flex-wrap:wrap!important}.flex-lg-nowrap{flex-wrap:nowrap!important}.flex-lg-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-lg-start{justify-content:flex-start!important}.justify-content-lg-end{justify-content:flex-end!important}.justify-content-lg-center{justify-content:center!important}.justify-content-lg-between{justify-content:space-between!important}.justify-content-lg-around{justify-content:space-around!important}.justify-content-lg-evenly{justify-content:space-evenly!important}.align-items-lg-start{align-items:flex-start!important}.align-items-lg-end{align-items:flex-end!important}.align-items-lg-center{align-items:center!important}.align-items-lg-baseline{align-items:baseline!important}.align-items-lg-stretch{align-items:stretch!important}.align-content-lg-start{align-content:flex-start!important}.align-content-lg-end{align-content:flex-end!important}.align-content-lg-center{align-content:center!important}.align-content-lg-between{align-content:space-between!important}.align-content-lg-around{align-content:space-around!important}.align-content-lg-stretch{align-content:stretch!important}.align-self-lg-auto{align-self:auto!important}.align-self-lg-start{align-self:flex-start!important}.align-self-lg-end{align-self:flex-end!important}.align-self-lg-center{align-self:center!important}.align-self-lg-baseline{align-self:baseline!important}.align-self-lg-stretch{align-self:stretch!important}.order-lg-first{order:-1!important}.order-lg-0{order:0!important}.order-lg-1{order:1!important}.order-lg-2{order:2!important}.order-lg-3{order:3!important}.order-lg-4{order:4!important}.order-lg-5{order:5!important}.order-lg-last{order:6!important}.m-lg-0{margin:0!important}.m-lg-1{margin:.25rem!important}.m-lg-2{margin:.5rem!important}.m-lg-3{margin:1rem!important}.m-lg-4{margin:1.5rem!important}.m-lg-5{margin:3rem!important}.m-lg-auto{margin:auto!important}.mx-lg-0{margin-right:0!important;margin-left:0!important}.mx-lg-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-lg-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-lg-3{margin-right:1rem!important;margin-left:1rem!important}.mx-lg-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-lg-5{margin-right:3rem!important;margin-left:3rem!important}.mx-lg-auto{margin-right:auto!important;margin-left:auto!important}.my-lg-0{margin-top:0!important;margin-bottom:0!important}.my-lg-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-lg-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-lg-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-lg-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-lg-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-lg-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-lg-0{margin-top:0!important}.mt-lg-1{margin-top:.25rem!important}.mt-lg-2{margin-top:.5rem!important}.mt-lg-3{margin-top:1rem!important}.mt-lg-4{margin-top:1.5rem!important}.mt-lg-5{margin-top:3rem!important}.mt-lg-auto{margin-top:auto!important}.me-lg-0{margin-right:0!important}.me-lg-1{margin-right:.25rem!important}.me-lg-2{margin-right:.5rem!important}.me-lg-3{margin-right:1rem!important}.me-lg-4{margin-right:1.5rem!important}.me-lg-5{margin-right:3rem!important}.me-lg-auto{margin-right:auto!important}.mb-lg-0{margin-bottom:0!important}.mb-lg-1{margin-bottom:.25rem!important}.mb-lg-2{margin-bottom:.5rem!important}.mb-lg-3{margin-bottom:1rem!important}.mb-lg-4{margin-bottom:1.5rem!important}.mb-lg-5{margin-bottom:3rem!important}.mb-lg-auto{margin-bottom:auto!important}.ms-lg-0{margin-left:0!important}.ms-lg-1{margin-left:.25rem!important}.ms-lg-2{margin-left:.5rem!important}.ms-lg-3{margin-left:1rem!important}.ms-lg-4{margin-left:1.5rem!important}.ms-lg-5{margin-left:3rem!important}.ms-lg-auto{margin-left:auto!important}.p-lg-0{padding:0!important}.p-lg-1{padding:.25rem!important}.p-lg-2{padding:.5rem!important}.p-lg-3{padding:1rem!important}.p-lg-4{padding:1.5rem!important}.p-lg-5{padding:3rem!important}.px-lg-0{padding-right:0!important;padding-left:0!important}.px-lg-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-lg-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-lg-3{padding-right:1rem!important;padding-left:1rem!important}.px-lg-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-lg-5{padding-right:3rem!important;padding-left:3rem!important}.py-lg-0{padding-top:0!important;padding-bottom:0!important}.py-lg-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-lg-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-lg-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-lg-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-lg-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-lg-0{padding-top:0!important}.pt-lg-1{padding-top:.25rem!important}.pt-lg-2{padding-top:.5rem!important}.pt-lg-3{padding-top:1rem!important}.pt-lg-4{padding-top:1.5rem!important}.pt-lg-5{padding-top:3rem!important}.pe-lg-0{padding-right:0!important}.pe-lg-1{padding-right:.25rem!important}.pe-lg-2{padding-right:.5rem!important}.pe-lg-3{padding-right:1rem!important}.pe-lg-4{padding-right:1.5rem!important}.pe-lg-5{padding-right:3rem!important}.pb-lg-0{padding-bottom:0!important}.pb-lg-1{padding-bottom:.25rem!important}.pb-lg-2{padding-bottom:.5rem!important}.pb-lg-3{padding-bottom:1rem!important}.pb-lg-4{padding-bottom:1.5rem!important}.pb-lg-5{padding-bottom:3rem!important}.ps-lg-0{padding-left:0!important}.ps-lg-1{padding-left:.25rem!important}.ps-lg-2{padding-left:.5rem!important}.ps-lg-3{padding-left:1rem!important}.ps-lg-4{padding-left:1.5rem!important}.ps-lg-5{padding-left:3rem!important}.gap-lg-0{gap:0!important}.gap-lg-1{gap:.25rem!important}.gap-lg-2{gap:.5rem!important}.gap-lg-3{gap:1rem!important}.gap-lg-4{gap:1.5rem!important}.gap-lg-5{gap:3rem!important}.text-lg-start{text-align:left!important}.text-lg-end{text-align:right!important}.text-lg-center{text-align:center!important}}@media (min-width:1200px){.float-xl-start{float:left!important}.float-xl-end{float:right!important}.float-xl-none{float:none!important}.d-xl-inline{display:inline!important}.d-xl-inline-block{display:inline-block!important}.d-xl-block{display:block!important}.d-xl-grid{display:grid!important}.d-xl-table{display:table!important}.d-xl-table-row{display:table-row!important}.d-xl-table-cell{display:table-cell!important}.d-xl-flex{display:flex!important}.d-xl-inline-flex{display:inline-flex!important}.d-xl-none{display:none!important}.flex-xl-fill{flex:1 1 auto!important}.flex-xl-row{flex-direction:row!important}.flex-xl-column{flex-direction:column!important}.flex-xl-row-reverse{flex-direction:row-reverse!important}.flex-xl-column-reverse{flex-direction:column-reverse!important}.flex-xl-grow-0{flex-grow:0!important}.flex-xl-grow-1{flex-grow:1!important}.flex-xl-shrink-0{flex-shrink:0!important}.flex-xl-shrink-1{flex-shrink:1!important}.flex-xl-wrap{flex-wrap:wrap!important}.flex-xl-nowrap{flex-wrap:nowrap!important}.flex-xl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xl-start{justify-content:flex-start!important}.justify-content-xl-end{justify-content:flex-end!important}.justify-content-xl-center{justify-content:center!important}.justify-content-xl-between{justify-content:space-between!important}.justify-content-xl-around{justify-content:space-around!important}.justify-content-xl-evenly{justify-content:space-evenly!important}.align-items-xl-start{align-items:flex-start!important}.align-items-xl-end{align-items:flex-end!important}.align-items-xl-center{align-items:center!important}.align-items-xl-baseline{align-items:baseline!important}.align-items-xl-stretch{align-items:stretch!important}.align-content-xl-start{align-content:flex-start!important}.align-content-xl-end{align-content:flex-end!important}.align-content-xl-center{align-content:center!important}.align-content-xl-between{align-content:space-between!important}.align-content-xl-around{align-content:space-around!important}.align-content-xl-stretch{align-content:stretch!important}.align-self-xl-auto{align-self:auto!important}.align-self-xl-start{align-self:flex-start!important}.align-self-xl-end{align-self:flex-end!important}.align-self-xl-center{align-self:center!important}.align-self-xl-baseline{align-self:baseline!important}.align-self-xl-stretch{align-self:stretch!important}.order-xl-first{order:-1!important}.order-xl-0{order:0!important}.order-xl-1{order:1!important}.order-xl-2{order:2!important}.order-xl-3{order:3!important}.order-xl-4{order:4!important}.order-xl-5{order:5!important}.order-xl-last{order:6!important}.m-xl-0{margin:0!important}.m-xl-1{margin:.25rem!important}.m-xl-2{margin:.5rem!important}.m-xl-3{margin:1rem!important}.m-xl-4{margin:1.5rem!important}.m-xl-5{margin:3rem!important}.m-xl-auto{margin:auto!important}.mx-xl-0{margin-right:0!important;margin-left:0!important}.mx-xl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xl-auto{margin-right:auto!important;margin-left:auto!important}.my-xl-0{margin-top:0!important;margin-bottom:0!important}.my-xl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xl-0{margin-top:0!important}.mt-xl-1{margin-top:.25rem!important}.mt-xl-2{margin-top:.5rem!important}.mt-xl-3{margin-top:1rem!important}.mt-xl-4{margin-top:1.5rem!important}.mt-xl-5{margin-top:3rem!important}.mt-xl-auto{margin-top:auto!important}.me-xl-0{margin-right:0!important}.me-xl-1{margin-right:.25rem!important}.me-xl-2{margin-right:.5rem!important}.me-xl-3{margin-right:1rem!important}.me-xl-4{margin-right:1.5rem!important}.me-xl-5{margin-right:3rem!important}.me-xl-auto{margin-right:auto!important}.mb-xl-0{margin-bottom:0!important}.mb-xl-1{margin-bottom:.25rem!important}.mb-xl-2{margin-bottom:.5rem!important}.mb-xl-3{margin-bottom:1rem!important}.mb-xl-4{margin-bottom:1.5rem!important}.mb-xl-5{margin-bottom:3rem!important}.mb-xl-auto{margin-bottom:auto!important}.ms-xl-0{margin-left:0!important}.ms-xl-1{margin-left:.25rem!important}.ms-xl-2{margin-left:.5rem!important}.ms-xl-3{margin-left:1rem!important}.ms-xl-4{margin-left:1.5rem!important}.ms-xl-5{margin-left:3rem!important}.ms-xl-auto{margin-left:auto!important}.p-xl-0{padding:0!important}.p-xl-1{padding:.25rem!important}.p-xl-2{padding:.5rem!important}.p-xl-3{padding:1rem!important}.p-xl-4{padding:1.5rem!important}.p-xl-5{padding:3rem!important}.px-xl-0{padding-right:0!important;padding-left:0!important}.px-xl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xl-0{padding-top:0!important;padding-bottom:0!important}.py-xl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xl-0{padding-top:0!important}.pt-xl-1{padding-top:.25rem!important}.pt-xl-2{padding-top:.5rem!important}.pt-xl-3{padding-top:1rem!important}.pt-xl-4{padding-top:1.5rem!important}.pt-xl-5{padding-top:3rem!important}.pe-xl-0{padding-right:0!important}.pe-xl-1{padding-right:.25rem!important}.pe-xl-2{padding-right:.5rem!important}.pe-xl-3{padding-right:1rem!important}.pe-xl-4{padding-right:1.5rem!important}.pe-xl-5{padding-right:3rem!important}.pb-xl-0{padding-bottom:0!important}.pb-xl-1{padding-bottom:.25rem!important}.pb-xl-2{padding-bottom:.5rem!important}.pb-xl-3{padding-bottom:1rem!important}.pb-xl-4{padding-bottom:1.5rem!important}.pb-xl-5{padding-bottom:3rem!important}.ps-xl-0{padding-left:0!important}.ps-xl-1{padding-left:.25rem!important}.ps-xl-2{padding-left:.5rem!important}.ps-xl-3{padding-left:1rem!important}.ps-xl-4{padding-left:1.5rem!important}.ps-xl-5{padding-left:3rem!important}.gap-xl-0{gap:0!important}.gap-xl-1{gap:.25rem!important}.gap-xl-2{gap:.5rem!important}.gap-xl-3{gap:1rem!important}.gap-xl-4{gap:1.5rem!important}.gap-xl-5{gap:3rem!important}.text-xl-start{text-align:left!important}.text-xl-end{text-align:right!important}.text-xl-center{text-align:center!important}}@media (min-width:1400px){.float-xxl-start{float:left!important}.float-xxl-end{float:right!important}.float-xxl-none{float:none!important}.d-xxl-inline{display:inline!important}.d-xxl-inline-block{display:inline-block!important}.d-xxl-block{display:block!important}.d-xxl-grid{display:grid!important}.d-xxl-table{display:table!important}.d-xxl-table-row{display:table-row!important}.d-xxl-table-cell{display:table-cell!important}.d-xxl-flex{display:flex!important}.d-xxl-inline-flex{display:inline-flex!important}.d-xxl-none{display:none!important}.flex-xxl-fill{flex:1 1 auto!important}.flex-xxl-row{flex-direction:row!important}.flex-xxl-column{flex-direction:column!important}.flex-xxl-row-reverse{flex-direction:row-reverse!important}.flex-xxl-column-reverse{flex-direction:column-reverse!important}.flex-xxl-grow-0{flex-grow:0!important}.flex-xxl-grow-1{flex-grow:1!important}.flex-xxl-shrink-0{flex-shrink:0!important}.flex-xxl-shrink-1{flex-shrink:1!important}.flex-xxl-wrap{flex-wrap:wrap!important}.flex-xxl-nowrap{flex-wrap:nowrap!important}.flex-xxl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xxl-start{justify-content:flex-start!important}.justify-content-xxl-end{justify-content:flex-end!important}.justify-content-xxl-center{justify-content:center!important}.justify-content-xxl-between{justify-content:space-between!important}.justify-content-xxl-around{justify-content:space-around!important}.justify-content-xxl-evenly{justify-content:space-evenly!important}.align-items-xxl-start{align-items:flex-start!important}.align-items-xxl-end{align-items:flex-end!important}.align-items-xxl-center{align-items:center!important}.align-items-xxl-baseline{align-items:baseline!important}.align-items-xxl-stretch{align-items:stretch!important}.align-content-xxl-start{align-content:flex-start!important}.align-content-xxl-end{align-content:flex-end!important}.align-content-xxl-center{align-content:center!important}.align-content-xxl-between{align-content:space-between!important}.align-content-xxl-around{align-content:space-around!important}.align-content-xxl-stretch{align-content:stretch!important}.align-self-xxl-auto{align-self:auto!important}.align-self-xxl-start{align-self:flex-start!important}.align-self-xxl-end{align-self:flex-end!important}.align-self-xxl-center{align-self:center!important}.align-self-xxl-baseline{align-self:baseline!important}.align-self-xxl-stretch{align-self:stretch!important}.order-xxl-first{order:-1!important}.order-xxl-0{order:0!important}.order-xxl-1{order:1!important}.order-xxl-2{order:2!important}.order-xxl-3{order:3!important}.order-xxl-4{order:4!important}.order-xxl-5{order:5!important}.order-xxl-last{order:6!important}.m-xxl-0{margin:0!important}.m-xxl-1{margin:.25rem!important}.m-xxl-2{margin:.5rem!important}.m-xxl-3{margin:1rem!important}.m-xxl-4{margin:1.5rem!important}.m-xxl-5{margin:3rem!important}.m-xxl-auto{margin:auto!important}.mx-xxl-0{margin-right:0!important;margin-left:0!important}.mx-xxl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xxl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xxl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xxl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xxl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xxl-auto{margin-right:auto!important;margin-left:auto!important}.my-xxl-0{margin-top:0!important;margin-bottom:0!important}.my-xxl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xxl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xxl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xxl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xxl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xxl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xxl-0{margin-top:0!important}.mt-xxl-1{margin-top:.25rem!important}.mt-xxl-2{margin-top:.5rem!important}.mt-xxl-3{margin-top:1rem!important}.mt-xxl-4{margin-top:1.5rem!important}.mt-xxl-5{margin-top:3rem!important}.mt-xxl-auto{margin-top:auto!important}.me-xxl-0{margin-right:0!important}.me-xxl-1{margin-right:.25rem!important}.me-xxl-2{margin-right:.5rem!important}.me-xxl-3{margin-right:1rem!important}.me-xxl-4{margin-right:1.5rem!important}.me-xxl-5{margin-right:3rem!important}.me-xxl-auto{margin-right:auto!important}.mb-xxl-0{margin-bottom:0!important}.mb-xxl-1{margin-bottom:.25rem!important}.mb-xxl-2{margin-bottom:.5rem!important}.mb-xxl-3{margin-bottom:1rem!important}.mb-xxl-4{margin-bottom:1.5rem!important}.mb-xxl-5{margin-bottom:3rem!important}.mb-xxl-auto{margin-bottom:auto!important}.ms-xxl-0{margin-left:0!important}.ms-xxl-1{margin-left:.25rem!important}.ms-xxl-2{margin-left:.5rem!important}.ms-xxl-3{margin-left:1rem!important}.ms-xxl-4{margin-left:1.5rem!important}.ms-xxl-5{margin-left:3rem!important}.ms-xxl-auto{margin-left:auto!important}.p-xxl-0{padding:0!important}.p-xxl-1{padding:.25rem!important}.p-xxl-2{padding:.5rem!important}.p-xxl-3{padding:1rem!important}.p-xxl-4{padding:1.5rem!important}.p-xxl-5{padding:3rem!important}.px-xxl-0{padding-right:0!important;padding-left:0!important}.px-xxl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xxl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xxl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xxl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xxl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xxl-0{padding-top:0!important;padding-bottom:0!important}.py-xxl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xxl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xxl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xxl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xxl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xxl-0{padding-top:0!important}.pt-xxl-1{padding-top:.25rem!important}.pt-xxl-2{padding-top:.5rem!important}.pt-xxl-3{padding-top:1rem!important}.pt-xxl-4{padding-top:1.5rem!important}.pt-xxl-5{padding-top:3rem!important}.pe-xxl-0{padding-right:0!important}.pe-xxl-1{padding-right:.25rem!important}.pe-xxl-2{padding-right:.5rem!important}.pe-xxl-3{padding-right:1rem!important}.pe-xxl-4{padding-right:1.5rem!important}.pe-xxl-5{padding-right:3rem!important}.pb-xxl-0{padding-bottom:0!important}.pb-xxl-1{padding-bottom:.25rem!important}.pb-xxl-2{padding-bottom:.5rem!important}.pb-xxl-3{padding-bottom:1rem!important}.pb-xxl-4{padding-bottom:1.5rem!important}.pb-xxl-5{padding-bottom:3rem!important}.ps-xxl-0{padding-left:0!important}.ps-xxl-1{padding-left:.25rem!important}.ps-xxl-2{padding-left:.5rem!important}.ps-xxl-3{padding-left:1rem!important}.ps-xxl-4{padding-left:1.5rem!important}.ps-xxl-5{padding-left:3rem!important}.gap-xxl-0{gap:0!important}.gap-xxl-1{gap:.25rem!important}.gap-xxl-2{gap:.5rem!important}.gap-xxl-3{gap:1rem!important}.gap-xxl-4{gap:1.5rem!important}.gap-xxl-5{gap:3rem!important}.text-xxl-start{text-align:left!important}.text-xxl-end{text-align:right!important}.text-xxl-center{text-align:center!important}}@media (min-width:1200px){.fs-1{font-size:2.5rem!important}.fs-2{font-size:2rem!important}.fs-3{font-size:1.75rem!important}.fs-4{font-size:1.5rem!important}}@media print{.d-print-inline{display:inline!important}.d-print-inline-block{display:inline-block!important}.d-print-block{display:block!important}.d-print-grid{display:grid!important}.d-print-table{display:table!important}.d-print-table-row{display:table-row!important}.d-print-table-cell{display:table-cell!important}.d-print-flex{display:flex!important}.d-print-inline-flex{display:inline-flex!important}.d-print-none{display:none!important}} | |
21 /*# sourceMappingURL=bootstrap.min.css.map */</style> | |
22 <body | |
23 class="bg-secondary bg-gradient" | |
24 style="--bs-bg-opacity: .1; padding-top: 80px;" | |
25 > | |
26 <nav | |
27 class="navbar justify-content-center navbar-dark navbar-expand" | |
28 id="history_metadata_extractor_masthead" | |
29 style=" | |
30 background-color: #2c3143; | |
31 top:0px; | |
32 position:fixed; | |
33 width: 100%; | |
34 z-index: 999 ; | |
35 " | |
36 > | |
37 <a class="navbar-brand"> | |
38 <span class="navbar-brand-title"> <h1>Galaxy - 22.01</h1></span> | |
39 </a> | |
40 | |
41 <button id="history_metadata_extractor_top" class="btn btn-outline-light d-block m-2"> | |
42 Top | |
43 </button> | |
44 <button id="history_metadata_extractor_folder" class="btn btn-outline-light d-block m-2"> | |
45 Fold/Unfold tables | |
46 </button> | |
47 <button id="history_metadata_extractor_toggle_deleted" class="btn btn-outline-light d-block m-2"> | |
48 Show/Hide deleted | |
49 </button> | |
50 <button id="history_metadata_extractor_bottom" class="btn btn-outline-light d-block m-2"> | |
51 Bottom | |
52 </button> | |
53 </nav> | |
54 <div | |
55 id="history_metadata_extractor_content" | |
56 class="container pt-2 bg-white" | |
57 style="overflow-y: auto ; height: 100%" | |
58 > | |
59 | |
60 <div class="alert alert-success"> | |
61 <h2 | |
62 class="history_metadata_extractor_h2" | |
63 style="cursor: pointer" | |
64 title="click to fold/unfold the table" | |
65 > | |
66 [1] - __DATA_FETCH__ - 0.1.0 | |
67 </h2> | |
68 <p class="history_metadata_extractor_status"> | |
69 Status: Ok (0) | |
70 </p> | |
71 <p class="history_metadata_extractor_glitter"></p> | |
72 <table class=" | |
73 table | |
74 table-bordered | |
75 table-dark | |
76 table-striped | |
77 table-hover | |
78 d-block | |
79 overflow-auto | |
80 history_metadata_extractor_table | |
81 "> | |
82 <thead> | |
83 <tr> | |
84 <th scope="col"></th> | |
85 <th scope="col">value</th> | |
86 <th scope="col">name</th> | |
87 <th scope="col">extension</th> | |
88 <th scope="col">hid</th> | |
89 </tr> | |
90 </thead> | |
91 <tr class=""> | |
92 <th scope="row">file_count</th> | |
93 <td>1</td> | |
94 <td></td> | |
95 <td></td> | |
96 <td></td> | |
97 </tr><tr class=""> | |
98 <th scope="row">files</th> | |
99 <td>file_data: /galaxy/data/tmp/c400d309afc6474c8b5d1900ad47051a</td> | |
100 <td>test.rdata</td> | |
101 <td>auto</td> | |
102 <td>232343</td> | |
103 </tr><tr class=""> | |
104 <th scope="row">paramfile</th> | |
105 <td>None</td> | |
106 <td></td> | |
107 <td></td> | |
108 <td></td> | |
109 </tr><tr class=""> | |
110 <th scope="row">request_version</th> | |
111 <td>1</td> | |
112 <td></td> | |
113 <td></td> | |
114 <td></td> | |
115 </tr><tr class=""> | |
116 <th scope="row">auto_decompress</th> | |
117 <td>True</td> | |
118 <td></td> | |
119 <td></td> | |
120 <td></td> | |
121 </tr><tr class=""> | |
122 <th scope="row">check_content</th> | |
123 <td>True</td> | |
124 <td></td> | |
125 <td></td> | |
126 <td></td> | |
127 </tr> | |
128 </table> | |
129 </div> | |
130 | |
131 | |
132 <div class="alert alert-success"> | |
133 <h2 | |
134 class="history_metadata_extractor_h2" | |
135 style="cursor: pointer" | |
136 title="click to fold/unfold the table" | |
137 > | |
138 [42] - __DATA_FETCH__ - 0.1.0 | |
139 </h2> | |
140 <p class="history_metadata_extractor_status"> | |
141 Status: Ok (0) | |
142 </p> | |
143 <p class="history_metadata_extractor_glitter"></p> | |
144 <table class=" | |
145 table | |
146 table-bordered | |
147 table-dark | |
148 table-striped | |
149 table-hover | |
150 d-block | |
151 overflow-auto | |
152 history_metadata_extractor_table | |
153 "> | |
154 <thead> | |
155 <tr> | |
156 <th scope="col"></th> | |
157 <th scope="col">value</th> | |
158 <th scope="col">name</th> | |
159 <th scope="col">extension</th> | |
160 <th scope="col">hid</th> | |
161 </tr> | |
162 </thead> | |
163 <tr class=""> | |
164 <th scope="row">file_count</th> | |
165 <td>1</td> | |
166 <td></td> | |
167 <td></td> | |
168 <td></td> | |
169 </tr><tr class=""> | |
170 <th scope="row">files</th> | |
171 <td>file_data: /galaxy/data/tmp/e44f6de2f1fd410ab5ab76d3589ed689</td> | |
172 <td>peaklist_fragments.tsv</td> | |
173 <td>auto</td> | |
174 <td>232384</td> | |
175 </tr><tr class=""> | |
176 <th scope="row">paramfile</th> | |
177 <td>None</td> | |
178 <td></td> | |
179 <td></td> | |
180 <td></td> | |
181 </tr><tr class=""> | |
182 <th scope="row">request_version</th> | |
183 <td>1</td> | |
184 <td></td> | |
185 <td></td> | |
186 <td></td> | |
187 </tr><tr class=""> | |
188 <th scope="row">auto_decompress</th> | |
189 <td>True</td> | |
190 <td></td> | |
191 <td></td> | |
192 <td></td> | |
193 </tr><tr class=""> | |
194 <th scope="row">check_content</th> | |
195 <td>True</td> | |
196 <td></td> | |
197 <td></td> | |
198 <td></td> | |
199 </tr> | |
200 </table> | |
201 </div> | |
202 | |
203 | |
204 <div class="alert alert-success history_metadata_extractor_deleted"> | |
205 <h2 | |
206 class="history_metadata_extractor_h2" | |
207 style="cursor: pointer" | |
208 title="click to fold/unfold the table" | |
209 > | |
210 [DELETED] - csv_to_tabular - 1.0.0 | |
211 </h2> | |
212 <p class="history_metadata_extractor_status"> | |
213 Status: Ok (0) | |
214 </p> | |
215 <p class="history_metadata_extractor_glitter"></p> | |
216 <table class=" | |
217 table | |
218 table-bordered | |
219 table-dark | |
220 table-striped | |
221 table-hover | |
222 d-block | |
223 overflow-auto | |
224 history_metadata_extractor_table | |
225 "> | |
226 <thead> | |
227 <tr> | |
228 <th scope="col"></th> | |
229 <th scope="col">value</th> | |
230 <th scope="col">name</th> | |
231 <th scope="col">extension</th> | |
232 <th scope="col">hid</th> | |
233 </tr> | |
234 </thead> | |
235 <tr class=""> | |
236 <th scope="row">__target_datatype__</th> | |
237 <td>tabular</td> | |
238 <td></td> | |
239 <td></td> | |
240 <td></td> | |
241 </tr><tr class=""> | |
242 <th scope="row">csv</th> | |
243 <td>eee378ebc66a66f1</td> | |
244 <td>peaklist_precursors.csv</td> | |
245 <td>csv</td> | |
246 <td>43</td> | |
247 </tr> | |
248 </table> | |
249 </div> | |
250 | |
251 | |
252 <div class="alert alert-success"> | |
253 <h2 | |
254 class="history_metadata_extractor_h2" | |
255 style="cursor: pointer" | |
256 title="click to fold/unfold the table" | |
257 > | |
258 [43] - __DATA_FETCH__ - 0.1.0 | |
259 </h2> | |
260 <p class="history_metadata_extractor_status"> | |
261 Status: Ok (0) | |
262 </p> | |
263 <p class="history_metadata_extractor_glitter"></p> | |
264 <table class=" | |
265 table | |
266 table-bordered | |
267 table-dark | |
268 table-striped | |
269 table-hover | |
270 d-block | |
271 overflow-auto | |
272 history_metadata_extractor_table | |
273 "> | |
274 <thead> | |
275 <tr> | |
276 <th scope="col"></th> | |
277 <th scope="col">value</th> | |
278 <th scope="col">name</th> | |
279 <th scope="col">extension</th> | |
280 <th scope="col">hid</th> | |
281 </tr> | |
282 </thead> | |
283 <tr class=""> | |
284 <th scope="row">file_count</th> | |
285 <td>1</td> | |
286 <td></td> | |
287 <td></td> | |
288 <td></td> | |
289 </tr><tr class=""> | |
290 <th scope="row">files</th> | |
291 <td>file_data: /galaxy/data/tmp/7964e374d9fa423cb3438b054c7f91f0</td> | |
292 <td>peaklist_precursors.csv</td> | |
293 <td>auto</td> | |
294 <td>232385</td> | |
295 </tr><tr class=""> | |
296 <th scope="row">paramfile</th> | |
297 <td>None</td> | |
298 <td></td> | |
299 <td></td> | |
300 <td></td> | |
301 </tr><tr class=""> | |
302 <th scope="row">request_version</th> | |
303 <td>1</td> | |
304 <td></td> | |
305 <td></td> | |
306 <td></td> | |
307 </tr><tr class=""> | |
308 <th scope="row">auto_decompress</th> | |
309 <td>True</td> | |
310 <td></td> | |
311 <td></td> | |
312 <td></td> | |
313 </tr><tr class=""> | |
314 <th scope="row">check_content</th> | |
315 <td>True</td> | |
316 <td></td> | |
317 <td></td> | |
318 <td></td> | |
319 </tr> | |
320 </table> | |
321 </div> | |
322 | |
323 | |
324 <div class="alert alert-success"> | |
325 <h2 | |
326 class="history_metadata_extractor_h2" | |
327 style="cursor: pointer" | |
328 title="click to fold/unfold the table" | |
329 > | |
330 [44] - __DATA_FETCH__ - 0.1.0 | |
331 </h2> | |
332 <p class="history_metadata_extractor_status"> | |
333 Status: Ok (0) | |
334 </p> | |
335 <p class="history_metadata_extractor_glitter"></p> | |
336 <table class=" | |
337 table | |
338 table-bordered | |
339 table-dark | |
340 table-striped | |
341 table-hover | |
342 d-block | |
343 overflow-auto | |
344 history_metadata_extractor_table | |
345 "> | |
346 <thead> | |
347 <tr> | |
348 <th scope="col"></th> | |
349 <th scope="col">value</th> | |
350 <th scope="col">name</th> | |
351 <th scope="col">extension</th> | |
352 <th scope="col">hid</th> | |
353 </tr> | |
354 </thead> | |
355 <tr class=""> | |
356 <th scope="row">file_count</th> | |
357 <td>1</td> | |
358 <td></td> | |
359 <td></td> | |
360 <td></td> | |
361 </tr><tr class=""> | |
362 <th scope="row">files</th> | |
363 <td>file_data: /galaxy/data/tmp/2e503324d9d54059953fac2d6151c762</td> | |
364 <td>compounds_pos.txt</td> | |
365 <td>auto</td> | |
366 <td>232386</td> | |
367 </tr><tr class=""> | |
368 <th scope="row">paramfile</th> | |
369 <td>None</td> | |
370 <td></td> | |
371 <td></td> | |
372 <td></td> | |
373 </tr><tr class=""> | |
374 <th scope="row">request_version</th> | |
375 <td>1</td> | |
376 <td></td> | |
377 <td></td> | |
378 <td></td> | |
379 </tr><tr class=""> | |
380 <th scope="row">auto_decompress</th> | |
381 <td>True</td> | |
382 <td></td> | |
383 <td></td> | |
384 <td></td> | |
385 </tr><tr class=""> | |
386 <th scope="row">check_content</th> | |
387 <td>True</td> | |
388 <td></td> | |
389 <td></td> | |
390 <td></td> | |
391 </tr> | |
392 </table> | |
393 </div> | |
394 | |
395 | |
396 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
397 <h2 | |
398 class="history_metadata_extractor_h2" | |
399 style="cursor: pointer" | |
400 title="click to fold/unfold the table" | |
401 > | |
402 [DELETED] - Batch_correction - 3.0.0 | |
403 </h2> | |
404 <p class="history_metadata_extractor_status"> | |
405 Status: Failed (1) | |
406 </p> | |
407 <p class="history_metadata_extractor_glitter"></p> | |
408 <table class=" | |
409 table | |
410 table-bordered | |
411 table-dark | |
412 table-striped | |
413 table-hover | |
414 d-block | |
415 overflow-auto | |
416 history_metadata_extractor_table | |
417 "> | |
418 <thead> | |
419 <tr> | |
420 <th scope="col"></th> | |
421 <th scope="col">value</th> | |
422 <th scope="col">name</th> | |
423 <th scope="col">extension</th> | |
424 <th scope="col">hid</th> | |
425 </tr> | |
426 </thead> | |
427 <tr class=""> | |
428 <th scope="row">dataMatrix</th> | |
429 <td>9a0ce47bd1734ae7</td> | |
430 <td>peaklist_fragments.tsv</td> | |
431 <td>tabular</td> | |
432 <td>42</td> | |
433 </tr><tr class=""> | |
434 <th scope="row">sampleMetadata</th> | |
435 <td></td> | |
436 <td></td> | |
437 <td></td> | |
438 <td></td> | |
439 </tr><tr class=""> | |
440 <th scope="row">batch_col_name</th> | |
441 <td>batch</td> | |
442 <td></td> | |
443 <td></td> | |
444 <td></td> | |
445 </tr><tr class=""> | |
446 <th scope="row">injection_order_col_name</th> | |
447 <td>injectionOrder</td> | |
448 <td></td> | |
449 <td></td> | |
450 <td></td> | |
451 </tr><tr class=""> | |
452 <th scope="row">sampleTypeTagBlank</th> | |
453 <td>blank</td> | |
454 <td></td> | |
455 <td></td> | |
456 <td></td> | |
457 </tr><tr class=""> | |
458 <th scope="row">sampleTypeTagPool</th> | |
459 <td>pool</td> | |
460 <td></td> | |
461 <td></td> | |
462 <td></td> | |
463 </tr><tr class=""> | |
464 <th scope="row">sampleTypeTagSample</th> | |
465 <td>sample</td> | |
466 <td></td> | |
467 <td></td> | |
468 <td></td> | |
469 </tr><tr class=""> | |
470 <th scope="row">sample_type_col_name</th> | |
471 <td>sampleType</td> | |
472 <td></td> | |
473 <td></td> | |
474 <td></td> | |
475 </tr><tr class=""> | |
476 <th scope="row">detail</th> | |
477 <td>no</td> | |
478 <td></td> | |
479 <td></td> | |
480 <td></td> | |
481 </tr><tr class=""> | |
482 <th scope="row">method</th> | |
483 <td>linear</td> | |
484 <td></td> | |
485 <td></td> | |
486 <td></td> | |
487 </tr><tr class=""> | |
488 <th scope="row">ref_factor</th> | |
489 <td>batch</td> | |
490 <td></td> | |
491 <td></td> | |
492 <td></td> | |
493 </tr><tr class=""> | |
494 <th scope="row">valnull</th> | |
495 <td>none</td> | |
496 <td></td> | |
497 <td></td> | |
498 <td></td> | |
499 </tr><tr class=""> | |
500 <th scope="row">variableMetadata</th> | |
501 <td>9a0ce47bd1734ae7</td> | |
502 <td>peaklist_fragments.tsv</td> | |
503 <td>tabular</td> | |
504 <td>42</td> | |
505 </tr> | |
506 </table> | |
507 </div> | |
508 | |
509 | |
510 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
511 <h2 | |
512 class="history_metadata_extractor_h2" | |
513 style="cursor: pointer" | |
514 title="click to fold/unfold the table" | |
515 > | |
516 [DELETED] - Batch_correction - 3.0.0 | |
517 </h2> | |
518 <p class="history_metadata_extractor_status"> | |
519 Status: Failed (1) | |
520 </p> | |
521 <p class="history_metadata_extractor_glitter"></p> | |
522 <table class=" | |
523 table | |
524 table-bordered | |
525 table-dark | |
526 table-striped | |
527 table-hover | |
528 d-block | |
529 overflow-auto | |
530 history_metadata_extractor_table | |
531 "> | |
532 <thead> | |
533 <tr> | |
534 <th scope="col"></th> | |
535 <th scope="col">value</th> | |
536 <th scope="col">name</th> | |
537 <th scope="col">extension</th> | |
538 <th scope="col">hid</th> | |
539 </tr> | |
540 </thead> | |
541 <tr class=""> | |
542 <th scope="row">dataMatrix</th> | |
543 <td>9a0ce47bd1734ae7</td> | |
544 <td>peaklist_fragments.tsv</td> | |
545 <td>tabular</td> | |
546 <td>42</td> | |
547 </tr><tr class=""> | |
548 <th scope="row">sampleMetadata</th> | |
549 <td></td> | |
550 <td></td> | |
551 <td></td> | |
552 <td></td> | |
553 </tr><tr class=""> | |
554 <th scope="row">batch_col_name</th> | |
555 <td>batch</td> | |
556 <td></td> | |
557 <td></td> | |
558 <td></td> | |
559 </tr><tr class=""> | |
560 <th scope="row">injection_order_col_name</th> | |
561 <td>injectionOrder</td> | |
562 <td></td> | |
563 <td></td> | |
564 <td></td> | |
565 </tr><tr class=""> | |
566 <th scope="row">sampleTypeTagBlank</th> | |
567 <td>blank</td> | |
568 <td></td> | |
569 <td></td> | |
570 <td></td> | |
571 </tr><tr class=""> | |
572 <th scope="row">sampleTypeTagPool</th> | |
573 <td>pool</td> | |
574 <td></td> | |
575 <td></td> | |
576 <td></td> | |
577 </tr><tr class=""> | |
578 <th scope="row">sampleTypeTagSample</th> | |
579 <td>sample</td> | |
580 <td></td> | |
581 <td></td> | |
582 <td></td> | |
583 </tr><tr class=""> | |
584 <th scope="row">sample_type_col_name</th> | |
585 <td>sampleType</td> | |
586 <td></td> | |
587 <td></td> | |
588 <td></td> | |
589 </tr><tr class=""> | |
590 <th scope="row">detail</th> | |
591 <td>no</td> | |
592 <td></td> | |
593 <td></td> | |
594 <td></td> | |
595 </tr><tr class=""> | |
596 <th scope="row">method</th> | |
597 <td>linear</td> | |
598 <td></td> | |
599 <td></td> | |
600 <td></td> | |
601 </tr><tr class=""> | |
602 <th scope="row">ref_factor</th> | |
603 <td>batch</td> | |
604 <td></td> | |
605 <td></td> | |
606 <td></td> | |
607 </tr><tr class=""> | |
608 <th scope="row">valnull</th> | |
609 <td>none</td> | |
610 <td></td> | |
611 <td></td> | |
612 <td></td> | |
613 </tr><tr class=""> | |
614 <th scope="row">variableMetadata</th> | |
615 <td>9a0ce47bd1734ae7</td> | |
616 <td>peaklist_fragments.tsv</td> | |
617 <td>tabular</td> | |
618 <td>42</td> | |
619 </tr> | |
620 </table> | |
621 </div> | |
622 | |
623 | |
624 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
625 <h2 | |
626 class="history_metadata_extractor_h2" | |
627 style="cursor: pointer" | |
628 title="click to fold/unfold the table" | |
629 > | |
630 [DELETED] - Batch_correction - 3.0.0 | |
631 </h2> | |
632 <p class="history_metadata_extractor_status"> | |
633 Status: Failed (1) | |
634 </p> | |
635 <p class="history_metadata_extractor_glitter"></p> | |
636 <table class=" | |
637 table | |
638 table-bordered | |
639 table-dark | |
640 table-striped | |
641 table-hover | |
642 d-block | |
643 overflow-auto | |
644 history_metadata_extractor_table | |
645 "> | |
646 <thead> | |
647 <tr> | |
648 <th scope="col"></th> | |
649 <th scope="col">value</th> | |
650 <th scope="col">name</th> | |
651 <th scope="col">extension</th> | |
652 <th scope="col">hid</th> | |
653 </tr> | |
654 </thead> | |
655 <tr class=""> | |
656 <th scope="row">dataMatrix</th> | |
657 <td>9a0ce47bd1734ae7</td> | |
658 <td>peaklist_fragments.tsv</td> | |
659 <td>tabular</td> | |
660 <td>42</td> | |
661 </tr><tr class=""> | |
662 <th scope="row">sampleMetadata</th> | |
663 <td></td> | |
664 <td></td> | |
665 <td></td> | |
666 <td></td> | |
667 </tr><tr class=""> | |
668 <th scope="row">batch_col_name</th> | |
669 <td>batch</td> | |
670 <td></td> | |
671 <td></td> | |
672 <td></td> | |
673 </tr><tr class=""> | |
674 <th scope="row">injection_order_col_name</th> | |
675 <td>injectionOrder</td> | |
676 <td></td> | |
677 <td></td> | |
678 <td></td> | |
679 </tr><tr class=""> | |
680 <th scope="row">sampleTypeTagBlank</th> | |
681 <td>blank</td> | |
682 <td></td> | |
683 <td></td> | |
684 <td></td> | |
685 </tr><tr class=""> | |
686 <th scope="row">sampleTypeTagPool</th> | |
687 <td>pool</td> | |
688 <td></td> | |
689 <td></td> | |
690 <td></td> | |
691 </tr><tr class=""> | |
692 <th scope="row">sampleTypeTagSample</th> | |
693 <td>sample</td> | |
694 <td></td> | |
695 <td></td> | |
696 <td></td> | |
697 </tr><tr class=""> | |
698 <th scope="row">sample_type_col_name</th> | |
699 <td>sampleType</td> | |
700 <td></td> | |
701 <td></td> | |
702 <td></td> | |
703 </tr><tr class=""> | |
704 <th scope="row">detail</th> | |
705 <td>no</td> | |
706 <td></td> | |
707 <td></td> | |
708 <td></td> | |
709 </tr><tr class=""> | |
710 <th scope="row">method</th> | |
711 <td>linear</td> | |
712 <td></td> | |
713 <td></td> | |
714 <td></td> | |
715 </tr><tr class=""> | |
716 <th scope="row">ref_factor</th> | |
717 <td>batch</td> | |
718 <td></td> | |
719 <td></td> | |
720 <td></td> | |
721 </tr><tr class=""> | |
722 <th scope="row">valnull</th> | |
723 <td>none</td> | |
724 <td></td> | |
725 <td></td> | |
726 <td></td> | |
727 </tr><tr class=""> | |
728 <th scope="row">variableMetadata</th> | |
729 <td>9a0ce47bd1734ae7</td> | |
730 <td>peaklist_fragments.tsv</td> | |
731 <td>tabular</td> | |
732 <td>42</td> | |
733 </tr> | |
734 </table> | |
735 </div> | |
736 | |
737 | |
738 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
739 <h2 | |
740 class="history_metadata_extractor_h2" | |
741 style="cursor: pointer" | |
742 title="click to fold/unfold the table" | |
743 > | |
744 [DELETED] - quality_metrics - 2.2.8 | |
745 </h2> | |
746 <p class="history_metadata_extractor_status"> | |
747 Status: Failed (1) | |
748 </p> | |
749 <p class="history_metadata_extractor_glitter"></p> | |
750 <table class=" | |
751 table | |
752 table-bordered | |
753 table-dark | |
754 table-striped | |
755 table-hover | |
756 d-block | |
757 overflow-auto | |
758 history_metadata_extractor_table | |
759 "> | |
760 <thead> | |
761 <tr> | |
762 <th scope="col"></th> | |
763 <th scope="col">value</th> | |
764 <th scope="col">name</th> | |
765 <th scope="col">extension</th> | |
766 <th scope="col">hid</th> | |
767 </tr> | |
768 </thead> | |
769 <tr class=""> | |
770 <th scope="row">CV</th> | |
771 <td>FALSE</td> | |
772 <td></td> | |
773 <td></td> | |
774 <td></td> | |
775 </tr><tr class=""> | |
776 <th scope="row">Compa</th> | |
777 <td>TRUE</td> | |
778 <td></td> | |
779 <td></td> | |
780 <td></td> | |
781 </tr><tr class=""> | |
782 <th scope="row">seuil</th> | |
783 <td>1</td> | |
784 <td></td> | |
785 <td></td> | |
786 <td></td> | |
787 </tr><tr class=""> | |
788 <th scope="row">optC</th> | |
789 <td>default</td> | |
790 <td></td> | |
791 <td></td> | |
792 <td></td> | |
793 </tr><tr class=""> | |
794 <th scope="row">poolAsPool1L</th> | |
795 <td>TRUE</td> | |
796 <td></td> | |
797 <td></td> | |
798 <td></td> | |
799 </tr><tr class=""> | |
800 <th scope="row">dataMatrix_in</th> | |
801 <td>9a0ce47bd1734ae7</td> | |
802 <td>peaklist_fragments.tsv</td> | |
803 <td>tabular</td> | |
804 <td>42</td> | |
805 </tr><tr class=""> | |
806 <th scope="row">sampleMetadata_in</th> | |
807 <td>9a0ce47bd1734ae7</td> | |
808 <td>peaklist_fragments.tsv</td> | |
809 <td>tabular</td> | |
810 <td>42</td> | |
811 </tr><tr class=""> | |
812 <th scope="row">variableMetadata_in</th> | |
813 <td>9a0ce47bd1734ae7</td> | |
814 <td>peaklist_fragments.tsv</td> | |
815 <td>tabular</td> | |
816 <td>42</td> | |
817 </tr> | |
818 </table> | |
819 </div> | |
820 | |
821 | |
822 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
823 <h2 | |
824 class="history_metadata_extractor_h2" | |
825 style="cursor: pointer" | |
826 title="click to fold/unfold the table" | |
827 > | |
828 [DELETED] - quality_metrics - 2.2.8 | |
829 </h2> | |
830 <p class="history_metadata_extractor_status"> | |
831 Status: Failed (1) | |
832 </p> | |
833 <p class="history_metadata_extractor_glitter"></p> | |
834 <table class=" | |
835 table | |
836 table-bordered | |
837 table-dark | |
838 table-striped | |
839 table-hover | |
840 d-block | |
841 overflow-auto | |
842 history_metadata_extractor_table | |
843 "> | |
844 <thead> | |
845 <tr> | |
846 <th scope="col"></th> | |
847 <th scope="col">value</th> | |
848 <th scope="col">name</th> | |
849 <th scope="col">extension</th> | |
850 <th scope="col">hid</th> | |
851 </tr> | |
852 </thead> | |
853 <tr class=""> | |
854 <th scope="row">CV</th> | |
855 <td>FALSE</td> | |
856 <td></td> | |
857 <td></td> | |
858 <td></td> | |
859 </tr><tr class=""> | |
860 <th scope="row">Compa</th> | |
861 <td>TRUE</td> | |
862 <td></td> | |
863 <td></td> | |
864 <td></td> | |
865 </tr><tr class=""> | |
866 <th scope="row">seuil</th> | |
867 <td>1</td> | |
868 <td></td> | |
869 <td></td> | |
870 <td></td> | |
871 </tr><tr class=""> | |
872 <th scope="row">optC</th> | |
873 <td>default</td> | |
874 <td></td> | |
875 <td></td> | |
876 <td></td> | |
877 </tr><tr class=""> | |
878 <th scope="row">poolAsPool1L</th> | |
879 <td>TRUE</td> | |
880 <td></td> | |
881 <td></td> | |
882 <td></td> | |
883 </tr><tr class=""> | |
884 <th scope="row">dataMatrix_in</th> | |
885 <td>9a0ce47bd1734ae7</td> | |
886 <td>peaklist_fragments.tsv</td> | |
887 <td>tabular</td> | |
888 <td>42</td> | |
889 </tr><tr class=""> | |
890 <th scope="row">sampleMetadata_in</th> | |
891 <td>9a0ce47bd1734ae7</td> | |
892 <td>peaklist_fragments.tsv</td> | |
893 <td>tabular</td> | |
894 <td>42</td> | |
895 </tr><tr class=""> | |
896 <th scope="row">variableMetadata_in</th> | |
897 <td>9a0ce47bd1734ae7</td> | |
898 <td>peaklist_fragments.tsv</td> | |
899 <td>tabular</td> | |
900 <td>42</td> | |
901 </tr> | |
902 </table> | |
903 </div> | |
904 | |
905 | |
906 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
907 <h2 | |
908 class="history_metadata_extractor_h2" | |
909 style="cursor: pointer" | |
910 title="click to fold/unfold the table" | |
911 > | |
912 [DELETED] - quality_metrics - 2.2.8 | |
913 </h2> | |
914 <p class="history_metadata_extractor_status"> | |
915 Status: Failed (1) | |
916 </p> | |
917 <p class="history_metadata_extractor_glitter"></p> | |
918 <table class=" | |
919 table | |
920 table-bordered | |
921 table-dark | |
922 table-striped | |
923 table-hover | |
924 d-block | |
925 overflow-auto | |
926 history_metadata_extractor_table | |
927 "> | |
928 <thead> | |
929 <tr> | |
930 <th scope="col"></th> | |
931 <th scope="col">value</th> | |
932 <th scope="col">name</th> | |
933 <th scope="col">extension</th> | |
934 <th scope="col">hid</th> | |
935 </tr> | |
936 </thead> | |
937 <tr class=""> | |
938 <th scope="row">CV</th> | |
939 <td>FALSE</td> | |
940 <td></td> | |
941 <td></td> | |
942 <td></td> | |
943 </tr><tr class=""> | |
944 <th scope="row">Compa</th> | |
945 <td>TRUE</td> | |
946 <td></td> | |
947 <td></td> | |
948 <td></td> | |
949 </tr><tr class=""> | |
950 <th scope="row">seuil</th> | |
951 <td>1</td> | |
952 <td></td> | |
953 <td></td> | |
954 <td></td> | |
955 </tr><tr class=""> | |
956 <th scope="row">optC</th> | |
957 <td>default</td> | |
958 <td></td> | |
959 <td></td> | |
960 <td></td> | |
961 </tr><tr class=""> | |
962 <th scope="row">poolAsPool1L</th> | |
963 <td>TRUE</td> | |
964 <td></td> | |
965 <td></td> | |
966 <td></td> | |
967 </tr><tr class=""> | |
968 <th scope="row">dataMatrix_in</th> | |
969 <td>9a0ce47bd1734ae7</td> | |
970 <td>peaklist_fragments.tsv</td> | |
971 <td>tabular</td> | |
972 <td>42</td> | |
973 </tr><tr class=""> | |
974 <th scope="row">sampleMetadata_in</th> | |
975 <td>9a0ce47bd1734ae7</td> | |
976 <td>peaklist_fragments.tsv</td> | |
977 <td>tabular</td> | |
978 <td>42</td> | |
979 </tr><tr class=""> | |
980 <th scope="row">variableMetadata_in</th> | |
981 <td>9a0ce47bd1734ae7</td> | |
982 <td>peaklist_fragments.tsv</td> | |
983 <td>tabular</td> | |
984 <td>42</td> | |
985 </tr> | |
986 </table> | |
987 </div> | |
988 | |
989 | |
990 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
991 <h2 | |
992 class="history_metadata_extractor_h2" | |
993 style="cursor: pointer" | |
994 title="click to fold/unfold the table" | |
995 > | |
996 [DELETED] - quality_metrics - 2.2.8 | |
997 </h2> | |
998 <p class="history_metadata_extractor_status"> | |
999 Status: Failed (1) | |
1000 </p> | |
1001 <p class="history_metadata_extractor_glitter"></p> | |
1002 <table class=" | |
1003 table | |
1004 table-bordered | |
1005 table-dark | |
1006 table-striped | |
1007 table-hover | |
1008 d-block | |
1009 overflow-auto | |
1010 history_metadata_extractor_table | |
1011 "> | |
1012 <thead> | |
1013 <tr> | |
1014 <th scope="col"></th> | |
1015 <th scope="col">value</th> | |
1016 <th scope="col">name</th> | |
1017 <th scope="col">extension</th> | |
1018 <th scope="col">hid</th> | |
1019 </tr> | |
1020 </thead> | |
1021 <tr class=""> | |
1022 <th scope="row">CV</th> | |
1023 <td>FALSE</td> | |
1024 <td></td> | |
1025 <td></td> | |
1026 <td></td> | |
1027 </tr><tr class=""> | |
1028 <th scope="row">Compa</th> | |
1029 <td>TRUE</td> | |
1030 <td></td> | |
1031 <td></td> | |
1032 <td></td> | |
1033 </tr><tr class=""> | |
1034 <th scope="row">seuil</th> | |
1035 <td>1</td> | |
1036 <td></td> | |
1037 <td></td> | |
1038 <td></td> | |
1039 </tr><tr class=""> | |
1040 <th scope="row">optC</th> | |
1041 <td>default</td> | |
1042 <td></td> | |
1043 <td></td> | |
1044 <td></td> | |
1045 </tr><tr class=""> | |
1046 <th scope="row">poolAsPool1L</th> | |
1047 <td>TRUE</td> | |
1048 <td></td> | |
1049 <td></td> | |
1050 <td></td> | |
1051 </tr><tr class=""> | |
1052 <th scope="row">dataMatrix_in</th> | |
1053 <td>9a0ce47bd1734ae7</td> | |
1054 <td>peaklist_fragments.tsv</td> | |
1055 <td>tabular</td> | |
1056 <td>42</td> | |
1057 </tr><tr class=""> | |
1058 <th scope="row">sampleMetadata_in</th> | |
1059 <td>9a0ce47bd1734ae7</td> | |
1060 <td>peaklist_fragments.tsv</td> | |
1061 <td>tabular</td> | |
1062 <td>42</td> | |
1063 </tr><tr class=""> | |
1064 <th scope="row">variableMetadata_in</th> | |
1065 <td>9a0ce47bd1734ae7</td> | |
1066 <td>peaklist_fragments.tsv</td> | |
1067 <td>tabular</td> | |
1068 <td>42</td> | |
1069 </tr> | |
1070 </table> | |
1071 </div> | |
1072 | |
1073 | |
1074 <div class="alert alert-success history_metadata_extractor_deleted"> | |
1075 <h2 | |
1076 class="history_metadata_extractor_h2" | |
1077 style="cursor: pointer" | |
1078 title="click to fold/unfold the table" | |
1079 > | |
1080 [DELETED] - __DATA_FETCH__ - 0.1.0 | |
1081 </h2> | |
1082 <p class="history_metadata_extractor_status"> | |
1083 Status: Ok (0) | |
1084 </p> | |
1085 <p class="history_metadata_extractor_glitter"></p> | |
1086 <table class=" | |
1087 table | |
1088 table-bordered | |
1089 table-dark | |
1090 table-striped | |
1091 table-hover | |
1092 d-block | |
1093 overflow-auto | |
1094 history_metadata_extractor_table | |
1095 "> | |
1096 <thead> | |
1097 <tr> | |
1098 <th scope="col"></th> | |
1099 <th scope="col">value</th> | |
1100 <th scope="col">name</th> | |
1101 <th scope="col">extension</th> | |
1102 <th scope="col">hid</th> | |
1103 </tr> | |
1104 </thead> | |
1105 <tr class=""> | |
1106 <th scope="row">file_count</th> | |
1107 <td>1</td> | |
1108 <td></td> | |
1109 <td></td> | |
1110 <td></td> | |
1111 </tr><tr class=""> | |
1112 <th scope="row">files</th> | |
1113 <td>file_data: /galaxy/data/tmp/88d2ff5c70f646e182b4b058607d486d</td> | |
1114 <td>image.png</td> | |
1115 <td>auto</td> | |
1116 <td>232870</td> | |
1117 </tr><tr class=""> | |
1118 <th scope="row">paramfile</th> | |
1119 <td>None</td> | |
1120 <td></td> | |
1121 <td></td> | |
1122 <td></td> | |
1123 </tr><tr class=""> | |
1124 <th scope="row">request_version</th> | |
1125 <td>1</td> | |
1126 <td></td> | |
1127 <td></td> | |
1128 <td></td> | |
1129 </tr><tr class=""> | |
1130 <th scope="row">auto_decompress</th> | |
1131 <td>True</td> | |
1132 <td></td> | |
1133 <td></td> | |
1134 <td></td> | |
1135 </tr><tr class=""> | |
1136 <th scope="row">check_content</th> | |
1137 <td>True</td> | |
1138 <td></td> | |
1139 <td></td> | |
1140 <td></td> | |
1141 </tr> | |
1142 </table> | |
1143 </div> | |
1144 | |
1145 | |
1146 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
1147 <h2 | |
1148 class="history_metadata_extractor_h2" | |
1149 style="cursor: pointer" | |
1150 title="click to fold/unfold the table" | |
1151 > | |
1152 [DELETED] - abims_CAMERA_annotateDiffreport - 2.2.6+camera1.48.0-galaxy0 | |
1153 </h2> | |
1154 <p class="history_metadata_extractor_status"> | |
1155 Status: Failed (None) | |
1156 </p> | |
1157 <p class="history_metadata_extractor_glitter"></p> | |
1158 <table class=" | |
1159 table | |
1160 table-bordered | |
1161 table-dark | |
1162 table-striped | |
1163 table-hover | |
1164 d-block | |
1165 overflow-auto | |
1166 history_metadata_extractor_table | |
1167 "> | |
1168 <thead> | |
1169 <tr> | |
1170 <th scope="col"></th> | |
1171 <th scope="col">value</th> | |
1172 <th scope="col">name</th> | |
1173 <th scope="col">extension</th> | |
1174 <th scope="col">hid</th> | |
1175 </tr> | |
1176 </thead> | |
1177 <tr class=""> | |
1178 <th scope="row">option</th> | |
1179 <td>hide</td> | |
1180 <td></td> | |
1181 <td></td> | |
1182 <td></td> | |
1183 </tr><tr class=""> | |
1184 <th scope="row">convertRTMinute</th> | |
1185 <td>false</td> | |
1186 <td></td> | |
1187 <td></td> | |
1188 <td></td> | |
1189 </tr><tr class=""> | |
1190 <th scope="row">intval</th> | |
1191 <td>into</td> | |
1192 <td></td> | |
1193 <td></td> | |
1194 <td></td> | |
1195 </tr><tr class=""> | |
1196 <th scope="row">numDigitsMZ</th> | |
1197 <td>4</td> | |
1198 <td></td> | |
1199 <td></td> | |
1200 <td></td> | |
1201 </tr><tr class=""> | |
1202 <th scope="row">numDigitsRT</th> | |
1203 <td>0</td> | |
1204 <td></td> | |
1205 <td></td> | |
1206 <td></td> | |
1207 </tr><tr class=""> | |
1208 <th scope="row">file_load_select</th> | |
1209 <td>no</td> | |
1210 <td></td> | |
1211 <td></td> | |
1212 <td></td> | |
1213 </tr><tr class=""> | |
1214 <th scope="row">mzabs</th> | |
1215 <td>0.015</td> | |
1216 <td></td> | |
1217 <td></td> | |
1218 <td></td> | |
1219 </tr><tr class=""> | |
1220 <th scope="row">ppm</th> | |
1221 <td>5</td> | |
1222 <td></td> | |
1223 <td></td> | |
1224 <td></td> | |
1225 </tr><tr class=""> | |
1226 <th scope="row">maxcharge</th> | |
1227 <td>3</td> | |
1228 <td></td> | |
1229 <td></td> | |
1230 <td></td> | |
1231 </tr><tr class=""> | |
1232 <th scope="row">maxiso</th> | |
1233 <td>4</td> | |
1234 <td></td> | |
1235 <td></td> | |
1236 <td></td> | |
1237 </tr><tr class=""> | |
1238 <th scope="row">minfrac</th> | |
1239 <td>0.5</td> | |
1240 <td></td> | |
1241 <td></td> | |
1242 <td></td> | |
1243 </tr><tr class=""> | |
1244 <th scope="row">perfwhm</th> | |
1245 <td>0.6</td> | |
1246 <td></td> | |
1247 <td></td> | |
1248 <td></td> | |
1249 </tr><tr class=""> | |
1250 <th scope="row">sigma</th> | |
1251 <td>6</td> | |
1252 <td></td> | |
1253 <td></td> | |
1254 <td></td> | |
1255 </tr><tr class=""> | |
1256 <th scope="row">image</th> | |
1257 <td>9e77b3d7d0887128</td> | |
1258 <td>test.rdata</td> | |
1259 <td>rdata</td> | |
1260 <td>1</td> | |
1261 </tr><tr class=""> | |
1262 <th scope="row">max_peaks</th> | |
1263 <td>100</td> | |
1264 <td></td> | |
1265 <td></td> | |
1266 <td></td> | |
1267 </tr><tr class=""> | |
1268 <th scope="row">polarity</th> | |
1269 <td>negative</td> | |
1270 <td></td> | |
1271 <td></td> | |
1272 <td></td> | |
1273 </tr><tr class=""> | |
1274 <th scope="row">multiplier</th> | |
1275 <td>3</td> | |
1276 <td></td> | |
1277 <td></td> | |
1278 <td></td> | |
1279 </tr><tr class=""> | |
1280 <th scope="row">rules_select</th> | |
1281 <td>FALSE</td> | |
1282 <td></td> | |
1283 <td></td> | |
1284 <td></td> | |
1285 </tr><tr class=""> | |
1286 <th scope="row">calcCaS</th> | |
1287 <td>false</td> | |
1288 <td></td> | |
1289 <td></td> | |
1290 <td></td> | |
1291 </tr><tr class=""> | |
1292 <th scope="row">calcCiS</th> | |
1293 <td>true</td> | |
1294 <td></td> | |
1295 <td></td> | |
1296 <td></td> | |
1297 </tr><tr class=""> | |
1298 <th scope="row">calcIso</th> | |
1299 <td>false</td> | |
1300 <td></td> | |
1301 <td></td> | |
1302 <td></td> | |
1303 </tr><tr class=""> | |
1304 <th scope="row">cor_eic_th</th> | |
1305 <td>0.75</td> | |
1306 <td></td> | |
1307 <td></td> | |
1308 <td></td> | |
1309 </tr><tr class=""> | |
1310 <th scope="row">graphMethod</th> | |
1311 <td>hcs</td> | |
1312 <td></td> | |
1313 <td></td> | |
1314 <td></td> | |
1315 </tr><tr class=""> | |
1316 <th scope="row">pval</th> | |
1317 <td>0.05</td> | |
1318 <td></td> | |
1319 <td></td> | |
1320 <td></td> | |
1321 </tr><tr class=""> | |
1322 <th scope="row">quick</th> | |
1323 <td>FALSE</td> | |
1324 <td></td> | |
1325 <td></td> | |
1326 <td></td> | |
1327 </tr> | |
1328 </table> | |
1329 </div> | |
1330 | |
1331 | |
1332 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
1333 <h2 | |
1334 class="history_metadata_extractor_h2" | |
1335 style="cursor: pointer" | |
1336 title="click to fold/unfold the table" | |
1337 > | |
1338 [DELETED] - abims_CAMERA_annotateDiffreport - 2.2.6+camera1.48.0-galaxy0 | |
1339 </h2> | |
1340 <p class="history_metadata_extractor_status"> | |
1341 Status: Failed (None) | |
1342 </p> | |
1343 <p class="history_metadata_extractor_glitter"></p> | |
1344 <table class=" | |
1345 table | |
1346 table-bordered | |
1347 table-dark | |
1348 table-striped | |
1349 table-hover | |
1350 d-block | |
1351 overflow-auto | |
1352 history_metadata_extractor_table | |
1353 "> | |
1354 <thead> | |
1355 <tr> | |
1356 <th scope="col"></th> | |
1357 <th scope="col">value</th> | |
1358 <th scope="col">name</th> | |
1359 <th scope="col">extension</th> | |
1360 <th scope="col">hid</th> | |
1361 </tr> | |
1362 </thead> | |
1363 <tr class=""> | |
1364 <th scope="row">option</th> | |
1365 <td>hide</td> | |
1366 <td></td> | |
1367 <td></td> | |
1368 <td></td> | |
1369 </tr><tr class=""> | |
1370 <th scope="row">convertRTMinute</th> | |
1371 <td>false</td> | |
1372 <td></td> | |
1373 <td></td> | |
1374 <td></td> | |
1375 </tr><tr class=""> | |
1376 <th scope="row">intval</th> | |
1377 <td>into</td> | |
1378 <td></td> | |
1379 <td></td> | |
1380 <td></td> | |
1381 </tr><tr class=""> | |
1382 <th scope="row">numDigitsMZ</th> | |
1383 <td>4</td> | |
1384 <td></td> | |
1385 <td></td> | |
1386 <td></td> | |
1387 </tr><tr class=""> | |
1388 <th scope="row">numDigitsRT</th> | |
1389 <td>0</td> | |
1390 <td></td> | |
1391 <td></td> | |
1392 <td></td> | |
1393 </tr><tr class=""> | |
1394 <th scope="row">file_load_select</th> | |
1395 <td>no</td> | |
1396 <td></td> | |
1397 <td></td> | |
1398 <td></td> | |
1399 </tr><tr class=""> | |
1400 <th scope="row">mzabs</th> | |
1401 <td>0.015</td> | |
1402 <td></td> | |
1403 <td></td> | |
1404 <td></td> | |
1405 </tr><tr class=""> | |
1406 <th scope="row">ppm</th> | |
1407 <td>5</td> | |
1408 <td></td> | |
1409 <td></td> | |
1410 <td></td> | |
1411 </tr><tr class=""> | |
1412 <th scope="row">maxcharge</th> | |
1413 <td>3</td> | |
1414 <td></td> | |
1415 <td></td> | |
1416 <td></td> | |
1417 </tr><tr class=""> | |
1418 <th scope="row">maxiso</th> | |
1419 <td>4</td> | |
1420 <td></td> | |
1421 <td></td> | |
1422 <td></td> | |
1423 </tr><tr class=""> | |
1424 <th scope="row">minfrac</th> | |
1425 <td>0.5</td> | |
1426 <td></td> | |
1427 <td></td> | |
1428 <td></td> | |
1429 </tr><tr class=""> | |
1430 <th scope="row">perfwhm</th> | |
1431 <td>0.6</td> | |
1432 <td></td> | |
1433 <td></td> | |
1434 <td></td> | |
1435 </tr><tr class=""> | |
1436 <th scope="row">sigma</th> | |
1437 <td>6</td> | |
1438 <td></td> | |
1439 <td></td> | |
1440 <td></td> | |
1441 </tr><tr class=""> | |
1442 <th scope="row">image</th> | |
1443 <td>9e77b3d7d0887128</td> | |
1444 <td>test.rdata</td> | |
1445 <td>rdata</td> | |
1446 <td>1</td> | |
1447 </tr><tr class=""> | |
1448 <th scope="row">max_peaks</th> | |
1449 <td>100</td> | |
1450 <td></td> | |
1451 <td></td> | |
1452 <td></td> | |
1453 </tr><tr class=""> | |
1454 <th scope="row">polarity</th> | |
1455 <td>negative</td> | |
1456 <td></td> | |
1457 <td></td> | |
1458 <td></td> | |
1459 </tr><tr class=""> | |
1460 <th scope="row">multiplier</th> | |
1461 <td>3</td> | |
1462 <td></td> | |
1463 <td></td> | |
1464 <td></td> | |
1465 </tr><tr class=""> | |
1466 <th scope="row">rules_select</th> | |
1467 <td>FALSE</td> | |
1468 <td></td> | |
1469 <td></td> | |
1470 <td></td> | |
1471 </tr><tr class=""> | |
1472 <th scope="row">calcCaS</th> | |
1473 <td>false</td> | |
1474 <td></td> | |
1475 <td></td> | |
1476 <td></td> | |
1477 </tr><tr class=""> | |
1478 <th scope="row">calcCiS</th> | |
1479 <td>true</td> | |
1480 <td></td> | |
1481 <td></td> | |
1482 <td></td> | |
1483 </tr><tr class=""> | |
1484 <th scope="row">calcIso</th> | |
1485 <td>false</td> | |
1486 <td></td> | |
1487 <td></td> | |
1488 <td></td> | |
1489 </tr><tr class=""> | |
1490 <th scope="row">cor_eic_th</th> | |
1491 <td>0.75</td> | |
1492 <td></td> | |
1493 <td></td> | |
1494 <td></td> | |
1495 </tr><tr class=""> | |
1496 <th scope="row">graphMethod</th> | |
1497 <td>hcs</td> | |
1498 <td></td> | |
1499 <td></td> | |
1500 <td></td> | |
1501 </tr><tr class=""> | |
1502 <th scope="row">pval</th> | |
1503 <td>0.05</td> | |
1504 <td></td> | |
1505 <td></td> | |
1506 <td></td> | |
1507 </tr><tr class=""> | |
1508 <th scope="row">quick</th> | |
1509 <td>FALSE</td> | |
1510 <td></td> | |
1511 <td></td> | |
1512 <td></td> | |
1513 </tr> | |
1514 </table> | |
1515 </div> | |
1516 | |
1517 | |
1518 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
1519 <h2 | |
1520 class="history_metadata_extractor_h2" | |
1521 style="cursor: pointer" | |
1522 title="click to fold/unfold the table" | |
1523 > | |
1524 [DELETED] - corrtable - 1.0.0 | |
1525 </h2> | |
1526 <p class="history_metadata_extractor_status"> | |
1527 Status: Failed (127) | |
1528 </p> | |
1529 <p class="history_metadata_extractor_glitter"></p> | |
1530 <table class=" | |
1531 table | |
1532 table-bordered | |
1533 table-dark | |
1534 table-striped | |
1535 table-hover | |
1536 d-block | |
1537 overflow-auto | |
1538 history_metadata_extractor_table | |
1539 "> | |
1540 <thead> | |
1541 <tr> | |
1542 <th scope="col"></th> | |
1543 <th scope="col">value</th> | |
1544 <th scope="col">name</th> | |
1545 <th scope="col">extension</th> | |
1546 <th scope="col">hid</th> | |
1547 </tr> | |
1548 </thead> | |
1549 <tr class=""> | |
1550 <th scope="row">corr_method</th> | |
1551 <td>pearson</td> | |
1552 <td></td> | |
1553 <td></td> | |
1554 <td></td> | |
1555 </tr><tr class=""> | |
1556 <th scope="row">filter</th> | |
1557 <td>no</td> | |
1558 <td></td> | |
1559 <td></td> | |
1560 <td></td> | |
1561 </tr><tr class=""> | |
1562 <th scope="row">test_corr</th> | |
1563 <td>no</td> | |
1564 <td></td> | |
1565 <td></td> | |
1566 <td></td> | |
1567 </tr><tr class=""> | |
1568 <th scope="row">color_heatmap</th> | |
1569 <td>no</td> | |
1570 <td></td> | |
1571 <td></td> | |
1572 <td></td> | |
1573 </tr><tr class=""> | |
1574 <th scope="row">plot_choice</th> | |
1575 <td>auto</td> | |
1576 <td></td> | |
1577 <td></td> | |
1578 <td></td> | |
1579 </tr><tr class=""> | |
1580 <th scope="row">reorder_var</th> | |
1581 <td>no</td> | |
1582 <td></td> | |
1583 <td></td> | |
1584 <td></td> | |
1585 </tr><tr class=""> | |
1586 <th scope="row">tab1_in</th> | |
1587 <td>7cf499d16bd542b2</td> | |
1588 <td>compounds_pos.txt</td> | |
1589 <td>tabular</td> | |
1590 <td>44</td> | |
1591 </tr><tr class=""> | |
1592 <th scope="row">tab1_samples</th> | |
1593 <td>row</td> | |
1594 <td></td> | |
1595 <td></td> | |
1596 <td></td> | |
1597 </tr><tr class=""> | |
1598 <th scope="row">tab2_in</th> | |
1599 <td>7cf499d16bd542b2</td> | |
1600 <td>compounds_pos.txt</td> | |
1601 <td>tabular</td> | |
1602 <td>44</td> | |
1603 </tr><tr class=""> | |
1604 <th scope="row">tab2_samples</th> | |
1605 <td>row</td> | |
1606 <td></td> | |
1607 <td></td> | |
1608 <td></td> | |
1609 </tr> | |
1610 </table> | |
1611 </div> | |
1612 | |
1613 | |
1614 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
1615 <h2 | |
1616 class="history_metadata_extractor_h2" | |
1617 style="cursor: pointer" | |
1618 title="click to fold/unfold the table" | |
1619 > | |
1620 [DELETED] - corrtable - 1.0.0 | |
1621 </h2> | |
1622 <p class="history_metadata_extractor_status"> | |
1623 Status: Failed (127) | |
1624 </p> | |
1625 <p class="history_metadata_extractor_glitter"></p> | |
1626 <table class=" | |
1627 table | |
1628 table-bordered | |
1629 table-dark | |
1630 table-striped | |
1631 table-hover | |
1632 d-block | |
1633 overflow-auto | |
1634 history_metadata_extractor_table | |
1635 "> | |
1636 <thead> | |
1637 <tr> | |
1638 <th scope="col"></th> | |
1639 <th scope="col">value</th> | |
1640 <th scope="col">name</th> | |
1641 <th scope="col">extension</th> | |
1642 <th scope="col">hid</th> | |
1643 </tr> | |
1644 </thead> | |
1645 <tr class=""> | |
1646 <th scope="row">corr_method</th> | |
1647 <td>pearson</td> | |
1648 <td></td> | |
1649 <td></td> | |
1650 <td></td> | |
1651 </tr><tr class=""> | |
1652 <th scope="row">filter</th> | |
1653 <td>no</td> | |
1654 <td></td> | |
1655 <td></td> | |
1656 <td></td> | |
1657 </tr><tr class=""> | |
1658 <th scope="row">test_corr</th> | |
1659 <td>no</td> | |
1660 <td></td> | |
1661 <td></td> | |
1662 <td></td> | |
1663 </tr><tr class=""> | |
1664 <th scope="row">color_heatmap</th> | |
1665 <td>no</td> | |
1666 <td></td> | |
1667 <td></td> | |
1668 <td></td> | |
1669 </tr><tr class=""> | |
1670 <th scope="row">plot_choice</th> | |
1671 <td>auto</td> | |
1672 <td></td> | |
1673 <td></td> | |
1674 <td></td> | |
1675 </tr><tr class=""> | |
1676 <th scope="row">reorder_var</th> | |
1677 <td>no</td> | |
1678 <td></td> | |
1679 <td></td> | |
1680 <td></td> | |
1681 </tr><tr class=""> | |
1682 <th scope="row">tab1_in</th> | |
1683 <td>7cf499d16bd542b2</td> | |
1684 <td>compounds_pos.txt</td> | |
1685 <td>tabular</td> | |
1686 <td>44</td> | |
1687 </tr><tr class=""> | |
1688 <th scope="row">tab1_samples</th> | |
1689 <td>row</td> | |
1690 <td></td> | |
1691 <td></td> | |
1692 <td></td> | |
1693 </tr><tr class=""> | |
1694 <th scope="row">tab2_in</th> | |
1695 <td>7cf499d16bd542b2</td> | |
1696 <td>compounds_pos.txt</td> | |
1697 <td>tabular</td> | |
1698 <td>44</td> | |
1699 </tr><tr class=""> | |
1700 <th scope="row">tab2_samples</th> | |
1701 <td>row</td> | |
1702 <td></td> | |
1703 <td></td> | |
1704 <td></td> | |
1705 </tr> | |
1706 </table> | |
1707 </div> | |
1708 | |
1709 | |
1710 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
1711 <h2 | |
1712 class="history_metadata_extractor_h2" | |
1713 style="cursor: pointer" | |
1714 title="click to fold/unfold the table" | |
1715 > | |
1716 [DELETED] - corrtable - 1.0.0 | |
1717 </h2> | |
1718 <p class="history_metadata_extractor_status"> | |
1719 Status: Failed (127) | |
1720 </p> | |
1721 <p class="history_metadata_extractor_glitter"></p> | |
1722 <table class=" | |
1723 table | |
1724 table-bordered | |
1725 table-dark | |
1726 table-striped | |
1727 table-hover | |
1728 d-block | |
1729 overflow-auto | |
1730 history_metadata_extractor_table | |
1731 "> | |
1732 <thead> | |
1733 <tr> | |
1734 <th scope="col"></th> | |
1735 <th scope="col">value</th> | |
1736 <th scope="col">name</th> | |
1737 <th scope="col">extension</th> | |
1738 <th scope="col">hid</th> | |
1739 </tr> | |
1740 </thead> | |
1741 <tr class=""> | |
1742 <th scope="row">corr_method</th> | |
1743 <td>pearson</td> | |
1744 <td></td> | |
1745 <td></td> | |
1746 <td></td> | |
1747 </tr><tr class=""> | |
1748 <th scope="row">filter</th> | |
1749 <td>no</td> | |
1750 <td></td> | |
1751 <td></td> | |
1752 <td></td> | |
1753 </tr><tr class=""> | |
1754 <th scope="row">test_corr</th> | |
1755 <td>no</td> | |
1756 <td></td> | |
1757 <td></td> | |
1758 <td></td> | |
1759 </tr><tr class=""> | |
1760 <th scope="row">color_heatmap</th> | |
1761 <td>no</td> | |
1762 <td></td> | |
1763 <td></td> | |
1764 <td></td> | |
1765 </tr><tr class=""> | |
1766 <th scope="row">plot_choice</th> | |
1767 <td>auto</td> | |
1768 <td></td> | |
1769 <td></td> | |
1770 <td></td> | |
1771 </tr><tr class=""> | |
1772 <th scope="row">reorder_var</th> | |
1773 <td>no</td> | |
1774 <td></td> | |
1775 <td></td> | |
1776 <td></td> | |
1777 </tr><tr class=""> | |
1778 <th scope="row">tab1_in</th> | |
1779 <td>7cf499d16bd542b2</td> | |
1780 <td>compounds_pos.txt</td> | |
1781 <td>tabular</td> | |
1782 <td>44</td> | |
1783 </tr><tr class=""> | |
1784 <th scope="row">tab1_samples</th> | |
1785 <td>row</td> | |
1786 <td></td> | |
1787 <td></td> | |
1788 <td></td> | |
1789 </tr><tr class=""> | |
1790 <th scope="row">tab2_in</th> | |
1791 <td>7cf499d16bd542b2</td> | |
1792 <td>compounds_pos.txt</td> | |
1793 <td>tabular</td> | |
1794 <td>44</td> | |
1795 </tr><tr class=""> | |
1796 <th scope="row">tab2_samples</th> | |
1797 <td>row</td> | |
1798 <td></td> | |
1799 <td></td> | |
1800 <td></td> | |
1801 </tr> | |
1802 </table> | |
1803 </div> | |
1804 | |
1805 | |
1806 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
1807 <h2 | |
1808 class="history_metadata_extractor_h2" | |
1809 style="cursor: pointer" | |
1810 title="click to fold/unfold the table" | |
1811 > | |
1812 [DELETED] - corrtable - 1.0.0 | |
1813 </h2> | |
1814 <p class="history_metadata_extractor_status"> | |
1815 Status: Failed (127) | |
1816 </p> | |
1817 <p class="history_metadata_extractor_glitter"></p> | |
1818 <table class=" | |
1819 table | |
1820 table-bordered | |
1821 table-dark | |
1822 table-striped | |
1823 table-hover | |
1824 d-block | |
1825 overflow-auto | |
1826 history_metadata_extractor_table | |
1827 "> | |
1828 <thead> | |
1829 <tr> | |
1830 <th scope="col"></th> | |
1831 <th scope="col">value</th> | |
1832 <th scope="col">name</th> | |
1833 <th scope="col">extension</th> | |
1834 <th scope="col">hid</th> | |
1835 </tr> | |
1836 </thead> | |
1837 <tr class=""> | |
1838 <th scope="row">corr_method</th> | |
1839 <td>pearson</td> | |
1840 <td></td> | |
1841 <td></td> | |
1842 <td></td> | |
1843 </tr><tr class=""> | |
1844 <th scope="row">filter</th> | |
1845 <td>no</td> | |
1846 <td></td> | |
1847 <td></td> | |
1848 <td></td> | |
1849 </tr><tr class=""> | |
1850 <th scope="row">test_corr</th> | |
1851 <td>no</td> | |
1852 <td></td> | |
1853 <td></td> | |
1854 <td></td> | |
1855 </tr><tr class=""> | |
1856 <th scope="row">color_heatmap</th> | |
1857 <td>no</td> | |
1858 <td></td> | |
1859 <td></td> | |
1860 <td></td> | |
1861 </tr><tr class=""> | |
1862 <th scope="row">plot_choice</th> | |
1863 <td>auto</td> | |
1864 <td></td> | |
1865 <td></td> | |
1866 <td></td> | |
1867 </tr><tr class=""> | |
1868 <th scope="row">reorder_var</th> | |
1869 <td>no</td> | |
1870 <td></td> | |
1871 <td></td> | |
1872 <td></td> | |
1873 </tr><tr class=""> | |
1874 <th scope="row">tab1_in</th> | |
1875 <td>7cf499d16bd542b2</td> | |
1876 <td>compounds_pos.txt</td> | |
1877 <td>tabular</td> | |
1878 <td>44</td> | |
1879 </tr><tr class=""> | |
1880 <th scope="row">tab1_samples</th> | |
1881 <td>row</td> | |
1882 <td></td> | |
1883 <td></td> | |
1884 <td></td> | |
1885 </tr><tr class=""> | |
1886 <th scope="row">tab2_in</th> | |
1887 <td>7cf499d16bd542b2</td> | |
1888 <td>compounds_pos.txt</td> | |
1889 <td>tabular</td> | |
1890 <td>44</td> | |
1891 </tr><tr class=""> | |
1892 <th scope="row">tab2_samples</th> | |
1893 <td>row</td> | |
1894 <td></td> | |
1895 <td></td> | |
1896 <td></td> | |
1897 </tr> | |
1898 </table> | |
1899 </div> | |
1900 | |
1901 | |
1902 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
1903 <h2 | |
1904 class="history_metadata_extractor_h2" | |
1905 style="cursor: pointer" | |
1906 title="click to fold/unfold the table" | |
1907 > | |
1908 [DELETED] - intens_check - 1.2.8 | |
1909 </h2> | |
1910 <p class="history_metadata_extractor_status"> | |
1911 Status: Failed (1) | |
1912 </p> | |
1913 <p class="history_metadata_extractor_glitter"></p> | |
1914 <table class=" | |
1915 table | |
1916 table-bordered | |
1917 table-dark | |
1918 table-striped | |
1919 table-hover | |
1920 d-block | |
1921 overflow-auto | |
1922 history_metadata_extractor_table | |
1923 "> | |
1924 <thead> | |
1925 <tr> | |
1926 <th scope="col"></th> | |
1927 <th scope="col">value</th> | |
1928 <th scope="col">name</th> | |
1929 <th scope="col">extension</th> | |
1930 <th scope="col">hid</th> | |
1931 </tr> | |
1932 </thead> | |
1933 <tr class=""> | |
1934 <th scope="row">dataMatrix_in</th> | |
1935 <td>7cf499d16bd542b2</td> | |
1936 <td>compounds_pos.txt</td> | |
1937 <td>tabular</td> | |
1938 <td>44</td> | |
1939 </tr><tr class=""> | |
1940 <th scope="row">chosen_stat</th> | |
1941 <td>None</td> | |
1942 <td></td> | |
1943 <td></td> | |
1944 <td></td> | |
1945 </tr><tr class=""> | |
1946 <th scope="row">method</th> | |
1947 <td>no_class</td> | |
1948 <td></td> | |
1949 <td></td> | |
1950 <td></td> | |
1951 </tr><tr class=""> | |
1952 <th scope="row">sampleMetadata_in</th> | |
1953 <td>7cf499d16bd542b2</td> | |
1954 <td>compounds_pos.txt</td> | |
1955 <td>tabular</td> | |
1956 <td>44</td> | |
1957 </tr><tr class=""> | |
1958 <th scope="row">variableMetadata_in</th> | |
1959 <td>7cf499d16bd542b2</td> | |
1960 <td>compounds_pos.txt</td> | |
1961 <td>tabular</td> | |
1962 <td>44</td> | |
1963 </tr> | |
1964 </table> | |
1965 </div> | |
1966 | |
1967 | |
1968 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
1969 <h2 | |
1970 class="history_metadata_extractor_h2" | |
1971 style="cursor: pointer" | |
1972 title="click to fold/unfold the table" | |
1973 > | |
1974 [DELETED] - intens_check - 1.2.8 | |
1975 </h2> | |
1976 <p class="history_metadata_extractor_status"> | |
1977 Status: Failed (1) | |
1978 </p> | |
1979 <p class="history_metadata_extractor_glitter"></p> | |
1980 <table class=" | |
1981 table | |
1982 table-bordered | |
1983 table-dark | |
1984 table-striped | |
1985 table-hover | |
1986 d-block | |
1987 overflow-auto | |
1988 history_metadata_extractor_table | |
1989 "> | |
1990 <thead> | |
1991 <tr> | |
1992 <th scope="col"></th> | |
1993 <th scope="col">value</th> | |
1994 <th scope="col">name</th> | |
1995 <th scope="col">extension</th> | |
1996 <th scope="col">hid</th> | |
1997 </tr> | |
1998 </thead> | |
1999 <tr class=""> | |
2000 <th scope="row">dataMatrix_in</th> | |
2001 <td>7cf499d16bd542b2</td> | |
2002 <td>compounds_pos.txt</td> | |
2003 <td>tabular</td> | |
2004 <td>44</td> | |
2005 </tr><tr class=""> | |
2006 <th scope="row">chosen_stat</th> | |
2007 <td>None</td> | |
2008 <td></td> | |
2009 <td></td> | |
2010 <td></td> | |
2011 </tr><tr class=""> | |
2012 <th scope="row">method</th> | |
2013 <td>no_class</td> | |
2014 <td></td> | |
2015 <td></td> | |
2016 <td></td> | |
2017 </tr><tr class=""> | |
2018 <th scope="row">sampleMetadata_in</th> | |
2019 <td>7cf499d16bd542b2</td> | |
2020 <td>compounds_pos.txt</td> | |
2021 <td>tabular</td> | |
2022 <td>44</td> | |
2023 </tr><tr class=""> | |
2024 <th scope="row">variableMetadata_in</th> | |
2025 <td>7cf499d16bd542b2</td> | |
2026 <td>compounds_pos.txt</td> | |
2027 <td>tabular</td> | |
2028 <td>44</td> | |
2029 </tr> | |
2030 </table> | |
2031 </div> | |
2032 | |
2033 | |
2034 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
2035 <h2 | |
2036 class="history_metadata_extractor_h2" | |
2037 style="cursor: pointer" | |
2038 title="click to fold/unfold the table" | |
2039 > | |
2040 [DELETED] - wsdl_hmdb - 1.6.1 | |
2041 </h2> | |
2042 <p class="history_metadata_extractor_status"> | |
2043 Status: Failed (255) | |
2044 </p> | |
2045 <p class="history_metadata_extractor_glitter"></p> | |
2046 <table class=" | |
2047 table | |
2048 table-bordered | |
2049 table-dark | |
2050 table-striped | |
2051 table-hover | |
2052 d-block | |
2053 overflow-auto | |
2054 history_metadata_extractor_table | |
2055 "> | |
2056 <thead> | |
2057 <tr> | |
2058 <th scope="col"></th> | |
2059 <th scope="col">value</th> | |
2060 <th scope="col">name</th> | |
2061 <th scope="col">extension</th> | |
2062 <th scope="col">hid</th> | |
2063 </tr> | |
2064 </thead> | |
2065 <tr class=""> | |
2066 <th scope="row">advancedFeatures</th> | |
2067 <td>0</td> | |
2068 <td></td> | |
2069 <td></td> | |
2070 <td></td> | |
2071 </tr><tr class=""> | |
2072 <th scope="row">delta</th> | |
2073 <td>0.05</td> | |
2074 <td></td> | |
2075 <td></td> | |
2076 <td></td> | |
2077 </tr><tr class=""> | |
2078 <th scope="row">choice</th> | |
2079 <td>YES</td> | |
2080 <td></td> | |
2081 <td></td> | |
2082 <td></td> | |
2083 </tr><tr class=""> | |
2084 <th scope="row">colfactor</th> | |
2085 <td>1</td> | |
2086 <td></td> | |
2087 <td></td> | |
2088 <td></td> | |
2089 </tr><tr class=""> | |
2090 <th scope="row">header_choice</th> | |
2091 <td>yes</td> | |
2092 <td></td> | |
2093 <td></td> | |
2094 <td></td> | |
2095 </tr><tr class=""> | |
2096 <th scope="row">nbHeader</th> | |
2097 <td>1</td> | |
2098 <td></td> | |
2099 <td></td> | |
2100 <td></td> | |
2101 </tr><tr class=""> | |
2102 <th scope="row">masses</th> | |
2103 <td>7cf499d16bd542b2</td> | |
2104 <td>compounds_pos.txt</td> | |
2105 <td>tabular</td> | |
2106 <td>44</td> | |
2107 </tr><tr class=""> | |
2108 <th scope="row">maxquery</th> | |
2109 <td>10</td> | |
2110 <td></td> | |
2111 <td></td> | |
2112 <td></td> | |
2113 </tr><tr class=""> | |
2114 <th scope="row">data_neutral_adducts</th> | |
2115 <td>M</td> | |
2116 <td></td> | |
2117 <td></td> | |
2118 <td></td> | |
2119 </tr><tr class=""> | |
2120 <th scope="row">mode</th> | |
2121 <td>neutral</td> | |
2122 <td></td> | |
2123 <td></td> | |
2124 <td></td> | |
2125 </tr><tr class=""> | |
2126 <th scope="row">verbose</th> | |
2127 <td>1</td> | |
2128 <td></td> | |
2129 <td></td> | |
2130 <td></td> | |
2131 </tr> | |
2132 </table> | |
2133 </div> | |
2134 | |
2135 | |
2136 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
2137 <h2 | |
2138 class="history_metadata_extractor_h2" | |
2139 style="cursor: pointer" | |
2140 title="click to fold/unfold the table" | |
2141 > | |
2142 [DELETED] - wsdl_hmdb - 1.6.1 | |
2143 </h2> | |
2144 <p class="history_metadata_extractor_status"> | |
2145 Status: Failed (255) | |
2146 </p> | |
2147 <p class="history_metadata_extractor_glitter"></p> | |
2148 <table class=" | |
2149 table | |
2150 table-bordered | |
2151 table-dark | |
2152 table-striped | |
2153 table-hover | |
2154 d-block | |
2155 overflow-auto | |
2156 history_metadata_extractor_table | |
2157 "> | |
2158 <thead> | |
2159 <tr> | |
2160 <th scope="col"></th> | |
2161 <th scope="col">value</th> | |
2162 <th scope="col">name</th> | |
2163 <th scope="col">extension</th> | |
2164 <th scope="col">hid</th> | |
2165 </tr> | |
2166 </thead> | |
2167 <tr class=""> | |
2168 <th scope="row">advancedFeatures</th> | |
2169 <td>0</td> | |
2170 <td></td> | |
2171 <td></td> | |
2172 <td></td> | |
2173 </tr><tr class=""> | |
2174 <th scope="row">delta</th> | |
2175 <td>0.05</td> | |
2176 <td></td> | |
2177 <td></td> | |
2178 <td></td> | |
2179 </tr><tr class=""> | |
2180 <th scope="row">choice</th> | |
2181 <td>YES</td> | |
2182 <td></td> | |
2183 <td></td> | |
2184 <td></td> | |
2185 </tr><tr class=""> | |
2186 <th scope="row">colfactor</th> | |
2187 <td>1</td> | |
2188 <td></td> | |
2189 <td></td> | |
2190 <td></td> | |
2191 </tr><tr class=""> | |
2192 <th scope="row">header_choice</th> | |
2193 <td>yes</td> | |
2194 <td></td> | |
2195 <td></td> | |
2196 <td></td> | |
2197 </tr><tr class=""> | |
2198 <th scope="row">nbHeader</th> | |
2199 <td>1</td> | |
2200 <td></td> | |
2201 <td></td> | |
2202 <td></td> | |
2203 </tr><tr class=""> | |
2204 <th scope="row">masses</th> | |
2205 <td>7cf499d16bd542b2</td> | |
2206 <td>compounds_pos.txt</td> | |
2207 <td>tabular</td> | |
2208 <td>44</td> | |
2209 </tr><tr class=""> | |
2210 <th scope="row">maxquery</th> | |
2211 <td>10</td> | |
2212 <td></td> | |
2213 <td></td> | |
2214 <td></td> | |
2215 </tr><tr class=""> | |
2216 <th scope="row">data_neutral_adducts</th> | |
2217 <td>M</td> | |
2218 <td></td> | |
2219 <td></td> | |
2220 <td></td> | |
2221 </tr><tr class=""> | |
2222 <th scope="row">mode</th> | |
2223 <td>neutral</td> | |
2224 <td></td> | |
2225 <td></td> | |
2226 <td></td> | |
2227 </tr><tr class=""> | |
2228 <th scope="row">verbose</th> | |
2229 <td>1</td> | |
2230 <td></td> | |
2231 <td></td> | |
2232 <td></td> | |
2233 </tr> | |
2234 </table> | |
2235 </div> | |
2236 | |
2237 | |
2238 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
2239 <h2 | |
2240 class="history_metadata_extractor_h2" | |
2241 style="cursor: pointer" | |
2242 title="click to fold/unfold the table" | |
2243 > | |
2244 [DELETED] - wsdl_hmdb - 1.6.1 | |
2245 </h2> | |
2246 <p class="history_metadata_extractor_status"> | |
2247 Status: Failed (255) | |
2248 </p> | |
2249 <p class="history_metadata_extractor_glitter"></p> | |
2250 <table class=" | |
2251 table | |
2252 table-bordered | |
2253 table-dark | |
2254 table-striped | |
2255 table-hover | |
2256 d-block | |
2257 overflow-auto | |
2258 history_metadata_extractor_table | |
2259 "> | |
2260 <thead> | |
2261 <tr> | |
2262 <th scope="col"></th> | |
2263 <th scope="col">value</th> | |
2264 <th scope="col">name</th> | |
2265 <th scope="col">extension</th> | |
2266 <th scope="col">hid</th> | |
2267 </tr> | |
2268 </thead> | |
2269 <tr class=""> | |
2270 <th scope="row">advancedFeatures</th> | |
2271 <td>0</td> | |
2272 <td></td> | |
2273 <td></td> | |
2274 <td></td> | |
2275 </tr><tr class=""> | |
2276 <th scope="row">delta</th> | |
2277 <td>0.05</td> | |
2278 <td></td> | |
2279 <td></td> | |
2280 <td></td> | |
2281 </tr><tr class=""> | |
2282 <th scope="row">choice</th> | |
2283 <td>YES</td> | |
2284 <td></td> | |
2285 <td></td> | |
2286 <td></td> | |
2287 </tr><tr class=""> | |
2288 <th scope="row">colfactor</th> | |
2289 <td>1</td> | |
2290 <td></td> | |
2291 <td></td> | |
2292 <td></td> | |
2293 </tr><tr class=""> | |
2294 <th scope="row">header_choice</th> | |
2295 <td>yes</td> | |
2296 <td></td> | |
2297 <td></td> | |
2298 <td></td> | |
2299 </tr><tr class=""> | |
2300 <th scope="row">nbHeader</th> | |
2301 <td>1</td> | |
2302 <td></td> | |
2303 <td></td> | |
2304 <td></td> | |
2305 </tr><tr class=""> | |
2306 <th scope="row">masses</th> | |
2307 <td>7cf499d16bd542b2</td> | |
2308 <td>compounds_pos.txt</td> | |
2309 <td>tabular</td> | |
2310 <td>44</td> | |
2311 </tr><tr class=""> | |
2312 <th scope="row">maxquery</th> | |
2313 <td>10</td> | |
2314 <td></td> | |
2315 <td></td> | |
2316 <td></td> | |
2317 </tr><tr class=""> | |
2318 <th scope="row">data_neutral_adducts</th> | |
2319 <td>M</td> | |
2320 <td></td> | |
2321 <td></td> | |
2322 <td></td> | |
2323 </tr><tr class=""> | |
2324 <th scope="row">mode</th> | |
2325 <td>neutral</td> | |
2326 <td></td> | |
2327 <td></td> | |
2328 <td></td> | |
2329 </tr><tr class=""> | |
2330 <th scope="row">verbose</th> | |
2331 <td>1</td> | |
2332 <td></td> | |
2333 <td></td> | |
2334 <td></td> | |
2335 </tr> | |
2336 </table> | |
2337 </div> | |
2338 | |
2339 | |
2340 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
2341 <h2 | |
2342 class="history_metadata_extractor_h2" | |
2343 style="cursor: pointer" | |
2344 title="click to fold/unfold the table" | |
2345 > | |
2346 [DELETED] - idchoice - 19.12 | |
2347 </h2> | |
2348 <p class="history_metadata_extractor_status"> | |
2349 Status: Failed (1) | |
2350 </p> | |
2351 <p class="history_metadata_extractor_glitter"></p> | |
2352 <table class=" | |
2353 table | |
2354 table-bordered | |
2355 table-dark | |
2356 table-striped | |
2357 table-hover | |
2358 d-block | |
2359 overflow-auto | |
2360 history_metadata_extractor_table | |
2361 "> | |
2362 <thead> | |
2363 <tr> | |
2364 <th scope="col"></th> | |
2365 <th scope="col">value</th> | |
2366 <th scope="col">name</th> | |
2367 <th scope="col">extension</th> | |
2368 <th scope="col">hid</th> | |
2369 </tr> | |
2370 </thead> | |
2371 <tr class=""> | |
2372 <th scope="row">Metadata_in</th> | |
2373 <td>7cf499d16bd542b2</td> | |
2374 <td>compounds_pos.txt</td> | |
2375 <td>tabular</td> | |
2376 <td>44</td> | |
2377 </tr><tr class=""> | |
2378 <th scope="row">col_name</th> | |
2379 <td></td> | |
2380 <td></td> | |
2381 <td></td> | |
2382 <td></td> | |
2383 </tr><tr class=""> | |
2384 <th scope="row">dataMatrix_in</th> | |
2385 <td>7cf499d16bd542b2</td> | |
2386 <td>compounds_pos.txt</td> | |
2387 <td>tabular</td> | |
2388 <td>44</td> | |
2389 </tr><tr class=""> | |
2390 <th scope="row">makeunique</th> | |
2391 <td>no</td> | |
2392 <td></td> | |
2393 <td></td> | |
2394 <td></td> | |
2395 </tr><tr class=""> | |
2396 <th scope="row">metatype</th> | |
2397 <td>variable</td> | |
2398 <td></td> | |
2399 <td></td> | |
2400 <td></td> | |
2401 </tr> | |
2402 </table> | |
2403 </div> | |
2404 | |
2405 | |
2406 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
2407 <h2 | |
2408 class="history_metadata_extractor_h2" | |
2409 style="cursor: pointer" | |
2410 title="click to fold/unfold the table" | |
2411 > | |
2412 [DELETED] - idchoice - 19.12 | |
2413 </h2> | |
2414 <p class="history_metadata_extractor_status"> | |
2415 Status: Failed (1) | |
2416 </p> | |
2417 <p class="history_metadata_extractor_glitter"></p> | |
2418 <table class=" | |
2419 table | |
2420 table-bordered | |
2421 table-dark | |
2422 table-striped | |
2423 table-hover | |
2424 d-block | |
2425 overflow-auto | |
2426 history_metadata_extractor_table | |
2427 "> | |
2428 <thead> | |
2429 <tr> | |
2430 <th scope="col"></th> | |
2431 <th scope="col">value</th> | |
2432 <th scope="col">name</th> | |
2433 <th scope="col">extension</th> | |
2434 <th scope="col">hid</th> | |
2435 </tr> | |
2436 </thead> | |
2437 <tr class=""> | |
2438 <th scope="row">Metadata_in</th> | |
2439 <td>7cf499d16bd542b2</td> | |
2440 <td>compounds_pos.txt</td> | |
2441 <td>tabular</td> | |
2442 <td>44</td> | |
2443 </tr><tr class=""> | |
2444 <th scope="row">col_name</th> | |
2445 <td></td> | |
2446 <td></td> | |
2447 <td></td> | |
2448 <td></td> | |
2449 </tr><tr class=""> | |
2450 <th scope="row">dataMatrix_in</th> | |
2451 <td>7cf499d16bd542b2</td> | |
2452 <td>compounds_pos.txt</td> | |
2453 <td>tabular</td> | |
2454 <td>44</td> | |
2455 </tr><tr class=""> | |
2456 <th scope="row">makeunique</th> | |
2457 <td>no</td> | |
2458 <td></td> | |
2459 <td></td> | |
2460 <td></td> | |
2461 </tr><tr class=""> | |
2462 <th scope="row">metatype</th> | |
2463 <td>variable</td> | |
2464 <td></td> | |
2465 <td></td> | |
2466 <td></td> | |
2467 </tr> | |
2468 </table> | |
2469 </div> | |
2470 | |
2471 | |
2472 <div class="alert alert-success history_metadata_extractor_deleted"> | |
2473 <h2 | |
2474 class="history_metadata_extractor_h2" | |
2475 style="cursor: pointer" | |
2476 title="click to fold/unfold the table" | |
2477 > | |
2478 [DELETED] - Analytic_correlation_filtration - 2019-06-20 | |
2479 </h2> | |
2480 <p class="history_metadata_extractor_status"> | |
2481 Status: Ok (0) | |
2482 </p> | |
2483 <p class="history_metadata_extractor_glitter"></p> | |
2484 <table class=" | |
2485 table | |
2486 table-bordered | |
2487 table-dark | |
2488 table-striped | |
2489 table-hover | |
2490 d-block | |
2491 overflow-auto | |
2492 history_metadata_extractor_table | |
2493 "> | |
2494 <thead> | |
2495 <tr> | |
2496 <th scope="col"></th> | |
2497 <th scope="col">value</th> | |
2498 <th scope="col">name</th> | |
2499 <th scope="col">extension</th> | |
2500 <th scope="col">hid</th> | |
2501 </tr> | |
2502 </thead> | |
2503 <tr class=""> | |
2504 <th scope="row">correl_threshold</th> | |
2505 <td>0.9</td> | |
2506 <td></td> | |
2507 <td></td> | |
2508 <td></td> | |
2509 </tr><tr class=""> | |
2510 <th scope="row">dataMatrix_in</th> | |
2511 <td>7cf499d16bd542b2</td> | |
2512 <td>compounds_pos.txt</td> | |
2513 <td>tabular</td> | |
2514 <td>44</td> | |
2515 </tr><tr class=""> | |
2516 <th scope="row">file_in</th> | |
2517 <td>7cf499d16bd542b2</td> | |
2518 <td>compounds_pos.txt</td> | |
2519 <td>tabular</td> | |
2520 <td>44</td> | |
2521 </tr><tr class=""> | |
2522 <th scope="row">mass_file_in</th> | |
2523 <td>7cf499d16bd542b2</td> | |
2524 <td>compounds_pos.txt</td> | |
2525 <td>tabular</td> | |
2526 <td>44</td> | |
2527 </tr><tr class=""> | |
2528 <th scope="row">mass_list</th> | |
2529 <td>true</td> | |
2530 <td></td> | |
2531 <td></td> | |
2532 <td></td> | |
2533 </tr><tr class=""> | |
2534 <th scope="row">mass_choice</th> | |
2535 <td>true</td> | |
2536 <td></td> | |
2537 <td></td> | |
2538 <td></td> | |
2539 </tr><tr class=""> | |
2540 <th scope="row">mass_threshold</th> | |
2541 <td>0.005</td> | |
2542 <td></td> | |
2543 <td></td> | |
2544 <td></td> | |
2545 </tr><tr class=""> | |
2546 <th scope="row">repres_opt_selector</th> | |
2547 <td>intensity</td> | |
2548 <td></td> | |
2549 <td></td> | |
2550 <td></td> | |
2551 </tr><tr class=""> | |
2552 <th scope="row">rt_choice</th> | |
2553 <td>true</td> | |
2554 <td></td> | |
2555 <td></td> | |
2556 <td></td> | |
2557 </tr><tr class=""> | |
2558 <th scope="row">rt_threshold</th> | |
2559 <td>0.1</td> | |
2560 <td></td> | |
2561 <td></td> | |
2562 <td></td> | |
2563 </tr><tr class=""> | |
2564 <th scope="row">variableMetadata_in</th> | |
2565 <td>7cf499d16bd542b2</td> | |
2566 <td>compounds_pos.txt</td> | |
2567 <td>tabular</td> | |
2568 <td>44</td> | |
2569 </tr> | |
2570 </table> | |
2571 </div> | |
2572 | |
2573 | |
2574 <div class="alert alert-success history_metadata_extractor_deleted"> | |
2575 <h2 | |
2576 class="history_metadata_extractor_h2" | |
2577 style="cursor: pointer" | |
2578 title="click to fold/unfold the table" | |
2579 > | |
2580 [DELETED] - Analytic_correlation_filtration - 2019-06-20 | |
2581 </h2> | |
2582 <p class="history_metadata_extractor_status"> | |
2583 Status: Ok (0) | |
2584 </p> | |
2585 <p class="history_metadata_extractor_glitter"></p> | |
2586 <table class=" | |
2587 table | |
2588 table-bordered | |
2589 table-dark | |
2590 table-striped | |
2591 table-hover | |
2592 d-block | |
2593 overflow-auto | |
2594 history_metadata_extractor_table | |
2595 "> | |
2596 <thead> | |
2597 <tr> | |
2598 <th scope="col"></th> | |
2599 <th scope="col">value</th> | |
2600 <th scope="col">name</th> | |
2601 <th scope="col">extension</th> | |
2602 <th scope="col">hid</th> | |
2603 </tr> | |
2604 </thead> | |
2605 <tr class=""> | |
2606 <th scope="row">correl_threshold</th> | |
2607 <td>0.9</td> | |
2608 <td></td> | |
2609 <td></td> | |
2610 <td></td> | |
2611 </tr><tr class=""> | |
2612 <th scope="row">dataMatrix_in</th> | |
2613 <td>7cf499d16bd542b2</td> | |
2614 <td>compounds_pos.txt</td> | |
2615 <td>tabular</td> | |
2616 <td>44</td> | |
2617 </tr><tr class=""> | |
2618 <th scope="row">file_in</th> | |
2619 <td>7cf499d16bd542b2</td> | |
2620 <td>compounds_pos.txt</td> | |
2621 <td>tabular</td> | |
2622 <td>44</td> | |
2623 </tr><tr class=""> | |
2624 <th scope="row">mass_file_in</th> | |
2625 <td>7cf499d16bd542b2</td> | |
2626 <td>compounds_pos.txt</td> | |
2627 <td>tabular</td> | |
2628 <td>44</td> | |
2629 </tr><tr class=""> | |
2630 <th scope="row">mass_list</th> | |
2631 <td>true</td> | |
2632 <td></td> | |
2633 <td></td> | |
2634 <td></td> | |
2635 </tr><tr class=""> | |
2636 <th scope="row">mass_choice</th> | |
2637 <td>true</td> | |
2638 <td></td> | |
2639 <td></td> | |
2640 <td></td> | |
2641 </tr><tr class=""> | |
2642 <th scope="row">mass_threshold</th> | |
2643 <td>0.005</td> | |
2644 <td></td> | |
2645 <td></td> | |
2646 <td></td> | |
2647 </tr><tr class=""> | |
2648 <th scope="row">repres_opt_selector</th> | |
2649 <td>intensity</td> | |
2650 <td></td> | |
2651 <td></td> | |
2652 <td></td> | |
2653 </tr><tr class=""> | |
2654 <th scope="row">rt_choice</th> | |
2655 <td>true</td> | |
2656 <td></td> | |
2657 <td></td> | |
2658 <td></td> | |
2659 </tr><tr class=""> | |
2660 <th scope="row">rt_threshold</th> | |
2661 <td>0.1</td> | |
2662 <td></td> | |
2663 <td></td> | |
2664 <td></td> | |
2665 </tr><tr class=""> | |
2666 <th scope="row">variableMetadata_in</th> | |
2667 <td>7cf499d16bd542b2</td> | |
2668 <td>compounds_pos.txt</td> | |
2669 <td>tabular</td> | |
2670 <td>44</td> | |
2671 </tr> | |
2672 </table> | |
2673 </div> | |
2674 | |
2675 | |
2676 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
2677 <h2 | |
2678 class="history_metadata_extractor_h2" | |
2679 style="cursor: pointer" | |
2680 title="click to fold/unfold the table" | |
2681 > | |
2682 [DELETED] - correlation_analysis - 1.0.1+galaxy0 | |
2683 </h2> | |
2684 <p class="history_metadata_extractor_status"> | |
2685 Status: Failed (1) | |
2686 </p> | |
2687 <p class="history_metadata_extractor_glitter"></p> | |
2688 <table class=" | |
2689 table | |
2690 table-bordered | |
2691 table-dark | |
2692 table-striped | |
2693 table-hover | |
2694 d-block | |
2695 overflow-auto | |
2696 history_metadata_extractor_table | |
2697 "> | |
2698 <thead> | |
2699 <tr> | |
2700 <th scope="col"></th> | |
2701 <th scope="col">value</th> | |
2702 <th scope="col">name</th> | |
2703 <th scope="col">extension</th> | |
2704 <th scope="col">hid</th> | |
2705 </tr> | |
2706 </thead> | |
2707 <tr class=""> | |
2708 <th scope="row">select_funtion</th> | |
2709 <td>sort_only</td> | |
2710 <td></td> | |
2711 <td></td> | |
2712 <td></td> | |
2713 </tr><tr class=""> | |
2714 <th scope="row">dataMatrix</th> | |
2715 <td>7cf499d16bd542b2</td> | |
2716 <td>compounds_pos.txt</td> | |
2717 <td>tabular</td> | |
2718 <td>44</td> | |
2719 </tr><tr class=""> | |
2720 <th scope="row">sampleMetadata</th> | |
2721 <td>7cf499d16bd542b2</td> | |
2722 <td>compounds_pos.txt</td> | |
2723 <td>tabular</td> | |
2724 <td>44</td> | |
2725 </tr><tr class=""> | |
2726 <th scope="row">select_input_type</th> | |
2727 <td>select_input_from_w4m</td> | |
2728 <td></td> | |
2729 <td></td> | |
2730 <td></td> | |
2731 </tr><tr class=""> | |
2732 <th scope="row">variableMetadata</th> | |
2733 <td>7cf499d16bd542b2</td> | |
2734 <td>compounds_pos.txt</td> | |
2735 <td>tabular</td> | |
2736 <td>44</td> | |
2737 </tr> | |
2738 </table> | |
2739 </div> | |
2740 | |
2741 | |
2742 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
2743 <h2 | |
2744 class="history_metadata_extractor_h2" | |
2745 style="cursor: pointer" | |
2746 title="click to fold/unfold the table" | |
2747 > | |
2748 [DELETED] - Multivariate - 2.4.0 | |
2749 </h2> | |
2750 <p class="history_metadata_extractor_status"> | |
2751 Status: Failed (1) | |
2752 </p> | |
2753 <p class="history_metadata_extractor_glitter"></p> | |
2754 <table class=" | |
2755 table | |
2756 table-bordered | |
2757 table-dark | |
2758 table-striped | |
2759 table-hover | |
2760 d-block | |
2761 overflow-auto | |
2762 history_metadata_extractor_table | |
2763 "> | |
2764 <thead> | |
2765 <tr> | |
2766 <th scope="col"></th> | |
2767 <th scope="col">value</th> | |
2768 <th scope="col">name</th> | |
2769 <th scope="col">extension</th> | |
2770 <th scope="col">hid</th> | |
2771 </tr> | |
2772 </thead> | |
2773 <tr class=""> | |
2774 <th scope="row">algorithm</th> | |
2775 <td>default</td> | |
2776 <td></td> | |
2777 <td></td> | |
2778 <td></td> | |
2779 </tr><tr class=""> | |
2780 <th scope="row">cross_validation_number</th> | |
2781 <td>7</td> | |
2782 <td></td> | |
2783 <td></td> | |
2784 <td></td> | |
2785 </tr><tr class=""> | |
2786 <th scope="row">log10L</th> | |
2787 <td>FALSE</td> | |
2788 <td></td> | |
2789 <td></td> | |
2790 <td></td> | |
2791 </tr><tr class=""> | |
2792 <th scope="row">permutation_number</th> | |
2793 <td>20</td> | |
2794 <td></td> | |
2795 <td></td> | |
2796 <td></td> | |
2797 </tr><tr class=""> | |
2798 <th scope="row">scaling</th> | |
2799 <td>standard</td> | |
2800 <td></td> | |
2801 <td></td> | |
2802 <td></td> | |
2803 </tr><tr class=""> | |
2804 <th scope="row">dataMatrix_in</th> | |
2805 <td>7cf499d16bd542b2</td> | |
2806 <td>compounds_pos.txt</td> | |
2807 <td>tabular</td> | |
2808 <td>44</td> | |
2809 </tr><tr class=""> | |
2810 <th scope="row">abcissa_parameter</th> | |
2811 <td>1</td> | |
2812 <td></td> | |
2813 <td></td> | |
2814 <td></td> | |
2815 </tr><tr class=""> | |
2816 <th scope="row">color_parameter</th> | |
2817 <td>None</td> | |
2818 <td></td> | |
2819 <td></td> | |
2820 <td></td> | |
2821 </tr><tr class=""> | |
2822 <th scope="row">ellipsis_component</th> | |
2823 <td>NA</td> | |
2824 <td></td> | |
2825 <td></td> | |
2826 <td></td> | |
2827 </tr><tr class=""> | |
2828 <th scope="row">graphic_type</th> | |
2829 <td>summary</td> | |
2830 <td></td> | |
2831 <td></td> | |
2832 <td></td> | |
2833 </tr><tr class=""> | |
2834 <th scope="row">labels_parameter</th> | |
2835 <td>None</td> | |
2836 <td></td> | |
2837 <td></td> | |
2838 <td></td> | |
2839 </tr><tr class=""> | |
2840 <th scope="row">magnify_text</th> | |
2841 <td>0.8</td> | |
2842 <td></td> | |
2843 <td></td> | |
2844 <td></td> | |
2845 </tr><tr class=""> | |
2846 <th scope="row">ordinate_parameter</th> | |
2847 <td>2</td> | |
2848 <td></td> | |
2849 <td></td> | |
2850 <td></td> | |
2851 </tr><tr class=""> | |
2852 <th scope="row">orthogonal_component_number</th> | |
2853 <td>0</td> | |
2854 <td></td> | |
2855 <td></td> | |
2856 <td></td> | |
2857 </tr><tr class=""> | |
2858 <th scope="row">predictive_component_number</th> | |
2859 <td>NA</td> | |
2860 <td></td> | |
2861 <td></td> | |
2862 <td></td> | |
2863 </tr><tr class=""> | |
2864 <th scope="row">response_component</th> | |
2865 <td>1</td> | |
2866 <td></td> | |
2867 <td></td> | |
2868 <td></td> | |
2869 </tr><tr class=""> | |
2870 <th scope="row">sampleMetadata_in</th> | |
2871 <td>7cf499d16bd542b2</td> | |
2872 <td>compounds_pos.txt</td> | |
2873 <td>tabular</td> | |
2874 <td>44</td> | |
2875 </tr><tr class=""> | |
2876 <th scope="row">save_rdata</th> | |
2877 <td>false</td> | |
2878 <td></td> | |
2879 <td></td> | |
2880 <td></td> | |
2881 </tr><tr class=""> | |
2882 <th scope="row">test_sample</th> | |
2883 <td>FALSE</td> | |
2884 <td></td> | |
2885 <td></td> | |
2886 <td></td> | |
2887 </tr><tr class=""> | |
2888 <th scope="row">variableMetadata_in</th> | |
2889 <td>7cf499d16bd542b2</td> | |
2890 <td>compounds_pos.txt</td> | |
2891 <td>tabular</td> | |
2892 <td>44</td> | |
2893 </tr> | |
2894 </table> | |
2895 </div> | |
2896 | |
2897 | |
2898 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
2899 <h2 | |
2900 class="history_metadata_extractor_h2" | |
2901 style="cursor: pointer" | |
2902 title="click to fold/unfold the table" | |
2903 > | |
2904 [DELETED] - Multivariate - 2.4.0 | |
2905 </h2> | |
2906 <p class="history_metadata_extractor_status"> | |
2907 Status: Failed (1) | |
2908 </p> | |
2909 <p class="history_metadata_extractor_glitter"></p> | |
2910 <table class=" | |
2911 table | |
2912 table-bordered | |
2913 table-dark | |
2914 table-striped | |
2915 table-hover | |
2916 d-block | |
2917 overflow-auto | |
2918 history_metadata_extractor_table | |
2919 "> | |
2920 <thead> | |
2921 <tr> | |
2922 <th scope="col"></th> | |
2923 <th scope="col">value</th> | |
2924 <th scope="col">name</th> | |
2925 <th scope="col">extension</th> | |
2926 <th scope="col">hid</th> | |
2927 </tr> | |
2928 </thead> | |
2929 <tr class=""> | |
2930 <th scope="row">algorithm</th> | |
2931 <td>default</td> | |
2932 <td></td> | |
2933 <td></td> | |
2934 <td></td> | |
2935 </tr><tr class=""> | |
2936 <th scope="row">cross_validation_number</th> | |
2937 <td>7</td> | |
2938 <td></td> | |
2939 <td></td> | |
2940 <td></td> | |
2941 </tr><tr class=""> | |
2942 <th scope="row">log10L</th> | |
2943 <td>FALSE</td> | |
2944 <td></td> | |
2945 <td></td> | |
2946 <td></td> | |
2947 </tr><tr class=""> | |
2948 <th scope="row">permutation_number</th> | |
2949 <td>20</td> | |
2950 <td></td> | |
2951 <td></td> | |
2952 <td></td> | |
2953 </tr><tr class=""> | |
2954 <th scope="row">scaling</th> | |
2955 <td>standard</td> | |
2956 <td></td> | |
2957 <td></td> | |
2958 <td></td> | |
2959 </tr><tr class=""> | |
2960 <th scope="row">dataMatrix_in</th> | |
2961 <td>7cf499d16bd542b2</td> | |
2962 <td>compounds_pos.txt</td> | |
2963 <td>tabular</td> | |
2964 <td>44</td> | |
2965 </tr><tr class=""> | |
2966 <th scope="row">abcissa_parameter</th> | |
2967 <td>1</td> | |
2968 <td></td> | |
2969 <td></td> | |
2970 <td></td> | |
2971 </tr><tr class=""> | |
2972 <th scope="row">color_parameter</th> | |
2973 <td>None</td> | |
2974 <td></td> | |
2975 <td></td> | |
2976 <td></td> | |
2977 </tr><tr class=""> | |
2978 <th scope="row">ellipsis_component</th> | |
2979 <td>NA</td> | |
2980 <td></td> | |
2981 <td></td> | |
2982 <td></td> | |
2983 </tr><tr class=""> | |
2984 <th scope="row">graphic_type</th> | |
2985 <td>summary</td> | |
2986 <td></td> | |
2987 <td></td> | |
2988 <td></td> | |
2989 </tr><tr class=""> | |
2990 <th scope="row">labels_parameter</th> | |
2991 <td>None</td> | |
2992 <td></td> | |
2993 <td></td> | |
2994 <td></td> | |
2995 </tr><tr class=""> | |
2996 <th scope="row">magnify_text</th> | |
2997 <td>0.8</td> | |
2998 <td></td> | |
2999 <td></td> | |
3000 <td></td> | |
3001 </tr><tr class=""> | |
3002 <th scope="row">ordinate_parameter</th> | |
3003 <td>2</td> | |
3004 <td></td> | |
3005 <td></td> | |
3006 <td></td> | |
3007 </tr><tr class=""> | |
3008 <th scope="row">orthogonal_component_number</th> | |
3009 <td>0</td> | |
3010 <td></td> | |
3011 <td></td> | |
3012 <td></td> | |
3013 </tr><tr class=""> | |
3014 <th scope="row">predictive_component_number</th> | |
3015 <td>NA</td> | |
3016 <td></td> | |
3017 <td></td> | |
3018 <td></td> | |
3019 </tr><tr class=""> | |
3020 <th scope="row">response_component</th> | |
3021 <td>1</td> | |
3022 <td></td> | |
3023 <td></td> | |
3024 <td></td> | |
3025 </tr><tr class=""> | |
3026 <th scope="row">sampleMetadata_in</th> | |
3027 <td>7cf499d16bd542b2</td> | |
3028 <td>compounds_pos.txt</td> | |
3029 <td>tabular</td> | |
3030 <td>44</td> | |
3031 </tr><tr class=""> | |
3032 <th scope="row">save_rdata</th> | |
3033 <td>false</td> | |
3034 <td></td> | |
3035 <td></td> | |
3036 <td></td> | |
3037 </tr><tr class=""> | |
3038 <th scope="row">test_sample</th> | |
3039 <td>FALSE</td> | |
3040 <td></td> | |
3041 <td></td> | |
3042 <td></td> | |
3043 </tr><tr class=""> | |
3044 <th scope="row">variableMetadata_in</th> | |
3045 <td>7cf499d16bd542b2</td> | |
3046 <td>compounds_pos.txt</td> | |
3047 <td>tabular</td> | |
3048 <td>44</td> | |
3049 </tr> | |
3050 </table> | |
3051 </div> | |
3052 | |
3053 | |
3054 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
3055 <h2 | |
3056 class="history_metadata_extractor_h2" | |
3057 style="cursor: pointer" | |
3058 title="click to fold/unfold the table" | |
3059 > | |
3060 [DELETED] - Multivariate - 2.4.0 | |
3061 </h2> | |
3062 <p class="history_metadata_extractor_status"> | |
3063 Status: Failed (1) | |
3064 </p> | |
3065 <p class="history_metadata_extractor_glitter"></p> | |
3066 <table class=" | |
3067 table | |
3068 table-bordered | |
3069 table-dark | |
3070 table-striped | |
3071 table-hover | |
3072 d-block | |
3073 overflow-auto | |
3074 history_metadata_extractor_table | |
3075 "> | |
3076 <thead> | |
3077 <tr> | |
3078 <th scope="col"></th> | |
3079 <th scope="col">value</th> | |
3080 <th scope="col">name</th> | |
3081 <th scope="col">extension</th> | |
3082 <th scope="col">hid</th> | |
3083 </tr> | |
3084 </thead> | |
3085 <tr class=""> | |
3086 <th scope="row">algorithm</th> | |
3087 <td>default</td> | |
3088 <td></td> | |
3089 <td></td> | |
3090 <td></td> | |
3091 </tr><tr class=""> | |
3092 <th scope="row">cross_validation_number</th> | |
3093 <td>7</td> | |
3094 <td></td> | |
3095 <td></td> | |
3096 <td></td> | |
3097 </tr><tr class=""> | |
3098 <th scope="row">log10L</th> | |
3099 <td>FALSE</td> | |
3100 <td></td> | |
3101 <td></td> | |
3102 <td></td> | |
3103 </tr><tr class=""> | |
3104 <th scope="row">permutation_number</th> | |
3105 <td>20</td> | |
3106 <td></td> | |
3107 <td></td> | |
3108 <td></td> | |
3109 </tr><tr class=""> | |
3110 <th scope="row">scaling</th> | |
3111 <td>standard</td> | |
3112 <td></td> | |
3113 <td></td> | |
3114 <td></td> | |
3115 </tr><tr class=""> | |
3116 <th scope="row">dataMatrix_in</th> | |
3117 <td>7cf499d16bd542b2</td> | |
3118 <td>compounds_pos.txt</td> | |
3119 <td>tabular</td> | |
3120 <td>44</td> | |
3121 </tr><tr class=""> | |
3122 <th scope="row">abcissa_parameter</th> | |
3123 <td>1</td> | |
3124 <td></td> | |
3125 <td></td> | |
3126 <td></td> | |
3127 </tr><tr class=""> | |
3128 <th scope="row">color_parameter</th> | |
3129 <td>None</td> | |
3130 <td></td> | |
3131 <td></td> | |
3132 <td></td> | |
3133 </tr><tr class=""> | |
3134 <th scope="row">ellipsis_component</th> | |
3135 <td>NA</td> | |
3136 <td></td> | |
3137 <td></td> | |
3138 <td></td> | |
3139 </tr><tr class=""> | |
3140 <th scope="row">graphic_type</th> | |
3141 <td>summary</td> | |
3142 <td></td> | |
3143 <td></td> | |
3144 <td></td> | |
3145 </tr><tr class=""> | |
3146 <th scope="row">labels_parameter</th> | |
3147 <td>None</td> | |
3148 <td></td> | |
3149 <td></td> | |
3150 <td></td> | |
3151 </tr><tr class=""> | |
3152 <th scope="row">magnify_text</th> | |
3153 <td>0.8</td> | |
3154 <td></td> | |
3155 <td></td> | |
3156 <td></td> | |
3157 </tr><tr class=""> | |
3158 <th scope="row">ordinate_parameter</th> | |
3159 <td>2</td> | |
3160 <td></td> | |
3161 <td></td> | |
3162 <td></td> | |
3163 </tr><tr class=""> | |
3164 <th scope="row">orthogonal_component_number</th> | |
3165 <td>0</td> | |
3166 <td></td> | |
3167 <td></td> | |
3168 <td></td> | |
3169 </tr><tr class=""> | |
3170 <th scope="row">predictive_component_number</th> | |
3171 <td>NA</td> | |
3172 <td></td> | |
3173 <td></td> | |
3174 <td></td> | |
3175 </tr><tr class=""> | |
3176 <th scope="row">response_component</th> | |
3177 <td>1</td> | |
3178 <td></td> | |
3179 <td></td> | |
3180 <td></td> | |
3181 </tr><tr class=""> | |
3182 <th scope="row">sampleMetadata_in</th> | |
3183 <td>7cf499d16bd542b2</td> | |
3184 <td>compounds_pos.txt</td> | |
3185 <td>tabular</td> | |
3186 <td>44</td> | |
3187 </tr><tr class=""> | |
3188 <th scope="row">save_rdata</th> | |
3189 <td>false</td> | |
3190 <td></td> | |
3191 <td></td> | |
3192 <td></td> | |
3193 </tr><tr class=""> | |
3194 <th scope="row">test_sample</th> | |
3195 <td>FALSE</td> | |
3196 <td></td> | |
3197 <td></td> | |
3198 <td></td> | |
3199 </tr><tr class=""> | |
3200 <th scope="row">variableMetadata_in</th> | |
3201 <td>7cf499d16bd542b2</td> | |
3202 <td>compounds_pos.txt</td> | |
3203 <td>tabular</td> | |
3204 <td>44</td> | |
3205 </tr> | |
3206 </table> | |
3207 </div> | |
3208 | |
3209 | |
3210 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
3211 <h2 | |
3212 class="history_metadata_extractor_h2" | |
3213 style="cursor: pointer" | |
3214 title="click to fold/unfold the table" | |
3215 > | |
3216 [DELETED] - Multivariate - 2.4.0 | |
3217 </h2> | |
3218 <p class="history_metadata_extractor_status"> | |
3219 Status: Failed (1) | |
3220 </p> | |
3221 <p class="history_metadata_extractor_glitter"></p> | |
3222 <table class=" | |
3223 table | |
3224 table-bordered | |
3225 table-dark | |
3226 table-striped | |
3227 table-hover | |
3228 d-block | |
3229 overflow-auto | |
3230 history_metadata_extractor_table | |
3231 "> | |
3232 <thead> | |
3233 <tr> | |
3234 <th scope="col"></th> | |
3235 <th scope="col">value</th> | |
3236 <th scope="col">name</th> | |
3237 <th scope="col">extension</th> | |
3238 <th scope="col">hid</th> | |
3239 </tr> | |
3240 </thead> | |
3241 <tr class=""> | |
3242 <th scope="row">algorithm</th> | |
3243 <td>default</td> | |
3244 <td></td> | |
3245 <td></td> | |
3246 <td></td> | |
3247 </tr><tr class=""> | |
3248 <th scope="row">cross_validation_number</th> | |
3249 <td>7</td> | |
3250 <td></td> | |
3251 <td></td> | |
3252 <td></td> | |
3253 </tr><tr class=""> | |
3254 <th scope="row">log10L</th> | |
3255 <td>FALSE</td> | |
3256 <td></td> | |
3257 <td></td> | |
3258 <td></td> | |
3259 </tr><tr class=""> | |
3260 <th scope="row">permutation_number</th> | |
3261 <td>20</td> | |
3262 <td></td> | |
3263 <td></td> | |
3264 <td></td> | |
3265 </tr><tr class=""> | |
3266 <th scope="row">scaling</th> | |
3267 <td>standard</td> | |
3268 <td></td> | |
3269 <td></td> | |
3270 <td></td> | |
3271 </tr><tr class=""> | |
3272 <th scope="row">dataMatrix_in</th> | |
3273 <td>7cf499d16bd542b2</td> | |
3274 <td>compounds_pos.txt</td> | |
3275 <td>tabular</td> | |
3276 <td>44</td> | |
3277 </tr><tr class=""> | |
3278 <th scope="row">abcissa_parameter</th> | |
3279 <td>1</td> | |
3280 <td></td> | |
3281 <td></td> | |
3282 <td></td> | |
3283 </tr><tr class=""> | |
3284 <th scope="row">color_parameter</th> | |
3285 <td>None</td> | |
3286 <td></td> | |
3287 <td></td> | |
3288 <td></td> | |
3289 </tr><tr class=""> | |
3290 <th scope="row">ellipsis_component</th> | |
3291 <td>NA</td> | |
3292 <td></td> | |
3293 <td></td> | |
3294 <td></td> | |
3295 </tr><tr class=""> | |
3296 <th scope="row">graphic_type</th> | |
3297 <td>summary</td> | |
3298 <td></td> | |
3299 <td></td> | |
3300 <td></td> | |
3301 </tr><tr class=""> | |
3302 <th scope="row">labels_parameter</th> | |
3303 <td>None</td> | |
3304 <td></td> | |
3305 <td></td> | |
3306 <td></td> | |
3307 </tr><tr class=""> | |
3308 <th scope="row">magnify_text</th> | |
3309 <td>0.8</td> | |
3310 <td></td> | |
3311 <td></td> | |
3312 <td></td> | |
3313 </tr><tr class=""> | |
3314 <th scope="row">ordinate_parameter</th> | |
3315 <td>2</td> | |
3316 <td></td> | |
3317 <td></td> | |
3318 <td></td> | |
3319 </tr><tr class=""> | |
3320 <th scope="row">orthogonal_component_number</th> | |
3321 <td>0</td> | |
3322 <td></td> | |
3323 <td></td> | |
3324 <td></td> | |
3325 </tr><tr class=""> | |
3326 <th scope="row">predictive_component_number</th> | |
3327 <td>NA</td> | |
3328 <td></td> | |
3329 <td></td> | |
3330 <td></td> | |
3331 </tr><tr class=""> | |
3332 <th scope="row">response_component</th> | |
3333 <td>1</td> | |
3334 <td></td> | |
3335 <td></td> | |
3336 <td></td> | |
3337 </tr><tr class=""> | |
3338 <th scope="row">sampleMetadata_in</th> | |
3339 <td>7cf499d16bd542b2</td> | |
3340 <td>compounds_pos.txt</td> | |
3341 <td>tabular</td> | |
3342 <td>44</td> | |
3343 </tr><tr class=""> | |
3344 <th scope="row">save_rdata</th> | |
3345 <td>false</td> | |
3346 <td></td> | |
3347 <td></td> | |
3348 <td></td> | |
3349 </tr><tr class=""> | |
3350 <th scope="row">test_sample</th> | |
3351 <td>FALSE</td> | |
3352 <td></td> | |
3353 <td></td> | |
3354 <td></td> | |
3355 </tr><tr class=""> | |
3356 <th scope="row">variableMetadata_in</th> | |
3357 <td>7cf499d16bd542b2</td> | |
3358 <td>compounds_pos.txt</td> | |
3359 <td>tabular</td> | |
3360 <td>44</td> | |
3361 </tr> | |
3362 </table> | |
3363 </div> | |
3364 | |
3365 | |
3366 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
3367 <h2 | |
3368 class="history_metadata_extractor_h2" | |
3369 style="cursor: pointer" | |
3370 title="click to fold/unfold the table" | |
3371 > | |
3372 [DELETED] - corrtable - 1.0.0 | |
3373 </h2> | |
3374 <p class="history_metadata_extractor_status"> | |
3375 Status: Failed (127) | |
3376 </p> | |
3377 <p class="history_metadata_extractor_glitter"></p> | |
3378 <table class=" | |
3379 table | |
3380 table-bordered | |
3381 table-dark | |
3382 table-striped | |
3383 table-hover | |
3384 d-block | |
3385 overflow-auto | |
3386 history_metadata_extractor_table | |
3387 "> | |
3388 <thead> | |
3389 <tr> | |
3390 <th scope="col"></th> | |
3391 <th scope="col">value</th> | |
3392 <th scope="col">name</th> | |
3393 <th scope="col">extension</th> | |
3394 <th scope="col">hid</th> | |
3395 </tr> | |
3396 </thead> | |
3397 <tr class=""> | |
3398 <th scope="row">corr_method</th> | |
3399 <td>pearson</td> | |
3400 <td></td> | |
3401 <td></td> | |
3402 <td></td> | |
3403 </tr><tr class=""> | |
3404 <th scope="row">filter</th> | |
3405 <td>no</td> | |
3406 <td></td> | |
3407 <td></td> | |
3408 <td></td> | |
3409 </tr><tr class=""> | |
3410 <th scope="row">test_corr</th> | |
3411 <td>no</td> | |
3412 <td></td> | |
3413 <td></td> | |
3414 <td></td> | |
3415 </tr><tr class=""> | |
3416 <th scope="row">color_heatmap</th> | |
3417 <td>no</td> | |
3418 <td></td> | |
3419 <td></td> | |
3420 <td></td> | |
3421 </tr><tr class=""> | |
3422 <th scope="row">plot_choice</th> | |
3423 <td>auto</td> | |
3424 <td></td> | |
3425 <td></td> | |
3426 <td></td> | |
3427 </tr><tr class=""> | |
3428 <th scope="row">reorder_var</th> | |
3429 <td>no</td> | |
3430 <td></td> | |
3431 <td></td> | |
3432 <td></td> | |
3433 </tr><tr class=""> | |
3434 <th scope="row">tab1_in</th> | |
3435 <td>7cf499d16bd542b2</td> | |
3436 <td>compounds_pos.txt</td> | |
3437 <td>tabular</td> | |
3438 <td>44</td> | |
3439 </tr><tr class=""> | |
3440 <th scope="row">tab1_samples</th> | |
3441 <td>row</td> | |
3442 <td></td> | |
3443 <td></td> | |
3444 <td></td> | |
3445 </tr><tr class=""> | |
3446 <th scope="row">tab2_in</th> | |
3447 <td>7cf499d16bd542b2</td> | |
3448 <td>compounds_pos.txt</td> | |
3449 <td>tabular</td> | |
3450 <td>44</td> | |
3451 </tr><tr class=""> | |
3452 <th scope="row">tab2_samples</th> | |
3453 <td>row</td> | |
3454 <td></td> | |
3455 <td></td> | |
3456 <td></td> | |
3457 </tr> | |
3458 </table> | |
3459 </div> | |
3460 | |
3461 | |
3462 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
3463 <h2 | |
3464 class="history_metadata_extractor_h2" | |
3465 style="cursor: pointer" | |
3466 title="click to fold/unfold the table" | |
3467 > | |
3468 [DELETED] - corrtable - 1.0.0 | |
3469 </h2> | |
3470 <p class="history_metadata_extractor_status"> | |
3471 Status: Failed (127) | |
3472 </p> | |
3473 <p class="history_metadata_extractor_glitter"></p> | |
3474 <table class=" | |
3475 table | |
3476 table-bordered | |
3477 table-dark | |
3478 table-striped | |
3479 table-hover | |
3480 d-block | |
3481 overflow-auto | |
3482 history_metadata_extractor_table | |
3483 "> | |
3484 <thead> | |
3485 <tr> | |
3486 <th scope="col"></th> | |
3487 <th scope="col">value</th> | |
3488 <th scope="col">name</th> | |
3489 <th scope="col">extension</th> | |
3490 <th scope="col">hid</th> | |
3491 </tr> | |
3492 </thead> | |
3493 <tr class=""> | |
3494 <th scope="row">corr_method</th> | |
3495 <td>pearson</td> | |
3496 <td></td> | |
3497 <td></td> | |
3498 <td></td> | |
3499 </tr><tr class=""> | |
3500 <th scope="row">filter</th> | |
3501 <td>no</td> | |
3502 <td></td> | |
3503 <td></td> | |
3504 <td></td> | |
3505 </tr><tr class=""> | |
3506 <th scope="row">test_corr</th> | |
3507 <td>no</td> | |
3508 <td></td> | |
3509 <td></td> | |
3510 <td></td> | |
3511 </tr><tr class=""> | |
3512 <th scope="row">color_heatmap</th> | |
3513 <td>no</td> | |
3514 <td></td> | |
3515 <td></td> | |
3516 <td></td> | |
3517 </tr><tr class=""> | |
3518 <th scope="row">plot_choice</th> | |
3519 <td>auto</td> | |
3520 <td></td> | |
3521 <td></td> | |
3522 <td></td> | |
3523 </tr><tr class=""> | |
3524 <th scope="row">reorder_var</th> | |
3525 <td>no</td> | |
3526 <td></td> | |
3527 <td></td> | |
3528 <td></td> | |
3529 </tr><tr class=""> | |
3530 <th scope="row">tab1_in</th> | |
3531 <td>7cf499d16bd542b2</td> | |
3532 <td>compounds_pos.txt</td> | |
3533 <td>tabular</td> | |
3534 <td>44</td> | |
3535 </tr><tr class=""> | |
3536 <th scope="row">tab1_samples</th> | |
3537 <td>row</td> | |
3538 <td></td> | |
3539 <td></td> | |
3540 <td></td> | |
3541 </tr><tr class=""> | |
3542 <th scope="row">tab2_in</th> | |
3543 <td>7cf499d16bd542b2</td> | |
3544 <td>compounds_pos.txt</td> | |
3545 <td>tabular</td> | |
3546 <td>44</td> | |
3547 </tr><tr class=""> | |
3548 <th scope="row">tab2_samples</th> | |
3549 <td>row</td> | |
3550 <td></td> | |
3551 <td></td> | |
3552 <td></td> | |
3553 </tr> | |
3554 </table> | |
3555 </div> | |
3556 | |
3557 | |
3558 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
3559 <h2 | |
3560 class="history_metadata_extractor_h2" | |
3561 style="cursor: pointer" | |
3562 title="click to fold/unfold the table" | |
3563 > | |
3564 [DELETED] - abims_CAMERA_annotateDiffreport - 2.2.6+camera1.48.0-galaxy0 | |
3565 </h2> | |
3566 <p class="history_metadata_extractor_status"> | |
3567 Status: Failed (127) | |
3568 </p> | |
3569 <p class="history_metadata_extractor_glitter"></p> | |
3570 <table class=" | |
3571 table | |
3572 table-bordered | |
3573 table-dark | |
3574 table-striped | |
3575 table-hover | |
3576 d-block | |
3577 overflow-auto | |
3578 history_metadata_extractor_table | |
3579 "> | |
3580 <thead> | |
3581 <tr> | |
3582 <th scope="col"></th> | |
3583 <th scope="col">value</th> | |
3584 <th scope="col">name</th> | |
3585 <th scope="col">extension</th> | |
3586 <th scope="col">hid</th> | |
3587 </tr> | |
3588 </thead> | |
3589 <tr class=""> | |
3590 <th scope="row">option</th> | |
3591 <td>hide</td> | |
3592 <td></td> | |
3593 <td></td> | |
3594 <td></td> | |
3595 </tr><tr class=""> | |
3596 <th scope="row">convertRTMinute</th> | |
3597 <td>false</td> | |
3598 <td></td> | |
3599 <td></td> | |
3600 <td></td> | |
3601 </tr><tr class=""> | |
3602 <th scope="row">intval</th> | |
3603 <td>into</td> | |
3604 <td></td> | |
3605 <td></td> | |
3606 <td></td> | |
3607 </tr><tr class=""> | |
3608 <th scope="row">numDigitsMZ</th> | |
3609 <td>4</td> | |
3610 <td></td> | |
3611 <td></td> | |
3612 <td></td> | |
3613 </tr><tr class=""> | |
3614 <th scope="row">numDigitsRT</th> | |
3615 <td>0</td> | |
3616 <td></td> | |
3617 <td></td> | |
3618 <td></td> | |
3619 </tr><tr class=""> | |
3620 <th scope="row">file_load_select</th> | |
3621 <td>no</td> | |
3622 <td></td> | |
3623 <td></td> | |
3624 <td></td> | |
3625 </tr><tr class=""> | |
3626 <th scope="row">mzabs</th> | |
3627 <td>0.015</td> | |
3628 <td></td> | |
3629 <td></td> | |
3630 <td></td> | |
3631 </tr><tr class=""> | |
3632 <th scope="row">ppm</th> | |
3633 <td>5</td> | |
3634 <td></td> | |
3635 <td></td> | |
3636 <td></td> | |
3637 </tr><tr class=""> | |
3638 <th scope="row">maxcharge</th> | |
3639 <td>3</td> | |
3640 <td></td> | |
3641 <td></td> | |
3642 <td></td> | |
3643 </tr><tr class=""> | |
3644 <th scope="row">maxiso</th> | |
3645 <td>4</td> | |
3646 <td></td> | |
3647 <td></td> | |
3648 <td></td> | |
3649 </tr><tr class=""> | |
3650 <th scope="row">minfrac</th> | |
3651 <td>0.5</td> | |
3652 <td></td> | |
3653 <td></td> | |
3654 <td></td> | |
3655 </tr><tr class=""> | |
3656 <th scope="row">perfwhm</th> | |
3657 <td>0.6</td> | |
3658 <td></td> | |
3659 <td></td> | |
3660 <td></td> | |
3661 </tr><tr class=""> | |
3662 <th scope="row">sigma</th> | |
3663 <td>6</td> | |
3664 <td></td> | |
3665 <td></td> | |
3666 <td></td> | |
3667 </tr><tr class=""> | |
3668 <th scope="row">image</th> | |
3669 <td>9e77b3d7d0887128</td> | |
3670 <td>test.rdata</td> | |
3671 <td>rdata</td> | |
3672 <td>1</td> | |
3673 </tr><tr class=""> | |
3674 <th scope="row">max_peaks</th> | |
3675 <td>100</td> | |
3676 <td></td> | |
3677 <td></td> | |
3678 <td></td> | |
3679 </tr><tr class=""> | |
3680 <th scope="row">polarity</th> | |
3681 <td>negative</td> | |
3682 <td></td> | |
3683 <td></td> | |
3684 <td></td> | |
3685 </tr><tr class=""> | |
3686 <th scope="row">multiplier</th> | |
3687 <td>3</td> | |
3688 <td></td> | |
3689 <td></td> | |
3690 <td></td> | |
3691 </tr><tr class=""> | |
3692 <th scope="row">rules_select</th> | |
3693 <td>FALSE</td> | |
3694 <td></td> | |
3695 <td></td> | |
3696 <td></td> | |
3697 </tr><tr class=""> | |
3698 <th scope="row">calcCaS</th> | |
3699 <td>false</td> | |
3700 <td></td> | |
3701 <td></td> | |
3702 <td></td> | |
3703 </tr><tr class=""> | |
3704 <th scope="row">calcCiS</th> | |
3705 <td>true</td> | |
3706 <td></td> | |
3707 <td></td> | |
3708 <td></td> | |
3709 </tr><tr class=""> | |
3710 <th scope="row">calcIso</th> | |
3711 <td>false</td> | |
3712 <td></td> | |
3713 <td></td> | |
3714 <td></td> | |
3715 </tr><tr class=""> | |
3716 <th scope="row">cor_eic_th</th> | |
3717 <td>0.75</td> | |
3718 <td></td> | |
3719 <td></td> | |
3720 <td></td> | |
3721 </tr><tr class=""> | |
3722 <th scope="row">graphMethod</th> | |
3723 <td>hcs</td> | |
3724 <td></td> | |
3725 <td></td> | |
3726 <td></td> | |
3727 </tr><tr class=""> | |
3728 <th scope="row">pval</th> | |
3729 <td>0.05</td> | |
3730 <td></td> | |
3731 <td></td> | |
3732 <td></td> | |
3733 </tr><tr class=""> | |
3734 <th scope="row">quick</th> | |
3735 <td>FALSE</td> | |
3736 <td></td> | |
3737 <td></td> | |
3738 <td></td> | |
3739 </tr> | |
3740 </table> | |
3741 </div> | |
3742 | |
3743 | |
3744 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
3745 <h2 | |
3746 class="history_metadata_extractor_h2" | |
3747 style="cursor: pointer" | |
3748 title="click to fold/unfold the table" | |
3749 > | |
3750 [DELETED] - abims_CAMERA_annotateDiffreport - 2.2.6+camera1.48.0-galaxy0 | |
3751 </h2> | |
3752 <p class="history_metadata_extractor_status"> | |
3753 Status: Failed (127) | |
3754 </p> | |
3755 <p class="history_metadata_extractor_glitter"></p> | |
3756 <table class=" | |
3757 table | |
3758 table-bordered | |
3759 table-dark | |
3760 table-striped | |
3761 table-hover | |
3762 d-block | |
3763 overflow-auto | |
3764 history_metadata_extractor_table | |
3765 "> | |
3766 <thead> | |
3767 <tr> | |
3768 <th scope="col"></th> | |
3769 <th scope="col">value</th> | |
3770 <th scope="col">name</th> | |
3771 <th scope="col">extension</th> | |
3772 <th scope="col">hid</th> | |
3773 </tr> | |
3774 </thead> | |
3775 <tr class=""> | |
3776 <th scope="row">option</th> | |
3777 <td>hide</td> | |
3778 <td></td> | |
3779 <td></td> | |
3780 <td></td> | |
3781 </tr><tr class=""> | |
3782 <th scope="row">convertRTMinute</th> | |
3783 <td>false</td> | |
3784 <td></td> | |
3785 <td></td> | |
3786 <td></td> | |
3787 </tr><tr class=""> | |
3788 <th scope="row">intval</th> | |
3789 <td>into</td> | |
3790 <td></td> | |
3791 <td></td> | |
3792 <td></td> | |
3793 </tr><tr class=""> | |
3794 <th scope="row">numDigitsMZ</th> | |
3795 <td>4</td> | |
3796 <td></td> | |
3797 <td></td> | |
3798 <td></td> | |
3799 </tr><tr class=""> | |
3800 <th scope="row">numDigitsRT</th> | |
3801 <td>0</td> | |
3802 <td></td> | |
3803 <td></td> | |
3804 <td></td> | |
3805 </tr><tr class=""> | |
3806 <th scope="row">file_load_select</th> | |
3807 <td>no</td> | |
3808 <td></td> | |
3809 <td></td> | |
3810 <td></td> | |
3811 </tr><tr class=""> | |
3812 <th scope="row">mzabs</th> | |
3813 <td>0.015</td> | |
3814 <td></td> | |
3815 <td></td> | |
3816 <td></td> | |
3817 </tr><tr class=""> | |
3818 <th scope="row">ppm</th> | |
3819 <td>5</td> | |
3820 <td></td> | |
3821 <td></td> | |
3822 <td></td> | |
3823 </tr><tr class=""> | |
3824 <th scope="row">maxcharge</th> | |
3825 <td>3</td> | |
3826 <td></td> | |
3827 <td></td> | |
3828 <td></td> | |
3829 </tr><tr class=""> | |
3830 <th scope="row">maxiso</th> | |
3831 <td>4</td> | |
3832 <td></td> | |
3833 <td></td> | |
3834 <td></td> | |
3835 </tr><tr class=""> | |
3836 <th scope="row">minfrac</th> | |
3837 <td>0.5</td> | |
3838 <td></td> | |
3839 <td></td> | |
3840 <td></td> | |
3841 </tr><tr class=""> | |
3842 <th scope="row">perfwhm</th> | |
3843 <td>0.6</td> | |
3844 <td></td> | |
3845 <td></td> | |
3846 <td></td> | |
3847 </tr><tr class=""> | |
3848 <th scope="row">sigma</th> | |
3849 <td>6</td> | |
3850 <td></td> | |
3851 <td></td> | |
3852 <td></td> | |
3853 </tr><tr class=""> | |
3854 <th scope="row">image</th> | |
3855 <td>9e77b3d7d0887128</td> | |
3856 <td>test.rdata</td> | |
3857 <td>rdata</td> | |
3858 <td>1</td> | |
3859 </tr><tr class=""> | |
3860 <th scope="row">max_peaks</th> | |
3861 <td>100</td> | |
3862 <td></td> | |
3863 <td></td> | |
3864 <td></td> | |
3865 </tr><tr class=""> | |
3866 <th scope="row">polarity</th> | |
3867 <td>negative</td> | |
3868 <td></td> | |
3869 <td></td> | |
3870 <td></td> | |
3871 </tr><tr class=""> | |
3872 <th scope="row">multiplier</th> | |
3873 <td>3</td> | |
3874 <td></td> | |
3875 <td></td> | |
3876 <td></td> | |
3877 </tr><tr class=""> | |
3878 <th scope="row">rules_select</th> | |
3879 <td>FALSE</td> | |
3880 <td></td> | |
3881 <td></td> | |
3882 <td></td> | |
3883 </tr><tr class=""> | |
3884 <th scope="row">calcCaS</th> | |
3885 <td>false</td> | |
3886 <td></td> | |
3887 <td></td> | |
3888 <td></td> | |
3889 </tr><tr class=""> | |
3890 <th scope="row">calcCiS</th> | |
3891 <td>true</td> | |
3892 <td></td> | |
3893 <td></td> | |
3894 <td></td> | |
3895 </tr><tr class=""> | |
3896 <th scope="row">calcIso</th> | |
3897 <td>false</td> | |
3898 <td></td> | |
3899 <td></td> | |
3900 <td></td> | |
3901 </tr><tr class=""> | |
3902 <th scope="row">cor_eic_th</th> | |
3903 <td>0.75</td> | |
3904 <td></td> | |
3905 <td></td> | |
3906 <td></td> | |
3907 </tr><tr class=""> | |
3908 <th scope="row">graphMethod</th> | |
3909 <td>hcs</td> | |
3910 <td></td> | |
3911 <td></td> | |
3912 <td></td> | |
3913 </tr><tr class=""> | |
3914 <th scope="row">pval</th> | |
3915 <td>0.05</td> | |
3916 <td></td> | |
3917 <td></td> | |
3918 <td></td> | |
3919 </tr><tr class=""> | |
3920 <th scope="row">quick</th> | |
3921 <td>FALSE</td> | |
3922 <td></td> | |
3923 <td></td> | |
3924 <td></td> | |
3925 </tr> | |
3926 </table> | |
3927 </div> | |
3928 | |
3929 | |
3930 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
3931 <h2 | |
3932 class="history_metadata_extractor_h2" | |
3933 style="cursor: pointer" | |
3934 title="click to fold/unfold the table" | |
3935 > | |
3936 [DELETED] - abims_xcms_retcor - 3.12.0+galaxy0 | |
3937 </h2> | |
3938 <p class="history_metadata_extractor_status"> | |
3939 Status: Failed (1) | |
3940 </p> | |
3941 <p class="history_metadata_extractor_glitter"></p> | |
3942 <table class=" | |
3943 table | |
3944 table-bordered | |
3945 table-dark | |
3946 table-striped | |
3947 table-hover | |
3948 d-block | |
3949 overflow-auto | |
3950 history_metadata_extractor_table | |
3951 "> | |
3952 <thead> | |
3953 <tr> | |
3954 <th scope="col"></th> | |
3955 <th scope="col">value</th> | |
3956 <th scope="col">name</th> | |
3957 <th scope="col">extension</th> | |
3958 <th scope="col">hid</th> | |
3959 </tr> | |
3960 </thead> | |
3961 <tr class=""> | |
3962 <th scope="row">file_load_select</th> | |
3963 <td>no</td> | |
3964 <td></td> | |
3965 <td></td> | |
3966 <td></td> | |
3967 </tr><tr class=""> | |
3968 <th scope="row">image</th> | |
3969 <td>9e77b3d7d0887128</td> | |
3970 <td>test.rdata</td> | |
3971 <td>rdata</td> | |
3972 <td>1</td> | |
3973 </tr><tr class=""> | |
3974 <th scope="row">extraPeaks</th> | |
3975 <td>1</td> | |
3976 <td></td> | |
3977 <td></td> | |
3978 <td></td> | |
3979 </tr><tr class=""> | |
3980 <th scope="row">method</th> | |
3981 <td>PeakGroups</td> | |
3982 <td></td> | |
3983 <td></td> | |
3984 <td></td> | |
3985 </tr><tr class=""> | |
3986 <th scope="row">minFraction</th> | |
3987 <td>0.9</td> | |
3988 <td></td> | |
3989 <td></td> | |
3990 <td></td> | |
3991 </tr><tr class=""> | |
3992 <th scope="row">family</th> | |
3993 <td>gaussian</td> | |
3994 <td></td> | |
3995 <td></td> | |
3996 <td></td> | |
3997 </tr><tr class=""> | |
3998 <th scope="row">span</th> | |
3999 <td>0.2</td> | |
4000 <td></td> | |
4001 <td></td> | |
4002 <td></td> | |
4003 </tr><tr class=""> | |
4004 <th scope="row">smooth</th> | |
4005 <td>loess</td> | |
4006 <td></td> | |
4007 <td></td> | |
4008 <td></td> | |
4009 </tr> | |
4010 </table> | |
4011 </div> | |
4012 | |
4013 | |
4014 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
4015 <h2 | |
4016 class="history_metadata_extractor_h2" | |
4017 style="cursor: pointer" | |
4018 title="click to fold/unfold the table" | |
4019 > | |
4020 [DELETED] - abims_xcms_retcor - 3.12.0+galaxy0 | |
4021 </h2> | |
4022 <p class="history_metadata_extractor_status"> | |
4023 Status: Failed (1) | |
4024 </p> | |
4025 <p class="history_metadata_extractor_glitter"></p> | |
4026 <table class=" | |
4027 table | |
4028 table-bordered | |
4029 table-dark | |
4030 table-striped | |
4031 table-hover | |
4032 d-block | |
4033 overflow-auto | |
4034 history_metadata_extractor_table | |
4035 "> | |
4036 <thead> | |
4037 <tr> | |
4038 <th scope="col"></th> | |
4039 <th scope="col">value</th> | |
4040 <th scope="col">name</th> | |
4041 <th scope="col">extension</th> | |
4042 <th scope="col">hid</th> | |
4043 </tr> | |
4044 </thead> | |
4045 <tr class=""> | |
4046 <th scope="row">file_load_select</th> | |
4047 <td>no</td> | |
4048 <td></td> | |
4049 <td></td> | |
4050 <td></td> | |
4051 </tr><tr class=""> | |
4052 <th scope="row">image</th> | |
4053 <td>9e77b3d7d0887128</td> | |
4054 <td>test.rdata</td> | |
4055 <td>rdata</td> | |
4056 <td>1</td> | |
4057 </tr><tr class=""> | |
4058 <th scope="row">extraPeaks</th> | |
4059 <td>1</td> | |
4060 <td></td> | |
4061 <td></td> | |
4062 <td></td> | |
4063 </tr><tr class=""> | |
4064 <th scope="row">method</th> | |
4065 <td>PeakGroups</td> | |
4066 <td></td> | |
4067 <td></td> | |
4068 <td></td> | |
4069 </tr><tr class=""> | |
4070 <th scope="row">minFraction</th> | |
4071 <td>0.9</td> | |
4072 <td></td> | |
4073 <td></td> | |
4074 <td></td> | |
4075 </tr><tr class=""> | |
4076 <th scope="row">family</th> | |
4077 <td>gaussian</td> | |
4078 <td></td> | |
4079 <td></td> | |
4080 <td></td> | |
4081 </tr><tr class=""> | |
4082 <th scope="row">span</th> | |
4083 <td>0.2</td> | |
4084 <td></td> | |
4085 <td></td> | |
4086 <td></td> | |
4087 </tr><tr class=""> | |
4088 <th scope="row">smooth</th> | |
4089 <td>loess</td> | |
4090 <td></td> | |
4091 <td></td> | |
4092 <td></td> | |
4093 </tr> | |
4094 </table> | |
4095 </div> | |
4096 | |
4097 | |
4098 <div class="alert alert-success history_metadata_extractor_deleted"> | |
4099 <h2 | |
4100 class="history_metadata_extractor_h2" | |
4101 style="cursor: pointer" | |
4102 title="click to fold/unfold the table" | |
4103 > | |
4104 [DELETED] - abims_xcms_summary - 3.12.0+galaxy0 | |
4105 </h2> | |
4106 <p class="history_metadata_extractor_status"> | |
4107 Status: Ok (0) | |
4108 </p> | |
4109 <p class="history_metadata_extractor_glitter"></p> | |
4110 <table class=" | |
4111 table | |
4112 table-bordered | |
4113 table-dark | |
4114 table-striped | |
4115 table-hover | |
4116 d-block | |
4117 overflow-auto | |
4118 history_metadata_extractor_table | |
4119 "> | |
4120 <thead> | |
4121 <tr> | |
4122 <th scope="col"></th> | |
4123 <th scope="col">value</th> | |
4124 <th scope="col">name</th> | |
4125 <th scope="col">extension</th> | |
4126 <th scope="col">hid</th> | |
4127 </tr> | |
4128 </thead> | |
4129 <tr class=""> | |
4130 <th scope="row">image</th> | |
4131 <td>9e77b3d7d0887128</td> | |
4132 <td>test.rdata</td> | |
4133 <td>rdata</td> | |
4134 <td>1</td> | |
4135 </tr> | |
4136 </table> | |
4137 </div> | |
4138 | |
4139 | |
4140 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
4141 <h2 | |
4142 class="history_metadata_extractor_h2" | |
4143 style="cursor: pointer" | |
4144 title="click to fold/unfold the table" | |
4145 > | |
4146 [DELETED] - abims_xcms_group - 3.12.0+galaxy0 | |
4147 </h2> | |
4148 <p class="history_metadata_extractor_status"> | |
4149 Status: Failed (1) | |
4150 </p> | |
4151 <p class="history_metadata_extractor_glitter"></p> | |
4152 <table class=" | |
4153 table | |
4154 table-bordered | |
4155 table-dark | |
4156 table-striped | |
4157 table-hover | |
4158 d-block | |
4159 overflow-auto | |
4160 history_metadata_extractor_table | |
4161 "> | |
4162 <thead> | |
4163 <tr> | |
4164 <th scope="col"></th> | |
4165 <th scope="col">value</th> | |
4166 <th scope="col">name</th> | |
4167 <th scope="col">extension</th> | |
4168 <th scope="col">hid</th> | |
4169 </tr> | |
4170 </thead> | |
4171 <tr class=""> | |
4172 <th scope="row">file_load_select</th> | |
4173 <td>no</td> | |
4174 <td></td> | |
4175 <td></td> | |
4176 <td></td> | |
4177 </tr><tr class=""> | |
4178 <th scope="row">image</th> | |
4179 <td>9e77b3d7d0887128</td> | |
4180 <td>test.rdata</td> | |
4181 <td>rdata</td> | |
4182 <td>1</td> | |
4183 </tr><tr class=""> | |
4184 <th scope="row">maxFeatures</th> | |
4185 <td>50</td> | |
4186 <td></td> | |
4187 <td></td> | |
4188 <td></td> | |
4189 </tr><tr class=""> | |
4190 <th scope="row">binSize</th> | |
4191 <td>0.25</td> | |
4192 <td></td> | |
4193 <td></td> | |
4194 <td></td> | |
4195 </tr><tr class=""> | |
4196 <th scope="row">bw</th> | |
4197 <td>30.0</td> | |
4198 <td></td> | |
4199 <td></td> | |
4200 <td></td> | |
4201 </tr><tr class=""> | |
4202 <th scope="row">method</th> | |
4203 <td>PeakDensity</td> | |
4204 <td></td> | |
4205 <td></td> | |
4206 <td></td> | |
4207 </tr><tr class=""> | |
4208 <th scope="row">minFraction</th> | |
4209 <td>0.5</td> | |
4210 <td></td> | |
4211 <td></td> | |
4212 <td></td> | |
4213 </tr><tr class=""> | |
4214 <th scope="row">minSamples</th> | |
4215 <td>1</td> | |
4216 <td></td> | |
4217 <td></td> | |
4218 <td></td> | |
4219 </tr><tr class=""> | |
4220 <th scope="row">peaklistBool</th> | |
4221 <td>false</td> | |
4222 <td></td> | |
4223 <td></td> | |
4224 <td></td> | |
4225 </tr> | |
4226 </table> | |
4227 </div> | |
4228 | |
4229 | |
4230 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
4231 <h2 | |
4232 class="history_metadata_extractor_h2" | |
4233 style="cursor: pointer" | |
4234 title="click to fold/unfold the table" | |
4235 > | |
4236 [DELETED] - abims_xcms_group - 3.12.0+galaxy0 | |
4237 </h2> | |
4238 <p class="history_metadata_extractor_status"> | |
4239 Status: Failed (1) | |
4240 </p> | |
4241 <p class="history_metadata_extractor_glitter"></p> | |
4242 <table class=" | |
4243 table | |
4244 table-bordered | |
4245 table-dark | |
4246 table-striped | |
4247 table-hover | |
4248 d-block | |
4249 overflow-auto | |
4250 history_metadata_extractor_table | |
4251 "> | |
4252 <thead> | |
4253 <tr> | |
4254 <th scope="col"></th> | |
4255 <th scope="col">value</th> | |
4256 <th scope="col">name</th> | |
4257 <th scope="col">extension</th> | |
4258 <th scope="col">hid</th> | |
4259 </tr> | |
4260 </thead> | |
4261 <tr class=""> | |
4262 <th scope="row">file_load_select</th> | |
4263 <td>no</td> | |
4264 <td></td> | |
4265 <td></td> | |
4266 <td></td> | |
4267 </tr><tr class=""> | |
4268 <th scope="row">image</th> | |
4269 <td>9e77b3d7d0887128</td> | |
4270 <td>test.rdata</td> | |
4271 <td>rdata</td> | |
4272 <td>1</td> | |
4273 </tr><tr class=""> | |
4274 <th scope="row">maxFeatures</th> | |
4275 <td>50</td> | |
4276 <td></td> | |
4277 <td></td> | |
4278 <td></td> | |
4279 </tr><tr class=""> | |
4280 <th scope="row">binSize</th> | |
4281 <td>0.25</td> | |
4282 <td></td> | |
4283 <td></td> | |
4284 <td></td> | |
4285 </tr><tr class=""> | |
4286 <th scope="row">bw</th> | |
4287 <td>30.0</td> | |
4288 <td></td> | |
4289 <td></td> | |
4290 <td></td> | |
4291 </tr><tr class=""> | |
4292 <th scope="row">method</th> | |
4293 <td>PeakDensity</td> | |
4294 <td></td> | |
4295 <td></td> | |
4296 <td></td> | |
4297 </tr><tr class=""> | |
4298 <th scope="row">minFraction</th> | |
4299 <td>0.5</td> | |
4300 <td></td> | |
4301 <td></td> | |
4302 <td></td> | |
4303 </tr><tr class=""> | |
4304 <th scope="row">minSamples</th> | |
4305 <td>1</td> | |
4306 <td></td> | |
4307 <td></td> | |
4308 <td></td> | |
4309 </tr><tr class=""> | |
4310 <th scope="row">peaklistBool</th> | |
4311 <td>false</td> | |
4312 <td></td> | |
4313 <td></td> | |
4314 <td></td> | |
4315 </tr> | |
4316 </table> | |
4317 </div> | |
4318 | |
4319 | |
4320 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
4321 <h2 | |
4322 class="history_metadata_extractor_h2" | |
4323 style="cursor: pointer" | |
4324 title="click to fold/unfold the table" | |
4325 > | |
4326 [DELETED] - xcms_merge - 3.12.0+galaxy0 | |
4327 </h2> | |
4328 <p class="history_metadata_extractor_status"> | |
4329 Status: Failed (1) | |
4330 </p> | |
4331 <p class="history_metadata_extractor_glitter"></p> | |
4332 <table class=" | |
4333 table | |
4334 table-bordered | |
4335 table-dark | |
4336 table-striped | |
4337 table-hover | |
4338 d-block | |
4339 overflow-auto | |
4340 history_metadata_extractor_table | |
4341 "> | |
4342 <thead> | |
4343 <tr> | |
4344 <th scope="col"></th> | |
4345 <th scope="col">value</th> | |
4346 <th scope="col">name</th> | |
4347 <th scope="col">extension</th> | |
4348 <th scope="col">hid</th> | |
4349 </tr> | |
4350 </thead> | |
4351 <tr class=""> | |
4352 <th scope="row">file_load_select</th> | |
4353 <td>no</td> | |
4354 <td></td> | |
4355 <td></td> | |
4356 <td></td> | |
4357 </tr><tr class=""> | |
4358 <th scope="row">images</th> | |
4359 <td>9e77b3d7d0887128</td> | |
4360 <td>test.rdata</td> | |
4361 <td>rdata</td> | |
4362 <td>1</td> | |
4363 </tr><tr class=""> | |
4364 <th scope="row">sampleMetadata</th> | |
4365 <td>None</td> | |
4366 <td></td> | |
4367 <td></td> | |
4368 <td></td> | |
4369 </tr> | |
4370 </table> | |
4371 </div> | |
4372 | |
4373 | |
4374 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
4375 <h2 | |
4376 class="history_metadata_extractor_h2" | |
4377 style="cursor: pointer" | |
4378 title="click to fold/unfold the table" | |
4379 > | |
4380 [DELETED] - xcms_merge - 3.12.0+galaxy0 | |
4381 </h2> | |
4382 <p class="history_metadata_extractor_status"> | |
4383 Status: Failed (1) | |
4384 </p> | |
4385 <p class="history_metadata_extractor_glitter"></p> | |
4386 <table class=" | |
4387 table | |
4388 table-bordered | |
4389 table-dark | |
4390 table-striped | |
4391 table-hover | |
4392 d-block | |
4393 overflow-auto | |
4394 history_metadata_extractor_table | |
4395 "> | |
4396 <thead> | |
4397 <tr> | |
4398 <th scope="col"></th> | |
4399 <th scope="col">value</th> | |
4400 <th scope="col">name</th> | |
4401 <th scope="col">extension</th> | |
4402 <th scope="col">hid</th> | |
4403 </tr> | |
4404 </thead> | |
4405 <tr class=""> | |
4406 <th scope="row">file_load_select</th> | |
4407 <td>no</td> | |
4408 <td></td> | |
4409 <td></td> | |
4410 <td></td> | |
4411 </tr><tr class=""> | |
4412 <th scope="row">images</th> | |
4413 <td>9e77b3d7d0887128</td> | |
4414 <td>test.rdata</td> | |
4415 <td>rdata</td> | |
4416 <td>1</td> | |
4417 </tr><tr class=""> | |
4418 <th scope="row">sampleMetadata</th> | |
4419 <td>None</td> | |
4420 <td></td> | |
4421 <td></td> | |
4422 <td></td> | |
4423 </tr> | |
4424 </table> | |
4425 </div> | |
4426 | |
4427 | |
4428 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
4429 <h2 | |
4430 class="history_metadata_extractor_h2" | |
4431 style="cursor: pointer" | |
4432 title="click to fold/unfold the table" | |
4433 > | |
4434 [DELETED] - abims_xcms_xcmsSet - 3.12.0+galaxy0 | |
4435 </h2> | |
4436 <p class="history_metadata_extractor_status"> | |
4437 Status: Failed (1) | |
4438 </p> | |
4439 <p class="history_metadata_extractor_glitter"></p> | |
4440 <table class=" | |
4441 table | |
4442 table-bordered | |
4443 table-dark | |
4444 table-striped | |
4445 table-hover | |
4446 d-block | |
4447 overflow-auto | |
4448 history_metadata_extractor_table | |
4449 "> | |
4450 <thead> | |
4451 <tr> | |
4452 <th scope="col"></th> | |
4453 <th scope="col">value</th> | |
4454 <th scope="col">name</th> | |
4455 <th scope="col">extension</th> | |
4456 <th scope="col">hid</th> | |
4457 </tr> | |
4458 </thead> | |
4459 <tr class=""> | |
4460 <th scope="row">file_load_select</th> | |
4461 <td>no</td> | |
4462 <td></td> | |
4463 <td></td> | |
4464 <td></td> | |
4465 </tr><tr class=""> | |
4466 <th scope="row">filterAcquisitionNum</th> | |
4467 <td></td> | |
4468 <td></td> | |
4469 <td></td> | |
4470 <td></td> | |
4471 </tr><tr class=""> | |
4472 <th scope="row">filterMz</th> | |
4473 <td></td> | |
4474 <td></td> | |
4475 <td></td> | |
4476 <td></td> | |
4477 </tr><tr class=""> | |
4478 <th scope="row">filterRt</th> | |
4479 <td></td> | |
4480 <td></td> | |
4481 <td></td> | |
4482 <td></td> | |
4483 </tr><tr class=""> | |
4484 <th scope="row">image</th> | |
4485 <td>9e77b3d7d0887128</td> | |
4486 <td>test.rdata</td> | |
4487 <td>rdata</td> | |
4488 <td>1</td> | |
4489 </tr><tr class=""> | |
4490 <th scope="row">impute</th> | |
4491 <td>none</td> | |
4492 <td></td> | |
4493 <td></td> | |
4494 <td></td> | |
4495 </tr><tr class=""> | |
4496 <th scope="row">max</th> | |
4497 <td>5</td> | |
4498 <td></td> | |
4499 <td></td> | |
4500 <td></td> | |
4501 </tr><tr class=""> | |
4502 <th scope="row">mzdiff</th> | |
4503 <td>0.6</td> | |
4504 <td></td> | |
4505 <td></td> | |
4506 <td></td> | |
4507 </tr><tr class=""> | |
4508 <th scope="row">peaklist</th> | |
4509 <td>false</td> | |
4510 <td></td> | |
4511 <td></td> | |
4512 <td></td> | |
4513 </tr><tr class=""> | |
4514 <th scope="row">sigma</th> | |
4515 <td></td> | |
4516 <td></td> | |
4517 <td></td> | |
4518 <td></td> | |
4519 </tr><tr class=""> | |
4520 <th scope="row">snthresh</th> | |
4521 <td>10</td> | |
4522 <td></td> | |
4523 <td></td> | |
4524 <td></td> | |
4525 </tr><tr class=""> | |
4526 <th scope="row">steps</th> | |
4527 <td>2</td> | |
4528 <td></td> | |
4529 <td></td> | |
4530 <td></td> | |
4531 </tr><tr class=""> | |
4532 <th scope="row">binSize</th> | |
4533 <td>0.1</td> | |
4534 <td></td> | |
4535 <td></td> | |
4536 <td></td> | |
4537 </tr><tr class=""> | |
4538 <th scope="row">fwhm</th> | |
4539 <td>30</td> | |
4540 <td></td> | |
4541 <td></td> | |
4542 <td></td> | |
4543 </tr><tr class=""> | |
4544 <th scope="row">method</th> | |
4545 <td>MatchedFilter</td> | |
4546 <td></td> | |
4547 <td></td> | |
4548 <td></td> | |
4549 </tr> | |
4550 </table> | |
4551 </div> | |
4552 | |
4553 | |
4554 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
4555 <h2 | |
4556 class="history_metadata_extractor_h2" | |
4557 style="cursor: pointer" | |
4558 title="click to fold/unfold the table" | |
4559 > | |
4560 [DELETED] - abims_xcms_xcmsSet - 3.12.0+galaxy0 | |
4561 </h2> | |
4562 <p class="history_metadata_extractor_status"> | |
4563 Status: Failed (1) | |
4564 </p> | |
4565 <p class="history_metadata_extractor_glitter"></p> | |
4566 <table class=" | |
4567 table | |
4568 table-bordered | |
4569 table-dark | |
4570 table-striped | |
4571 table-hover | |
4572 d-block | |
4573 overflow-auto | |
4574 history_metadata_extractor_table | |
4575 "> | |
4576 <thead> | |
4577 <tr> | |
4578 <th scope="col"></th> | |
4579 <th scope="col">value</th> | |
4580 <th scope="col">name</th> | |
4581 <th scope="col">extension</th> | |
4582 <th scope="col">hid</th> | |
4583 </tr> | |
4584 </thead> | |
4585 <tr class=""> | |
4586 <th scope="row">file_load_select</th> | |
4587 <td>no</td> | |
4588 <td></td> | |
4589 <td></td> | |
4590 <td></td> | |
4591 </tr><tr class=""> | |
4592 <th scope="row">filterAcquisitionNum</th> | |
4593 <td></td> | |
4594 <td></td> | |
4595 <td></td> | |
4596 <td></td> | |
4597 </tr><tr class=""> | |
4598 <th scope="row">filterMz</th> | |
4599 <td></td> | |
4600 <td></td> | |
4601 <td></td> | |
4602 <td></td> | |
4603 </tr><tr class=""> | |
4604 <th scope="row">filterRt</th> | |
4605 <td></td> | |
4606 <td></td> | |
4607 <td></td> | |
4608 <td></td> | |
4609 </tr><tr class=""> | |
4610 <th scope="row">image</th> | |
4611 <td>9e77b3d7d0887128</td> | |
4612 <td>test.rdata</td> | |
4613 <td>rdata</td> | |
4614 <td>1</td> | |
4615 </tr><tr class=""> | |
4616 <th scope="row">impute</th> | |
4617 <td>none</td> | |
4618 <td></td> | |
4619 <td></td> | |
4620 <td></td> | |
4621 </tr><tr class=""> | |
4622 <th scope="row">max</th> | |
4623 <td>5</td> | |
4624 <td></td> | |
4625 <td></td> | |
4626 <td></td> | |
4627 </tr><tr class=""> | |
4628 <th scope="row">mzdiff</th> | |
4629 <td>0.6</td> | |
4630 <td></td> | |
4631 <td></td> | |
4632 <td></td> | |
4633 </tr><tr class=""> | |
4634 <th scope="row">peaklist</th> | |
4635 <td>false</td> | |
4636 <td></td> | |
4637 <td></td> | |
4638 <td></td> | |
4639 </tr><tr class=""> | |
4640 <th scope="row">sigma</th> | |
4641 <td></td> | |
4642 <td></td> | |
4643 <td></td> | |
4644 <td></td> | |
4645 </tr><tr class=""> | |
4646 <th scope="row">snthresh</th> | |
4647 <td>10</td> | |
4648 <td></td> | |
4649 <td></td> | |
4650 <td></td> | |
4651 </tr><tr class=""> | |
4652 <th scope="row">steps</th> | |
4653 <td>2</td> | |
4654 <td></td> | |
4655 <td></td> | |
4656 <td></td> | |
4657 </tr><tr class=""> | |
4658 <th scope="row">binSize</th> | |
4659 <td>0.1</td> | |
4660 <td></td> | |
4661 <td></td> | |
4662 <td></td> | |
4663 </tr><tr class=""> | |
4664 <th scope="row">fwhm</th> | |
4665 <td>30</td> | |
4666 <td></td> | |
4667 <td></td> | |
4668 <td></td> | |
4669 </tr><tr class=""> | |
4670 <th scope="row">method</th> | |
4671 <td>MatchedFilter</td> | |
4672 <td></td> | |
4673 <td></td> | |
4674 <td></td> | |
4675 </tr> | |
4676 </table> | |
4677 </div> | |
4678 | |
4679 | |
4680 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
4681 <h2 | |
4682 class="history_metadata_extractor_h2" | |
4683 style="cursor: pointer" | |
4684 title="click to fold/unfold the table" | |
4685 > | |
4686 [DELETED] - xcms_export_samplemetadata - 3.12.0+galaxy0 | |
4687 </h2> | |
4688 <p class="history_metadata_extractor_status"> | |
4689 Status: Failed (1) | |
4690 </p> | |
4691 <p class="history_metadata_extractor_glitter"></p> | |
4692 <table class=" | |
4693 table | |
4694 table-bordered | |
4695 table-dark | |
4696 table-striped | |
4697 table-hover | |
4698 d-block | |
4699 overflow-auto | |
4700 history_metadata_extractor_table | |
4701 "> | |
4702 <thead> | |
4703 <tr> | |
4704 <th scope="col"></th> | |
4705 <th scope="col">value</th> | |
4706 <th scope="col">name</th> | |
4707 <th scope="col">extension</th> | |
4708 <th scope="col">hid</th> | |
4709 </tr> | |
4710 </thead> | |
4711 <tr class=""> | |
4712 <th scope="row">images</th> | |
4713 <td>9e77b3d7d0887128</td> | |
4714 <td>test.rdata</td> | |
4715 <td>rdata</td> | |
4716 <td>1</td> | |
4717 </tr> | |
4718 </table> | |
4719 </div> | |
4720 | |
4721 | |
4722 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
4723 <h2 | |
4724 class="history_metadata_extractor_h2" | |
4725 style="cursor: pointer" | |
4726 title="click to fold/unfold the table" | |
4727 > | |
4728 [DELETED] - xcms_plot_chromatogram - 3.12.0+galaxy0 | |
4729 </h2> | |
4730 <p class="history_metadata_extractor_status"> | |
4731 Status: Failed (1) | |
4732 </p> | |
4733 <p class="history_metadata_extractor_glitter"></p> | |
4734 <table class=" | |
4735 table | |
4736 table-bordered | |
4737 table-dark | |
4738 table-striped | |
4739 table-hover | |
4740 d-block | |
4741 overflow-auto | |
4742 history_metadata_extractor_table | |
4743 "> | |
4744 <thead> | |
4745 <tr> | |
4746 <th scope="col"></th> | |
4747 <th scope="col">value</th> | |
4748 <th scope="col">name</th> | |
4749 <th scope="col">extension</th> | |
4750 <th scope="col">hid</th> | |
4751 </tr> | |
4752 </thead> | |
4753 <tr class=""> | |
4754 <th scope="row">file_load_select</th> | |
4755 <td>no</td> | |
4756 <td></td> | |
4757 <td></td> | |
4758 <td></td> | |
4759 </tr><tr class=""> | |
4760 <th scope="row">images</th> | |
4761 <td>9e77b3d7d0887128</td> | |
4762 <td>test.rdata</td> | |
4763 <td>rdata</td> | |
4764 <td>1</td> | |
4765 </tr><tr class=""> | |
4766 <th scope="row">sampleMetadata</th> | |
4767 <td>None</td> | |
4768 <td></td> | |
4769 <td></td> | |
4770 <td></td> | |
4771 </tr> | |
4772 </table> | |
4773 </div> | |
4774 | |
4775 | |
4776 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
4777 <h2 | |
4778 class="history_metadata_extractor_h2" | |
4779 style="cursor: pointer" | |
4780 title="click to fold/unfold the table" | |
4781 > | |
4782 [DELETED] - xcms_plot_chromatogram - 3.12.0+galaxy0 | |
4783 </h2> | |
4784 <p class="history_metadata_extractor_status"> | |
4785 Status: Failed (1) | |
4786 </p> | |
4787 <p class="history_metadata_extractor_glitter"></p> | |
4788 <table class=" | |
4789 table | |
4790 table-bordered | |
4791 table-dark | |
4792 table-striped | |
4793 table-hover | |
4794 d-block | |
4795 overflow-auto | |
4796 history_metadata_extractor_table | |
4797 "> | |
4798 <thead> | |
4799 <tr> | |
4800 <th scope="col"></th> | |
4801 <th scope="col">value</th> | |
4802 <th scope="col">name</th> | |
4803 <th scope="col">extension</th> | |
4804 <th scope="col">hid</th> | |
4805 </tr> | |
4806 </thead> | |
4807 <tr class=""> | |
4808 <th scope="row">file_load_select</th> | |
4809 <td>no</td> | |
4810 <td></td> | |
4811 <td></td> | |
4812 <td></td> | |
4813 </tr><tr class=""> | |
4814 <th scope="row">images</th> | |
4815 <td>9e77b3d7d0887128</td> | |
4816 <td>test.rdata</td> | |
4817 <td>rdata</td> | |
4818 <td>1</td> | |
4819 </tr><tr class=""> | |
4820 <th scope="row">sampleMetadata</th> | |
4821 <td>None</td> | |
4822 <td></td> | |
4823 <td></td> | |
4824 <td></td> | |
4825 </tr> | |
4826 </table> | |
4827 </div> | |
4828 | |
4829 | |
4830 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
4831 <h2 | |
4832 class="history_metadata_extractor_h2" | |
4833 style="cursor: pointer" | |
4834 title="click to fold/unfold the table" | |
4835 > | |
4836 [DELETED] - abims_xcms_fillPeaks - 3.12.0+galaxy0 | |
4837 </h2> | |
4838 <p class="history_metadata_extractor_status"> | |
4839 Status: Failed (1) | |
4840 </p> | |
4841 <p class="history_metadata_extractor_glitter"></p> | |
4842 <table class=" | |
4843 table | |
4844 table-bordered | |
4845 table-dark | |
4846 table-striped | |
4847 table-hover | |
4848 d-block | |
4849 overflow-auto | |
4850 history_metadata_extractor_table | |
4851 "> | |
4852 <thead> | |
4853 <tr> | |
4854 <th scope="col"></th> | |
4855 <th scope="col">value</th> | |
4856 <th scope="col">name</th> | |
4857 <th scope="col">extension</th> | |
4858 <th scope="col">hid</th> | |
4859 </tr> | |
4860 </thead> | |
4861 <tr class=""> | |
4862 <th scope="row">expandMz</th> | |
4863 <td>0</td> | |
4864 <td></td> | |
4865 <td></td> | |
4866 <td></td> | |
4867 </tr><tr class=""> | |
4868 <th scope="row">expandRt</th> | |
4869 <td>0</td> | |
4870 <td></td> | |
4871 <td></td> | |
4872 <td></td> | |
4873 </tr><tr class=""> | |
4874 <th scope="row">ppm</th> | |
4875 <td>0</td> | |
4876 <td></td> | |
4877 <td></td> | |
4878 <td></td> | |
4879 </tr><tr class=""> | |
4880 <th scope="row">file_load_select</th> | |
4881 <td>no</td> | |
4882 <td></td> | |
4883 <td></td> | |
4884 <td></td> | |
4885 </tr><tr class=""> | |
4886 <th scope="row">image</th> | |
4887 <td>9e77b3d7d0887128</td> | |
4888 <td>test.rdata</td> | |
4889 <td>rdata</td> | |
4890 <td>1</td> | |
4891 </tr><tr class=""> | |
4892 <th scope="row">convertRTMinute</th> | |
4893 <td>false</td> | |
4894 <td></td> | |
4895 <td></td> | |
4896 <td></td> | |
4897 </tr><tr class=""> | |
4898 <th scope="row">intval</th> | |
4899 <td>into</td> | |
4900 <td></td> | |
4901 <td></td> | |
4902 <td></td> | |
4903 </tr><tr class=""> | |
4904 <th scope="row">naTOzero</th> | |
4905 <td>true</td> | |
4906 <td></td> | |
4907 <td></td> | |
4908 <td></td> | |
4909 </tr><tr class=""> | |
4910 <th scope="row">numDigitsMZ</th> | |
4911 <td>4</td> | |
4912 <td></td> | |
4913 <td></td> | |
4914 <td></td> | |
4915 </tr><tr class=""> | |
4916 <th scope="row">numDigitsRT</th> | |
4917 <td>0</td> | |
4918 <td></td> | |
4919 <td></td> | |
4920 <td></td> | |
4921 </tr><tr class=""> | |
4922 <th scope="row">peaklistBool</th> | |
4923 <td>True</td> | |
4924 <td></td> | |
4925 <td></td> | |
4926 <td></td> | |
4927 </tr> | |
4928 </table> | |
4929 </div> | |
4930 | |
4931 | |
4932 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
4933 <h2 | |
4934 class="history_metadata_extractor_h2" | |
4935 style="cursor: pointer" | |
4936 title="click to fold/unfold the table" | |
4937 > | |
4938 [DELETED] - abims_xcms_fillPeaks - 3.12.0+galaxy0 | |
4939 </h2> | |
4940 <p class="history_metadata_extractor_status"> | |
4941 Status: Failed (1) | |
4942 </p> | |
4943 <p class="history_metadata_extractor_glitter"></p> | |
4944 <table class=" | |
4945 table | |
4946 table-bordered | |
4947 table-dark | |
4948 table-striped | |
4949 table-hover | |
4950 d-block | |
4951 overflow-auto | |
4952 history_metadata_extractor_table | |
4953 "> | |
4954 <thead> | |
4955 <tr> | |
4956 <th scope="col"></th> | |
4957 <th scope="col">value</th> | |
4958 <th scope="col">name</th> | |
4959 <th scope="col">extension</th> | |
4960 <th scope="col">hid</th> | |
4961 </tr> | |
4962 </thead> | |
4963 <tr class=""> | |
4964 <th scope="row">expandMz</th> | |
4965 <td>0</td> | |
4966 <td></td> | |
4967 <td></td> | |
4968 <td></td> | |
4969 </tr><tr class=""> | |
4970 <th scope="row">expandRt</th> | |
4971 <td>0</td> | |
4972 <td></td> | |
4973 <td></td> | |
4974 <td></td> | |
4975 </tr><tr class=""> | |
4976 <th scope="row">ppm</th> | |
4977 <td>0</td> | |
4978 <td></td> | |
4979 <td></td> | |
4980 <td></td> | |
4981 </tr><tr class=""> | |
4982 <th scope="row">file_load_select</th> | |
4983 <td>no</td> | |
4984 <td></td> | |
4985 <td></td> | |
4986 <td></td> | |
4987 </tr><tr class=""> | |
4988 <th scope="row">image</th> | |
4989 <td>9e77b3d7d0887128</td> | |
4990 <td>test.rdata</td> | |
4991 <td>rdata</td> | |
4992 <td>1</td> | |
4993 </tr><tr class=""> | |
4994 <th scope="row">convertRTMinute</th> | |
4995 <td>false</td> | |
4996 <td></td> | |
4997 <td></td> | |
4998 <td></td> | |
4999 </tr><tr class=""> | |
5000 <th scope="row">intval</th> | |
5001 <td>into</td> | |
5002 <td></td> | |
5003 <td></td> | |
5004 <td></td> | |
5005 </tr><tr class=""> | |
5006 <th scope="row">naTOzero</th> | |
5007 <td>true</td> | |
5008 <td></td> | |
5009 <td></td> | |
5010 <td></td> | |
5011 </tr><tr class=""> | |
5012 <th scope="row">numDigitsMZ</th> | |
5013 <td>4</td> | |
5014 <td></td> | |
5015 <td></td> | |
5016 <td></td> | |
5017 </tr><tr class=""> | |
5018 <th scope="row">numDigitsRT</th> | |
5019 <td>0</td> | |
5020 <td></td> | |
5021 <td></td> | |
5022 <td></td> | |
5023 </tr><tr class=""> | |
5024 <th scope="row">peaklistBool</th> | |
5025 <td>True</td> | |
5026 <td></td> | |
5027 <td></td> | |
5028 <td></td> | |
5029 </tr> | |
5030 </table> | |
5031 </div> | |
5032 | |
5033 | |
5034 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
5035 <h2 | |
5036 class="history_metadata_extractor_h2" | |
5037 style="cursor: pointer" | |
5038 title="click to fold/unfold the table" | |
5039 > | |
5040 [DELETED] - abims_xcms_fillPeaks - 3.12.0+galaxy0 | |
5041 </h2> | |
5042 <p class="history_metadata_extractor_status"> | |
5043 Status: Failed (1) | |
5044 </p> | |
5045 <p class="history_metadata_extractor_glitter"></p> | |
5046 <table class=" | |
5047 table | |
5048 table-bordered | |
5049 table-dark | |
5050 table-striped | |
5051 table-hover | |
5052 d-block | |
5053 overflow-auto | |
5054 history_metadata_extractor_table | |
5055 "> | |
5056 <thead> | |
5057 <tr> | |
5058 <th scope="col"></th> | |
5059 <th scope="col">value</th> | |
5060 <th scope="col">name</th> | |
5061 <th scope="col">extension</th> | |
5062 <th scope="col">hid</th> | |
5063 </tr> | |
5064 </thead> | |
5065 <tr class=""> | |
5066 <th scope="row">expandMz</th> | |
5067 <td>0</td> | |
5068 <td></td> | |
5069 <td></td> | |
5070 <td></td> | |
5071 </tr><tr class=""> | |
5072 <th scope="row">expandRt</th> | |
5073 <td>0</td> | |
5074 <td></td> | |
5075 <td></td> | |
5076 <td></td> | |
5077 </tr><tr class=""> | |
5078 <th scope="row">ppm</th> | |
5079 <td>0</td> | |
5080 <td></td> | |
5081 <td></td> | |
5082 <td></td> | |
5083 </tr><tr class=""> | |
5084 <th scope="row">file_load_select</th> | |
5085 <td>no</td> | |
5086 <td></td> | |
5087 <td></td> | |
5088 <td></td> | |
5089 </tr><tr class=""> | |
5090 <th scope="row">image</th> | |
5091 <td>9e77b3d7d0887128</td> | |
5092 <td>test.rdata</td> | |
5093 <td>rdata</td> | |
5094 <td>1</td> | |
5095 </tr><tr class=""> | |
5096 <th scope="row">convertRTMinute</th> | |
5097 <td>false</td> | |
5098 <td></td> | |
5099 <td></td> | |
5100 <td></td> | |
5101 </tr><tr class=""> | |
5102 <th scope="row">intval</th> | |
5103 <td>into</td> | |
5104 <td></td> | |
5105 <td></td> | |
5106 <td></td> | |
5107 </tr><tr class=""> | |
5108 <th scope="row">naTOzero</th> | |
5109 <td>true</td> | |
5110 <td></td> | |
5111 <td></td> | |
5112 <td></td> | |
5113 </tr><tr class=""> | |
5114 <th scope="row">numDigitsMZ</th> | |
5115 <td>4</td> | |
5116 <td></td> | |
5117 <td></td> | |
5118 <td></td> | |
5119 </tr><tr class=""> | |
5120 <th scope="row">numDigitsRT</th> | |
5121 <td>0</td> | |
5122 <td></td> | |
5123 <td></td> | |
5124 <td></td> | |
5125 </tr><tr class=""> | |
5126 <th scope="row">peaklistBool</th> | |
5127 <td>True</td> | |
5128 <td></td> | |
5129 <td></td> | |
5130 <td></td> | |
5131 </tr> | |
5132 </table> | |
5133 </div> | |
5134 | |
5135 | |
5136 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
5137 <h2 | |
5138 class="history_metadata_extractor_h2" | |
5139 style="cursor: pointer" | |
5140 title="click to fold/unfold the table" | |
5141 > | |
5142 [DELETED] - quality_metrics - 2.2.8 | |
5143 </h2> | |
5144 <p class="history_metadata_extractor_status"> | |
5145 Status: Failed (1) | |
5146 </p> | |
5147 <p class="history_metadata_extractor_glitter"></p> | |
5148 <table class=" | |
5149 table | |
5150 table-bordered | |
5151 table-dark | |
5152 table-striped | |
5153 table-hover | |
5154 d-block | |
5155 overflow-auto | |
5156 history_metadata_extractor_table | |
5157 "> | |
5158 <thead> | |
5159 <tr> | |
5160 <th scope="col"></th> | |
5161 <th scope="col">value</th> | |
5162 <th scope="col">name</th> | |
5163 <th scope="col">extension</th> | |
5164 <th scope="col">hid</th> | |
5165 </tr> | |
5166 </thead> | |
5167 <tr class=""> | |
5168 <th scope="row">CV</th> | |
5169 <td>FALSE</td> | |
5170 <td></td> | |
5171 <td></td> | |
5172 <td></td> | |
5173 </tr><tr class=""> | |
5174 <th scope="row">Compa</th> | |
5175 <td>TRUE</td> | |
5176 <td></td> | |
5177 <td></td> | |
5178 <td></td> | |
5179 </tr><tr class=""> | |
5180 <th scope="row">seuil</th> | |
5181 <td>1</td> | |
5182 <td></td> | |
5183 <td></td> | |
5184 <td></td> | |
5185 </tr><tr class=""> | |
5186 <th scope="row">optC</th> | |
5187 <td>default</td> | |
5188 <td></td> | |
5189 <td></td> | |
5190 <td></td> | |
5191 </tr><tr class=""> | |
5192 <th scope="row">poolAsPool1L</th> | |
5193 <td>TRUE</td> | |
5194 <td></td> | |
5195 <td></td> | |
5196 <td></td> | |
5197 </tr><tr class=""> | |
5198 <th scope="row">dataMatrix_in</th> | |
5199 <td>9a0ce47bd1734ae7</td> | |
5200 <td>peaklist_fragments.tsv</td> | |
5201 <td>tabular</td> | |
5202 <td>42</td> | |
5203 </tr><tr class=""> | |
5204 <th scope="row">sampleMetadata_in</th> | |
5205 <td>9a0ce47bd1734ae7</td> | |
5206 <td>peaklist_fragments.tsv</td> | |
5207 <td>tabular</td> | |
5208 <td>42</td> | |
5209 </tr><tr class=""> | |
5210 <th scope="row">variableMetadata_in</th> | |
5211 <td>9a0ce47bd1734ae7</td> | |
5212 <td>peaklist_fragments.tsv</td> | |
5213 <td>tabular</td> | |
5214 <td>42</td> | |
5215 </tr> | |
5216 </table> | |
5217 </div> | |
5218 | |
5219 | |
5220 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
5221 <h2 | |
5222 class="history_metadata_extractor_h2" | |
5223 style="cursor: pointer" | |
5224 title="click to fold/unfold the table" | |
5225 > | |
5226 [DELETED] - quality_metrics - 2.2.8 | |
5227 </h2> | |
5228 <p class="history_metadata_extractor_status"> | |
5229 Status: Failed (1) | |
5230 </p> | |
5231 <p class="history_metadata_extractor_glitter"></p> | |
5232 <table class=" | |
5233 table | |
5234 table-bordered | |
5235 table-dark | |
5236 table-striped | |
5237 table-hover | |
5238 d-block | |
5239 overflow-auto | |
5240 history_metadata_extractor_table | |
5241 "> | |
5242 <thead> | |
5243 <tr> | |
5244 <th scope="col"></th> | |
5245 <th scope="col">value</th> | |
5246 <th scope="col">name</th> | |
5247 <th scope="col">extension</th> | |
5248 <th scope="col">hid</th> | |
5249 </tr> | |
5250 </thead> | |
5251 <tr class=""> | |
5252 <th scope="row">CV</th> | |
5253 <td>FALSE</td> | |
5254 <td></td> | |
5255 <td></td> | |
5256 <td></td> | |
5257 </tr><tr class=""> | |
5258 <th scope="row">Compa</th> | |
5259 <td>TRUE</td> | |
5260 <td></td> | |
5261 <td></td> | |
5262 <td></td> | |
5263 </tr><tr class=""> | |
5264 <th scope="row">seuil</th> | |
5265 <td>1</td> | |
5266 <td></td> | |
5267 <td></td> | |
5268 <td></td> | |
5269 </tr><tr class=""> | |
5270 <th scope="row">optC</th> | |
5271 <td>default</td> | |
5272 <td></td> | |
5273 <td></td> | |
5274 <td></td> | |
5275 </tr><tr class=""> | |
5276 <th scope="row">poolAsPool1L</th> | |
5277 <td>TRUE</td> | |
5278 <td></td> | |
5279 <td></td> | |
5280 <td></td> | |
5281 </tr><tr class=""> | |
5282 <th scope="row">dataMatrix_in</th> | |
5283 <td>9a0ce47bd1734ae7</td> | |
5284 <td>peaklist_fragments.tsv</td> | |
5285 <td>tabular</td> | |
5286 <td>42</td> | |
5287 </tr><tr class=""> | |
5288 <th scope="row">sampleMetadata_in</th> | |
5289 <td>9a0ce47bd1734ae7</td> | |
5290 <td>peaklist_fragments.tsv</td> | |
5291 <td>tabular</td> | |
5292 <td>42</td> | |
5293 </tr><tr class=""> | |
5294 <th scope="row">variableMetadata_in</th> | |
5295 <td>9a0ce47bd1734ae7</td> | |
5296 <td>peaklist_fragments.tsv</td> | |
5297 <td>tabular</td> | |
5298 <td>42</td> | |
5299 </tr> | |
5300 </table> | |
5301 </div> | |
5302 | |
5303 | |
5304 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
5305 <h2 | |
5306 class="history_metadata_extractor_h2" | |
5307 style="cursor: pointer" | |
5308 title="click to fold/unfold the table" | |
5309 > | |
5310 [DELETED] - quality_metrics - 2.2.8 | |
5311 </h2> | |
5312 <p class="history_metadata_extractor_status"> | |
5313 Status: Failed (1) | |
5314 </p> | |
5315 <p class="history_metadata_extractor_glitter"></p> | |
5316 <table class=" | |
5317 table | |
5318 table-bordered | |
5319 table-dark | |
5320 table-striped | |
5321 table-hover | |
5322 d-block | |
5323 overflow-auto | |
5324 history_metadata_extractor_table | |
5325 "> | |
5326 <thead> | |
5327 <tr> | |
5328 <th scope="col"></th> | |
5329 <th scope="col">value</th> | |
5330 <th scope="col">name</th> | |
5331 <th scope="col">extension</th> | |
5332 <th scope="col">hid</th> | |
5333 </tr> | |
5334 </thead> | |
5335 <tr class=""> | |
5336 <th scope="row">CV</th> | |
5337 <td>FALSE</td> | |
5338 <td></td> | |
5339 <td></td> | |
5340 <td></td> | |
5341 </tr><tr class=""> | |
5342 <th scope="row">Compa</th> | |
5343 <td>TRUE</td> | |
5344 <td></td> | |
5345 <td></td> | |
5346 <td></td> | |
5347 </tr><tr class=""> | |
5348 <th scope="row">seuil</th> | |
5349 <td>1</td> | |
5350 <td></td> | |
5351 <td></td> | |
5352 <td></td> | |
5353 </tr><tr class=""> | |
5354 <th scope="row">optC</th> | |
5355 <td>default</td> | |
5356 <td></td> | |
5357 <td></td> | |
5358 <td></td> | |
5359 </tr><tr class=""> | |
5360 <th scope="row">poolAsPool1L</th> | |
5361 <td>TRUE</td> | |
5362 <td></td> | |
5363 <td></td> | |
5364 <td></td> | |
5365 </tr><tr class=""> | |
5366 <th scope="row">dataMatrix_in</th> | |
5367 <td>9a0ce47bd1734ae7</td> | |
5368 <td>peaklist_fragments.tsv</td> | |
5369 <td>tabular</td> | |
5370 <td>42</td> | |
5371 </tr><tr class=""> | |
5372 <th scope="row">sampleMetadata_in</th> | |
5373 <td>9a0ce47bd1734ae7</td> | |
5374 <td>peaklist_fragments.tsv</td> | |
5375 <td>tabular</td> | |
5376 <td>42</td> | |
5377 </tr><tr class=""> | |
5378 <th scope="row">variableMetadata_in</th> | |
5379 <td>9a0ce47bd1734ae7</td> | |
5380 <td>peaklist_fragments.tsv</td> | |
5381 <td>tabular</td> | |
5382 <td>42</td> | |
5383 </tr> | |
5384 </table> | |
5385 </div> | |
5386 | |
5387 | |
5388 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
5389 <h2 | |
5390 class="history_metadata_extractor_h2" | |
5391 style="cursor: pointer" | |
5392 title="click to fold/unfold the table" | |
5393 > | |
5394 [DELETED] - quality_metrics - 2.2.8 | |
5395 </h2> | |
5396 <p class="history_metadata_extractor_status"> | |
5397 Status: Failed (1) | |
5398 </p> | |
5399 <p class="history_metadata_extractor_glitter"></p> | |
5400 <table class=" | |
5401 table | |
5402 table-bordered | |
5403 table-dark | |
5404 table-striped | |
5405 table-hover | |
5406 d-block | |
5407 overflow-auto | |
5408 history_metadata_extractor_table | |
5409 "> | |
5410 <thead> | |
5411 <tr> | |
5412 <th scope="col"></th> | |
5413 <th scope="col">value</th> | |
5414 <th scope="col">name</th> | |
5415 <th scope="col">extension</th> | |
5416 <th scope="col">hid</th> | |
5417 </tr> | |
5418 </thead> | |
5419 <tr class=""> | |
5420 <th scope="row">CV</th> | |
5421 <td>FALSE</td> | |
5422 <td></td> | |
5423 <td></td> | |
5424 <td></td> | |
5425 </tr><tr class=""> | |
5426 <th scope="row">Compa</th> | |
5427 <td>TRUE</td> | |
5428 <td></td> | |
5429 <td></td> | |
5430 <td></td> | |
5431 </tr><tr class=""> | |
5432 <th scope="row">seuil</th> | |
5433 <td>1</td> | |
5434 <td></td> | |
5435 <td></td> | |
5436 <td></td> | |
5437 </tr><tr class=""> | |
5438 <th scope="row">optC</th> | |
5439 <td>default</td> | |
5440 <td></td> | |
5441 <td></td> | |
5442 <td></td> | |
5443 </tr><tr class=""> | |
5444 <th scope="row">poolAsPool1L</th> | |
5445 <td>TRUE</td> | |
5446 <td></td> | |
5447 <td></td> | |
5448 <td></td> | |
5449 </tr><tr class=""> | |
5450 <th scope="row">dataMatrix_in</th> | |
5451 <td>9a0ce47bd1734ae7</td> | |
5452 <td>peaklist_fragments.tsv</td> | |
5453 <td>tabular</td> | |
5454 <td>42</td> | |
5455 </tr><tr class=""> | |
5456 <th scope="row">sampleMetadata_in</th> | |
5457 <td>9a0ce47bd1734ae7</td> | |
5458 <td>peaklist_fragments.tsv</td> | |
5459 <td>tabular</td> | |
5460 <td>42</td> | |
5461 </tr><tr class=""> | |
5462 <th scope="row">variableMetadata_in</th> | |
5463 <td>9a0ce47bd1734ae7</td> | |
5464 <td>peaklist_fragments.tsv</td> | |
5465 <td>tabular</td> | |
5466 <td>42</td> | |
5467 </tr> | |
5468 </table> | |
5469 </div> | |
5470 | |
5471 | |
5472 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
5473 <h2 | |
5474 class="history_metadata_extractor_h2" | |
5475 style="cursor: pointer" | |
5476 title="click to fold/unfold the table" | |
5477 > | |
5478 [DELETED] - abims_CAMERA_annotateDiffreport - 2.2.6+camera1.48.0-galaxy0 | |
5479 </h2> | |
5480 <p class="history_metadata_extractor_status"> | |
5481 Status: Failed (127) | |
5482 </p> | |
5483 <p class="history_metadata_extractor_glitter"></p> | |
5484 <table class=" | |
5485 table | |
5486 table-bordered | |
5487 table-dark | |
5488 table-striped | |
5489 table-hover | |
5490 d-block | |
5491 overflow-auto | |
5492 history_metadata_extractor_table | |
5493 "> | |
5494 <thead> | |
5495 <tr> | |
5496 <th scope="col"></th> | |
5497 <th scope="col">value</th> | |
5498 <th scope="col">name</th> | |
5499 <th scope="col">extension</th> | |
5500 <th scope="col">hid</th> | |
5501 </tr> | |
5502 </thead> | |
5503 <tr class=""> | |
5504 <th scope="row">option</th> | |
5505 <td>hide</td> | |
5506 <td></td> | |
5507 <td></td> | |
5508 <td></td> | |
5509 </tr><tr class=""> | |
5510 <th scope="row">convertRTMinute</th> | |
5511 <td>false</td> | |
5512 <td></td> | |
5513 <td></td> | |
5514 <td></td> | |
5515 </tr><tr class=""> | |
5516 <th scope="row">intval</th> | |
5517 <td>into</td> | |
5518 <td></td> | |
5519 <td></td> | |
5520 <td></td> | |
5521 </tr><tr class=""> | |
5522 <th scope="row">numDigitsMZ</th> | |
5523 <td>4</td> | |
5524 <td></td> | |
5525 <td></td> | |
5526 <td></td> | |
5527 </tr><tr class=""> | |
5528 <th scope="row">numDigitsRT</th> | |
5529 <td>0</td> | |
5530 <td></td> | |
5531 <td></td> | |
5532 <td></td> | |
5533 </tr><tr class=""> | |
5534 <th scope="row">file_load_select</th> | |
5535 <td>no</td> | |
5536 <td></td> | |
5537 <td></td> | |
5538 <td></td> | |
5539 </tr><tr class=""> | |
5540 <th scope="row">mzabs</th> | |
5541 <td>0.015</td> | |
5542 <td></td> | |
5543 <td></td> | |
5544 <td></td> | |
5545 </tr><tr class=""> | |
5546 <th scope="row">ppm</th> | |
5547 <td>5</td> | |
5548 <td></td> | |
5549 <td></td> | |
5550 <td></td> | |
5551 </tr><tr class=""> | |
5552 <th scope="row">maxcharge</th> | |
5553 <td>3</td> | |
5554 <td></td> | |
5555 <td></td> | |
5556 <td></td> | |
5557 </tr><tr class=""> | |
5558 <th scope="row">maxiso</th> | |
5559 <td>4</td> | |
5560 <td></td> | |
5561 <td></td> | |
5562 <td></td> | |
5563 </tr><tr class=""> | |
5564 <th scope="row">minfrac</th> | |
5565 <td>0.5</td> | |
5566 <td></td> | |
5567 <td></td> | |
5568 <td></td> | |
5569 </tr><tr class=""> | |
5570 <th scope="row">perfwhm</th> | |
5571 <td>0.6</td> | |
5572 <td></td> | |
5573 <td></td> | |
5574 <td></td> | |
5575 </tr><tr class=""> | |
5576 <th scope="row">sigma</th> | |
5577 <td>6</td> | |
5578 <td></td> | |
5579 <td></td> | |
5580 <td></td> | |
5581 </tr><tr class=""> | |
5582 <th scope="row">image</th> | |
5583 <td>9e77b3d7d0887128</td> | |
5584 <td>test.rdata</td> | |
5585 <td>rdata</td> | |
5586 <td>1</td> | |
5587 </tr><tr class=""> | |
5588 <th scope="row">max_peaks</th> | |
5589 <td>100</td> | |
5590 <td></td> | |
5591 <td></td> | |
5592 <td></td> | |
5593 </tr><tr class=""> | |
5594 <th scope="row">polarity</th> | |
5595 <td>negative</td> | |
5596 <td></td> | |
5597 <td></td> | |
5598 <td></td> | |
5599 </tr><tr class=""> | |
5600 <th scope="row">multiplier</th> | |
5601 <td>3</td> | |
5602 <td></td> | |
5603 <td></td> | |
5604 <td></td> | |
5605 </tr><tr class=""> | |
5606 <th scope="row">rules_select</th> | |
5607 <td>FALSE</td> | |
5608 <td></td> | |
5609 <td></td> | |
5610 <td></td> | |
5611 </tr><tr class=""> | |
5612 <th scope="row">calcCaS</th> | |
5613 <td>false</td> | |
5614 <td></td> | |
5615 <td></td> | |
5616 <td></td> | |
5617 </tr><tr class=""> | |
5618 <th scope="row">calcCiS</th> | |
5619 <td>true</td> | |
5620 <td></td> | |
5621 <td></td> | |
5622 <td></td> | |
5623 </tr><tr class=""> | |
5624 <th scope="row">calcIso</th> | |
5625 <td>false</td> | |
5626 <td></td> | |
5627 <td></td> | |
5628 <td></td> | |
5629 </tr><tr class=""> | |
5630 <th scope="row">cor_eic_th</th> | |
5631 <td>0.75</td> | |
5632 <td></td> | |
5633 <td></td> | |
5634 <td></td> | |
5635 </tr><tr class=""> | |
5636 <th scope="row">graphMethod</th> | |
5637 <td>hcs</td> | |
5638 <td></td> | |
5639 <td></td> | |
5640 <td></td> | |
5641 </tr><tr class=""> | |
5642 <th scope="row">pval</th> | |
5643 <td>0.05</td> | |
5644 <td></td> | |
5645 <td></td> | |
5646 <td></td> | |
5647 </tr><tr class=""> | |
5648 <th scope="row">quick</th> | |
5649 <td>FALSE</td> | |
5650 <td></td> | |
5651 <td></td> | |
5652 <td></td> | |
5653 </tr> | |
5654 </table> | |
5655 </div> | |
5656 | |
5657 | |
5658 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
5659 <h2 | |
5660 class="history_metadata_extractor_h2" | |
5661 style="cursor: pointer" | |
5662 title="click to fold/unfold the table" | |
5663 > | |
5664 [DELETED] - abims_CAMERA_annotateDiffreport - 2.2.6+camera1.48.0-galaxy0 | |
5665 </h2> | |
5666 <p class="history_metadata_extractor_status"> | |
5667 Status: Failed (127) | |
5668 </p> | |
5669 <p class="history_metadata_extractor_glitter"></p> | |
5670 <table class=" | |
5671 table | |
5672 table-bordered | |
5673 table-dark | |
5674 table-striped | |
5675 table-hover | |
5676 d-block | |
5677 overflow-auto | |
5678 history_metadata_extractor_table | |
5679 "> | |
5680 <thead> | |
5681 <tr> | |
5682 <th scope="col"></th> | |
5683 <th scope="col">value</th> | |
5684 <th scope="col">name</th> | |
5685 <th scope="col">extension</th> | |
5686 <th scope="col">hid</th> | |
5687 </tr> | |
5688 </thead> | |
5689 <tr class=""> | |
5690 <th scope="row">option</th> | |
5691 <td>hide</td> | |
5692 <td></td> | |
5693 <td></td> | |
5694 <td></td> | |
5695 </tr><tr class=""> | |
5696 <th scope="row">convertRTMinute</th> | |
5697 <td>false</td> | |
5698 <td></td> | |
5699 <td></td> | |
5700 <td></td> | |
5701 </tr><tr class=""> | |
5702 <th scope="row">intval</th> | |
5703 <td>into</td> | |
5704 <td></td> | |
5705 <td></td> | |
5706 <td></td> | |
5707 </tr><tr class=""> | |
5708 <th scope="row">numDigitsMZ</th> | |
5709 <td>4</td> | |
5710 <td></td> | |
5711 <td></td> | |
5712 <td></td> | |
5713 </tr><tr class=""> | |
5714 <th scope="row">numDigitsRT</th> | |
5715 <td>0</td> | |
5716 <td></td> | |
5717 <td></td> | |
5718 <td></td> | |
5719 </tr><tr class=""> | |
5720 <th scope="row">file_load_select</th> | |
5721 <td>no</td> | |
5722 <td></td> | |
5723 <td></td> | |
5724 <td></td> | |
5725 </tr><tr class=""> | |
5726 <th scope="row">mzabs</th> | |
5727 <td>0.015</td> | |
5728 <td></td> | |
5729 <td></td> | |
5730 <td></td> | |
5731 </tr><tr class=""> | |
5732 <th scope="row">ppm</th> | |
5733 <td>5</td> | |
5734 <td></td> | |
5735 <td></td> | |
5736 <td></td> | |
5737 </tr><tr class=""> | |
5738 <th scope="row">maxcharge</th> | |
5739 <td>3</td> | |
5740 <td></td> | |
5741 <td></td> | |
5742 <td></td> | |
5743 </tr><tr class=""> | |
5744 <th scope="row">maxiso</th> | |
5745 <td>4</td> | |
5746 <td></td> | |
5747 <td></td> | |
5748 <td></td> | |
5749 </tr><tr class=""> | |
5750 <th scope="row">minfrac</th> | |
5751 <td>0.5</td> | |
5752 <td></td> | |
5753 <td></td> | |
5754 <td></td> | |
5755 </tr><tr class=""> | |
5756 <th scope="row">perfwhm</th> | |
5757 <td>0.6</td> | |
5758 <td></td> | |
5759 <td></td> | |
5760 <td></td> | |
5761 </tr><tr class=""> | |
5762 <th scope="row">sigma</th> | |
5763 <td>6</td> | |
5764 <td></td> | |
5765 <td></td> | |
5766 <td></td> | |
5767 </tr><tr class=""> | |
5768 <th scope="row">image</th> | |
5769 <td>9e77b3d7d0887128</td> | |
5770 <td>test.rdata</td> | |
5771 <td>rdata</td> | |
5772 <td>1</td> | |
5773 </tr><tr class=""> | |
5774 <th scope="row">max_peaks</th> | |
5775 <td>100</td> | |
5776 <td></td> | |
5777 <td></td> | |
5778 <td></td> | |
5779 </tr><tr class=""> | |
5780 <th scope="row">polarity</th> | |
5781 <td>negative</td> | |
5782 <td></td> | |
5783 <td></td> | |
5784 <td></td> | |
5785 </tr><tr class=""> | |
5786 <th scope="row">multiplier</th> | |
5787 <td>3</td> | |
5788 <td></td> | |
5789 <td></td> | |
5790 <td></td> | |
5791 </tr><tr class=""> | |
5792 <th scope="row">rules_select</th> | |
5793 <td>FALSE</td> | |
5794 <td></td> | |
5795 <td></td> | |
5796 <td></td> | |
5797 </tr><tr class=""> | |
5798 <th scope="row">calcCaS</th> | |
5799 <td>false</td> | |
5800 <td></td> | |
5801 <td></td> | |
5802 <td></td> | |
5803 </tr><tr class=""> | |
5804 <th scope="row">calcCiS</th> | |
5805 <td>true</td> | |
5806 <td></td> | |
5807 <td></td> | |
5808 <td></td> | |
5809 </tr><tr class=""> | |
5810 <th scope="row">calcIso</th> | |
5811 <td>false</td> | |
5812 <td></td> | |
5813 <td></td> | |
5814 <td></td> | |
5815 </tr><tr class=""> | |
5816 <th scope="row">cor_eic_th</th> | |
5817 <td>0.75</td> | |
5818 <td></td> | |
5819 <td></td> | |
5820 <td></td> | |
5821 </tr><tr class=""> | |
5822 <th scope="row">graphMethod</th> | |
5823 <td>hcs</td> | |
5824 <td></td> | |
5825 <td></td> | |
5826 <td></td> | |
5827 </tr><tr class=""> | |
5828 <th scope="row">pval</th> | |
5829 <td>0.05</td> | |
5830 <td></td> | |
5831 <td></td> | |
5832 <td></td> | |
5833 </tr><tr class=""> | |
5834 <th scope="row">quick</th> | |
5835 <td>FALSE</td> | |
5836 <td></td> | |
5837 <td></td> | |
5838 <td></td> | |
5839 </tr> | |
5840 </table> | |
5841 </div> | |
5842 | |
5843 | |
5844 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
5845 <h2 | |
5846 class="history_metadata_extractor_h2" | |
5847 style="cursor: pointer" | |
5848 title="click to fold/unfold the table" | |
5849 > | |
5850 [DELETED] - abims_CAMERA_annotateDiffreport - 2.2.6+camera1.48.0-galaxy0 | |
5851 </h2> | |
5852 <p class="history_metadata_extractor_status"> | |
5853 Status: Failed (127) | |
5854 </p> | |
5855 <p class="history_metadata_extractor_glitter"></p> | |
5856 <table class=" | |
5857 table | |
5858 table-bordered | |
5859 table-dark | |
5860 table-striped | |
5861 table-hover | |
5862 d-block | |
5863 overflow-auto | |
5864 history_metadata_extractor_table | |
5865 "> | |
5866 <thead> | |
5867 <tr> | |
5868 <th scope="col"></th> | |
5869 <th scope="col">value</th> | |
5870 <th scope="col">name</th> | |
5871 <th scope="col">extension</th> | |
5872 <th scope="col">hid</th> | |
5873 </tr> | |
5874 </thead> | |
5875 <tr class=""> | |
5876 <th scope="row">option</th> | |
5877 <td>hide</td> | |
5878 <td></td> | |
5879 <td></td> | |
5880 <td></td> | |
5881 </tr><tr class=""> | |
5882 <th scope="row">convertRTMinute</th> | |
5883 <td>false</td> | |
5884 <td></td> | |
5885 <td></td> | |
5886 <td></td> | |
5887 </tr><tr class=""> | |
5888 <th scope="row">intval</th> | |
5889 <td>into</td> | |
5890 <td></td> | |
5891 <td></td> | |
5892 <td></td> | |
5893 </tr><tr class=""> | |
5894 <th scope="row">numDigitsMZ</th> | |
5895 <td>4</td> | |
5896 <td></td> | |
5897 <td></td> | |
5898 <td></td> | |
5899 </tr><tr class=""> | |
5900 <th scope="row">numDigitsRT</th> | |
5901 <td>0</td> | |
5902 <td></td> | |
5903 <td></td> | |
5904 <td></td> | |
5905 </tr><tr class=""> | |
5906 <th scope="row">file_load_select</th> | |
5907 <td>no</td> | |
5908 <td></td> | |
5909 <td></td> | |
5910 <td></td> | |
5911 </tr><tr class=""> | |
5912 <th scope="row">mzabs</th> | |
5913 <td>0.015</td> | |
5914 <td></td> | |
5915 <td></td> | |
5916 <td></td> | |
5917 </tr><tr class=""> | |
5918 <th scope="row">ppm</th> | |
5919 <td>5</td> | |
5920 <td></td> | |
5921 <td></td> | |
5922 <td></td> | |
5923 </tr><tr class=""> | |
5924 <th scope="row">maxcharge</th> | |
5925 <td>3</td> | |
5926 <td></td> | |
5927 <td></td> | |
5928 <td></td> | |
5929 </tr><tr class=""> | |
5930 <th scope="row">maxiso</th> | |
5931 <td>4</td> | |
5932 <td></td> | |
5933 <td></td> | |
5934 <td></td> | |
5935 </tr><tr class=""> | |
5936 <th scope="row">minfrac</th> | |
5937 <td>0.5</td> | |
5938 <td></td> | |
5939 <td></td> | |
5940 <td></td> | |
5941 </tr><tr class=""> | |
5942 <th scope="row">perfwhm</th> | |
5943 <td>0.6</td> | |
5944 <td></td> | |
5945 <td></td> | |
5946 <td></td> | |
5947 </tr><tr class=""> | |
5948 <th scope="row">sigma</th> | |
5949 <td>6</td> | |
5950 <td></td> | |
5951 <td></td> | |
5952 <td></td> | |
5953 </tr><tr class=""> | |
5954 <th scope="row">image</th> | |
5955 <td>9e77b3d7d0887128</td> | |
5956 <td>test.rdata</td> | |
5957 <td>rdata</td> | |
5958 <td>1</td> | |
5959 </tr><tr class=""> | |
5960 <th scope="row">max_peaks</th> | |
5961 <td>100</td> | |
5962 <td></td> | |
5963 <td></td> | |
5964 <td></td> | |
5965 </tr><tr class=""> | |
5966 <th scope="row">polarity</th> | |
5967 <td>negative</td> | |
5968 <td></td> | |
5969 <td></td> | |
5970 <td></td> | |
5971 </tr><tr class=""> | |
5972 <th scope="row">multiplier</th> | |
5973 <td>3</td> | |
5974 <td></td> | |
5975 <td></td> | |
5976 <td></td> | |
5977 </tr><tr class=""> | |
5978 <th scope="row">rules_select</th> | |
5979 <td>FALSE</td> | |
5980 <td></td> | |
5981 <td></td> | |
5982 <td></td> | |
5983 </tr><tr class=""> | |
5984 <th scope="row">calcCaS</th> | |
5985 <td>false</td> | |
5986 <td></td> | |
5987 <td></td> | |
5988 <td></td> | |
5989 </tr><tr class=""> | |
5990 <th scope="row">calcCiS</th> | |
5991 <td>true</td> | |
5992 <td></td> | |
5993 <td></td> | |
5994 <td></td> | |
5995 </tr><tr class=""> | |
5996 <th scope="row">calcIso</th> | |
5997 <td>false</td> | |
5998 <td></td> | |
5999 <td></td> | |
6000 <td></td> | |
6001 </tr><tr class=""> | |
6002 <th scope="row">cor_eic_th</th> | |
6003 <td>0.75</td> | |
6004 <td></td> | |
6005 <td></td> | |
6006 <td></td> | |
6007 </tr><tr class=""> | |
6008 <th scope="row">graphMethod</th> | |
6009 <td>hcs</td> | |
6010 <td></td> | |
6011 <td></td> | |
6012 <td></td> | |
6013 </tr><tr class=""> | |
6014 <th scope="row">pval</th> | |
6015 <td>0.05</td> | |
6016 <td></td> | |
6017 <td></td> | |
6018 <td></td> | |
6019 </tr><tr class=""> | |
6020 <th scope="row">quick</th> | |
6021 <td>FALSE</td> | |
6022 <td></td> | |
6023 <td></td> | |
6024 <td></td> | |
6025 </tr> | |
6026 </table> | |
6027 </div> | |
6028 | |
6029 | |
6030 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
6031 <h2 | |
6032 class="history_metadata_extractor_h2" | |
6033 style="cursor: pointer" | |
6034 title="click to fold/unfold the table" | |
6035 > | |
6036 [DELETED] - abims_CAMERA_annotateDiffreport - 2.2.6+camera1.48.0-galaxy0 | |
6037 </h2> | |
6038 <p class="history_metadata_extractor_status"> | |
6039 Status: Failed (127) | |
6040 </p> | |
6041 <p class="history_metadata_extractor_glitter"></p> | |
6042 <table class=" | |
6043 table | |
6044 table-bordered | |
6045 table-dark | |
6046 table-striped | |
6047 table-hover | |
6048 d-block | |
6049 overflow-auto | |
6050 history_metadata_extractor_table | |
6051 "> | |
6052 <thead> | |
6053 <tr> | |
6054 <th scope="col"></th> | |
6055 <th scope="col">value</th> | |
6056 <th scope="col">name</th> | |
6057 <th scope="col">extension</th> | |
6058 <th scope="col">hid</th> | |
6059 </tr> | |
6060 </thead> | |
6061 <tr class=""> | |
6062 <th scope="row">option</th> | |
6063 <td>hide</td> | |
6064 <td></td> | |
6065 <td></td> | |
6066 <td></td> | |
6067 </tr><tr class=""> | |
6068 <th scope="row">convertRTMinute</th> | |
6069 <td>false</td> | |
6070 <td></td> | |
6071 <td></td> | |
6072 <td></td> | |
6073 </tr><tr class=""> | |
6074 <th scope="row">intval</th> | |
6075 <td>into</td> | |
6076 <td></td> | |
6077 <td></td> | |
6078 <td></td> | |
6079 </tr><tr class=""> | |
6080 <th scope="row">numDigitsMZ</th> | |
6081 <td>4</td> | |
6082 <td></td> | |
6083 <td></td> | |
6084 <td></td> | |
6085 </tr><tr class=""> | |
6086 <th scope="row">numDigitsRT</th> | |
6087 <td>0</td> | |
6088 <td></td> | |
6089 <td></td> | |
6090 <td></td> | |
6091 </tr><tr class=""> | |
6092 <th scope="row">file_load_select</th> | |
6093 <td>no</td> | |
6094 <td></td> | |
6095 <td></td> | |
6096 <td></td> | |
6097 </tr><tr class=""> | |
6098 <th scope="row">mzabs</th> | |
6099 <td>0.015</td> | |
6100 <td></td> | |
6101 <td></td> | |
6102 <td></td> | |
6103 </tr><tr class=""> | |
6104 <th scope="row">ppm</th> | |
6105 <td>5</td> | |
6106 <td></td> | |
6107 <td></td> | |
6108 <td></td> | |
6109 </tr><tr class=""> | |
6110 <th scope="row">maxcharge</th> | |
6111 <td>3</td> | |
6112 <td></td> | |
6113 <td></td> | |
6114 <td></td> | |
6115 </tr><tr class=""> | |
6116 <th scope="row">maxiso</th> | |
6117 <td>4</td> | |
6118 <td></td> | |
6119 <td></td> | |
6120 <td></td> | |
6121 </tr><tr class=""> | |
6122 <th scope="row">minfrac</th> | |
6123 <td>0.5</td> | |
6124 <td></td> | |
6125 <td></td> | |
6126 <td></td> | |
6127 </tr><tr class=""> | |
6128 <th scope="row">perfwhm</th> | |
6129 <td>0.6</td> | |
6130 <td></td> | |
6131 <td></td> | |
6132 <td></td> | |
6133 </tr><tr class=""> | |
6134 <th scope="row">sigma</th> | |
6135 <td>6</td> | |
6136 <td></td> | |
6137 <td></td> | |
6138 <td></td> | |
6139 </tr><tr class=""> | |
6140 <th scope="row">image</th> | |
6141 <td>9e77b3d7d0887128</td> | |
6142 <td>test.rdata</td> | |
6143 <td>rdata</td> | |
6144 <td>1</td> | |
6145 </tr><tr class=""> | |
6146 <th scope="row">max_peaks</th> | |
6147 <td>100</td> | |
6148 <td></td> | |
6149 <td></td> | |
6150 <td></td> | |
6151 </tr><tr class=""> | |
6152 <th scope="row">polarity</th> | |
6153 <td>negative</td> | |
6154 <td></td> | |
6155 <td></td> | |
6156 <td></td> | |
6157 </tr><tr class=""> | |
6158 <th scope="row">multiplier</th> | |
6159 <td>3</td> | |
6160 <td></td> | |
6161 <td></td> | |
6162 <td></td> | |
6163 </tr><tr class=""> | |
6164 <th scope="row">rules_select</th> | |
6165 <td>FALSE</td> | |
6166 <td></td> | |
6167 <td></td> | |
6168 <td></td> | |
6169 </tr><tr class=""> | |
6170 <th scope="row">calcCaS</th> | |
6171 <td>false</td> | |
6172 <td></td> | |
6173 <td></td> | |
6174 <td></td> | |
6175 </tr><tr class=""> | |
6176 <th scope="row">calcCiS</th> | |
6177 <td>true</td> | |
6178 <td></td> | |
6179 <td></td> | |
6180 <td></td> | |
6181 </tr><tr class=""> | |
6182 <th scope="row">calcIso</th> | |
6183 <td>false</td> | |
6184 <td></td> | |
6185 <td></td> | |
6186 <td></td> | |
6187 </tr><tr class=""> | |
6188 <th scope="row">cor_eic_th</th> | |
6189 <td>0.75</td> | |
6190 <td></td> | |
6191 <td></td> | |
6192 <td></td> | |
6193 </tr><tr class=""> | |
6194 <th scope="row">graphMethod</th> | |
6195 <td>hcs</td> | |
6196 <td></td> | |
6197 <td></td> | |
6198 <td></td> | |
6199 </tr><tr class=""> | |
6200 <th scope="row">pval</th> | |
6201 <td>0.05</td> | |
6202 <td></td> | |
6203 <td></td> | |
6204 <td></td> | |
6205 </tr><tr class=""> | |
6206 <th scope="row">quick</th> | |
6207 <td>FALSE</td> | |
6208 <td></td> | |
6209 <td></td> | |
6210 <td></td> | |
6211 </tr> | |
6212 </table> | |
6213 </div> | |
6214 | |
6215 | |
6216 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
6217 <h2 | |
6218 class="history_metadata_extractor_h2" | |
6219 style="cursor: pointer" | |
6220 title="click to fold/unfold the table" | |
6221 > | |
6222 [DELETED] - abims_CAMERA_annotateDiffreport - 2.2.6+camera1.48.0-galaxy0 | |
6223 </h2> | |
6224 <p class="history_metadata_extractor_status"> | |
6225 Status: Failed (1) | |
6226 </p> | |
6227 <p class="history_metadata_extractor_glitter"></p> | |
6228 <table class=" | |
6229 table | |
6230 table-bordered | |
6231 table-dark | |
6232 table-striped | |
6233 table-hover | |
6234 d-block | |
6235 overflow-auto | |
6236 history_metadata_extractor_table | |
6237 "> | |
6238 <thead> | |
6239 <tr> | |
6240 <th scope="col"></th> | |
6241 <th scope="col">value</th> | |
6242 <th scope="col">name</th> | |
6243 <th scope="col">extension</th> | |
6244 <th scope="col">hid</th> | |
6245 </tr> | |
6246 </thead> | |
6247 <tr class=""> | |
6248 <th scope="row">option</th> | |
6249 <td>hide</td> | |
6250 <td></td> | |
6251 <td></td> | |
6252 <td></td> | |
6253 </tr><tr class=""> | |
6254 <th scope="row">convertRTMinute</th> | |
6255 <td>false</td> | |
6256 <td></td> | |
6257 <td></td> | |
6258 <td></td> | |
6259 </tr><tr class=""> | |
6260 <th scope="row">intval</th> | |
6261 <td>into</td> | |
6262 <td></td> | |
6263 <td></td> | |
6264 <td></td> | |
6265 </tr><tr class=""> | |
6266 <th scope="row">numDigitsMZ</th> | |
6267 <td>4</td> | |
6268 <td></td> | |
6269 <td></td> | |
6270 <td></td> | |
6271 </tr><tr class=""> | |
6272 <th scope="row">numDigitsRT</th> | |
6273 <td>0</td> | |
6274 <td></td> | |
6275 <td></td> | |
6276 <td></td> | |
6277 </tr><tr class=""> | |
6278 <th scope="row">file_load_select</th> | |
6279 <td>no</td> | |
6280 <td></td> | |
6281 <td></td> | |
6282 <td></td> | |
6283 </tr><tr class=""> | |
6284 <th scope="row">mzabs</th> | |
6285 <td>0.015</td> | |
6286 <td></td> | |
6287 <td></td> | |
6288 <td></td> | |
6289 </tr><tr class=""> | |
6290 <th scope="row">ppm</th> | |
6291 <td>5</td> | |
6292 <td></td> | |
6293 <td></td> | |
6294 <td></td> | |
6295 </tr><tr class=""> | |
6296 <th scope="row">maxcharge</th> | |
6297 <td>3</td> | |
6298 <td></td> | |
6299 <td></td> | |
6300 <td></td> | |
6301 </tr><tr class=""> | |
6302 <th scope="row">maxiso</th> | |
6303 <td>4</td> | |
6304 <td></td> | |
6305 <td></td> | |
6306 <td></td> | |
6307 </tr><tr class=""> | |
6308 <th scope="row">minfrac</th> | |
6309 <td>0.5</td> | |
6310 <td></td> | |
6311 <td></td> | |
6312 <td></td> | |
6313 </tr><tr class=""> | |
6314 <th scope="row">perfwhm</th> | |
6315 <td>0.6</td> | |
6316 <td></td> | |
6317 <td></td> | |
6318 <td></td> | |
6319 </tr><tr class=""> | |
6320 <th scope="row">sigma</th> | |
6321 <td>6</td> | |
6322 <td></td> | |
6323 <td></td> | |
6324 <td></td> | |
6325 </tr><tr class=""> | |
6326 <th scope="row">image</th> | |
6327 <td>9e77b3d7d0887128</td> | |
6328 <td>test.rdata</td> | |
6329 <td>rdata</td> | |
6330 <td>1</td> | |
6331 </tr><tr class=""> | |
6332 <th scope="row">max_peaks</th> | |
6333 <td>100</td> | |
6334 <td></td> | |
6335 <td></td> | |
6336 <td></td> | |
6337 </tr><tr class=""> | |
6338 <th scope="row">polarity</th> | |
6339 <td>negative</td> | |
6340 <td></td> | |
6341 <td></td> | |
6342 <td></td> | |
6343 </tr><tr class=""> | |
6344 <th scope="row">multiplier</th> | |
6345 <td>3</td> | |
6346 <td></td> | |
6347 <td></td> | |
6348 <td></td> | |
6349 </tr><tr class=""> | |
6350 <th scope="row">rules_select</th> | |
6351 <td>FALSE</td> | |
6352 <td></td> | |
6353 <td></td> | |
6354 <td></td> | |
6355 </tr><tr class=""> | |
6356 <th scope="row">calcCaS</th> | |
6357 <td>false</td> | |
6358 <td></td> | |
6359 <td></td> | |
6360 <td></td> | |
6361 </tr><tr class=""> | |
6362 <th scope="row">calcCiS</th> | |
6363 <td>true</td> | |
6364 <td></td> | |
6365 <td></td> | |
6366 <td></td> | |
6367 </tr><tr class=""> | |
6368 <th scope="row">calcIso</th> | |
6369 <td>false</td> | |
6370 <td></td> | |
6371 <td></td> | |
6372 <td></td> | |
6373 </tr><tr class=""> | |
6374 <th scope="row">cor_eic_th</th> | |
6375 <td>0.75</td> | |
6376 <td></td> | |
6377 <td></td> | |
6378 <td></td> | |
6379 </tr><tr class=""> | |
6380 <th scope="row">graphMethod</th> | |
6381 <td>hcs</td> | |
6382 <td></td> | |
6383 <td></td> | |
6384 <td></td> | |
6385 </tr><tr class=""> | |
6386 <th scope="row">pval</th> | |
6387 <td>0.05</td> | |
6388 <td></td> | |
6389 <td></td> | |
6390 <td></td> | |
6391 </tr><tr class=""> | |
6392 <th scope="row">quick</th> | |
6393 <td>FALSE</td> | |
6394 <td></td> | |
6395 <td></td> | |
6396 <td></td> | |
6397 </tr> | |
6398 </table> | |
6399 </div> | |
6400 | |
6401 | |
6402 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
6403 <h2 | |
6404 class="history_metadata_extractor_h2" | |
6405 style="cursor: pointer" | |
6406 title="click to fold/unfold the table" | |
6407 > | |
6408 [DELETED] - abims_CAMERA_annotateDiffreport - 2.2.6+camera1.48.0-galaxy0 | |
6409 </h2> | |
6410 <p class="history_metadata_extractor_status"> | |
6411 Status: Failed (1) | |
6412 </p> | |
6413 <p class="history_metadata_extractor_glitter"></p> | |
6414 <table class=" | |
6415 table | |
6416 table-bordered | |
6417 table-dark | |
6418 table-striped | |
6419 table-hover | |
6420 d-block | |
6421 overflow-auto | |
6422 history_metadata_extractor_table | |
6423 "> | |
6424 <thead> | |
6425 <tr> | |
6426 <th scope="col"></th> | |
6427 <th scope="col">value</th> | |
6428 <th scope="col">name</th> | |
6429 <th scope="col">extension</th> | |
6430 <th scope="col">hid</th> | |
6431 </tr> | |
6432 </thead> | |
6433 <tr class=""> | |
6434 <th scope="row">option</th> | |
6435 <td>hide</td> | |
6436 <td></td> | |
6437 <td></td> | |
6438 <td></td> | |
6439 </tr><tr class=""> | |
6440 <th scope="row">convertRTMinute</th> | |
6441 <td>false</td> | |
6442 <td></td> | |
6443 <td></td> | |
6444 <td></td> | |
6445 </tr><tr class=""> | |
6446 <th scope="row">intval</th> | |
6447 <td>into</td> | |
6448 <td></td> | |
6449 <td></td> | |
6450 <td></td> | |
6451 </tr><tr class=""> | |
6452 <th scope="row">numDigitsMZ</th> | |
6453 <td>4</td> | |
6454 <td></td> | |
6455 <td></td> | |
6456 <td></td> | |
6457 </tr><tr class=""> | |
6458 <th scope="row">numDigitsRT</th> | |
6459 <td>0</td> | |
6460 <td></td> | |
6461 <td></td> | |
6462 <td></td> | |
6463 </tr><tr class=""> | |
6464 <th scope="row">file_load_select</th> | |
6465 <td>no</td> | |
6466 <td></td> | |
6467 <td></td> | |
6468 <td></td> | |
6469 </tr><tr class=""> | |
6470 <th scope="row">mzabs</th> | |
6471 <td>0.015</td> | |
6472 <td></td> | |
6473 <td></td> | |
6474 <td></td> | |
6475 </tr><tr class=""> | |
6476 <th scope="row">ppm</th> | |
6477 <td>5</td> | |
6478 <td></td> | |
6479 <td></td> | |
6480 <td></td> | |
6481 </tr><tr class=""> | |
6482 <th scope="row">maxcharge</th> | |
6483 <td>3</td> | |
6484 <td></td> | |
6485 <td></td> | |
6486 <td></td> | |
6487 </tr><tr class=""> | |
6488 <th scope="row">maxiso</th> | |
6489 <td>4</td> | |
6490 <td></td> | |
6491 <td></td> | |
6492 <td></td> | |
6493 </tr><tr class=""> | |
6494 <th scope="row">minfrac</th> | |
6495 <td>0.5</td> | |
6496 <td></td> | |
6497 <td></td> | |
6498 <td></td> | |
6499 </tr><tr class=""> | |
6500 <th scope="row">perfwhm</th> | |
6501 <td>0.6</td> | |
6502 <td></td> | |
6503 <td></td> | |
6504 <td></td> | |
6505 </tr><tr class=""> | |
6506 <th scope="row">sigma</th> | |
6507 <td>6</td> | |
6508 <td></td> | |
6509 <td></td> | |
6510 <td></td> | |
6511 </tr><tr class=""> | |
6512 <th scope="row">image</th> | |
6513 <td>9e77b3d7d0887128</td> | |
6514 <td>test.rdata</td> | |
6515 <td>rdata</td> | |
6516 <td>1</td> | |
6517 </tr><tr class=""> | |
6518 <th scope="row">max_peaks</th> | |
6519 <td>100</td> | |
6520 <td></td> | |
6521 <td></td> | |
6522 <td></td> | |
6523 </tr><tr class=""> | |
6524 <th scope="row">polarity</th> | |
6525 <td>negative</td> | |
6526 <td></td> | |
6527 <td></td> | |
6528 <td></td> | |
6529 </tr><tr class=""> | |
6530 <th scope="row">multiplier</th> | |
6531 <td>3</td> | |
6532 <td></td> | |
6533 <td></td> | |
6534 <td></td> | |
6535 </tr><tr class=""> | |
6536 <th scope="row">rules_select</th> | |
6537 <td>FALSE</td> | |
6538 <td></td> | |
6539 <td></td> | |
6540 <td></td> | |
6541 </tr><tr class=""> | |
6542 <th scope="row">calcCaS</th> | |
6543 <td>false</td> | |
6544 <td></td> | |
6545 <td></td> | |
6546 <td></td> | |
6547 </tr><tr class=""> | |
6548 <th scope="row">calcCiS</th> | |
6549 <td>true</td> | |
6550 <td></td> | |
6551 <td></td> | |
6552 <td></td> | |
6553 </tr><tr class=""> | |
6554 <th scope="row">calcIso</th> | |
6555 <td>false</td> | |
6556 <td></td> | |
6557 <td></td> | |
6558 <td></td> | |
6559 </tr><tr class=""> | |
6560 <th scope="row">cor_eic_th</th> | |
6561 <td>0.75</td> | |
6562 <td></td> | |
6563 <td></td> | |
6564 <td></td> | |
6565 </tr><tr class=""> | |
6566 <th scope="row">graphMethod</th> | |
6567 <td>hcs</td> | |
6568 <td></td> | |
6569 <td></td> | |
6570 <td></td> | |
6571 </tr><tr class=""> | |
6572 <th scope="row">pval</th> | |
6573 <td>0.05</td> | |
6574 <td></td> | |
6575 <td></td> | |
6576 <td></td> | |
6577 </tr><tr class=""> | |
6578 <th scope="row">quick</th> | |
6579 <td>FALSE</td> | |
6580 <td></td> | |
6581 <td></td> | |
6582 <td></td> | |
6583 </tr> | |
6584 </table> | |
6585 </div> | |
6586 | |
6587 | |
6588 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
6589 <h2 | |
6590 class="history_metadata_extractor_h2" | |
6591 style="cursor: pointer" | |
6592 title="click to fold/unfold the table" | |
6593 > | |
6594 [DELETED] - abims_xcms_retcor - 3.12.0+galaxy0 | |
6595 </h2> | |
6596 <p class="history_metadata_extractor_status"> | |
6597 Status: Failed (1) | |
6598 </p> | |
6599 <p class="history_metadata_extractor_glitter"></p> | |
6600 <table class=" | |
6601 table | |
6602 table-bordered | |
6603 table-dark | |
6604 table-striped | |
6605 table-hover | |
6606 d-block | |
6607 overflow-auto | |
6608 history_metadata_extractor_table | |
6609 "> | |
6610 <thead> | |
6611 <tr> | |
6612 <th scope="col"></th> | |
6613 <th scope="col">value</th> | |
6614 <th scope="col">name</th> | |
6615 <th scope="col">extension</th> | |
6616 <th scope="col">hid</th> | |
6617 </tr> | |
6618 </thead> | |
6619 <tr class=""> | |
6620 <th scope="row">file_load_select</th> | |
6621 <td>no</td> | |
6622 <td></td> | |
6623 <td></td> | |
6624 <td></td> | |
6625 </tr><tr class=""> | |
6626 <th scope="row">image</th> | |
6627 <td>9e77b3d7d0887128</td> | |
6628 <td>test.rdata</td> | |
6629 <td>rdata</td> | |
6630 <td>1</td> | |
6631 </tr><tr class=""> | |
6632 <th scope="row">extraPeaks</th> | |
6633 <td>1</td> | |
6634 <td></td> | |
6635 <td></td> | |
6636 <td></td> | |
6637 </tr><tr class=""> | |
6638 <th scope="row">method</th> | |
6639 <td>PeakGroups</td> | |
6640 <td></td> | |
6641 <td></td> | |
6642 <td></td> | |
6643 </tr><tr class=""> | |
6644 <th scope="row">minFraction</th> | |
6645 <td>0.9</td> | |
6646 <td></td> | |
6647 <td></td> | |
6648 <td></td> | |
6649 </tr><tr class=""> | |
6650 <th scope="row">family</th> | |
6651 <td>gaussian</td> | |
6652 <td></td> | |
6653 <td></td> | |
6654 <td></td> | |
6655 </tr><tr class=""> | |
6656 <th scope="row">span</th> | |
6657 <td>0.2</td> | |
6658 <td></td> | |
6659 <td></td> | |
6660 <td></td> | |
6661 </tr><tr class=""> | |
6662 <th scope="row">smooth</th> | |
6663 <td>loess</td> | |
6664 <td></td> | |
6665 <td></td> | |
6666 <td></td> | |
6667 </tr> | |
6668 </table> | |
6669 </div> | |
6670 | |
6671 | |
6672 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
6673 <h2 | |
6674 class="history_metadata_extractor_h2" | |
6675 style="cursor: pointer" | |
6676 title="click to fold/unfold the table" | |
6677 > | |
6678 [DELETED] - abims_xcms_retcor - 3.12.0+galaxy0 | |
6679 </h2> | |
6680 <p class="history_metadata_extractor_status"> | |
6681 Status: Failed (1) | |
6682 </p> | |
6683 <p class="history_metadata_extractor_glitter"></p> | |
6684 <table class=" | |
6685 table | |
6686 table-bordered | |
6687 table-dark | |
6688 table-striped | |
6689 table-hover | |
6690 d-block | |
6691 overflow-auto | |
6692 history_metadata_extractor_table | |
6693 "> | |
6694 <thead> | |
6695 <tr> | |
6696 <th scope="col"></th> | |
6697 <th scope="col">value</th> | |
6698 <th scope="col">name</th> | |
6699 <th scope="col">extension</th> | |
6700 <th scope="col">hid</th> | |
6701 </tr> | |
6702 </thead> | |
6703 <tr class=""> | |
6704 <th scope="row">file_load_select</th> | |
6705 <td>no</td> | |
6706 <td></td> | |
6707 <td></td> | |
6708 <td></td> | |
6709 </tr><tr class=""> | |
6710 <th scope="row">image</th> | |
6711 <td>9e77b3d7d0887128</td> | |
6712 <td>test.rdata</td> | |
6713 <td>rdata</td> | |
6714 <td>1</td> | |
6715 </tr><tr class=""> | |
6716 <th scope="row">extraPeaks</th> | |
6717 <td>1</td> | |
6718 <td></td> | |
6719 <td></td> | |
6720 <td></td> | |
6721 </tr><tr class=""> | |
6722 <th scope="row">method</th> | |
6723 <td>PeakGroups</td> | |
6724 <td></td> | |
6725 <td></td> | |
6726 <td></td> | |
6727 </tr><tr class=""> | |
6728 <th scope="row">minFraction</th> | |
6729 <td>0.9</td> | |
6730 <td></td> | |
6731 <td></td> | |
6732 <td></td> | |
6733 </tr><tr class=""> | |
6734 <th scope="row">family</th> | |
6735 <td>gaussian</td> | |
6736 <td></td> | |
6737 <td></td> | |
6738 <td></td> | |
6739 </tr><tr class=""> | |
6740 <th scope="row">span</th> | |
6741 <td>0.2</td> | |
6742 <td></td> | |
6743 <td></td> | |
6744 <td></td> | |
6745 </tr><tr class=""> | |
6746 <th scope="row">smooth</th> | |
6747 <td>loess</td> | |
6748 <td></td> | |
6749 <td></td> | |
6750 <td></td> | |
6751 </tr> | |
6752 </table> | |
6753 </div> | |
6754 | |
6755 | |
6756 <div class="alert alert-success history_metadata_extractor_deleted"> | |
6757 <h2 | |
6758 class="history_metadata_extractor_h2" | |
6759 style="cursor: pointer" | |
6760 title="click to fold/unfold the table" | |
6761 > | |
6762 [DELETED] - abims_xcms_summary - 3.12.0+galaxy0 | |
6763 </h2> | |
6764 <p class="history_metadata_extractor_status"> | |
6765 Status: Ok (0) | |
6766 </p> | |
6767 <p class="history_metadata_extractor_glitter"></p> | |
6768 <table class=" | |
6769 table | |
6770 table-bordered | |
6771 table-dark | |
6772 table-striped | |
6773 table-hover | |
6774 d-block | |
6775 overflow-auto | |
6776 history_metadata_extractor_table | |
6777 "> | |
6778 <thead> | |
6779 <tr> | |
6780 <th scope="col"></th> | |
6781 <th scope="col">value</th> | |
6782 <th scope="col">name</th> | |
6783 <th scope="col">extension</th> | |
6784 <th scope="col">hid</th> | |
6785 </tr> | |
6786 </thead> | |
6787 <tr class=""> | |
6788 <th scope="row">image</th> | |
6789 <td>9e77b3d7d0887128</td> | |
6790 <td>test.rdata</td> | |
6791 <td>rdata</td> | |
6792 <td>1</td> | |
6793 </tr> | |
6794 </table> | |
6795 </div> | |
6796 | |
6797 | |
6798 <div class="alert alert-success history_metadata_extractor_deleted"> | |
6799 <h2 | |
6800 class="history_metadata_extractor_h2" | |
6801 style="cursor: pointer" | |
6802 title="click to fold/unfold the table" | |
6803 > | |
6804 [DELETED] - abims_xcms_summary - 3.12.0+galaxy0 | |
6805 </h2> | |
6806 <p class="history_metadata_extractor_status"> | |
6807 Status: Ok (0) | |
6808 </p> | |
6809 <p class="history_metadata_extractor_glitter"></p> | |
6810 <table class=" | |
6811 table | |
6812 table-bordered | |
6813 table-dark | |
6814 table-striped | |
6815 table-hover | |
6816 d-block | |
6817 overflow-auto | |
6818 history_metadata_extractor_table | |
6819 "> | |
6820 <thead> | |
6821 <tr> | |
6822 <th scope="col"></th> | |
6823 <th scope="col">value</th> | |
6824 <th scope="col">name</th> | |
6825 <th scope="col">extension</th> | |
6826 <th scope="col">hid</th> | |
6827 </tr> | |
6828 </thead> | |
6829 <tr class=""> | |
6830 <th scope="row">image</th> | |
6831 <td>9e77b3d7d0887128</td> | |
6832 <td>test.rdata</td> | |
6833 <td>rdata</td> | |
6834 <td>1</td> | |
6835 </tr> | |
6836 </table> | |
6837 </div> | |
6838 | |
6839 | |
6840 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
6841 <h2 | |
6842 class="history_metadata_extractor_h2" | |
6843 style="cursor: pointer" | |
6844 title="click to fold/unfold the table" | |
6845 > | |
6846 [DELETED] - abims_xcms_group - 3.12.0+galaxy0 | |
6847 </h2> | |
6848 <p class="history_metadata_extractor_status"> | |
6849 Status: Failed (1) | |
6850 </p> | |
6851 <p class="history_metadata_extractor_glitter"></p> | |
6852 <table class=" | |
6853 table | |
6854 table-bordered | |
6855 table-dark | |
6856 table-striped | |
6857 table-hover | |
6858 d-block | |
6859 overflow-auto | |
6860 history_metadata_extractor_table | |
6861 "> | |
6862 <thead> | |
6863 <tr> | |
6864 <th scope="col"></th> | |
6865 <th scope="col">value</th> | |
6866 <th scope="col">name</th> | |
6867 <th scope="col">extension</th> | |
6868 <th scope="col">hid</th> | |
6869 </tr> | |
6870 </thead> | |
6871 <tr class=""> | |
6872 <th scope="row">file_load_select</th> | |
6873 <td>no</td> | |
6874 <td></td> | |
6875 <td></td> | |
6876 <td></td> | |
6877 </tr><tr class=""> | |
6878 <th scope="row">image</th> | |
6879 <td>9e77b3d7d0887128</td> | |
6880 <td>test.rdata</td> | |
6881 <td>rdata</td> | |
6882 <td>1</td> | |
6883 </tr><tr class=""> | |
6884 <th scope="row">maxFeatures</th> | |
6885 <td>50</td> | |
6886 <td></td> | |
6887 <td></td> | |
6888 <td></td> | |
6889 </tr><tr class=""> | |
6890 <th scope="row">binSize</th> | |
6891 <td>0.25</td> | |
6892 <td></td> | |
6893 <td></td> | |
6894 <td></td> | |
6895 </tr><tr class=""> | |
6896 <th scope="row">bw</th> | |
6897 <td>30.0</td> | |
6898 <td></td> | |
6899 <td></td> | |
6900 <td></td> | |
6901 </tr><tr class=""> | |
6902 <th scope="row">method</th> | |
6903 <td>PeakDensity</td> | |
6904 <td></td> | |
6905 <td></td> | |
6906 <td></td> | |
6907 </tr><tr class=""> | |
6908 <th scope="row">minFraction</th> | |
6909 <td>0.5</td> | |
6910 <td></td> | |
6911 <td></td> | |
6912 <td></td> | |
6913 </tr><tr class=""> | |
6914 <th scope="row">minSamples</th> | |
6915 <td>1</td> | |
6916 <td></td> | |
6917 <td></td> | |
6918 <td></td> | |
6919 </tr><tr class=""> | |
6920 <th scope="row">peaklistBool</th> | |
6921 <td>false</td> | |
6922 <td></td> | |
6923 <td></td> | |
6924 <td></td> | |
6925 </tr> | |
6926 </table> | |
6927 </div> | |
6928 | |
6929 | |
6930 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
6931 <h2 | |
6932 class="history_metadata_extractor_h2" | |
6933 style="cursor: pointer" | |
6934 title="click to fold/unfold the table" | |
6935 > | |
6936 [DELETED] - abims_xcms_group - 3.12.0+galaxy0 | |
6937 </h2> | |
6938 <p class="history_metadata_extractor_status"> | |
6939 Status: Failed (1) | |
6940 </p> | |
6941 <p class="history_metadata_extractor_glitter"></p> | |
6942 <table class=" | |
6943 table | |
6944 table-bordered | |
6945 table-dark | |
6946 table-striped | |
6947 table-hover | |
6948 d-block | |
6949 overflow-auto | |
6950 history_metadata_extractor_table | |
6951 "> | |
6952 <thead> | |
6953 <tr> | |
6954 <th scope="col"></th> | |
6955 <th scope="col">value</th> | |
6956 <th scope="col">name</th> | |
6957 <th scope="col">extension</th> | |
6958 <th scope="col">hid</th> | |
6959 </tr> | |
6960 </thead> | |
6961 <tr class=""> | |
6962 <th scope="row">file_load_select</th> | |
6963 <td>no</td> | |
6964 <td></td> | |
6965 <td></td> | |
6966 <td></td> | |
6967 </tr><tr class=""> | |
6968 <th scope="row">image</th> | |
6969 <td>9e77b3d7d0887128</td> | |
6970 <td>test.rdata</td> | |
6971 <td>rdata</td> | |
6972 <td>1</td> | |
6973 </tr><tr class=""> | |
6974 <th scope="row">maxFeatures</th> | |
6975 <td>50</td> | |
6976 <td></td> | |
6977 <td></td> | |
6978 <td></td> | |
6979 </tr><tr class=""> | |
6980 <th scope="row">binSize</th> | |
6981 <td>0.25</td> | |
6982 <td></td> | |
6983 <td></td> | |
6984 <td></td> | |
6985 </tr><tr class=""> | |
6986 <th scope="row">bw</th> | |
6987 <td>30.0</td> | |
6988 <td></td> | |
6989 <td></td> | |
6990 <td></td> | |
6991 </tr><tr class=""> | |
6992 <th scope="row">method</th> | |
6993 <td>PeakDensity</td> | |
6994 <td></td> | |
6995 <td></td> | |
6996 <td></td> | |
6997 </tr><tr class=""> | |
6998 <th scope="row">minFraction</th> | |
6999 <td>0.5</td> | |
7000 <td></td> | |
7001 <td></td> | |
7002 <td></td> | |
7003 </tr><tr class=""> | |
7004 <th scope="row">minSamples</th> | |
7005 <td>1</td> | |
7006 <td></td> | |
7007 <td></td> | |
7008 <td></td> | |
7009 </tr><tr class=""> | |
7010 <th scope="row">peaklistBool</th> | |
7011 <td>false</td> | |
7012 <td></td> | |
7013 <td></td> | |
7014 <td></td> | |
7015 </tr> | |
7016 </table> | |
7017 </div> | |
7018 | |
7019 | |
7020 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
7021 <h2 | |
7022 class="history_metadata_extractor_h2" | |
7023 style="cursor: pointer" | |
7024 title="click to fold/unfold the table" | |
7025 > | |
7026 [DELETED] - abims_xcms_group - 3.12.0+galaxy0 | |
7027 </h2> | |
7028 <p class="history_metadata_extractor_status"> | |
7029 Status: Failed (1) | |
7030 </p> | |
7031 <p class="history_metadata_extractor_glitter"></p> | |
7032 <table class=" | |
7033 table | |
7034 table-bordered | |
7035 table-dark | |
7036 table-striped | |
7037 table-hover | |
7038 d-block | |
7039 overflow-auto | |
7040 history_metadata_extractor_table | |
7041 "> | |
7042 <thead> | |
7043 <tr> | |
7044 <th scope="col"></th> | |
7045 <th scope="col">value</th> | |
7046 <th scope="col">name</th> | |
7047 <th scope="col">extension</th> | |
7048 <th scope="col">hid</th> | |
7049 </tr> | |
7050 </thead> | |
7051 <tr class=""> | |
7052 <th scope="row">file_load_select</th> | |
7053 <td>no</td> | |
7054 <td></td> | |
7055 <td></td> | |
7056 <td></td> | |
7057 </tr><tr class=""> | |
7058 <th scope="row">image</th> | |
7059 <td>9e77b3d7d0887128</td> | |
7060 <td>test.rdata</td> | |
7061 <td>rdata</td> | |
7062 <td>1</td> | |
7063 </tr><tr class=""> | |
7064 <th scope="row">maxFeatures</th> | |
7065 <td>50</td> | |
7066 <td></td> | |
7067 <td></td> | |
7068 <td></td> | |
7069 </tr><tr class=""> | |
7070 <th scope="row">binSize</th> | |
7071 <td>0.25</td> | |
7072 <td></td> | |
7073 <td></td> | |
7074 <td></td> | |
7075 </tr><tr class=""> | |
7076 <th scope="row">bw</th> | |
7077 <td>30.0</td> | |
7078 <td></td> | |
7079 <td></td> | |
7080 <td></td> | |
7081 </tr><tr class=""> | |
7082 <th scope="row">method</th> | |
7083 <td>PeakDensity</td> | |
7084 <td></td> | |
7085 <td></td> | |
7086 <td></td> | |
7087 </tr><tr class=""> | |
7088 <th scope="row">minFraction</th> | |
7089 <td>0.5</td> | |
7090 <td></td> | |
7091 <td></td> | |
7092 <td></td> | |
7093 </tr><tr class=""> | |
7094 <th scope="row">minSamples</th> | |
7095 <td>1</td> | |
7096 <td></td> | |
7097 <td></td> | |
7098 <td></td> | |
7099 </tr><tr class=""> | |
7100 <th scope="row">peaklistBool</th> | |
7101 <td>false</td> | |
7102 <td></td> | |
7103 <td></td> | |
7104 <td></td> | |
7105 </tr> | |
7106 </table> | |
7107 </div> | |
7108 | |
7109 | |
7110 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
7111 <h2 | |
7112 class="history_metadata_extractor_h2" | |
7113 style="cursor: pointer" | |
7114 title="click to fold/unfold the table" | |
7115 > | |
7116 [DELETED] - abims_xcms_group - 3.12.0+galaxy0 | |
7117 </h2> | |
7118 <p class="history_metadata_extractor_status"> | |
7119 Status: Failed (1) | |
7120 </p> | |
7121 <p class="history_metadata_extractor_glitter"></p> | |
7122 <table class=" | |
7123 table | |
7124 table-bordered | |
7125 table-dark | |
7126 table-striped | |
7127 table-hover | |
7128 d-block | |
7129 overflow-auto | |
7130 history_metadata_extractor_table | |
7131 "> | |
7132 <thead> | |
7133 <tr> | |
7134 <th scope="col"></th> | |
7135 <th scope="col">value</th> | |
7136 <th scope="col">name</th> | |
7137 <th scope="col">extension</th> | |
7138 <th scope="col">hid</th> | |
7139 </tr> | |
7140 </thead> | |
7141 <tr class=""> | |
7142 <th scope="row">file_load_select</th> | |
7143 <td>no</td> | |
7144 <td></td> | |
7145 <td></td> | |
7146 <td></td> | |
7147 </tr><tr class=""> | |
7148 <th scope="row">image</th> | |
7149 <td>9e77b3d7d0887128</td> | |
7150 <td>test.rdata</td> | |
7151 <td>rdata</td> | |
7152 <td>1</td> | |
7153 </tr><tr class=""> | |
7154 <th scope="row">maxFeatures</th> | |
7155 <td>50</td> | |
7156 <td></td> | |
7157 <td></td> | |
7158 <td></td> | |
7159 </tr><tr class=""> | |
7160 <th scope="row">binSize</th> | |
7161 <td>0.25</td> | |
7162 <td></td> | |
7163 <td></td> | |
7164 <td></td> | |
7165 </tr><tr class=""> | |
7166 <th scope="row">bw</th> | |
7167 <td>30.0</td> | |
7168 <td></td> | |
7169 <td></td> | |
7170 <td></td> | |
7171 </tr><tr class=""> | |
7172 <th scope="row">method</th> | |
7173 <td>PeakDensity</td> | |
7174 <td></td> | |
7175 <td></td> | |
7176 <td></td> | |
7177 </tr><tr class=""> | |
7178 <th scope="row">minFraction</th> | |
7179 <td>0.5</td> | |
7180 <td></td> | |
7181 <td></td> | |
7182 <td></td> | |
7183 </tr><tr class=""> | |
7184 <th scope="row">minSamples</th> | |
7185 <td>1</td> | |
7186 <td></td> | |
7187 <td></td> | |
7188 <td></td> | |
7189 </tr><tr class=""> | |
7190 <th scope="row">peaklistBool</th> | |
7191 <td>false</td> | |
7192 <td></td> | |
7193 <td></td> | |
7194 <td></td> | |
7195 </tr> | |
7196 </table> | |
7197 </div> | |
7198 | |
7199 | |
7200 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
7201 <h2 | |
7202 class="history_metadata_extractor_h2" | |
7203 style="cursor: pointer" | |
7204 title="click to fold/unfold the table" | |
7205 > | |
7206 [DELETED] - xcms_merge - 3.12.0+galaxy0 | |
7207 </h2> | |
7208 <p class="history_metadata_extractor_status"> | |
7209 Status: Failed (1) | |
7210 </p> | |
7211 <p class="history_metadata_extractor_glitter"></p> | |
7212 <table class=" | |
7213 table | |
7214 table-bordered | |
7215 table-dark | |
7216 table-striped | |
7217 table-hover | |
7218 d-block | |
7219 overflow-auto | |
7220 history_metadata_extractor_table | |
7221 "> | |
7222 <thead> | |
7223 <tr> | |
7224 <th scope="col"></th> | |
7225 <th scope="col">value</th> | |
7226 <th scope="col">name</th> | |
7227 <th scope="col">extension</th> | |
7228 <th scope="col">hid</th> | |
7229 </tr> | |
7230 </thead> | |
7231 <tr class=""> | |
7232 <th scope="row">file_load_select</th> | |
7233 <td>no</td> | |
7234 <td></td> | |
7235 <td></td> | |
7236 <td></td> | |
7237 </tr><tr class=""> | |
7238 <th scope="row">images</th> | |
7239 <td>9e77b3d7d0887128</td> | |
7240 <td>test.rdata</td> | |
7241 <td>rdata</td> | |
7242 <td>1</td> | |
7243 </tr><tr class=""> | |
7244 <th scope="row">sampleMetadata</th> | |
7245 <td>None</td> | |
7246 <td></td> | |
7247 <td></td> | |
7248 <td></td> | |
7249 </tr> | |
7250 </table> | |
7251 </div> | |
7252 | |
7253 | |
7254 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
7255 <h2 | |
7256 class="history_metadata_extractor_h2" | |
7257 style="cursor: pointer" | |
7258 title="click to fold/unfold the table" | |
7259 > | |
7260 [DELETED] - xcms_merge - 3.12.0+galaxy0 | |
7261 </h2> | |
7262 <p class="history_metadata_extractor_status"> | |
7263 Status: Failed (1) | |
7264 </p> | |
7265 <p class="history_metadata_extractor_glitter"></p> | |
7266 <table class=" | |
7267 table | |
7268 table-bordered | |
7269 table-dark | |
7270 table-striped | |
7271 table-hover | |
7272 d-block | |
7273 overflow-auto | |
7274 history_metadata_extractor_table | |
7275 "> | |
7276 <thead> | |
7277 <tr> | |
7278 <th scope="col"></th> | |
7279 <th scope="col">value</th> | |
7280 <th scope="col">name</th> | |
7281 <th scope="col">extension</th> | |
7282 <th scope="col">hid</th> | |
7283 </tr> | |
7284 </thead> | |
7285 <tr class=""> | |
7286 <th scope="row">file_load_select</th> | |
7287 <td>no</td> | |
7288 <td></td> | |
7289 <td></td> | |
7290 <td></td> | |
7291 </tr><tr class=""> | |
7292 <th scope="row">images</th> | |
7293 <td>9e77b3d7d0887128</td> | |
7294 <td>test.rdata</td> | |
7295 <td>rdata</td> | |
7296 <td>1</td> | |
7297 </tr><tr class=""> | |
7298 <th scope="row">sampleMetadata</th> | |
7299 <td>None</td> | |
7300 <td></td> | |
7301 <td></td> | |
7302 <td></td> | |
7303 </tr> | |
7304 </table> | |
7305 </div> | |
7306 | |
7307 | |
7308 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
7309 <h2 | |
7310 class="history_metadata_extractor_h2" | |
7311 style="cursor: pointer" | |
7312 title="click to fold/unfold the table" | |
7313 > | |
7314 [DELETED] - xcms_export_samplemetadata - 3.12.0+galaxy0 | |
7315 </h2> | |
7316 <p class="history_metadata_extractor_status"> | |
7317 Status: Failed (1) | |
7318 </p> | |
7319 <p class="history_metadata_extractor_glitter"></p> | |
7320 <table class=" | |
7321 table | |
7322 table-bordered | |
7323 table-dark | |
7324 table-striped | |
7325 table-hover | |
7326 d-block | |
7327 overflow-auto | |
7328 history_metadata_extractor_table | |
7329 "> | |
7330 <thead> | |
7331 <tr> | |
7332 <th scope="col"></th> | |
7333 <th scope="col">value</th> | |
7334 <th scope="col">name</th> | |
7335 <th scope="col">extension</th> | |
7336 <th scope="col">hid</th> | |
7337 </tr> | |
7338 </thead> | |
7339 <tr class=""> | |
7340 <th scope="row">images</th> | |
7341 <td>9e77b3d7d0887128</td> | |
7342 <td>test.rdata</td> | |
7343 <td>rdata</td> | |
7344 <td>1</td> | |
7345 </tr> | |
7346 </table> | |
7347 </div> | |
7348 | |
7349 | |
7350 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
7351 <h2 | |
7352 class="history_metadata_extractor_h2" | |
7353 style="cursor: pointer" | |
7354 title="click to fold/unfold the table" | |
7355 > | |
7356 [DELETED] - xcms_plot_chromatogram - 3.12.0+galaxy0 | |
7357 </h2> | |
7358 <p class="history_metadata_extractor_status"> | |
7359 Status: Failed (1) | |
7360 </p> | |
7361 <p class="history_metadata_extractor_glitter"></p> | |
7362 <table class=" | |
7363 table | |
7364 table-bordered | |
7365 table-dark | |
7366 table-striped | |
7367 table-hover | |
7368 d-block | |
7369 overflow-auto | |
7370 history_metadata_extractor_table | |
7371 "> | |
7372 <thead> | |
7373 <tr> | |
7374 <th scope="col"></th> | |
7375 <th scope="col">value</th> | |
7376 <th scope="col">name</th> | |
7377 <th scope="col">extension</th> | |
7378 <th scope="col">hid</th> | |
7379 </tr> | |
7380 </thead> | |
7381 <tr class=""> | |
7382 <th scope="row">file_load_select</th> | |
7383 <td>no</td> | |
7384 <td></td> | |
7385 <td></td> | |
7386 <td></td> | |
7387 </tr><tr class=""> | |
7388 <th scope="row">images</th> | |
7389 <td>9e77b3d7d0887128</td> | |
7390 <td>test.rdata</td> | |
7391 <td>rdata</td> | |
7392 <td>1</td> | |
7393 </tr><tr class=""> | |
7394 <th scope="row">sampleMetadata</th> | |
7395 <td>None</td> | |
7396 <td></td> | |
7397 <td></td> | |
7398 <td></td> | |
7399 </tr> | |
7400 </table> | |
7401 </div> | |
7402 | |
7403 | |
7404 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
7405 <h2 | |
7406 class="history_metadata_extractor_h2" | |
7407 style="cursor: pointer" | |
7408 title="click to fold/unfold the table" | |
7409 > | |
7410 [DELETED] - xcms_plot_chromatogram - 3.12.0+galaxy0 | |
7411 </h2> | |
7412 <p class="history_metadata_extractor_status"> | |
7413 Status: Failed (1) | |
7414 </p> | |
7415 <p class="history_metadata_extractor_glitter"></p> | |
7416 <table class=" | |
7417 table | |
7418 table-bordered | |
7419 table-dark | |
7420 table-striped | |
7421 table-hover | |
7422 d-block | |
7423 overflow-auto | |
7424 history_metadata_extractor_table | |
7425 "> | |
7426 <thead> | |
7427 <tr> | |
7428 <th scope="col"></th> | |
7429 <th scope="col">value</th> | |
7430 <th scope="col">name</th> | |
7431 <th scope="col">extension</th> | |
7432 <th scope="col">hid</th> | |
7433 </tr> | |
7434 </thead> | |
7435 <tr class=""> | |
7436 <th scope="row">file_load_select</th> | |
7437 <td>no</td> | |
7438 <td></td> | |
7439 <td></td> | |
7440 <td></td> | |
7441 </tr><tr class=""> | |
7442 <th scope="row">images</th> | |
7443 <td>9e77b3d7d0887128</td> | |
7444 <td>test.rdata</td> | |
7445 <td>rdata</td> | |
7446 <td>1</td> | |
7447 </tr><tr class=""> | |
7448 <th scope="row">sampleMetadata</th> | |
7449 <td>None</td> | |
7450 <td></td> | |
7451 <td></td> | |
7452 <td></td> | |
7453 </tr> | |
7454 </table> | |
7455 </div> | |
7456 | |
7457 | |
7458 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
7459 <h2 | |
7460 class="history_metadata_extractor_h2" | |
7461 style="cursor: pointer" | |
7462 title="click to fold/unfold the table" | |
7463 > | |
7464 [DELETED] - abims_xcms_fillPeaks - 3.12.0+galaxy0 | |
7465 </h2> | |
7466 <p class="history_metadata_extractor_status"> | |
7467 Status: Failed (1) | |
7468 </p> | |
7469 <p class="history_metadata_extractor_glitter"></p> | |
7470 <table class=" | |
7471 table | |
7472 table-bordered | |
7473 table-dark | |
7474 table-striped | |
7475 table-hover | |
7476 d-block | |
7477 overflow-auto | |
7478 history_metadata_extractor_table | |
7479 "> | |
7480 <thead> | |
7481 <tr> | |
7482 <th scope="col"></th> | |
7483 <th scope="col">value</th> | |
7484 <th scope="col">name</th> | |
7485 <th scope="col">extension</th> | |
7486 <th scope="col">hid</th> | |
7487 </tr> | |
7488 </thead> | |
7489 <tr class=""> | |
7490 <th scope="row">expandMz</th> | |
7491 <td>0</td> | |
7492 <td></td> | |
7493 <td></td> | |
7494 <td></td> | |
7495 </tr><tr class=""> | |
7496 <th scope="row">expandRt</th> | |
7497 <td>0</td> | |
7498 <td></td> | |
7499 <td></td> | |
7500 <td></td> | |
7501 </tr><tr class=""> | |
7502 <th scope="row">ppm</th> | |
7503 <td>0</td> | |
7504 <td></td> | |
7505 <td></td> | |
7506 <td></td> | |
7507 </tr><tr class=""> | |
7508 <th scope="row">file_load_select</th> | |
7509 <td>no</td> | |
7510 <td></td> | |
7511 <td></td> | |
7512 <td></td> | |
7513 </tr><tr class=""> | |
7514 <th scope="row">image</th> | |
7515 <td>9e77b3d7d0887128</td> | |
7516 <td>test.rdata</td> | |
7517 <td>rdata</td> | |
7518 <td>1</td> | |
7519 </tr><tr class=""> | |
7520 <th scope="row">convertRTMinute</th> | |
7521 <td>false</td> | |
7522 <td></td> | |
7523 <td></td> | |
7524 <td></td> | |
7525 </tr><tr class=""> | |
7526 <th scope="row">intval</th> | |
7527 <td>into</td> | |
7528 <td></td> | |
7529 <td></td> | |
7530 <td></td> | |
7531 </tr><tr class=""> | |
7532 <th scope="row">naTOzero</th> | |
7533 <td>true</td> | |
7534 <td></td> | |
7535 <td></td> | |
7536 <td></td> | |
7537 </tr><tr class=""> | |
7538 <th scope="row">numDigitsMZ</th> | |
7539 <td>4</td> | |
7540 <td></td> | |
7541 <td></td> | |
7542 <td></td> | |
7543 </tr><tr class=""> | |
7544 <th scope="row">numDigitsRT</th> | |
7545 <td>0</td> | |
7546 <td></td> | |
7547 <td></td> | |
7548 <td></td> | |
7549 </tr><tr class=""> | |
7550 <th scope="row">peaklistBool</th> | |
7551 <td>True</td> | |
7552 <td></td> | |
7553 <td></td> | |
7554 <td></td> | |
7555 </tr> | |
7556 </table> | |
7557 </div> | |
7558 | |
7559 | |
7560 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
7561 <h2 | |
7562 class="history_metadata_extractor_h2" | |
7563 style="cursor: pointer" | |
7564 title="click to fold/unfold the table" | |
7565 > | |
7566 [DELETED] - abims_xcms_fillPeaks - 3.12.0+galaxy0 | |
7567 </h2> | |
7568 <p class="history_metadata_extractor_status"> | |
7569 Status: Failed (1) | |
7570 </p> | |
7571 <p class="history_metadata_extractor_glitter"></p> | |
7572 <table class=" | |
7573 table | |
7574 table-bordered | |
7575 table-dark | |
7576 table-striped | |
7577 table-hover | |
7578 d-block | |
7579 overflow-auto | |
7580 history_metadata_extractor_table | |
7581 "> | |
7582 <thead> | |
7583 <tr> | |
7584 <th scope="col"></th> | |
7585 <th scope="col">value</th> | |
7586 <th scope="col">name</th> | |
7587 <th scope="col">extension</th> | |
7588 <th scope="col">hid</th> | |
7589 </tr> | |
7590 </thead> | |
7591 <tr class=""> | |
7592 <th scope="row">expandMz</th> | |
7593 <td>0</td> | |
7594 <td></td> | |
7595 <td></td> | |
7596 <td></td> | |
7597 </tr><tr class=""> | |
7598 <th scope="row">expandRt</th> | |
7599 <td>0</td> | |
7600 <td></td> | |
7601 <td></td> | |
7602 <td></td> | |
7603 </tr><tr class=""> | |
7604 <th scope="row">ppm</th> | |
7605 <td>0</td> | |
7606 <td></td> | |
7607 <td></td> | |
7608 <td></td> | |
7609 </tr><tr class=""> | |
7610 <th scope="row">file_load_select</th> | |
7611 <td>no</td> | |
7612 <td></td> | |
7613 <td></td> | |
7614 <td></td> | |
7615 </tr><tr class=""> | |
7616 <th scope="row">image</th> | |
7617 <td>9e77b3d7d0887128</td> | |
7618 <td>test.rdata</td> | |
7619 <td>rdata</td> | |
7620 <td>1</td> | |
7621 </tr><tr class=""> | |
7622 <th scope="row">convertRTMinute</th> | |
7623 <td>false</td> | |
7624 <td></td> | |
7625 <td></td> | |
7626 <td></td> | |
7627 </tr><tr class=""> | |
7628 <th scope="row">intval</th> | |
7629 <td>into</td> | |
7630 <td></td> | |
7631 <td></td> | |
7632 <td></td> | |
7633 </tr><tr class=""> | |
7634 <th scope="row">naTOzero</th> | |
7635 <td>true</td> | |
7636 <td></td> | |
7637 <td></td> | |
7638 <td></td> | |
7639 </tr><tr class=""> | |
7640 <th scope="row">numDigitsMZ</th> | |
7641 <td>4</td> | |
7642 <td></td> | |
7643 <td></td> | |
7644 <td></td> | |
7645 </tr><tr class=""> | |
7646 <th scope="row">numDigitsRT</th> | |
7647 <td>0</td> | |
7648 <td></td> | |
7649 <td></td> | |
7650 <td></td> | |
7651 </tr><tr class=""> | |
7652 <th scope="row">peaklistBool</th> | |
7653 <td>True</td> | |
7654 <td></td> | |
7655 <td></td> | |
7656 <td></td> | |
7657 </tr> | |
7658 </table> | |
7659 </div> | |
7660 | |
7661 | |
7662 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
7663 <h2 | |
7664 class="history_metadata_extractor_h2" | |
7665 style="cursor: pointer" | |
7666 title="click to fold/unfold the table" | |
7667 > | |
7668 [DELETED] - abims_xcms_fillPeaks - 3.12.0+galaxy0 | |
7669 </h2> | |
7670 <p class="history_metadata_extractor_status"> | |
7671 Status: Failed (1) | |
7672 </p> | |
7673 <p class="history_metadata_extractor_glitter"></p> | |
7674 <table class=" | |
7675 table | |
7676 table-bordered | |
7677 table-dark | |
7678 table-striped | |
7679 table-hover | |
7680 d-block | |
7681 overflow-auto | |
7682 history_metadata_extractor_table | |
7683 "> | |
7684 <thead> | |
7685 <tr> | |
7686 <th scope="col"></th> | |
7687 <th scope="col">value</th> | |
7688 <th scope="col">name</th> | |
7689 <th scope="col">extension</th> | |
7690 <th scope="col">hid</th> | |
7691 </tr> | |
7692 </thead> | |
7693 <tr class=""> | |
7694 <th scope="row">expandMz</th> | |
7695 <td>0</td> | |
7696 <td></td> | |
7697 <td></td> | |
7698 <td></td> | |
7699 </tr><tr class=""> | |
7700 <th scope="row">expandRt</th> | |
7701 <td>0</td> | |
7702 <td></td> | |
7703 <td></td> | |
7704 <td></td> | |
7705 </tr><tr class=""> | |
7706 <th scope="row">ppm</th> | |
7707 <td>0</td> | |
7708 <td></td> | |
7709 <td></td> | |
7710 <td></td> | |
7711 </tr><tr class=""> | |
7712 <th scope="row">file_load_select</th> | |
7713 <td>no</td> | |
7714 <td></td> | |
7715 <td></td> | |
7716 <td></td> | |
7717 </tr><tr class=""> | |
7718 <th scope="row">image</th> | |
7719 <td>9e77b3d7d0887128</td> | |
7720 <td>test.rdata</td> | |
7721 <td>rdata</td> | |
7722 <td>1</td> | |
7723 </tr><tr class=""> | |
7724 <th scope="row">convertRTMinute</th> | |
7725 <td>false</td> | |
7726 <td></td> | |
7727 <td></td> | |
7728 <td></td> | |
7729 </tr><tr class=""> | |
7730 <th scope="row">intval</th> | |
7731 <td>into</td> | |
7732 <td></td> | |
7733 <td></td> | |
7734 <td></td> | |
7735 </tr><tr class=""> | |
7736 <th scope="row">naTOzero</th> | |
7737 <td>true</td> | |
7738 <td></td> | |
7739 <td></td> | |
7740 <td></td> | |
7741 </tr><tr class=""> | |
7742 <th scope="row">numDigitsMZ</th> | |
7743 <td>4</td> | |
7744 <td></td> | |
7745 <td></td> | |
7746 <td></td> | |
7747 </tr><tr class=""> | |
7748 <th scope="row">numDigitsRT</th> | |
7749 <td>0</td> | |
7750 <td></td> | |
7751 <td></td> | |
7752 <td></td> | |
7753 </tr><tr class=""> | |
7754 <th scope="row">peaklistBool</th> | |
7755 <td>True</td> | |
7756 <td></td> | |
7757 <td></td> | |
7758 <td></td> | |
7759 </tr> | |
7760 </table> | |
7761 </div> | |
7762 | |
7763 | |
7764 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
7765 <h2 | |
7766 class="history_metadata_extractor_h2" | |
7767 style="cursor: pointer" | |
7768 title="click to fold/unfold the table" | |
7769 > | |
7770 [DELETED] - quality_metrics - 2.2.8 | |
7771 </h2> | |
7772 <p class="history_metadata_extractor_status"> | |
7773 Status: Failed (1) | |
7774 </p> | |
7775 <p class="history_metadata_extractor_glitter"></p> | |
7776 <table class=" | |
7777 table | |
7778 table-bordered | |
7779 table-dark | |
7780 table-striped | |
7781 table-hover | |
7782 d-block | |
7783 overflow-auto | |
7784 history_metadata_extractor_table | |
7785 "> | |
7786 <thead> | |
7787 <tr> | |
7788 <th scope="col"></th> | |
7789 <th scope="col">value</th> | |
7790 <th scope="col">name</th> | |
7791 <th scope="col">extension</th> | |
7792 <th scope="col">hid</th> | |
7793 </tr> | |
7794 </thead> | |
7795 <tr class=""> | |
7796 <th scope="row">CV</th> | |
7797 <td>FALSE</td> | |
7798 <td></td> | |
7799 <td></td> | |
7800 <td></td> | |
7801 </tr><tr class=""> | |
7802 <th scope="row">Compa</th> | |
7803 <td>TRUE</td> | |
7804 <td></td> | |
7805 <td></td> | |
7806 <td></td> | |
7807 </tr><tr class=""> | |
7808 <th scope="row">seuil</th> | |
7809 <td>1</td> | |
7810 <td></td> | |
7811 <td></td> | |
7812 <td></td> | |
7813 </tr><tr class=""> | |
7814 <th scope="row">optC</th> | |
7815 <td>default</td> | |
7816 <td></td> | |
7817 <td></td> | |
7818 <td></td> | |
7819 </tr><tr class=""> | |
7820 <th scope="row">poolAsPool1L</th> | |
7821 <td>TRUE</td> | |
7822 <td></td> | |
7823 <td></td> | |
7824 <td></td> | |
7825 </tr><tr class=""> | |
7826 <th scope="row">dataMatrix_in</th> | |
7827 <td>7cf499d16bd542b2</td> | |
7828 <td>compounds_pos.txt</td> | |
7829 <td>tabular</td> | |
7830 <td>44</td> | |
7831 </tr><tr class=""> | |
7832 <th scope="row">sampleMetadata_in</th> | |
7833 <td>7cf499d16bd542b2</td> | |
7834 <td>compounds_pos.txt</td> | |
7835 <td>tabular</td> | |
7836 <td>44</td> | |
7837 </tr><tr class=""> | |
7838 <th scope="row">variableMetadata_in</th> | |
7839 <td>7cf499d16bd542b2</td> | |
7840 <td>compounds_pos.txt</td> | |
7841 <td>tabular</td> | |
7842 <td>44</td> | |
7843 </tr> | |
7844 </table> | |
7845 </div> | |
7846 | |
7847 | |
7848 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
7849 <h2 | |
7850 class="history_metadata_extractor_h2" | |
7851 style="cursor: pointer" | |
7852 title="click to fold/unfold the table" | |
7853 > | |
7854 [DELETED] - quality_metrics - 2.2.8 | |
7855 </h2> | |
7856 <p class="history_metadata_extractor_status"> | |
7857 Status: Failed (1) | |
7858 </p> | |
7859 <p class="history_metadata_extractor_glitter"></p> | |
7860 <table class=" | |
7861 table | |
7862 table-bordered | |
7863 table-dark | |
7864 table-striped | |
7865 table-hover | |
7866 d-block | |
7867 overflow-auto | |
7868 history_metadata_extractor_table | |
7869 "> | |
7870 <thead> | |
7871 <tr> | |
7872 <th scope="col"></th> | |
7873 <th scope="col">value</th> | |
7874 <th scope="col">name</th> | |
7875 <th scope="col">extension</th> | |
7876 <th scope="col">hid</th> | |
7877 </tr> | |
7878 </thead> | |
7879 <tr class=""> | |
7880 <th scope="row">CV</th> | |
7881 <td>FALSE</td> | |
7882 <td></td> | |
7883 <td></td> | |
7884 <td></td> | |
7885 </tr><tr class=""> | |
7886 <th scope="row">Compa</th> | |
7887 <td>TRUE</td> | |
7888 <td></td> | |
7889 <td></td> | |
7890 <td></td> | |
7891 </tr><tr class=""> | |
7892 <th scope="row">seuil</th> | |
7893 <td>1</td> | |
7894 <td></td> | |
7895 <td></td> | |
7896 <td></td> | |
7897 </tr><tr class=""> | |
7898 <th scope="row">optC</th> | |
7899 <td>default</td> | |
7900 <td></td> | |
7901 <td></td> | |
7902 <td></td> | |
7903 </tr><tr class=""> | |
7904 <th scope="row">poolAsPool1L</th> | |
7905 <td>TRUE</td> | |
7906 <td></td> | |
7907 <td></td> | |
7908 <td></td> | |
7909 </tr><tr class=""> | |
7910 <th scope="row">dataMatrix_in</th> | |
7911 <td>7cf499d16bd542b2</td> | |
7912 <td>compounds_pos.txt</td> | |
7913 <td>tabular</td> | |
7914 <td>44</td> | |
7915 </tr><tr class=""> | |
7916 <th scope="row">sampleMetadata_in</th> | |
7917 <td>7cf499d16bd542b2</td> | |
7918 <td>compounds_pos.txt</td> | |
7919 <td>tabular</td> | |
7920 <td>44</td> | |
7921 </tr><tr class=""> | |
7922 <th scope="row">variableMetadata_in</th> | |
7923 <td>7cf499d16bd542b2</td> | |
7924 <td>compounds_pos.txt</td> | |
7925 <td>tabular</td> | |
7926 <td>44</td> | |
7927 </tr> | |
7928 </table> | |
7929 </div> | |
7930 | |
7931 | |
7932 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
7933 <h2 | |
7934 class="history_metadata_extractor_h2" | |
7935 style="cursor: pointer" | |
7936 title="click to fold/unfold the table" | |
7937 > | |
7938 [DELETED] - quality_metrics - 2.2.8 | |
7939 </h2> | |
7940 <p class="history_metadata_extractor_status"> | |
7941 Status: Failed (1) | |
7942 </p> | |
7943 <p class="history_metadata_extractor_glitter"></p> | |
7944 <table class=" | |
7945 table | |
7946 table-bordered | |
7947 table-dark | |
7948 table-striped | |
7949 table-hover | |
7950 d-block | |
7951 overflow-auto | |
7952 history_metadata_extractor_table | |
7953 "> | |
7954 <thead> | |
7955 <tr> | |
7956 <th scope="col"></th> | |
7957 <th scope="col">value</th> | |
7958 <th scope="col">name</th> | |
7959 <th scope="col">extension</th> | |
7960 <th scope="col">hid</th> | |
7961 </tr> | |
7962 </thead> | |
7963 <tr class=""> | |
7964 <th scope="row">CV</th> | |
7965 <td>FALSE</td> | |
7966 <td></td> | |
7967 <td></td> | |
7968 <td></td> | |
7969 </tr><tr class=""> | |
7970 <th scope="row">Compa</th> | |
7971 <td>TRUE</td> | |
7972 <td></td> | |
7973 <td></td> | |
7974 <td></td> | |
7975 </tr><tr class=""> | |
7976 <th scope="row">seuil</th> | |
7977 <td>1</td> | |
7978 <td></td> | |
7979 <td></td> | |
7980 <td></td> | |
7981 </tr><tr class=""> | |
7982 <th scope="row">optC</th> | |
7983 <td>default</td> | |
7984 <td></td> | |
7985 <td></td> | |
7986 <td></td> | |
7987 </tr><tr class=""> | |
7988 <th scope="row">poolAsPool1L</th> | |
7989 <td>TRUE</td> | |
7990 <td></td> | |
7991 <td></td> | |
7992 <td></td> | |
7993 </tr><tr class=""> | |
7994 <th scope="row">dataMatrix_in</th> | |
7995 <td>7cf499d16bd542b2</td> | |
7996 <td>compounds_pos.txt</td> | |
7997 <td>tabular</td> | |
7998 <td>44</td> | |
7999 </tr><tr class=""> | |
8000 <th scope="row">sampleMetadata_in</th> | |
8001 <td>7cf499d16bd542b2</td> | |
8002 <td>compounds_pos.txt</td> | |
8003 <td>tabular</td> | |
8004 <td>44</td> | |
8005 </tr><tr class=""> | |
8006 <th scope="row">variableMetadata_in</th> | |
8007 <td>7cf499d16bd542b2</td> | |
8008 <td>compounds_pos.txt</td> | |
8009 <td>tabular</td> | |
8010 <td>44</td> | |
8011 </tr> | |
8012 </table> | |
8013 </div> | |
8014 | |
8015 | |
8016 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
8017 <h2 | |
8018 class="history_metadata_extractor_h2" | |
8019 style="cursor: pointer" | |
8020 title="click to fold/unfold the table" | |
8021 > | |
8022 [DELETED] - quality_metrics - 2.2.8 | |
8023 </h2> | |
8024 <p class="history_metadata_extractor_status"> | |
8025 Status: Failed (1) | |
8026 </p> | |
8027 <p class="history_metadata_extractor_glitter"></p> | |
8028 <table class=" | |
8029 table | |
8030 table-bordered | |
8031 table-dark | |
8032 table-striped | |
8033 table-hover | |
8034 d-block | |
8035 overflow-auto | |
8036 history_metadata_extractor_table | |
8037 "> | |
8038 <thead> | |
8039 <tr> | |
8040 <th scope="col"></th> | |
8041 <th scope="col">value</th> | |
8042 <th scope="col">name</th> | |
8043 <th scope="col">extension</th> | |
8044 <th scope="col">hid</th> | |
8045 </tr> | |
8046 </thead> | |
8047 <tr class=""> | |
8048 <th scope="row">CV</th> | |
8049 <td>FALSE</td> | |
8050 <td></td> | |
8051 <td></td> | |
8052 <td></td> | |
8053 </tr><tr class=""> | |
8054 <th scope="row">Compa</th> | |
8055 <td>TRUE</td> | |
8056 <td></td> | |
8057 <td></td> | |
8058 <td></td> | |
8059 </tr><tr class=""> | |
8060 <th scope="row">seuil</th> | |
8061 <td>1</td> | |
8062 <td></td> | |
8063 <td></td> | |
8064 <td></td> | |
8065 </tr><tr class=""> | |
8066 <th scope="row">optC</th> | |
8067 <td>default</td> | |
8068 <td></td> | |
8069 <td></td> | |
8070 <td></td> | |
8071 </tr><tr class=""> | |
8072 <th scope="row">poolAsPool1L</th> | |
8073 <td>TRUE</td> | |
8074 <td></td> | |
8075 <td></td> | |
8076 <td></td> | |
8077 </tr><tr class=""> | |
8078 <th scope="row">dataMatrix_in</th> | |
8079 <td>7cf499d16bd542b2</td> | |
8080 <td>compounds_pos.txt</td> | |
8081 <td>tabular</td> | |
8082 <td>44</td> | |
8083 </tr><tr class=""> | |
8084 <th scope="row">sampleMetadata_in</th> | |
8085 <td>7cf499d16bd542b2</td> | |
8086 <td>compounds_pos.txt</td> | |
8087 <td>tabular</td> | |
8088 <td>44</td> | |
8089 </tr><tr class=""> | |
8090 <th scope="row">variableMetadata_in</th> | |
8091 <td>7cf499d16bd542b2</td> | |
8092 <td>compounds_pos.txt</td> | |
8093 <td>tabular</td> | |
8094 <td>44</td> | |
8095 </tr> | |
8096 </table> | |
8097 </div> | |
8098 | |
8099 | |
8100 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
8101 <h2 | |
8102 class="history_metadata_extractor_h2" | |
8103 style="cursor: pointer" | |
8104 title="click to fold/unfold the table" | |
8105 > | |
8106 [DELETED] - intens_check - 1.2.8 | |
8107 </h2> | |
8108 <p class="history_metadata_extractor_status"> | |
8109 Status: Failed (1) | |
8110 </p> | |
8111 <p class="history_metadata_extractor_glitter"></p> | |
8112 <table class=" | |
8113 table | |
8114 table-bordered | |
8115 table-dark | |
8116 table-striped | |
8117 table-hover | |
8118 d-block | |
8119 overflow-auto | |
8120 history_metadata_extractor_table | |
8121 "> | |
8122 <thead> | |
8123 <tr> | |
8124 <th scope="col"></th> | |
8125 <th scope="col">value</th> | |
8126 <th scope="col">name</th> | |
8127 <th scope="col">extension</th> | |
8128 <th scope="col">hid</th> | |
8129 </tr> | |
8130 </thead> | |
8131 <tr class=""> | |
8132 <th scope="row">dataMatrix_in</th> | |
8133 <td>9a0ce47bd1734ae7</td> | |
8134 <td>peaklist_fragments.tsv</td> | |
8135 <td>tabular</td> | |
8136 <td>42</td> | |
8137 </tr><tr class=""> | |
8138 <th scope="row">chosen_stat</th> | |
8139 <td>None</td> | |
8140 <td></td> | |
8141 <td></td> | |
8142 <td></td> | |
8143 </tr><tr class=""> | |
8144 <th scope="row">method</th> | |
8145 <td>no_class</td> | |
8146 <td></td> | |
8147 <td></td> | |
8148 <td></td> | |
8149 </tr><tr class=""> | |
8150 <th scope="row">sampleMetadata_in</th> | |
8151 <td>9a0ce47bd1734ae7</td> | |
8152 <td>peaklist_fragments.tsv</td> | |
8153 <td>tabular</td> | |
8154 <td>42</td> | |
8155 </tr><tr class=""> | |
8156 <th scope="row">variableMetadata_in</th> | |
8157 <td>9a0ce47bd1734ae7</td> | |
8158 <td>peaklist_fragments.tsv</td> | |
8159 <td>tabular</td> | |
8160 <td>42</td> | |
8161 </tr> | |
8162 </table> | |
8163 </div> | |
8164 | |
8165 | |
8166 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
8167 <h2 | |
8168 class="history_metadata_extractor_h2" | |
8169 style="cursor: pointer" | |
8170 title="click to fold/unfold the table" | |
8171 > | |
8172 [DELETED] - intens_check - 1.2.8 | |
8173 </h2> | |
8174 <p class="history_metadata_extractor_status"> | |
8175 Status: Failed (1) | |
8176 </p> | |
8177 <p class="history_metadata_extractor_glitter"></p> | |
8178 <table class=" | |
8179 table | |
8180 table-bordered | |
8181 table-dark | |
8182 table-striped | |
8183 table-hover | |
8184 d-block | |
8185 overflow-auto | |
8186 history_metadata_extractor_table | |
8187 "> | |
8188 <thead> | |
8189 <tr> | |
8190 <th scope="col"></th> | |
8191 <th scope="col">value</th> | |
8192 <th scope="col">name</th> | |
8193 <th scope="col">extension</th> | |
8194 <th scope="col">hid</th> | |
8195 </tr> | |
8196 </thead> | |
8197 <tr class=""> | |
8198 <th scope="row">dataMatrix_in</th> | |
8199 <td>9a0ce47bd1734ae7</td> | |
8200 <td>peaklist_fragments.tsv</td> | |
8201 <td>tabular</td> | |
8202 <td>42</td> | |
8203 </tr><tr class=""> | |
8204 <th scope="row">chosen_stat</th> | |
8205 <td>None</td> | |
8206 <td></td> | |
8207 <td></td> | |
8208 <td></td> | |
8209 </tr><tr class=""> | |
8210 <th scope="row">method</th> | |
8211 <td>no_class</td> | |
8212 <td></td> | |
8213 <td></td> | |
8214 <td></td> | |
8215 </tr><tr class=""> | |
8216 <th scope="row">sampleMetadata_in</th> | |
8217 <td>9a0ce47bd1734ae7</td> | |
8218 <td>peaklist_fragments.tsv</td> | |
8219 <td>tabular</td> | |
8220 <td>42</td> | |
8221 </tr><tr class=""> | |
8222 <th scope="row">variableMetadata_in</th> | |
8223 <td>9a0ce47bd1734ae7</td> | |
8224 <td>peaklist_fragments.tsv</td> | |
8225 <td>tabular</td> | |
8226 <td>42</td> | |
8227 </tr> | |
8228 </table> | |
8229 </div> | |
8230 | |
8231 | |
8232 <div class="alert alert-success history_metadata_extractor_deleted"> | |
8233 <h2 | |
8234 class="history_metadata_extractor_h2" | |
8235 style="cursor: pointer" | |
8236 title="click to fold/unfold the table" | |
8237 > | |
8238 [DELETED] - Analytic_correlation_filtration - 2019-06-20 | |
8239 </h2> | |
8240 <p class="history_metadata_extractor_status"> | |
8241 Status: Ok (0) | |
8242 </p> | |
8243 <p class="history_metadata_extractor_glitter"></p> | |
8244 <table class=" | |
8245 table | |
8246 table-bordered | |
8247 table-dark | |
8248 table-striped | |
8249 table-hover | |
8250 d-block | |
8251 overflow-auto | |
8252 history_metadata_extractor_table | |
8253 "> | |
8254 <thead> | |
8255 <tr> | |
8256 <th scope="col"></th> | |
8257 <th scope="col">value</th> | |
8258 <th scope="col">name</th> | |
8259 <th scope="col">extension</th> | |
8260 <th scope="col">hid</th> | |
8261 </tr> | |
8262 </thead> | |
8263 <tr class=""> | |
8264 <th scope="row">correl_threshold</th> | |
8265 <td>0.9</td> | |
8266 <td></td> | |
8267 <td></td> | |
8268 <td></td> | |
8269 </tr><tr class=""> | |
8270 <th scope="row">dataMatrix_in</th> | |
8271 <td>9a0ce47bd1734ae7</td> | |
8272 <td>peaklist_fragments.tsv</td> | |
8273 <td>tabular</td> | |
8274 <td>42</td> | |
8275 </tr><tr class=""> | |
8276 <th scope="row">file_in</th> | |
8277 <td>9a0ce47bd1734ae7</td> | |
8278 <td>peaklist_fragments.tsv</td> | |
8279 <td>tabular</td> | |
8280 <td>42</td> | |
8281 </tr><tr class=""> | |
8282 <th scope="row">mass_file_in</th> | |
8283 <td>9a0ce47bd1734ae7</td> | |
8284 <td>peaklist_fragments.tsv</td> | |
8285 <td>tabular</td> | |
8286 <td>42</td> | |
8287 </tr><tr class=""> | |
8288 <th scope="row">mass_list</th> | |
8289 <td>true</td> | |
8290 <td></td> | |
8291 <td></td> | |
8292 <td></td> | |
8293 </tr><tr class=""> | |
8294 <th scope="row">mass_choice</th> | |
8295 <td>true</td> | |
8296 <td></td> | |
8297 <td></td> | |
8298 <td></td> | |
8299 </tr><tr class=""> | |
8300 <th scope="row">mass_threshold</th> | |
8301 <td>0.005</td> | |
8302 <td></td> | |
8303 <td></td> | |
8304 <td></td> | |
8305 </tr><tr class=""> | |
8306 <th scope="row">repres_opt_selector</th> | |
8307 <td>intensity</td> | |
8308 <td></td> | |
8309 <td></td> | |
8310 <td></td> | |
8311 </tr><tr class=""> | |
8312 <th scope="row">rt_choice</th> | |
8313 <td>true</td> | |
8314 <td></td> | |
8315 <td></td> | |
8316 <td></td> | |
8317 </tr><tr class=""> | |
8318 <th scope="row">rt_threshold</th> | |
8319 <td>0.1</td> | |
8320 <td></td> | |
8321 <td></td> | |
8322 <td></td> | |
8323 </tr><tr class=""> | |
8324 <th scope="row">variableMetadata_in</th> | |
8325 <td>9a0ce47bd1734ae7</td> | |
8326 <td>peaklist_fragments.tsv</td> | |
8327 <td>tabular</td> | |
8328 <td>42</td> | |
8329 </tr> | |
8330 </table> | |
8331 </div> | |
8332 | |
8333 | |
8334 <div class="alert alert-success history_metadata_extractor_deleted"> | |
8335 <h2 | |
8336 class="history_metadata_extractor_h2" | |
8337 style="cursor: pointer" | |
8338 title="click to fold/unfold the table" | |
8339 > | |
8340 [DELETED] - Analytic_correlation_filtration - 2019-06-20 | |
8341 </h2> | |
8342 <p class="history_metadata_extractor_status"> | |
8343 Status: Ok (0) | |
8344 </p> | |
8345 <p class="history_metadata_extractor_glitter"></p> | |
8346 <table class=" | |
8347 table | |
8348 table-bordered | |
8349 table-dark | |
8350 table-striped | |
8351 table-hover | |
8352 d-block | |
8353 overflow-auto | |
8354 history_metadata_extractor_table | |
8355 "> | |
8356 <thead> | |
8357 <tr> | |
8358 <th scope="col"></th> | |
8359 <th scope="col">value</th> | |
8360 <th scope="col">name</th> | |
8361 <th scope="col">extension</th> | |
8362 <th scope="col">hid</th> | |
8363 </tr> | |
8364 </thead> | |
8365 <tr class=""> | |
8366 <th scope="row">correl_threshold</th> | |
8367 <td>0.9</td> | |
8368 <td></td> | |
8369 <td></td> | |
8370 <td></td> | |
8371 </tr><tr class=""> | |
8372 <th scope="row">dataMatrix_in</th> | |
8373 <td>9a0ce47bd1734ae7</td> | |
8374 <td>peaklist_fragments.tsv</td> | |
8375 <td>tabular</td> | |
8376 <td>42</td> | |
8377 </tr><tr class=""> | |
8378 <th scope="row">file_in</th> | |
8379 <td>9a0ce47bd1734ae7</td> | |
8380 <td>peaklist_fragments.tsv</td> | |
8381 <td>tabular</td> | |
8382 <td>42</td> | |
8383 </tr><tr class=""> | |
8384 <th scope="row">mass_file_in</th> | |
8385 <td>9a0ce47bd1734ae7</td> | |
8386 <td>peaklist_fragments.tsv</td> | |
8387 <td>tabular</td> | |
8388 <td>42</td> | |
8389 </tr><tr class=""> | |
8390 <th scope="row">mass_list</th> | |
8391 <td>true</td> | |
8392 <td></td> | |
8393 <td></td> | |
8394 <td></td> | |
8395 </tr><tr class=""> | |
8396 <th scope="row">mass_choice</th> | |
8397 <td>true</td> | |
8398 <td></td> | |
8399 <td></td> | |
8400 <td></td> | |
8401 </tr><tr class=""> | |
8402 <th scope="row">mass_threshold</th> | |
8403 <td>0.005</td> | |
8404 <td></td> | |
8405 <td></td> | |
8406 <td></td> | |
8407 </tr><tr class=""> | |
8408 <th scope="row">repres_opt_selector</th> | |
8409 <td>intensity</td> | |
8410 <td></td> | |
8411 <td></td> | |
8412 <td></td> | |
8413 </tr><tr class=""> | |
8414 <th scope="row">rt_choice</th> | |
8415 <td>true</td> | |
8416 <td></td> | |
8417 <td></td> | |
8418 <td></td> | |
8419 </tr><tr class=""> | |
8420 <th scope="row">rt_threshold</th> | |
8421 <td>0.1</td> | |
8422 <td></td> | |
8423 <td></td> | |
8424 <td></td> | |
8425 </tr><tr class=""> | |
8426 <th scope="row">variableMetadata_in</th> | |
8427 <td>9a0ce47bd1734ae7</td> | |
8428 <td>peaklist_fragments.tsv</td> | |
8429 <td>tabular</td> | |
8430 <td>42</td> | |
8431 </tr> | |
8432 </table> | |
8433 </div> | |
8434 | |
8435 | |
8436 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
8437 <h2 | |
8438 class="history_metadata_extractor_h2" | |
8439 style="cursor: pointer" | |
8440 title="click to fold/unfold the table" | |
8441 > | |
8442 [DELETED] - correlation_analysis - 1.0.1+galaxy0 | |
8443 </h2> | |
8444 <p class="history_metadata_extractor_status"> | |
8445 Status: Failed (1) | |
8446 </p> | |
8447 <p class="history_metadata_extractor_glitter"></p> | |
8448 <table class=" | |
8449 table | |
8450 table-bordered | |
8451 table-dark | |
8452 table-striped | |
8453 table-hover | |
8454 d-block | |
8455 overflow-auto | |
8456 history_metadata_extractor_table | |
8457 "> | |
8458 <thead> | |
8459 <tr> | |
8460 <th scope="col"></th> | |
8461 <th scope="col">value</th> | |
8462 <th scope="col">name</th> | |
8463 <th scope="col">extension</th> | |
8464 <th scope="col">hid</th> | |
8465 </tr> | |
8466 </thead> | |
8467 <tr class=""> | |
8468 <th scope="row">select_funtion</th> | |
8469 <td>sort_only</td> | |
8470 <td></td> | |
8471 <td></td> | |
8472 <td></td> | |
8473 </tr><tr class=""> | |
8474 <th scope="row">dataMatrix</th> | |
8475 <td>7cf499d16bd542b2</td> | |
8476 <td>compounds_pos.txt</td> | |
8477 <td>tabular</td> | |
8478 <td>44</td> | |
8479 </tr><tr class=""> | |
8480 <th scope="row">sampleMetadata</th> | |
8481 <td>7cf499d16bd542b2</td> | |
8482 <td>compounds_pos.txt</td> | |
8483 <td>tabular</td> | |
8484 <td>44</td> | |
8485 </tr><tr class=""> | |
8486 <th scope="row">select_input_type</th> | |
8487 <td>select_input_from_w4m</td> | |
8488 <td></td> | |
8489 <td></td> | |
8490 <td></td> | |
8491 </tr><tr class=""> | |
8492 <th scope="row">variableMetadata</th> | |
8493 <td>7cf499d16bd542b2</td> | |
8494 <td>compounds_pos.txt</td> | |
8495 <td>tabular</td> | |
8496 <td>44</td> | |
8497 </tr> | |
8498 </table> | |
8499 </div> | |
8500 | |
8501 | |
8502 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
8503 <h2 | |
8504 class="history_metadata_extractor_h2" | |
8505 style="cursor: pointer" | |
8506 title="click to fold/unfold the table" | |
8507 > | |
8508 [DELETED] - Transformation - 2.2.0 | |
8509 </h2> | |
8510 <p class="history_metadata_extractor_status"> | |
8511 Status: Failed (1) | |
8512 </p> | |
8513 <p class="history_metadata_extractor_glitter"></p> | |
8514 <table class=" | |
8515 table | |
8516 table-bordered | |
8517 table-dark | |
8518 table-striped | |
8519 table-hover | |
8520 d-block | |
8521 overflow-auto | |
8522 history_metadata_extractor_table | |
8523 "> | |
8524 <thead> | |
8525 <tr> | |
8526 <th scope="col"></th> | |
8527 <th scope="col">value</th> | |
8528 <th scope="col">name</th> | |
8529 <th scope="col">extension</th> | |
8530 <th scope="col">hid</th> | |
8531 </tr> | |
8532 </thead> | |
8533 <tr class=""> | |
8534 <th scope="row">dataMatrix_in</th> | |
8535 <td>9a0ce47bd1734ae7</td> | |
8536 <td>peaklist_fragments.tsv</td> | |
8537 <td>tabular</td> | |
8538 <td>42</td> | |
8539 </tr><tr class=""> | |
8540 <th scope="row">method</th> | |
8541 <td>log2</td> | |
8542 <td></td> | |
8543 <td></td> | |
8544 <td></td> | |
8545 </tr> | |
8546 </table> | |
8547 </div> | |
8548 | |
8549 | |
8550 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
8551 <h2 | |
8552 class="history_metadata_extractor_h2" | |
8553 style="cursor: pointer" | |
8554 title="click to fold/unfold the table" | |
8555 > | |
8556 [DELETED] - Transformation - 2.2.0 | |
8557 </h2> | |
8558 <p class="history_metadata_extractor_status"> | |
8559 Status: Failed (1) | |
8560 </p> | |
8561 <p class="history_metadata_extractor_glitter"></p> | |
8562 <table class=" | |
8563 table | |
8564 table-bordered | |
8565 table-dark | |
8566 table-striped | |
8567 table-hover | |
8568 d-block | |
8569 overflow-auto | |
8570 history_metadata_extractor_table | |
8571 "> | |
8572 <thead> | |
8573 <tr> | |
8574 <th scope="col"></th> | |
8575 <th scope="col">value</th> | |
8576 <th scope="col">name</th> | |
8577 <th scope="col">extension</th> | |
8578 <th scope="col">hid</th> | |
8579 </tr> | |
8580 </thead> | |
8581 <tr class=""> | |
8582 <th scope="row">dataMatrix_in</th> | |
8583 <td>9a0ce47bd1734ae7</td> | |
8584 <td>peaklist_fragments.tsv</td> | |
8585 <td>tabular</td> | |
8586 <td>42</td> | |
8587 </tr><tr class=""> | |
8588 <th scope="row">method</th> | |
8589 <td>log2</td> | |
8590 <td></td> | |
8591 <td></td> | |
8592 <td></td> | |
8593 </tr> | |
8594 </table> | |
8595 </div> | |
8596 | |
8597 | |
8598 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
8599 <h2 | |
8600 class="history_metadata_extractor_h2" | |
8601 style="cursor: pointer" | |
8602 title="click to fold/unfold the table" | |
8603 > | |
8604 [DELETED] - normalization - 1.0.7 | |
8605 </h2> | |
8606 <p class="history_metadata_extractor_status"> | |
8607 Status: Failed (1) | |
8608 </p> | |
8609 <p class="history_metadata_extractor_glitter"></p> | |
8610 <table class=" | |
8611 table | |
8612 table-bordered | |
8613 table-dark | |
8614 table-striped | |
8615 table-hover | |
8616 d-block | |
8617 overflow-auto | |
8618 history_metadata_extractor_table | |
8619 "> | |
8620 <thead> | |
8621 <tr> | |
8622 <th scope="col"></th> | |
8623 <th scope="col">value</th> | |
8624 <th scope="col">name</th> | |
8625 <th scope="col">extension</th> | |
8626 <th scope="col">hid</th> | |
8627 </tr> | |
8628 </thead> | |
8629 <tr class=""> | |
8630 <th scope="row">dataMatrix</th> | |
8631 <td>9a0ce47bd1734ae7</td> | |
8632 <td>peaklist_fragments.tsv</td> | |
8633 <td>tabular</td> | |
8634 <td>42</td> | |
8635 </tr><tr class=""> | |
8636 <th scope="row">graphType</th> | |
8637 <td>None</td> | |
8638 <td></td> | |
8639 <td></td> | |
8640 <td></td> | |
8641 </tr><tr class=""> | |
8642 <th scope="row">method</th> | |
8643 <td>None</td> | |
8644 <td></td> | |
8645 <td></td> | |
8646 <td></td> | |
8647 </tr> | |
8648 </table> | |
8649 </div> | |
8650 | |
8651 | |
8652 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
8653 <h2 | |
8654 class="history_metadata_extractor_h2" | |
8655 style="cursor: pointer" | |
8656 title="click to fold/unfold the table" | |
8657 > | |
8658 [DELETED] - normalization - 1.0.7 | |
8659 </h2> | |
8660 <p class="history_metadata_extractor_status"> | |
8661 Status: Failed (1) | |
8662 </p> | |
8663 <p class="history_metadata_extractor_glitter"></p> | |
8664 <table class=" | |
8665 table | |
8666 table-bordered | |
8667 table-dark | |
8668 table-striped | |
8669 table-hover | |
8670 d-block | |
8671 overflow-auto | |
8672 history_metadata_extractor_table | |
8673 "> | |
8674 <thead> | |
8675 <tr> | |
8676 <th scope="col"></th> | |
8677 <th scope="col">value</th> | |
8678 <th scope="col">name</th> | |
8679 <th scope="col">extension</th> | |
8680 <th scope="col">hid</th> | |
8681 </tr> | |
8682 </thead> | |
8683 <tr class=""> | |
8684 <th scope="row">dataMatrix</th> | |
8685 <td>9a0ce47bd1734ae7</td> | |
8686 <td>peaklist_fragments.tsv</td> | |
8687 <td>tabular</td> | |
8688 <td>42</td> | |
8689 </tr><tr class=""> | |
8690 <th scope="row">graphType</th> | |
8691 <td>None</td> | |
8692 <td></td> | |
8693 <td></td> | |
8694 <td></td> | |
8695 </tr><tr class=""> | |
8696 <th scope="row">method</th> | |
8697 <td>None</td> | |
8698 <td></td> | |
8699 <td></td> | |
8700 <td></td> | |
8701 </tr> | |
8702 </table> | |
8703 </div> | |
8704 | |
8705 | |
8706 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
8707 <h2 | |
8708 class="history_metadata_extractor_h2" | |
8709 style="cursor: pointer" | |
8710 title="click to fold/unfold the table" | |
8711 > | |
8712 [DELETED] - Determine_BC - 3.0.0 | |
8713 </h2> | |
8714 <p class="history_metadata_extractor_status"> | |
8715 Status: Failed (1) | |
8716 </p> | |
8717 <p class="history_metadata_extractor_glitter"></p> | |
8718 <table class=" | |
8719 table | |
8720 table-bordered | |
8721 table-dark | |
8722 table-striped | |
8723 table-hover | |
8724 d-block | |
8725 overflow-auto | |
8726 history_metadata_extractor_table | |
8727 "> | |
8728 <thead> | |
8729 <tr> | |
8730 <th scope="col"></th> | |
8731 <th scope="col">value</th> | |
8732 <th scope="col">name</th> | |
8733 <th scope="col">extension</th> | |
8734 <th scope="col">hid</th> | |
8735 </tr> | |
8736 </thead> | |
8737 <tr class=""> | |
8738 <th scope="row">option</th> | |
8739 <td>hide</td> | |
8740 <td></td> | |
8741 <td></td> | |
8742 <td></td> | |
8743 </tr><tr class=""> | |
8744 <th scope="row">dataMatrix</th> | |
8745 <td>9a0ce47bd1734ae7</td> | |
8746 <td>peaklist_fragments.tsv</td> | |
8747 <td>tabular</td> | |
8748 <td>42</td> | |
8749 </tr><tr class=""> | |
8750 <th scope="row">ref_factor</th> | |
8751 <td>batch</td> | |
8752 <td></td> | |
8753 <td></td> | |
8754 <td></td> | |
8755 </tr><tr class=""> | |
8756 <th scope="row">sampleMetadata</th> | |
8757 <td>9a0ce47bd1734ae7</td> | |
8758 <td>peaklist_fragments.tsv</td> | |
8759 <td>tabular</td> | |
8760 <td>42</td> | |
8761 </tr><tr class=""> | |
8762 <th scope="row">batch_col_name</th> | |
8763 <td>batch</td> | |
8764 <td></td> | |
8765 <td></td> | |
8766 <td></td> | |
8767 </tr><tr class=""> | |
8768 <th scope="row">injection_order_col_name</th> | |
8769 <td>injectionOrder</td> | |
8770 <td></td> | |
8771 <td></td> | |
8772 <td></td> | |
8773 </tr><tr class=""> | |
8774 <th scope="row">sampleTypeTagBlank</th> | |
8775 <td>blank</td> | |
8776 <td></td> | |
8777 <td></td> | |
8778 <td></td> | |
8779 </tr><tr class=""> | |
8780 <th scope="row">sampleTypeTagPool</th> | |
8781 <td>pool</td> | |
8782 <td></td> | |
8783 <td></td> | |
8784 <td></td> | |
8785 </tr><tr class=""> | |
8786 <th scope="row">sampleTypeTagSample</th> | |
8787 <td>sample</td> | |
8788 <td></td> | |
8789 <td></td> | |
8790 <td></td> | |
8791 </tr><tr class=""> | |
8792 <th scope="row">sample_type_col_name</th> | |
8793 <td>sampleType</td> | |
8794 <td></td> | |
8795 <td></td> | |
8796 <td></td> | |
8797 </tr> | |
8798 </table> | |
8799 </div> | |
8800 | |
8801 | |
8802 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
8803 <h2 | |
8804 class="history_metadata_extractor_h2" | |
8805 style="cursor: pointer" | |
8806 title="click to fold/unfold the table" | |
8807 > | |
8808 [DELETED] - Determine_BC - 3.0.0 | |
8809 </h2> | |
8810 <p class="history_metadata_extractor_status"> | |
8811 Status: Failed (1) | |
8812 </p> | |
8813 <p class="history_metadata_extractor_glitter"></p> | |
8814 <table class=" | |
8815 table | |
8816 table-bordered | |
8817 table-dark | |
8818 table-striped | |
8819 table-hover | |
8820 d-block | |
8821 overflow-auto | |
8822 history_metadata_extractor_table | |
8823 "> | |
8824 <thead> | |
8825 <tr> | |
8826 <th scope="col"></th> | |
8827 <th scope="col">value</th> | |
8828 <th scope="col">name</th> | |
8829 <th scope="col">extension</th> | |
8830 <th scope="col">hid</th> | |
8831 </tr> | |
8832 </thead> | |
8833 <tr class=""> | |
8834 <th scope="row">option</th> | |
8835 <td>hide</td> | |
8836 <td></td> | |
8837 <td></td> | |
8838 <td></td> | |
8839 </tr><tr class=""> | |
8840 <th scope="row">dataMatrix</th> | |
8841 <td>9a0ce47bd1734ae7</td> | |
8842 <td>peaklist_fragments.tsv</td> | |
8843 <td>tabular</td> | |
8844 <td>42</td> | |
8845 </tr><tr class=""> | |
8846 <th scope="row">ref_factor</th> | |
8847 <td>batch</td> | |
8848 <td></td> | |
8849 <td></td> | |
8850 <td></td> | |
8851 </tr><tr class=""> | |
8852 <th scope="row">sampleMetadata</th> | |
8853 <td>9a0ce47bd1734ae7</td> | |
8854 <td>peaklist_fragments.tsv</td> | |
8855 <td>tabular</td> | |
8856 <td>42</td> | |
8857 </tr><tr class=""> | |
8858 <th scope="row">batch_col_name</th> | |
8859 <td>batch</td> | |
8860 <td></td> | |
8861 <td></td> | |
8862 <td></td> | |
8863 </tr><tr class=""> | |
8864 <th scope="row">injection_order_col_name</th> | |
8865 <td>injectionOrder</td> | |
8866 <td></td> | |
8867 <td></td> | |
8868 <td></td> | |
8869 </tr><tr class=""> | |
8870 <th scope="row">sampleTypeTagBlank</th> | |
8871 <td>blank</td> | |
8872 <td></td> | |
8873 <td></td> | |
8874 <td></td> | |
8875 </tr><tr class=""> | |
8876 <th scope="row">sampleTypeTagPool</th> | |
8877 <td>pool</td> | |
8878 <td></td> | |
8879 <td></td> | |
8880 <td></td> | |
8881 </tr><tr class=""> | |
8882 <th scope="row">sampleTypeTagSample</th> | |
8883 <td>sample</td> | |
8884 <td></td> | |
8885 <td></td> | |
8886 <td></td> | |
8887 </tr><tr class=""> | |
8888 <th scope="row">sample_type_col_name</th> | |
8889 <td>sampleType</td> | |
8890 <td></td> | |
8891 <td></td> | |
8892 <td></td> | |
8893 </tr> | |
8894 </table> | |
8895 </div> | |
8896 | |
8897 | |
8898 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
8899 <h2 | |
8900 class="history_metadata_extractor_h2" | |
8901 style="cursor: pointer" | |
8902 title="click to fold/unfold the table" | |
8903 > | |
8904 [DELETED] - Batch_correction - 3.0.0 | |
8905 </h2> | |
8906 <p class="history_metadata_extractor_status"> | |
8907 Status: Failed (127) | |
8908 </p> | |
8909 <p class="history_metadata_extractor_glitter"></p> | |
8910 <table class=" | |
8911 table | |
8912 table-bordered | |
8913 table-dark | |
8914 table-striped | |
8915 table-hover | |
8916 d-block | |
8917 overflow-auto | |
8918 history_metadata_extractor_table | |
8919 "> | |
8920 <thead> | |
8921 <tr> | |
8922 <th scope="col"></th> | |
8923 <th scope="col">value</th> | |
8924 <th scope="col">name</th> | |
8925 <th scope="col">extension</th> | |
8926 <th scope="col">hid</th> | |
8927 </tr> | |
8928 </thead> | |
8929 <tr class=""> | |
8930 <th scope="row">dataMatrix</th> | |
8931 <td>9a0ce47bd1734ae7</td> | |
8932 <td>peaklist_fragments.tsv</td> | |
8933 <td>tabular</td> | |
8934 <td>42</td> | |
8935 </tr><tr class=""> | |
8936 <th scope="row">sampleMetadata</th> | |
8937 <td>9a0ce47bd1734ae7</td> | |
8938 <td>peaklist_fragments.tsv</td> | |
8939 <td>tabular</td> | |
8940 <td>42</td> | |
8941 </tr><tr class=""> | |
8942 <th scope="row">batch_col_name</th> | |
8943 <td>batch</td> | |
8944 <td></td> | |
8945 <td></td> | |
8946 <td></td> | |
8947 </tr><tr class=""> | |
8948 <th scope="row">injection_order_col_name</th> | |
8949 <td>injectionOrder</td> | |
8950 <td></td> | |
8951 <td></td> | |
8952 <td></td> | |
8953 </tr><tr class=""> | |
8954 <th scope="row">sampleTypeTagBlank</th> | |
8955 <td>blank</td> | |
8956 <td></td> | |
8957 <td></td> | |
8958 <td></td> | |
8959 </tr><tr class=""> | |
8960 <th scope="row">sampleTypeTagPool</th> | |
8961 <td>pool</td> | |
8962 <td></td> | |
8963 <td></td> | |
8964 <td></td> | |
8965 </tr><tr class=""> | |
8966 <th scope="row">sampleTypeTagSample</th> | |
8967 <td>sample</td> | |
8968 <td></td> | |
8969 <td></td> | |
8970 <td></td> | |
8971 </tr><tr class=""> | |
8972 <th scope="row">sample_type_col_name</th> | |
8973 <td>sampleType</td> | |
8974 <td></td> | |
8975 <td></td> | |
8976 <td></td> | |
8977 </tr><tr class=""> | |
8978 <th scope="row">detail</th> | |
8979 <td>no</td> | |
8980 <td></td> | |
8981 <td></td> | |
8982 <td></td> | |
8983 </tr><tr class=""> | |
8984 <th scope="row">method</th> | |
8985 <td>linear</td> | |
8986 <td></td> | |
8987 <td></td> | |
8988 <td></td> | |
8989 </tr><tr class=""> | |
8990 <th scope="row">ref_factor</th> | |
8991 <td>batch</td> | |
8992 <td></td> | |
8993 <td></td> | |
8994 <td></td> | |
8995 </tr><tr class=""> | |
8996 <th scope="row">valnull</th> | |
8997 <td>none</td> | |
8998 <td></td> | |
8999 <td></td> | |
9000 <td></td> | |
9001 </tr><tr class=""> | |
9002 <th scope="row">variableMetadata</th> | |
9003 <td>9a0ce47bd1734ae7</td> | |
9004 <td>peaklist_fragments.tsv</td> | |
9005 <td>tabular</td> | |
9006 <td>42</td> | |
9007 </tr> | |
9008 </table> | |
9009 </div> | |
9010 | |
9011 | |
9012 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
9013 <h2 | |
9014 class="history_metadata_extractor_h2" | |
9015 style="cursor: pointer" | |
9016 title="click to fold/unfold the table" | |
9017 > | |
9018 [DELETED] - Batch_correction - 3.0.0 | |
9019 </h2> | |
9020 <p class="history_metadata_extractor_status"> | |
9021 Status: Failed (127) | |
9022 </p> | |
9023 <p class="history_metadata_extractor_glitter"></p> | |
9024 <table class=" | |
9025 table | |
9026 table-bordered | |
9027 table-dark | |
9028 table-striped | |
9029 table-hover | |
9030 d-block | |
9031 overflow-auto | |
9032 history_metadata_extractor_table | |
9033 "> | |
9034 <thead> | |
9035 <tr> | |
9036 <th scope="col"></th> | |
9037 <th scope="col">value</th> | |
9038 <th scope="col">name</th> | |
9039 <th scope="col">extension</th> | |
9040 <th scope="col">hid</th> | |
9041 </tr> | |
9042 </thead> | |
9043 <tr class=""> | |
9044 <th scope="row">dataMatrix</th> | |
9045 <td>9a0ce47bd1734ae7</td> | |
9046 <td>peaklist_fragments.tsv</td> | |
9047 <td>tabular</td> | |
9048 <td>42</td> | |
9049 </tr><tr class=""> | |
9050 <th scope="row">sampleMetadata</th> | |
9051 <td>9a0ce47bd1734ae7</td> | |
9052 <td>peaklist_fragments.tsv</td> | |
9053 <td>tabular</td> | |
9054 <td>42</td> | |
9055 </tr><tr class=""> | |
9056 <th scope="row">batch_col_name</th> | |
9057 <td>batch</td> | |
9058 <td></td> | |
9059 <td></td> | |
9060 <td></td> | |
9061 </tr><tr class=""> | |
9062 <th scope="row">injection_order_col_name</th> | |
9063 <td>injectionOrder</td> | |
9064 <td></td> | |
9065 <td></td> | |
9066 <td></td> | |
9067 </tr><tr class=""> | |
9068 <th scope="row">sampleTypeTagBlank</th> | |
9069 <td>blank</td> | |
9070 <td></td> | |
9071 <td></td> | |
9072 <td></td> | |
9073 </tr><tr class=""> | |
9074 <th scope="row">sampleTypeTagPool</th> | |
9075 <td>pool</td> | |
9076 <td></td> | |
9077 <td></td> | |
9078 <td></td> | |
9079 </tr><tr class=""> | |
9080 <th scope="row">sampleTypeTagSample</th> | |
9081 <td>sample</td> | |
9082 <td></td> | |
9083 <td></td> | |
9084 <td></td> | |
9085 </tr><tr class=""> | |
9086 <th scope="row">sample_type_col_name</th> | |
9087 <td>sampleType</td> | |
9088 <td></td> | |
9089 <td></td> | |
9090 <td></td> | |
9091 </tr><tr class=""> | |
9092 <th scope="row">detail</th> | |
9093 <td>no</td> | |
9094 <td></td> | |
9095 <td></td> | |
9096 <td></td> | |
9097 </tr><tr class=""> | |
9098 <th scope="row">method</th> | |
9099 <td>linear</td> | |
9100 <td></td> | |
9101 <td></td> | |
9102 <td></td> | |
9103 </tr><tr class=""> | |
9104 <th scope="row">ref_factor</th> | |
9105 <td>batch</td> | |
9106 <td></td> | |
9107 <td></td> | |
9108 <td></td> | |
9109 </tr><tr class=""> | |
9110 <th scope="row">valnull</th> | |
9111 <td>none</td> | |
9112 <td></td> | |
9113 <td></td> | |
9114 <td></td> | |
9115 </tr><tr class=""> | |
9116 <th scope="row">variableMetadata</th> | |
9117 <td>9a0ce47bd1734ae7</td> | |
9118 <td>peaklist_fragments.tsv</td> | |
9119 <td>tabular</td> | |
9120 <td>42</td> | |
9121 </tr> | |
9122 </table> | |
9123 </div> | |
9124 | |
9125 | |
9126 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
9127 <h2 | |
9128 class="history_metadata_extractor_h2" | |
9129 style="cursor: pointer" | |
9130 title="click to fold/unfold the table" | |
9131 > | |
9132 [DELETED] - Batch_correction - 3.0.0 | |
9133 </h2> | |
9134 <p class="history_metadata_extractor_status"> | |
9135 Status: Failed (127) | |
9136 </p> | |
9137 <p class="history_metadata_extractor_glitter"></p> | |
9138 <table class=" | |
9139 table | |
9140 table-bordered | |
9141 table-dark | |
9142 table-striped | |
9143 table-hover | |
9144 d-block | |
9145 overflow-auto | |
9146 history_metadata_extractor_table | |
9147 "> | |
9148 <thead> | |
9149 <tr> | |
9150 <th scope="col"></th> | |
9151 <th scope="col">value</th> | |
9152 <th scope="col">name</th> | |
9153 <th scope="col">extension</th> | |
9154 <th scope="col">hid</th> | |
9155 </tr> | |
9156 </thead> | |
9157 <tr class=""> | |
9158 <th scope="row">dataMatrix</th> | |
9159 <td>9a0ce47bd1734ae7</td> | |
9160 <td>peaklist_fragments.tsv</td> | |
9161 <td>tabular</td> | |
9162 <td>42</td> | |
9163 </tr><tr class=""> | |
9164 <th scope="row">sampleMetadata</th> | |
9165 <td>9a0ce47bd1734ae7</td> | |
9166 <td>peaklist_fragments.tsv</td> | |
9167 <td>tabular</td> | |
9168 <td>42</td> | |
9169 </tr><tr class=""> | |
9170 <th scope="row">batch_col_name</th> | |
9171 <td>batch</td> | |
9172 <td></td> | |
9173 <td></td> | |
9174 <td></td> | |
9175 </tr><tr class=""> | |
9176 <th scope="row">injection_order_col_name</th> | |
9177 <td>injectionOrder</td> | |
9178 <td></td> | |
9179 <td></td> | |
9180 <td></td> | |
9181 </tr><tr class=""> | |
9182 <th scope="row">sampleTypeTagBlank</th> | |
9183 <td>blank</td> | |
9184 <td></td> | |
9185 <td></td> | |
9186 <td></td> | |
9187 </tr><tr class=""> | |
9188 <th scope="row">sampleTypeTagPool</th> | |
9189 <td>pool</td> | |
9190 <td></td> | |
9191 <td></td> | |
9192 <td></td> | |
9193 </tr><tr class=""> | |
9194 <th scope="row">sampleTypeTagSample</th> | |
9195 <td>sample</td> | |
9196 <td></td> | |
9197 <td></td> | |
9198 <td></td> | |
9199 </tr><tr class=""> | |
9200 <th scope="row">sample_type_col_name</th> | |
9201 <td>sampleType</td> | |
9202 <td></td> | |
9203 <td></td> | |
9204 <td></td> | |
9205 </tr><tr class=""> | |
9206 <th scope="row">detail</th> | |
9207 <td>no</td> | |
9208 <td></td> | |
9209 <td></td> | |
9210 <td></td> | |
9211 </tr><tr class=""> | |
9212 <th scope="row">method</th> | |
9213 <td>linear</td> | |
9214 <td></td> | |
9215 <td></td> | |
9216 <td></td> | |
9217 </tr><tr class=""> | |
9218 <th scope="row">ref_factor</th> | |
9219 <td>batch</td> | |
9220 <td></td> | |
9221 <td></td> | |
9222 <td></td> | |
9223 </tr><tr class=""> | |
9224 <th scope="row">valnull</th> | |
9225 <td>none</td> | |
9226 <td></td> | |
9227 <td></td> | |
9228 <td></td> | |
9229 </tr><tr class=""> | |
9230 <th scope="row">variableMetadata</th> | |
9231 <td>9a0ce47bd1734ae7</td> | |
9232 <td>peaklist_fragments.tsv</td> | |
9233 <td>tabular</td> | |
9234 <td>42</td> | |
9235 </tr> | |
9236 </table> | |
9237 </div> | |
9238 | |
9239 | |
9240 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
9241 <h2 | |
9242 class="history_metadata_extractor_h2" | |
9243 style="cursor: pointer" | |
9244 title="click to fold/unfold the table" | |
9245 > | |
9246 [DELETED] - Batch_correction - 3.0.0 | |
9247 </h2> | |
9248 <p class="history_metadata_extractor_status"> | |
9249 Status: Failed (127) | |
9250 </p> | |
9251 <p class="history_metadata_extractor_glitter"></p> | |
9252 <table class=" | |
9253 table | |
9254 table-bordered | |
9255 table-dark | |
9256 table-striped | |
9257 table-hover | |
9258 d-block | |
9259 overflow-auto | |
9260 history_metadata_extractor_table | |
9261 "> | |
9262 <thead> | |
9263 <tr> | |
9264 <th scope="col"></th> | |
9265 <th scope="col">value</th> | |
9266 <th scope="col">name</th> | |
9267 <th scope="col">extension</th> | |
9268 <th scope="col">hid</th> | |
9269 </tr> | |
9270 </thead> | |
9271 <tr class=""> | |
9272 <th scope="row">dataMatrix</th> | |
9273 <td>9a0ce47bd1734ae7</td> | |
9274 <td>peaklist_fragments.tsv</td> | |
9275 <td>tabular</td> | |
9276 <td>42</td> | |
9277 </tr><tr class=""> | |
9278 <th scope="row">sampleMetadata</th> | |
9279 <td>9a0ce47bd1734ae7</td> | |
9280 <td>peaklist_fragments.tsv</td> | |
9281 <td>tabular</td> | |
9282 <td>42</td> | |
9283 </tr><tr class=""> | |
9284 <th scope="row">batch_col_name</th> | |
9285 <td>batch</td> | |
9286 <td></td> | |
9287 <td></td> | |
9288 <td></td> | |
9289 </tr><tr class=""> | |
9290 <th scope="row">injection_order_col_name</th> | |
9291 <td>injectionOrder</td> | |
9292 <td></td> | |
9293 <td></td> | |
9294 <td></td> | |
9295 </tr><tr class=""> | |
9296 <th scope="row">sampleTypeTagBlank</th> | |
9297 <td>blank</td> | |
9298 <td></td> | |
9299 <td></td> | |
9300 <td></td> | |
9301 </tr><tr class=""> | |
9302 <th scope="row">sampleTypeTagPool</th> | |
9303 <td>pool</td> | |
9304 <td></td> | |
9305 <td></td> | |
9306 <td></td> | |
9307 </tr><tr class=""> | |
9308 <th scope="row">sampleTypeTagSample</th> | |
9309 <td>sample</td> | |
9310 <td></td> | |
9311 <td></td> | |
9312 <td></td> | |
9313 </tr><tr class=""> | |
9314 <th scope="row">sample_type_col_name</th> | |
9315 <td>sampleType</td> | |
9316 <td></td> | |
9317 <td></td> | |
9318 <td></td> | |
9319 </tr><tr class=""> | |
9320 <th scope="row">detail</th> | |
9321 <td>no</td> | |
9322 <td></td> | |
9323 <td></td> | |
9324 <td></td> | |
9325 </tr><tr class=""> | |
9326 <th scope="row">method</th> | |
9327 <td>linear</td> | |
9328 <td></td> | |
9329 <td></td> | |
9330 <td></td> | |
9331 </tr><tr class=""> | |
9332 <th scope="row">ref_factor</th> | |
9333 <td>batch</td> | |
9334 <td></td> | |
9335 <td></td> | |
9336 <td></td> | |
9337 </tr><tr class=""> | |
9338 <th scope="row">valnull</th> | |
9339 <td>none</td> | |
9340 <td></td> | |
9341 <td></td> | |
9342 <td></td> | |
9343 </tr><tr class=""> | |
9344 <th scope="row">variableMetadata</th> | |
9345 <td>9a0ce47bd1734ae7</td> | |
9346 <td>peaklist_fragments.tsv</td> | |
9347 <td>tabular</td> | |
9348 <td>42</td> | |
9349 </tr> | |
9350 </table> | |
9351 </div> | |
9352 | |
9353 | |
9354 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
9355 <h2 | |
9356 class="history_metadata_extractor_h2" | |
9357 style="cursor: pointer" | |
9358 title="click to fold/unfold the table" | |
9359 > | |
9360 [DELETED] - Batch_correction - 3.0.0 | |
9361 </h2> | |
9362 <p class="history_metadata_extractor_status"> | |
9363 Status: Failed (127) | |
9364 </p> | |
9365 <p class="history_metadata_extractor_glitter"></p> | |
9366 <table class=" | |
9367 table | |
9368 table-bordered | |
9369 table-dark | |
9370 table-striped | |
9371 table-hover | |
9372 d-block | |
9373 overflow-auto | |
9374 history_metadata_extractor_table | |
9375 "> | |
9376 <thead> | |
9377 <tr> | |
9378 <th scope="col"></th> | |
9379 <th scope="col">value</th> | |
9380 <th scope="col">name</th> | |
9381 <th scope="col">extension</th> | |
9382 <th scope="col">hid</th> | |
9383 </tr> | |
9384 </thead> | |
9385 <tr class=""> | |
9386 <th scope="row">dataMatrix</th> | |
9387 <td>9a0ce47bd1734ae7</td> | |
9388 <td>peaklist_fragments.tsv</td> | |
9389 <td>tabular</td> | |
9390 <td>42</td> | |
9391 </tr><tr class=""> | |
9392 <th scope="row">sampleMetadata</th> | |
9393 <td>9a0ce47bd1734ae7</td> | |
9394 <td>peaklist_fragments.tsv</td> | |
9395 <td>tabular</td> | |
9396 <td>42</td> | |
9397 </tr><tr class=""> | |
9398 <th scope="row">batch_col_name</th> | |
9399 <td>batch</td> | |
9400 <td></td> | |
9401 <td></td> | |
9402 <td></td> | |
9403 </tr><tr class=""> | |
9404 <th scope="row">injection_order_col_name</th> | |
9405 <td>injectionOrder</td> | |
9406 <td></td> | |
9407 <td></td> | |
9408 <td></td> | |
9409 </tr><tr class=""> | |
9410 <th scope="row">sampleTypeTagBlank</th> | |
9411 <td>blank</td> | |
9412 <td></td> | |
9413 <td></td> | |
9414 <td></td> | |
9415 </tr><tr class=""> | |
9416 <th scope="row">sampleTypeTagPool</th> | |
9417 <td>pool</td> | |
9418 <td></td> | |
9419 <td></td> | |
9420 <td></td> | |
9421 </tr><tr class=""> | |
9422 <th scope="row">sampleTypeTagSample</th> | |
9423 <td>sample</td> | |
9424 <td></td> | |
9425 <td></td> | |
9426 <td></td> | |
9427 </tr><tr class=""> | |
9428 <th scope="row">sample_type_col_name</th> | |
9429 <td>sampleType</td> | |
9430 <td></td> | |
9431 <td></td> | |
9432 <td></td> | |
9433 </tr><tr class=""> | |
9434 <th scope="row">detail</th> | |
9435 <td>no</td> | |
9436 <td></td> | |
9437 <td></td> | |
9438 <td></td> | |
9439 </tr><tr class=""> | |
9440 <th scope="row">method</th> | |
9441 <td>linear</td> | |
9442 <td></td> | |
9443 <td></td> | |
9444 <td></td> | |
9445 </tr><tr class=""> | |
9446 <th scope="row">ref_factor</th> | |
9447 <td>batch</td> | |
9448 <td></td> | |
9449 <td></td> | |
9450 <td></td> | |
9451 </tr><tr class=""> | |
9452 <th scope="row">valnull</th> | |
9453 <td>none</td> | |
9454 <td></td> | |
9455 <td></td> | |
9456 <td></td> | |
9457 </tr><tr class=""> | |
9458 <th scope="row">variableMetadata</th> | |
9459 <td>9a0ce47bd1734ae7</td> | |
9460 <td>peaklist_fragments.tsv</td> | |
9461 <td>tabular</td> | |
9462 <td>42</td> | |
9463 </tr> | |
9464 </table> | |
9465 </div> | |
9466 | |
9467 | |
9468 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
9469 <h2 | |
9470 class="history_metadata_extractor_h2" | |
9471 style="cursor: pointer" | |
9472 title="click to fold/unfold the table" | |
9473 > | |
9474 [DELETED] - Batch_correction - 3.0.0 | |
9475 </h2> | |
9476 <p class="history_metadata_extractor_status"> | |
9477 Status: Failed (127) | |
9478 </p> | |
9479 <p class="history_metadata_extractor_glitter"></p> | |
9480 <table class=" | |
9481 table | |
9482 table-bordered | |
9483 table-dark | |
9484 table-striped | |
9485 table-hover | |
9486 d-block | |
9487 overflow-auto | |
9488 history_metadata_extractor_table | |
9489 "> | |
9490 <thead> | |
9491 <tr> | |
9492 <th scope="col"></th> | |
9493 <th scope="col">value</th> | |
9494 <th scope="col">name</th> | |
9495 <th scope="col">extension</th> | |
9496 <th scope="col">hid</th> | |
9497 </tr> | |
9498 </thead> | |
9499 <tr class=""> | |
9500 <th scope="row">dataMatrix</th> | |
9501 <td>9a0ce47bd1734ae7</td> | |
9502 <td>peaklist_fragments.tsv</td> | |
9503 <td>tabular</td> | |
9504 <td>42</td> | |
9505 </tr><tr class=""> | |
9506 <th scope="row">sampleMetadata</th> | |
9507 <td>9a0ce47bd1734ae7</td> | |
9508 <td>peaklist_fragments.tsv</td> | |
9509 <td>tabular</td> | |
9510 <td>42</td> | |
9511 </tr><tr class=""> | |
9512 <th scope="row">batch_col_name</th> | |
9513 <td>batch</td> | |
9514 <td></td> | |
9515 <td></td> | |
9516 <td></td> | |
9517 </tr><tr class=""> | |
9518 <th scope="row">injection_order_col_name</th> | |
9519 <td>injectionOrder</td> | |
9520 <td></td> | |
9521 <td></td> | |
9522 <td></td> | |
9523 </tr><tr class=""> | |
9524 <th scope="row">sampleTypeTagBlank</th> | |
9525 <td>blank</td> | |
9526 <td></td> | |
9527 <td></td> | |
9528 <td></td> | |
9529 </tr><tr class=""> | |
9530 <th scope="row">sampleTypeTagPool</th> | |
9531 <td>pool</td> | |
9532 <td></td> | |
9533 <td></td> | |
9534 <td></td> | |
9535 </tr><tr class=""> | |
9536 <th scope="row">sampleTypeTagSample</th> | |
9537 <td>sample</td> | |
9538 <td></td> | |
9539 <td></td> | |
9540 <td></td> | |
9541 </tr><tr class=""> | |
9542 <th scope="row">sample_type_col_name</th> | |
9543 <td>sampleType</td> | |
9544 <td></td> | |
9545 <td></td> | |
9546 <td></td> | |
9547 </tr><tr class=""> | |
9548 <th scope="row">detail</th> | |
9549 <td>no</td> | |
9550 <td></td> | |
9551 <td></td> | |
9552 <td></td> | |
9553 </tr><tr class=""> | |
9554 <th scope="row">method</th> | |
9555 <td>linear</td> | |
9556 <td></td> | |
9557 <td></td> | |
9558 <td></td> | |
9559 </tr><tr class=""> | |
9560 <th scope="row">ref_factor</th> | |
9561 <td>batch</td> | |
9562 <td></td> | |
9563 <td></td> | |
9564 <td></td> | |
9565 </tr><tr class=""> | |
9566 <th scope="row">valnull</th> | |
9567 <td>none</td> | |
9568 <td></td> | |
9569 <td></td> | |
9570 <td></td> | |
9571 </tr><tr class=""> | |
9572 <th scope="row">variableMetadata</th> | |
9573 <td>9a0ce47bd1734ae7</td> | |
9574 <td>peaklist_fragments.tsv</td> | |
9575 <td>tabular</td> | |
9576 <td>42</td> | |
9577 </tr> | |
9578 </table> | |
9579 </div> | |
9580 | |
9581 | |
9582 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
9583 <h2 | |
9584 class="history_metadata_extractor_h2" | |
9585 style="cursor: pointer" | |
9586 title="click to fold/unfold the table" | |
9587 > | |
9588 [DELETED] - Batch_correction - 3.0.0 | |
9589 </h2> | |
9590 <p class="history_metadata_extractor_status"> | |
9591 Status: Failed (1) | |
9592 </p> | |
9593 <p class="history_metadata_extractor_glitter"></p> | |
9594 <table class=" | |
9595 table | |
9596 table-bordered | |
9597 table-dark | |
9598 table-striped | |
9599 table-hover | |
9600 d-block | |
9601 overflow-auto | |
9602 history_metadata_extractor_table | |
9603 "> | |
9604 <thead> | |
9605 <tr> | |
9606 <th scope="col"></th> | |
9607 <th scope="col">value</th> | |
9608 <th scope="col">name</th> | |
9609 <th scope="col">extension</th> | |
9610 <th scope="col">hid</th> | |
9611 </tr> | |
9612 </thead> | |
9613 <tr class=""> | |
9614 <th scope="row">dataMatrix</th> | |
9615 <td>9a0ce47bd1734ae7</td> | |
9616 <td>peaklist_fragments.tsv</td> | |
9617 <td>tabular</td> | |
9618 <td>42</td> | |
9619 </tr><tr class=""> | |
9620 <th scope="row">sampleMetadata</th> | |
9621 <td>9a0ce47bd1734ae7</td> | |
9622 <td>peaklist_fragments.tsv</td> | |
9623 <td>tabular</td> | |
9624 <td>42</td> | |
9625 </tr><tr class=""> | |
9626 <th scope="row">batch_col_name</th> | |
9627 <td>batch</td> | |
9628 <td></td> | |
9629 <td></td> | |
9630 <td></td> | |
9631 </tr><tr class=""> | |
9632 <th scope="row">injection_order_col_name</th> | |
9633 <td>injectionOrder</td> | |
9634 <td></td> | |
9635 <td></td> | |
9636 <td></td> | |
9637 </tr><tr class=""> | |
9638 <th scope="row">sampleTypeTagBlank</th> | |
9639 <td>blank</td> | |
9640 <td></td> | |
9641 <td></td> | |
9642 <td></td> | |
9643 </tr><tr class=""> | |
9644 <th scope="row">sampleTypeTagPool</th> | |
9645 <td>pool</td> | |
9646 <td></td> | |
9647 <td></td> | |
9648 <td></td> | |
9649 </tr><tr class=""> | |
9650 <th scope="row">sampleTypeTagSample</th> | |
9651 <td>sample</td> | |
9652 <td></td> | |
9653 <td></td> | |
9654 <td></td> | |
9655 </tr><tr class=""> | |
9656 <th scope="row">sample_type_col_name</th> | |
9657 <td>sampleType</td> | |
9658 <td></td> | |
9659 <td></td> | |
9660 <td></td> | |
9661 </tr><tr class=""> | |
9662 <th scope="row">detail</th> | |
9663 <td>no</td> | |
9664 <td></td> | |
9665 <td></td> | |
9666 <td></td> | |
9667 </tr><tr class=""> | |
9668 <th scope="row">method</th> | |
9669 <td>linear</td> | |
9670 <td></td> | |
9671 <td></td> | |
9672 <td></td> | |
9673 </tr><tr class=""> | |
9674 <th scope="row">ref_factor</th> | |
9675 <td>batch</td> | |
9676 <td></td> | |
9677 <td></td> | |
9678 <td></td> | |
9679 </tr><tr class=""> | |
9680 <th scope="row">valnull</th> | |
9681 <td>none</td> | |
9682 <td></td> | |
9683 <td></td> | |
9684 <td></td> | |
9685 </tr><tr class=""> | |
9686 <th scope="row">variableMetadata</th> | |
9687 <td>9a0ce47bd1734ae7</td> | |
9688 <td>peaklist_fragments.tsv</td> | |
9689 <td>tabular</td> | |
9690 <td>42</td> | |
9691 </tr> | |
9692 </table> | |
9693 </div> | |
9694 | |
9695 | |
9696 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
9697 <h2 | |
9698 class="history_metadata_extractor_h2" | |
9699 style="cursor: pointer" | |
9700 title="click to fold/unfold the table" | |
9701 > | |
9702 [DELETED] - Batch_correction - 3.0.0 | |
9703 </h2> | |
9704 <p class="history_metadata_extractor_status"> | |
9705 Status: Failed (1) | |
9706 </p> | |
9707 <p class="history_metadata_extractor_glitter"></p> | |
9708 <table class=" | |
9709 table | |
9710 table-bordered | |
9711 table-dark | |
9712 table-striped | |
9713 table-hover | |
9714 d-block | |
9715 overflow-auto | |
9716 history_metadata_extractor_table | |
9717 "> | |
9718 <thead> | |
9719 <tr> | |
9720 <th scope="col"></th> | |
9721 <th scope="col">value</th> | |
9722 <th scope="col">name</th> | |
9723 <th scope="col">extension</th> | |
9724 <th scope="col">hid</th> | |
9725 </tr> | |
9726 </thead> | |
9727 <tr class=""> | |
9728 <th scope="row">dataMatrix</th> | |
9729 <td>9a0ce47bd1734ae7</td> | |
9730 <td>peaklist_fragments.tsv</td> | |
9731 <td>tabular</td> | |
9732 <td>42</td> | |
9733 </tr><tr class=""> | |
9734 <th scope="row">sampleMetadata</th> | |
9735 <td>9a0ce47bd1734ae7</td> | |
9736 <td>peaklist_fragments.tsv</td> | |
9737 <td>tabular</td> | |
9738 <td>42</td> | |
9739 </tr><tr class=""> | |
9740 <th scope="row">batch_col_name</th> | |
9741 <td>batch</td> | |
9742 <td></td> | |
9743 <td></td> | |
9744 <td></td> | |
9745 </tr><tr class=""> | |
9746 <th scope="row">injection_order_col_name</th> | |
9747 <td>injectionOrder</td> | |
9748 <td></td> | |
9749 <td></td> | |
9750 <td></td> | |
9751 </tr><tr class=""> | |
9752 <th scope="row">sampleTypeTagBlank</th> | |
9753 <td>blank</td> | |
9754 <td></td> | |
9755 <td></td> | |
9756 <td></td> | |
9757 </tr><tr class=""> | |
9758 <th scope="row">sampleTypeTagPool</th> | |
9759 <td>pool</td> | |
9760 <td></td> | |
9761 <td></td> | |
9762 <td></td> | |
9763 </tr><tr class=""> | |
9764 <th scope="row">sampleTypeTagSample</th> | |
9765 <td>sample</td> | |
9766 <td></td> | |
9767 <td></td> | |
9768 <td></td> | |
9769 </tr><tr class=""> | |
9770 <th scope="row">sample_type_col_name</th> | |
9771 <td>sampleType</td> | |
9772 <td></td> | |
9773 <td></td> | |
9774 <td></td> | |
9775 </tr><tr class=""> | |
9776 <th scope="row">detail</th> | |
9777 <td>no</td> | |
9778 <td></td> | |
9779 <td></td> | |
9780 <td></td> | |
9781 </tr><tr class=""> | |
9782 <th scope="row">method</th> | |
9783 <td>linear</td> | |
9784 <td></td> | |
9785 <td></td> | |
9786 <td></td> | |
9787 </tr><tr class=""> | |
9788 <th scope="row">ref_factor</th> | |
9789 <td>batch</td> | |
9790 <td></td> | |
9791 <td></td> | |
9792 <td></td> | |
9793 </tr><tr class=""> | |
9794 <th scope="row">valnull</th> | |
9795 <td>none</td> | |
9796 <td></td> | |
9797 <td></td> | |
9798 <td></td> | |
9799 </tr><tr class=""> | |
9800 <th scope="row">variableMetadata</th> | |
9801 <td>9a0ce47bd1734ae7</td> | |
9802 <td>peaklist_fragments.tsv</td> | |
9803 <td>tabular</td> | |
9804 <td>42</td> | |
9805 </tr> | |
9806 </table> | |
9807 </div> | |
9808 | |
9809 | |
9810 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
9811 <h2 | |
9812 class="history_metadata_extractor_h2" | |
9813 style="cursor: pointer" | |
9814 title="click to fold/unfold the table" | |
9815 > | |
9816 [DELETED] - Batch_correction - 3.0.0 | |
9817 </h2> | |
9818 <p class="history_metadata_extractor_status"> | |
9819 Status: Failed (1) | |
9820 </p> | |
9821 <p class="history_metadata_extractor_glitter"></p> | |
9822 <table class=" | |
9823 table | |
9824 table-bordered | |
9825 table-dark | |
9826 table-striped | |
9827 table-hover | |
9828 d-block | |
9829 overflow-auto | |
9830 history_metadata_extractor_table | |
9831 "> | |
9832 <thead> | |
9833 <tr> | |
9834 <th scope="col"></th> | |
9835 <th scope="col">value</th> | |
9836 <th scope="col">name</th> | |
9837 <th scope="col">extension</th> | |
9838 <th scope="col">hid</th> | |
9839 </tr> | |
9840 </thead> | |
9841 <tr class=""> | |
9842 <th scope="row">dataMatrix</th> | |
9843 <td>9a0ce47bd1734ae7</td> | |
9844 <td>peaklist_fragments.tsv</td> | |
9845 <td>tabular</td> | |
9846 <td>42</td> | |
9847 </tr><tr class=""> | |
9848 <th scope="row">sampleMetadata</th> | |
9849 <td>9a0ce47bd1734ae7</td> | |
9850 <td>peaklist_fragments.tsv</td> | |
9851 <td>tabular</td> | |
9852 <td>42</td> | |
9853 </tr><tr class=""> | |
9854 <th scope="row">batch_col_name</th> | |
9855 <td>batch</td> | |
9856 <td></td> | |
9857 <td></td> | |
9858 <td></td> | |
9859 </tr><tr class=""> | |
9860 <th scope="row">injection_order_col_name</th> | |
9861 <td>injectionOrder</td> | |
9862 <td></td> | |
9863 <td></td> | |
9864 <td></td> | |
9865 </tr><tr class=""> | |
9866 <th scope="row">sampleTypeTagBlank</th> | |
9867 <td>blank</td> | |
9868 <td></td> | |
9869 <td></td> | |
9870 <td></td> | |
9871 </tr><tr class=""> | |
9872 <th scope="row">sampleTypeTagPool</th> | |
9873 <td>pool</td> | |
9874 <td></td> | |
9875 <td></td> | |
9876 <td></td> | |
9877 </tr><tr class=""> | |
9878 <th scope="row">sampleTypeTagSample</th> | |
9879 <td>sample</td> | |
9880 <td></td> | |
9881 <td></td> | |
9882 <td></td> | |
9883 </tr><tr class=""> | |
9884 <th scope="row">sample_type_col_name</th> | |
9885 <td>sampleType</td> | |
9886 <td></td> | |
9887 <td></td> | |
9888 <td></td> | |
9889 </tr><tr class=""> | |
9890 <th scope="row">detail</th> | |
9891 <td>no</td> | |
9892 <td></td> | |
9893 <td></td> | |
9894 <td></td> | |
9895 </tr><tr class=""> | |
9896 <th scope="row">method</th> | |
9897 <td>linear</td> | |
9898 <td></td> | |
9899 <td></td> | |
9900 <td></td> | |
9901 </tr><tr class=""> | |
9902 <th scope="row">ref_factor</th> | |
9903 <td>batch</td> | |
9904 <td></td> | |
9905 <td></td> | |
9906 <td></td> | |
9907 </tr><tr class=""> | |
9908 <th scope="row">valnull</th> | |
9909 <td>none</td> | |
9910 <td></td> | |
9911 <td></td> | |
9912 <td></td> | |
9913 </tr><tr class=""> | |
9914 <th scope="row">variableMetadata</th> | |
9915 <td>9a0ce47bd1734ae7</td> | |
9916 <td>peaklist_fragments.tsv</td> | |
9917 <td>tabular</td> | |
9918 <td>42</td> | |
9919 </tr> | |
9920 </table> | |
9921 </div> | |
9922 | |
9923 | |
9924 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
9925 <h2 | |
9926 class="history_metadata_extractor_h2" | |
9927 style="cursor: pointer" | |
9928 title="click to fold/unfold the table" | |
9929 > | |
9930 [DELETED] - Determine_BC - 3.0.0 | |
9931 </h2> | |
9932 <p class="history_metadata_extractor_status"> | |
9933 Status: Failed (1) | |
9934 </p> | |
9935 <p class="history_metadata_extractor_glitter"></p> | |
9936 <table class=" | |
9937 table | |
9938 table-bordered | |
9939 table-dark | |
9940 table-striped | |
9941 table-hover | |
9942 d-block | |
9943 overflow-auto | |
9944 history_metadata_extractor_table | |
9945 "> | |
9946 <thead> | |
9947 <tr> | |
9948 <th scope="col"></th> | |
9949 <th scope="col">value</th> | |
9950 <th scope="col">name</th> | |
9951 <th scope="col">extension</th> | |
9952 <th scope="col">hid</th> | |
9953 </tr> | |
9954 </thead> | |
9955 <tr class=""> | |
9956 <th scope="row">option</th> | |
9957 <td>hide</td> | |
9958 <td></td> | |
9959 <td></td> | |
9960 <td></td> | |
9961 </tr><tr class=""> | |
9962 <th scope="row">dataMatrix</th> | |
9963 <td>7cf499d16bd542b2</td> | |
9964 <td>compounds_pos.txt</td> | |
9965 <td>tabular</td> | |
9966 <td>44</td> | |
9967 </tr><tr class=""> | |
9968 <th scope="row">ref_factor</th> | |
9969 <td>batch</td> | |
9970 <td></td> | |
9971 <td></td> | |
9972 <td></td> | |
9973 </tr><tr class=""> | |
9974 <th scope="row">sampleMetadata</th> | |
9975 <td>7cf499d16bd542b2</td> | |
9976 <td>compounds_pos.txt</td> | |
9977 <td>tabular</td> | |
9978 <td>44</td> | |
9979 </tr><tr class=""> | |
9980 <th scope="row">batch_col_name</th> | |
9981 <td>batch</td> | |
9982 <td></td> | |
9983 <td></td> | |
9984 <td></td> | |
9985 </tr><tr class=""> | |
9986 <th scope="row">injection_order_col_name</th> | |
9987 <td>injectionOrder</td> | |
9988 <td></td> | |
9989 <td></td> | |
9990 <td></td> | |
9991 </tr><tr class=""> | |
9992 <th scope="row">sampleTypeTagBlank</th> | |
9993 <td>blank</td> | |
9994 <td></td> | |
9995 <td></td> | |
9996 <td></td> | |
9997 </tr><tr class=""> | |
9998 <th scope="row">sampleTypeTagPool</th> | |
9999 <td>pool</td> | |
10000 <td></td> | |
10001 <td></td> | |
10002 <td></td> | |
10003 </tr><tr class=""> | |
10004 <th scope="row">sampleTypeTagSample</th> | |
10005 <td>sample</td> | |
10006 <td></td> | |
10007 <td></td> | |
10008 <td></td> | |
10009 </tr><tr class=""> | |
10010 <th scope="row">sample_type_col_name</th> | |
10011 <td>sampleType</td> | |
10012 <td></td> | |
10013 <td></td> | |
10014 <td></td> | |
10015 </tr> | |
10016 </table> | |
10017 </div> | |
10018 | |
10019 | |
10020 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
10021 <h2 | |
10022 class="history_metadata_extractor_h2" | |
10023 style="cursor: pointer" | |
10024 title="click to fold/unfold the table" | |
10025 > | |
10026 [DELETED] - Determine_BC - 3.0.0 | |
10027 </h2> | |
10028 <p class="history_metadata_extractor_status"> | |
10029 Status: Failed (1) | |
10030 </p> | |
10031 <p class="history_metadata_extractor_glitter"></p> | |
10032 <table class=" | |
10033 table | |
10034 table-bordered | |
10035 table-dark | |
10036 table-striped | |
10037 table-hover | |
10038 d-block | |
10039 overflow-auto | |
10040 history_metadata_extractor_table | |
10041 "> | |
10042 <thead> | |
10043 <tr> | |
10044 <th scope="col"></th> | |
10045 <th scope="col">value</th> | |
10046 <th scope="col">name</th> | |
10047 <th scope="col">extension</th> | |
10048 <th scope="col">hid</th> | |
10049 </tr> | |
10050 </thead> | |
10051 <tr class=""> | |
10052 <th scope="row">option</th> | |
10053 <td>hide</td> | |
10054 <td></td> | |
10055 <td></td> | |
10056 <td></td> | |
10057 </tr><tr class=""> | |
10058 <th scope="row">dataMatrix</th> | |
10059 <td>7cf499d16bd542b2</td> | |
10060 <td>compounds_pos.txt</td> | |
10061 <td>tabular</td> | |
10062 <td>44</td> | |
10063 </tr><tr class=""> | |
10064 <th scope="row">ref_factor</th> | |
10065 <td>batch</td> | |
10066 <td></td> | |
10067 <td></td> | |
10068 <td></td> | |
10069 </tr><tr class=""> | |
10070 <th scope="row">sampleMetadata</th> | |
10071 <td>7cf499d16bd542b2</td> | |
10072 <td>compounds_pos.txt</td> | |
10073 <td>tabular</td> | |
10074 <td>44</td> | |
10075 </tr><tr class=""> | |
10076 <th scope="row">batch_col_name</th> | |
10077 <td>batch</td> | |
10078 <td></td> | |
10079 <td></td> | |
10080 <td></td> | |
10081 </tr><tr class=""> | |
10082 <th scope="row">injection_order_col_name</th> | |
10083 <td>injectionOrder</td> | |
10084 <td></td> | |
10085 <td></td> | |
10086 <td></td> | |
10087 </tr><tr class=""> | |
10088 <th scope="row">sampleTypeTagBlank</th> | |
10089 <td>blank</td> | |
10090 <td></td> | |
10091 <td></td> | |
10092 <td></td> | |
10093 </tr><tr class=""> | |
10094 <th scope="row">sampleTypeTagPool</th> | |
10095 <td>pool</td> | |
10096 <td></td> | |
10097 <td></td> | |
10098 <td></td> | |
10099 </tr><tr class=""> | |
10100 <th scope="row">sampleTypeTagSample</th> | |
10101 <td>sample</td> | |
10102 <td></td> | |
10103 <td></td> | |
10104 <td></td> | |
10105 </tr><tr class=""> | |
10106 <th scope="row">sample_type_col_name</th> | |
10107 <td>sampleType</td> | |
10108 <td></td> | |
10109 <td></td> | |
10110 <td></td> | |
10111 </tr> | |
10112 </table> | |
10113 </div> | |
10114 | |
10115 | |
10116 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
10117 <h2 | |
10118 class="history_metadata_extractor_h2" | |
10119 style="cursor: pointer" | |
10120 title="click to fold/unfold the table" | |
10121 > | |
10122 [DELETED] - Batch_correction - 3.0.0 | |
10123 </h2> | |
10124 <p class="history_metadata_extractor_status"> | |
10125 Status: Failed (1) | |
10126 </p> | |
10127 <p class="history_metadata_extractor_glitter"></p> | |
10128 <table class=" | |
10129 table | |
10130 table-bordered | |
10131 table-dark | |
10132 table-striped | |
10133 table-hover | |
10134 d-block | |
10135 overflow-auto | |
10136 history_metadata_extractor_table | |
10137 "> | |
10138 <thead> | |
10139 <tr> | |
10140 <th scope="col"></th> | |
10141 <th scope="col">value</th> | |
10142 <th scope="col">name</th> | |
10143 <th scope="col">extension</th> | |
10144 <th scope="col">hid</th> | |
10145 </tr> | |
10146 </thead> | |
10147 <tr class=""> | |
10148 <th scope="row">dataMatrix</th> | |
10149 <td>7cf499d16bd542b2</td> | |
10150 <td>compounds_pos.txt</td> | |
10151 <td>tabular</td> | |
10152 <td>44</td> | |
10153 </tr><tr class=""> | |
10154 <th scope="row">sampleMetadata</th> | |
10155 <td>7cf499d16bd542b2</td> | |
10156 <td>compounds_pos.txt</td> | |
10157 <td>tabular</td> | |
10158 <td>44</td> | |
10159 </tr><tr class=""> | |
10160 <th scope="row">batch_col_name</th> | |
10161 <td>batch</td> | |
10162 <td></td> | |
10163 <td></td> | |
10164 <td></td> | |
10165 </tr><tr class=""> | |
10166 <th scope="row">injection_order_col_name</th> | |
10167 <td>injectionOrder</td> | |
10168 <td></td> | |
10169 <td></td> | |
10170 <td></td> | |
10171 </tr><tr class=""> | |
10172 <th scope="row">sampleTypeTagBlank</th> | |
10173 <td>blank</td> | |
10174 <td></td> | |
10175 <td></td> | |
10176 <td></td> | |
10177 </tr><tr class=""> | |
10178 <th scope="row">sampleTypeTagPool</th> | |
10179 <td>pool</td> | |
10180 <td></td> | |
10181 <td></td> | |
10182 <td></td> | |
10183 </tr><tr class=""> | |
10184 <th scope="row">sampleTypeTagSample</th> | |
10185 <td>sample</td> | |
10186 <td></td> | |
10187 <td></td> | |
10188 <td></td> | |
10189 </tr><tr class=""> | |
10190 <th scope="row">sample_type_col_name</th> | |
10191 <td>sampleType</td> | |
10192 <td></td> | |
10193 <td></td> | |
10194 <td></td> | |
10195 </tr><tr class=""> | |
10196 <th scope="row">detail</th> | |
10197 <td>no</td> | |
10198 <td></td> | |
10199 <td></td> | |
10200 <td></td> | |
10201 </tr><tr class=""> | |
10202 <th scope="row">method</th> | |
10203 <td>linear</td> | |
10204 <td></td> | |
10205 <td></td> | |
10206 <td></td> | |
10207 </tr><tr class=""> | |
10208 <th scope="row">ref_factor</th> | |
10209 <td>batch</td> | |
10210 <td></td> | |
10211 <td></td> | |
10212 <td></td> | |
10213 </tr><tr class=""> | |
10214 <th scope="row">valnull</th> | |
10215 <td>none</td> | |
10216 <td></td> | |
10217 <td></td> | |
10218 <td></td> | |
10219 </tr><tr class=""> | |
10220 <th scope="row">variableMetadata</th> | |
10221 <td>7cf499d16bd542b2</td> | |
10222 <td>compounds_pos.txt</td> | |
10223 <td>tabular</td> | |
10224 <td>44</td> | |
10225 </tr> | |
10226 </table> | |
10227 </div> | |
10228 | |
10229 | |
10230 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
10231 <h2 | |
10232 class="history_metadata_extractor_h2" | |
10233 style="cursor: pointer" | |
10234 title="click to fold/unfold the table" | |
10235 > | |
10236 [DELETED] - Batch_correction - 3.0.0 | |
10237 </h2> | |
10238 <p class="history_metadata_extractor_status"> | |
10239 Status: Failed (1) | |
10240 </p> | |
10241 <p class="history_metadata_extractor_glitter"></p> | |
10242 <table class=" | |
10243 table | |
10244 table-bordered | |
10245 table-dark | |
10246 table-striped | |
10247 table-hover | |
10248 d-block | |
10249 overflow-auto | |
10250 history_metadata_extractor_table | |
10251 "> | |
10252 <thead> | |
10253 <tr> | |
10254 <th scope="col"></th> | |
10255 <th scope="col">value</th> | |
10256 <th scope="col">name</th> | |
10257 <th scope="col">extension</th> | |
10258 <th scope="col">hid</th> | |
10259 </tr> | |
10260 </thead> | |
10261 <tr class=""> | |
10262 <th scope="row">dataMatrix</th> | |
10263 <td>7cf499d16bd542b2</td> | |
10264 <td>compounds_pos.txt</td> | |
10265 <td>tabular</td> | |
10266 <td>44</td> | |
10267 </tr><tr class=""> | |
10268 <th scope="row">sampleMetadata</th> | |
10269 <td>7cf499d16bd542b2</td> | |
10270 <td>compounds_pos.txt</td> | |
10271 <td>tabular</td> | |
10272 <td>44</td> | |
10273 </tr><tr class=""> | |
10274 <th scope="row">batch_col_name</th> | |
10275 <td>batch</td> | |
10276 <td></td> | |
10277 <td></td> | |
10278 <td></td> | |
10279 </tr><tr class=""> | |
10280 <th scope="row">injection_order_col_name</th> | |
10281 <td>injectionOrder</td> | |
10282 <td></td> | |
10283 <td></td> | |
10284 <td></td> | |
10285 </tr><tr class=""> | |
10286 <th scope="row">sampleTypeTagBlank</th> | |
10287 <td>blank</td> | |
10288 <td></td> | |
10289 <td></td> | |
10290 <td></td> | |
10291 </tr><tr class=""> | |
10292 <th scope="row">sampleTypeTagPool</th> | |
10293 <td>pool</td> | |
10294 <td></td> | |
10295 <td></td> | |
10296 <td></td> | |
10297 </tr><tr class=""> | |
10298 <th scope="row">sampleTypeTagSample</th> | |
10299 <td>sample</td> | |
10300 <td></td> | |
10301 <td></td> | |
10302 <td></td> | |
10303 </tr><tr class=""> | |
10304 <th scope="row">sample_type_col_name</th> | |
10305 <td>sampleType</td> | |
10306 <td></td> | |
10307 <td></td> | |
10308 <td></td> | |
10309 </tr><tr class=""> | |
10310 <th scope="row">detail</th> | |
10311 <td>no</td> | |
10312 <td></td> | |
10313 <td></td> | |
10314 <td></td> | |
10315 </tr><tr class=""> | |
10316 <th scope="row">method</th> | |
10317 <td>linear</td> | |
10318 <td></td> | |
10319 <td></td> | |
10320 <td></td> | |
10321 </tr><tr class=""> | |
10322 <th scope="row">ref_factor</th> | |
10323 <td>batch</td> | |
10324 <td></td> | |
10325 <td></td> | |
10326 <td></td> | |
10327 </tr><tr class=""> | |
10328 <th scope="row">valnull</th> | |
10329 <td>none</td> | |
10330 <td></td> | |
10331 <td></td> | |
10332 <td></td> | |
10333 </tr><tr class=""> | |
10334 <th scope="row">variableMetadata</th> | |
10335 <td>7cf499d16bd542b2</td> | |
10336 <td>compounds_pos.txt</td> | |
10337 <td>tabular</td> | |
10338 <td>44</td> | |
10339 </tr> | |
10340 </table> | |
10341 </div> | |
10342 | |
10343 | |
10344 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
10345 <h2 | |
10346 class="history_metadata_extractor_h2" | |
10347 style="cursor: pointer" | |
10348 title="click to fold/unfold the table" | |
10349 > | |
10350 [DELETED] - Batch_correction - 3.0.0 | |
10351 </h2> | |
10352 <p class="history_metadata_extractor_status"> | |
10353 Status: Failed (1) | |
10354 </p> | |
10355 <p class="history_metadata_extractor_glitter"></p> | |
10356 <table class=" | |
10357 table | |
10358 table-bordered | |
10359 table-dark | |
10360 table-striped | |
10361 table-hover | |
10362 d-block | |
10363 overflow-auto | |
10364 history_metadata_extractor_table | |
10365 "> | |
10366 <thead> | |
10367 <tr> | |
10368 <th scope="col"></th> | |
10369 <th scope="col">value</th> | |
10370 <th scope="col">name</th> | |
10371 <th scope="col">extension</th> | |
10372 <th scope="col">hid</th> | |
10373 </tr> | |
10374 </thead> | |
10375 <tr class=""> | |
10376 <th scope="row">dataMatrix</th> | |
10377 <td>7cf499d16bd542b2</td> | |
10378 <td>compounds_pos.txt</td> | |
10379 <td>tabular</td> | |
10380 <td>44</td> | |
10381 </tr><tr class=""> | |
10382 <th scope="row">sampleMetadata</th> | |
10383 <td>7cf499d16bd542b2</td> | |
10384 <td>compounds_pos.txt</td> | |
10385 <td>tabular</td> | |
10386 <td>44</td> | |
10387 </tr><tr class=""> | |
10388 <th scope="row">batch_col_name</th> | |
10389 <td>batch</td> | |
10390 <td></td> | |
10391 <td></td> | |
10392 <td></td> | |
10393 </tr><tr class=""> | |
10394 <th scope="row">injection_order_col_name</th> | |
10395 <td>injectionOrder</td> | |
10396 <td></td> | |
10397 <td></td> | |
10398 <td></td> | |
10399 </tr><tr class=""> | |
10400 <th scope="row">sampleTypeTagBlank</th> | |
10401 <td>blank</td> | |
10402 <td></td> | |
10403 <td></td> | |
10404 <td></td> | |
10405 </tr><tr class=""> | |
10406 <th scope="row">sampleTypeTagPool</th> | |
10407 <td>pool</td> | |
10408 <td></td> | |
10409 <td></td> | |
10410 <td></td> | |
10411 </tr><tr class=""> | |
10412 <th scope="row">sampleTypeTagSample</th> | |
10413 <td>sample</td> | |
10414 <td></td> | |
10415 <td></td> | |
10416 <td></td> | |
10417 </tr><tr class=""> | |
10418 <th scope="row">sample_type_col_name</th> | |
10419 <td>sampleType</td> | |
10420 <td></td> | |
10421 <td></td> | |
10422 <td></td> | |
10423 </tr><tr class=""> | |
10424 <th scope="row">detail</th> | |
10425 <td>no</td> | |
10426 <td></td> | |
10427 <td></td> | |
10428 <td></td> | |
10429 </tr><tr class=""> | |
10430 <th scope="row">method</th> | |
10431 <td>linear</td> | |
10432 <td></td> | |
10433 <td></td> | |
10434 <td></td> | |
10435 </tr><tr class=""> | |
10436 <th scope="row">ref_factor</th> | |
10437 <td>batch</td> | |
10438 <td></td> | |
10439 <td></td> | |
10440 <td></td> | |
10441 </tr><tr class=""> | |
10442 <th scope="row">valnull</th> | |
10443 <td>none</td> | |
10444 <td></td> | |
10445 <td></td> | |
10446 <td></td> | |
10447 </tr><tr class=""> | |
10448 <th scope="row">variableMetadata</th> | |
10449 <td>7cf499d16bd542b2</td> | |
10450 <td>compounds_pos.txt</td> | |
10451 <td>tabular</td> | |
10452 <td>44</td> | |
10453 </tr> | |
10454 </table> | |
10455 </div> | |
10456 | |
10457 | |
10458 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
10459 <h2 | |
10460 class="history_metadata_extractor_h2" | |
10461 style="cursor: pointer" | |
10462 title="click to fold/unfold the table" | |
10463 > | |
10464 [DELETED] - Determine_BC - 3.0.0 | |
10465 </h2> | |
10466 <p class="history_metadata_extractor_status"> | |
10467 Status: Failed (1) | |
10468 </p> | |
10469 <p class="history_metadata_extractor_glitter"></p> | |
10470 <table class=" | |
10471 table | |
10472 table-bordered | |
10473 table-dark | |
10474 table-striped | |
10475 table-hover | |
10476 d-block | |
10477 overflow-auto | |
10478 history_metadata_extractor_table | |
10479 "> | |
10480 <thead> | |
10481 <tr> | |
10482 <th scope="col"></th> | |
10483 <th scope="col">value</th> | |
10484 <th scope="col">name</th> | |
10485 <th scope="col">extension</th> | |
10486 <th scope="col">hid</th> | |
10487 </tr> | |
10488 </thead> | |
10489 <tr class=""> | |
10490 <th scope="row">option</th> | |
10491 <td>hide</td> | |
10492 <td></td> | |
10493 <td></td> | |
10494 <td></td> | |
10495 </tr><tr class=""> | |
10496 <th scope="row">dataMatrix</th> | |
10497 <td>9a0ce47bd1734ae7</td> | |
10498 <td>peaklist_fragments.tsv</td> | |
10499 <td>tabular</td> | |
10500 <td>42</td> | |
10501 </tr><tr class=""> | |
10502 <th scope="row">ref_factor</th> | |
10503 <td>batch</td> | |
10504 <td></td> | |
10505 <td></td> | |
10506 <td></td> | |
10507 </tr><tr class=""> | |
10508 <th scope="row">sampleMetadata</th> | |
10509 <td>9a0ce47bd1734ae7</td> | |
10510 <td>peaklist_fragments.tsv</td> | |
10511 <td>tabular</td> | |
10512 <td>42</td> | |
10513 </tr><tr class=""> | |
10514 <th scope="row">batch_col_name</th> | |
10515 <td>batch</td> | |
10516 <td></td> | |
10517 <td></td> | |
10518 <td></td> | |
10519 </tr><tr class=""> | |
10520 <th scope="row">injection_order_col_name</th> | |
10521 <td>injectionOrder</td> | |
10522 <td></td> | |
10523 <td></td> | |
10524 <td></td> | |
10525 </tr><tr class=""> | |
10526 <th scope="row">sampleTypeTagBlank</th> | |
10527 <td>blank</td> | |
10528 <td></td> | |
10529 <td></td> | |
10530 <td></td> | |
10531 </tr><tr class=""> | |
10532 <th scope="row">sampleTypeTagPool</th> | |
10533 <td>pool</td> | |
10534 <td></td> | |
10535 <td></td> | |
10536 <td></td> | |
10537 </tr><tr class=""> | |
10538 <th scope="row">sampleTypeTagSample</th> | |
10539 <td>sample</td> | |
10540 <td></td> | |
10541 <td></td> | |
10542 <td></td> | |
10543 </tr><tr class=""> | |
10544 <th scope="row">sample_type_col_name</th> | |
10545 <td>sampleType</td> | |
10546 <td></td> | |
10547 <td></td> | |
10548 <td></td> | |
10549 </tr> | |
10550 </table> | |
10551 </div> | |
10552 | |
10553 | |
10554 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
10555 <h2 | |
10556 class="history_metadata_extractor_h2" | |
10557 style="cursor: pointer" | |
10558 title="click to fold/unfold the table" | |
10559 > | |
10560 [DELETED] - Determine_BC - 3.0.0 | |
10561 </h2> | |
10562 <p class="history_metadata_extractor_status"> | |
10563 Status: Failed (1) | |
10564 </p> | |
10565 <p class="history_metadata_extractor_glitter"></p> | |
10566 <table class=" | |
10567 table | |
10568 table-bordered | |
10569 table-dark | |
10570 table-striped | |
10571 table-hover | |
10572 d-block | |
10573 overflow-auto | |
10574 history_metadata_extractor_table | |
10575 "> | |
10576 <thead> | |
10577 <tr> | |
10578 <th scope="col"></th> | |
10579 <th scope="col">value</th> | |
10580 <th scope="col">name</th> | |
10581 <th scope="col">extension</th> | |
10582 <th scope="col">hid</th> | |
10583 </tr> | |
10584 </thead> | |
10585 <tr class=""> | |
10586 <th scope="row">option</th> | |
10587 <td>hide</td> | |
10588 <td></td> | |
10589 <td></td> | |
10590 <td></td> | |
10591 </tr><tr class=""> | |
10592 <th scope="row">dataMatrix</th> | |
10593 <td>9a0ce47bd1734ae7</td> | |
10594 <td>peaklist_fragments.tsv</td> | |
10595 <td>tabular</td> | |
10596 <td>42</td> | |
10597 </tr><tr class=""> | |
10598 <th scope="row">ref_factor</th> | |
10599 <td>batch</td> | |
10600 <td></td> | |
10601 <td></td> | |
10602 <td></td> | |
10603 </tr><tr class=""> | |
10604 <th scope="row">sampleMetadata</th> | |
10605 <td>9a0ce47bd1734ae7</td> | |
10606 <td>peaklist_fragments.tsv</td> | |
10607 <td>tabular</td> | |
10608 <td>42</td> | |
10609 </tr><tr class=""> | |
10610 <th scope="row">batch_col_name</th> | |
10611 <td>batch</td> | |
10612 <td></td> | |
10613 <td></td> | |
10614 <td></td> | |
10615 </tr><tr class=""> | |
10616 <th scope="row">injection_order_col_name</th> | |
10617 <td>injectionOrder</td> | |
10618 <td></td> | |
10619 <td></td> | |
10620 <td></td> | |
10621 </tr><tr class=""> | |
10622 <th scope="row">sampleTypeTagBlank</th> | |
10623 <td>blank</td> | |
10624 <td></td> | |
10625 <td></td> | |
10626 <td></td> | |
10627 </tr><tr class=""> | |
10628 <th scope="row">sampleTypeTagPool</th> | |
10629 <td>pool</td> | |
10630 <td></td> | |
10631 <td></td> | |
10632 <td></td> | |
10633 </tr><tr class=""> | |
10634 <th scope="row">sampleTypeTagSample</th> | |
10635 <td>sample</td> | |
10636 <td></td> | |
10637 <td></td> | |
10638 <td></td> | |
10639 </tr><tr class=""> | |
10640 <th scope="row">sample_type_col_name</th> | |
10641 <td>sampleType</td> | |
10642 <td></td> | |
10643 <td></td> | |
10644 <td></td> | |
10645 </tr> | |
10646 </table> | |
10647 </div> | |
10648 | |
10649 | |
10650 <div class="alert alert-success history_metadata_extractor_deleted"> | |
10651 <h2 | |
10652 class="history_metadata_extractor_h2" | |
10653 style="cursor: pointer" | |
10654 title="click to fold/unfold the table" | |
10655 > | |
10656 [DELETED] - corrtable - 1.0.0 | |
10657 </h2> | |
10658 <p class="history_metadata_extractor_status"> | |
10659 Status: Ok (0) | |
10660 </p> | |
10661 <p class="history_metadata_extractor_glitter"></p> | |
10662 <table class=" | |
10663 table | |
10664 table-bordered | |
10665 table-dark | |
10666 table-striped | |
10667 table-hover | |
10668 d-block | |
10669 overflow-auto | |
10670 history_metadata_extractor_table | |
10671 "> | |
10672 <thead> | |
10673 <tr> | |
10674 <th scope="col"></th> | |
10675 <th scope="col">value</th> | |
10676 <th scope="col">name</th> | |
10677 <th scope="col">extension</th> | |
10678 <th scope="col">hid</th> | |
10679 </tr> | |
10680 </thead> | |
10681 <tr class=""> | |
10682 <th scope="row">corr_method</th> | |
10683 <td>pearson</td> | |
10684 <td></td> | |
10685 <td></td> | |
10686 <td></td> | |
10687 </tr><tr class=""> | |
10688 <th scope="row">filter</th> | |
10689 <td>no</td> | |
10690 <td></td> | |
10691 <td></td> | |
10692 <td></td> | |
10693 </tr><tr class=""> | |
10694 <th scope="row">test_corr</th> | |
10695 <td>no</td> | |
10696 <td></td> | |
10697 <td></td> | |
10698 <td></td> | |
10699 </tr><tr class=""> | |
10700 <th scope="row">color_heatmap</th> | |
10701 <td>no</td> | |
10702 <td></td> | |
10703 <td></td> | |
10704 <td></td> | |
10705 </tr><tr class=""> | |
10706 <th scope="row">plot_choice</th> | |
10707 <td>auto</td> | |
10708 <td></td> | |
10709 <td></td> | |
10710 <td></td> | |
10711 </tr><tr class=""> | |
10712 <th scope="row">reorder_var</th> | |
10713 <td>no</td> | |
10714 <td></td> | |
10715 <td></td> | |
10716 <td></td> | |
10717 </tr><tr class=""> | |
10718 <th scope="row">tab1_in</th> | |
10719 <td>7cf499d16bd542b2</td> | |
10720 <td>compounds_pos.txt</td> | |
10721 <td>tabular</td> | |
10722 <td>44</td> | |
10723 </tr><tr class=""> | |
10724 <th scope="row">tab1_samples</th> | |
10725 <td>row</td> | |
10726 <td></td> | |
10727 <td></td> | |
10728 <td></td> | |
10729 </tr><tr class=""> | |
10730 <th scope="row">tab2_in</th> | |
10731 <td>7cf499d16bd542b2</td> | |
10732 <td>compounds_pos.txt</td> | |
10733 <td>tabular</td> | |
10734 <td>44</td> | |
10735 </tr><tr class=""> | |
10736 <th scope="row">tab2_samples</th> | |
10737 <td>row</td> | |
10738 <td></td> | |
10739 <td></td> | |
10740 <td></td> | |
10741 </tr> | |
10742 </table> | |
10743 </div> | |
10744 | |
10745 | |
10746 <div class="alert alert-success history_metadata_extractor_deleted"> | |
10747 <h2 | |
10748 class="history_metadata_extractor_h2" | |
10749 style="cursor: pointer" | |
10750 title="click to fold/unfold the table" | |
10751 > | |
10752 [DELETED] - corrtable - 1.0.0 | |
10753 </h2> | |
10754 <p class="history_metadata_extractor_status"> | |
10755 Status: Ok (0) | |
10756 </p> | |
10757 <p class="history_metadata_extractor_glitter"></p> | |
10758 <table class=" | |
10759 table | |
10760 table-bordered | |
10761 table-dark | |
10762 table-striped | |
10763 table-hover | |
10764 d-block | |
10765 overflow-auto | |
10766 history_metadata_extractor_table | |
10767 "> | |
10768 <thead> | |
10769 <tr> | |
10770 <th scope="col"></th> | |
10771 <th scope="col">value</th> | |
10772 <th scope="col">name</th> | |
10773 <th scope="col">extension</th> | |
10774 <th scope="col">hid</th> | |
10775 </tr> | |
10776 </thead> | |
10777 <tr class=""> | |
10778 <th scope="row">corr_method</th> | |
10779 <td>pearson</td> | |
10780 <td></td> | |
10781 <td></td> | |
10782 <td></td> | |
10783 </tr><tr class=""> | |
10784 <th scope="row">filter</th> | |
10785 <td>no</td> | |
10786 <td></td> | |
10787 <td></td> | |
10788 <td></td> | |
10789 </tr><tr class=""> | |
10790 <th scope="row">test_corr</th> | |
10791 <td>no</td> | |
10792 <td></td> | |
10793 <td></td> | |
10794 <td></td> | |
10795 </tr><tr class=""> | |
10796 <th scope="row">color_heatmap</th> | |
10797 <td>no</td> | |
10798 <td></td> | |
10799 <td></td> | |
10800 <td></td> | |
10801 </tr><tr class=""> | |
10802 <th scope="row">plot_choice</th> | |
10803 <td>auto</td> | |
10804 <td></td> | |
10805 <td></td> | |
10806 <td></td> | |
10807 </tr><tr class=""> | |
10808 <th scope="row">reorder_var</th> | |
10809 <td>no</td> | |
10810 <td></td> | |
10811 <td></td> | |
10812 <td></td> | |
10813 </tr><tr class=""> | |
10814 <th scope="row">tab1_in</th> | |
10815 <td>7cf499d16bd542b2</td> | |
10816 <td>compounds_pos.txt</td> | |
10817 <td>tabular</td> | |
10818 <td>44</td> | |
10819 </tr><tr class=""> | |
10820 <th scope="row">tab1_samples</th> | |
10821 <td>row</td> | |
10822 <td></td> | |
10823 <td></td> | |
10824 <td></td> | |
10825 </tr><tr class=""> | |
10826 <th scope="row">tab2_in</th> | |
10827 <td>7cf499d16bd542b2</td> | |
10828 <td>compounds_pos.txt</td> | |
10829 <td>tabular</td> | |
10830 <td>44</td> | |
10831 </tr><tr class=""> | |
10832 <th scope="row">tab2_samples</th> | |
10833 <td>row</td> | |
10834 <td></td> | |
10835 <td></td> | |
10836 <td></td> | |
10837 </tr> | |
10838 </table> | |
10839 </div> | |
10840 | |
10841 | |
10842 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
10843 <h2 | |
10844 class="history_metadata_extractor_h2" | |
10845 style="cursor: pointer" | |
10846 title="click to fold/unfold the table" | |
10847 > | |
10848 [DELETED] - Multivariate - 2.4.0 | |
10849 </h2> | |
10850 <p class="history_metadata_extractor_status"> | |
10851 Status: Failed (1) | |
10852 </p> | |
10853 <p class="history_metadata_extractor_glitter"></p> | |
10854 <table class=" | |
10855 table | |
10856 table-bordered | |
10857 table-dark | |
10858 table-striped | |
10859 table-hover | |
10860 d-block | |
10861 overflow-auto | |
10862 history_metadata_extractor_table | |
10863 "> | |
10864 <thead> | |
10865 <tr> | |
10866 <th scope="col"></th> | |
10867 <th scope="col">value</th> | |
10868 <th scope="col">name</th> | |
10869 <th scope="col">extension</th> | |
10870 <th scope="col">hid</th> | |
10871 </tr> | |
10872 </thead> | |
10873 <tr class=""> | |
10874 <th scope="row">algorithm</th> | |
10875 <td>default</td> | |
10876 <td></td> | |
10877 <td></td> | |
10878 <td></td> | |
10879 </tr><tr class=""> | |
10880 <th scope="row">cross_validation_number</th> | |
10881 <td>7</td> | |
10882 <td></td> | |
10883 <td></td> | |
10884 <td></td> | |
10885 </tr><tr class=""> | |
10886 <th scope="row">log10L</th> | |
10887 <td>FALSE</td> | |
10888 <td></td> | |
10889 <td></td> | |
10890 <td></td> | |
10891 </tr><tr class=""> | |
10892 <th scope="row">permutation_number</th> | |
10893 <td>20</td> | |
10894 <td></td> | |
10895 <td></td> | |
10896 <td></td> | |
10897 </tr><tr class=""> | |
10898 <th scope="row">scaling</th> | |
10899 <td>standard</td> | |
10900 <td></td> | |
10901 <td></td> | |
10902 <td></td> | |
10903 </tr><tr class=""> | |
10904 <th scope="row">dataMatrix_in</th> | |
10905 <td>9a0ce47bd1734ae7</td> | |
10906 <td>peaklist_fragments.tsv</td> | |
10907 <td>tabular</td> | |
10908 <td>42</td> | |
10909 </tr><tr class=""> | |
10910 <th scope="row">abcissa_parameter</th> | |
10911 <td>1</td> | |
10912 <td></td> | |
10913 <td></td> | |
10914 <td></td> | |
10915 </tr><tr class=""> | |
10916 <th scope="row">color_parameter</th> | |
10917 <td>None</td> | |
10918 <td></td> | |
10919 <td></td> | |
10920 <td></td> | |
10921 </tr><tr class=""> | |
10922 <th scope="row">ellipsis_component</th> | |
10923 <td>NA</td> | |
10924 <td></td> | |
10925 <td></td> | |
10926 <td></td> | |
10927 </tr><tr class=""> | |
10928 <th scope="row">graphic_type</th> | |
10929 <td>summary</td> | |
10930 <td></td> | |
10931 <td></td> | |
10932 <td></td> | |
10933 </tr><tr class=""> | |
10934 <th scope="row">labels_parameter</th> | |
10935 <td>None</td> | |
10936 <td></td> | |
10937 <td></td> | |
10938 <td></td> | |
10939 </tr><tr class=""> | |
10940 <th scope="row">magnify_text</th> | |
10941 <td>0.8</td> | |
10942 <td></td> | |
10943 <td></td> | |
10944 <td></td> | |
10945 </tr><tr class=""> | |
10946 <th scope="row">ordinate_parameter</th> | |
10947 <td>2</td> | |
10948 <td></td> | |
10949 <td></td> | |
10950 <td></td> | |
10951 </tr><tr class=""> | |
10952 <th scope="row">orthogonal_component_number</th> | |
10953 <td>0</td> | |
10954 <td></td> | |
10955 <td></td> | |
10956 <td></td> | |
10957 </tr><tr class=""> | |
10958 <th scope="row">predictive_component_number</th> | |
10959 <td>NA</td> | |
10960 <td></td> | |
10961 <td></td> | |
10962 <td></td> | |
10963 </tr><tr class=""> | |
10964 <th scope="row">response_component</th> | |
10965 <td>1</td> | |
10966 <td></td> | |
10967 <td></td> | |
10968 <td></td> | |
10969 </tr><tr class=""> | |
10970 <th scope="row">sampleMetadata_in</th> | |
10971 <td>9a0ce47bd1734ae7</td> | |
10972 <td>peaklist_fragments.tsv</td> | |
10973 <td>tabular</td> | |
10974 <td>42</td> | |
10975 </tr><tr class=""> | |
10976 <th scope="row">save_rdata</th> | |
10977 <td>false</td> | |
10978 <td></td> | |
10979 <td></td> | |
10980 <td></td> | |
10981 </tr><tr class=""> | |
10982 <th scope="row">test_sample</th> | |
10983 <td>FALSE</td> | |
10984 <td></td> | |
10985 <td></td> | |
10986 <td></td> | |
10987 </tr><tr class=""> | |
10988 <th scope="row">variableMetadata_in</th> | |
10989 <td>9a0ce47bd1734ae7</td> | |
10990 <td>peaklist_fragments.tsv</td> | |
10991 <td>tabular</td> | |
10992 <td>42</td> | |
10993 </tr> | |
10994 </table> | |
10995 </div> | |
10996 | |
10997 | |
10998 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
10999 <h2 | |
11000 class="history_metadata_extractor_h2" | |
11001 style="cursor: pointer" | |
11002 title="click to fold/unfold the table" | |
11003 > | |
11004 [DELETED] - Multivariate - 2.4.0 | |
11005 </h2> | |
11006 <p class="history_metadata_extractor_status"> | |
11007 Status: Failed (1) | |
11008 </p> | |
11009 <p class="history_metadata_extractor_glitter"></p> | |
11010 <table class=" | |
11011 table | |
11012 table-bordered | |
11013 table-dark | |
11014 table-striped | |
11015 table-hover | |
11016 d-block | |
11017 overflow-auto | |
11018 history_metadata_extractor_table | |
11019 "> | |
11020 <thead> | |
11021 <tr> | |
11022 <th scope="col"></th> | |
11023 <th scope="col">value</th> | |
11024 <th scope="col">name</th> | |
11025 <th scope="col">extension</th> | |
11026 <th scope="col">hid</th> | |
11027 </tr> | |
11028 </thead> | |
11029 <tr class=""> | |
11030 <th scope="row">algorithm</th> | |
11031 <td>default</td> | |
11032 <td></td> | |
11033 <td></td> | |
11034 <td></td> | |
11035 </tr><tr class=""> | |
11036 <th scope="row">cross_validation_number</th> | |
11037 <td>7</td> | |
11038 <td></td> | |
11039 <td></td> | |
11040 <td></td> | |
11041 </tr><tr class=""> | |
11042 <th scope="row">log10L</th> | |
11043 <td>FALSE</td> | |
11044 <td></td> | |
11045 <td></td> | |
11046 <td></td> | |
11047 </tr><tr class=""> | |
11048 <th scope="row">permutation_number</th> | |
11049 <td>20</td> | |
11050 <td></td> | |
11051 <td></td> | |
11052 <td></td> | |
11053 </tr><tr class=""> | |
11054 <th scope="row">scaling</th> | |
11055 <td>standard</td> | |
11056 <td></td> | |
11057 <td></td> | |
11058 <td></td> | |
11059 </tr><tr class=""> | |
11060 <th scope="row">dataMatrix_in</th> | |
11061 <td>9a0ce47bd1734ae7</td> | |
11062 <td>peaklist_fragments.tsv</td> | |
11063 <td>tabular</td> | |
11064 <td>42</td> | |
11065 </tr><tr class=""> | |
11066 <th scope="row">abcissa_parameter</th> | |
11067 <td>1</td> | |
11068 <td></td> | |
11069 <td></td> | |
11070 <td></td> | |
11071 </tr><tr class=""> | |
11072 <th scope="row">color_parameter</th> | |
11073 <td>None</td> | |
11074 <td></td> | |
11075 <td></td> | |
11076 <td></td> | |
11077 </tr><tr class=""> | |
11078 <th scope="row">ellipsis_component</th> | |
11079 <td>NA</td> | |
11080 <td></td> | |
11081 <td></td> | |
11082 <td></td> | |
11083 </tr><tr class=""> | |
11084 <th scope="row">graphic_type</th> | |
11085 <td>summary</td> | |
11086 <td></td> | |
11087 <td></td> | |
11088 <td></td> | |
11089 </tr><tr class=""> | |
11090 <th scope="row">labels_parameter</th> | |
11091 <td>None</td> | |
11092 <td></td> | |
11093 <td></td> | |
11094 <td></td> | |
11095 </tr><tr class=""> | |
11096 <th scope="row">magnify_text</th> | |
11097 <td>0.8</td> | |
11098 <td></td> | |
11099 <td></td> | |
11100 <td></td> | |
11101 </tr><tr class=""> | |
11102 <th scope="row">ordinate_parameter</th> | |
11103 <td>2</td> | |
11104 <td></td> | |
11105 <td></td> | |
11106 <td></td> | |
11107 </tr><tr class=""> | |
11108 <th scope="row">orthogonal_component_number</th> | |
11109 <td>0</td> | |
11110 <td></td> | |
11111 <td></td> | |
11112 <td></td> | |
11113 </tr><tr class=""> | |
11114 <th scope="row">predictive_component_number</th> | |
11115 <td>NA</td> | |
11116 <td></td> | |
11117 <td></td> | |
11118 <td></td> | |
11119 </tr><tr class=""> | |
11120 <th scope="row">response_component</th> | |
11121 <td>1</td> | |
11122 <td></td> | |
11123 <td></td> | |
11124 <td></td> | |
11125 </tr><tr class=""> | |
11126 <th scope="row">sampleMetadata_in</th> | |
11127 <td>9a0ce47bd1734ae7</td> | |
11128 <td>peaklist_fragments.tsv</td> | |
11129 <td>tabular</td> | |
11130 <td>42</td> | |
11131 </tr><tr class=""> | |
11132 <th scope="row">save_rdata</th> | |
11133 <td>false</td> | |
11134 <td></td> | |
11135 <td></td> | |
11136 <td></td> | |
11137 </tr><tr class=""> | |
11138 <th scope="row">test_sample</th> | |
11139 <td>FALSE</td> | |
11140 <td></td> | |
11141 <td></td> | |
11142 <td></td> | |
11143 </tr><tr class=""> | |
11144 <th scope="row">variableMetadata_in</th> | |
11145 <td>9a0ce47bd1734ae7</td> | |
11146 <td>peaklist_fragments.tsv</td> | |
11147 <td>tabular</td> | |
11148 <td>42</td> | |
11149 </tr> | |
11150 </table> | |
11151 </div> | |
11152 | |
11153 | |
11154 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
11155 <h2 | |
11156 class="history_metadata_extractor_h2" | |
11157 style="cursor: pointer" | |
11158 title="click to fold/unfold the table" | |
11159 > | |
11160 [DELETED] - Multivariate - 2.4.0 | |
11161 </h2> | |
11162 <p class="history_metadata_extractor_status"> | |
11163 Status: Failed (1) | |
11164 </p> | |
11165 <p class="history_metadata_extractor_glitter"></p> | |
11166 <table class=" | |
11167 table | |
11168 table-bordered | |
11169 table-dark | |
11170 table-striped | |
11171 table-hover | |
11172 d-block | |
11173 overflow-auto | |
11174 history_metadata_extractor_table | |
11175 "> | |
11176 <thead> | |
11177 <tr> | |
11178 <th scope="col"></th> | |
11179 <th scope="col">value</th> | |
11180 <th scope="col">name</th> | |
11181 <th scope="col">extension</th> | |
11182 <th scope="col">hid</th> | |
11183 </tr> | |
11184 </thead> | |
11185 <tr class=""> | |
11186 <th scope="row">algorithm</th> | |
11187 <td>default</td> | |
11188 <td></td> | |
11189 <td></td> | |
11190 <td></td> | |
11191 </tr><tr class=""> | |
11192 <th scope="row">cross_validation_number</th> | |
11193 <td>7</td> | |
11194 <td></td> | |
11195 <td></td> | |
11196 <td></td> | |
11197 </tr><tr class=""> | |
11198 <th scope="row">log10L</th> | |
11199 <td>FALSE</td> | |
11200 <td></td> | |
11201 <td></td> | |
11202 <td></td> | |
11203 </tr><tr class=""> | |
11204 <th scope="row">permutation_number</th> | |
11205 <td>20</td> | |
11206 <td></td> | |
11207 <td></td> | |
11208 <td></td> | |
11209 </tr><tr class=""> | |
11210 <th scope="row">scaling</th> | |
11211 <td>standard</td> | |
11212 <td></td> | |
11213 <td></td> | |
11214 <td></td> | |
11215 </tr><tr class=""> | |
11216 <th scope="row">dataMatrix_in</th> | |
11217 <td>9a0ce47bd1734ae7</td> | |
11218 <td>peaklist_fragments.tsv</td> | |
11219 <td>tabular</td> | |
11220 <td>42</td> | |
11221 </tr><tr class=""> | |
11222 <th scope="row">abcissa_parameter</th> | |
11223 <td>1</td> | |
11224 <td></td> | |
11225 <td></td> | |
11226 <td></td> | |
11227 </tr><tr class=""> | |
11228 <th scope="row">color_parameter</th> | |
11229 <td>None</td> | |
11230 <td></td> | |
11231 <td></td> | |
11232 <td></td> | |
11233 </tr><tr class=""> | |
11234 <th scope="row">ellipsis_component</th> | |
11235 <td>NA</td> | |
11236 <td></td> | |
11237 <td></td> | |
11238 <td></td> | |
11239 </tr><tr class=""> | |
11240 <th scope="row">graphic_type</th> | |
11241 <td>summary</td> | |
11242 <td></td> | |
11243 <td></td> | |
11244 <td></td> | |
11245 </tr><tr class=""> | |
11246 <th scope="row">labels_parameter</th> | |
11247 <td>None</td> | |
11248 <td></td> | |
11249 <td></td> | |
11250 <td></td> | |
11251 </tr><tr class=""> | |
11252 <th scope="row">magnify_text</th> | |
11253 <td>0.8</td> | |
11254 <td></td> | |
11255 <td></td> | |
11256 <td></td> | |
11257 </tr><tr class=""> | |
11258 <th scope="row">ordinate_parameter</th> | |
11259 <td>2</td> | |
11260 <td></td> | |
11261 <td></td> | |
11262 <td></td> | |
11263 </tr><tr class=""> | |
11264 <th scope="row">orthogonal_component_number</th> | |
11265 <td>0</td> | |
11266 <td></td> | |
11267 <td></td> | |
11268 <td></td> | |
11269 </tr><tr class=""> | |
11270 <th scope="row">predictive_component_number</th> | |
11271 <td>NA</td> | |
11272 <td></td> | |
11273 <td></td> | |
11274 <td></td> | |
11275 </tr><tr class=""> | |
11276 <th scope="row">response_component</th> | |
11277 <td>1</td> | |
11278 <td></td> | |
11279 <td></td> | |
11280 <td></td> | |
11281 </tr><tr class=""> | |
11282 <th scope="row">sampleMetadata_in</th> | |
11283 <td>9a0ce47bd1734ae7</td> | |
11284 <td>peaklist_fragments.tsv</td> | |
11285 <td>tabular</td> | |
11286 <td>42</td> | |
11287 </tr><tr class=""> | |
11288 <th scope="row">save_rdata</th> | |
11289 <td>false</td> | |
11290 <td></td> | |
11291 <td></td> | |
11292 <td></td> | |
11293 </tr><tr class=""> | |
11294 <th scope="row">test_sample</th> | |
11295 <td>FALSE</td> | |
11296 <td></td> | |
11297 <td></td> | |
11298 <td></td> | |
11299 </tr><tr class=""> | |
11300 <th scope="row">variableMetadata_in</th> | |
11301 <td>9a0ce47bd1734ae7</td> | |
11302 <td>peaklist_fragments.tsv</td> | |
11303 <td>tabular</td> | |
11304 <td>42</td> | |
11305 </tr> | |
11306 </table> | |
11307 </div> | |
11308 | |
11309 | |
11310 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
11311 <h2 | |
11312 class="history_metadata_extractor_h2" | |
11313 style="cursor: pointer" | |
11314 title="click to fold/unfold the table" | |
11315 > | |
11316 [DELETED] - Multivariate - 2.4.0 | |
11317 </h2> | |
11318 <p class="history_metadata_extractor_status"> | |
11319 Status: Failed (1) | |
11320 </p> | |
11321 <p class="history_metadata_extractor_glitter"></p> | |
11322 <table class=" | |
11323 table | |
11324 table-bordered | |
11325 table-dark | |
11326 table-striped | |
11327 table-hover | |
11328 d-block | |
11329 overflow-auto | |
11330 history_metadata_extractor_table | |
11331 "> | |
11332 <thead> | |
11333 <tr> | |
11334 <th scope="col"></th> | |
11335 <th scope="col">value</th> | |
11336 <th scope="col">name</th> | |
11337 <th scope="col">extension</th> | |
11338 <th scope="col">hid</th> | |
11339 </tr> | |
11340 </thead> | |
11341 <tr class=""> | |
11342 <th scope="row">algorithm</th> | |
11343 <td>default</td> | |
11344 <td></td> | |
11345 <td></td> | |
11346 <td></td> | |
11347 </tr><tr class=""> | |
11348 <th scope="row">cross_validation_number</th> | |
11349 <td>7</td> | |
11350 <td></td> | |
11351 <td></td> | |
11352 <td></td> | |
11353 </tr><tr class=""> | |
11354 <th scope="row">log10L</th> | |
11355 <td>FALSE</td> | |
11356 <td></td> | |
11357 <td></td> | |
11358 <td></td> | |
11359 </tr><tr class=""> | |
11360 <th scope="row">permutation_number</th> | |
11361 <td>20</td> | |
11362 <td></td> | |
11363 <td></td> | |
11364 <td></td> | |
11365 </tr><tr class=""> | |
11366 <th scope="row">scaling</th> | |
11367 <td>standard</td> | |
11368 <td></td> | |
11369 <td></td> | |
11370 <td></td> | |
11371 </tr><tr class=""> | |
11372 <th scope="row">dataMatrix_in</th> | |
11373 <td>9a0ce47bd1734ae7</td> | |
11374 <td>peaklist_fragments.tsv</td> | |
11375 <td>tabular</td> | |
11376 <td>42</td> | |
11377 </tr><tr class=""> | |
11378 <th scope="row">abcissa_parameter</th> | |
11379 <td>1</td> | |
11380 <td></td> | |
11381 <td></td> | |
11382 <td></td> | |
11383 </tr><tr class=""> | |
11384 <th scope="row">color_parameter</th> | |
11385 <td>None</td> | |
11386 <td></td> | |
11387 <td></td> | |
11388 <td></td> | |
11389 </tr><tr class=""> | |
11390 <th scope="row">ellipsis_component</th> | |
11391 <td>NA</td> | |
11392 <td></td> | |
11393 <td></td> | |
11394 <td></td> | |
11395 </tr><tr class=""> | |
11396 <th scope="row">graphic_type</th> | |
11397 <td>summary</td> | |
11398 <td></td> | |
11399 <td></td> | |
11400 <td></td> | |
11401 </tr><tr class=""> | |
11402 <th scope="row">labels_parameter</th> | |
11403 <td>None</td> | |
11404 <td></td> | |
11405 <td></td> | |
11406 <td></td> | |
11407 </tr><tr class=""> | |
11408 <th scope="row">magnify_text</th> | |
11409 <td>0.8</td> | |
11410 <td></td> | |
11411 <td></td> | |
11412 <td></td> | |
11413 </tr><tr class=""> | |
11414 <th scope="row">ordinate_parameter</th> | |
11415 <td>2</td> | |
11416 <td></td> | |
11417 <td></td> | |
11418 <td></td> | |
11419 </tr><tr class=""> | |
11420 <th scope="row">orthogonal_component_number</th> | |
11421 <td>0</td> | |
11422 <td></td> | |
11423 <td></td> | |
11424 <td></td> | |
11425 </tr><tr class=""> | |
11426 <th scope="row">predictive_component_number</th> | |
11427 <td>NA</td> | |
11428 <td></td> | |
11429 <td></td> | |
11430 <td></td> | |
11431 </tr><tr class=""> | |
11432 <th scope="row">response_component</th> | |
11433 <td>1</td> | |
11434 <td></td> | |
11435 <td></td> | |
11436 <td></td> | |
11437 </tr><tr class=""> | |
11438 <th scope="row">sampleMetadata_in</th> | |
11439 <td>9a0ce47bd1734ae7</td> | |
11440 <td>peaklist_fragments.tsv</td> | |
11441 <td>tabular</td> | |
11442 <td>42</td> | |
11443 </tr><tr class=""> | |
11444 <th scope="row">save_rdata</th> | |
11445 <td>false</td> | |
11446 <td></td> | |
11447 <td></td> | |
11448 <td></td> | |
11449 </tr><tr class=""> | |
11450 <th scope="row">test_sample</th> | |
11451 <td>FALSE</td> | |
11452 <td></td> | |
11453 <td></td> | |
11454 <td></td> | |
11455 </tr><tr class=""> | |
11456 <th scope="row">variableMetadata_in</th> | |
11457 <td>9a0ce47bd1734ae7</td> | |
11458 <td>peaklist_fragments.tsv</td> | |
11459 <td>tabular</td> | |
11460 <td>42</td> | |
11461 </tr> | |
11462 </table> | |
11463 </div> | |
11464 | |
11465 | |
11466 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
11467 <h2 | |
11468 class="history_metadata_extractor_h2" | |
11469 style="cursor: pointer" | |
11470 title="click to fold/unfold the table" | |
11471 > | |
11472 [DELETED] - biosigner - 2.2.7 | |
11473 </h2> | |
11474 <p class="history_metadata_extractor_status"> | |
11475 Status: Failed (1) | |
11476 </p> | |
11477 <p class="history_metadata_extractor_glitter"></p> | |
11478 <table class=" | |
11479 table | |
11480 table-bordered | |
11481 table-dark | |
11482 table-striped | |
11483 table-hover | |
11484 d-block | |
11485 overflow-auto | |
11486 history_metadata_extractor_table | |
11487 "> | |
11488 <thead> | |
11489 <tr> | |
11490 <th scope="col"></th> | |
11491 <th scope="col">value</th> | |
11492 <th scope="col">name</th> | |
11493 <th scope="col">extension</th> | |
11494 <th scope="col">hid</th> | |
11495 </tr> | |
11496 </thead> | |
11497 <tr class=""> | |
11498 <th scope="row">opcC</th> | |
11499 <td>default</td> | |
11500 <td></td> | |
11501 <td></td> | |
11502 <td></td> | |
11503 </tr><tr class=""> | |
11504 <th scope="row">dataMatrix_in</th> | |
11505 <td>9a0ce47bd1734ae7</td> | |
11506 <td>peaklist_fragments.tsv</td> | |
11507 <td>tabular</td> | |
11508 <td>42</td> | |
11509 </tr><tr class=""> | |
11510 <th scope="row">respC</th> | |
11511 <td></td> | |
11512 <td></td> | |
11513 <td></td> | |
11514 <td></td> | |
11515 </tr><tr class=""> | |
11516 <th scope="row">sampleMetadata_in</th> | |
11517 <td>9a0ce47bd1734ae7</td> | |
11518 <td>peaklist_fragments.tsv</td> | |
11519 <td>tabular</td> | |
11520 <td>42</td> | |
11521 </tr><tr class=""> | |
11522 <th scope="row">variableMetadata_in</th> | |
11523 <td>9a0ce47bd1734ae7</td> | |
11524 <td>peaklist_fragments.tsv</td> | |
11525 <td>tabular</td> | |
11526 <td>42</td> | |
11527 </tr> | |
11528 </table> | |
11529 </div> | |
11530 | |
11531 | |
11532 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
11533 <h2 | |
11534 class="history_metadata_extractor_h2" | |
11535 style="cursor: pointer" | |
11536 title="click to fold/unfold the table" | |
11537 > | |
11538 [DELETED] - biosigner - 2.2.7 | |
11539 </h2> | |
11540 <p class="history_metadata_extractor_status"> | |
11541 Status: Failed (1) | |
11542 </p> | |
11543 <p class="history_metadata_extractor_glitter"></p> | |
11544 <table class=" | |
11545 table | |
11546 table-bordered | |
11547 table-dark | |
11548 table-striped | |
11549 table-hover | |
11550 d-block | |
11551 overflow-auto | |
11552 history_metadata_extractor_table | |
11553 "> | |
11554 <thead> | |
11555 <tr> | |
11556 <th scope="col"></th> | |
11557 <th scope="col">value</th> | |
11558 <th scope="col">name</th> | |
11559 <th scope="col">extension</th> | |
11560 <th scope="col">hid</th> | |
11561 </tr> | |
11562 </thead> | |
11563 <tr class=""> | |
11564 <th scope="row">opcC</th> | |
11565 <td>default</td> | |
11566 <td></td> | |
11567 <td></td> | |
11568 <td></td> | |
11569 </tr><tr class=""> | |
11570 <th scope="row">dataMatrix_in</th> | |
11571 <td>9a0ce47bd1734ae7</td> | |
11572 <td>peaklist_fragments.tsv</td> | |
11573 <td>tabular</td> | |
11574 <td>42</td> | |
11575 </tr><tr class=""> | |
11576 <th scope="row">respC</th> | |
11577 <td></td> | |
11578 <td></td> | |
11579 <td></td> | |
11580 <td></td> | |
11581 </tr><tr class=""> | |
11582 <th scope="row">sampleMetadata_in</th> | |
11583 <td>9a0ce47bd1734ae7</td> | |
11584 <td>peaklist_fragments.tsv</td> | |
11585 <td>tabular</td> | |
11586 <td>42</td> | |
11587 </tr><tr class=""> | |
11588 <th scope="row">variableMetadata_in</th> | |
11589 <td>9a0ce47bd1734ae7</td> | |
11590 <td>peaklist_fragments.tsv</td> | |
11591 <td>tabular</td> | |
11592 <td>42</td> | |
11593 </tr> | |
11594 </table> | |
11595 </div> | |
11596 | |
11597 | |
11598 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
11599 <h2 | |
11600 class="history_metadata_extractor_h2" | |
11601 style="cursor: pointer" | |
11602 title="click to fold/unfold the table" | |
11603 > | |
11604 [DELETED] - biosigner - 2.2.7 | |
11605 </h2> | |
11606 <p class="history_metadata_extractor_status"> | |
11607 Status: Failed (1) | |
11608 </p> | |
11609 <p class="history_metadata_extractor_glitter"></p> | |
11610 <table class=" | |
11611 table | |
11612 table-bordered | |
11613 table-dark | |
11614 table-striped | |
11615 table-hover | |
11616 d-block | |
11617 overflow-auto | |
11618 history_metadata_extractor_table | |
11619 "> | |
11620 <thead> | |
11621 <tr> | |
11622 <th scope="col"></th> | |
11623 <th scope="col">value</th> | |
11624 <th scope="col">name</th> | |
11625 <th scope="col">extension</th> | |
11626 <th scope="col">hid</th> | |
11627 </tr> | |
11628 </thead> | |
11629 <tr class=""> | |
11630 <th scope="row">opcC</th> | |
11631 <td>default</td> | |
11632 <td></td> | |
11633 <td></td> | |
11634 <td></td> | |
11635 </tr><tr class=""> | |
11636 <th scope="row">dataMatrix_in</th> | |
11637 <td>9a0ce47bd1734ae7</td> | |
11638 <td>peaklist_fragments.tsv</td> | |
11639 <td>tabular</td> | |
11640 <td>42</td> | |
11641 </tr><tr class=""> | |
11642 <th scope="row">respC</th> | |
11643 <td></td> | |
11644 <td></td> | |
11645 <td></td> | |
11646 <td></td> | |
11647 </tr><tr class=""> | |
11648 <th scope="row">sampleMetadata_in</th> | |
11649 <td>9a0ce47bd1734ae7</td> | |
11650 <td>peaklist_fragments.tsv</td> | |
11651 <td>tabular</td> | |
11652 <td>42</td> | |
11653 </tr><tr class=""> | |
11654 <th scope="row">variableMetadata_in</th> | |
11655 <td>9a0ce47bd1734ae7</td> | |
11656 <td>peaklist_fragments.tsv</td> | |
11657 <td>tabular</td> | |
11658 <td>42</td> | |
11659 </tr> | |
11660 </table> | |
11661 </div> | |
11662 | |
11663 | |
11664 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
11665 <h2 | |
11666 class="history_metadata_extractor_h2" | |
11667 style="cursor: pointer" | |
11668 title="click to fold/unfold the table" | |
11669 > | |
11670 [DELETED] - biosigner - 2.2.7 | |
11671 </h2> | |
11672 <p class="history_metadata_extractor_status"> | |
11673 Status: Failed (1) | |
11674 </p> | |
11675 <p class="history_metadata_extractor_glitter"></p> | |
11676 <table class=" | |
11677 table | |
11678 table-bordered | |
11679 table-dark | |
11680 table-striped | |
11681 table-hover | |
11682 d-block | |
11683 overflow-auto | |
11684 history_metadata_extractor_table | |
11685 "> | |
11686 <thead> | |
11687 <tr> | |
11688 <th scope="col"></th> | |
11689 <th scope="col">value</th> | |
11690 <th scope="col">name</th> | |
11691 <th scope="col">extension</th> | |
11692 <th scope="col">hid</th> | |
11693 </tr> | |
11694 </thead> | |
11695 <tr class=""> | |
11696 <th scope="row">opcC</th> | |
11697 <td>default</td> | |
11698 <td></td> | |
11699 <td></td> | |
11700 <td></td> | |
11701 </tr><tr class=""> | |
11702 <th scope="row">dataMatrix_in</th> | |
11703 <td>9a0ce47bd1734ae7</td> | |
11704 <td>peaklist_fragments.tsv</td> | |
11705 <td>tabular</td> | |
11706 <td>42</td> | |
11707 </tr><tr class=""> | |
11708 <th scope="row">respC</th> | |
11709 <td></td> | |
11710 <td></td> | |
11711 <td></td> | |
11712 <td></td> | |
11713 </tr><tr class=""> | |
11714 <th scope="row">sampleMetadata_in</th> | |
11715 <td>9a0ce47bd1734ae7</td> | |
11716 <td>peaklist_fragments.tsv</td> | |
11717 <td>tabular</td> | |
11718 <td>42</td> | |
11719 </tr><tr class=""> | |
11720 <th scope="row">variableMetadata_in</th> | |
11721 <td>9a0ce47bd1734ae7</td> | |
11722 <td>peaklist_fragments.tsv</td> | |
11723 <td>tabular</td> | |
11724 <td>42</td> | |
11725 </tr> | |
11726 </table> | |
11727 </div> | |
11728 | |
11729 | |
11730 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
11731 <h2 | |
11732 class="history_metadata_extractor_h2" | |
11733 style="cursor: pointer" | |
11734 title="click to fold/unfold the table" | |
11735 > | |
11736 [DELETED] - Univariate - 2.2.4 | |
11737 </h2> | |
11738 <p class="history_metadata_extractor_status"> | |
11739 Status: Failed (1) | |
11740 </p> | |
11741 <p class="history_metadata_extractor_glitter"></p> | |
11742 <table class=" | |
11743 table | |
11744 table-bordered | |
11745 table-dark | |
11746 table-striped | |
11747 table-hover | |
11748 d-block | |
11749 overflow-auto | |
11750 history_metadata_extractor_table | |
11751 "> | |
11752 <thead> | |
11753 <tr> | |
11754 <th scope="col"></th> | |
11755 <th scope="col">value</th> | |
11756 <th scope="col">name</th> | |
11757 <th scope="col">extension</th> | |
11758 <th scope="col">hid</th> | |
11759 </tr> | |
11760 </thead> | |
11761 <tr class=""> | |
11762 <th scope="row">adjC</th> | |
11763 <td>fdr</td> | |
11764 <td></td> | |
11765 <td></td> | |
11766 <td></td> | |
11767 </tr><tr class=""> | |
11768 <th scope="row">dataMatrix_in</th> | |
11769 <td>7cf499d16bd542b2</td> | |
11770 <td>compounds_pos.txt</td> | |
11771 <td>tabular</td> | |
11772 <td>44</td> | |
11773 </tr><tr class=""> | |
11774 <th scope="row">facC</th> | |
11775 <td></td> | |
11776 <td></td> | |
11777 <td></td> | |
11778 <td></td> | |
11779 </tr><tr class=""> | |
11780 <th scope="row">sampleMetadata_in</th> | |
11781 <td>7cf499d16bd542b2</td> | |
11782 <td>compounds_pos.txt</td> | |
11783 <td>tabular</td> | |
11784 <td>44</td> | |
11785 </tr><tr class=""> | |
11786 <th scope="row">tesC</th> | |
11787 <td>ttest</td> | |
11788 <td></td> | |
11789 <td></td> | |
11790 <td></td> | |
11791 </tr><tr class=""> | |
11792 <th scope="row">thrN</th> | |
11793 <td>0.05</td> | |
11794 <td></td> | |
11795 <td></td> | |
11796 <td></td> | |
11797 </tr><tr class=""> | |
11798 <th scope="row">variableMetadata_in</th> | |
11799 <td>7cf499d16bd542b2</td> | |
11800 <td>compounds_pos.txt</td> | |
11801 <td>tabular</td> | |
11802 <td>44</td> | |
11803 </tr> | |
11804 </table> | |
11805 </div> | |
11806 | |
11807 | |
11808 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
11809 <h2 | |
11810 class="history_metadata_extractor_h2" | |
11811 style="cursor: pointer" | |
11812 title="click to fold/unfold the table" | |
11813 > | |
11814 [DELETED] - Univariate - 2.2.4 | |
11815 </h2> | |
11816 <p class="history_metadata_extractor_status"> | |
11817 Status: Failed (1) | |
11818 </p> | |
11819 <p class="history_metadata_extractor_glitter"></p> | |
11820 <table class=" | |
11821 table | |
11822 table-bordered | |
11823 table-dark | |
11824 table-striped | |
11825 table-hover | |
11826 d-block | |
11827 overflow-auto | |
11828 history_metadata_extractor_table | |
11829 "> | |
11830 <thead> | |
11831 <tr> | |
11832 <th scope="col"></th> | |
11833 <th scope="col">value</th> | |
11834 <th scope="col">name</th> | |
11835 <th scope="col">extension</th> | |
11836 <th scope="col">hid</th> | |
11837 </tr> | |
11838 </thead> | |
11839 <tr class=""> | |
11840 <th scope="row">adjC</th> | |
11841 <td>fdr</td> | |
11842 <td></td> | |
11843 <td></td> | |
11844 <td></td> | |
11845 </tr><tr class=""> | |
11846 <th scope="row">dataMatrix_in</th> | |
11847 <td>7cf499d16bd542b2</td> | |
11848 <td>compounds_pos.txt</td> | |
11849 <td>tabular</td> | |
11850 <td>44</td> | |
11851 </tr><tr class=""> | |
11852 <th scope="row">facC</th> | |
11853 <td></td> | |
11854 <td></td> | |
11855 <td></td> | |
11856 <td></td> | |
11857 </tr><tr class=""> | |
11858 <th scope="row">sampleMetadata_in</th> | |
11859 <td>7cf499d16bd542b2</td> | |
11860 <td>compounds_pos.txt</td> | |
11861 <td>tabular</td> | |
11862 <td>44</td> | |
11863 </tr><tr class=""> | |
11864 <th scope="row">tesC</th> | |
11865 <td>ttest</td> | |
11866 <td></td> | |
11867 <td></td> | |
11868 <td></td> | |
11869 </tr><tr class=""> | |
11870 <th scope="row">thrN</th> | |
11871 <td>0.05</td> | |
11872 <td></td> | |
11873 <td></td> | |
11874 <td></td> | |
11875 </tr><tr class=""> | |
11876 <th scope="row">variableMetadata_in</th> | |
11877 <td>7cf499d16bd542b2</td> | |
11878 <td>compounds_pos.txt</td> | |
11879 <td>tabular</td> | |
11880 <td>44</td> | |
11881 </tr> | |
11882 </table> | |
11883 </div> | |
11884 | |
11885 | |
11886 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
11887 <h2 | |
11888 class="history_metadata_extractor_h2" | |
11889 style="cursor: pointer" | |
11890 title="click to fold/unfold the table" | |
11891 > | |
11892 [DELETED] - Univariate - 2.2.4 | |
11893 </h2> | |
11894 <p class="history_metadata_extractor_status"> | |
11895 Status: Failed (1) | |
11896 </p> | |
11897 <p class="history_metadata_extractor_glitter"></p> | |
11898 <table class=" | |
11899 table | |
11900 table-bordered | |
11901 table-dark | |
11902 table-striped | |
11903 table-hover | |
11904 d-block | |
11905 overflow-auto | |
11906 history_metadata_extractor_table | |
11907 "> | |
11908 <thead> | |
11909 <tr> | |
11910 <th scope="col"></th> | |
11911 <th scope="col">value</th> | |
11912 <th scope="col">name</th> | |
11913 <th scope="col">extension</th> | |
11914 <th scope="col">hid</th> | |
11915 </tr> | |
11916 </thead> | |
11917 <tr class=""> | |
11918 <th scope="row">adjC</th> | |
11919 <td>fdr</td> | |
11920 <td></td> | |
11921 <td></td> | |
11922 <td></td> | |
11923 </tr><tr class=""> | |
11924 <th scope="row">dataMatrix_in</th> | |
11925 <td>7cf499d16bd542b2</td> | |
11926 <td>compounds_pos.txt</td> | |
11927 <td>tabular</td> | |
11928 <td>44</td> | |
11929 </tr><tr class=""> | |
11930 <th scope="row">facC</th> | |
11931 <td></td> | |
11932 <td></td> | |
11933 <td></td> | |
11934 <td></td> | |
11935 </tr><tr class=""> | |
11936 <th scope="row">sampleMetadata_in</th> | |
11937 <td>7cf499d16bd542b2</td> | |
11938 <td>compounds_pos.txt</td> | |
11939 <td>tabular</td> | |
11940 <td>44</td> | |
11941 </tr><tr class=""> | |
11942 <th scope="row">tesC</th> | |
11943 <td>ttest</td> | |
11944 <td></td> | |
11945 <td></td> | |
11946 <td></td> | |
11947 </tr><tr class=""> | |
11948 <th scope="row">thrN</th> | |
11949 <td>0.05</td> | |
11950 <td></td> | |
11951 <td></td> | |
11952 <td></td> | |
11953 </tr><tr class=""> | |
11954 <th scope="row">variableMetadata_in</th> | |
11955 <td>7cf499d16bd542b2</td> | |
11956 <td>compounds_pos.txt</td> | |
11957 <td>tabular</td> | |
11958 <td>44</td> | |
11959 </tr> | |
11960 </table> | |
11961 </div> | |
11962 | |
11963 | |
11964 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
11965 <h2 | |
11966 class="history_metadata_extractor_h2" | |
11967 style="cursor: pointer" | |
11968 title="click to fold/unfold the table" | |
11969 > | |
11970 [DELETED] - abims_anova - 1.2.1 | |
11971 </h2> | |
11972 <p class="history_metadata_extractor_status"> | |
11973 Status: Failed (1) | |
11974 </p> | |
11975 <p class="history_metadata_extractor_glitter"></p> | |
11976 <table class=" | |
11977 table | |
11978 table-bordered | |
11979 table-dark | |
11980 table-striped | |
11981 table-hover | |
11982 d-block | |
11983 overflow-auto | |
11984 history_metadata_extractor_table | |
11985 "> | |
11986 <thead> | |
11987 <tr> | |
11988 <th scope="col"></th> | |
11989 <th scope="col">value</th> | |
11990 <th scope="col">name</th> | |
11991 <th scope="col">extension</th> | |
11992 <th scope="col">hid</th> | |
11993 </tr> | |
11994 </thead> | |
11995 <tr class=""> | |
11996 <th scope="row">condition_1</th> | |
11997 <td></td> | |
11998 <td></td> | |
11999 <td></td> | |
12000 <td></td> | |
12001 </tr><tr class=""> | |
12002 <th scope="row">conditions</th> | |
12003 <td></td> | |
12004 <td></td> | |
12005 <td></td> | |
12006 <td></td> | |
12007 </tr><tr class=""> | |
12008 <th scope="row">dec</th> | |
12009 <td>.</td> | |
12010 <td></td> | |
12011 <td></td> | |
12012 <td></td> | |
12013 </tr><tr class=""> | |
12014 <th scope="row">input</th> | |
12015 <td>9a0ce47bd1734ae7</td> | |
12016 <td>peaklist_fragments.tsv</td> | |
12017 <td>tabular</td> | |
12018 <td>42</td> | |
12019 </tr><tr class=""> | |
12020 <th scope="row">interaction</th> | |
12021 <td>false</td> | |
12022 <td></td> | |
12023 <td></td> | |
12024 <td></td> | |
12025 </tr><tr class=""> | |
12026 <th scope="row">method</th> | |
12027 <td>none</td> | |
12028 <td></td> | |
12029 <td></td> | |
12030 <td></td> | |
12031 </tr><tr class=""> | |
12032 <th scope="row">mode</th> | |
12033 <td>row</td> | |
12034 <td></td> | |
12035 <td></td> | |
12036 <td></td> | |
12037 </tr><tr class=""> | |
12038 <th scope="row">sampleinfo</th> | |
12039 <td>9a0ce47bd1734ae7</td> | |
12040 <td>peaklist_fragments.tsv</td> | |
12041 <td>tabular</td> | |
12042 <td>42</td> | |
12043 </tr><tr class=""> | |
12044 <th scope="row">selection_method</th> | |
12045 <td>intersection</td> | |
12046 <td></td> | |
12047 <td></td> | |
12048 <td></td> | |
12049 </tr><tr class=""> | |
12050 <th scope="row">sep</th> | |
12051 <td>tabulation</td> | |
12052 <td></td> | |
12053 <td></td> | |
12054 <td></td> | |
12055 </tr><tr class=""> | |
12056 <th scope="row">threshold</th> | |
12057 <td>0.01</td> | |
12058 <td></td> | |
12059 <td></td> | |
12060 <td></td> | |
12061 </tr><tr class=""> | |
12062 <th scope="row">varinfo</th> | |
12063 <td>9a0ce47bd1734ae7</td> | |
12064 <td>peaklist_fragments.tsv</td> | |
12065 <td>tabular</td> | |
12066 <td>42</td> | |
12067 </tr> | |
12068 </table> | |
12069 </div> | |
12070 | |
12071 | |
12072 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
12073 <h2 | |
12074 class="history_metadata_extractor_h2" | |
12075 style="cursor: pointer" | |
12076 title="click to fold/unfold the table" | |
12077 > | |
12078 [DELETED] - abims_anova - 1.2.1 | |
12079 </h2> | |
12080 <p class="history_metadata_extractor_status"> | |
12081 Status: Failed (1) | |
12082 </p> | |
12083 <p class="history_metadata_extractor_glitter"></p> | |
12084 <table class=" | |
12085 table | |
12086 table-bordered | |
12087 table-dark | |
12088 table-striped | |
12089 table-hover | |
12090 d-block | |
12091 overflow-auto | |
12092 history_metadata_extractor_table | |
12093 "> | |
12094 <thead> | |
12095 <tr> | |
12096 <th scope="col"></th> | |
12097 <th scope="col">value</th> | |
12098 <th scope="col">name</th> | |
12099 <th scope="col">extension</th> | |
12100 <th scope="col">hid</th> | |
12101 </tr> | |
12102 </thead> | |
12103 <tr class=""> | |
12104 <th scope="row">condition_1</th> | |
12105 <td></td> | |
12106 <td></td> | |
12107 <td></td> | |
12108 <td></td> | |
12109 </tr><tr class=""> | |
12110 <th scope="row">conditions</th> | |
12111 <td></td> | |
12112 <td></td> | |
12113 <td></td> | |
12114 <td></td> | |
12115 </tr><tr class=""> | |
12116 <th scope="row">dec</th> | |
12117 <td>.</td> | |
12118 <td></td> | |
12119 <td></td> | |
12120 <td></td> | |
12121 </tr><tr class=""> | |
12122 <th scope="row">input</th> | |
12123 <td>9a0ce47bd1734ae7</td> | |
12124 <td>peaklist_fragments.tsv</td> | |
12125 <td>tabular</td> | |
12126 <td>42</td> | |
12127 </tr><tr class=""> | |
12128 <th scope="row">interaction</th> | |
12129 <td>false</td> | |
12130 <td></td> | |
12131 <td></td> | |
12132 <td></td> | |
12133 </tr><tr class=""> | |
12134 <th scope="row">method</th> | |
12135 <td>none</td> | |
12136 <td></td> | |
12137 <td></td> | |
12138 <td></td> | |
12139 </tr><tr class=""> | |
12140 <th scope="row">mode</th> | |
12141 <td>row</td> | |
12142 <td></td> | |
12143 <td></td> | |
12144 <td></td> | |
12145 </tr><tr class=""> | |
12146 <th scope="row">sampleinfo</th> | |
12147 <td>9a0ce47bd1734ae7</td> | |
12148 <td>peaklist_fragments.tsv</td> | |
12149 <td>tabular</td> | |
12150 <td>42</td> | |
12151 </tr><tr class=""> | |
12152 <th scope="row">selection_method</th> | |
12153 <td>intersection</td> | |
12154 <td></td> | |
12155 <td></td> | |
12156 <td></td> | |
12157 </tr><tr class=""> | |
12158 <th scope="row">sep</th> | |
12159 <td>tabulation</td> | |
12160 <td></td> | |
12161 <td></td> | |
12162 <td></td> | |
12163 </tr><tr class=""> | |
12164 <th scope="row">threshold</th> | |
12165 <td>0.01</td> | |
12166 <td></td> | |
12167 <td></td> | |
12168 <td></td> | |
12169 </tr><tr class=""> | |
12170 <th scope="row">varinfo</th> | |
12171 <td>9a0ce47bd1734ae7</td> | |
12172 <td>peaklist_fragments.tsv</td> | |
12173 <td>tabular</td> | |
12174 <td>42</td> | |
12175 </tr> | |
12176 </table> | |
12177 </div> | |
12178 | |
12179 | |
12180 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
12181 <h2 | |
12182 class="history_metadata_extractor_h2" | |
12183 style="cursor: pointer" | |
12184 title="click to fold/unfold the table" | |
12185 > | |
12186 [DELETED] - wsdl_hmdb - 1.7.2 | |
12187 </h2> | |
12188 <p class="history_metadata_extractor_status"> | |
12189 Status: Failed (255) | |
12190 </p> | |
12191 <p class="history_metadata_extractor_glitter"></p> | |
12192 <table class=" | |
12193 table | |
12194 table-bordered | |
12195 table-dark | |
12196 table-striped | |
12197 table-hover | |
12198 d-block | |
12199 overflow-auto | |
12200 history_metadata_extractor_table | |
12201 "> | |
12202 <thead> | |
12203 <tr> | |
12204 <th scope="col"></th> | |
12205 <th scope="col">value</th> | |
12206 <th scope="col">name</th> | |
12207 <th scope="col">extension</th> | |
12208 <th scope="col">hid</th> | |
12209 </tr> | |
12210 </thead> | |
12211 <tr class=""> | |
12212 <th scope="row">advancedFeatures</th> | |
12213 <td>0</td> | |
12214 <td></td> | |
12215 <td></td> | |
12216 <td></td> | |
12217 </tr><tr class=""> | |
12218 <th scope="row">delta</th> | |
12219 <td>0.05</td> | |
12220 <td></td> | |
12221 <td></td> | |
12222 <td></td> | |
12223 </tr><tr class=""> | |
12224 <th scope="row">choice</th> | |
12225 <td>YES</td> | |
12226 <td></td> | |
12227 <td></td> | |
12228 <td></td> | |
12229 </tr><tr class=""> | |
12230 <th scope="row">colfactor</th> | |
12231 <td>1</td> | |
12232 <td></td> | |
12233 <td></td> | |
12234 <td></td> | |
12235 </tr><tr class=""> | |
12236 <th scope="row">header_choice</th> | |
12237 <td>yes</td> | |
12238 <td></td> | |
12239 <td></td> | |
12240 <td></td> | |
12241 </tr><tr class=""> | |
12242 <th scope="row">nbHeader</th> | |
12243 <td>1</td> | |
12244 <td></td> | |
12245 <td></td> | |
12246 <td></td> | |
12247 </tr><tr class=""> | |
12248 <th scope="row">masses</th> | |
12249 <td>7cf499d16bd542b2</td> | |
12250 <td>compounds_pos.txt</td> | |
12251 <td>tabular</td> | |
12252 <td>44</td> | |
12253 </tr><tr class=""> | |
12254 <th scope="row">maxquery</th> | |
12255 <td>10</td> | |
12256 <td></td> | |
12257 <td></td> | |
12258 <td></td> | |
12259 </tr><tr class=""> | |
12260 <th scope="row">data_neutral_adducts</th> | |
12261 <td>M</td> | |
12262 <td></td> | |
12263 <td></td> | |
12264 <td></td> | |
12265 </tr><tr class=""> | |
12266 <th scope="row">mode</th> | |
12267 <td>neutral</td> | |
12268 <td></td> | |
12269 <td></td> | |
12270 <td></td> | |
12271 </tr><tr class=""> | |
12272 <th scope="row">verbose</th> | |
12273 <td>1</td> | |
12274 <td></td> | |
12275 <td></td> | |
12276 <td></td> | |
12277 </tr> | |
12278 </table> | |
12279 </div> | |
12280 | |
12281 | |
12282 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
12283 <h2 | |
12284 class="history_metadata_extractor_h2" | |
12285 style="cursor: pointer" | |
12286 title="click to fold/unfold the table" | |
12287 > | |
12288 [DELETED] - wsdl_hmdb - 1.7.2 | |
12289 </h2> | |
12290 <p class="history_metadata_extractor_status"> | |
12291 Status: Failed (255) | |
12292 </p> | |
12293 <p class="history_metadata_extractor_glitter"></p> | |
12294 <table class=" | |
12295 table | |
12296 table-bordered | |
12297 table-dark | |
12298 table-striped | |
12299 table-hover | |
12300 d-block | |
12301 overflow-auto | |
12302 history_metadata_extractor_table | |
12303 "> | |
12304 <thead> | |
12305 <tr> | |
12306 <th scope="col"></th> | |
12307 <th scope="col">value</th> | |
12308 <th scope="col">name</th> | |
12309 <th scope="col">extension</th> | |
12310 <th scope="col">hid</th> | |
12311 </tr> | |
12312 </thead> | |
12313 <tr class=""> | |
12314 <th scope="row">advancedFeatures</th> | |
12315 <td>0</td> | |
12316 <td></td> | |
12317 <td></td> | |
12318 <td></td> | |
12319 </tr><tr class=""> | |
12320 <th scope="row">delta</th> | |
12321 <td>0.05</td> | |
12322 <td></td> | |
12323 <td></td> | |
12324 <td></td> | |
12325 </tr><tr class=""> | |
12326 <th scope="row">choice</th> | |
12327 <td>YES</td> | |
12328 <td></td> | |
12329 <td></td> | |
12330 <td></td> | |
12331 </tr><tr class=""> | |
12332 <th scope="row">colfactor</th> | |
12333 <td>1</td> | |
12334 <td></td> | |
12335 <td></td> | |
12336 <td></td> | |
12337 </tr><tr class=""> | |
12338 <th scope="row">header_choice</th> | |
12339 <td>yes</td> | |
12340 <td></td> | |
12341 <td></td> | |
12342 <td></td> | |
12343 </tr><tr class=""> | |
12344 <th scope="row">nbHeader</th> | |
12345 <td>1</td> | |
12346 <td></td> | |
12347 <td></td> | |
12348 <td></td> | |
12349 </tr><tr class=""> | |
12350 <th scope="row">masses</th> | |
12351 <td>7cf499d16bd542b2</td> | |
12352 <td>compounds_pos.txt</td> | |
12353 <td>tabular</td> | |
12354 <td>44</td> | |
12355 </tr><tr class=""> | |
12356 <th scope="row">maxquery</th> | |
12357 <td>10</td> | |
12358 <td></td> | |
12359 <td></td> | |
12360 <td></td> | |
12361 </tr><tr class=""> | |
12362 <th scope="row">data_neutral_adducts</th> | |
12363 <td>M</td> | |
12364 <td></td> | |
12365 <td></td> | |
12366 <td></td> | |
12367 </tr><tr class=""> | |
12368 <th scope="row">mode</th> | |
12369 <td>neutral</td> | |
12370 <td></td> | |
12371 <td></td> | |
12372 <td></td> | |
12373 </tr><tr class=""> | |
12374 <th scope="row">verbose</th> | |
12375 <td>1</td> | |
12376 <td></td> | |
12377 <td></td> | |
12378 <td></td> | |
12379 </tr> | |
12380 </table> | |
12381 </div> | |
12382 | |
12383 | |
12384 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
12385 <h2 | |
12386 class="history_metadata_extractor_h2" | |
12387 style="cursor: pointer" | |
12388 title="click to fold/unfold the table" | |
12389 > | |
12390 [DELETED] - wsdl_hmdb - 1.7.2 | |
12391 </h2> | |
12392 <p class="history_metadata_extractor_status"> | |
12393 Status: Failed (255) | |
12394 </p> | |
12395 <p class="history_metadata_extractor_glitter"></p> | |
12396 <table class=" | |
12397 table | |
12398 table-bordered | |
12399 table-dark | |
12400 table-striped | |
12401 table-hover | |
12402 d-block | |
12403 overflow-auto | |
12404 history_metadata_extractor_table | |
12405 "> | |
12406 <thead> | |
12407 <tr> | |
12408 <th scope="col"></th> | |
12409 <th scope="col">value</th> | |
12410 <th scope="col">name</th> | |
12411 <th scope="col">extension</th> | |
12412 <th scope="col">hid</th> | |
12413 </tr> | |
12414 </thead> | |
12415 <tr class=""> | |
12416 <th scope="row">advancedFeatures</th> | |
12417 <td>0</td> | |
12418 <td></td> | |
12419 <td></td> | |
12420 <td></td> | |
12421 </tr><tr class=""> | |
12422 <th scope="row">delta</th> | |
12423 <td>0.05</td> | |
12424 <td></td> | |
12425 <td></td> | |
12426 <td></td> | |
12427 </tr><tr class=""> | |
12428 <th scope="row">choice</th> | |
12429 <td>YES</td> | |
12430 <td></td> | |
12431 <td></td> | |
12432 <td></td> | |
12433 </tr><tr class=""> | |
12434 <th scope="row">colfactor</th> | |
12435 <td>1</td> | |
12436 <td></td> | |
12437 <td></td> | |
12438 <td></td> | |
12439 </tr><tr class=""> | |
12440 <th scope="row">header_choice</th> | |
12441 <td>yes</td> | |
12442 <td></td> | |
12443 <td></td> | |
12444 <td></td> | |
12445 </tr><tr class=""> | |
12446 <th scope="row">nbHeader</th> | |
12447 <td>1</td> | |
12448 <td></td> | |
12449 <td></td> | |
12450 <td></td> | |
12451 </tr><tr class=""> | |
12452 <th scope="row">masses</th> | |
12453 <td>7cf499d16bd542b2</td> | |
12454 <td>compounds_pos.txt</td> | |
12455 <td>tabular</td> | |
12456 <td>44</td> | |
12457 </tr><tr class=""> | |
12458 <th scope="row">maxquery</th> | |
12459 <td>10</td> | |
12460 <td></td> | |
12461 <td></td> | |
12462 <td></td> | |
12463 </tr><tr class=""> | |
12464 <th scope="row">data_neutral_adducts</th> | |
12465 <td>M</td> | |
12466 <td></td> | |
12467 <td></td> | |
12468 <td></td> | |
12469 </tr><tr class=""> | |
12470 <th scope="row">mode</th> | |
12471 <td>neutral</td> | |
12472 <td></td> | |
12473 <td></td> | |
12474 <td></td> | |
12475 </tr><tr class=""> | |
12476 <th scope="row">verbose</th> | |
12477 <td>1</td> | |
12478 <td></td> | |
12479 <td></td> | |
12480 <td></td> | |
12481 </tr> | |
12482 </table> | |
12483 </div> | |
12484 | |
12485 | |
12486 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
12487 <h2 | |
12488 class="history_metadata_extractor_h2" | |
12489 style="cursor: pointer" | |
12490 title="click to fold/unfold the table" | |
12491 > | |
12492 [DELETED] - bank_inhouse - 1.2.1 | |
12493 </h2> | |
12494 <p class="history_metadata_extractor_status"> | |
12495 Status: Failed (255) | |
12496 </p> | |
12497 <p class="history_metadata_extractor_glitter"></p> | |
12498 <table class=" | |
12499 table | |
12500 table-bordered | |
12501 table-dark | |
12502 table-striped | |
12503 table-hover | |
12504 d-block | |
12505 overflow-auto | |
12506 history_metadata_extractor_table | |
12507 "> | |
12508 <thead> | |
12509 <tr> | |
12510 <th scope="col"></th> | |
12511 <th scope="col">value</th> | |
12512 <th scope="col">name</th> | |
12513 <th scope="col">extension</th> | |
12514 <th scope="col">hid</th> | |
12515 </tr> | |
12516 </thead> | |
12517 <tr class=""> | |
12518 <th scope="row">bank_in</th> | |
12519 <td></td> | |
12520 <td></td> | |
12521 <td></td> | |
12522 <td></td> | |
12523 </tr><tr class=""> | |
12524 <th scope="row">bank_rt_choice</th> | |
12525 <td>true</td> | |
12526 <td></td> | |
12527 <td></td> | |
12528 <td></td> | |
12529 </tr><tr class=""> | |
12530 <th scope="row">rtdb</th> | |
12531 <td>1</td> | |
12532 <td></td> | |
12533 <td></td> | |
12534 <td></td> | |
12535 </tr><tr class=""> | |
12536 <th scope="row">mzdb</th> | |
12537 <td>1</td> | |
12538 <td></td> | |
12539 <td></td> | |
12540 <td></td> | |
12541 </tr><tr class=""> | |
12542 <th scope="row">perso_bank</th> | |
12543 <td>true</td> | |
12544 <td></td> | |
12545 <td></td> | |
12546 <td></td> | |
12547 </tr><tr class=""> | |
12548 <th scope="row">choice</th> | |
12549 <td>YES</td> | |
12550 <td></td> | |
12551 <td></td> | |
12552 <td></td> | |
12553 </tr><tr class=""> | |
12554 <th scope="row">colmass</th> | |
12555 <td>1</td> | |
12556 <td></td> | |
12557 <td></td> | |
12558 <td></td> | |
12559 </tr><tr class=""> | |
12560 <th scope="row">header_choice</th> | |
12561 <td>true</td> | |
12562 <td></td> | |
12563 <td></td> | |
12564 <td></td> | |
12565 </tr><tr class=""> | |
12566 <th scope="row">nbheader</th> | |
12567 <td>1</td> | |
12568 <td></td> | |
12569 <td></td> | |
12570 <td></td> | |
12571 </tr><tr class=""> | |
12572 <th scope="row">colrt</th> | |
12573 <td>1</td> | |
12574 <td></td> | |
12575 <td></td> | |
12576 <td></td> | |
12577 </tr><tr class=""> | |
12578 <th scope="row">rt_file_choice</th> | |
12579 <td>true</td> | |
12580 <td></td> | |
12581 <td></td> | |
12582 <td></td> | |
12583 </tr><tr class=""> | |
12584 <th scope="row">rt_file_delta</th> | |
12585 <td>0.1</td> | |
12586 <td></td> | |
12587 <td></td> | |
12588 <td></td> | |
12589 </tr><tr class=""> | |
12590 <th scope="row">variableMetadata_in</th> | |
12591 <td></td> | |
12592 <td></td> | |
12593 <td></td> | |
12594 <td></td> | |
12595 </tr><tr class=""> | |
12596 <th scope="row">mass_delta</th> | |
12597 <td>0.005</td> | |
12598 <td></td> | |
12599 <td></td> | |
12600 <td></td> | |
12601 </tr><tr class=""> | |
12602 <th scope="row">mz_delta</th> | |
12603 <td>Da</td> | |
12604 <td></td> | |
12605 <td></td> | |
12606 <td></td> | |
12607 </tr><tr class=""> | |
12608 <th scope="row">outfiles</th> | |
12609 <td>NO</td> | |
12610 <td></td> | |
12611 <td></td> | |
12612 <td></td> | |
12613 </tr> | |
12614 </table> | |
12615 </div> | |
12616 | |
12617 | |
12618 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
12619 <h2 | |
12620 class="history_metadata_extractor_h2" | |
12621 style="cursor: pointer" | |
12622 title="click to fold/unfold the table" | |
12623 > | |
12624 [DELETED] - bank_inhouse - 1.2.1 | |
12625 </h2> | |
12626 <p class="history_metadata_extractor_status"> | |
12627 Status: Failed (255) | |
12628 </p> | |
12629 <p class="history_metadata_extractor_glitter"></p> | |
12630 <table class=" | |
12631 table | |
12632 table-bordered | |
12633 table-dark | |
12634 table-striped | |
12635 table-hover | |
12636 d-block | |
12637 overflow-auto | |
12638 history_metadata_extractor_table | |
12639 "> | |
12640 <thead> | |
12641 <tr> | |
12642 <th scope="col"></th> | |
12643 <th scope="col">value</th> | |
12644 <th scope="col">name</th> | |
12645 <th scope="col">extension</th> | |
12646 <th scope="col">hid</th> | |
12647 </tr> | |
12648 </thead> | |
12649 <tr class=""> | |
12650 <th scope="row">bank_in</th> | |
12651 <td></td> | |
12652 <td></td> | |
12653 <td></td> | |
12654 <td></td> | |
12655 </tr><tr class=""> | |
12656 <th scope="row">bank_rt_choice</th> | |
12657 <td>true</td> | |
12658 <td></td> | |
12659 <td></td> | |
12660 <td></td> | |
12661 </tr><tr class=""> | |
12662 <th scope="row">rtdb</th> | |
12663 <td>1</td> | |
12664 <td></td> | |
12665 <td></td> | |
12666 <td></td> | |
12667 </tr><tr class=""> | |
12668 <th scope="row">mzdb</th> | |
12669 <td>1</td> | |
12670 <td></td> | |
12671 <td></td> | |
12672 <td></td> | |
12673 </tr><tr class=""> | |
12674 <th scope="row">perso_bank</th> | |
12675 <td>true</td> | |
12676 <td></td> | |
12677 <td></td> | |
12678 <td></td> | |
12679 </tr><tr class=""> | |
12680 <th scope="row">choice</th> | |
12681 <td>YES</td> | |
12682 <td></td> | |
12683 <td></td> | |
12684 <td></td> | |
12685 </tr><tr class=""> | |
12686 <th scope="row">colmass</th> | |
12687 <td>1</td> | |
12688 <td></td> | |
12689 <td></td> | |
12690 <td></td> | |
12691 </tr><tr class=""> | |
12692 <th scope="row">header_choice</th> | |
12693 <td>true</td> | |
12694 <td></td> | |
12695 <td></td> | |
12696 <td></td> | |
12697 </tr><tr class=""> | |
12698 <th scope="row">nbheader</th> | |
12699 <td>1</td> | |
12700 <td></td> | |
12701 <td></td> | |
12702 <td></td> | |
12703 </tr><tr class=""> | |
12704 <th scope="row">colrt</th> | |
12705 <td>1</td> | |
12706 <td></td> | |
12707 <td></td> | |
12708 <td></td> | |
12709 </tr><tr class=""> | |
12710 <th scope="row">rt_file_choice</th> | |
12711 <td>true</td> | |
12712 <td></td> | |
12713 <td></td> | |
12714 <td></td> | |
12715 </tr><tr class=""> | |
12716 <th scope="row">rt_file_delta</th> | |
12717 <td>0.1</td> | |
12718 <td></td> | |
12719 <td></td> | |
12720 <td></td> | |
12721 </tr><tr class=""> | |
12722 <th scope="row">variableMetadata_in</th> | |
12723 <td></td> | |
12724 <td></td> | |
12725 <td></td> | |
12726 <td></td> | |
12727 </tr><tr class=""> | |
12728 <th scope="row">mass_delta</th> | |
12729 <td>0.005</td> | |
12730 <td></td> | |
12731 <td></td> | |
12732 <td></td> | |
12733 </tr><tr class=""> | |
12734 <th scope="row">mz_delta</th> | |
12735 <td>Da</td> | |
12736 <td></td> | |
12737 <td></td> | |
12738 <td></td> | |
12739 </tr><tr class=""> | |
12740 <th scope="row">outfiles</th> | |
12741 <td>NO</td> | |
12742 <td></td> | |
12743 <td></td> | |
12744 <td></td> | |
12745 </tr> | |
12746 </table> | |
12747 </div> | |
12748 | |
12749 | |
12750 <div class="alert alert-success"> | |
12751 <h2 | |
12752 class="history_metadata_extractor_h2" | |
12753 style="cursor: pointer" | |
12754 title="click to fold/unfold the table" | |
12755 > | |
12756 [576] - bih4bloodexposome - 0.1.2 | |
12757 </h2> | |
12758 <p class="history_metadata_extractor_status"> | |
12759 Status: Ok (0) | |
12760 </p> | |
12761 <p class="history_metadata_extractor_glitter"></p> | |
12762 <table class=" | |
12763 table | |
12764 table-bordered | |
12765 table-dark | |
12766 table-striped | |
12767 table-hover | |
12768 d-block | |
12769 overflow-auto | |
12770 history_metadata_extractor_table | |
12771 "> | |
12772 <thead> | |
12773 <tr> | |
12774 <th scope="col"></th> | |
12775 <th scope="col">value</th> | |
12776 <th scope="col">name</th> | |
12777 <th scope="col">extension</th> | |
12778 <th scope="col">hid</th> | |
12779 </tr> | |
12780 </thead> | |
12781 <tr class=""> | |
12782 <th scope="row">colmass</th> | |
12783 <td>1</td> | |
12784 <td></td> | |
12785 <td></td> | |
12786 <td></td> | |
12787 </tr><tr class=""> | |
12788 <th scope="row">header</th> | |
12789 <td>1</td> | |
12790 <td></td> | |
12791 <td></td> | |
12792 <td></td> | |
12793 </tr><tr class=""> | |
12794 <th scope="row">header_choice</th> | |
12795 <td>true</td> | |
12796 <td></td> | |
12797 <td></td> | |
12798 <td></td> | |
12799 </tr><tr class=""> | |
12800 <th scope="row">mode</th> | |
12801 <td>POSITIVE</td> | |
12802 <td></td> | |
12803 <td></td> | |
12804 <td></td> | |
12805 </tr><tr class=""> | |
12806 <th scope="row">ppm_error</th> | |
12807 <td>5.0</td> | |
12808 <td></td> | |
12809 <td></td> | |
12810 <td></td> | |
12811 </tr><tr class=""> | |
12812 <th scope="row">variableMetadata_in</th> | |
12813 <td>9a0ce47bd1734ae7</td> | |
12814 <td>peaklist_fragments.tsv</td> | |
12815 <td>tabular</td> | |
12816 <td>42</td> | |
12817 </tr><tr class=""> | |
12818 <th scope="row">verbose</th> | |
12819 <td>1</td> | |
12820 <td></td> | |
12821 <td></td> | |
12822 <td></td> | |
12823 </tr> | |
12824 </table> | |
12825 </div> | |
12826 | |
12827 | |
12828 <div class="alert alert-success"> | |
12829 <h2 | |
12830 class="history_metadata_extractor_h2" | |
12831 style="cursor: pointer" | |
12832 title="click to fold/unfold the table" | |
12833 > | |
12834 [577] - bih4bloodexposome - 0.1.2 | |
12835 </h2> | |
12836 <p class="history_metadata_extractor_status"> | |
12837 Status: Ok (0) | |
12838 </p> | |
12839 <p class="history_metadata_extractor_glitter"></p> | |
12840 <table class=" | |
12841 table | |
12842 table-bordered | |
12843 table-dark | |
12844 table-striped | |
12845 table-hover | |
12846 d-block | |
12847 overflow-auto | |
12848 history_metadata_extractor_table | |
12849 "> | |
12850 <thead> | |
12851 <tr> | |
12852 <th scope="col"></th> | |
12853 <th scope="col">value</th> | |
12854 <th scope="col">name</th> | |
12855 <th scope="col">extension</th> | |
12856 <th scope="col">hid</th> | |
12857 </tr> | |
12858 </thead> | |
12859 <tr class=""> | |
12860 <th scope="row">colmass</th> | |
12861 <td>1</td> | |
12862 <td></td> | |
12863 <td></td> | |
12864 <td></td> | |
12865 </tr><tr class=""> | |
12866 <th scope="row">header</th> | |
12867 <td>1</td> | |
12868 <td></td> | |
12869 <td></td> | |
12870 <td></td> | |
12871 </tr><tr class=""> | |
12872 <th scope="row">header_choice</th> | |
12873 <td>true</td> | |
12874 <td></td> | |
12875 <td></td> | |
12876 <td></td> | |
12877 </tr><tr class=""> | |
12878 <th scope="row">mode</th> | |
12879 <td>POSITIVE</td> | |
12880 <td></td> | |
12881 <td></td> | |
12882 <td></td> | |
12883 </tr><tr class=""> | |
12884 <th scope="row">ppm_error</th> | |
12885 <td>5.0</td> | |
12886 <td></td> | |
12887 <td></td> | |
12888 <td></td> | |
12889 </tr><tr class=""> | |
12890 <th scope="row">variableMetadata_in</th> | |
12891 <td>9a0ce47bd1734ae7</td> | |
12892 <td>peaklist_fragments.tsv</td> | |
12893 <td>tabular</td> | |
12894 <td>42</td> | |
12895 </tr><tr class=""> | |
12896 <th scope="row">verbose</th> | |
12897 <td>1</td> | |
12898 <td></td> | |
12899 <td></td> | |
12900 <td></td> | |
12901 </tr> | |
12902 </table> | |
12903 </div> | |
12904 | |
12905 | |
12906 <div class="alert alert-success history_metadata_extractor_deleted"> | |
12907 <h2 | |
12908 class="history_metadata_extractor_h2" | |
12909 style="cursor: pointer" | |
12910 title="click to fold/unfold the table" | |
12911 > | |
12912 [DELETED] - bih4maconda - 0.1.4 | |
12913 </h2> | |
12914 <p class="history_metadata_extractor_status"> | |
12915 Status: Ok (0) | |
12916 </p> | |
12917 <p class="history_metadata_extractor_glitter"></p> | |
12918 <table class=" | |
12919 table | |
12920 table-bordered | |
12921 table-dark | |
12922 table-striped | |
12923 table-hover | |
12924 d-block | |
12925 overflow-auto | |
12926 history_metadata_extractor_table | |
12927 "> | |
12928 <thead> | |
12929 <tr> | |
12930 <th scope="col"></th> | |
12931 <th scope="col">value</th> | |
12932 <th scope="col">name</th> | |
12933 <th scope="col">extension</th> | |
12934 <th scope="col">hid</th> | |
12935 </tr> | |
12936 </thead> | |
12937 <tr class=""> | |
12938 <th scope="row">colmass</th> | |
12939 <td>1</td> | |
12940 <td></td> | |
12941 <td></td> | |
12942 <td></td> | |
12943 </tr><tr class=""> | |
12944 <th scope="row">header</th> | |
12945 <td>1</td> | |
12946 <td></td> | |
12947 <td></td> | |
12948 <td></td> | |
12949 </tr><tr class=""> | |
12950 <th scope="row">header_choice</th> | |
12951 <td>true</td> | |
12952 <td></td> | |
12953 <td></td> | |
12954 <td></td> | |
12955 </tr><tr class=""> | |
12956 <th scope="row">mode</th> | |
12957 <td>POSITIVE</td> | |
12958 <td></td> | |
12959 <td></td> | |
12960 <td></td> | |
12961 </tr><tr class=""> | |
12962 <th scope="row">ppm_error</th> | |
12963 <td>5.0</td> | |
12964 <td></td> | |
12965 <td></td> | |
12966 <td></td> | |
12967 </tr><tr class=""> | |
12968 <th scope="row">variableMetadata_in</th> | |
12969 <td>7cf499d16bd542b2</td> | |
12970 <td>compounds_pos.txt</td> | |
12971 <td>tabular</td> | |
12972 <td>44</td> | |
12973 </tr><tr class=""> | |
12974 <th scope="row">verbose</th> | |
12975 <td>1</td> | |
12976 <td></td> | |
12977 <td></td> | |
12978 <td></td> | |
12979 </tr> | |
12980 </table> | |
12981 </div> | |
12982 | |
12983 | |
12984 <div class="alert alert-success history_metadata_extractor_deleted"> | |
12985 <h2 | |
12986 class="history_metadata_extractor_h2" | |
12987 style="cursor: pointer" | |
12988 title="click to fold/unfold the table" | |
12989 > | |
12990 [DELETED] - bih4maconda - 0.1.4 | |
12991 </h2> | |
12992 <p class="history_metadata_extractor_status"> | |
12993 Status: Ok (0) | |
12994 </p> | |
12995 <p class="history_metadata_extractor_glitter"></p> | |
12996 <table class=" | |
12997 table | |
12998 table-bordered | |
12999 table-dark | |
13000 table-striped | |
13001 table-hover | |
13002 d-block | |
13003 overflow-auto | |
13004 history_metadata_extractor_table | |
13005 "> | |
13006 <thead> | |
13007 <tr> | |
13008 <th scope="col"></th> | |
13009 <th scope="col">value</th> | |
13010 <th scope="col">name</th> | |
13011 <th scope="col">extension</th> | |
13012 <th scope="col">hid</th> | |
13013 </tr> | |
13014 </thead> | |
13015 <tr class=""> | |
13016 <th scope="row">colmass</th> | |
13017 <td>1</td> | |
13018 <td></td> | |
13019 <td></td> | |
13020 <td></td> | |
13021 </tr><tr class=""> | |
13022 <th scope="row">header</th> | |
13023 <td>1</td> | |
13024 <td></td> | |
13025 <td></td> | |
13026 <td></td> | |
13027 </tr><tr class=""> | |
13028 <th scope="row">header_choice</th> | |
13029 <td>true</td> | |
13030 <td></td> | |
13031 <td></td> | |
13032 <td></td> | |
13033 </tr><tr class=""> | |
13034 <th scope="row">mode</th> | |
13035 <td>POSITIVE</td> | |
13036 <td></td> | |
13037 <td></td> | |
13038 <td></td> | |
13039 </tr><tr class=""> | |
13040 <th scope="row">ppm_error</th> | |
13041 <td>5.0</td> | |
13042 <td></td> | |
13043 <td></td> | |
13044 <td></td> | |
13045 </tr><tr class=""> | |
13046 <th scope="row">variableMetadata_in</th> | |
13047 <td>7cf499d16bd542b2</td> | |
13048 <td>compounds_pos.txt</td> | |
13049 <td>tabular</td> | |
13050 <td>44</td> | |
13051 </tr><tr class=""> | |
13052 <th scope="row">verbose</th> | |
13053 <td>1</td> | |
13054 <td></td> | |
13055 <td></td> | |
13056 <td></td> | |
13057 </tr> | |
13058 </table> | |
13059 </div> | |
13060 | |
13061 | |
13062 <div class="alert alert-danger"> | |
13063 <h2 | |
13064 class="history_metadata_extractor_h2" | |
13065 style="cursor: pointer" | |
13066 title="click to fold/unfold the table" | |
13067 > | |
13068 [580] - hr2 - 1.1.1.7 | |
13069 </h2> | |
13070 <p class="history_metadata_extractor_status"> | |
13071 Status: Failed (None) | |
13072 </p> | |
13073 <p class="history_metadata_extractor_glitter"></p> | |
13074 <table class=" | |
13075 table | |
13076 table-bordered | |
13077 table-dark | |
13078 table-striped | |
13079 table-hover | |
13080 d-block | |
13081 overflow-auto | |
13082 history_metadata_extractor_table | |
13083 "> | |
13084 <thead> | |
13085 <tr> | |
13086 <th scope="col"></th> | |
13087 <th scope="col">value</th> | |
13088 <th scope="col">name</th> | |
13089 <th scope="col">extension</th> | |
13090 <th scope="col">hid</th> | |
13091 </tr> | |
13092 </thead> | |
13093 <tr class=""> | |
13094 <th scope="row">atomes_basic</th> | |
13095 <td>C;N;O;H;P</td> | |
13096 <td></td> | |
13097 <td></td> | |
13098 <td></td> | |
13099 </tr><tr class=""> | |
13100 <th scope="row">atomes_sup</th> | |
13101 <td>None</td> | |
13102 <td></td> | |
13103 <td></td> | |
13104 <td></td> | |
13105 </tr><tr class=""> | |
13106 <th scope="row">choice</th> | |
13107 <td>YES</td> | |
13108 <td></td> | |
13109 <td></td> | |
13110 <td></td> | |
13111 </tr><tr class=""> | |
13112 <th scope="row">colId</th> | |
13113 <td>1</td> | |
13114 <td></td> | |
13115 <td></td> | |
13116 <td></td> | |
13117 </tr><tr class=""> | |
13118 <th scope="row">colmass</th> | |
13119 <td>1</td> | |
13120 <td></td> | |
13121 <td></td> | |
13122 <td></td> | |
13123 </tr><tr class=""> | |
13124 <th scope="row">header_choice</th> | |
13125 <td>true</td> | |
13126 <td></td> | |
13127 <td></td> | |
13128 <td></td> | |
13129 </tr><tr class=""> | |
13130 <th scope="row">nbHeader</th> | |
13131 <td>1</td> | |
13132 <td></td> | |
13133 <td></td> | |
13134 <td></td> | |
13135 </tr><tr class=""> | |
13136 <th scope="row">input</th> | |
13137 <td>9a0ce47bd1734ae7</td> | |
13138 <td>peaklist_fragments.tsv</td> | |
13139 <td>tabular</td> | |
13140 <td>42</td> | |
13141 </tr><tr class=""> | |
13142 <th scope="row">mode</th> | |
13143 <td>neutral</td> | |
13144 <td></td> | |
13145 <td></td> | |
13146 <td></td> | |
13147 </tr><tr class=""> | |
13148 <th scope="row">regleOr</th> | |
13149 <td>NO</td> | |
13150 <td></td> | |
13151 <td></td> | |
13152 <td></td> | |
13153 </tr><tr class=""> | |
13154 <th scope="row">tol</th> | |
13155 <td>1.0</td> | |
13156 <td></td> | |
13157 <td></td> | |
13158 <td></td> | |
13159 </tr><tr class=""> | |
13160 <th scope="row">verbose</th> | |
13161 <td>1</td> | |
13162 <td></td> | |
13163 <td></td> | |
13164 <td></td> | |
13165 </tr> | |
13166 </table> | |
13167 </div> | |
13168 | |
13169 | |
13170 <div class="alert alert-danger"> | |
13171 <h2 | |
13172 class="history_metadata_extractor_h2" | |
13173 style="cursor: pointer" | |
13174 title="click to fold/unfold the table" | |
13175 > | |
13176 [581] - hr2 - 1.1.1.7 | |
13177 </h2> | |
13178 <p class="history_metadata_extractor_status"> | |
13179 Status: Failed (None) | |
13180 </p> | |
13181 <p class="history_metadata_extractor_glitter"></p> | |
13182 <table class=" | |
13183 table | |
13184 table-bordered | |
13185 table-dark | |
13186 table-striped | |
13187 table-hover | |
13188 d-block | |
13189 overflow-auto | |
13190 history_metadata_extractor_table | |
13191 "> | |
13192 <thead> | |
13193 <tr> | |
13194 <th scope="col"></th> | |
13195 <th scope="col">value</th> | |
13196 <th scope="col">name</th> | |
13197 <th scope="col">extension</th> | |
13198 <th scope="col">hid</th> | |
13199 </tr> | |
13200 </thead> | |
13201 <tr class=""> | |
13202 <th scope="row">atomes_basic</th> | |
13203 <td>C;N;O;H;P</td> | |
13204 <td></td> | |
13205 <td></td> | |
13206 <td></td> | |
13207 </tr><tr class=""> | |
13208 <th scope="row">atomes_sup</th> | |
13209 <td>None</td> | |
13210 <td></td> | |
13211 <td></td> | |
13212 <td></td> | |
13213 </tr><tr class=""> | |
13214 <th scope="row">choice</th> | |
13215 <td>YES</td> | |
13216 <td></td> | |
13217 <td></td> | |
13218 <td></td> | |
13219 </tr><tr class=""> | |
13220 <th scope="row">colId</th> | |
13221 <td>1</td> | |
13222 <td></td> | |
13223 <td></td> | |
13224 <td></td> | |
13225 </tr><tr class=""> | |
13226 <th scope="row">colmass</th> | |
13227 <td>1</td> | |
13228 <td></td> | |
13229 <td></td> | |
13230 <td></td> | |
13231 </tr><tr class=""> | |
13232 <th scope="row">header_choice</th> | |
13233 <td>true</td> | |
13234 <td></td> | |
13235 <td></td> | |
13236 <td></td> | |
13237 </tr><tr class=""> | |
13238 <th scope="row">nbHeader</th> | |
13239 <td>1</td> | |
13240 <td></td> | |
13241 <td></td> | |
13242 <td></td> | |
13243 </tr><tr class=""> | |
13244 <th scope="row">input</th> | |
13245 <td>9a0ce47bd1734ae7</td> | |
13246 <td>peaklist_fragments.tsv</td> | |
13247 <td>tabular</td> | |
13248 <td>42</td> | |
13249 </tr><tr class=""> | |
13250 <th scope="row">mode</th> | |
13251 <td>neutral</td> | |
13252 <td></td> | |
13253 <td></td> | |
13254 <td></td> | |
13255 </tr><tr class=""> | |
13256 <th scope="row">regleOr</th> | |
13257 <td>NO</td> | |
13258 <td></td> | |
13259 <td></td> | |
13260 <td></td> | |
13261 </tr><tr class=""> | |
13262 <th scope="row">tol</th> | |
13263 <td>1.0</td> | |
13264 <td></td> | |
13265 <td></td> | |
13266 <td></td> | |
13267 </tr><tr class=""> | |
13268 <th scope="row">verbose</th> | |
13269 <td>1</td> | |
13270 <td></td> | |
13271 <td></td> | |
13272 <td></td> | |
13273 </tr> | |
13274 </table> | |
13275 </div> | |
13276 | |
13277 | |
13278 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
13279 <h2 | |
13280 class="history_metadata_extractor_h2" | |
13281 style="cursor: pointer" | |
13282 title="click to fold/unfold the table" | |
13283 > | |
13284 [DELETED] - metams_runGC - 2.1.1 | |
13285 </h2> | |
13286 <p class="history_metadata_extractor_status"> | |
13287 Status: Failed (1) | |
13288 </p> | |
13289 <p class="history_metadata_extractor_glitter"></p> | |
13290 <table class=" | |
13291 table | |
13292 table-bordered | |
13293 table-dark | |
13294 table-striped | |
13295 table-hover | |
13296 d-block | |
13297 overflow-auto | |
13298 history_metadata_extractor_table | |
13299 "> | |
13300 <thead> | |
13301 <tr> | |
13302 <th scope="col"></th> | |
13303 <th scope="col">value</th> | |
13304 <th scope="col">name</th> | |
13305 <th scope="col">extension</th> | |
13306 <th scope="col">hid</th> | |
13307 </tr> | |
13308 </thead> | |
13309 <tr class=""> | |
13310 <th scope="row">input</th> | |
13311 <td>xset</td> | |
13312 <td></td> | |
13313 <td></td> | |
13314 <td></td> | |
13315 </tr><tr class=""> | |
13316 <th scope="row">xset</th> | |
13317 <td>9e77b3d7d0887128</td> | |
13318 <td>test.rdata</td> | |
13319 <td>rdata</td> | |
13320 <td>1</td> | |
13321 </tr><tr class=""> | |
13322 <th scope="row">option</th> | |
13323 <td>false</td> | |
13324 <td></td> | |
13325 <td></td> | |
13326 <td></td> | |
13327 </tr><tr class=""> | |
13328 <th scope="row">option</th> | |
13329 <td>hide</td> | |
13330 <td></td> | |
13331 <td></td> | |
13332 <td></td> | |
13333 </tr><tr class=""> | |
13334 <th scope="row">option</th> | |
13335 <td>hide</td> | |
13336 <td></td> | |
13337 <td></td> | |
13338 <td></td> | |
13339 </tr><tr class=""> | |
13340 <th scope="row">option</th> | |
13341 <td>hide</td> | |
13342 <td></td> | |
13343 <td></td> | |
13344 <td></td> | |
13345 </tr><tr class=""> | |
13346 <th scope="row">setting</th> | |
13347 <td>gcdefault</td> | |
13348 <td></td> | |
13349 <td></td> | |
13350 <td></td> | |
13351 </tr><tr class=""> | |
13352 <th scope="row">unkn</th> | |
13353 <td>1:5</td> | |
13354 <td></td> | |
13355 <td></td> | |
13356 <td></td> | |
13357 </tr> | |
13358 </table> | |
13359 </div> | |
13360 | |
13361 | |
13362 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
13363 <h2 | |
13364 class="history_metadata_extractor_h2" | |
13365 style="cursor: pointer" | |
13366 title="click to fold/unfold the table" | |
13367 > | |
13368 [DELETED] - metams_runGC - 2.1.1 | |
13369 </h2> | |
13370 <p class="history_metadata_extractor_status"> | |
13371 Status: Failed (1) | |
13372 </p> | |
13373 <p class="history_metadata_extractor_glitter"></p> | |
13374 <table class=" | |
13375 table | |
13376 table-bordered | |
13377 table-dark | |
13378 table-striped | |
13379 table-hover | |
13380 d-block | |
13381 overflow-auto | |
13382 history_metadata_extractor_table | |
13383 "> | |
13384 <thead> | |
13385 <tr> | |
13386 <th scope="col"></th> | |
13387 <th scope="col">value</th> | |
13388 <th scope="col">name</th> | |
13389 <th scope="col">extension</th> | |
13390 <th scope="col">hid</th> | |
13391 </tr> | |
13392 </thead> | |
13393 <tr class=""> | |
13394 <th scope="row">input</th> | |
13395 <td>xset</td> | |
13396 <td></td> | |
13397 <td></td> | |
13398 <td></td> | |
13399 </tr><tr class=""> | |
13400 <th scope="row">xset</th> | |
13401 <td>9e77b3d7d0887128</td> | |
13402 <td>test.rdata</td> | |
13403 <td>rdata</td> | |
13404 <td>1</td> | |
13405 </tr><tr class=""> | |
13406 <th scope="row">option</th> | |
13407 <td>false</td> | |
13408 <td></td> | |
13409 <td></td> | |
13410 <td></td> | |
13411 </tr><tr class=""> | |
13412 <th scope="row">option</th> | |
13413 <td>hide</td> | |
13414 <td></td> | |
13415 <td></td> | |
13416 <td></td> | |
13417 </tr><tr class=""> | |
13418 <th scope="row">option</th> | |
13419 <td>hide</td> | |
13420 <td></td> | |
13421 <td></td> | |
13422 <td></td> | |
13423 </tr><tr class=""> | |
13424 <th scope="row">option</th> | |
13425 <td>hide</td> | |
13426 <td></td> | |
13427 <td></td> | |
13428 <td></td> | |
13429 </tr><tr class=""> | |
13430 <th scope="row">setting</th> | |
13431 <td>gcdefault</td> | |
13432 <td></td> | |
13433 <td></td> | |
13434 <td></td> | |
13435 </tr><tr class=""> | |
13436 <th scope="row">unkn</th> | |
13437 <td>1:5</td> | |
13438 <td></td> | |
13439 <td></td> | |
13440 <td></td> | |
13441 </tr> | |
13442 </table> | |
13443 </div> | |
13444 | |
13445 | |
13446 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
13447 <h2 | |
13448 class="history_metadata_extractor_h2" | |
13449 style="cursor: pointer" | |
13450 title="click to fold/unfold the table" | |
13451 > | |
13452 [DELETED] - metams_runGC - 2.1.1 | |
13453 </h2> | |
13454 <p class="history_metadata_extractor_status"> | |
13455 Status: Failed (1) | |
13456 </p> | |
13457 <p class="history_metadata_extractor_glitter"></p> | |
13458 <table class=" | |
13459 table | |
13460 table-bordered | |
13461 table-dark | |
13462 table-striped | |
13463 table-hover | |
13464 d-block | |
13465 overflow-auto | |
13466 history_metadata_extractor_table | |
13467 "> | |
13468 <thead> | |
13469 <tr> | |
13470 <th scope="col"></th> | |
13471 <th scope="col">value</th> | |
13472 <th scope="col">name</th> | |
13473 <th scope="col">extension</th> | |
13474 <th scope="col">hid</th> | |
13475 </tr> | |
13476 </thead> | |
13477 <tr class=""> | |
13478 <th scope="row">input</th> | |
13479 <td>xset</td> | |
13480 <td></td> | |
13481 <td></td> | |
13482 <td></td> | |
13483 </tr><tr class=""> | |
13484 <th scope="row">xset</th> | |
13485 <td>9e77b3d7d0887128</td> | |
13486 <td>test.rdata</td> | |
13487 <td>rdata</td> | |
13488 <td>1</td> | |
13489 </tr><tr class=""> | |
13490 <th scope="row">option</th> | |
13491 <td>false</td> | |
13492 <td></td> | |
13493 <td></td> | |
13494 <td></td> | |
13495 </tr><tr class=""> | |
13496 <th scope="row">option</th> | |
13497 <td>hide</td> | |
13498 <td></td> | |
13499 <td></td> | |
13500 <td></td> | |
13501 </tr><tr class=""> | |
13502 <th scope="row">option</th> | |
13503 <td>hide</td> | |
13504 <td></td> | |
13505 <td></td> | |
13506 <td></td> | |
13507 </tr><tr class=""> | |
13508 <th scope="row">option</th> | |
13509 <td>hide</td> | |
13510 <td></td> | |
13511 <td></td> | |
13512 <td></td> | |
13513 </tr><tr class=""> | |
13514 <th scope="row">setting</th> | |
13515 <td>gcdefault</td> | |
13516 <td></td> | |
13517 <td></td> | |
13518 <td></td> | |
13519 </tr><tr class=""> | |
13520 <th scope="row">unkn</th> | |
13521 <td>1:5</td> | |
13522 <td></td> | |
13523 <td></td> | |
13524 <td></td> | |
13525 </tr> | |
13526 </table> | |
13527 </div> | |
13528 | |
13529 | |
13530 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
13531 <h2 | |
13532 class="history_metadata_extractor_h2" | |
13533 style="cursor: pointer" | |
13534 title="click to fold/unfold the table" | |
13535 > | |
13536 [DELETED] - metams_runGC - 2.1.1 | |
13537 </h2> | |
13538 <p class="history_metadata_extractor_status"> | |
13539 Status: Failed (1) | |
13540 </p> | |
13541 <p class="history_metadata_extractor_glitter"></p> | |
13542 <table class=" | |
13543 table | |
13544 table-bordered | |
13545 table-dark | |
13546 table-striped | |
13547 table-hover | |
13548 d-block | |
13549 overflow-auto | |
13550 history_metadata_extractor_table | |
13551 "> | |
13552 <thead> | |
13553 <tr> | |
13554 <th scope="col"></th> | |
13555 <th scope="col">value</th> | |
13556 <th scope="col">name</th> | |
13557 <th scope="col">extension</th> | |
13558 <th scope="col">hid</th> | |
13559 </tr> | |
13560 </thead> | |
13561 <tr class=""> | |
13562 <th scope="row">input</th> | |
13563 <td>xset</td> | |
13564 <td></td> | |
13565 <td></td> | |
13566 <td></td> | |
13567 </tr><tr class=""> | |
13568 <th scope="row">xset</th> | |
13569 <td>9e77b3d7d0887128</td> | |
13570 <td>test.rdata</td> | |
13571 <td>rdata</td> | |
13572 <td>1</td> | |
13573 </tr><tr class=""> | |
13574 <th scope="row">option</th> | |
13575 <td>false</td> | |
13576 <td></td> | |
13577 <td></td> | |
13578 <td></td> | |
13579 </tr><tr class=""> | |
13580 <th scope="row">option</th> | |
13581 <td>hide</td> | |
13582 <td></td> | |
13583 <td></td> | |
13584 <td></td> | |
13585 </tr><tr class=""> | |
13586 <th scope="row">option</th> | |
13587 <td>hide</td> | |
13588 <td></td> | |
13589 <td></td> | |
13590 <td></td> | |
13591 </tr><tr class=""> | |
13592 <th scope="row">option</th> | |
13593 <td>hide</td> | |
13594 <td></td> | |
13595 <td></td> | |
13596 <td></td> | |
13597 </tr><tr class=""> | |
13598 <th scope="row">setting</th> | |
13599 <td>gcdefault</td> | |
13600 <td></td> | |
13601 <td></td> | |
13602 <td></td> | |
13603 </tr><tr class=""> | |
13604 <th scope="row">unkn</th> | |
13605 <td>1:5</td> | |
13606 <td></td> | |
13607 <td></td> | |
13608 <td></td> | |
13609 </tr> | |
13610 </table> | |
13611 </div> | |
13612 | |
13613 | |
13614 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
13615 <h2 | |
13616 class="history_metadata_extractor_h2" | |
13617 style="cursor: pointer" | |
13618 title="click to fold/unfold the table" | |
13619 > | |
13620 [DELETED] - metams_runGC - 2.1.1 | |
13621 </h2> | |
13622 <p class="history_metadata_extractor_status"> | |
13623 Status: Failed (1) | |
13624 </p> | |
13625 <p class="history_metadata_extractor_glitter"></p> | |
13626 <table class=" | |
13627 table | |
13628 table-bordered | |
13629 table-dark | |
13630 table-striped | |
13631 table-hover | |
13632 d-block | |
13633 overflow-auto | |
13634 history_metadata_extractor_table | |
13635 "> | |
13636 <thead> | |
13637 <tr> | |
13638 <th scope="col"></th> | |
13639 <th scope="col">value</th> | |
13640 <th scope="col">name</th> | |
13641 <th scope="col">extension</th> | |
13642 <th scope="col">hid</th> | |
13643 </tr> | |
13644 </thead> | |
13645 <tr class=""> | |
13646 <th scope="row">input</th> | |
13647 <td>xset</td> | |
13648 <td></td> | |
13649 <td></td> | |
13650 <td></td> | |
13651 </tr><tr class=""> | |
13652 <th scope="row">xset</th> | |
13653 <td>9e77b3d7d0887128</td> | |
13654 <td>test.rdata</td> | |
13655 <td>rdata</td> | |
13656 <td>1</td> | |
13657 </tr><tr class=""> | |
13658 <th scope="row">option</th> | |
13659 <td>false</td> | |
13660 <td></td> | |
13661 <td></td> | |
13662 <td></td> | |
13663 </tr><tr class=""> | |
13664 <th scope="row">option</th> | |
13665 <td>hide</td> | |
13666 <td></td> | |
13667 <td></td> | |
13668 <td></td> | |
13669 </tr><tr class=""> | |
13670 <th scope="row">option</th> | |
13671 <td>hide</td> | |
13672 <td></td> | |
13673 <td></td> | |
13674 <td></td> | |
13675 </tr><tr class=""> | |
13676 <th scope="row">option</th> | |
13677 <td>hide</td> | |
13678 <td></td> | |
13679 <td></td> | |
13680 <td></td> | |
13681 </tr><tr class=""> | |
13682 <th scope="row">setting</th> | |
13683 <td>gcdefault</td> | |
13684 <td></td> | |
13685 <td></td> | |
13686 <td></td> | |
13687 </tr><tr class=""> | |
13688 <th scope="row">unkn</th> | |
13689 <td>1:5</td> | |
13690 <td></td> | |
13691 <td></td> | |
13692 <td></td> | |
13693 </tr> | |
13694 </table> | |
13695 </div> | |
13696 | |
13697 | |
13698 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
13699 <h2 | |
13700 class="history_metadata_extractor_h2" | |
13701 style="cursor: pointer" | |
13702 title="click to fold/unfold the table" | |
13703 > | |
13704 [DELETED] - metams_runGC - 2.1.1 | |
13705 </h2> | |
13706 <p class="history_metadata_extractor_status"> | |
13707 Status: Failed (1) | |
13708 </p> | |
13709 <p class="history_metadata_extractor_glitter"></p> | |
13710 <table class=" | |
13711 table | |
13712 table-bordered | |
13713 table-dark | |
13714 table-striped | |
13715 table-hover | |
13716 d-block | |
13717 overflow-auto | |
13718 history_metadata_extractor_table | |
13719 "> | |
13720 <thead> | |
13721 <tr> | |
13722 <th scope="col"></th> | |
13723 <th scope="col">value</th> | |
13724 <th scope="col">name</th> | |
13725 <th scope="col">extension</th> | |
13726 <th scope="col">hid</th> | |
13727 </tr> | |
13728 </thead> | |
13729 <tr class=""> | |
13730 <th scope="row">input</th> | |
13731 <td>xset</td> | |
13732 <td></td> | |
13733 <td></td> | |
13734 <td></td> | |
13735 </tr><tr class=""> | |
13736 <th scope="row">xset</th> | |
13737 <td>9e77b3d7d0887128</td> | |
13738 <td>test.rdata</td> | |
13739 <td>rdata</td> | |
13740 <td>1</td> | |
13741 </tr><tr class=""> | |
13742 <th scope="row">option</th> | |
13743 <td>false</td> | |
13744 <td></td> | |
13745 <td></td> | |
13746 <td></td> | |
13747 </tr><tr class=""> | |
13748 <th scope="row">option</th> | |
13749 <td>hide</td> | |
13750 <td></td> | |
13751 <td></td> | |
13752 <td></td> | |
13753 </tr><tr class=""> | |
13754 <th scope="row">option</th> | |
13755 <td>hide</td> | |
13756 <td></td> | |
13757 <td></td> | |
13758 <td></td> | |
13759 </tr><tr class=""> | |
13760 <th scope="row">option</th> | |
13761 <td>hide</td> | |
13762 <td></td> | |
13763 <td></td> | |
13764 <td></td> | |
13765 </tr><tr class=""> | |
13766 <th scope="row">setting</th> | |
13767 <td>gcdefault</td> | |
13768 <td></td> | |
13769 <td></td> | |
13770 <td></td> | |
13771 </tr><tr class=""> | |
13772 <th scope="row">unkn</th> | |
13773 <td>1:5</td> | |
13774 <td></td> | |
13775 <td></td> | |
13776 <td></td> | |
13777 </tr> | |
13778 </table> | |
13779 </div> | |
13780 | |
13781 | |
13782 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
13783 <h2 | |
13784 class="history_metadata_extractor_h2" | |
13785 style="cursor: pointer" | |
13786 title="click to fold/unfold the table" | |
13787 > | |
13788 [DELETED] - metams_runGC - 2.1.1 | |
13789 </h2> | |
13790 <p class="history_metadata_extractor_status"> | |
13791 Status: Failed (1) | |
13792 </p> | |
13793 <p class="history_metadata_extractor_glitter"></p> | |
13794 <table class=" | |
13795 table | |
13796 table-bordered | |
13797 table-dark | |
13798 table-striped | |
13799 table-hover | |
13800 d-block | |
13801 overflow-auto | |
13802 history_metadata_extractor_table | |
13803 "> | |
13804 <thead> | |
13805 <tr> | |
13806 <th scope="col"></th> | |
13807 <th scope="col">value</th> | |
13808 <th scope="col">name</th> | |
13809 <th scope="col">extension</th> | |
13810 <th scope="col">hid</th> | |
13811 </tr> | |
13812 </thead> | |
13813 <tr class=""> | |
13814 <th scope="row">input</th> | |
13815 <td>xset</td> | |
13816 <td></td> | |
13817 <td></td> | |
13818 <td></td> | |
13819 </tr><tr class=""> | |
13820 <th scope="row">xset</th> | |
13821 <td>9e77b3d7d0887128</td> | |
13822 <td>test.rdata</td> | |
13823 <td>rdata</td> | |
13824 <td>1</td> | |
13825 </tr><tr class=""> | |
13826 <th scope="row">option</th> | |
13827 <td>false</td> | |
13828 <td></td> | |
13829 <td></td> | |
13830 <td></td> | |
13831 </tr><tr class=""> | |
13832 <th scope="row">option</th> | |
13833 <td>hide</td> | |
13834 <td></td> | |
13835 <td></td> | |
13836 <td></td> | |
13837 </tr><tr class=""> | |
13838 <th scope="row">option</th> | |
13839 <td>hide</td> | |
13840 <td></td> | |
13841 <td></td> | |
13842 <td></td> | |
13843 </tr><tr class=""> | |
13844 <th scope="row">option</th> | |
13845 <td>hide</td> | |
13846 <td></td> | |
13847 <td></td> | |
13848 <td></td> | |
13849 </tr><tr class=""> | |
13850 <th scope="row">setting</th> | |
13851 <td>gcdefault</td> | |
13852 <td></td> | |
13853 <td></td> | |
13854 <td></td> | |
13855 </tr><tr class=""> | |
13856 <th scope="row">unkn</th> | |
13857 <td>1:5</td> | |
13858 <td></td> | |
13859 <td></td> | |
13860 <td></td> | |
13861 </tr> | |
13862 </table> | |
13863 </div> | |
13864 | |
13865 | |
13866 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
13867 <h2 | |
13868 class="history_metadata_extractor_h2" | |
13869 style="cursor: pointer" | |
13870 title="click to fold/unfold the table" | |
13871 > | |
13872 [DELETED] - metams_runGC - 2.1.1 | |
13873 </h2> | |
13874 <p class="history_metadata_extractor_status"> | |
13875 Status: Failed (1) | |
13876 </p> | |
13877 <p class="history_metadata_extractor_glitter"></p> | |
13878 <table class=" | |
13879 table | |
13880 table-bordered | |
13881 table-dark | |
13882 table-striped | |
13883 table-hover | |
13884 d-block | |
13885 overflow-auto | |
13886 history_metadata_extractor_table | |
13887 "> | |
13888 <thead> | |
13889 <tr> | |
13890 <th scope="col"></th> | |
13891 <th scope="col">value</th> | |
13892 <th scope="col">name</th> | |
13893 <th scope="col">extension</th> | |
13894 <th scope="col">hid</th> | |
13895 </tr> | |
13896 </thead> | |
13897 <tr class=""> | |
13898 <th scope="row">input</th> | |
13899 <td>xset</td> | |
13900 <td></td> | |
13901 <td></td> | |
13902 <td></td> | |
13903 </tr><tr class=""> | |
13904 <th scope="row">xset</th> | |
13905 <td>9e77b3d7d0887128</td> | |
13906 <td>test.rdata</td> | |
13907 <td>rdata</td> | |
13908 <td>1</td> | |
13909 </tr><tr class=""> | |
13910 <th scope="row">option</th> | |
13911 <td>false</td> | |
13912 <td></td> | |
13913 <td></td> | |
13914 <td></td> | |
13915 </tr><tr class=""> | |
13916 <th scope="row">option</th> | |
13917 <td>hide</td> | |
13918 <td></td> | |
13919 <td></td> | |
13920 <td></td> | |
13921 </tr><tr class=""> | |
13922 <th scope="row">option</th> | |
13923 <td>hide</td> | |
13924 <td></td> | |
13925 <td></td> | |
13926 <td></td> | |
13927 </tr><tr class=""> | |
13928 <th scope="row">option</th> | |
13929 <td>hide</td> | |
13930 <td></td> | |
13931 <td></td> | |
13932 <td></td> | |
13933 </tr><tr class=""> | |
13934 <th scope="row">setting</th> | |
13935 <td>gcdefault</td> | |
13936 <td></td> | |
13937 <td></td> | |
13938 <td></td> | |
13939 </tr><tr class=""> | |
13940 <th scope="row">unkn</th> | |
13941 <td>1:5</td> | |
13942 <td></td> | |
13943 <td></td> | |
13944 <td></td> | |
13945 </tr> | |
13946 </table> | |
13947 </div> | |
13948 | |
13949 | |
13950 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
13951 <h2 | |
13952 class="history_metadata_extractor_h2" | |
13953 style="cursor: pointer" | |
13954 title="click to fold/unfold the table" | |
13955 > | |
13956 [DELETED] - metams_runGC - 2.1.1 | |
13957 </h2> | |
13958 <p class="history_metadata_extractor_status"> | |
13959 Status: Failed (1) | |
13960 </p> | |
13961 <p class="history_metadata_extractor_glitter"></p> | |
13962 <table class=" | |
13963 table | |
13964 table-bordered | |
13965 table-dark | |
13966 table-striped | |
13967 table-hover | |
13968 d-block | |
13969 overflow-auto | |
13970 history_metadata_extractor_table | |
13971 "> | |
13972 <thead> | |
13973 <tr> | |
13974 <th scope="col"></th> | |
13975 <th scope="col">value</th> | |
13976 <th scope="col">name</th> | |
13977 <th scope="col">extension</th> | |
13978 <th scope="col">hid</th> | |
13979 </tr> | |
13980 </thead> | |
13981 <tr class=""> | |
13982 <th scope="row">input</th> | |
13983 <td>xset</td> | |
13984 <td></td> | |
13985 <td></td> | |
13986 <td></td> | |
13987 </tr><tr class=""> | |
13988 <th scope="row">xset</th> | |
13989 <td>9e77b3d7d0887128</td> | |
13990 <td>test.rdata</td> | |
13991 <td>rdata</td> | |
13992 <td>1</td> | |
13993 </tr><tr class=""> | |
13994 <th scope="row">option</th> | |
13995 <td>false</td> | |
13996 <td></td> | |
13997 <td></td> | |
13998 <td></td> | |
13999 </tr><tr class=""> | |
14000 <th scope="row">option</th> | |
14001 <td>hide</td> | |
14002 <td></td> | |
14003 <td></td> | |
14004 <td></td> | |
14005 </tr><tr class=""> | |
14006 <th scope="row">option</th> | |
14007 <td>hide</td> | |
14008 <td></td> | |
14009 <td></td> | |
14010 <td></td> | |
14011 </tr><tr class=""> | |
14012 <th scope="row">option</th> | |
14013 <td>hide</td> | |
14014 <td></td> | |
14015 <td></td> | |
14016 <td></td> | |
14017 </tr><tr class=""> | |
14018 <th scope="row">setting</th> | |
14019 <td>gcdefault</td> | |
14020 <td></td> | |
14021 <td></td> | |
14022 <td></td> | |
14023 </tr><tr class=""> | |
14024 <th scope="row">unkn</th> | |
14025 <td>1:5</td> | |
14026 <td></td> | |
14027 <td></td> | |
14028 <td></td> | |
14029 </tr> | |
14030 </table> | |
14031 </div> | |
14032 | |
14033 | |
14034 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
14035 <h2 | |
14036 class="history_metadata_extractor_h2" | |
14037 style="cursor: pointer" | |
14038 title="click to fold/unfold the table" | |
14039 > | |
14040 [DELETED] - metams_runGC - 2.1.1 | |
14041 </h2> | |
14042 <p class="history_metadata_extractor_status"> | |
14043 Status: Failed (1) | |
14044 </p> | |
14045 <p class="history_metadata_extractor_glitter"></p> | |
14046 <table class=" | |
14047 table | |
14048 table-bordered | |
14049 table-dark | |
14050 table-striped | |
14051 table-hover | |
14052 d-block | |
14053 overflow-auto | |
14054 history_metadata_extractor_table | |
14055 "> | |
14056 <thead> | |
14057 <tr> | |
14058 <th scope="col"></th> | |
14059 <th scope="col">value</th> | |
14060 <th scope="col">name</th> | |
14061 <th scope="col">extension</th> | |
14062 <th scope="col">hid</th> | |
14063 </tr> | |
14064 </thead> | |
14065 <tr class=""> | |
14066 <th scope="row">input</th> | |
14067 <td>xset</td> | |
14068 <td></td> | |
14069 <td></td> | |
14070 <td></td> | |
14071 </tr><tr class=""> | |
14072 <th scope="row">xset</th> | |
14073 <td>9e77b3d7d0887128</td> | |
14074 <td>test.rdata</td> | |
14075 <td>rdata</td> | |
14076 <td>1</td> | |
14077 </tr><tr class=""> | |
14078 <th scope="row">option</th> | |
14079 <td>false</td> | |
14080 <td></td> | |
14081 <td></td> | |
14082 <td></td> | |
14083 </tr><tr class=""> | |
14084 <th scope="row">option</th> | |
14085 <td>hide</td> | |
14086 <td></td> | |
14087 <td></td> | |
14088 <td></td> | |
14089 </tr><tr class=""> | |
14090 <th scope="row">option</th> | |
14091 <td>hide</td> | |
14092 <td></td> | |
14093 <td></td> | |
14094 <td></td> | |
14095 </tr><tr class=""> | |
14096 <th scope="row">option</th> | |
14097 <td>hide</td> | |
14098 <td></td> | |
14099 <td></td> | |
14100 <td></td> | |
14101 </tr><tr class=""> | |
14102 <th scope="row">setting</th> | |
14103 <td>gcdefault</td> | |
14104 <td></td> | |
14105 <td></td> | |
14106 <td></td> | |
14107 </tr><tr class=""> | |
14108 <th scope="row">unkn</th> | |
14109 <td>1:5</td> | |
14110 <td></td> | |
14111 <td></td> | |
14112 <td></td> | |
14113 </tr> | |
14114 </table> | |
14115 </div> | |
14116 | |
14117 | |
14118 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
14119 <h2 | |
14120 class="history_metadata_extractor_h2" | |
14121 style="cursor: pointer" | |
14122 title="click to fold/unfold the table" | |
14123 > | |
14124 [DELETED] - metams_runGC - 2.1.1 | |
14125 </h2> | |
14126 <p class="history_metadata_extractor_status"> | |
14127 Status: Failed (1) | |
14128 </p> | |
14129 <p class="history_metadata_extractor_glitter"></p> | |
14130 <table class=" | |
14131 table | |
14132 table-bordered | |
14133 table-dark | |
14134 table-striped | |
14135 table-hover | |
14136 d-block | |
14137 overflow-auto | |
14138 history_metadata_extractor_table | |
14139 "> | |
14140 <thead> | |
14141 <tr> | |
14142 <th scope="col"></th> | |
14143 <th scope="col">value</th> | |
14144 <th scope="col">name</th> | |
14145 <th scope="col">extension</th> | |
14146 <th scope="col">hid</th> | |
14147 </tr> | |
14148 </thead> | |
14149 <tr class=""> | |
14150 <th scope="row">input</th> | |
14151 <td>xset</td> | |
14152 <td></td> | |
14153 <td></td> | |
14154 <td></td> | |
14155 </tr><tr class=""> | |
14156 <th scope="row">xset</th> | |
14157 <td>9e77b3d7d0887128</td> | |
14158 <td>test.rdata</td> | |
14159 <td>rdata</td> | |
14160 <td>1</td> | |
14161 </tr><tr class=""> | |
14162 <th scope="row">option</th> | |
14163 <td>false</td> | |
14164 <td></td> | |
14165 <td></td> | |
14166 <td></td> | |
14167 </tr><tr class=""> | |
14168 <th scope="row">option</th> | |
14169 <td>hide</td> | |
14170 <td></td> | |
14171 <td></td> | |
14172 <td></td> | |
14173 </tr><tr class=""> | |
14174 <th scope="row">option</th> | |
14175 <td>hide</td> | |
14176 <td></td> | |
14177 <td></td> | |
14178 <td></td> | |
14179 </tr><tr class=""> | |
14180 <th scope="row">option</th> | |
14181 <td>hide</td> | |
14182 <td></td> | |
14183 <td></td> | |
14184 <td></td> | |
14185 </tr><tr class=""> | |
14186 <th scope="row">setting</th> | |
14187 <td>gcdefault</td> | |
14188 <td></td> | |
14189 <td></td> | |
14190 <td></td> | |
14191 </tr><tr class=""> | |
14192 <th scope="row">unkn</th> | |
14193 <td>1:5</td> | |
14194 <td></td> | |
14195 <td></td> | |
14196 <td></td> | |
14197 </tr> | |
14198 </table> | |
14199 </div> | |
14200 | |
14201 | |
14202 <div class="alert alert-danger"> | |
14203 <h2 | |
14204 class="history_metadata_extractor_h2" | |
14205 style="cursor: pointer" | |
14206 title="click to fold/unfold the table" | |
14207 > | |
14208 [595] - golm_ws_lib_search - 2016-12-05 | |
14209 </h2> | |
14210 <p class="history_metadata_extractor_status"> | |
14211 Status: Failed (2) | |
14212 </p> | |
14213 <p class="history_metadata_extractor_glitter"></p> | |
14214 <table class=" | |
14215 table | |
14216 table-bordered | |
14217 table-dark | |
14218 table-striped | |
14219 table-hover | |
14220 d-block | |
14221 overflow-auto | |
14222 history_metadata_extractor_table | |
14223 "> | |
14224 <thead> | |
14225 <tr> | |
14226 <th scope="col"></th> | |
14227 <th scope="col">value</th> | |
14228 <th scope="col">name</th> | |
14229 <th scope="col">extension</th> | |
14230 <th scope="col">hid</th> | |
14231 </tr> | |
14232 </thead> | |
14233 <tr class=""> | |
14234 <th scope="row">DotproductDistanceThreshold</th> | |
14235 <td>0.5</td> | |
14236 <td></td> | |
14237 <td></td> | |
14238 <td></td> | |
14239 </tr><tr class=""> | |
14240 <th scope="row">EuclideanDistanceThreshold</th> | |
14241 <td>0.5</td> | |
14242 <td></td> | |
14243 <td></td> | |
14244 <td></td> | |
14245 </tr><tr class=""> | |
14246 <th scope="row">HammingDistanceThreshold</th> | |
14247 <td>500.0</td> | |
14248 <td></td> | |
14249 <td></td> | |
14250 <td></td> | |
14251 </tr><tr class=""> | |
14252 <th scope="row">JaccardDistanceThreshold</th> | |
14253 <td>0.9</td> | |
14254 <td></td> | |
14255 <td></td> | |
14256 <td></td> | |
14257 </tr><tr class=""> | |
14258 <th scope="row">columnType</th> | |
14259 <td>VAR5</td> | |
14260 <td></td> | |
14261 <td></td> | |
14262 <td></td> | |
14263 </tr><tr class=""> | |
14264 <th scope="row">choice</th> | |
14265 <td>YES</td> | |
14266 <td></td> | |
14267 <td></td> | |
14268 <td></td> | |
14269 </tr><tr class=""> | |
14270 <th scope="row">masses</th> | |
14271 <td>9a0ce47bd1734ae7</td> | |
14272 <td>peaklist_fragments.tsv</td> | |
14273 <td>tabular</td> | |
14274 <td>42</td> | |
14275 </tr><tr class=""> | |
14276 <th scope="row">intensity_type</th> | |
14277 <td>true</td> | |
14278 <td></td> | |
14279 <td></td> | |
14280 <td></td> | |
14281 </tr><tr class=""> | |
14282 <th scope="row">maxHits</th> | |
14283 <td>100</td> | |
14284 <td></td> | |
14285 <td></td> | |
14286 <td></td> | |
14287 </tr><tr class=""> | |
14288 <th scope="row">maxIons</th> | |
14289 <td>0</td> | |
14290 <td></td> | |
14291 <td></td> | |
14292 <td></td> | |
14293 </tr><tr class=""> | |
14294 <th scope="row">mzRes</th> | |
14295 <td>0</td> | |
14296 <td></td> | |
14297 <td></td> | |
14298 <td></td> | |
14299 </tr><tr class=""> | |
14300 <th scope="row">ri</th> | |
14301 <td>1898</td> | |
14302 <td></td> | |
14303 <td></td> | |
14304 <td></td> | |
14305 </tr><tr class=""> | |
14306 <th scope="row">riWindow</th> | |
14307 <td>5</td> | |
14308 <td></td> | |
14309 <td></td> | |
14310 <td></td> | |
14311 </tr><tr class=""> | |
14312 <th scope="row">s12GowerLegendreDistanceThreshold</th> | |
14313 <td>0.9</td> | |
14314 <td></td> | |
14315 <td></td> | |
14316 <td></td> | |
14317 </tr> | |
14318 </table> | |
14319 </div> | |
14320 | |
14321 | |
14322 <div class="alert alert-danger"> | |
14323 <h2 | |
14324 class="history_metadata_extractor_h2" | |
14325 style="cursor: pointer" | |
14326 title="click to fold/unfold the table" | |
14327 > | |
14328 [593] - golm_ws_lib_search - 2016-12-05 | |
14329 </h2> | |
14330 <p class="history_metadata_extractor_status"> | |
14331 Status: Failed (2) | |
14332 </p> | |
14333 <p class="history_metadata_extractor_glitter"></p> | |
14334 <table class=" | |
14335 table | |
14336 table-bordered | |
14337 table-dark | |
14338 table-striped | |
14339 table-hover | |
14340 d-block | |
14341 overflow-auto | |
14342 history_metadata_extractor_table | |
14343 "> | |
14344 <thead> | |
14345 <tr> | |
14346 <th scope="col"></th> | |
14347 <th scope="col">value</th> | |
14348 <th scope="col">name</th> | |
14349 <th scope="col">extension</th> | |
14350 <th scope="col">hid</th> | |
14351 </tr> | |
14352 </thead> | |
14353 <tr class=""> | |
14354 <th scope="row">DotproductDistanceThreshold</th> | |
14355 <td>0.5</td> | |
14356 <td></td> | |
14357 <td></td> | |
14358 <td></td> | |
14359 </tr><tr class=""> | |
14360 <th scope="row">EuclideanDistanceThreshold</th> | |
14361 <td>0.5</td> | |
14362 <td></td> | |
14363 <td></td> | |
14364 <td></td> | |
14365 </tr><tr class=""> | |
14366 <th scope="row">HammingDistanceThreshold</th> | |
14367 <td>500.0</td> | |
14368 <td></td> | |
14369 <td></td> | |
14370 <td></td> | |
14371 </tr><tr class=""> | |
14372 <th scope="row">JaccardDistanceThreshold</th> | |
14373 <td>0.9</td> | |
14374 <td></td> | |
14375 <td></td> | |
14376 <td></td> | |
14377 </tr><tr class=""> | |
14378 <th scope="row">columnType</th> | |
14379 <td>VAR5</td> | |
14380 <td></td> | |
14381 <td></td> | |
14382 <td></td> | |
14383 </tr><tr class=""> | |
14384 <th scope="row">choice</th> | |
14385 <td>YES</td> | |
14386 <td></td> | |
14387 <td></td> | |
14388 <td></td> | |
14389 </tr><tr class=""> | |
14390 <th scope="row">masses</th> | |
14391 <td>9a0ce47bd1734ae7</td> | |
14392 <td>peaklist_fragments.tsv</td> | |
14393 <td>tabular</td> | |
14394 <td>42</td> | |
14395 </tr><tr class=""> | |
14396 <th scope="row">intensity_type</th> | |
14397 <td>true</td> | |
14398 <td></td> | |
14399 <td></td> | |
14400 <td></td> | |
14401 </tr><tr class=""> | |
14402 <th scope="row">maxHits</th> | |
14403 <td>100</td> | |
14404 <td></td> | |
14405 <td></td> | |
14406 <td></td> | |
14407 </tr><tr class=""> | |
14408 <th scope="row">maxIons</th> | |
14409 <td>0</td> | |
14410 <td></td> | |
14411 <td></td> | |
14412 <td></td> | |
14413 </tr><tr class=""> | |
14414 <th scope="row">mzRes</th> | |
14415 <td>0</td> | |
14416 <td></td> | |
14417 <td></td> | |
14418 <td></td> | |
14419 </tr><tr class=""> | |
14420 <th scope="row">ri</th> | |
14421 <td>1898</td> | |
14422 <td></td> | |
14423 <td></td> | |
14424 <td></td> | |
14425 </tr><tr class=""> | |
14426 <th scope="row">riWindow</th> | |
14427 <td>5</td> | |
14428 <td></td> | |
14429 <td></td> | |
14430 <td></td> | |
14431 </tr><tr class=""> | |
14432 <th scope="row">s12GowerLegendreDistanceThreshold</th> | |
14433 <td>0.9</td> | |
14434 <td></td> | |
14435 <td></td> | |
14436 <td></td> | |
14437 </tr> | |
14438 </table> | |
14439 </div> | |
14440 | |
14441 | |
14442 <div class="alert alert-danger"> | |
14443 <h2 | |
14444 class="history_metadata_extractor_h2" | |
14445 style="cursor: pointer" | |
14446 title="click to fold/unfold the table" | |
14447 > | |
14448 [594] - golm_ws_lib_search - 2016-12-05 | |
14449 </h2> | |
14450 <p class="history_metadata_extractor_status"> | |
14451 Status: Failed (2) | |
14452 </p> | |
14453 <p class="history_metadata_extractor_glitter"></p> | |
14454 <table class=" | |
14455 table | |
14456 table-bordered | |
14457 table-dark | |
14458 table-striped | |
14459 table-hover | |
14460 d-block | |
14461 overflow-auto | |
14462 history_metadata_extractor_table | |
14463 "> | |
14464 <thead> | |
14465 <tr> | |
14466 <th scope="col"></th> | |
14467 <th scope="col">value</th> | |
14468 <th scope="col">name</th> | |
14469 <th scope="col">extension</th> | |
14470 <th scope="col">hid</th> | |
14471 </tr> | |
14472 </thead> | |
14473 <tr class=""> | |
14474 <th scope="row">DotproductDistanceThreshold</th> | |
14475 <td>0.5</td> | |
14476 <td></td> | |
14477 <td></td> | |
14478 <td></td> | |
14479 </tr><tr class=""> | |
14480 <th scope="row">EuclideanDistanceThreshold</th> | |
14481 <td>0.5</td> | |
14482 <td></td> | |
14483 <td></td> | |
14484 <td></td> | |
14485 </tr><tr class=""> | |
14486 <th scope="row">HammingDistanceThreshold</th> | |
14487 <td>500.0</td> | |
14488 <td></td> | |
14489 <td></td> | |
14490 <td></td> | |
14491 </tr><tr class=""> | |
14492 <th scope="row">JaccardDistanceThreshold</th> | |
14493 <td>0.9</td> | |
14494 <td></td> | |
14495 <td></td> | |
14496 <td></td> | |
14497 </tr><tr class=""> | |
14498 <th scope="row">columnType</th> | |
14499 <td>VAR5</td> | |
14500 <td></td> | |
14501 <td></td> | |
14502 <td></td> | |
14503 </tr><tr class=""> | |
14504 <th scope="row">choice</th> | |
14505 <td>YES</td> | |
14506 <td></td> | |
14507 <td></td> | |
14508 <td></td> | |
14509 </tr><tr class=""> | |
14510 <th scope="row">masses</th> | |
14511 <td>9a0ce47bd1734ae7</td> | |
14512 <td>peaklist_fragments.tsv</td> | |
14513 <td>tabular</td> | |
14514 <td>42</td> | |
14515 </tr><tr class=""> | |
14516 <th scope="row">intensity_type</th> | |
14517 <td>true</td> | |
14518 <td></td> | |
14519 <td></td> | |
14520 <td></td> | |
14521 </tr><tr class=""> | |
14522 <th scope="row">maxHits</th> | |
14523 <td>100</td> | |
14524 <td></td> | |
14525 <td></td> | |
14526 <td></td> | |
14527 </tr><tr class=""> | |
14528 <th scope="row">maxIons</th> | |
14529 <td>0</td> | |
14530 <td></td> | |
14531 <td></td> | |
14532 <td></td> | |
14533 </tr><tr class=""> | |
14534 <th scope="row">mzRes</th> | |
14535 <td>0</td> | |
14536 <td></td> | |
14537 <td></td> | |
14538 <td></td> | |
14539 </tr><tr class=""> | |
14540 <th scope="row">ri</th> | |
14541 <td>1898</td> | |
14542 <td></td> | |
14543 <td></td> | |
14544 <td></td> | |
14545 </tr><tr class=""> | |
14546 <th scope="row">riWindow</th> | |
14547 <td>5</td> | |
14548 <td></td> | |
14549 <td></td> | |
14550 <td></td> | |
14551 </tr><tr class=""> | |
14552 <th scope="row">s12GowerLegendreDistanceThreshold</th> | |
14553 <td>0.9</td> | |
14554 <td></td> | |
14555 <td></td> | |
14556 <td></td> | |
14557 </tr> | |
14558 </table> | |
14559 </div> | |
14560 | |
14561 | |
14562 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
14563 <h2 | |
14564 class="history_metadata_extractor_h2" | |
14565 style="cursor: pointer" | |
14566 title="click to fold/unfold the table" | |
14567 > | |
14568 [DELETED] - tablemerge - 1.0.1 | |
14569 </h2> | |
14570 <p class="history_metadata_extractor_status"> | |
14571 Status: Failed (1) | |
14572 </p> | |
14573 <p class="history_metadata_extractor_glitter"></p> | |
14574 <table class=" | |
14575 table | |
14576 table-bordered | |
14577 table-dark | |
14578 table-striped | |
14579 table-hover | |
14580 d-block | |
14581 overflow-auto | |
14582 history_metadata_extractor_table | |
14583 "> | |
14584 <thead> | |
14585 <tr> | |
14586 <th scope="col"></th> | |
14587 <th scope="col">value</th> | |
14588 <th scope="col">name</th> | |
14589 <th scope="col">extension</th> | |
14590 <th scope="col">hid</th> | |
14591 </tr> | |
14592 </thead> | |
14593 <tr class=""> | |
14594 <th scope="row">Metadata_in</th> | |
14595 <td>7cf499d16bd542b2</td> | |
14596 <td>compounds_pos.txt</td> | |
14597 <td>tabular</td> | |
14598 <td>44</td> | |
14599 </tr><tr class=""> | |
14600 <th scope="row">dataMatrix_in</th> | |
14601 <td>9a0ce47bd1734ae7</td> | |
14602 <td>peaklist_fragments.tsv</td> | |
14603 <td>tabular</td> | |
14604 <td>42</td> | |
14605 </tr><tr class=""> | |
14606 <th scope="row">metatype</th> | |
14607 <td>sample</td> | |
14608 <td></td> | |
14609 <td></td> | |
14610 <td></td> | |
14611 </tr> | |
14612 </table> | |
14613 </div> | |
14614 | |
14615 | |
14616 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
14617 <h2 | |
14618 class="history_metadata_extractor_h2" | |
14619 style="cursor: pointer" | |
14620 title="click to fold/unfold the table" | |
14621 > | |
14622 [DELETED] - idchoice - 19.12 | |
14623 </h2> | |
14624 <p class="history_metadata_extractor_status"> | |
14625 Status: Failed (1) | |
14626 </p> | |
14627 <p class="history_metadata_extractor_glitter"></p> | |
14628 <table class=" | |
14629 table | |
14630 table-bordered | |
14631 table-dark | |
14632 table-striped | |
14633 table-hover | |
14634 d-block | |
14635 overflow-auto | |
14636 history_metadata_extractor_table | |
14637 "> | |
14638 <thead> | |
14639 <tr> | |
14640 <th scope="col"></th> | |
14641 <th scope="col">value</th> | |
14642 <th scope="col">name</th> | |
14643 <th scope="col">extension</th> | |
14644 <th scope="col">hid</th> | |
14645 </tr> | |
14646 </thead> | |
14647 <tr class=""> | |
14648 <th scope="row">Metadata_in</th> | |
14649 <td>9a0ce47bd1734ae7</td> | |
14650 <td>peaklist_fragments.tsv</td> | |
14651 <td>tabular</td> | |
14652 <td>42</td> | |
14653 </tr><tr class=""> | |
14654 <th scope="row">col_name</th> | |
14655 <td></td> | |
14656 <td></td> | |
14657 <td></td> | |
14658 <td></td> | |
14659 </tr><tr class=""> | |
14660 <th scope="row">dataMatrix_in</th> | |
14661 <td>9a0ce47bd1734ae7</td> | |
14662 <td>peaklist_fragments.tsv</td> | |
14663 <td>tabular</td> | |
14664 <td>42</td> | |
14665 </tr><tr class=""> | |
14666 <th scope="row">makeunique</th> | |
14667 <td>no</td> | |
14668 <td></td> | |
14669 <td></td> | |
14670 <td></td> | |
14671 </tr><tr class=""> | |
14672 <th scope="row">metatype</th> | |
14673 <td>variable</td> | |
14674 <td></td> | |
14675 <td></td> | |
14676 <td></td> | |
14677 </tr> | |
14678 </table> | |
14679 </div> | |
14680 | |
14681 | |
14682 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
14683 <h2 | |
14684 class="history_metadata_extractor_h2" | |
14685 style="cursor: pointer" | |
14686 title="click to fold/unfold the table" | |
14687 > | |
14688 [DELETED] - idchoice - 19.12 | |
14689 </h2> | |
14690 <p class="history_metadata_extractor_status"> | |
14691 Status: Failed (1) | |
14692 </p> | |
14693 <p class="history_metadata_extractor_glitter"></p> | |
14694 <table class=" | |
14695 table | |
14696 table-bordered | |
14697 table-dark | |
14698 table-striped | |
14699 table-hover | |
14700 d-block | |
14701 overflow-auto | |
14702 history_metadata_extractor_table | |
14703 "> | |
14704 <thead> | |
14705 <tr> | |
14706 <th scope="col"></th> | |
14707 <th scope="col">value</th> | |
14708 <th scope="col">name</th> | |
14709 <th scope="col">extension</th> | |
14710 <th scope="col">hid</th> | |
14711 </tr> | |
14712 </thead> | |
14713 <tr class=""> | |
14714 <th scope="row">Metadata_in</th> | |
14715 <td>9a0ce47bd1734ae7</td> | |
14716 <td>peaklist_fragments.tsv</td> | |
14717 <td>tabular</td> | |
14718 <td>42</td> | |
14719 </tr><tr class=""> | |
14720 <th scope="row">col_name</th> | |
14721 <td></td> | |
14722 <td></td> | |
14723 <td></td> | |
14724 <td></td> | |
14725 </tr><tr class=""> | |
14726 <th scope="row">dataMatrix_in</th> | |
14727 <td>9a0ce47bd1734ae7</td> | |
14728 <td>peaklist_fragments.tsv</td> | |
14729 <td>tabular</td> | |
14730 <td>42</td> | |
14731 </tr><tr class=""> | |
14732 <th scope="row">makeunique</th> | |
14733 <td>no</td> | |
14734 <td></td> | |
14735 <td></td> | |
14736 <td></td> | |
14737 </tr><tr class=""> | |
14738 <th scope="row">metatype</th> | |
14739 <td>variable</td> | |
14740 <td></td> | |
14741 <td></td> | |
14742 <td></td> | |
14743 </tr> | |
14744 </table> | |
14745 </div> | |
14746 | |
14747 | |
14748 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
14749 <h2 | |
14750 class="history_metadata_extractor_h2" | |
14751 style="cursor: pointer" | |
14752 title="click to fold/unfold the table" | |
14753 > | |
14754 [DELETED] - generic_filter - 2020.01 | |
14755 </h2> | |
14756 <p class="history_metadata_extractor_status"> | |
14757 Status: Failed (1) | |
14758 </p> | |
14759 <p class="history_metadata_extractor_glitter"></p> | |
14760 <table class=" | |
14761 table | |
14762 table-bordered | |
14763 table-dark | |
14764 table-striped | |
14765 table-hover | |
14766 d-block | |
14767 overflow-auto | |
14768 history_metadata_extractor_table | |
14769 "> | |
14770 <thead> | |
14771 <tr> | |
14772 <th scope="col"></th> | |
14773 <th scope="col">value</th> | |
14774 <th scope="col">name</th> | |
14775 <th scope="col">extension</th> | |
14776 <th scope="col">hid</th> | |
14777 </tr> | |
14778 </thead> | |
14779 <tr class=""> | |
14780 <th scope="row">dataMatrix_in</th> | |
14781 <td>9a0ce47bd1734ae7</td> | |
14782 <td>peaklist_fragments.tsv</td> | |
14783 <td>tabular</td> | |
14784 <td>42</td> | |
14785 </tr><tr class=""> | |
14786 <th scope="row">Factors</th> | |
14787 <td>FALSE</td> | |
14788 <td></td> | |
14789 <td></td> | |
14790 <td></td> | |
14791 </tr><tr class=""> | |
14792 <th scope="row">Factors</th> | |
14793 <td>FALSE</td> | |
14794 <td></td> | |
14795 <td></td> | |
14796 <td></td> | |
14797 </tr><tr class=""> | |
14798 <th scope="row">sampleMetadata_in</th> | |
14799 <td>9a0ce47bd1734ae7</td> | |
14800 <td>peaklist_fragments.tsv</td> | |
14801 <td>tabular</td> | |
14802 <td>42</td> | |
14803 </tr><tr class=""> | |
14804 <th scope="row">variableMetadata_in</th> | |
14805 <td>9a0ce47bd1734ae7</td> | |
14806 <td>peaklist_fragments.tsv</td> | |
14807 <td>tabular</td> | |
14808 <td>42</td> | |
14809 </tr> | |
14810 </table> | |
14811 </div> | |
14812 | |
14813 | |
14814 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
14815 <h2 | |
14816 class="history_metadata_extractor_h2" | |
14817 style="cursor: pointer" | |
14818 title="click to fold/unfold the table" | |
14819 > | |
14820 [DELETED] - generic_filter - 2020.01 | |
14821 </h2> | |
14822 <p class="history_metadata_extractor_status"> | |
14823 Status: Failed (1) | |
14824 </p> | |
14825 <p class="history_metadata_extractor_glitter"></p> | |
14826 <table class=" | |
14827 table | |
14828 table-bordered | |
14829 table-dark | |
14830 table-striped | |
14831 table-hover | |
14832 d-block | |
14833 overflow-auto | |
14834 history_metadata_extractor_table | |
14835 "> | |
14836 <thead> | |
14837 <tr> | |
14838 <th scope="col"></th> | |
14839 <th scope="col">value</th> | |
14840 <th scope="col">name</th> | |
14841 <th scope="col">extension</th> | |
14842 <th scope="col">hid</th> | |
14843 </tr> | |
14844 </thead> | |
14845 <tr class=""> | |
14846 <th scope="row">dataMatrix_in</th> | |
14847 <td>9a0ce47bd1734ae7</td> | |
14848 <td>peaklist_fragments.tsv</td> | |
14849 <td>tabular</td> | |
14850 <td>42</td> | |
14851 </tr><tr class=""> | |
14852 <th scope="row">Factors</th> | |
14853 <td>FALSE</td> | |
14854 <td></td> | |
14855 <td></td> | |
14856 <td></td> | |
14857 </tr><tr class=""> | |
14858 <th scope="row">Factors</th> | |
14859 <td>FALSE</td> | |
14860 <td></td> | |
14861 <td></td> | |
14862 <td></td> | |
14863 </tr><tr class=""> | |
14864 <th scope="row">sampleMetadata_in</th> | |
14865 <td>9a0ce47bd1734ae7</td> | |
14866 <td>peaklist_fragments.tsv</td> | |
14867 <td>tabular</td> | |
14868 <td>42</td> | |
14869 </tr><tr class=""> | |
14870 <th scope="row">variableMetadata_in</th> | |
14871 <td>9a0ce47bd1734ae7</td> | |
14872 <td>peaklist_fragments.tsv</td> | |
14873 <td>tabular</td> | |
14874 <td>42</td> | |
14875 </tr> | |
14876 </table> | |
14877 </div> | |
14878 | |
14879 | |
14880 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
14881 <h2 | |
14882 class="history_metadata_extractor_h2" | |
14883 style="cursor: pointer" | |
14884 title="click to fold/unfold the table" | |
14885 > | |
14886 [DELETED] - generic_filter - 2020.01 | |
14887 </h2> | |
14888 <p class="history_metadata_extractor_status"> | |
14889 Status: Failed (1) | |
14890 </p> | |
14891 <p class="history_metadata_extractor_glitter"></p> | |
14892 <table class=" | |
14893 table | |
14894 table-bordered | |
14895 table-dark | |
14896 table-striped | |
14897 table-hover | |
14898 d-block | |
14899 overflow-auto | |
14900 history_metadata_extractor_table | |
14901 "> | |
14902 <thead> | |
14903 <tr> | |
14904 <th scope="col"></th> | |
14905 <th scope="col">value</th> | |
14906 <th scope="col">name</th> | |
14907 <th scope="col">extension</th> | |
14908 <th scope="col">hid</th> | |
14909 </tr> | |
14910 </thead> | |
14911 <tr class=""> | |
14912 <th scope="row">dataMatrix_in</th> | |
14913 <td>9a0ce47bd1734ae7</td> | |
14914 <td>peaklist_fragments.tsv</td> | |
14915 <td>tabular</td> | |
14916 <td>42</td> | |
14917 </tr><tr class=""> | |
14918 <th scope="row">Factors</th> | |
14919 <td>FALSE</td> | |
14920 <td></td> | |
14921 <td></td> | |
14922 <td></td> | |
14923 </tr><tr class=""> | |
14924 <th scope="row">Factors</th> | |
14925 <td>FALSE</td> | |
14926 <td></td> | |
14927 <td></td> | |
14928 <td></td> | |
14929 </tr><tr class=""> | |
14930 <th scope="row">sampleMetadata_in</th> | |
14931 <td>9a0ce47bd1734ae7</td> | |
14932 <td>peaklist_fragments.tsv</td> | |
14933 <td>tabular</td> | |
14934 <td>42</td> | |
14935 </tr><tr class=""> | |
14936 <th scope="row">variableMetadata_in</th> | |
14937 <td>9a0ce47bd1734ae7</td> | |
14938 <td>peaklist_fragments.tsv</td> | |
14939 <td>tabular</td> | |
14940 <td>42</td> | |
14941 </tr> | |
14942 </table> | |
14943 </div> | |
14944 | |
14945 | |
14946 <div class="alert alert-danger"> | |
14947 <h2 | |
14948 class="history_metadata_extractor_h2" | |
14949 style="cursor: pointer" | |
14950 title="click to fold/unfold the table" | |
14951 > | |
14952 [602] - Add_a_column1 - 1.1.0 | |
14953 </h2> | |
14954 <p class="history_metadata_extractor_status"> | |
14955 Status: Failed (1) | |
14956 </p> | |
14957 <p class="history_metadata_extractor_glitter"></p> | |
14958 <table class=" | |
14959 table | |
14960 table-bordered | |
14961 table-dark | |
14962 table-striped | |
14963 table-hover | |
14964 d-block | |
14965 overflow-auto | |
14966 history_metadata_extractor_table | |
14967 "> | |
14968 <thead> | |
14969 <tr> | |
14970 <th scope="col"></th> | |
14971 <th scope="col">value</th> | |
14972 <th scope="col">name</th> | |
14973 <th scope="col">extension</th> | |
14974 <th scope="col">hid</th> | |
14975 </tr> | |
14976 </thead> | |
14977 <tr class=""> | |
14978 <th scope="row">cond</th> | |
14979 <td>c3-c2</td> | |
14980 <td></td> | |
14981 <td></td> | |
14982 <td></td> | |
14983 </tr><tr class=""> | |
14984 <th scope="row">input</th> | |
14985 <td>9a0ce47bd1734ae7</td> | |
14986 <td>peaklist_fragments.tsv</td> | |
14987 <td>tabular</td> | |
14988 <td>42</td> | |
14989 </tr><tr class=""> | |
14990 <th scope="row">round</th> | |
14991 <td>no</td> | |
14992 <td></td> | |
14993 <td></td> | |
14994 <td></td> | |
14995 </tr> | |
14996 </table> | |
14997 </div> | |
14998 | |
14999 | |
15000 <div class="alert alert-success history_metadata_extractor_deleted"> | |
15001 <h2 | |
15002 class="history_metadata_extractor_h2" | |
15003 style="cursor: pointer" | |
15004 title="click to fold/unfold the table" | |
15005 > | |
15006 [DELETED] - Cut1 - 1.0.2 | |
15007 </h2> | |
15008 <p class="history_metadata_extractor_status"> | |
15009 Status: Ok (0) | |
15010 </p> | |
15011 <p class="history_metadata_extractor_glitter"></p> | |
15012 <table class=" | |
15013 table | |
15014 table-bordered | |
15015 table-dark | |
15016 table-striped | |
15017 table-hover | |
15018 d-block | |
15019 overflow-auto | |
15020 history_metadata_extractor_table | |
15021 "> | |
15022 <thead> | |
15023 <tr> | |
15024 <th scope="col"></th> | |
15025 <th scope="col">value</th> | |
15026 <th scope="col">name</th> | |
15027 <th scope="col">extension</th> | |
15028 <th scope="col">hid</th> | |
15029 </tr> | |
15030 </thead> | |
15031 <tr class=""> | |
15032 <th scope="row">columnList</th> | |
15033 <td>c1,c2</td> | |
15034 <td></td> | |
15035 <td></td> | |
15036 <td></td> | |
15037 </tr><tr class=""> | |
15038 <th scope="row">delimiter</th> | |
15039 <td>T</td> | |
15040 <td></td> | |
15041 <td></td> | |
15042 <td></td> | |
15043 </tr><tr class=""> | |
15044 <th scope="row">input</th> | |
15045 <td>9a0ce47bd1734ae7</td> | |
15046 <td>peaklist_fragments.tsv</td> | |
15047 <td>tabular</td> | |
15048 <td>42</td> | |
15049 </tr> | |
15050 </table> | |
15051 </div> | |
15052 | |
15053 | |
15054 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
15055 <h2 | |
15056 class="history_metadata_extractor_h2" | |
15057 style="cursor: pointer" | |
15058 title="click to fold/unfold the table" | |
15059 > | |
15060 [DELETED] - quality_metrics - 2.2.8 | |
15061 </h2> | |
15062 <p class="history_metadata_extractor_status"> | |
15063 Status: Failed (1) | |
15064 </p> | |
15065 <p class="history_metadata_extractor_glitter"></p> | |
15066 <table class=" | |
15067 table | |
15068 table-bordered | |
15069 table-dark | |
15070 table-striped | |
15071 table-hover | |
15072 d-block | |
15073 overflow-auto | |
15074 history_metadata_extractor_table | |
15075 "> | |
15076 <thead> | |
15077 <tr> | |
15078 <th scope="col"></th> | |
15079 <th scope="col">value</th> | |
15080 <th scope="col">name</th> | |
15081 <th scope="col">extension</th> | |
15082 <th scope="col">hid</th> | |
15083 </tr> | |
15084 </thead> | |
15085 <tr class=""> | |
15086 <th scope="row">CV</th> | |
15087 <td>FALSE</td> | |
15088 <td></td> | |
15089 <td></td> | |
15090 <td></td> | |
15091 </tr><tr class=""> | |
15092 <th scope="row">Compa</th> | |
15093 <td>TRUE</td> | |
15094 <td></td> | |
15095 <td></td> | |
15096 <td></td> | |
15097 </tr><tr class=""> | |
15098 <th scope="row">seuil</th> | |
15099 <td>1</td> | |
15100 <td></td> | |
15101 <td></td> | |
15102 <td></td> | |
15103 </tr><tr class=""> | |
15104 <th scope="row">optC</th> | |
15105 <td>default</td> | |
15106 <td></td> | |
15107 <td></td> | |
15108 <td></td> | |
15109 </tr><tr class=""> | |
15110 <th scope="row">poolAsPool1L</th> | |
15111 <td>TRUE</td> | |
15112 <td></td> | |
15113 <td></td> | |
15114 <td></td> | |
15115 </tr><tr class=""> | |
15116 <th scope="row">dataMatrix_in</th> | |
15117 <td>5c30ceded02186bf</td> | |
15118 <td>peaklist_fragmen.GOLM.txt</td> | |
15119 <td>tabular</td> | |
15120 <td>595</td> | |
15121 </tr><tr class=""> | |
15122 <th scope="row">sampleMetadata_in</th> | |
15123 <td>5c30ceded02186bf</td> | |
15124 <td>peaklist_fragmen.GOLM.txt</td> | |
15125 <td>tabular</td> | |
15126 <td>595</td> | |
15127 </tr><tr class=""> | |
15128 <th scope="row">variableMetadata_in</th> | |
15129 <td>5c30ceded02186bf</td> | |
15130 <td>peaklist_fragmen.GOLM.txt</td> | |
15131 <td>tabular</td> | |
15132 <td>595</td> | |
15133 </tr> | |
15134 </table> | |
15135 </div> | |
15136 | |
15137 | |
15138 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
15139 <h2 | |
15140 class="history_metadata_extractor_h2" | |
15141 style="cursor: pointer" | |
15142 title="click to fold/unfold the table" | |
15143 > | |
15144 [DELETED] - quality_metrics - 2.2.8 | |
15145 </h2> | |
15146 <p class="history_metadata_extractor_status"> | |
15147 Status: Failed (1) | |
15148 </p> | |
15149 <p class="history_metadata_extractor_glitter"></p> | |
15150 <table class=" | |
15151 table | |
15152 table-bordered | |
15153 table-dark | |
15154 table-striped | |
15155 table-hover | |
15156 d-block | |
15157 overflow-auto | |
15158 history_metadata_extractor_table | |
15159 "> | |
15160 <thead> | |
15161 <tr> | |
15162 <th scope="col"></th> | |
15163 <th scope="col">value</th> | |
15164 <th scope="col">name</th> | |
15165 <th scope="col">extension</th> | |
15166 <th scope="col">hid</th> | |
15167 </tr> | |
15168 </thead> | |
15169 <tr class=""> | |
15170 <th scope="row">CV</th> | |
15171 <td>FALSE</td> | |
15172 <td></td> | |
15173 <td></td> | |
15174 <td></td> | |
15175 </tr><tr class=""> | |
15176 <th scope="row">Compa</th> | |
15177 <td>TRUE</td> | |
15178 <td></td> | |
15179 <td></td> | |
15180 <td></td> | |
15181 </tr><tr class=""> | |
15182 <th scope="row">seuil</th> | |
15183 <td>1</td> | |
15184 <td></td> | |
15185 <td></td> | |
15186 <td></td> | |
15187 </tr><tr class=""> | |
15188 <th scope="row">optC</th> | |
15189 <td>default</td> | |
15190 <td></td> | |
15191 <td></td> | |
15192 <td></td> | |
15193 </tr><tr class=""> | |
15194 <th scope="row">poolAsPool1L</th> | |
15195 <td>TRUE</td> | |
15196 <td></td> | |
15197 <td></td> | |
15198 <td></td> | |
15199 </tr><tr class=""> | |
15200 <th scope="row">dataMatrix_in</th> | |
15201 <td>5c30ceded02186bf</td> | |
15202 <td>peaklist_fragmen.GOLM.txt</td> | |
15203 <td>tabular</td> | |
15204 <td>595</td> | |
15205 </tr><tr class=""> | |
15206 <th scope="row">sampleMetadata_in</th> | |
15207 <td>5c30ceded02186bf</td> | |
15208 <td>peaklist_fragmen.GOLM.txt</td> | |
15209 <td>tabular</td> | |
15210 <td>595</td> | |
15211 </tr><tr class=""> | |
15212 <th scope="row">variableMetadata_in</th> | |
15213 <td>5c30ceded02186bf</td> | |
15214 <td>peaklist_fragmen.GOLM.txt</td> | |
15215 <td>tabular</td> | |
15216 <td>595</td> | |
15217 </tr> | |
15218 </table> | |
15219 </div> | |
15220 | |
15221 | |
15222 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
15223 <h2 | |
15224 class="history_metadata_extractor_h2" | |
15225 style="cursor: pointer" | |
15226 title="click to fold/unfold the table" | |
15227 > | |
15228 [DELETED] - quality_metrics - 2.2.8 | |
15229 </h2> | |
15230 <p class="history_metadata_extractor_status"> | |
15231 Status: Failed (1) | |
15232 </p> | |
15233 <p class="history_metadata_extractor_glitter"></p> | |
15234 <table class=" | |
15235 table | |
15236 table-bordered | |
15237 table-dark | |
15238 table-striped | |
15239 table-hover | |
15240 d-block | |
15241 overflow-auto | |
15242 history_metadata_extractor_table | |
15243 "> | |
15244 <thead> | |
15245 <tr> | |
15246 <th scope="col"></th> | |
15247 <th scope="col">value</th> | |
15248 <th scope="col">name</th> | |
15249 <th scope="col">extension</th> | |
15250 <th scope="col">hid</th> | |
15251 </tr> | |
15252 </thead> | |
15253 <tr class=""> | |
15254 <th scope="row">CV</th> | |
15255 <td>FALSE</td> | |
15256 <td></td> | |
15257 <td></td> | |
15258 <td></td> | |
15259 </tr><tr class=""> | |
15260 <th scope="row">Compa</th> | |
15261 <td>TRUE</td> | |
15262 <td></td> | |
15263 <td></td> | |
15264 <td></td> | |
15265 </tr><tr class=""> | |
15266 <th scope="row">seuil</th> | |
15267 <td>1</td> | |
15268 <td></td> | |
15269 <td></td> | |
15270 <td></td> | |
15271 </tr><tr class=""> | |
15272 <th scope="row">optC</th> | |
15273 <td>default</td> | |
15274 <td></td> | |
15275 <td></td> | |
15276 <td></td> | |
15277 </tr><tr class=""> | |
15278 <th scope="row">poolAsPool1L</th> | |
15279 <td>TRUE</td> | |
15280 <td></td> | |
15281 <td></td> | |
15282 <td></td> | |
15283 </tr><tr class=""> | |
15284 <th scope="row">dataMatrix_in</th> | |
15285 <td>5c30ceded02186bf</td> | |
15286 <td>peaklist_fragmen.GOLM.txt</td> | |
15287 <td>tabular</td> | |
15288 <td>595</td> | |
15289 </tr><tr class=""> | |
15290 <th scope="row">sampleMetadata_in</th> | |
15291 <td>5c30ceded02186bf</td> | |
15292 <td>peaklist_fragmen.GOLM.txt</td> | |
15293 <td>tabular</td> | |
15294 <td>595</td> | |
15295 </tr><tr class=""> | |
15296 <th scope="row">variableMetadata_in</th> | |
15297 <td>5c30ceded02186bf</td> | |
15298 <td>peaklist_fragmen.GOLM.txt</td> | |
15299 <td>tabular</td> | |
15300 <td>595</td> | |
15301 </tr> | |
15302 </table> | |
15303 </div> | |
15304 | |
15305 | |
15306 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
15307 <h2 | |
15308 class="history_metadata_extractor_h2" | |
15309 style="cursor: pointer" | |
15310 title="click to fold/unfold the table" | |
15311 > | |
15312 [DELETED] - quality_metrics - 2.2.8 | |
15313 </h2> | |
15314 <p class="history_metadata_extractor_status"> | |
15315 Status: Failed (1) | |
15316 </p> | |
15317 <p class="history_metadata_extractor_glitter"></p> | |
15318 <table class=" | |
15319 table | |
15320 table-bordered | |
15321 table-dark | |
15322 table-striped | |
15323 table-hover | |
15324 d-block | |
15325 overflow-auto | |
15326 history_metadata_extractor_table | |
15327 "> | |
15328 <thead> | |
15329 <tr> | |
15330 <th scope="col"></th> | |
15331 <th scope="col">value</th> | |
15332 <th scope="col">name</th> | |
15333 <th scope="col">extension</th> | |
15334 <th scope="col">hid</th> | |
15335 </tr> | |
15336 </thead> | |
15337 <tr class=""> | |
15338 <th scope="row">CV</th> | |
15339 <td>FALSE</td> | |
15340 <td></td> | |
15341 <td></td> | |
15342 <td></td> | |
15343 </tr><tr class=""> | |
15344 <th scope="row">Compa</th> | |
15345 <td>TRUE</td> | |
15346 <td></td> | |
15347 <td></td> | |
15348 <td></td> | |
15349 </tr><tr class=""> | |
15350 <th scope="row">seuil</th> | |
15351 <td>1</td> | |
15352 <td></td> | |
15353 <td></td> | |
15354 <td></td> | |
15355 </tr><tr class=""> | |
15356 <th scope="row">optC</th> | |
15357 <td>default</td> | |
15358 <td></td> | |
15359 <td></td> | |
15360 <td></td> | |
15361 </tr><tr class=""> | |
15362 <th scope="row">poolAsPool1L</th> | |
15363 <td>TRUE</td> | |
15364 <td></td> | |
15365 <td></td> | |
15366 <td></td> | |
15367 </tr><tr class=""> | |
15368 <th scope="row">dataMatrix_in</th> | |
15369 <td>5c30ceded02186bf</td> | |
15370 <td>peaklist_fragmen.GOLM.txt</td> | |
15371 <td>tabular</td> | |
15372 <td>595</td> | |
15373 </tr><tr class=""> | |
15374 <th scope="row">sampleMetadata_in</th> | |
15375 <td>5c30ceded02186bf</td> | |
15376 <td>peaklist_fragmen.GOLM.txt</td> | |
15377 <td>tabular</td> | |
15378 <td>595</td> | |
15379 </tr><tr class=""> | |
15380 <th scope="row">variableMetadata_in</th> | |
15381 <td>5c30ceded02186bf</td> | |
15382 <td>peaklist_fragmen.GOLM.txt</td> | |
15383 <td>tabular</td> | |
15384 <td>595</td> | |
15385 </tr> | |
15386 </table> | |
15387 </div> | |
15388 | |
15389 | |
15390 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
15391 <h2 | |
15392 class="history_metadata_extractor_h2" | |
15393 style="cursor: pointer" | |
15394 title="click to fold/unfold the table" | |
15395 > | |
15396 [DELETED] - quality_metrics - 2.2.8 | |
15397 </h2> | |
15398 <p class="history_metadata_extractor_status"> | |
15399 Status: Failed (1) | |
15400 </p> | |
15401 <p class="history_metadata_extractor_glitter"></p> | |
15402 <table class=" | |
15403 table | |
15404 table-bordered | |
15405 table-dark | |
15406 table-striped | |
15407 table-hover | |
15408 d-block | |
15409 overflow-auto | |
15410 history_metadata_extractor_table | |
15411 "> | |
15412 <thead> | |
15413 <tr> | |
15414 <th scope="col"></th> | |
15415 <th scope="col">value</th> | |
15416 <th scope="col">name</th> | |
15417 <th scope="col">extension</th> | |
15418 <th scope="col">hid</th> | |
15419 </tr> | |
15420 </thead> | |
15421 <tr class=""> | |
15422 <th scope="row">CV</th> | |
15423 <td>FALSE</td> | |
15424 <td></td> | |
15425 <td></td> | |
15426 <td></td> | |
15427 </tr><tr class=""> | |
15428 <th scope="row">Compa</th> | |
15429 <td>TRUE</td> | |
15430 <td></td> | |
15431 <td></td> | |
15432 <td></td> | |
15433 </tr><tr class=""> | |
15434 <th scope="row">seuil</th> | |
15435 <td>1</td> | |
15436 <td></td> | |
15437 <td></td> | |
15438 <td></td> | |
15439 </tr><tr class=""> | |
15440 <th scope="row">optC</th> | |
15441 <td>default</td> | |
15442 <td></td> | |
15443 <td></td> | |
15444 <td></td> | |
15445 </tr><tr class=""> | |
15446 <th scope="row">poolAsPool1L</th> | |
15447 <td>TRUE</td> | |
15448 <td></td> | |
15449 <td></td> | |
15450 <td></td> | |
15451 </tr><tr class=""> | |
15452 <th scope="row">dataMatrix_in</th> | |
15453 <td>9a0ce47bd1734ae7</td> | |
15454 <td>peaklist_fragments.tsv</td> | |
15455 <td>tabular</td> | |
15456 <td>42</td> | |
15457 </tr><tr class=""> | |
15458 <th scope="row">sampleMetadata_in</th> | |
15459 <td>9a0ce47bd1734ae7</td> | |
15460 <td>peaklist_fragments.tsv</td> | |
15461 <td>tabular</td> | |
15462 <td>42</td> | |
15463 </tr><tr class=""> | |
15464 <th scope="row">variableMetadata_in</th> | |
15465 <td>9a0ce47bd1734ae7</td> | |
15466 <td>peaklist_fragments.tsv</td> | |
15467 <td>tabular</td> | |
15468 <td>42</td> | |
15469 </tr> | |
15470 </table> | |
15471 </div> | |
15472 | |
15473 | |
15474 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
15475 <h2 | |
15476 class="history_metadata_extractor_h2" | |
15477 style="cursor: pointer" | |
15478 title="click to fold/unfold the table" | |
15479 > | |
15480 [DELETED] - quality_metrics - 2.2.8 | |
15481 </h2> | |
15482 <p class="history_metadata_extractor_status"> | |
15483 Status: Failed (1) | |
15484 </p> | |
15485 <p class="history_metadata_extractor_glitter"></p> | |
15486 <table class=" | |
15487 table | |
15488 table-bordered | |
15489 table-dark | |
15490 table-striped | |
15491 table-hover | |
15492 d-block | |
15493 overflow-auto | |
15494 history_metadata_extractor_table | |
15495 "> | |
15496 <thead> | |
15497 <tr> | |
15498 <th scope="col"></th> | |
15499 <th scope="col">value</th> | |
15500 <th scope="col">name</th> | |
15501 <th scope="col">extension</th> | |
15502 <th scope="col">hid</th> | |
15503 </tr> | |
15504 </thead> | |
15505 <tr class=""> | |
15506 <th scope="row">CV</th> | |
15507 <td>FALSE</td> | |
15508 <td></td> | |
15509 <td></td> | |
15510 <td></td> | |
15511 </tr><tr class=""> | |
15512 <th scope="row">Compa</th> | |
15513 <td>TRUE</td> | |
15514 <td></td> | |
15515 <td></td> | |
15516 <td></td> | |
15517 </tr><tr class=""> | |
15518 <th scope="row">seuil</th> | |
15519 <td>1</td> | |
15520 <td></td> | |
15521 <td></td> | |
15522 <td></td> | |
15523 </tr><tr class=""> | |
15524 <th scope="row">optC</th> | |
15525 <td>default</td> | |
15526 <td></td> | |
15527 <td></td> | |
15528 <td></td> | |
15529 </tr><tr class=""> | |
15530 <th scope="row">poolAsPool1L</th> | |
15531 <td>TRUE</td> | |
15532 <td></td> | |
15533 <td></td> | |
15534 <td></td> | |
15535 </tr><tr class=""> | |
15536 <th scope="row">dataMatrix_in</th> | |
15537 <td>9a0ce47bd1734ae7</td> | |
15538 <td>peaklist_fragments.tsv</td> | |
15539 <td>tabular</td> | |
15540 <td>42</td> | |
15541 </tr><tr class=""> | |
15542 <th scope="row">sampleMetadata_in</th> | |
15543 <td>9a0ce47bd1734ae7</td> | |
15544 <td>peaklist_fragments.tsv</td> | |
15545 <td>tabular</td> | |
15546 <td>42</td> | |
15547 </tr><tr class=""> | |
15548 <th scope="row">variableMetadata_in</th> | |
15549 <td>9a0ce47bd1734ae7</td> | |
15550 <td>peaklist_fragments.tsv</td> | |
15551 <td>tabular</td> | |
15552 <td>42</td> | |
15553 </tr> | |
15554 </table> | |
15555 </div> | |
15556 | |
15557 | |
15558 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
15559 <h2 | |
15560 class="history_metadata_extractor_h2" | |
15561 style="cursor: pointer" | |
15562 title="click to fold/unfold the table" | |
15563 > | |
15564 [DELETED] - quality_metrics - 2.2.8 | |
15565 </h2> | |
15566 <p class="history_metadata_extractor_status"> | |
15567 Status: Failed (1) | |
15568 </p> | |
15569 <p class="history_metadata_extractor_glitter"></p> | |
15570 <table class=" | |
15571 table | |
15572 table-bordered | |
15573 table-dark | |
15574 table-striped | |
15575 table-hover | |
15576 d-block | |
15577 overflow-auto | |
15578 history_metadata_extractor_table | |
15579 "> | |
15580 <thead> | |
15581 <tr> | |
15582 <th scope="col"></th> | |
15583 <th scope="col">value</th> | |
15584 <th scope="col">name</th> | |
15585 <th scope="col">extension</th> | |
15586 <th scope="col">hid</th> | |
15587 </tr> | |
15588 </thead> | |
15589 <tr class=""> | |
15590 <th scope="row">CV</th> | |
15591 <td>FALSE</td> | |
15592 <td></td> | |
15593 <td></td> | |
15594 <td></td> | |
15595 </tr><tr class=""> | |
15596 <th scope="row">Compa</th> | |
15597 <td>TRUE</td> | |
15598 <td></td> | |
15599 <td></td> | |
15600 <td></td> | |
15601 </tr><tr class=""> | |
15602 <th scope="row">seuil</th> | |
15603 <td>1</td> | |
15604 <td></td> | |
15605 <td></td> | |
15606 <td></td> | |
15607 </tr><tr class=""> | |
15608 <th scope="row">optC</th> | |
15609 <td>default</td> | |
15610 <td></td> | |
15611 <td></td> | |
15612 <td></td> | |
15613 </tr><tr class=""> | |
15614 <th scope="row">poolAsPool1L</th> | |
15615 <td>TRUE</td> | |
15616 <td></td> | |
15617 <td></td> | |
15618 <td></td> | |
15619 </tr><tr class=""> | |
15620 <th scope="row">dataMatrix_in</th> | |
15621 <td>9a0ce47bd1734ae7</td> | |
15622 <td>peaklist_fragments.tsv</td> | |
15623 <td>tabular</td> | |
15624 <td>42</td> | |
15625 </tr><tr class=""> | |
15626 <th scope="row">sampleMetadata_in</th> | |
15627 <td>9a0ce47bd1734ae7</td> | |
15628 <td>peaklist_fragments.tsv</td> | |
15629 <td>tabular</td> | |
15630 <td>42</td> | |
15631 </tr><tr class=""> | |
15632 <th scope="row">variableMetadata_in</th> | |
15633 <td>9a0ce47bd1734ae7</td> | |
15634 <td>peaklist_fragments.tsv</td> | |
15635 <td>tabular</td> | |
15636 <td>42</td> | |
15637 </tr> | |
15638 </table> | |
15639 </div> | |
15640 | |
15641 | |
15642 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
15643 <h2 | |
15644 class="history_metadata_extractor_h2" | |
15645 style="cursor: pointer" | |
15646 title="click to fold/unfold the table" | |
15647 > | |
15648 [DELETED] - quality_metrics - 2.2.8 | |
15649 </h2> | |
15650 <p class="history_metadata_extractor_status"> | |
15651 Status: Failed (1) | |
15652 </p> | |
15653 <p class="history_metadata_extractor_glitter"></p> | |
15654 <table class=" | |
15655 table | |
15656 table-bordered | |
15657 table-dark | |
15658 table-striped | |
15659 table-hover | |
15660 d-block | |
15661 overflow-auto | |
15662 history_metadata_extractor_table | |
15663 "> | |
15664 <thead> | |
15665 <tr> | |
15666 <th scope="col"></th> | |
15667 <th scope="col">value</th> | |
15668 <th scope="col">name</th> | |
15669 <th scope="col">extension</th> | |
15670 <th scope="col">hid</th> | |
15671 </tr> | |
15672 </thead> | |
15673 <tr class=""> | |
15674 <th scope="row">CV</th> | |
15675 <td>FALSE</td> | |
15676 <td></td> | |
15677 <td></td> | |
15678 <td></td> | |
15679 </tr><tr class=""> | |
15680 <th scope="row">Compa</th> | |
15681 <td>TRUE</td> | |
15682 <td></td> | |
15683 <td></td> | |
15684 <td></td> | |
15685 </tr><tr class=""> | |
15686 <th scope="row">seuil</th> | |
15687 <td>1</td> | |
15688 <td></td> | |
15689 <td></td> | |
15690 <td></td> | |
15691 </tr><tr class=""> | |
15692 <th scope="row">optC</th> | |
15693 <td>default</td> | |
15694 <td></td> | |
15695 <td></td> | |
15696 <td></td> | |
15697 </tr><tr class=""> | |
15698 <th scope="row">poolAsPool1L</th> | |
15699 <td>TRUE</td> | |
15700 <td></td> | |
15701 <td></td> | |
15702 <td></td> | |
15703 </tr><tr class=""> | |
15704 <th scope="row">dataMatrix_in</th> | |
15705 <td>9a0ce47bd1734ae7</td> | |
15706 <td>peaklist_fragments.tsv</td> | |
15707 <td>tabular</td> | |
15708 <td>42</td> | |
15709 </tr><tr class=""> | |
15710 <th scope="row">sampleMetadata_in</th> | |
15711 <td>9a0ce47bd1734ae7</td> | |
15712 <td>peaklist_fragments.tsv</td> | |
15713 <td>tabular</td> | |
15714 <td>42</td> | |
15715 </tr><tr class=""> | |
15716 <th scope="row">variableMetadata_in</th> | |
15717 <td>9a0ce47bd1734ae7</td> | |
15718 <td>peaklist_fragments.tsv</td> | |
15719 <td>tabular</td> | |
15720 <td>42</td> | |
15721 </tr> | |
15722 </table> | |
15723 </div> | |
15724 | |
15725 <footer class="d-block py-3"> | |
15726 <div class="container text-center"> | |
15727 <p> | |
15728 Made with | |
15729 <span id="glitter-generator" title="click for glitter and kawaii >‿<"> | |
15730 ❤️ | |
15731 </span> | |
15732 by Lain (mail: lain pavot inrae fr) - feel free to contact me for improvement requests | |
15733 </p> | |
15734 </div> | |
15735 </footer> | |
15736 </div> | |
15737 <script> | |
15738 | |
15739 var content = document.getElementById("history_metadata_extractor_content") ; | |
15740 document.getElementById("history_metadata_extractor_top").onclick = () => { | |
15741 content.scrollTo(0, 0) ; | |
15742 } ; | |
15743 document.getElementById("history_metadata_extractor_bottom").onclick = () => { | |
15744 content.scrollTo(0, content.scrollHeight) ; | |
15745 } ; | |
15746 var folded = false ; | |
15747 document.getElementById("history_metadata_extractor_folder").onclick = (e) => { | |
15748 if (folded) { | |
15749 var func = (item) => item.classList.remove("d-none") ; | |
15750 } else { | |
15751 var func = (item) => item.classList.add("d-none") ; | |
15752 } | |
15753 Array.prototype.forEach.call(document.getElementsByClassName("history_metadata_extractor_table"), func) ; | |
15754 folded = ! folded ; | |
15755 } ; | |
15756 | |
15757 var kawaii = false ; | |
15758 document.getElementById("glitter-generator").onclick = (e) => { | |
15759 if (kawaii) { | |
15760 var func = (item) => item.classList.remove("kawaii") ; | |
15761 } else { | |
15762 var func = (item) => item.classList.add("kawaii") ; | |
15763 } | |
15764 Array.prototype.forEach.call(document.querySelectorAll("[class^=history_metadata_extractor_]"), func) ; | |
15765 kawaii = ! kawaii ; | |
15766 } ; | |
15767 | |
15768 var show_deleted = true ; | |
15769 document.getElementById("history_metadata_extractor_toggle_deleted").onclick = (e) => { | |
15770 show_deleted = !show_deleted ; | |
15771 if (show_deleted) { | |
15772 var func = (item) => item.classList.remove("d-none") ; | |
15773 } else { | |
15774 var func = (item) => item.classList.add("d-none") ; | |
15775 } | |
15776 Array.prototype.forEach.call( | |
15777 document.getElementsByClassName("history_metadata_extractor_deleted"), | |
15778 func | |
15779 ) ; | |
15780 } ; | |
15781 | |
15782 Array.prototype.forEach.call(document.getElementsByClassName( | |
15783 "history_metadata_extractor_h2"), | |
15784 (h2) => { | |
15785 var table = h2.nextElementSibling.nextElementSibling.nextElementSibling ; | |
15786 h2.onclick = (e) => { | |
15787 if (table.classList.contains("d-none")) { | |
15788 table.classList.remove("d-none") ; | |
15789 } else { | |
15790 table.classList.add("d-none") ; | |
15791 } | |
15792 } | |
15793 } | |
15794 ) | |
15795 | |
15796 </script> | |
15797 </body> | |
15798 </html> |