Mercurial > repos > metexplore > met4j
comparison tools/reconstruction/CreateMetaNetwork/test-data/Human-GEM_pathways.xml @ 9:0976a6257300 draft
planemo upload for repository https://forgemia.inra.fr/metexplore/met4j-galaxy commit 05db35f63cadb9d56dafff594a3507c59cd85273
author | metexplore |
---|---|
date | Fri, 31 Jan 2025 18:28:53 +0000 |
parents | |
children |
comparison
equal
deleted
inserted
replaced
8:1274e2a62479 | 9:0976a6257300 |
---|---|
1 <?xml version="1.0" encoding="UTF-8"?> | |
2 <sbml fbc:required="false" groups:required="false" level="3" version="2" xmlns="http://www.sbml.org/sbml/level3/version2/core" xmlns:fbc="http://www.sbml.org/sbml/level3/version1/fbc/version2" xmlns:groups="http://www.sbml.org/sbml/level3/version1/groups/version1"> | |
3 <model fbc:strict="true" id="HumanGEM" metaid="HumanGEM" name="Generic genome-scale metabolic model of Homo sapiens"> | |
4 <notes> | |
5 <body xmlns="http://www.w3.org/1999/xhtml"> | |
6 <p>Genome-scale metabolic models are valuable tools to study metabolism and provide a scaffold for the integrative analysis of omics data. This is the latest version of Human-GEM, which is a genome-scale metabolic model of a generic human cell. The objective of Human-GEM is to serve as a community model for enabling integrative and mechanistic studies of human metabolism.</p> | |
7 </body> | |
8 </notes> | |
9 <annotation> | |
10 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
11 <rdf:Description rdf:about="#HumanGEM"> | |
12 <bqbiol:is> | |
13 <rdf:Bag> | |
14 <rdf:li rdf:resource="https://identifiers.org/taxonomy/9606"/> | |
15 </rdf:Bag> | |
16 </bqbiol:is> | |
17 </rdf:Description> | |
18 </rdf:RDF> | |
19 </annotation> | |
20 <fbc:listOfObjectives fbc:activeObjective="obj"> | |
21 <fbc:objective fbc:id="obj" fbc:type="maximize"> | |
22 <fbc:listOfFluxObjectives> | |
23 <fbc:fluxObjective fbc:coefficient="1" fbc:reaction="R_biomass_human"/> | |
24 </fbc:listOfFluxObjectives> | |
25 </fbc:objective> | |
26 </fbc:listOfObjectives> | |
27 <fbc:listOfGeneProducts> | |
28 <fbc:geneProduct fbc:id="ENSG00000023697" fbc:label="ENSG00000023697" fbc:name="ENSG00000023697" metaid="_12915ddf-e017-4a38-a80d-e9982f8ac7cc"> | |
29 <notes> | |
30 <body xmlns="http://www.w3.org/1999/xhtml"> | |
31 <p>ensembl: ENSG00000023697</p> | |
32 <p>hgnc.symbol: DERA</p> | |
33 <p>ncbigene: 51071</p> | |
34 <p>uniprot: Q9Y315</p> | |
35 </body> | |
36 </notes> | |
37 </fbc:geneProduct> | |
38 <fbc:geneProduct fbc:id="ENSG00000130313" fbc:label="ENSG00000130313" fbc:name="ENSG00000130313" metaid="b7f31dab-0da6-4c9e-9c76-6ea1952d4f6b"> | |
39 <notes> | |
40 <body xmlns="http://www.w3.org/1999/xhtml"> | |
41 <p>ensembl: ENSG00000130313</p> | |
42 <p>hgnc.symbol: PGLS</p> | |
43 <p>ncbigene: 25796</p> | |
44 <p>uniprot: O95336</p> | |
45 </body> | |
46 </notes> | |
47 </fbc:geneProduct> | |
48 <fbc:geneProduct fbc:id="ENSG00000157353" fbc:label="ENSG00000157353" fbc:name="ENSG00000157353" metaid="f2bfd1a8-b479-4718-bb3f-030aed87a562"> | |
49 <notes> | |
50 <body xmlns="http://www.w3.org/1999/xhtml"> | |
51 <p>ensembl: ENSG00000157353</p> | |
52 <p>hgnc.symbol: FCSK</p> | |
53 <p>ncbigene: 197258</p> | |
54 <p>uniprot: Q8N0W3</p> | |
55 </body> | |
56 </notes> | |
57 </fbc:geneProduct> | |
58 <fbc:geneProduct fbc:id="ENSG00000114268" fbc:label="ENSG00000114268" fbc:name="ENSG00000114268" metaid="d1ad0711-77a6-4e33-85ba-dff0e0e56b5c"> | |
59 <notes> | |
60 <body xmlns="http://www.w3.org/1999/xhtml"> | |
61 <p>ensembl: ENSG00000114268</p> | |
62 <p>hgnc.symbol: PFKFB4</p> | |
63 <p>ncbigene: 5210</p> | |
64 <p>uniprot: Q16877</p> | |
65 </body> | |
66 </notes> | |
67 </fbc:geneProduct> | |
68 <fbc:geneProduct fbc:id="ENSG00000197417" fbc:label="ENSG00000197417" fbc:name="ENSG00000197417" metaid="_36aac772-72a3-44fd-97f3-84213d36d9e2"> | |
69 <notes> | |
70 <body xmlns="http://www.w3.org/1999/xhtml"> | |
71 <p>ensembl: ENSG00000197417</p> | |
72 <p>hgnc.symbol: SHPK</p> | |
73 <p>ncbigene: 23729</p> | |
74 <p>uniprot: Q9UHJ6</p> | |
75 </body> | |
76 </notes> | |
77 </fbc:geneProduct> | |
78 <fbc:geneProduct fbc:id="ENSG00000117411" fbc:label="ENSG00000117411" fbc:name="ENSG00000117411" metaid="_8a05124a-b1a0-492d-83cd-3aac293621f3"> | |
79 <notes> | |
80 <body xmlns="http://www.w3.org/1999/xhtml"> | |
81 <p>ensembl: ENSG00000117411</p> | |
82 <p>hgnc.symbol: B4GALT2</p> | |
83 <p>ncbigene: 8704</p> | |
84 <p>uniprot: O60909</p> | |
85 </body> | |
86 </notes> | |
87 </fbc:geneProduct> | |
88 <fbc:geneProduct fbc:id="ENSG00000170525" fbc:label="ENSG00000170525" fbc:name="ENSG00000170525" metaid="_37605db9-6c99-4033-a556-016ad0da13f8"> | |
89 <notes> | |
90 <body xmlns="http://www.w3.org/1999/xhtml"> | |
91 <p>ensembl: ENSG00000170525</p> | |
92 <p>hgnc.symbol: PFKFB3</p> | |
93 <p>ncbigene: 5209</p> | |
94 <p>uniprot: Q16875</p> | |
95 </body> | |
96 </notes> | |
97 </fbc:geneProduct> | |
98 <fbc:geneProduct fbc:id="ENSG00000229937" fbc:label="ENSG00000229937" fbc:name="ENSG00000229937" metaid="_58f34e8c-42a2-4a2a-8de9-714e67c5b732"> | |
99 <notes> | |
100 <body xmlns="http://www.w3.org/1999/xhtml"> | |
101 <p>ensembl: ENSG00000229937</p> | |
102 <p>hgnc.symbol: PRPS1L1</p> | |
103 <p>ncbigene: 221823</p> | |
104 </body> | |
105 </notes> | |
106 </fbc:geneProduct> | |
107 <fbc:geneProduct fbc:id="ENSG00000085662" fbc:label="ENSG00000085662" fbc:name="ENSG00000085662" metaid="fb8056b5-fb1e-42ed-b1e3-0f3530b674e2"> | |
108 <notes> | |
109 <body xmlns="http://www.w3.org/1999/xhtml"> | |
110 <p>ensembl: ENSG00000085662</p> | |
111 <p>hgnc.symbol: AKR1B1</p> | |
112 <p>ncbigene: 231</p> | |
113 <p>uniprot: P15121</p> | |
114 </body> | |
115 </notes> | |
116 </fbc:geneProduct> | |
117 <fbc:geneProduct fbc:id="ENSG00000101911" fbc:label="ENSG00000101911" fbc:name="ENSG00000101911" metaid="b98d9eef-49ad-45d4-8889-02e296604457"> | |
118 <notes> | |
119 <body xmlns="http://www.w3.org/1999/xhtml"> | |
120 <p>ensembl: ENSG00000101911</p> | |
121 <p>hgnc.symbol: PRPS2</p> | |
122 <p>ncbigene: 5634</p> | |
123 <p>uniprot: P11908</p> | |
124 </body> | |
125 </notes> | |
126 </fbc:geneProduct> | |
127 <fbc:geneProduct fbc:id="ENSG00000138030" fbc:label="ENSG00000138030" fbc:name="ENSG00000138030" metaid="a0549ed3-97c1-4eb0-9891-467f734cfd29"> | |
128 <notes> | |
129 <body xmlns="http://www.w3.org/1999/xhtml"> | |
130 <p>ensembl: ENSG00000138030</p> | |
131 <p>hgnc.symbol: KHK</p> | |
132 <p>ncbigene: 3795</p> | |
133 <p>uniprot: P50053</p> | |
134 </body> | |
135 </notes> | |
136 </fbc:geneProduct> | |
137 <fbc:geneProduct fbc:id="ENSG00000167363" fbc:label="ENSG00000167363" fbc:name="ENSG00000167363" metaid="_940a3aa4-9800-407e-a89c-3c2940a0c773"> | |
138 <notes> | |
139 <body xmlns="http://www.w3.org/1999/xhtml"> | |
140 <p>ensembl: ENSG00000167363</p> | |
141 <p>hgnc.symbol: FN3K</p> | |
142 <p>ncbigene: 64122</p> | |
143 <p>uniprot: Q9H479</p> | |
144 </body> | |
145 </notes> | |
146 </fbc:geneProduct> | |
147 <fbc:geneProduct fbc:id="ENSG00000160211" fbc:label="ENSG00000160211" fbc:name="ENSG00000160211" metaid="d7d059c0-a147-4808-a248-4b83244f07eb"> | |
148 <notes> | |
149 <body xmlns="http://www.w3.org/1999/xhtml"> | |
150 <p>ensembl: ENSG00000160211</p> | |
151 <p>hgnc.symbol: G6PD</p> | |
152 <p>ncbigene: 2539</p> | |
153 <p>uniprot: P11413</p> | |
154 </body> | |
155 </notes> | |
156 </fbc:geneProduct> | |
157 <fbc:geneProduct fbc:id="ENSG00000090402" fbc:label="ENSG00000090402" fbc:name="ENSG00000090402" metaid="_3ac56916-54f0-4fcd-8dc5-767cbd61ff9b"> | |
158 <notes> | |
159 <body xmlns="http://www.w3.org/1999/xhtml"> | |
160 <p>ensembl: ENSG00000090402</p> | |
161 <p>hgnc.symbol: SI</p> | |
162 <p>ncbigene: 6476</p> | |
163 <p>uniprot: P14410</p> | |
164 </body> | |
165 </notes> | |
166 </fbc:geneProduct> | |
167 <fbc:geneProduct fbc:id="ENSG00000163521" fbc:label="ENSG00000163521" fbc:name="ENSG00000163521" metaid="cb001f39-7403-47ab-a7f6-94ccbf288b16"> | |
168 <notes> | |
169 <body xmlns="http://www.w3.org/1999/xhtml"> | |
170 <p>ensembl: ENSG00000163521</p> | |
171 <p>hgnc.symbol: GLB1L</p> | |
172 <p>ncbigene: 79411</p> | |
173 <p>uniprot: Q6UWU2</p> | |
174 </body> | |
175 </notes> | |
176 </fbc:geneProduct> | |
177 <fbc:geneProduct fbc:id="ENSG00000235376" fbc:label="ENSG00000235376" fbc:name="ENSG00000235376" metaid="fc35bd7a-90b3-4ede-927f-fd37279642dd"> | |
178 <notes> | |
179 <body xmlns="http://www.w3.org/1999/xhtml"> | |
180 <p>ensembl: ENSG00000235376</p> | |
181 <p>hgnc.symbol: RPEL1</p> | |
182 <p>ncbigene: 729020</p> | |
183 <p>uniprot: Q2QD12</p> | |
184 </body> | |
185 </notes> | |
186 </fbc:geneProduct> | |
187 <fbc:geneProduct fbc:id="ENSG00000049239" fbc:label="ENSG00000049239" fbc:name="ENSG00000049239" metaid="_32ef79cb-7c0c-4511-b69b-34ab8e054773"> | |
188 <notes> | |
189 <body xmlns="http://www.w3.org/1999/xhtml"> | |
190 <p>ensembl: ENSG00000049239</p> | |
191 <p>hgnc.symbol: H6PD</p> | |
192 <p>ncbigene: 9563</p> | |
193 <p>uniprot: O95479</p> | |
194 </body> | |
195 </notes> | |
196 </fbc:geneProduct> | |
197 <fbc:geneProduct fbc:id="ENSG00000102393" fbc:label="ENSG00000102393" fbc:name="ENSG00000102393" metaid="_5fc82091-e274-44d1-9963-ee5037073028"> | |
198 <notes> | |
199 <body xmlns="http://www.w3.org/1999/xhtml"> | |
200 <p>ensembl: ENSG00000102393</p> | |
201 <p>hgnc.symbol: GLA</p> | |
202 <p>ncbigene: 2717</p> | |
203 <p>uniprot: P06280</p> | |
204 </body> | |
205 </notes> | |
206 </fbc:geneProduct> | |
207 <fbc:geneProduct fbc:id="ENSG00000109107" fbc:label="ENSG00000109107" fbc:name="ENSG00000109107" metaid="f8bf3621-aa7c-4b44-851a-391c43c7cbb2"> | |
208 <notes> | |
209 <body xmlns="http://www.w3.org/1999/xhtml"> | |
210 <p>ensembl: ENSG00000109107</p> | |
211 <p>hgnc.symbol: ALDOC</p> | |
212 <p>ncbigene: 230</p> | |
213 <p>uniprot: P09972</p> | |
214 </body> | |
215 </notes> | |
216 </fbc:geneProduct> | |
217 <fbc:geneProduct fbc:id="ENSG00000285043" fbc:label="ENSG00000285043" fbc:name="ENSG00000285043" metaid="c11eee35-7869-49f9-9544-50a998907f37"> | |
218 <notes> | |
219 <body xmlns="http://www.w3.org/1999/xhtml"> | |
220 <p>ensembl: ENSG00000285043</p> | |
221 <p>hgnc.symbol: AC093512.2</p> | |
222 <p>ncbigene: 112694756</p> | |
223 </body> | |
224 </notes> | |
225 </fbc:geneProduct> | |
226 <fbc:geneProduct fbc:id="ENSG00000132746" fbc:label="ENSG00000132746" fbc:name="ENSG00000132746" metaid="_471be81a-0170-4a4f-af8d-346cd6ae65e4"> | |
227 <notes> | |
228 <body xmlns="http://www.w3.org/1999/xhtml"> | |
229 <p>ensembl: ENSG00000132746</p> | |
230 <p>hgnc.symbol: ALDH3B2</p> | |
231 <p>ncbigene: 222</p> | |
232 <p>uniprot: P48448</p> | |
233 </body> | |
234 </notes> | |
235 </fbc:geneProduct> | |
236 <fbc:geneProduct fbc:id="ENSG00000141959" fbc:label="ENSG00000141959" fbc:name="ENSG00000141959" metaid="_9b6348d8-9868-49a9-8ea5-b19d1936b26e"> | |
237 <notes> | |
238 <body xmlns="http://www.w3.org/1999/xhtml"> | |
239 <p>ensembl: ENSG00000141959</p> | |
240 <p>hgnc.symbol: PFKL</p> | |
241 <p>ncbigene: 5211</p> | |
242 <p>uniprot: P17858</p> | |
243 </body> | |
244 </notes> | |
245 </fbc:geneProduct> | |
246 <fbc:geneProduct fbc:id="ENSG00000108813" fbc:label="ENSG00000108813" fbc:name="ENSG00000108813" metaid="_7a5c0fbb-1847-4113-bb3b-28088fca4338"> | |
247 <notes> | |
248 <body xmlns="http://www.w3.org/1999/xhtml"> | |
249 <p>ensembl: ENSG00000108813</p> | |
250 <p>hgnc.symbol: DLX4</p> | |
251 <p>ncbigene: 1748</p> | |
252 <p>uniprot: Q92988</p> | |
253 </body> | |
254 </notes> | |
255 </fbc:geneProduct> | |
256 <fbc:geneProduct fbc:id="ENSG00000144591" fbc:label="ENSG00000144591" fbc:name="ENSG00000144591" metaid="_51230f4a-d1e5-4390-9313-7228d09b99fe"> | |
257 <notes> | |
258 <body xmlns="http://www.w3.org/1999/xhtml"> | |
259 <p>ensembl: ENSG00000144591</p> | |
260 <p>hgnc.symbol: GMPPA</p> | |
261 <p>ncbigene: 29926</p> | |
262 <p>uniprot: Q96IJ6</p> | |
263 </body> | |
264 </notes> | |
265 </fbc:geneProduct> | |
266 <fbc:geneProduct fbc:id="ENSG00000213930" fbc:label="ENSG00000213930" fbc:name="ENSG00000213930" metaid="_74d4cb52-23dc-49d0-adc2-7526f07863ab"> | |
267 <notes> | |
268 <body xmlns="http://www.w3.org/1999/xhtml"> | |
269 <p>ensembl: ENSG00000213930</p> | |
270 <p>hgnc.symbol: GALT</p> | |
271 <p>ncbigene: 2592</p> | |
272 <p>uniprot: P07902</p> | |
273 </body> | |
274 </notes> | |
275 </fbc:geneProduct> | |
276 <fbc:geneProduct fbc:id="ENSG00000170266" fbc:label="ENSG00000170266" fbc:name="ENSG00000170266" metaid="e1de023f-00b6-4b3e-9be0-e9ae93a2c334"> | |
277 <notes> | |
278 <body xmlns="http://www.w3.org/1999/xhtml"> | |
279 <p>ensembl: ENSG00000170266</p> | |
280 <p>hgnc.symbol: GLB1</p> | |
281 <p>ncbigene: 2720</p> | |
282 <p>uniprot: P16278</p> | |
283 </body> | |
284 </notes> | |
285 </fbc:geneProduct> | |
286 <fbc:geneProduct fbc:id="ENSG00000241343" fbc:label="ENSG00000241343" fbc:name="ENSG00000241343" metaid="_25cf8431-007a-45f6-b496-f624fde5f63b"> | |
287 <notes> | |
288 <body xmlns="http://www.w3.org/1999/xhtml"> | |
289 <p>ensembl: ENSG00000241343</p> | |
290 <p>hgnc.symbol: RPL36A</p> | |
291 <p>ncbigene: 6173</p> | |
292 <p>uniprot: P83881</p> | |
293 </body> | |
294 </notes> | |
295 </fbc:geneProduct> | |
296 <fbc:geneProduct fbc:id="ENSG00000151005" fbc:label="ENSG00000151005" fbc:name="ENSG00000151005" metaid="_46587b13-0f5e-4416-b277-0a03f5b571eb"> | |
297 <notes> | |
298 <body xmlns="http://www.w3.org/1999/xhtml"> | |
299 <p>ensembl: ENSG00000151005</p> | |
300 <p>hgnc.symbol: TKTL2</p> | |
301 <p>ncbigene: 84076</p> | |
302 <p>uniprot: Q9H0I9</p> | |
303 </body> | |
304 </notes> | |
305 </fbc:geneProduct> | |
306 <fbc:geneProduct fbc:id="ENSG00000123836" fbc:label="ENSG00000123836" fbc:name="ENSG00000123836" metaid="d5c747e3-5a3b-4577-ac04-56469d75e91c"> | |
307 <notes> | |
308 <body xmlns="http://www.w3.org/1999/xhtml"> | |
309 <p>ensembl: ENSG00000123836</p> | |
310 <p>hgnc.symbol: PFKFB2</p> | |
311 <p>ncbigene: 5208</p> | |
312 <p>uniprot: O60825</p> | |
313 </body> | |
314 </notes> | |
315 </fbc:geneProduct> | |
316 <fbc:geneProduct fbc:id="ENSG00000116199" fbc:label="ENSG00000116199" fbc:name="ENSG00000116199" metaid="_76a43217-c502-4f65-9a11-d073910cfd5c"> | |
317 <notes> | |
318 <body xmlns="http://www.w3.org/1999/xhtml"> | |
319 <p>ensembl: ENSG00000116199</p> | |
320 <p>hgnc.symbol: FAM20B</p> | |
321 <p>ncbigene: 9917</p> | |
322 <p>uniprot: O75063</p> | |
323 </body> | |
324 </notes> | |
325 </fbc:geneProduct> | |
326 <fbc:geneProduct fbc:id="ENSG00000164068" fbc:label="ENSG00000164068" fbc:name="ENSG00000164068" metaid="e4d5b9d5-59c0-4c44-9088-ad7a6080049f"> | |
327 <notes> | |
328 <body xmlns="http://www.w3.org/1999/xhtml"> | |
329 <p>ensembl: ENSG00000164068</p> | |
330 <p>hgnc.symbol: RNF123</p> | |
331 <p>ncbigene: 63891</p> | |
332 <p>uniprot: Q5XPI4</p> | |
333 </body> | |
334 </notes> | |
335 </fbc:geneProduct> | |
336 <fbc:geneProduct fbc:id="ENSG00000100417" fbc:label="ENSG00000100417" fbc:name="ENSG00000100417" metaid="_26c82f2c-e9c8-4d20-9e49-8640aff44e96"> | |
337 <notes> | |
338 <body xmlns="http://www.w3.org/1999/xhtml"> | |
339 <p>ensembl: ENSG00000100417</p> | |
340 <p>hgnc.symbol: PMM1</p> | |
341 <p>ncbigene: 5372</p> | |
342 <p>uniprot: Q92871</p> | |
343 </body> | |
344 </notes> | |
345 </fbc:geneProduct> | |
346 <fbc:geneProduct fbc:id="ENSG00000167531" fbc:label="ENSG00000167531" fbc:name="ENSG00000167531" metaid="_6173500e-92e9-4814-b379-bea6c79b96d6"> | |
347 <notes> | |
348 <body xmlns="http://www.w3.org/1999/xhtml"> | |
349 <p>ensembl: ENSG00000167531</p> | |
350 <p>hgnc.symbol: LALBA</p> | |
351 <p>ncbigene: 3906</p> | |
352 <p>uniprot: P00709</p> | |
353 </body> | |
354 </notes> | |
355 </fbc:geneProduct> | |
356 <fbc:geneProduct fbc:id="ENSG00000149925" fbc:label="ENSG00000149925" fbc:name="ENSG00000149925" metaid="_844a3d97-d13a-4529-a1be-baa8040739b6"> | |
357 <notes> | |
358 <body xmlns="http://www.w3.org/1999/xhtml"> | |
359 <p>ensembl: ENSG00000149925</p> | |
360 <p>hgnc.symbol: ALDOA</p> | |
361 <p>ncbigene: 226</p> | |
362 <p>uniprot: P04075</p> | |
363 </body> | |
364 </notes> | |
365 </fbc:geneProduct> | |
366 <fbc:geneProduct fbc:id="ENSG00000141560" fbc:label="ENSG00000141560" fbc:name="ENSG00000141560" metaid="_5a622d9f-6dee-420e-bb39-e7c40ca653b2"> | |
367 <notes> | |
368 <body xmlns="http://www.w3.org/1999/xhtml"> | |
369 <p>ensembl: ENSG00000141560</p> | |
370 <p>hgnc.symbol: FN3KRP</p> | |
371 <p>ncbigene: 79672</p> | |
372 <p>uniprot: Q9HA64</p> | |
373 </body> | |
374 </notes> | |
375 </fbc:geneProduct> | |
376 <fbc:geneProduct fbc:id="ENSG00000100413" fbc:label="ENSG00000100413" fbc:name="ENSG00000100413" metaid="_85b3bca0-ab21-4d12-b312-d8b2b366af39"> | |
377 <notes> | |
378 <body xmlns="http://www.w3.org/1999/xhtml"> | |
379 <p>ensembl: ENSG00000100413</p> | |
380 <p>hgnc.symbol: POLR3H</p> | |
381 <p>ncbigene: 171568</p> | |
382 <p>uniprot: Q9Y535</p> | |
383 </body> | |
384 </notes> | |
385 </fbc:geneProduct> | |
386 <fbc:geneProduct fbc:id="ENSG00000007350" fbc:label="ENSG00000007350" fbc:name="ENSG00000007350" metaid="_6601c12a-ae74-4669-9b3e-db90da268d86"> | |
387 <notes> | |
388 <body xmlns="http://www.w3.org/1999/xhtml"> | |
389 <p>ensembl: ENSG00000007350</p> | |
390 <p>hgnc.symbol: TKTL1</p> | |
391 <p>ncbigene: 8277</p> | |
392 <p>uniprot: P51854</p> | |
393 </body> | |
394 </notes> | |
395 </fbc:geneProduct> | |
396 <fbc:geneProduct fbc:id="ENSG00000184254" fbc:label="ENSG00000184254" fbc:name="ENSG00000184254" metaid="_1bee2946-bc61-47c3-8dbf-7b84f796515d"> | |
397 <notes> | |
398 <body xmlns="http://www.w3.org/1999/xhtml"> | |
399 <p>ensembl: ENSG00000184254</p> | |
400 <p>hgnc.symbol: ALDH1A3</p> | |
401 <p>ncbigene: 220</p> | |
402 <p>uniprot: P47895</p> | |
403 </body> | |
404 </notes> | |
405 </fbc:geneProduct> | |
406 <fbc:geneProduct fbc:id="ENSG00000163931" fbc:label="ENSG00000163931" fbc:name="ENSG00000163931" metaid="dc4a1857-080d-45fc-987e-2adf5620ea3d"> | |
407 <notes> | |
408 <body xmlns="http://www.w3.org/1999/xhtml"> | |
409 <p>ensembl: ENSG00000163931</p> | |
410 <p>hgnc.symbol: TKT</p> | |
411 <p>ncbigene: 7086</p> | |
412 <p>uniprot: P29401</p> | |
413 </body> | |
414 </notes> | |
415 </fbc:geneProduct> | |
416 <fbc:geneProduct fbc:id="ENSG00000147224" fbc:label="ENSG00000147224" fbc:name="ENSG00000147224" metaid="c4d0c0db-49df-4667-a605-36cd16b32f8c"> | |
417 <notes> | |
418 <body xmlns="http://www.w3.org/1999/xhtml"> | |
419 <p>ensembl: ENSG00000147224</p> | |
420 <p>hgnc.symbol: PRPS1</p> | |
421 <p>ncbigene: 5631</p> | |
422 <p>uniprot: P60891</p> | |
423 </body> | |
424 </notes> | |
425 </fbc:geneProduct> | |
426 <fbc:geneProduct fbc:id="ENSG00000142657" fbc:label="ENSG00000142657" fbc:name="ENSG00000142657" metaid="beabaf4f-5581-48ed-b522-8dcd497f96aa"> | |
427 <notes> | |
428 <body xmlns="http://www.w3.org/1999/xhtml"> | |
429 <p>ensembl: ENSG00000142657</p> | |
430 <p>hgnc.symbol: PGD</p> | |
431 <p>ncbigene: 5226</p> | |
432 <p>uniprot: P52209</p> | |
433 </body> | |
434 </notes> | |
435 </fbc:geneProduct> | |
436 <fbc:geneProduct fbc:id="ENSG00000086062" fbc:label="ENSG00000086062" fbc:name="ENSG00000086062" metaid="_5e8317c7-1bfe-47e1-bebb-535601d5f6aa"> | |
437 <notes> | |
438 <body xmlns="http://www.w3.org/1999/xhtml"> | |
439 <p>ensembl: ENSG00000086062</p> | |
440 <p>hgnc.symbol: B4GALT1</p> | |
441 <p>ncbigene: 2683</p> | |
442 <p>uniprot: P15291</p> | |
443 </body> | |
444 </notes> | |
445 </fbc:geneProduct> | |
446 <fbc:geneProduct fbc:id="ENSG00000079739" fbc:label="ENSG00000079739" fbc:name="ENSG00000079739" metaid="_224dd45b-ce2d-4b1b-9b2e-b1c2ecbd40c9"> | |
447 <notes> | |
448 <body xmlns="http://www.w3.org/1999/xhtml"> | |
449 <p>ensembl: ENSG00000079739</p> | |
450 <p>hgnc.symbol: PGM1</p> | |
451 <p>ncbigene: 5236</p> | |
452 <p>uniprot: P36871</p> | |
453 </body> | |
454 </notes> | |
455 </fbc:geneProduct> | |
456 <fbc:geneProduct fbc:id="ENSG00000254685" fbc:label="ENSG00000254685" fbc:name="ENSG00000254685" metaid="e68446d0-1583-4e86-a77d-d8dc3ce4f50c"> | |
457 <notes> | |
458 <body xmlns="http://www.w3.org/1999/xhtml"> | |
459 <p>ensembl: ENSG00000254685</p> | |
460 <p>hgnc.symbol: FPGT</p> | |
461 <p>ncbigene: 8790</p> | |
462 <p>uniprot: O14772</p> | |
463 </body> | |
464 </notes> | |
465 </fbc:geneProduct> | |
466 <fbc:geneProduct fbc:id="ENSG00000153574" fbc:label="ENSG00000153574" fbc:name="ENSG00000153574" metaid="_3830d3c8-693c-4d4c-bb14-8c9f169e5898"> | |
467 <notes> | |
468 <body xmlns="http://www.w3.org/1999/xhtml"> | |
469 <p>ensembl: ENSG00000153574</p> | |
470 <p>hgnc.symbol: RPIA</p> | |
471 <p>ncbigene: 22934</p> | |
472 <p>uniprot: P49247</p> | |
473 </body> | |
474 </notes> | |
475 </fbc:geneProduct> | |
476 <fbc:geneProduct fbc:id="ENSG00000108602" fbc:label="ENSG00000108602" fbc:name="ENSG00000108602" metaid="a488fe33-4083-4e23-a23a-76ca737cd093"> | |
477 <notes> | |
478 <body xmlns="http://www.w3.org/1999/xhtml"> | |
479 <p>ensembl: ENSG00000108602</p> | |
480 <p>hgnc.symbol: ALDH3A1</p> | |
481 <p>ncbigene: 218</p> | |
482 <p>uniprot: P30838</p> | |
483 </body> | |
484 </notes> | |
485 </fbc:geneProduct> | |
486 <fbc:geneProduct fbc:id="ENSG00000214013" fbc:label="ENSG00000214013" fbc:name="ENSG00000214013" metaid="_2117f97e-9b80-42e9-a912-66e60108428e"> | |
487 <notes> | |
488 <body xmlns="http://www.w3.org/1999/xhtml"> | |
489 <p>ensembl: ENSG00000214013</p> | |
490 <p>hgnc.symbol: GANC</p> | |
491 <p>ncbigene: 2595</p> | |
492 <p>uniprot: Q8TET4</p> | |
493 </body> | |
494 </notes> | |
495 </fbc:geneProduct> | |
496 <fbc:geneProduct fbc:id="ENSG00000104522" fbc:label="ENSG00000104522" fbc:name="ENSG00000104522" metaid="bc4e7c8d-cd54-48a1-b42c-0ebd38d1753c"> | |
497 <notes> | |
498 <body xmlns="http://www.w3.org/1999/xhtml"> | |
499 <p>ensembl: ENSG00000104522</p> | |
500 <p>hgnc.symbol: TSTA3</p> | |
501 <p>ncbigene: 7264</p> | |
502 <p>uniprot: Q13630</p> | |
503 </body> | |
504 </notes> | |
505 </fbc:geneProduct> | |
506 <fbc:geneProduct fbc:id="ENSG00000067057" fbc:label="ENSG00000067057" fbc:name="ENSG00000067057" metaid="d6009707-416e-44ba-af3c-bf5d42e5b2ae"> | |
507 <notes> | |
508 <body xmlns="http://www.w3.org/1999/xhtml"> | |
509 <p>ensembl: ENSG00000067057</p> | |
510 <p>hgnc.symbol: PFKP</p> | |
511 <p>ncbigene: 5214</p> | |
512 <p>uniprot: Q01813</p> | |
513 </body> | |
514 </notes> | |
515 </fbc:geneProduct> | |
516 <fbc:geneProduct fbc:id="ENSG00000173540" fbc:label="ENSG00000173540" fbc:name="ENSG00000173540" metaid="_35aa5df1-9cdd-4670-9b8e-1070b94d1a97"> | |
517 <notes> | |
518 <body xmlns="http://www.w3.org/1999/xhtml"> | |
519 <p>ensembl: ENSG00000173540</p> | |
520 <p>hgnc.symbol: GMPPB</p> | |
521 <p>ncbigene: 29925</p> | |
522 <p>uniprot: Q9Y5P6</p> | |
523 </body> | |
524 </notes> | |
525 </fbc:geneProduct> | |
526 <fbc:geneProduct fbc:id="ENSG00000162408" fbc:label="ENSG00000162408" fbc:name="ENSG00000162408" metaid="_14129ba8-0b75-4879-8b15-1391ec64be48"> | |
527 <notes> | |
528 <body xmlns="http://www.w3.org/1999/xhtml"> | |
529 <p>ensembl: ENSG00000162408</p> | |
530 <p>hgnc.symbol: NOL9</p> | |
531 <p>ncbigene: 79707</p> | |
532 <p>uniprot: Q5SY16</p> | |
533 </body> | |
534 </notes> | |
535 </fbc:geneProduct> | |
536 <fbc:geneProduct fbc:id="ENSG00000159399" fbc:label="ENSG00000159399" fbc:name="ENSG00000159399" metaid="e69bc97a-c6e6-4251-b0e8-ad2336c2a6c1"> | |
537 <notes> | |
538 <body xmlns="http://www.w3.org/1999/xhtml"> | |
539 <p>ensembl: ENSG00000159399</p> | |
540 <p>hgnc.symbol: HK2</p> | |
541 <p>ncbigene: 3099</p> | |
542 <p>uniprot: P52789</p> | |
543 </body> | |
544 </notes> | |
545 </fbc:geneProduct> | |
546 <fbc:geneProduct fbc:id="ENSG00000136872" fbc:label="ENSG00000136872" fbc:name="ENSG00000136872" metaid="_8b796b8b-662b-479f-a03d-8f584914568c"> | |
547 <notes> | |
548 <body xmlns="http://www.w3.org/1999/xhtml"> | |
549 <p>ensembl: ENSG00000136872</p> | |
550 <p>hgnc.symbol: ALDOB</p> | |
551 <p>ncbigene: 229</p> | |
552 <p>uniprot: P05062</p> | |
553 </body> | |
554 </notes> | |
555 </fbc:geneProduct> | |
556 <fbc:geneProduct fbc:id="ENSG00000197713" fbc:label="ENSG00000197713" fbc:name="ENSG00000197713" metaid="b06a020b-806e-49ce-886c-c05931b71761"> | |
557 <notes> | |
558 <body xmlns="http://www.w3.org/1999/xhtml"> | |
559 <p>ensembl: ENSG00000197713</p> | |
560 <p>hgnc.symbol: RPE</p> | |
561 <p>ncbigene: 6120</p> | |
562 <p>uniprot: Q96AT9</p> | |
563 </body> | |
564 </notes> | |
565 </fbc:geneProduct> | |
566 <fbc:geneProduct fbc:id="ENSG00000115850" fbc:label="ENSG00000115850" fbc:name="ENSG00000115850" metaid="bdf0a3e9-cde6-4941-a89c-f31093c2f23c"> | |
567 <notes> | |
568 <body xmlns="http://www.w3.org/1999/xhtml"> | |
569 <p>ensembl: ENSG00000115850</p> | |
570 <p>hgnc.symbol: LCT</p> | |
571 <p>ncbigene: 3938</p> | |
572 <p>uniprot: P09848</p> | |
573 </body> | |
574 </notes> | |
575 </fbc:geneProduct> | |
576 <fbc:geneProduct fbc:id="ENSG00000172456" fbc:label="ENSG00000172456" fbc:name="ENSG00000172456" metaid="_43cdde20-f842-41ff-9a7c-f23706c9478f"> | |
577 <notes> | |
578 <body xmlns="http://www.w3.org/1999/xhtml"> | |
579 <p>ensembl: ENSG00000172456</p> | |
580 <p>hgnc.symbol: FGGY</p> | |
581 <p>ncbigene: 55277</p> | |
582 <p>uniprot: Q96C11</p> | |
583 </body> | |
584 </notes> | |
585 </fbc:geneProduct> | |
586 <fbc:geneProduct fbc:id="ENSG00000006534" fbc:label="ENSG00000006534" fbc:name="ENSG00000006534" metaid="e9d8a15a-9726-409a-aed9-cec6b317c4e6"> | |
587 <notes> | |
588 <body xmlns="http://www.w3.org/1999/xhtml"> | |
589 <p>ensembl: ENSG00000006534</p> | |
590 <p>hgnc.symbol: ALDH3B1</p> | |
591 <p>ncbigene: 221</p> | |
592 <p>uniprot: P43353</p> | |
593 </body> | |
594 </notes> | |
595 </fbc:geneProduct> | |
596 <fbc:geneProduct fbc:id="ENSG00000116783" fbc:label="ENSG00000116783" fbc:name="ENSG00000116783" metaid="_73d80bcf-dfe5-4ec8-b501-98ebfc6d6067"> | |
597 <notes> | |
598 <body xmlns="http://www.w3.org/1999/xhtml"> | |
599 <p>ensembl: ENSG00000116783</p> | |
600 <p>hgnc.symbol: TNNI3K</p> | |
601 <p>ncbigene: 51086</p> | |
602 <p>uniprot: Q59H18</p> | |
603 </body> | |
604 </notes> | |
605 </fbc:geneProduct> | |
606 <fbc:geneProduct fbc:id="ENSG00000169764" fbc:label="ENSG00000169764" fbc:name="ENSG00000169764" metaid="_948d2e18-a12b-4208-aaa3-127cb64223c2"> | |
607 <notes> | |
608 <body xmlns="http://www.w3.org/1999/xhtml"> | |
609 <p>ensembl: ENSG00000169764</p> | |
610 <p>hgnc.symbol: UGP2</p> | |
611 <p>ncbigene: 7360</p> | |
612 <p>uniprot: Q16851</p> | |
613 </body> | |
614 </notes> | |
615 </fbc:geneProduct> | |
616 <fbc:geneProduct fbc:id="ENSG00000140263" fbc:label="ENSG00000140263" fbc:name="ENSG00000140263" metaid="a50ba3ac-966e-434e-9674-e0c5f2e25b79"> | |
617 <notes> | |
618 <body xmlns="http://www.w3.org/1999/xhtml"> | |
619 <p>ensembl: ENSG00000140263</p> | |
620 <p>hgnc.symbol: SORD</p> | |
621 <p>ncbigene: 6652</p> | |
622 <p>uniprot: Q00796</p> | |
623 </body> | |
624 </notes> | |
625 </fbc:geneProduct> | |
626 <fbc:geneProduct fbc:id="ENSG00000188167" fbc:label="ENSG00000188167" fbc:name="ENSG00000188167" metaid="_2490e5dd-19aa-47d5-a66a-9f660b0085d3"> | |
627 <notes> | |
628 <body xmlns="http://www.w3.org/1999/xhtml"> | |
629 <p>ensembl: ENSG00000188167</p> | |
630 <p>hgnc.symbol: TMPPE</p> | |
631 <p>ncbigene: 643853</p> | |
632 <p>uniprot: Q6ZT21</p> | |
633 </body> | |
634 </notes> | |
635 </fbc:geneProduct> | |
636 <fbc:geneProduct fbc:id="ENSG00000177156" fbc:label="ENSG00000177156" fbc:name="ENSG00000177156" metaid="a63ba87e-11e6-4a4e-868b-ce7846566b64"> | |
637 <notes> | |
638 <body xmlns="http://www.w3.org/1999/xhtml"> | |
639 <p>ensembl: ENSG00000177156</p> | |
640 <p>hgnc.symbol: TALDO1</p> | |
641 <p>ncbigene: 6888</p> | |
642 <p>uniprot: P37837</p> | |
643 </body> | |
644 </notes> | |
645 </fbc:geneProduct> | |
646 <fbc:geneProduct fbc:id="ENSG00000198074" fbc:label="ENSG00000198074" fbc:name="ENSG00000198074" metaid="_809d317a-4047-4e3d-b2f4-1386e3129360"> | |
647 <notes> | |
648 <body xmlns="http://www.w3.org/1999/xhtml"> | |
649 <p>ensembl: ENSG00000198074</p> | |
650 <p>hgnc.symbol: AKR1B10</p> | |
651 <p>ncbigene: 57016</p> | |
652 <p>uniprot: O60218</p> | |
653 </body> | |
654 </notes> | |
655 </fbc:geneProduct> | |
656 <fbc:geneProduct fbc:id="ENSG00000176020" fbc:label="ENSG00000176020" fbc:name="ENSG00000176020" metaid="_513bae08-bdd4-4b97-98ae-07e801676dfe"> | |
657 <notes> | |
658 <body xmlns="http://www.w3.org/1999/xhtml"> | |
659 <p>ensembl: ENSG00000176020</p> | |
660 <p>hgnc.symbol: AMIGO3</p> | |
661 <p>ncbigene: 386724</p> | |
662 <p>uniprot: Q86WK7</p> | |
663 </body> | |
664 </notes> | |
665 </fbc:geneProduct> | |
666 <fbc:geneProduct fbc:id="ENSG00000156510" fbc:label="ENSG00000156510" fbc:name="ENSG00000156510" metaid="_61c6553c-2336-4290-82a1-7d87591a8fd8"> | |
667 <notes> | |
668 <body xmlns="http://www.w3.org/1999/xhtml"> | |
669 <p>ensembl: ENSG00000156510</p> | |
670 <p>hgnc.symbol: HKDC1</p> | |
671 <p>ncbigene: 80201</p> | |
672 <p>uniprot: Q2TB90</p> | |
673 </body> | |
674 </notes> | |
675 </fbc:geneProduct> | |
676 <fbc:geneProduct fbc:id="ENSG00000108479" fbc:label="ENSG00000108479" fbc:name="ENSG00000108479" metaid="aacb39b1-6ea5-4359-97fc-d8c44b24d923"> | |
677 <notes> | |
678 <body xmlns="http://www.w3.org/1999/xhtml"> | |
679 <p>ensembl: ENSG00000108479</p> | |
680 <p>hgnc.symbol: GALK1</p> | |
681 <p>ncbigene: 2584</p> | |
682 <p>uniprot: P51570</p> | |
683 </body> | |
684 </notes> | |
685 </fbc:geneProduct> | |
686 <fbc:geneProduct fbc:id="ENSG00000171174" fbc:label="ENSG00000171174" fbc:name="ENSG00000171174" metaid="d405b7b0-3b31-4a66-97af-a85fa4a32ce6"> | |
687 <notes> | |
688 <body xmlns="http://www.w3.org/1999/xhtml"> | |
689 <p>ensembl: ENSG00000171174</p> | |
690 <p>hgnc.symbol: RBKS</p> | |
691 <p>ncbigene: 64080</p> | |
692 <p>uniprot: Q9H477</p> | |
693 </body> | |
694 </notes> | |
695 </fbc:geneProduct> | |
696 <fbc:geneProduct fbc:id="ENSG00000259030" fbc:label="ENSG00000259030" fbc:name="ENSG00000259030" metaid="df89c41c-5769-4933-a26d-75489f2009cb"> | |
697 <notes> | |
698 <body xmlns="http://www.w3.org/1999/xhtml"> | |
699 <p>ensembl: ENSG00000259030</p> | |
700 <p>hgnc.symbol: FPGT-TNNI3K</p> | |
701 <p>ncbigene: 100526835</p> | |
702 </body> | |
703 </notes> | |
704 </fbc:geneProduct> | |
705 <fbc:geneProduct fbc:id="ENSG00000078237" fbc:label="ENSG00000078237" fbc:name="ENSG00000078237" metaid="a9faff55-64a8-4038-b4b9-e85a053970f0"> | |
706 <notes> | |
707 <body xmlns="http://www.w3.org/1999/xhtml"> | |
708 <p>ensembl: ENSG00000078237</p> | |
709 <p>hgnc.symbol: TIGAR</p> | |
710 <p>ncbigene: 57103</p> | |
711 <p>uniprot: Q9NQ88</p> | |
712 </body> | |
713 </notes> | |
714 </fbc:geneProduct> | |
715 <fbc:geneProduct fbc:id="ENSG00000171298" fbc:label="ENSG00000171298" fbc:name="ENSG00000171298" metaid="_510705a7-d23b-480a-bb95-8b9bcdcd3c9b"> | |
716 <notes> | |
717 <body xmlns="http://www.w3.org/1999/xhtml"> | |
718 <p>ensembl: ENSG00000171298</p> | |
719 <p>hgnc.symbol: GAA</p> | |
720 <p>ncbigene: 2548</p> | |
721 <p>uniprot: P10253</p> | |
722 </body> | |
723 </notes> | |
724 </fbc:geneProduct> | |
725 <fbc:geneProduct fbc:id="ENSG00000117308" fbc:label="ENSG00000117308" fbc:name="ENSG00000117308" metaid="ecfe5f24-1fb3-4f45-8964-128b17595266"> | |
726 <notes> | |
727 <body xmlns="http://www.w3.org/1999/xhtml"> | |
728 <p>ensembl: ENSG00000117308</p> | |
729 <p>hgnc.symbol: GALE</p> | |
730 <p>ncbigene: 2582</p> | |
731 <p>uniprot: Q14376</p> | |
732 </body> | |
733 </notes> | |
734 </fbc:geneProduct> | |
735 <fbc:geneProduct fbc:id="ENSG00000156958" fbc:label="ENSG00000156958" fbc:name="ENSG00000156958" metaid="_0ffa4e53-a04d-43a9-86a7-7017ab4b8bb0"> | |
736 <notes> | |
737 <body xmlns="http://www.w3.org/1999/xhtml"> | |
738 <p>ensembl: ENSG00000156958</p> | |
739 <p>hgnc.symbol: GALK2</p> | |
740 <p>ncbigene: 2585</p> | |
741 <p>uniprot: Q01415</p> | |
742 </body> | |
743 </notes> | |
744 </fbc:geneProduct> | |
745 <fbc:geneProduct fbc:id="ENSG00000112699" fbc:label="ENSG00000112699" fbc:name="ENSG00000112699" metaid="_0d9ddbad-2dcb-402f-9849-c6ae59283884"> | |
746 <notes> | |
747 <body xmlns="http://www.w3.org/1999/xhtml"> | |
748 <p>ensembl: ENSG00000112699</p> | |
749 <p>hgnc.symbol: GMDS</p> | |
750 <p>ncbigene: 2762</p> | |
751 <p>uniprot: O60547</p> | |
752 </body> | |
753 </notes> | |
754 </fbc:geneProduct> | |
755 <fbc:geneProduct fbc:id="ENSG00000156515" fbc:label="ENSG00000156515" fbc:name="ENSG00000156515" metaid="_1b7eb559-32a1-41f1-89ee-9ea63fc8ebb1"> | |
756 <notes> | |
757 <body xmlns="http://www.w3.org/1999/xhtml"> | |
758 <p>ensembl: ENSG00000156515</p> | |
759 <p>hgnc.symbol: HK1</p> | |
760 <p>ncbigene: 3098</p> | |
761 <p>uniprot: P19367</p> | |
762 </body> | |
763 </notes> | |
764 </fbc:geneProduct> | |
765 <fbc:geneProduct fbc:id="ENSG00000130066" fbc:label="ENSG00000130066" fbc:name="ENSG00000130066" metaid="_21cc9685-34dc-4f6f-b332-e409179228f9"> | |
766 <notes> | |
767 <body xmlns="http://www.w3.org/1999/xhtml"> | |
768 <p>ensembl: ENSG00000130066</p> | |
769 <p>hgnc.symbol: SAT1</p> | |
770 <p>ncbigene: 6303</p> | |
771 <p>uniprot: P21673</p> | |
772 </body> | |
773 </notes> | |
774 </fbc:geneProduct> | |
775 <fbc:geneProduct fbc:id="ENSG00000152556" fbc:label="ENSG00000152556" fbc:name="ENSG00000152556" metaid="_9978139a-2d36-41b2-8a16-ae119ad9c62a"> | |
776 <notes> | |
777 <body xmlns="http://www.w3.org/1999/xhtml"> | |
778 <p>ensembl: ENSG00000152556</p> | |
779 <p>hgnc.symbol: PFKM</p> | |
780 <p>ncbigene: 5213</p> | |
781 <p>uniprot: P08237</p> | |
782 </body> | |
783 </notes> | |
784 </fbc:geneProduct> | |
785 <fbc:geneProduct fbc:id="ENSG00000178802" fbc:label="ENSG00000178802" fbc:name="ENSG00000178802" metaid="_4cd75726-c25f-4f11-b645-1f763ef8eb84"> | |
786 <notes> | |
787 <body xmlns="http://www.w3.org/1999/xhtml"> | |
788 <p>ensembl: ENSG00000178802</p> | |
789 <p>hgnc.symbol: MPI</p> | |
790 <p>ncbigene: 4351</p> | |
791 <p>uniprot: P34949</p> | |
792 </body> | |
793 </notes> | |
794 </fbc:geneProduct> | |
795 <fbc:geneProduct fbc:id="ENSG00000158019" fbc:label="ENSG00000158019" fbc:name="ENSG00000158019" metaid="_538c0091-8464-47eb-91e1-646a853db46d"> | |
796 <notes> | |
797 <body xmlns="http://www.w3.org/1999/xhtml"> | |
798 <p>ensembl: ENSG00000158019</p> | |
799 <p>hgnc.symbol: BABAM2</p> | |
800 <p>ncbigene: 9577</p> | |
801 <p>uniprot: Q9NXR7</p> | |
802 </body> | |
803 </notes> | |
804 </fbc:geneProduct> | |
805 <fbc:geneProduct fbc:id="ENSG00000140650" fbc:label="ENSG00000140650" fbc:name="ENSG00000140650" metaid="_1fe1abbd-efb3-45fd-aac2-755de9d9f7c8"> | |
806 <notes> | |
807 <body xmlns="http://www.w3.org/1999/xhtml"> | |
808 <p>ensembl: ENSG00000140650</p> | |
809 <p>hgnc.symbol: PMM2</p> | |
810 <p>ncbigene: 5373</p> | |
811 <p>uniprot: O15305</p> | |
812 </body> | |
813 </notes> | |
814 </fbc:geneProduct> | |
815 <fbc:geneProduct fbc:id="ENSG00000166262" fbc:label="ENSG00000166262" fbc:name="ENSG00000166262" metaid="cfd467d1-528c-484b-8fda-084b7869c1f4"> | |
816 <notes> | |
817 <body xmlns="http://www.w3.org/1999/xhtml"> | |
818 <p>ensembl: ENSG00000166262</p> | |
819 <p>hgnc.symbol: FAM227B</p> | |
820 <p>ncbigene: 196951</p> | |
821 <p>uniprot: Q96M60</p> | |
822 </body> | |
823 </notes> | |
824 </fbc:geneProduct> | |
825 <fbc:geneProduct fbc:id="ENSG00000169299" fbc:label="ENSG00000169299" fbc:name="ENSG00000169299" metaid="_629f4e87-2b63-44ab-beb3-af1d667022ad"> | |
826 <notes> | |
827 <body xmlns="http://www.w3.org/1999/xhtml"> | |
828 <p>ensembl: ENSG00000169299</p> | |
829 <p>hgnc.symbol: PGM2</p> | |
830 <p>ncbigene: 55276</p> | |
831 <p>uniprot: Q96G03</p> | |
832 </body> | |
833 </notes> | |
834 </fbc:geneProduct> | |
835 <fbc:geneProduct fbc:id="ENSG00000158571" fbc:label="ENSG00000158571" fbc:name="ENSG00000158571" metaid="_4c698159-e0c6-4eed-b154-53776218f614"> | |
836 <notes> | |
837 <body xmlns="http://www.w3.org/1999/xhtml"> | |
838 <p>ensembl: ENSG00000158571</p> | |
839 <p>hgnc.symbol: PFKFB1</p> | |
840 <p>ncbigene: 5207</p> | |
841 <p>uniprot: P16118</p> | |
842 </body> | |
843 </notes> | |
844 </fbc:geneProduct> | |
845 <fbc:geneProduct fbc:id="ENSG00000160883" fbc:label="ENSG00000160883" fbc:name="ENSG00000160883" metaid="a2ac8838-366b-48b0-80e3-3274be26154e"> | |
846 <notes> | |
847 <body xmlns="http://www.w3.org/1999/xhtml"> | |
848 <p>ensembl: ENSG00000160883</p> | |
849 <p>hgnc.symbol: HK3</p> | |
850 <p>ncbigene: 3101</p> | |
851 <p>uniprot: P52790</p> | |
852 </body> | |
853 </notes> | |
854 </fbc:geneProduct> | |
855 <fbc:geneProduct fbc:id="ENSG00000141504" fbc:label="ENSG00000141504" fbc:name="ENSG00000141504" metaid="_54737a26-c3ba-47f6-9e01-83c9eba83079"> | |
856 <notes> | |
857 <body xmlns="http://www.w3.org/1999/xhtml"> | |
858 <p>ensembl: ENSG00000141504</p> | |
859 <p>hgnc.symbol: SAT2</p> | |
860 <p>ncbigene: 112483</p> | |
861 <p>uniprot: Q96F10</p> | |
862 </body> | |
863 </notes> | |
864 </fbc:geneProduct> | |
865 <fbc:geneProduct fbc:id="ENSG00000257335" fbc:label="ENSG00000257335" fbc:name="ENSG00000257335" metaid="_2f618266-9c9a-4c56-a73a-97dc9c6829b2"> | |
866 <notes> | |
867 <body xmlns="http://www.w3.org/1999/xhtml"> | |
868 <p>ensembl: ENSG00000257335</p> | |
869 <p>hgnc.symbol: MGAM</p> | |
870 <p>ncbigene: 8972</p> | |
871 <p>uniprot: O43451</p> | |
872 </body> | |
873 </notes> | |
874 </fbc:geneProduct> | |
875 <fbc:geneProduct fbc:id="ENSG00000180953" fbc:label="ENSG00000180953" fbc:name="ENSG00000180953" metaid="_125ff8ee-12ec-4eef-8955-07983faac86b"> | |
876 <notes> | |
877 <body xmlns="http://www.w3.org/1999/xhtml"> | |
878 <p>ensembl: ENSG00000180953</p> | |
879 <p>hgnc.symbol: ST20</p> | |
880 <p>uniprot: Q9HBF5</p> | |
881 </body> | |
882 </notes> | |
883 </fbc:geneProduct> | |
884 </fbc:listOfGeneProducts> | |
885 <groups:listOfGroups> | |
886 <groups:group groups:id="group102" groups:kind="classification" groups:name="Pentose phosphate pathway"> | |
887 <groups:listOfMembers> | |
888 <groups:member groups:idRef="R_HMR_4710"/> | |
889 <groups:member groups:idRef="R_RPEc"/> | |
890 <groups:member groups:idRef="R_PGLc"/> | |
891 <groups:member groups:idRef="R_GLYPHEHYc"/> | |
892 <groups:member groups:idRef="R_GNDc"/> | |
893 <groups:member groups:idRef="R_ABTD1"/> | |
894 <groups:member groups:idRef="R_HMR_4565"/> | |
895 <groups:member groups:idRef="R_HMR_9799"/> | |
896 <groups:member groups:idRef="R_HMR_4841"/> | |
897 <groups:member groups:idRef="R_HMR_4501"/> | |
898 <groups:member groups:idRef="R_HMR_4567"/> | |
899 <groups:member groups:idRef="R_HMR_4304"/> | |
900 <groups:member groups:idRef="R_HMR_4568"/> | |
901 <groups:member groups:idRef="R_HMR_4623"/> | |
902 <groups:member groups:idRef="R_HMR_4404"/> | |
903 <groups:member groups:idRef="R_HMR_4306"/> | |
904 <groups:member groups:idRef="R_HMR_4625"/> | |
905 <groups:member groups:idRef="R_G6PDH2c"/> | |
906 <groups:member groups:idRef="R_HMR_8074"/> | |
907 <groups:member groups:idRef="R_HMR_4052"/> | |
908 <groups:member groups:idRef="R_HMR_4350"/> | |
909 <groups:member groups:idRef="R_HMR_8653"/> | |
910 <groups:member groups:idRef="R_HMR_4351"/> | |
911 <groups:member groups:idRef="R_HMR_4352"/> | |
912 <groups:member groups:idRef="R_HMR_4473"/> | |
913 <groups:member groups:idRef="R_HMR_4474"/> | |
914 <groups:member groups:idRef="R_HMR_9800"/> | |
915 <groups:member groups:idRef="R_HMR_4354"/> | |
916 <groups:member groups:idRef="R_HMR_4398"/> | |
917 <groups:member groups:idRef="R_HMR_4476"/> | |
918 <groups:member groups:idRef="R_HMR_4477"/> | |
919 </groups:listOfMembers> | |
920 </groups:group> | |
921 <groups:group groups:id="group66" groups:kind="classification" groups:name="Galactose metabolism"> | |
922 <groups:listOfMembers> | |
923 <groups:member groups:idRef="R_HMR_4775"/> | |
924 <groups:member groups:idRef="R_HMR_4303"/> | |
925 <groups:member groups:idRef="R_HMR_4831"/> | |
926 <groups:member groups:idRef="R_HMR_4128"/> | |
927 <groups:member groups:idRef="R_HMR_4414"/> | |
928 <groups:member groups:idRef="R_HMR_4832"/> | |
929 <groups:member groups:idRef="R_HMR_4415"/> | |
930 <groups:member groups:idRef="R_HMR_4416"/> | |
931 <groups:member groups:idRef="R_HMR_3944"/> | |
932 <groups:member groups:idRef="R_FBA5"/> | |
933 <groups:member groups:idRef="R_HMR_8762"/> | |
934 <groups:member groups:idRef="R_HMR_4130"/> | |
935 <groups:member groups:idRef="R_KHK3"/> | |
936 <groups:member groups:idRef="R_HMR_4131"/> | |
937 <groups:member groups:idRef="R_HMR_7674"/> | |
938 <groups:member groups:idRef="R_HMR_4132"/> | |
939 <groups:member groups:idRef="R_HMR_8761"/> | |
940 <groups:member groups:idRef="R_HMR_8766"/> | |
941 <groups:member groups:idRef="R_HMR_8767"/> | |
942 <groups:member groups:idRef="R_HMR_8764"/> | |
943 <groups:member groups:idRef="R_HMR_4774"/> | |
944 </groups:listOfMembers> | |
945 </groups:group> | |
946 <groups:group groups:id="group65" groups:kind="classification" groups:name="Fructose and mannose metabolism"> | |
947 <groups:listOfMembers> | |
948 <groups:member groups:idRef="R_HMR_4401"/> | |
949 <groups:member groups:idRef="R_RE1342C"/> | |
950 <groups:member groups:idRef="R_HMR_4402"/> | |
951 <groups:member groups:idRef="R_HMR_4315"/> | |
952 <groups:member groups:idRef="R_HMR_4403"/> | |
953 <groups:member groups:idRef="R_HMR_8768"/> | |
954 <groups:member groups:idRef="R_HMR_4316"/> | |
955 <groups:member groups:idRef="R_HMR_4317"/> | |
956 <groups:member groups:idRef="R_HMR_4318"/> | |
957 <groups:member groups:idRef="R_HMR_4319"/> | |
958 <groups:member groups:idRef="R_HMR_4706"/> | |
959 <groups:member groups:idRef="R_HMR_4490"/> | |
960 <groups:member groups:idRef="R_HMR_4383"/> | |
961 <groups:member groups:idRef="R_HMR_4297"/> | |
962 <groups:member groups:idRef="R_HMR_4385"/> | |
963 <groups:member groups:idRef="R_HMR_0454"/> | |
964 <groups:member groups:idRef="R_HMR_4320"/> | |
965 <groups:member groups:idRef="R_HMR_4386"/> | |
966 <groups:member groups:idRef="R_HMR_4310"/> | |
967 <groups:member groups:idRef="R_HMR_4387"/> | |
968 <groups:member groups:idRef="R_HMR_4399"/> | |
969 <groups:member groups:idRef="R_HMR_4356"/> | |
970 <groups:member groups:idRef="R_HMR_4400"/> | |
971 </groups:listOfMembers> | |
972 </groups:group> | |
973 </groups:listOfGroups> | |
974 <listOfUnitDefinitions> | |
975 <unitDefinition id="mmol_per_gDW_per_hr" name="mmol_per_gDW_per_hr"> | |
976 <listOfUnits> | |
977 <unit exponent="-1" kind="gram" multiplier="1" scale="0"/> | |
978 <unit exponent="1" kind="mole" multiplier="1" scale="-3"/> | |
979 <unit exponent="-1" kind="second" multiplier="3600" scale="0"/> | |
980 </listOfUnits> | |
981 </unitDefinition> | |
982 </listOfUnitDefinitions> | |
983 <listOfCompartments> | |
984 <compartment constant="true" id="r" metaid="_884904cc-79eb-427d-b91b-3858ebf3f596" name="Endoplasmic reticulum" sboTerm="SBO:0000290" spatialDimensions="3"/> | |
985 <compartment constant="true" id="s" metaid="c2091cbb-7712-4d49-8306-2c20463fde5c" name="Extracellular" sboTerm="SBO:0000290" spatialDimensions="3"/> | |
986 <compartment constant="true" id="c" metaid="_9e846238-9a89-4c76-93c0-2ad9f62b3f5f" name="Cytosol" sboTerm="SBO:0000290" spatialDimensions="3"/> | |
987 <compartment constant="true" id="l" metaid="_1eae95e5-962a-462b-b3af-730aa2c62bf8" name="Lysosome" sboTerm="SBO:0000290" spatialDimensions="3"/> | |
988 <compartment constant="true" id="g" metaid="a36d7b30-c3c7-46e7-91bc-11d957f9efde" name="Golgi apparatus" sboTerm="SBO:0000290" spatialDimensions="3"/> | |
989 </listOfCompartments> | |
990 <listOfSpecies> | |
991 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C21H27N7O14P2" hasOnlySubstanceUnits="true" id="M_m02553c" initialConcentration="0" metaid="cdf46bb5-653c-4e4c-bf33-28c9d8abecaa" name="NADH" sboTerm="SBO:0000247"> | |
992 <notes> | |
993 <body xmlns="http://www.w3.org/1999/xhtml"> | |
994 <p>kegg.compound: C00004</p> | |
995 <p>hmdb: HMDB01487</p> | |
996 <p>bigg.metabolite: nadh</p> | |
997 <p>chebi: CHEBI:16908</p> | |
998 <p>pubchem.compound: 928</p> | |
999 <p>metanetx.chemical: MNXM10</p> | |
1000 <p>formula: C21H27N7O14P2</p> | |
1001 <p>charge: -2</p> | |
1002 </body> | |
1003 </notes> | |
1004 <annotation> | |
1005 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1006 <rdf:Description rdf:about="#cdf46bb5-653c-4e4c-bf33-28c9d8abecaa"> | |
1007 <bqbiol:is> | |
1008 <rdf:Bag> | |
1009 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00004"/> | |
1010 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB01487"/> | |
1011 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/nadh"/> | |
1012 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16908"/> | |
1013 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/928"/> | |
1014 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM10"/> | |
1015 </rdf:Bag> | |
1016 </bqbiol:is> | |
1017 </rdf:Description> | |
1018 </rdf:RDF> | |
1019 </annotation> | |
1020 </species> | |
1021 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C16H21N5O15P2" hasOnlySubstanceUnits="true" id="M_m01949c" initialConcentration="0" metaid="e5ead912-a5af-4eae-a2ca-54c38ddb04ab" name="GDP-4-dehydro-6-deoxy-D-mannose" sboTerm="SBO:0000247"> | |
1022 <notes> | |
1023 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1024 <p>kegg.compound: C01222</p> | |
1025 <p>bigg.metabolite: gdpddman</p> | |
1026 <p>chebi: CHEBI:16955</p> | |
1027 <p>pubchem.compound: 439446</p> | |
1028 <p>metanetx.chemical: MNXM516</p> | |
1029 <p>formula: C16H21N5O15P2</p> | |
1030 <p>charge: -2</p> | |
1031 </body> | |
1032 </notes> | |
1033 <annotation> | |
1034 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1035 <rdf:Description rdf:about="#e5ead912-a5af-4eae-a2ca-54c38ddb04ab"> | |
1036 <bqbiol:is> | |
1037 <rdf:Bag> | |
1038 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01222"/> | |
1039 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/gdpddman"/> | |
1040 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16955"/> | |
1041 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439446"/> | |
1042 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM516"/> | |
1043 </rdf:Bag> | |
1044 </bqbiol:is> | |
1045 </rdf:Description> | |
1046 </rdf:RDF> | |
1047 </annotation> | |
1048 </species> | |
1049 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H11O9P" hasOnlySubstanceUnits="true" id="M_tag1p_D_c" initialConcentration="0" metaid="c7984b99-3c59-482c-a42b-699b4ec0058c" name="D-Tagatose 1-Phosphate" sboTerm="SBO:0000247"> | |
1050 <notes> | |
1051 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1052 <p>bigg.metabolite: tag1p__D</p> | |
1053 <p>pubchem.compound: 6101730</p> | |
1054 <p>metanetx.chemical: MNXM11293</p> | |
1055 <p>formula: C6H11O9P</p> | |
1056 <p>charge: -2</p> | |
1057 </body> | |
1058 </notes> | |
1059 <annotation> | |
1060 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1061 <rdf:Description rdf:about="#c7984b99-3c59-482c-a42b-699b4ec0058c"> | |
1062 <bqbiol:is> | |
1063 <rdf:Bag> | |
1064 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/tag1p__D"/> | |
1065 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/6101730"/> | |
1066 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM11293"/> | |
1067 </rdf:Bag> | |
1068 </bqbiol:is> | |
1069 </rdf:Description> | |
1070 </rdf:RDF> | |
1071 </annotation> | |
1072 </species> | |
1073 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C11H14N2O3" hasOnlySubstanceUnits="true" id="M_glyphe_c" initialConcentration="0" metaid="_6fc683df-22a4-460b-bfae-8fbe15701927" name="Glycyl-Phenylalanine" sboTerm="SBO:0000247"> | |
1074 <notes> | |
1075 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1076 <p>hmdb: HMDB0028848</p> | |
1077 <p>bigg.metabolite: glyphe</p> | |
1078 <p>inchi: InChI=1S/C11H14N2O3/c12-7-10(14)13-9(11(15)16)6-8-4-2-1-3-5-8/h1-5,9H,6-7,12H2,(H,13,14)(H,15,16)</p> | |
1079 <p>metanetx.chemical: MNXM8669</p> | |
1080 <p>formula: C11H14N2O3</p> | |
1081 </body> | |
1082 </notes> | |
1083 <annotation> | |
1084 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1085 <rdf:Description rdf:about="#_6fc683df-22a4-460b-bfae-8fbe15701927"> | |
1086 <bqbiol:is> | |
1087 <rdf:Bag> | |
1088 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB0028848"/> | |
1089 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/glyphe"/> | |
1090 <rdf:li rdf:resource="https://identifiers.org/inchi/InChI=1S/C11H14N2O3/c12-7-10(14)13-9(11(15)16)6-8-4-2-1-3-5-8/h1-5,9H,6-7,12H2,(H,13,14)(H,15,16)"/> | |
1091 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM8669"/> | |
1092 </rdf:Bag> | |
1093 </bqbiol:is> | |
1094 </rdf:Description> | |
1095 </rdf:RDF> | |
1096 </annotation> | |
1097 </species> | |
1098 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O6" hasOnlySubstanceUnits="true" id="M_m01965c" initialConcentration="0" metaid="_94c2bee0-9d72-498c-ac24-cfc89072b989" name="glucose" sboTerm="SBO:0000247"> | |
1099 <notes> | |
1100 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1101 <p>kegg.compound: C00031</p> | |
1102 <p>hmdb: HMDB00122</p> | |
1103 <p>bigg.metabolite: glc__D</p> | |
1104 <p>chebi: CHEBI:4167</p> | |
1105 <p>pubchem.compound: 5793</p> | |
1106 <p>metanetx.chemical: MNXM41 || MNXM99</p> | |
1107 <p>formula: C6H12O6</p> | |
1108 </body> | |
1109 </notes> | |
1110 <annotation> | |
1111 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1112 <rdf:Description rdf:about="#_94c2bee0-9d72-498c-ac24-cfc89072b989"> | |
1113 <bqbiol:is> | |
1114 <rdf:Bag> | |
1115 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00031"/> | |
1116 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00122"/> | |
1117 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/glc__D"/> | |
1118 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:4167"/> | |
1119 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5793"/> | |
1120 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM41"/> | |
1121 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM99"/> | |
1122 </rdf:Bag> | |
1123 </bqbiol:is> | |
1124 </rdf:Description> | |
1125 </rdf:RDF> | |
1126 </annotation> | |
1127 </species> | |
1128 <species boundaryCondition="false" compartment="s" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H22O11" hasOnlySubstanceUnits="true" id="M_m02945s" initialConcentration="0" metaid="a013605d-e919-4407-ac07-58f2fa04eec0" name="sucrose" sboTerm="SBO:0000247"> | |
1129 <notes> | |
1130 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1131 <p>kegg.compound: C00089</p> | |
1132 <p>hmdb: HMDB00258</p> | |
1133 <p>bigg.metabolite: sucr</p> | |
1134 <p>chebi: CHEBI:17992</p> | |
1135 <p>pubchem.compound: 5988</p> | |
1136 <p>metanetx.chemical: MNXM167</p> | |
1137 <p>formula: C12H22O11</p> | |
1138 </body> | |
1139 </notes> | |
1140 <annotation> | |
1141 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1142 <rdf:Description rdf:about="#a013605d-e919-4407-ac07-58f2fa04eec0"> | |
1143 <bqbiol:is> | |
1144 <rdf:Bag> | |
1145 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00089"/> | |
1146 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00258"/> | |
1147 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/sucr"/> | |
1148 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17992"/> | |
1149 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5988"/> | |
1150 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM167"/> | |
1151 </rdf:Bag> | |
1152 </bqbiol:is> | |
1153 </rdf:Description> | |
1154 </rdf:RDF> | |
1155 </annotation> | |
1156 </species> | |
1157 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H11O9P" hasOnlySubstanceUnits="true" id="M_m01844c" initialConcentration="0" metaid="c12fb463-a912-4ae2-a619-e6e7123535ff" name="fructose-3-phosphate" sboTerm="SBO:0000247"> | |
1158 <notes> | |
1159 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1160 <p>formula: C6H11O9P</p> | |
1161 <p>charge: -2</p> | |
1162 </body> | |
1163 </notes> | |
1164 </species> | |
1165 <species boundaryCondition="false" compartment="g" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O6" hasOnlySubstanceUnits="true" id="M_m01965g" initialConcentration="0" metaid="c3ec1b4f-c423-4fb7-ba05-e21ba291103b" name="glucose" sboTerm="SBO:0000247"> | |
1166 <notes> | |
1167 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1168 <p>kegg.compound: C00031</p> | |
1169 <p>hmdb: HMDB00122</p> | |
1170 <p>bigg.metabolite: glc__D</p> | |
1171 <p>chebi: CHEBI:4167</p> | |
1172 <p>pubchem.compound: 5793</p> | |
1173 <p>metanetx.chemical: MNXM41 || MNXM99</p> | |
1174 <p>formula: C6H12O6</p> | |
1175 </body> | |
1176 </notes> | |
1177 <annotation> | |
1178 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1179 <rdf:Description rdf:about="#c3ec1b4f-c423-4fb7-ba05-e21ba291103b"> | |
1180 <bqbiol:is> | |
1181 <rdf:Bag> | |
1182 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00031"/> | |
1183 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00122"/> | |
1184 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/glc__D"/> | |
1185 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:4167"/> | |
1186 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5793"/> | |
1187 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM41"/> | |
1188 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM99"/> | |
1189 </rdf:Bag> | |
1190 </bqbiol:is> | |
1191 </rdf:Description> | |
1192 </rdf:RDF> | |
1193 </annotation> | |
1194 </species> | |
1195 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H14O7" hasOnlySubstanceUnits="true" id="M_m03165c" initialConcentration="0" metaid="_7fccf573-a7f5-4aeb-823a-e1049fe4b5c1" name="sedoheptulose" sboTerm="SBO:0000247"> | |
1196 <notes> | |
1197 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1198 <p>kegg.compound: C02076</p> | |
1199 <p>chebi: CHEBI:16802</p> | |
1200 <p>metanetx.chemical: MNXM44065</p> | |
1201 <p>formula: C7H14O7</p> | |
1202 </body> | |
1203 </notes> | |
1204 <annotation> | |
1205 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1206 <rdf:Description rdf:about="#_7fccf573-a7f5-4aeb-823a-e1049fe4b5c1"> | |
1207 <bqbiol:is> | |
1208 <rdf:Bag> | |
1209 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02076"/> | |
1210 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16802"/> | |
1211 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM44065"/> | |
1212 </rdf:Bag> | |
1213 </bqbiol:is> | |
1214 </rdf:Description> | |
1215 </rdf:RDF> | |
1216 </annotation> | |
1217 </species> | |
1218 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-3" fbc:chemicalFormula="C10H12N5O10P2" hasOnlySubstanceUnits="true" id="M_m01285c" initialConcentration="0" metaid="_521f7ad8-f72e-4338-a6f2-c0a842e7122b" name="ADP" sboTerm="SBO:0000247"> | |
1219 <notes> | |
1220 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1221 <p>kegg.compound: C00008</p> | |
1222 <p>hmdb: HMDB01341</p> | |
1223 <p>bigg.metabolite: adp</p> | |
1224 <p>chebi: CHEBI:16761</p> | |
1225 <p>pubchem.compound: 6022</p> | |
1226 <p>metanetx.chemical: MNXM7</p> | |
1227 <p>formula: C10H12N5O10P2</p> | |
1228 <p>charge: -3</p> | |
1229 </body> | |
1230 </notes> | |
1231 <annotation> | |
1232 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1233 <rdf:Description rdf:about="#_521f7ad8-f72e-4338-a6f2-c0a842e7122b"> | |
1234 <bqbiol:is> | |
1235 <rdf:Bag> | |
1236 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00008"/> | |
1237 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB01341"/> | |
1238 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/adp"/> | |
1239 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16761"/> | |
1240 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/6022"/> | |
1241 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM7"/> | |
1242 </rdf:Bag> | |
1243 </bqbiol:is> | |
1244 </rdf:Description> | |
1245 </rdf:RDF> | |
1246 </annotation> | |
1247 </species> | |
1248 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H6O3" hasOnlySubstanceUnits="true" id="M_m01981c" initialConcentration="0" metaid="_28c079d9-0897-4cc1-ac53-057881862cfb" name="glyceraldehyde" sboTerm="SBO:0000247"> | |
1249 <notes> | |
1250 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1251 <p>kegg.compound: C02154</p> | |
1252 <p>hmdb: HMDB01051</p> | |
1253 <p>bigg.metabolite: glyald</p> | |
1254 <p>chebi: CHEBI:5445</p> | |
1255 <p>inchi: InChI=1S/C3H6O3/c4-1-3(6)2-5/h1,3,5-6H,2H2/t3-/m0/s1</p> | |
1256 <p>pubchem.compound: 751</p> | |
1257 <p>metanetx.chemical: MNXM435</p> | |
1258 <p>formula: C3H6O3</p> | |
1259 </body> | |
1260 </notes> | |
1261 <annotation> | |
1262 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1263 <rdf:Description rdf:about="#_28c079d9-0897-4cc1-ac53-057881862cfb"> | |
1264 <bqbiol:is> | |
1265 <rdf:Bag> | |
1266 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02154"/> | |
1267 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB01051"/> | |
1268 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/glyald"/> | |
1269 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:5445"/> | |
1270 <rdf:li rdf:resource="https://identifiers.org/inchi/InChI=1S/C3H6O3/c4-1-3(6)2-5/h1,3,5-6H,2H2/t3-/m0/s1"/> | |
1271 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/751"/> | |
1272 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM435"/> | |
1273 </rdf:Bag> | |
1274 </bqbiol:is> | |
1275 </rdf:Description> | |
1276 </rdf:RDF> | |
1277 </annotation> | |
1278 </species> | |
1279 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H14O6" hasOnlySubstanceUnits="true" id="M_m01682c" initialConcentration="0" metaid="ae904b43-59ad-4e95-88e1-8e34700a9056" name="D-glucitol" sboTerm="SBO:0000247"> | |
1280 <notes> | |
1281 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1282 <p>kegg.compound: C00794</p> | |
1283 <p>hmdb: HMDB00247</p> | |
1284 <p>bigg.metabolite: sbt__D</p> | |
1285 <p>chebi: CHEBI:17924</p> | |
1286 <p>pubchem.compound: 5780</p> | |
1287 <p>metanetx.chemical: MNXM469</p> | |
1288 <p>formula: C6H14O6</p> | |
1289 </body> | |
1290 </notes> | |
1291 <annotation> | |
1292 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1293 <rdf:Description rdf:about="#ae904b43-59ad-4e95-88e1-8e34700a9056"> | |
1294 <bqbiol:is> | |
1295 <rdf:Bag> | |
1296 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00794"/> | |
1297 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00247"/> | |
1298 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/sbt__D"/> | |
1299 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17924"/> | |
1300 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5780"/> | |
1301 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM469"/> | |
1302 </rdf:Bag> | |
1303 </bqbiol:is> | |
1304 </rdf:Description> | |
1305 </rdf:RDF> | |
1306 </annotation> | |
1307 </species> | |
1308 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H13O9P" hasOnlySubstanceUnits="true" id="M_m02917c" initialConcentration="0" metaid="_42c68707-b6eb-4d18-8cc4-456bd62297d4" name="sorbitol-3-phosphate" sboTerm="SBO:0000247"> | |
1309 <notes> | |
1310 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1311 <p>pubchem.compound: 129544</p> | |
1312 <p>metanetx.chemical: MNXM48480</p> | |
1313 <p>formula: C6H13O9P</p> | |
1314 <p>charge: -2</p> | |
1315 </body> | |
1316 </notes> | |
1317 <annotation> | |
1318 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1319 <rdf:Description rdf:about="#_42c68707-b6eb-4d18-8cc4-456bd62297d4"> | |
1320 <bqbiol:is> | |
1321 <rdf:Bag> | |
1322 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/129544"/> | |
1323 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM48480"/> | |
1324 </rdf:Bag> | |
1325 </bqbiol:is> | |
1326 </rdf:Description> | |
1327 </rdf:RDF> | |
1328 </annotation> | |
1329 </species> | |
1330 <species boundaryCondition="false" compartment="l" constant="false" fbc:charge="0" fbc:chemicalFormula="H2O" hasOnlySubstanceUnits="true" id="M_m02040l" initialConcentration="0" metaid="eb95a981-8590-48ef-b0b9-b05c3507c687" name="H2O" sboTerm="SBO:0000247"> | |
1331 <notes> | |
1332 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1333 <p>lipidmaps: LMST01040128</p> | |
1334 <p>kegg.compound: C00001</p> | |
1335 <p>hmdb: HMDB02111</p> | |
1336 <p>bigg.metabolite: h2o</p> | |
1337 <p>chebi: CHEBI:15377</p> | |
1338 <p>pubchem.compound: 962</p> | |
1339 <p>metanetx.chemical: MNXM2</p> | |
1340 <p>formula: H2O</p> | |
1341 </body> | |
1342 </notes> | |
1343 <annotation> | |
1344 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1345 <rdf:Description rdf:about="#eb95a981-8590-48ef-b0b9-b05c3507c687"> | |
1346 <bqbiol:is> | |
1347 <rdf:Bag> | |
1348 <rdf:li rdf:resource="https://identifiers.org/lipidmaps/LMST01040128"/> | |
1349 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00001"/> | |
1350 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB02111"/> | |
1351 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/h2o"/> | |
1352 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15377"/> | |
1353 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/962"/> | |
1354 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM2"/> | |
1355 </rdf:Bag> | |
1356 </bqbiol:is> | |
1357 </rdf:Description> | |
1358 </rdf:RDF> | |
1359 </annotation> | |
1360 </species> | |
1361 <species boundaryCondition="false" compartment="r" constant="false" fbc:charge="-2" fbc:chemicalFormula="C21H27N7O14P2" hasOnlySubstanceUnits="true" id="M_m02553r" initialConcentration="0" metaid="a2069c73-802b-49cf-8f06-0e3f0be5669b" name="NADH" sboTerm="SBO:0000247"> | |
1362 <notes> | |
1363 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1364 <p>kegg.compound: C00004</p> | |
1365 <p>hmdb: HMDB01487</p> | |
1366 <p>bigg.metabolite: nadh</p> | |
1367 <p>chebi: CHEBI:16908</p> | |
1368 <p>pubchem.compound: 928</p> | |
1369 <p>metanetx.chemical: MNXM10</p> | |
1370 <p>formula: C21H27N7O14P2</p> | |
1371 <p>charge: -2</p> | |
1372 </body> | |
1373 </notes> | |
1374 <annotation> | |
1375 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1376 <rdf:Description rdf:about="#a2069c73-802b-49cf-8f06-0e3f0be5669b"> | |
1377 <bqbiol:is> | |
1378 <rdf:Bag> | |
1379 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00004"/> | |
1380 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB01487"/> | |
1381 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/nadh"/> | |
1382 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16908"/> | |
1383 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/928"/> | |
1384 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM10"/> | |
1385 </rdf:Bag> | |
1386 </bqbiol:is> | |
1387 </rdf:Description> | |
1388 </rdf:RDF> | |
1389 </annotation> | |
1390 </species> | |
1391 <species boundaryCondition="false" compartment="l" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O6" hasOnlySubstanceUnits="true" id="M_m01965l" initialConcentration="0" metaid="_25dd65f2-2228-440c-baf3-9f621a7e5ff0" name="glucose" sboTerm="SBO:0000247"> | |
1392 <notes> | |
1393 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1394 <p>kegg.compound: C00031</p> | |
1395 <p>hmdb: HMDB00122</p> | |
1396 <p>bigg.metabolite: glc__D</p> | |
1397 <p>chebi: CHEBI:4167</p> | |
1398 <p>pubchem.compound: 5793</p> | |
1399 <p>metanetx.chemical: MNXM41 || MNXM99</p> | |
1400 <p>formula: C6H12O6</p> | |
1401 </body> | |
1402 </notes> | |
1403 <annotation> | |
1404 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1405 <rdf:Description rdf:about="#_25dd65f2-2228-440c-baf3-9f621a7e5ff0"> | |
1406 <bqbiol:is> | |
1407 <rdf:Bag> | |
1408 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00031"/> | |
1409 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00122"/> | |
1410 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/glc__D"/> | |
1411 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:4167"/> | |
1412 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5793"/> | |
1413 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM41"/> | |
1414 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM99"/> | |
1415 </rdf:Bag> | |
1416 </bqbiol:is> | |
1417 </rdf:Description> | |
1418 </rdf:RDF> | |
1419 </annotation> | |
1420 </species> | |
1421 <species boundaryCondition="false" compartment="s" constant="false" fbc:charge="-2" fbc:chemicalFormula="C21H27N7O14P2" hasOnlySubstanceUnits="true" id="M_m02553s" initialConcentration="0" metaid="c0b50a6c-29cd-4c06-82af-9fce71d23255" name="NADH" sboTerm="SBO:0000247"> | |
1422 <notes> | |
1423 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1424 <p>kegg.compound: C00004</p> | |
1425 <p>hmdb: HMDB01487</p> | |
1426 <p>bigg.metabolite: nadh</p> | |
1427 <p>chebi: CHEBI:16908</p> | |
1428 <p>pubchem.compound: 928</p> | |
1429 <p>metanetx.chemical: MNXM10</p> | |
1430 <p>formula: C21H27N7O14P2</p> | |
1431 <p>charge: -2</p> | |
1432 </body> | |
1433 </notes> | |
1434 <annotation> | |
1435 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1436 <rdf:Description rdf:about="#c0b50a6c-29cd-4c06-82af-9fce71d23255"> | |
1437 <bqbiol:is> | |
1438 <rdf:Bag> | |
1439 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00004"/> | |
1440 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB01487"/> | |
1441 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/nadh"/> | |
1442 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16908"/> | |
1443 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/928"/> | |
1444 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM10"/> | |
1445 </rdf:Bag> | |
1446 </bqbiol:is> | |
1447 </rdf:Description> | |
1448 </rdf:RDF> | |
1449 </annotation> | |
1450 </species> | |
1451 <species boundaryCondition="false" compartment="s" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O6" hasOnlySubstanceUnits="true" id="M_m01965s" initialConcentration="0" metaid="ad2dbd72-4542-4c0b-8986-e308b158e31f" name="glucose" sboTerm="SBO:0000247"> | |
1452 <notes> | |
1453 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1454 <p>kegg.compound: C00031</p> | |
1455 <p>hmdb: HMDB00122</p> | |
1456 <p>bigg.metabolite: glc__D</p> | |
1457 <p>chebi: CHEBI:4167</p> | |
1458 <p>pubchem.compound: 5793</p> | |
1459 <p>metanetx.chemical: MNXM41 || MNXM99</p> | |
1460 <p>formula: C6H12O6</p> | |
1461 </body> | |
1462 </notes> | |
1463 <annotation> | |
1464 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1465 <rdf:Description rdf:about="#ad2dbd72-4542-4c0b-8986-e308b158e31f"> | |
1466 <bqbiol:is> | |
1467 <rdf:Bag> | |
1468 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00031"/> | |
1469 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00122"/> | |
1470 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/glc__D"/> | |
1471 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:4167"/> | |
1472 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5793"/> | |
1473 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM41"/> | |
1474 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM99"/> | |
1475 </rdf:Bag> | |
1476 </bqbiol:is> | |
1477 </rdf:Description> | |
1478 </rdf:RDF> | |
1479 </annotation> | |
1480 </species> | |
1481 <species boundaryCondition="false" compartment="s" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H18O8" hasOnlySubstanceUnits="true" id="M_m01913s" initialConcentration="0" metaid="ae24b707-1474-48c9-bc3e-184c9fc59f80" name="galactosylglycerol" sboTerm="SBO:0000247"> | |
1482 <notes> | |
1483 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1484 <p>kegg.compound: C05401</p> | |
1485 <p>chebi: CHEBI:15754</p> | |
1486 <p>pubchem.compound: 16048618</p> | |
1487 <p>metanetx.chemical: MNXM2608</p> | |
1488 <p>formula: C9H18O8</p> | |
1489 </body> | |
1490 </notes> | |
1491 <annotation> | |
1492 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1493 <rdf:Description rdf:about="#ae24b707-1474-48c9-bc3e-184c9fc59f80"> | |
1494 <bqbiol:is> | |
1495 <rdf:Bag> | |
1496 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05401"/> | |
1497 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15754"/> | |
1498 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/16048618"/> | |
1499 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM2608"/> | |
1500 </rdf:Bag> | |
1501 </bqbiol:is> | |
1502 </rdf:Description> | |
1503 </rdf:RDF> | |
1504 </annotation> | |
1505 </species> | |
1506 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="H2O" hasOnlySubstanceUnits="true" id="M_m02040c" initialConcentration="0" metaid="dce3ae33-5567-405a-9fd7-b571c4dce0b0" name="H2O" sboTerm="SBO:0000247"> | |
1507 <notes> | |
1508 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1509 <p>lipidmaps: LMST01040128</p> | |
1510 <p>kegg.compound: C00001</p> | |
1511 <p>hmdb: HMDB02111</p> | |
1512 <p>bigg.metabolite: h2o</p> | |
1513 <p>chebi: CHEBI:15377</p> | |
1514 <p>pubchem.compound: 962</p> | |
1515 <p>metanetx.chemical: MNXM2</p> | |
1516 <p>formula: H2O</p> | |
1517 </body> | |
1518 </notes> | |
1519 <annotation> | |
1520 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1521 <rdf:Description rdf:about="#dce3ae33-5567-405a-9fd7-b571c4dce0b0"> | |
1522 <bqbiol:is> | |
1523 <rdf:Bag> | |
1524 <rdf:li rdf:resource="https://identifiers.org/lipidmaps/LMST01040128"/> | |
1525 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00001"/> | |
1526 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB02111"/> | |
1527 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/h2o"/> | |
1528 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15377"/> | |
1529 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/962"/> | |
1530 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM2"/> | |
1531 </rdf:Bag> | |
1532 </bqbiol:is> | |
1533 </rdf:Description> | |
1534 </rdf:RDF> | |
1535 </annotation> | |
1536 </species> | |
1537 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-3" fbc:chemicalFormula="C10H11N4O11P2" hasOnlySubstanceUnits="true" id="M_m02161c" initialConcentration="0" metaid="_6588a61e-6e8e-4abf-b113-5c7d7bd46a74" name="IDP" sboTerm="SBO:0000247"> | |
1538 <notes> | |
1539 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1540 <p>kegg.compound: C00104</p> | |
1541 <p>bigg.metabolite: idp</p> | |
1542 <p>chebi: CHEBI:17808</p> | |
1543 <p>pubchem.compound: 6831</p> | |
1544 <p>metanetx.chemical: MNXM495</p> | |
1545 <p>formula: C10H11N4O11P2</p> | |
1546 <p>charge: -3</p> | |
1547 </body> | |
1548 </notes> | |
1549 <annotation> | |
1550 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1551 <rdf:Description rdf:about="#_6588a61e-6e8e-4abf-b113-5c7d7bd46a74"> | |
1552 <bqbiol:is> | |
1553 <rdf:Bag> | |
1554 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00104"/> | |
1555 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/idp"/> | |
1556 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17808"/> | |
1557 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/6831"/> | |
1558 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM495"/> | |
1559 </rdf:Bag> | |
1560 </bqbiol:is> | |
1561 </rdf:Description> | |
1562 </rdf:RDF> | |
1563 </annotation> | |
1564 </species> | |
1565 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-1" fbc:chemicalFormula="C21H26N7O14P2" hasOnlySubstanceUnits="true" id="M_m02552c" initialConcentration="0" metaid="c7546c47-b436-4f42-b25c-6a7ba5aae2db" name="NAD+" sboTerm="SBO:0000247"> | |
1566 <notes> | |
1567 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1568 <p>kegg.compound: C00003</p> | |
1569 <p>hmdb: HMDB00902</p> | |
1570 <p>bigg.metabolite: nad</p> | |
1571 <p>chebi: CHEBI:15846</p> | |
1572 <p>pubchem.compound: 5893</p> | |
1573 <p>metanetx.chemical: MNXM8</p> | |
1574 <p>formula: C21H26N7O14P2</p> | |
1575 <p>charge: -1</p> | |
1576 </body> | |
1577 </notes> | |
1578 <annotation> | |
1579 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1580 <rdf:Description rdf:about="#c7546c47-b436-4f42-b25c-6a7ba5aae2db"> | |
1581 <bqbiol:is> | |
1582 <rdf:Bag> | |
1583 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00003"/> | |
1584 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00902"/> | |
1585 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/nad"/> | |
1586 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15846"/> | |
1587 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5893"/> | |
1588 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM8"/> | |
1589 </rdf:Bag> | |
1590 </bqbiol:is> | |
1591 </rdf:Description> | |
1592 </rdf:RDF> | |
1593 </annotation> | |
1594 </species> | |
1595 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-3" fbc:chemicalFormula="C10H12N5O11P2" hasOnlySubstanceUnits="true" id="M_m01948c" initialConcentration="0" metaid="a0bbd11c-f5e5-4615-aa55-824abf6e90cf" name="GDP" sboTerm="SBO:0000247"> | |
1596 <notes> | |
1597 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1598 <p>kegg.compound: C00035</p> | |
1599 <p>hmdb: HMDB01201</p> | |
1600 <p>bigg.metabolite: gdp</p> | |
1601 <p>chebi: CHEBI:17552</p> | |
1602 <p>pubchem.compound: 8977</p> | |
1603 <p>metanetx.chemical: MNXM30</p> | |
1604 <p>formula: C10H12N5O11P2</p> | |
1605 <p>charge: -3</p> | |
1606 </body> | |
1607 </notes> | |
1608 <annotation> | |
1609 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1610 <rdf:Description rdf:about="#a0bbd11c-f5e5-4615-aa55-824abf6e90cf"> | |
1611 <bqbiol:is> | |
1612 <rdf:Bag> | |
1613 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00035"/> | |
1614 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB01201"/> | |
1615 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/gdp"/> | |
1616 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17552"/> | |
1617 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/8977"/> | |
1618 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM30"/> | |
1619 </rdf:Bag> | |
1620 </bqbiol:is> | |
1621 </rdf:Description> | |
1622 </rdf:RDF> | |
1623 </annotation> | |
1624 </species> | |
1625 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H11O9P" hasOnlySubstanceUnits="true" id="M_m02455c" initialConcentration="0" metaid="_45e1757e-5e64-4141-add5-c15cc95139e6" name="mannose-6-phosphate" sboTerm="SBO:0000247"> | |
1626 <notes> | |
1627 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1628 <p>kegg.compound: C00275</p> | |
1629 <p>bigg.metabolite: man6p</p> | |
1630 <p>chebi: CHEBI:17369</p> | |
1631 <p>pubchem.compound: 65127</p> | |
1632 <p>metanetx.chemical: MNXM427</p> | |
1633 <p>formula: C6H11O9P</p> | |
1634 <p>charge: -2</p> | |
1635 </body> | |
1636 </notes> | |
1637 <annotation> | |
1638 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1639 <rdf:Description rdf:about="#_45e1757e-5e64-4141-add5-c15cc95139e6"> | |
1640 <bqbiol:is> | |
1641 <rdf:Bag> | |
1642 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00275"/> | |
1643 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/man6p"/> | |
1644 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17369"/> | |
1645 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/65127"/> | |
1646 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM427"/> | |
1647 </rdf:Bag> | |
1648 </bqbiol:is> | |
1649 </rdf:Description> | |
1650 </rdf:RDF> | |
1651 </annotation> | |
1652 </species> | |
1653 <species boundaryCondition="false" compartment="s" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H20O11" hasOnlySubstanceUnits="true" id="M_m00812s" initialConcentration="0" metaid="_00ff2bbd-493a-4113-b2e9-db7ee06461c7" name="3-ketolactose" sboTerm="SBO:0000247"> | |
1654 <notes> | |
1655 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1656 <p>kegg.compound: C05403</p> | |
1657 <p>metanetx.chemical: MNXM36578</p> | |
1658 <p>formula: C12H20O11</p> | |
1659 </body> | |
1660 </notes> | |
1661 <annotation> | |
1662 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1663 <rdf:Description rdf:about="#_00ff2bbd-493a-4113-b2e9-db7ee06461c7"> | |
1664 <bqbiol:is> | |
1665 <rdf:Bag> | |
1666 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05403"/> | |
1667 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM36578"/> | |
1668 </rdf:Bag> | |
1669 </bqbiol:is> | |
1670 </rdf:Description> | |
1671 </rdf:RDF> | |
1672 </annotation> | |
1673 </species> | |
1674 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H11O9P" hasOnlySubstanceUnits="true" id="M_m01746c" initialConcentration="0" metaid="_649c6e13-719a-4c6a-816c-e44a17666513" name="D-tagatose-6-phosphate" sboTerm="SBO:0000247"> | |
1675 <notes> | |
1676 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1677 <p>kegg.compound: C01097</p> | |
1678 <p>bigg.metabolite: tag1p__D</p> | |
1679 <p>chebi: CHEBI:4251</p> | |
1680 <p>pubchem.compound: 439396</p> | |
1681 <p>metanetx.chemical: MNXM795 || MNXM164716</p> | |
1682 <p>formula: C6H11O9P</p> | |
1683 <p>charge: -2</p> | |
1684 </body> | |
1685 </notes> | |
1686 <annotation> | |
1687 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1688 <rdf:Description rdf:about="#_649c6e13-719a-4c6a-816c-e44a17666513"> | |
1689 <bqbiol:is> | |
1690 <rdf:Bag> | |
1691 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01097"/> | |
1692 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/tag1p__D"/> | |
1693 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:4251"/> | |
1694 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439396"/> | |
1695 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM795"/> | |
1696 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM164716"/> | |
1697 </rdf:Bag> | |
1698 </bqbiol:is> | |
1699 </rdf:Description> | |
1700 </rdf:RDF> | |
1701 </annotation> | |
1702 </species> | |
1703 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-4" fbc:chemicalFormula="C6H10O12P2" hasOnlySubstanceUnits="true" id="M_m01843c" initialConcentration="0" metaid="fd1b4759-172c-46ec-a6af-449961360664" name="fructose-2,6-bisphosphate" sboTerm="SBO:0000247"> | |
1704 <notes> | |
1705 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1706 <p>kegg.compound: C00665</p> | |
1707 <p>bigg.metabolite: f26bp</p> | |
1708 <p>chebi: CHEBI:28602</p> | |
1709 <p>pubchem.compound: 105021</p> | |
1710 <p>metanetx.chemical: MNXM651</p> | |
1711 <p>formula: C6H10O12P2</p> | |
1712 <p>charge: -4</p> | |
1713 </body> | |
1714 </notes> | |
1715 <annotation> | |
1716 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1717 <rdf:Description rdf:about="#fd1b4759-172c-46ec-a6af-449961360664"> | |
1718 <bqbiol:is> | |
1719 <rdf:Bag> | |
1720 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00665"/> | |
1721 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/f26bp"/> | |
1722 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:28602"/> | |
1723 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/105021"/> | |
1724 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM651"/> | |
1725 </rdf:Bag> | |
1726 </bqbiol:is> | |
1727 </rdf:Description> | |
1728 </rdf:RDF> | |
1729 </annotation> | |
1730 </species> | |
1731 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-4" fbc:chemicalFormula="C10H12N5O13P3" hasOnlySubstanceUnits="true" id="M_m01371c" initialConcentration="0" metaid="_7c99bce2-d604-4273-9c90-72c3d53e303d" name="ATP" sboTerm="SBO:0000247"> | |
1732 <notes> | |
1733 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1734 <p>kegg.compound: C00002</p> | |
1735 <p>hmdb: HMDB00538</p> | |
1736 <p>bigg.metabolite: atp</p> | |
1737 <p>chebi: CHEBI:15422</p> | |
1738 <p>pubchem.compound: 5957</p> | |
1739 <p>metanetx.chemical: MNXM3</p> | |
1740 <p>formula: C10H12N5O13P3</p> | |
1741 <p>charge: -4</p> | |
1742 </body> | |
1743 </notes> | |
1744 <annotation> | |
1745 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1746 <rdf:Description rdf:about="#_7c99bce2-d604-4273-9c90-72c3d53e303d"> | |
1747 <bqbiol:is> | |
1748 <rdf:Bag> | |
1749 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00002"/> | |
1750 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00538"/> | |
1751 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/atp"/> | |
1752 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15422"/> | |
1753 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5957"/> | |
1754 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM3"/> | |
1755 </rdf:Bag> | |
1756 </bqbiol:is> | |
1757 </rdf:Description> | |
1758 </rdf:RDF> | |
1759 </annotation> | |
1760 </species> | |
1761 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="CO2" hasOnlySubstanceUnits="true" id="M_m01596c" initialConcentration="0" metaid="_24121835-f370-42a9-89c1-f78191770ba5" name="CO2" sboTerm="SBO:0000247"> | |
1762 <notes> | |
1763 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1764 <p>kegg.compound: C00011</p> | |
1765 <p>hmdb: HMDB01967</p> | |
1766 <p>bigg.metabolite: co2</p> | |
1767 <p>chebi: CHEBI:16526</p> | |
1768 <p>inchi: InChI=1S/CO2/c2-1-3</p> | |
1769 <p>pubchem.compound: 280</p> | |
1770 <p>metanetx.chemical: MNXM13</p> | |
1771 <p>formula: CO2</p> | |
1772 </body> | |
1773 </notes> | |
1774 <annotation> | |
1775 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1776 <rdf:Description rdf:about="#_24121835-f370-42a9-89c1-f78191770ba5"> | |
1777 <bqbiol:is> | |
1778 <rdf:Bag> | |
1779 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00011"/> | |
1780 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB01967"/> | |
1781 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/co2"/> | |
1782 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16526"/> | |
1783 <rdf:li rdf:resource="https://identifiers.org/inchi/InChI=1S/CO2/c2-1-3"/> | |
1784 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/280"/> | |
1785 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM13"/> | |
1786 </rdf:Bag> | |
1787 </bqbiol:is> | |
1788 </rdf:Description> | |
1789 </rdf:RDF> | |
1790 </annotation> | |
1791 </species> | |
1792 <species boundaryCondition="false" compartment="s" constant="false" fbc:charge="-1" fbc:chemicalFormula="C21H26N7O14P2" hasOnlySubstanceUnits="true" id="M_m02552s" initialConcentration="0" metaid="_81c63c25-41ec-418f-a7ae-8917ef8e605f" name="NAD+" sboTerm="SBO:0000247"> | |
1793 <notes> | |
1794 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1795 <p>kegg.compound: C00003</p> | |
1796 <p>hmdb: HMDB00902</p> | |
1797 <p>bigg.metabolite: nad</p> | |
1798 <p>chebi: CHEBI:15846</p> | |
1799 <p>pubchem.compound: 5893</p> | |
1800 <p>metanetx.chemical: MNXM8</p> | |
1801 <p>formula: C21H26N7O14P2</p> | |
1802 <p>charge: -1</p> | |
1803 </body> | |
1804 </notes> | |
1805 <annotation> | |
1806 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1807 <rdf:Description rdf:about="#_81c63c25-41ec-418f-a7ae-8917ef8e605f"> | |
1808 <bqbiol:is> | |
1809 <rdf:Bag> | |
1810 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00003"/> | |
1811 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00902"/> | |
1812 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/nad"/> | |
1813 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15846"/> | |
1814 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5893"/> | |
1815 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM8"/> | |
1816 </rdf:Bag> | |
1817 </bqbiol:is> | |
1818 </rdf:Description> | |
1819 </rdf:RDF> | |
1820 </annotation> | |
1821 </species> | |
1822 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C15H22N2O17P2" hasOnlySubstanceUnits="true" id="M_m03108c" initialConcentration="0" metaid="_59be01c8-ef39-4d12-ba62-dae2abc178b3" name="UDP-glucose" sboTerm="SBO:0000247"> | |
1823 <notes> | |
1824 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1825 <p>kegg.compound: C00029</p> | |
1826 <p>bigg.metabolite: udpg</p> | |
1827 <p>chebi: CHEBI:18066</p> | |
1828 <p>pubchem.compound: 53477679</p> | |
1829 <p>metanetx.chemical: MNXM52</p> | |
1830 <p>formula: C15H22N2O17P2</p> | |
1831 <p>charge: -2</p> | |
1832 </body> | |
1833 </notes> | |
1834 <annotation> | |
1835 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1836 <rdf:Description rdf:about="#_59be01c8-ef39-4d12-ba62-dae2abc178b3"> | |
1837 <bqbiol:is> | |
1838 <rdf:Bag> | |
1839 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00029"/> | |
1840 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/udpg"/> | |
1841 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:18066"/> | |
1842 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/53477679"/> | |
1843 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM52"/> | |
1844 </rdf:Bag> | |
1845 </bqbiol:is> | |
1846 </rdf:Description> | |
1847 </rdf:RDF> | |
1848 </annotation> | |
1849 </species> | |
1850 <species boundaryCondition="false" compartment="r" constant="false" fbc:charge="-1" fbc:chemicalFormula="C21H26N7O14P2" hasOnlySubstanceUnits="true" id="M_m02552r" initialConcentration="0" metaid="_97a217ca-280a-4b3d-a2b8-ef92ea5df65e" name="NAD+" sboTerm="SBO:0000247"> | |
1851 <notes> | |
1852 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1853 <p>kegg.compound: C00003</p> | |
1854 <p>hmdb: HMDB00902</p> | |
1855 <p>bigg.metabolite: nad</p> | |
1856 <p>chebi: CHEBI:15846</p> | |
1857 <p>pubchem.compound: 5893</p> | |
1858 <p>metanetx.chemical: MNXM8</p> | |
1859 <p>formula: C21H26N7O14P2</p> | |
1860 <p>charge: -1</p> | |
1861 </body> | |
1862 </notes> | |
1863 <annotation> | |
1864 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1865 <rdf:Description rdf:about="#_97a217ca-280a-4b3d-a2b8-ef92ea5df65e"> | |
1866 <bqbiol:is> | |
1867 <rdf:Bag> | |
1868 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00003"/> | |
1869 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00902"/> | |
1870 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/nad"/> | |
1871 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15846"/> | |
1872 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5893"/> | |
1873 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM8"/> | |
1874 </rdf:Bag> | |
1875 </bqbiol:is> | |
1876 </rdf:Description> | |
1877 </rdf:RDF> | |
1878 </annotation> | |
1879 </species> | |
1880 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-3" fbc:chemicalFormula="C9H12N3O11P2" hasOnlySubstanceUnits="true" id="M_m01424c" initialConcentration="0" metaid="_430a23d5-3b46-409f-8228-66cb698937a6" name="CDP" sboTerm="SBO:0000247"> | |
1881 <notes> | |
1882 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1883 <p>kegg.compound: C00112</p> | |
1884 <p>bigg.metabolite: cdp</p> | |
1885 <p>chebi: CHEBI:17239</p> | |
1886 <p>pubchem.compound: 6132</p> | |
1887 <p>metanetx.chemical: MNXM220</p> | |
1888 <p>formula: C9H12N3O11P2</p> | |
1889 <p>charge: -3</p> | |
1890 </body> | |
1891 </notes> | |
1892 <annotation> | |
1893 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1894 <rdf:Description rdf:about="#_430a23d5-3b46-409f-8228-66cb698937a6"> | |
1895 <bqbiol:is> | |
1896 <rdf:Bag> | |
1897 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00112"/> | |
1898 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/cdp"/> | |
1899 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17239"/> | |
1900 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/6132"/> | |
1901 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM220"/> | |
1902 </rdf:Bag> | |
1903 </bqbiol:is> | |
1904 </rdf:Description> | |
1905 </rdf:RDF> | |
1906 </annotation> | |
1907 </species> | |
1908 <species boundaryCondition="false" compartment="r" constant="false" fbc:charge="0" fbc:chemicalFormula="CO2" hasOnlySubstanceUnits="true" id="M_m01596r" initialConcentration="0" metaid="_11e6d111-bf70-414d-9f90-152505ad9772" name="CO2" sboTerm="SBO:0000247"> | |
1909 <notes> | |
1910 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1911 <p>kegg.compound: C00011</p> | |
1912 <p>hmdb: HMDB01967</p> | |
1913 <p>bigg.metabolite: co2</p> | |
1914 <p>chebi: CHEBI:16526</p> | |
1915 <p>inchi: InChI=1S/CO2/c2-1-3</p> | |
1916 <p>pubchem.compound: 280</p> | |
1917 <p>metanetx.chemical: MNXM13</p> | |
1918 <p>formula: CO2</p> | |
1919 </body> | |
1920 </notes> | |
1921 <annotation> | |
1922 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1923 <rdf:Description rdf:about="#_11e6d111-bf70-414d-9f90-152505ad9772"> | |
1924 <bqbiol:is> | |
1925 <rdf:Bag> | |
1926 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00011"/> | |
1927 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB01967"/> | |
1928 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/co2"/> | |
1929 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16526"/> | |
1930 <rdf:li rdf:resource="https://identifiers.org/inchi/InChI=1S/CO2/c2-1-3"/> | |
1931 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/280"/> | |
1932 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM13"/> | |
1933 </rdf:Bag> | |
1934 </bqbiol:is> | |
1935 </rdf:Description> | |
1936 </rdf:RDF> | |
1937 </annotation> | |
1938 </species> | |
1939 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H14O6" hasOnlySubstanceUnits="true" id="M_m01909c" initialConcentration="0" metaid="_32fccb2f-e504-4de0-be7b-32b6e5e909af" name="galactitol" sboTerm="SBO:0000247"> | |
1940 <notes> | |
1941 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1942 <p>kegg.compound: C01697</p> | |
1943 <p>hmdb: HMDB00107</p> | |
1944 <p>bigg.metabolite: galt</p> | |
1945 <p>chebi: CHEBI:16813</p> | |
1946 <p>inchi: InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5+,6-</p> | |
1947 <p>pubchem.compound: 11850</p> | |
1948 <p>metanetx.chemical: MNXM1233</p> | |
1949 <p>formula: C6H14O6</p> | |
1950 </body> | |
1951 </notes> | |
1952 <annotation> | |
1953 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1954 <rdf:Description rdf:about="#_32fccb2f-e504-4de0-be7b-32b6e5e909af"> | |
1955 <bqbiol:is> | |
1956 <rdf:Bag> | |
1957 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01697"/> | |
1958 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00107"/> | |
1959 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/galt"/> | |
1960 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16813"/> | |
1961 <rdf:li rdf:resource="https://identifiers.org/inchi/InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5+,6-"/> | |
1962 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/11850"/> | |
1963 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM1233"/> | |
1964 </rdf:Bag> | |
1965 </bqbiol:is> | |
1966 </rdf:Description> | |
1967 </rdf:RDF> | |
1968 </annotation> | |
1969 </species> | |
1970 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H11O9P" hasOnlySubstanceUnits="true" id="M_m02454c" initialConcentration="0" metaid="a9ce0266-f645-439d-b18d-d18a8b0913d4" name="mannose-1-phosphate" sboTerm="SBO:0000247"> | |
1971 <notes> | |
1972 <body xmlns="http://www.w3.org/1999/xhtml"> | |
1973 <p>kegg.compound: C00636</p> | |
1974 <p>hmdb: HMDB06330</p> | |
1975 <p>bigg.metabolite: man1p</p> | |
1976 <p>chebi: CHEBI:35374</p> | |
1977 <p>pubchem.compound: 644175</p> | |
1978 <p>metanetx.chemical: MNXM721</p> | |
1979 <p>formula: C6H11O9P</p> | |
1980 <p>charge: -2</p> | |
1981 </body> | |
1982 </notes> | |
1983 <annotation> | |
1984 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
1985 <rdf:Description rdf:about="#a9ce0266-f645-439d-b18d-d18a8b0913d4"> | |
1986 <bqbiol:is> | |
1987 <rdf:Bag> | |
1988 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00636"/> | |
1989 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB06330"/> | |
1990 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/man1p"/> | |
1991 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:35374"/> | |
1992 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/644175"/> | |
1993 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM721"/> | |
1994 </rdf:Bag> | |
1995 </bqbiol:is> | |
1996 </rdf:Description> | |
1997 </rdf:RDF> | |
1998 </annotation> | |
1999 </species> | |
2000 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H12O5" hasOnlySubstanceUnits="true" id="M_abt_D_c" initialConcentration="0" metaid="_26494228-cd48-4a29-af7c-1b74871615b2" name="D-Arabitol" sboTerm="SBO:0000247"> | |
2001 <notes> | |
2002 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2003 <p>bigg.metabolite: abt__D</p> | |
2004 <p>inchi: InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4-/m1/s1</p> | |
2005 <p>metanetx.chemical: MNXM1018</p> | |
2006 <p>formula: C5H12O5</p> | |
2007 </body> | |
2008 </notes> | |
2009 <annotation> | |
2010 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2011 <rdf:Description rdf:about="#_26494228-cd48-4a29-af7c-1b74871615b2"> | |
2012 <bqbiol:is> | |
2013 <rdf:Bag> | |
2014 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/abt__D"/> | |
2015 <rdf:li rdf:resource="https://identifiers.org/inchi/InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4-/m1/s1"/> | |
2016 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM1018"/> | |
2017 </rdf:Bag> | |
2018 </bqbiol:is> | |
2019 </rdf:Description> | |
2020 </rdf:RDF> | |
2021 </annotation> | |
2022 </species> | |
2023 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-4" fbc:chemicalFormula="C6H10O12P2" hasOnlySubstanceUnits="true" id="M_m01717c" initialConcentration="0" metaid="_2615d46c-444b-4efb-8351-a5365965023d" name="D-mannose-1,6-bisphosphate" sboTerm="SBO:0000247"> | |
2024 <notes> | |
2025 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2026 <p>kegg.compound: C03693</p> | |
2027 <p>pubchem.compound: 3036654</p> | |
2028 <p>metanetx.chemical: MNXM48557</p> | |
2029 <p>formula: C6H10O12P2</p> | |
2030 <p>charge: -4</p> | |
2031 </body> | |
2032 </notes> | |
2033 <annotation> | |
2034 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2035 <rdf:Description rdf:about="#_2615d46c-444b-4efb-8351-a5365965023d"> | |
2036 <bqbiol:is> | |
2037 <rdf:Bag> | |
2038 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03693"/> | |
2039 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/3036654"/> | |
2040 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM48557"/> | |
2041 </rdf:Bag> | |
2042 </bqbiol:is> | |
2043 </rdf:Description> | |
2044 </rdf:RDF> | |
2045 </annotation> | |
2046 </species> | |
2047 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-4" fbc:chemicalFormula="C10H12N5O14P3" hasOnlySubstanceUnits="true" id="M_m02034c" initialConcentration="0" metaid="_949f82be-8e6d-4143-98fb-13e8a920d815" name="GTP" sboTerm="SBO:0000247"> | |
2048 <notes> | |
2049 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2050 <p>kegg.compound: C00044</p> | |
2051 <p>hmdb: HMDB01273</p> | |
2052 <p>bigg.metabolite: gtp</p> | |
2053 <p>chebi: CHEBI:15996</p> | |
2054 <p>pubchem.compound: 6830</p> | |
2055 <p>metanetx.chemical: MNXM51</p> | |
2056 <p>formula: C10H12N5O14P3</p> | |
2057 <p>charge: -4</p> | |
2058 </body> | |
2059 </notes> | |
2060 <annotation> | |
2061 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2062 <rdf:Description rdf:about="#_949f82be-8e6d-4143-98fb-13e8a920d815"> | |
2063 <bqbiol:is> | |
2064 <rdf:Bag> | |
2065 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00044"/> | |
2066 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB01273"/> | |
2067 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/gtp"/> | |
2068 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15996"/> | |
2069 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/6830"/> | |
2070 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM51"/> | |
2071 </rdf:Bag> | |
2072 </bqbiol:is> | |
2073 </rdf:Description> | |
2074 </rdf:RDF> | |
2075 </annotation> | |
2076 </species> | |
2077 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H11O9P" hasOnlySubstanceUnits="true" id="M_m01911c" initialConcentration="0" metaid="_71807f0a-77fc-4a83-83ec-587af94cb10d" name="galactose-1-phosphate" sboTerm="SBO:0000247"> | |
2078 <notes> | |
2079 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2080 <p>kegg.compound: C03384</p> | |
2081 <p>metanetx.chemical: MNXM336</p> | |
2082 <p>formula: C6H11O9P</p> | |
2083 <p>charge: -2</p> | |
2084 </body> | |
2085 </notes> | |
2086 <annotation> | |
2087 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2088 <rdf:Description rdf:about="#_71807f0a-77fc-4a83-83ec-587af94cb10d"> | |
2089 <bqbiol:is> | |
2090 <rdf:Bag> | |
2091 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03384"/> | |
2092 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM336"/> | |
2093 </rdf:Bag> | |
2094 </bqbiol:is> | |
2095 </rdf:Description> | |
2096 </rdf:RDF> | |
2097 </annotation> | |
2098 </species> | |
2099 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O6" hasOnlySubstanceUnits="true" id="M_m01745c" initialConcentration="0" metaid="a276d8cf-f71a-4d12-bd23-bd4bf3944d06" name="D-tagatose" sboTerm="SBO:0000247"> | |
2100 <notes> | |
2101 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2102 <p>kegg.compound: C00795</p> | |
2103 <p>hmdb: HMDB03418</p> | |
2104 <p>bigg.metabolite: tag__D</p> | |
2105 <p>chebi: CHEBI:47693</p> | |
2106 <p>pubchem.compound: 92092</p> | |
2107 <p>metanetx.chemical: MNXM92401</p> | |
2108 <p>formula: C6H12O6</p> | |
2109 </body> | |
2110 </notes> | |
2111 <annotation> | |
2112 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2113 <rdf:Description rdf:about="#a276d8cf-f71a-4d12-bd23-bd4bf3944d06"> | |
2114 <bqbiol:is> | |
2115 <rdf:Bag> | |
2116 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00795"/> | |
2117 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB03418"/> | |
2118 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/tag__D"/> | |
2119 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:47693"/> | |
2120 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/92092"/> | |
2121 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM92401"/> | |
2122 </rdf:Bag> | |
2123 </bqbiol:is> | |
2124 </rdf:Description> | |
2125 </rdf:RDF> | |
2126 </annotation> | |
2127 </species> | |
2128 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H11O9P" hasOnlySubstanceUnits="true" id="M_m01842c" initialConcentration="0" metaid="_5c5c742d-cd6a-48ff-87bb-0027c8b6eefe" name="fructose-1-phosphate" sboTerm="SBO:0000247"> | |
2129 <notes> | |
2130 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2131 <p>kegg.compound: C01094</p> | |
2132 <p>bigg.metabolite: f1p</p> | |
2133 <p>chebi: CHEBI:18105</p> | |
2134 <p>pubchem.compound: 10400369</p> | |
2135 <p>metanetx.chemical: MNXM145568</p> | |
2136 <p>formula: C6H11O9P</p> | |
2137 <p>charge: -2</p> | |
2138 </body> | |
2139 </notes> | |
2140 <annotation> | |
2141 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2142 <rdf:Description rdf:about="#_5c5c742d-cd6a-48ff-87bb-0027c8b6eefe"> | |
2143 <bqbiol:is> | |
2144 <rdf:Bag> | |
2145 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01094"/> | |
2146 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/f1p"/> | |
2147 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:18105"/> | |
2148 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/10400369"/> | |
2149 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM145568"/> | |
2150 </rdf:Bag> | |
2151 </bqbiol:is> | |
2152 </rdf:Description> | |
2153 </rdf:RDF> | |
2154 </annotation> | |
2155 </species> | |
2156 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C16H23N5O16P2" hasOnlySubstanceUnits="true" id="M_m01951c" initialConcentration="0" metaid="e11e80c6-cd80-4ea3-96ca-05f1b24ed09b" name="GDP-mannose" sboTerm="SBO:0000247"> | |
2157 <notes> | |
2158 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2159 <p>kegg.compound: C00096</p> | |
2160 <p>bigg.metabolite: gdpmann</p> | |
2161 <p>chebi: CHEBI:15820</p> | |
2162 <p>pubchem.compound: 18396</p> | |
2163 <p>metanetx.chemical: MNXM82</p> | |
2164 <p>formula: C16H23N5O16P2</p> | |
2165 <p>charge: -2</p> | |
2166 </body> | |
2167 </notes> | |
2168 <annotation> | |
2169 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2170 <rdf:Description rdf:about="#e11e80c6-cd80-4ea3-96ca-05f1b24ed09b"> | |
2171 <bqbiol:is> | |
2172 <rdf:Bag> | |
2173 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00096"/> | |
2174 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/gdpmann"/> | |
2175 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15820"/> | |
2176 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/18396"/> | |
2177 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM82"/> | |
2178 </rdf:Bag> | |
2179 </bqbiol:is> | |
2180 </rdf:Description> | |
2181 </rdf:RDF> | |
2182 </annotation> | |
2183 </species> | |
2184 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C5H9O8P" hasOnlySubstanceUnits="true" id="M_m02846c" initialConcentration="0" metaid="f88cd838-6cfd-4de1-80dd-47d8a4a5ec8c" name="ribulose-5-phosphate" sboTerm="SBO:0000247"> | |
2185 <notes> | |
2186 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2187 <p>kegg.compound: C00199</p> | |
2188 <p>bigg.metabolite: ru5p__D</p> | |
2189 <p>chebi: CHEBI:17363</p> | |
2190 <p>pubchem.compound: 439184</p> | |
2191 <p>metanetx.chemical: MNXM145 || MNXM186</p> | |
2192 <p>formula: C5H9O8P</p> | |
2193 <p>charge: -2</p> | |
2194 </body> | |
2195 </notes> | |
2196 <annotation> | |
2197 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2198 <rdf:Description rdf:about="#f88cd838-6cfd-4de1-80dd-47d8a4a5ec8c"> | |
2199 <bqbiol:is> | |
2200 <rdf:Bag> | |
2201 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00199"/> | |
2202 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/ru5p__D"/> | |
2203 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17363"/> | |
2204 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439184"/> | |
2205 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM145"/> | |
2206 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM186"/> | |
2207 </rdf:Bag> | |
2208 </bqbiol:is> | |
2209 </rdf:Description> | |
2210 </rdf:RDF> | |
2211 </annotation> | |
2212 </species> | |
2213 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C4H7O7P" hasOnlySubstanceUnits="true" id="M_m01785c" initialConcentration="0" metaid="_81dee1de-9ff0-4d2b-8f6f-99cf059accdf" name="erythrose-4-phosphate" sboTerm="SBO:0000247"> | |
2214 <notes> | |
2215 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2216 <p>kegg.compound: C00279</p> | |
2217 <p>bigg.metabolite: e4p</p> | |
2218 <p>chebi: CHEBI:48153</p> | |
2219 <p>pubchem.compound: 122357</p> | |
2220 <p>metanetx.chemical: MNXM258</p> | |
2221 <p>formula: C4H7O7P</p> | |
2222 <p>charge: -2</p> | |
2223 </body> | |
2224 </notes> | |
2225 <annotation> | |
2226 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2227 <rdf:Description rdf:about="#_81dee1de-9ff0-4d2b-8f6f-99cf059accdf"> | |
2228 <bqbiol:is> | |
2229 <rdf:Bag> | |
2230 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00279"/> | |
2231 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/e4p"/> | |
2232 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:48153"/> | |
2233 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/122357"/> | |
2234 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM258"/> | |
2235 </rdf:Bag> | |
2236 </bqbiol:is> | |
2237 </rdf:Description> | |
2238 </rdf:RDF> | |
2239 </annotation> | |
2240 </species> | |
2241 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C5H9O8P" hasOnlySubstanceUnits="true" id="M_m01761c" initialConcentration="0" metaid="e6b875ce-6d49-4f17-bac7-17eeb57f18fa" name="D-xylulose-5-phosphate" sboTerm="SBO:0000247"> | |
2242 <notes> | |
2243 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2244 <p>kegg.compound: C00231</p> | |
2245 <p>bigg.metabolite: xu5p__D</p> | |
2246 <p>chebi: CHEBI:16332</p> | |
2247 <p>pubchem.compound: 439190</p> | |
2248 <p>metanetx.chemical: MNXM186</p> | |
2249 <p>formula: C5H9O8P</p> | |
2250 <p>charge: -2</p> | |
2251 </body> | |
2252 </notes> | |
2253 <annotation> | |
2254 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2255 <rdf:Description rdf:about="#e6b875ce-6d49-4f17-bac7-17eeb57f18fa"> | |
2256 <bqbiol:is> | |
2257 <rdf:Bag> | |
2258 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00231"/> | |
2259 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/xu5p__D"/> | |
2260 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16332"/> | |
2261 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439190"/> | |
2262 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM186"/> | |
2263 </rdf:Bag> | |
2264 </bqbiol:is> | |
2265 </rdf:Description> | |
2266 </rdf:RDF> | |
2267 </annotation> | |
2268 </species> | |
2269 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-5" fbc:chemicalFormula="C5H8O14P3" hasOnlySubstanceUnits="true" id="M_m02806c" initialConcentration="0" metaid="_1c326a8e-e821-4f60-b8b0-51d295a2d118" name="PRPP" sboTerm="SBO:0000247"> | |
2270 <notes> | |
2271 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2272 <p>kegg.compound: C00119</p> | |
2273 <p>bigg.metabolite: prpp</p> | |
2274 <p>chebi: CHEBI:17111</p> | |
2275 <p>pubchem.compound: 7339</p> | |
2276 <p>metanetx.chemical: MNXM91</p> | |
2277 <p>formula: C5H8O14P3</p> | |
2278 <p>charge: -5</p> | |
2279 </body> | |
2280 </notes> | |
2281 <annotation> | |
2282 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2283 <rdf:Description rdf:about="#_1c326a8e-e821-4f60-b8b0-51d295a2d118"> | |
2284 <bqbiol:is> | |
2285 <rdf:Bag> | |
2286 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00119"/> | |
2287 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/prpp"/> | |
2288 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17111"/> | |
2289 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/7339"/> | |
2290 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM91"/> | |
2291 </rdf:Bag> | |
2292 </bqbiol:is> | |
2293 </rdf:Description> | |
2294 </rdf:RDF> | |
2295 </annotation> | |
2296 </species> | |
2297 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C5H9O7P" hasOnlySubstanceUnits="true" id="M_m00639c" initialConcentration="0" metaid="_669cde35-0c63-4dca-9a0d-3b24adb00ab7" name="2-deoxy-D-ribose-1-phosphate" sboTerm="SBO:0000247"> | |
2298 <notes> | |
2299 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2300 <p>kegg.compound: C00672</p> | |
2301 <p>bigg.metabolite: 2dr1p</p> | |
2302 <p>chebi: CHEBI:28542</p> | |
2303 <p>pubchem.compound: 5460448</p> | |
2304 <p>metanetx.chemical: MNXM789</p> | |
2305 <p>formula: C5H9O7P</p> | |
2306 <p>charge: -2</p> | |
2307 </body> | |
2308 </notes> | |
2309 <annotation> | |
2310 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2311 <rdf:Description rdf:about="#_669cde35-0c63-4dca-9a0d-3b24adb00ab7"> | |
2312 <bqbiol:is> | |
2313 <rdf:Bag> | |
2314 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00672"/> | |
2315 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/2dr1p"/> | |
2316 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:28542"/> | |
2317 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5460448"/> | |
2318 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM789"/> | |
2319 </rdf:Bag> | |
2320 </bqbiol:is> | |
2321 </rdf:Description> | |
2322 </rdf:RDF> | |
2323 </annotation> | |
2324 </species> | |
2325 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C15H22N2O17P2" hasOnlySubstanceUnits="true" id="M_m03107c" initialConcentration="0" metaid="_13becef8-df25-45f6-b797-6efd47ae03e2" name="UDP-galactose" sboTerm="SBO:0000247"> | |
2326 <notes> | |
2327 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2328 <p>kegg.compound: C00052</p> | |
2329 <p>hmdb: HMDB00302</p> | |
2330 <p>bigg.metabolite: udpgal</p> | |
2331 <p>chebi: CHEBI:67119</p> | |
2332 <p>pubchem.compound: 18068</p> | |
2333 <p>metanetx.chemical: MNXM89795</p> | |
2334 <p>formula: C15H22N2O17P2</p> | |
2335 <p>charge: -2</p> | |
2336 </body> | |
2337 </notes> | |
2338 <annotation> | |
2339 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2340 <rdf:Description rdf:about="#_13becef8-df25-45f6-b797-6efd47ae03e2"> | |
2341 <bqbiol:is> | |
2342 <rdf:Bag> | |
2343 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00052"/> | |
2344 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00302"/> | |
2345 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/udpgal"/> | |
2346 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:67119"/> | |
2347 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/18068"/> | |
2348 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM89795"/> | |
2349 </rdf:Bag> | |
2350 </bqbiol:is> | |
2351 </rdf:Description> | |
2352 </rdf:RDF> | |
2353 </annotation> | |
2354 </species> | |
2355 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-4" fbc:chemicalFormula="C6H10O12P2" hasOnlySubstanceUnits="true" id="M_m02955c" initialConcentration="0" metaid="_8cb2adcf-2881-4f20-8029-273b42f851bb" name="tagatose-1,6-bisphosphate" sboTerm="SBO:0000247"> | |
2356 <notes> | |
2357 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2358 <p>kegg.compound: C03785</p> | |
2359 <p>chebi: CHEBI:4250</p> | |
2360 <p>pubchem.compound: 440117</p> | |
2361 <p>metanetx.chemical: MNXM1324 || MNXM164715</p> | |
2362 <p>formula: C6H10O12P2</p> | |
2363 <p>charge: -4</p> | |
2364 </body> | |
2365 </notes> | |
2366 <annotation> | |
2367 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2368 <rdf:Description rdf:about="#_8cb2adcf-2881-4f20-8029-273b42f851bb"> | |
2369 <bqbiol:is> | |
2370 <rdf:Bag> | |
2371 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03785"/> | |
2372 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:4250"/> | |
2373 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/440117"/> | |
2374 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM1324"/> | |
2375 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM164715"/> | |
2376 </rdf:Bag> | |
2377 </bqbiol:is> | |
2378 </rdf:Description> | |
2379 </rdf:RDF> | |
2380 </annotation> | |
2381 </species> | |
2382 <species boundaryCondition="false" compartment="g" constant="false" fbc:charge="-2" fbc:chemicalFormula="C15H22N2O17P2" hasOnlySubstanceUnits="true" id="M_m03107g" initialConcentration="0" metaid="def6fe8a-f42f-410d-9563-fee60d2fb154" name="UDP-galactose" sboTerm="SBO:0000247"> | |
2383 <notes> | |
2384 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2385 <p>kegg.compound: C00052</p> | |
2386 <p>hmdb: HMDB00302</p> | |
2387 <p>bigg.metabolite: udpgal</p> | |
2388 <p>chebi: CHEBI:67119</p> | |
2389 <p>pubchem.compound: 18068</p> | |
2390 <p>metanetx.chemical: MNXM89795</p> | |
2391 <p>formula: C15H22N2O17P2</p> | |
2392 <p>charge: -2</p> | |
2393 </body> | |
2394 </notes> | |
2395 <annotation> | |
2396 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2397 <rdf:Description rdf:about="#def6fe8a-f42f-410d-9563-fee60d2fb154"> | |
2398 <bqbiol:is> | |
2399 <rdf:Bag> | |
2400 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00052"/> | |
2401 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00302"/> | |
2402 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/udpgal"/> | |
2403 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:67119"/> | |
2404 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/18068"/> | |
2405 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM89795"/> | |
2406 </rdf:Bag> | |
2407 </bqbiol:is> | |
2408 </rdf:Description> | |
2409 </rdf:RDF> | |
2410 </annotation> | |
2411 </species> | |
2412 <species boundaryCondition="false" compartment="r" constant="false" fbc:charge="-2" fbc:chemicalFormula="C5H9O8P" hasOnlySubstanceUnits="true" id="M_m02846r" initialConcentration="0" metaid="_627f203c-3273-472d-98be-2227cb9aa716" name="ribulose-5-phosphate" sboTerm="SBO:0000247"> | |
2413 <notes> | |
2414 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2415 <p>kegg.compound: C00199</p> | |
2416 <p>bigg.metabolite: ru5p__D</p> | |
2417 <p>chebi: CHEBI:17363</p> | |
2418 <p>pubchem.compound: 439184</p> | |
2419 <p>metanetx.chemical: MNXM145 || MNXM186</p> | |
2420 <p>formula: C5H9O8P</p> | |
2421 <p>charge: -2</p> | |
2422 </body> | |
2423 </notes> | |
2424 <annotation> | |
2425 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2426 <rdf:Description rdf:about="#_627f203c-3273-472d-98be-2227cb9aa716"> | |
2427 <bqbiol:is> | |
2428 <rdf:Bag> | |
2429 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00199"/> | |
2430 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/ru5p__D"/> | |
2431 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17363"/> | |
2432 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439184"/> | |
2433 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM145"/> | |
2434 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM186"/> | |
2435 </rdf:Bag> | |
2436 </bqbiol:is> | |
2437 </rdf:Description> | |
2438 </rdf:RDF> | |
2439 </annotation> | |
2440 </species> | |
2441 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O5" hasOnlySubstanceUnits="true" id="M_m02373c" initialConcentration="0" metaid="_6b685091-21fd-4e43-8051-0606e34176e9" name="L-fuculose" sboTerm="SBO:0000247"> | |
2442 <notes> | |
2443 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2444 <p>kegg.compound: C01721</p> | |
2445 <p>chebi: CHEBI:17617</p> | |
2446 <p>pubchem.compound: 6857362</p> | |
2447 <p>metanetx.chemical: MNXM1748</p> | |
2448 <p>formula: C6H12O5</p> | |
2449 </body> | |
2450 </notes> | |
2451 <annotation> | |
2452 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2453 <rdf:Description rdf:about="#_6b685091-21fd-4e43-8051-0606e34176e9"> | |
2454 <bqbiol:is> | |
2455 <rdf:Bag> | |
2456 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01721"/> | |
2457 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17617"/> | |
2458 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/6857362"/> | |
2459 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM1748"/> | |
2460 </rdf:Bag> | |
2461 </bqbiol:is> | |
2462 </rdf:Description> | |
2463 </rdf:RDF> | |
2464 </annotation> | |
2465 </species> | |
2466 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O6" hasOnlySubstanceUnits="true" id="M_m02453c" initialConcentration="0" metaid="_387d9eaf-8114-454d-9cbb-b68867f9fd37" name="mannose" sboTerm="SBO:0000247"> | |
2467 <notes> | |
2468 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2469 <p>kegg.compound: C00159</p> | |
2470 <p>hmdb: HMDB00169</p> | |
2471 <p>bigg.metabolite: man</p> | |
2472 <p>chebi: CHEBI:4208</p> | |
2473 <p>pubchem.compound: 18950</p> | |
2474 <p>metanetx.chemical: MNXM182</p> | |
2475 <p>formula: C6H12O6</p> | |
2476 </body> | |
2477 </notes> | |
2478 <annotation> | |
2479 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2480 <rdf:Description rdf:about="#_387d9eaf-8114-454d-9cbb-b68867f9fd37"> | |
2481 <bqbiol:is> | |
2482 <rdf:Bag> | |
2483 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00159"/> | |
2484 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00169"/> | |
2485 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/man"/> | |
2486 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:4208"/> | |
2487 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/18950"/> | |
2488 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM182"/> | |
2489 </rdf:Bag> | |
2490 </bqbiol:is> | |
2491 </rdf:Description> | |
2492 </rdf:RDF> | |
2493 </annotation> | |
2494 </species> | |
2495 <species boundaryCondition="false" compartment="s" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H10O6" hasOnlySubstanceUnits="true" id="M_m00810s" initialConcentration="0" metaid="_888b4b49-c5cf-4b3d-ae82-cbfdc5192782" name="3-keto-beta-D-galactose" sboTerm="SBO:0000247"> | |
2496 <notes> | |
2497 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2498 <p>kegg.compound: C05394</p> | |
2499 <p>chebi: CHEBI:27453</p> | |
2500 <p>pubchem.compound: 440653</p> | |
2501 <p>metanetx.chemical: MNXM4339</p> | |
2502 <p>formula: C6H10O6</p> | |
2503 </body> | |
2504 </notes> | |
2505 <annotation> | |
2506 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2507 <rdf:Description rdf:about="#_888b4b49-c5cf-4b3d-ae82-cbfdc5192782"> | |
2508 <bqbiol:is> | |
2509 <rdf:Bag> | |
2510 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05394"/> | |
2511 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:27453"/> | |
2512 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/440653"/> | |
2513 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM4339"/> | |
2514 </rdf:Bag> | |
2515 </bqbiol:is> | |
2516 </rdf:Description> | |
2517 </rdf:RDF> | |
2518 </annotation> | |
2519 </species> | |
2520 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H10O5" hasOnlySubstanceUnits="true" id="M_m02425c" initialConcentration="0" metaid="_1ec20d61-01eb-4ae4-b50f-08dfa29f333c" name="L-xylulose" sboTerm="SBO:0000247"> | |
2521 <notes> | |
2522 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2523 <p>kegg.compound: C00312</p> | |
2524 <p>hmdb: HMDB00751</p> | |
2525 <p>bigg.metabolite: xylu__L</p> | |
2526 <p>chebi: CHEBI:17399</p> | |
2527 <p>inchi: InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h3,5-8,10H,1-2H2/t3-,5+/m0/s1</p> | |
2528 <p>pubchem.compound: 22253</p> | |
2529 <p>metanetx.chemical: MNXM597</p> | |
2530 <p>formula: C5H10O5</p> | |
2531 </body> | |
2532 </notes> | |
2533 <annotation> | |
2534 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2535 <rdf:Description rdf:about="#_1ec20d61-01eb-4ae4-b50f-08dfa29f333c"> | |
2536 <bqbiol:is> | |
2537 <rdf:Bag> | |
2538 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00312"/> | |
2539 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00751"/> | |
2540 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/xylu__L"/> | |
2541 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17399"/> | |
2542 <rdf:li rdf:resource="https://identifiers.org/inchi/InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h3,5-8,10H,1-2H2/t3-,5+/m0/s1"/> | |
2543 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/22253"/> | |
2544 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM597"/> | |
2545 </rdf:Bag> | |
2546 </bqbiol:is> | |
2547 </rdf:Description> | |
2548 </rdf:RDF> | |
2549 </annotation> | |
2550 </species> | |
2551 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O6" hasOnlySubstanceUnits="true" id="M_m01910c" initialConcentration="0" metaid="_74a87466-9b69-4cc8-9d29-8036f2c76d6a" name="galactose" sboTerm="SBO:0000247"> | |
2552 <notes> | |
2553 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2554 <p>kegg.compound: C00984</p> | |
2555 <p>hmdb: HMDB00143</p> | |
2556 <p>bigg.metabolite: gal</p> | |
2557 <p>chebi: CHEBI:28061</p> | |
2558 <p>pubchem.compound: 439357</p> | |
2559 <p>metanetx.chemical: MNXM112 || MNXM390</p> | |
2560 <p>formula: C6H12O6</p> | |
2561 </body> | |
2562 </notes> | |
2563 <annotation> | |
2564 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2565 <rdf:Description rdf:about="#_74a87466-9b69-4cc8-9d29-8036f2c76d6a"> | |
2566 <bqbiol:is> | |
2567 <rdf:Bag> | |
2568 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00984"/> | |
2569 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00143"/> | |
2570 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/gal"/> | |
2571 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:28061"/> | |
2572 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439357"/> | |
2573 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM112"/> | |
2574 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM390"/> | |
2575 </rdf:Bag> | |
2576 </bqbiol:is> | |
2577 </rdf:Description> | |
2578 </rdf:RDF> | |
2579 </annotation> | |
2580 </species> | |
2581 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H11NO2" hasOnlySubstanceUnits="true" id="M_m02724c" initialConcentration="0" metaid="c4ed6ede-5c56-4346-acbd-7efd7f34b58b" name="phenylalanine" sboTerm="SBO:0000247"> | |
2582 <notes> | |
2583 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2584 <p>kegg.compound: C00079</p> | |
2585 <p>hmdb: HMDB00159</p> | |
2586 <p>bigg.metabolite: phe__L</p> | |
2587 <p>chebi: CHEBI:17295</p> | |
2588 <p>pubchem.compound: 6140</p> | |
2589 <p>metanetx.chemical: MNXM97</p> | |
2590 <p>formula: C9H11NO2</p> | |
2591 </body> | |
2592 </notes> | |
2593 <annotation> | |
2594 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2595 <rdf:Description rdf:about="#c4ed6ede-5c56-4346-acbd-7efd7f34b58b"> | |
2596 <bqbiol:is> | |
2597 <rdf:Bag> | |
2598 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00079"/> | |
2599 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00159"/> | |
2600 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/phe__L"/> | |
2601 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17295"/> | |
2602 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/6140"/> | |
2603 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM97"/> | |
2604 </rdf:Bag> | |
2605 </bqbiol:is> | |
2606 </rdf:Description> | |
2607 </rdf:RDF> | |
2608 </annotation> | |
2609 </species> | |
2610 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C5H9O8P" hasOnlySubstanceUnits="true" id="M_m02845c" initialConcentration="0" metaid="_7d86d6c1-f376-4349-a4ec-cc8fb8350868" name="ribose-5-phosphate" sboTerm="SBO:0000247"> | |
2611 <notes> | |
2612 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2613 <p>kegg.compound: C00117</p> | |
2614 <p>bigg.metabolite: r5p</p> | |
2615 <p>chebi: CHEBI:17797</p> | |
2616 <p>pubchem.compound: 440101</p> | |
2617 <p>metanetx.chemical: MNXM116 || MNXM15900</p> | |
2618 <p>formula: C5H9O8P</p> | |
2619 <p>charge: -2</p> | |
2620 </body> | |
2621 </notes> | |
2622 <annotation> | |
2623 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2624 <rdf:Description rdf:about="#_7d86d6c1-f376-4349-a4ec-cc8fb8350868"> | |
2625 <bqbiol:is> | |
2626 <rdf:Bag> | |
2627 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00117"/> | |
2628 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/r5p"/> | |
2629 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17797"/> | |
2630 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/440101"/> | |
2631 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM116"/> | |
2632 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM15900"/> | |
2633 </rdf:Bag> | |
2634 </bqbiol:is> | |
2635 </rdf:Description> | |
2636 </rdf:RDF> | |
2637 </annotation> | |
2638 </species> | |
2639 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-4" fbc:chemicalFormula="C9H12N3O14P3" hasOnlySubstanceUnits="true" id="M_m01623c" initialConcentration="0" metaid="b14f1569-0718-46ce-81e7-1b85790417ad" name="CTP" sboTerm="SBO:0000247"> | |
2640 <notes> | |
2641 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2642 <p>kegg.compound: C00063</p> | |
2643 <p>bigg.metabolite: ctp</p> | |
2644 <p>chebi: CHEBI:17677</p> | |
2645 <p>pubchem.compound: 6176</p> | |
2646 <p>metanetx.chemical: MNXM63</p> | |
2647 <p>formula: C9H12N3O14P3</p> | |
2648 <p>charge: -4</p> | |
2649 </body> | |
2650 </notes> | |
2651 <annotation> | |
2652 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2653 <rdf:Description rdf:about="#b14f1569-0718-46ce-81e7-1b85790417ad"> | |
2654 <bqbiol:is> | |
2655 <rdf:Bag> | |
2656 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00063"/> | |
2657 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/ctp"/> | |
2658 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17677"/> | |
2659 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/6176"/> | |
2660 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM63"/> | |
2661 </rdf:Bag> | |
2662 </bqbiol:is> | |
2663 </rdf:Description> | |
2664 </rdf:RDF> | |
2665 </annotation> | |
2666 </species> | |
2667 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C16H23N5O15P2" hasOnlySubstanceUnits="true" id="M_m01950c" initialConcentration="0" metaid="_945a262e-c045-4dfe-a70d-e948ad2a61ff" name="GDP-L-fucose" sboTerm="SBO:0000247"> | |
2668 <notes> | |
2669 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2670 <p>kegg.compound: C00325</p> | |
2671 <p>bigg.metabolite: gdpfuc</p> | |
2672 <p>chebi: CHEBI:17009</p> | |
2673 <p>pubchem.compound: 439211</p> | |
2674 <p>metanetx.chemical: MNXM193</p> | |
2675 <p>formula: C16H23N5O15P2</p> | |
2676 <p>charge: -2</p> | |
2677 </body> | |
2678 </notes> | |
2679 <annotation> | |
2680 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2681 <rdf:Description rdf:about="#_945a262e-c045-4dfe-a70d-e948ad2a61ff"> | |
2682 <bqbiol:is> | |
2683 <rdf:Bag> | |
2684 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00325"/> | |
2685 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/gdpfuc"/> | |
2686 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17009"/> | |
2687 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439211"/> | |
2688 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM193"/> | |
2689 </rdf:Bag> | |
2690 </bqbiol:is> | |
2691 </rdf:Description> | |
2692 </rdf:RDF> | |
2693 </annotation> | |
2694 </species> | |
2695 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C2H5NO2" hasOnlySubstanceUnits="true" id="M_m01986c" initialConcentration="0" metaid="_9866d694-865b-4df9-ab20-eb10d114f23c" name="glycine" sboTerm="SBO:0000247"> | |
2696 <notes> | |
2697 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2698 <p>kegg.compound: C00037</p> | |
2699 <p>hmdb: HMDB00123</p> | |
2700 <p>bigg.metabolite: gly</p> | |
2701 <p>chebi: CHEBI:15428</p> | |
2702 <p>inchi: InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)</p> | |
2703 <p>pubchem.compound: 750</p> | |
2704 <p>metanetx.chemical: MNXM29</p> | |
2705 <p>formula: C2H5NO2</p> | |
2706 </body> | |
2707 </notes> | |
2708 <annotation> | |
2709 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2710 <rdf:Description rdf:about="#_9866d694-865b-4df9-ab20-eb10d114f23c"> | |
2711 <bqbiol:is> | |
2712 <rdf:Bag> | |
2713 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00037"/> | |
2714 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00123"/> | |
2715 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/gly"/> | |
2716 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15428"/> | |
2717 <rdf:li rdf:resource="https://identifiers.org/inchi/InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)"/> | |
2718 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/750"/> | |
2719 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM29"/> | |
2720 </rdf:Bag> | |
2721 </bqbiol:is> | |
2722 </rdf:Description> | |
2723 </rdf:RDF> | |
2724 </annotation> | |
2725 </species> | |
2726 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-3" fbc:chemicalFormula="C9H11N2O12P2" hasOnlySubstanceUnits="true" id="M_m03106c" initialConcentration="0" metaid="_97e640b3-1f1b-4e3b-abda-a1e2d84549fb" name="UDP" sboTerm="SBO:0000247"> | |
2727 <notes> | |
2728 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2729 <p>kegg.compound: C00015</p> | |
2730 <p>hmdb: HMDB00295</p> | |
2731 <p>bigg.metabolite: udp</p> | |
2732 <p>chebi: CHEBI:17659</p> | |
2733 <p>pubchem.compound: 6031</p> | |
2734 <p>metanetx.chemical: MNXM17</p> | |
2735 <p>formula: C9H11N2O12P2</p> | |
2736 <p>charge: -3</p> | |
2737 </body> | |
2738 </notes> | |
2739 <annotation> | |
2740 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2741 <rdf:Description rdf:about="#_97e640b3-1f1b-4e3b-abda-a1e2d84549fb"> | |
2742 <bqbiol:is> | |
2743 <rdf:Bag> | |
2744 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00015"/> | |
2745 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00295"/> | |
2746 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/udp"/> | |
2747 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17659"/> | |
2748 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/6031"/> | |
2749 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM17"/> | |
2750 </rdf:Bag> | |
2751 </bqbiol:is> | |
2752 </rdf:Description> | |
2753 </rdf:RDF> | |
2754 </annotation> | |
2755 </species> | |
2756 <species boundaryCondition="false" compartment="l" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O6" hasOnlySubstanceUnits="true" id="M_m01910l" initialConcentration="0" metaid="_76b653c7-d3c8-43c3-86cd-767b18a4ec92" name="galactose" sboTerm="SBO:0000247"> | |
2757 <notes> | |
2758 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2759 <p>kegg.compound: C00984</p> | |
2760 <p>hmdb: HMDB00143</p> | |
2761 <p>bigg.metabolite: gal</p> | |
2762 <p>chebi: CHEBI:28061</p> | |
2763 <p>pubchem.compound: 439357</p> | |
2764 <p>metanetx.chemical: MNXM112 || MNXM390</p> | |
2765 <p>formula: C6H12O6</p> | |
2766 </body> | |
2767 </notes> | |
2768 <annotation> | |
2769 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2770 <rdf:Description rdf:about="#_76b653c7-d3c8-43c3-86cd-767b18a4ec92"> | |
2771 <bqbiol:is> | |
2772 <rdf:Bag> | |
2773 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00984"/> | |
2774 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00143"/> | |
2775 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/gal"/> | |
2776 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:28061"/> | |
2777 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439357"/> | |
2778 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM112"/> | |
2779 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM390"/> | |
2780 </rdf:Bag> | |
2781 </bqbiol:is> | |
2782 </rdf:Description> | |
2783 </rdf:RDF> | |
2784 </annotation> | |
2785 </species> | |
2786 <species boundaryCondition="false" compartment="s" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H22O11" hasOnlySubstanceUnits="true" id="M_m02332s" initialConcentration="0" metaid="acda4521-1f6a-4dff-8902-9ff667fc71dd" name="lactose" sboTerm="SBO:0000247"> | |
2787 <notes> | |
2788 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2789 <p>kegg.compound: C00243</p> | |
2790 <p>hmdb: HMDB00186</p> | |
2791 <p>bigg.metabolite: lcts</p> | |
2792 <p>chebi: CHEBI:36219</p> | |
2793 <p>pubchem.compound: 84571</p> | |
2794 <p>metanetx.chemical: MNXM362</p> | |
2795 <p>formula: C12H22O11</p> | |
2796 </body> | |
2797 </notes> | |
2798 <annotation> | |
2799 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2800 <rdf:Description rdf:about="#acda4521-1f6a-4dff-8902-9ff667fc71dd"> | |
2801 <bqbiol:is> | |
2802 <rdf:Bag> | |
2803 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00243"/> | |
2804 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00186"/> | |
2805 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/lcts"/> | |
2806 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:36219"/> | |
2807 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/84571"/> | |
2808 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM362"/> | |
2809 </rdf:Bag> | |
2810 </bqbiol:is> | |
2811 </rdf:Description> | |
2812 </rdf:RDF> | |
2813 </annotation> | |
2814 </species> | |
2815 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O5" hasOnlySubstanceUnits="true" id="M_m01159c" initialConcentration="0" metaid="_5d92060a-34c2-413d-a5c9-b2061168b482" name="6-deoxy-L-galactose" sboTerm="SBO:0000247"> | |
2816 <notes> | |
2817 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2818 <p>kegg.compound: C01019</p> | |
2819 <p>hmdb: HMDB00174</p> | |
2820 <p>bigg.metabolite: fuc__L</p> | |
2821 <p>chebi: CHEBI:2181</p> | |
2822 <p>pubchem.compound: 17106</p> | |
2823 <p>metanetx.chemical: MNXM40586 || MNXM659</p> | |
2824 <p>formula: C6H12O5</p> | |
2825 </body> | |
2826 </notes> | |
2827 <annotation> | |
2828 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2829 <rdf:Description rdf:about="#_5d92060a-34c2-413d-a5c9-b2061168b482"> | |
2830 <bqbiol:is> | |
2831 <rdf:Bag> | |
2832 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01019"/> | |
2833 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00174"/> | |
2834 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/fuc__L"/> | |
2835 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:2181"/> | |
2836 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/17106"/> | |
2837 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM40586"/> | |
2838 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM659"/> | |
2839 </rdf:Bag> | |
2840 </bqbiol:is> | |
2841 </rdf:Description> | |
2842 </rdf:RDF> | |
2843 </annotation> | |
2844 </species> | |
2845 <species boundaryCondition="false" compartment="g" constant="false" fbc:charge="-3" fbc:chemicalFormula="C9H11N2O12P2" hasOnlySubstanceUnits="true" id="M_m03106g" initialConcentration="0" metaid="_00d6b0f7-372e-4bcd-b4e4-734060396c74" name="UDP" sboTerm="SBO:0000247"> | |
2846 <notes> | |
2847 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2848 <p>kegg.compound: C00015</p> | |
2849 <p>hmdb: HMDB00295</p> | |
2850 <p>bigg.metabolite: udp</p> | |
2851 <p>chebi: CHEBI:17659</p> | |
2852 <p>pubchem.compound: 6031</p> | |
2853 <p>metanetx.chemical: MNXM17</p> | |
2854 <p>formula: C9H11N2O12P2</p> | |
2855 <p>charge: -3</p> | |
2856 </body> | |
2857 </notes> | |
2858 <annotation> | |
2859 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2860 <rdf:Description rdf:about="#_00d6b0f7-372e-4bcd-b4e4-734060396c74"> | |
2861 <bqbiol:is> | |
2862 <rdf:Bag> | |
2863 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00015"/> | |
2864 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00295"/> | |
2865 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/udp"/> | |
2866 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17659"/> | |
2867 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/6031"/> | |
2868 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM17"/> | |
2869 </rdf:Bag> | |
2870 </bqbiol:is> | |
2871 </rdf:Description> | |
2872 </rdf:RDF> | |
2873 </annotation> | |
2874 </species> | |
2875 <species boundaryCondition="false" compartment="s" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O6" hasOnlySubstanceUnits="true" id="M_m01910s" initialConcentration="0" metaid="_3719fc9b-15c2-48f2-af95-91380ed8985c" name="galactose" sboTerm="SBO:0000247"> | |
2876 <notes> | |
2877 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2878 <p>kegg.compound: C00984</p> | |
2879 <p>hmdb: HMDB00143</p> | |
2880 <p>bigg.metabolite: gal</p> | |
2881 <p>chebi: CHEBI:28061</p> | |
2882 <p>pubchem.compound: 439357</p> | |
2883 <p>metanetx.chemical: MNXM112 || MNXM390</p> | |
2884 <p>formula: C6H12O6</p> | |
2885 </body> | |
2886 </notes> | |
2887 <annotation> | |
2888 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2889 <rdf:Description rdf:about="#_3719fc9b-15c2-48f2-af95-91380ed8985c"> | |
2890 <bqbiol:is> | |
2891 <rdf:Bag> | |
2892 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00984"/> | |
2893 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00143"/> | |
2894 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/gal"/> | |
2895 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:28061"/> | |
2896 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439357"/> | |
2897 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM112"/> | |
2898 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM390"/> | |
2899 </rdf:Bag> | |
2900 </bqbiol:is> | |
2901 </rdf:Description> | |
2902 </rdf:RDF> | |
2903 </annotation> | |
2904 </species> | |
2905 <species boundaryCondition="false" compartment="r" constant="false" fbc:charge="-2" fbc:chemicalFormula="C5H9O8P" hasOnlySubstanceUnits="true" id="M_m02845r" initialConcentration="0" metaid="c375b7d8-5974-4e81-bae4-6ffd881176d0" name="ribose-5-phosphate" sboTerm="SBO:0000247"> | |
2906 <notes> | |
2907 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2908 <p>kegg.compound: C00117</p> | |
2909 <p>bigg.metabolite: r5p</p> | |
2910 <p>chebi: CHEBI:17797</p> | |
2911 <p>pubchem.compound: 440101</p> | |
2912 <p>metanetx.chemical: MNXM116 || MNXM15900</p> | |
2913 <p>formula: C5H9O8P</p> | |
2914 <p>charge: -2</p> | |
2915 </body> | |
2916 </notes> | |
2917 <annotation> | |
2918 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2919 <rdf:Description rdf:about="#c375b7d8-5974-4e81-bae4-6ffd881176d0"> | |
2920 <bqbiol:is> | |
2921 <rdf:Bag> | |
2922 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00117"/> | |
2923 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/r5p"/> | |
2924 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17797"/> | |
2925 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/440101"/> | |
2926 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM116"/> | |
2927 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM15900"/> | |
2928 </rdf:Bag> | |
2929 </bqbiol:is> | |
2930 </rdf:Description> | |
2931 </rdf:RDF> | |
2932 </annotation> | |
2933 </species> | |
2934 <species boundaryCondition="false" compartment="l" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H22O11" hasOnlySubstanceUnits="true" id="M_m02332l" initialConcentration="0" metaid="_18aca9f4-b145-4984-986a-5b4334761e06" name="lactose" sboTerm="SBO:0000247"> | |
2935 <notes> | |
2936 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2937 <p>kegg.compound: C00243</p> | |
2938 <p>hmdb: HMDB00186</p> | |
2939 <p>bigg.metabolite: lcts</p> | |
2940 <p>chebi: CHEBI:36219</p> | |
2941 <p>pubchem.compound: 84571</p> | |
2942 <p>metanetx.chemical: MNXM362</p> | |
2943 <p>formula: C12H22O11</p> | |
2944 </body> | |
2945 </notes> | |
2946 <annotation> | |
2947 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2948 <rdf:Description rdf:about="#_18aca9f4-b145-4984-986a-5b4334761e06"> | |
2949 <bqbiol:is> | |
2950 <rdf:Bag> | |
2951 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00243"/> | |
2952 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00186"/> | |
2953 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/lcts"/> | |
2954 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:36219"/> | |
2955 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/84571"/> | |
2956 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM362"/> | |
2957 </rdf:Bag> | |
2958 </bqbiol:is> | |
2959 </rdf:Description> | |
2960 </rdf:RDF> | |
2961 </annotation> | |
2962 </species> | |
2963 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H11O8P" hasOnlySubstanceUnits="true" id="M_m02372c" initialConcentration="0" metaid="d64f4610-d8ec-4669-a9cf-fd3e6e1a7f44" name="L-fucose-1-phosphate" sboTerm="SBO:0000247"> | |
2964 <notes> | |
2965 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2966 <p>kegg.compound: C02985</p> | |
2967 <p>bigg.metabolite: fuc1p__L</p> | |
2968 <p>chebi: CHEBI:28319</p> | |
2969 <p>pubchem.compound: 439871</p> | |
2970 <p>metanetx.chemical: MNXM1727</p> | |
2971 <p>formula: C6H11O8P</p> | |
2972 <p>charge: -2</p> | |
2973 </body> | |
2974 </notes> | |
2975 <annotation> | |
2976 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
2977 <rdf:Description rdf:about="#d64f4610-d8ec-4669-a9cf-fd3e6e1a7f44"> | |
2978 <bqbiol:is> | |
2979 <rdf:Bag> | |
2980 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02985"/> | |
2981 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/fuc1p__L"/> | |
2982 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:28319"/> | |
2983 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439871"/> | |
2984 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM1727"/> | |
2985 </rdf:Bag> | |
2986 </bqbiol:is> | |
2987 </rdf:Description> | |
2988 </rdf:RDF> | |
2989 </annotation> | |
2990 </species> | |
2991 <species boundaryCondition="false" compartment="g" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H22O11" hasOnlySubstanceUnits="true" id="M_m02332g" initialConcentration="0" metaid="f1b8e0f2-028c-4545-a1f4-bf750504814b" name="lactose" sboTerm="SBO:0000247"> | |
2992 <notes> | |
2993 <body xmlns="http://www.w3.org/1999/xhtml"> | |
2994 <p>kegg.compound: C00243</p> | |
2995 <p>hmdb: HMDB00186</p> | |
2996 <p>bigg.metabolite: lcts</p> | |
2997 <p>chebi: CHEBI:36219</p> | |
2998 <p>pubchem.compound: 84571</p> | |
2999 <p>metanetx.chemical: MNXM362</p> | |
3000 <p>formula: C12H22O11</p> | |
3001 </body> | |
3002 </notes> | |
3003 <annotation> | |
3004 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3005 <rdf:Description rdf:about="#f1b8e0f2-028c-4545-a1f4-bf750504814b"> | |
3006 <bqbiol:is> | |
3007 <rdf:Bag> | |
3008 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00243"/> | |
3009 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00186"/> | |
3010 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/lcts"/> | |
3011 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:36219"/> | |
3012 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/84571"/> | |
3013 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM362"/> | |
3014 </rdf:Bag> | |
3015 </bqbiol:is> | |
3016 </rdf:Description> | |
3017 </rdf:RDF> | |
3018 </annotation> | |
3019 </species> | |
3020 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="HO4P" hasOnlySubstanceUnits="true" id="M_m02751c" initialConcentration="0" metaid="c289024b-4290-4c49-b993-7aacf17d0e1b" name="Pi" sboTerm="SBO:0000247"> | |
3021 <notes> | |
3022 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3023 <p>kegg.compound: C00009</p> | |
3024 <p>bigg.metabolite: pi</p> | |
3025 <p>chebi: CHEBI:18367</p> | |
3026 <p>pubchem.compound: 1004</p> | |
3027 <p>metanetx.chemical: MNXM9</p> | |
3028 <p>formula: HO4P</p> | |
3029 <p>charge: -2</p> | |
3030 </body> | |
3031 </notes> | |
3032 <annotation> | |
3033 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3034 <rdf:Description rdf:about="#c289024b-4290-4c49-b993-7aacf17d0e1b"> | |
3035 <bqbiol:is> | |
3036 <rdf:Bag> | |
3037 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00009"/> | |
3038 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/pi"/> | |
3039 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:18367"/> | |
3040 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/1004"/> | |
3041 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM9"/> | |
3042 </rdf:Bag> | |
3043 </bqbiol:is> | |
3044 </rdf:Description> | |
3045 </rdf:RDF> | |
3046 </annotation> | |
3047 </species> | |
3048 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C7H13O10P" hasOnlySubstanceUnits="true" id="M_m02884c" initialConcentration="0" metaid="_3392db14-e8b9-4ab8-9f26-2c9ecda86328" name="sedoheptulose-7-phosphate" sboTerm="SBO:0000247"> | |
3049 <notes> | |
3050 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3051 <p>kegg.compound: C05382</p> | |
3052 <p>bigg.metabolite: s7p</p> | |
3053 <p>chebi: CHEBI:15721</p> | |
3054 <p>pubchem.compound: 22833559</p> | |
3055 <p>metanetx.chemical: MNXM271</p> | |
3056 <p>formula: C7H13O10P</p> | |
3057 <p>charge: -2</p> | |
3058 </body> | |
3059 </notes> | |
3060 <annotation> | |
3061 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3062 <rdf:Description rdf:about="#_3392db14-e8b9-4ab8-9f26-2c9ecda86328"> | |
3063 <bqbiol:is> | |
3064 <rdf:Bag> | |
3065 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05382"/> | |
3066 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/s7p"/> | |
3067 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15721"/> | |
3068 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/22833559"/> | |
3069 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM271"/> | |
3070 </rdf:Bag> | |
3071 </bqbiol:is> | |
3072 </rdf:Description> | |
3073 </rdf:RDF> | |
3074 </annotation> | |
3075 </species> | |
3076 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C5H9O8P" hasOnlySubstanceUnits="true" id="M_m02844c" initialConcentration="0" metaid="_43c0bdf1-d836-4a9f-921f-2ac7f20fb6bf" name="ribose-1-phosphate" sboTerm="SBO:0000247"> | |
3077 <notes> | |
3078 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3079 <p>kegg.compound: C00620</p> | |
3080 <p>bigg.metabolite: r1p</p> | |
3081 <p>chebi: CHEBI:35425</p> | |
3082 <p>pubchem.compound: 439236</p> | |
3083 <p>metanetx.chemical: MNXM295</p> | |
3084 <p>formula: C5H9O8P</p> | |
3085 <p>charge: -2</p> | |
3086 </body> | |
3087 </notes> | |
3088 <annotation> | |
3089 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3090 <rdf:Description rdf:about="#_43c0bdf1-d836-4a9f-921f-2ac7f20fb6bf"> | |
3091 <bqbiol:is> | |
3092 <rdf:Bag> | |
3093 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00620"/> | |
3094 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/r1p"/> | |
3095 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:35425"/> | |
3096 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439236"/> | |
3097 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM295"/> | |
3098 </rdf:Bag> | |
3099 </bqbiol:is> | |
3100 </rdf:Description> | |
3101 </rdf:RDF> | |
3102 </annotation> | |
3103 </species> | |
3104 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H9O9P" hasOnlySubstanceUnits="true" id="M_m01961c" initialConcentration="0" metaid="_24aa4d4c-882c-444d-b1e4-8191e7fe20d9" name="glucono-1,5-lactone-6-phosphate" sboTerm="SBO:0000247"> | |
3105 <notes> | |
3106 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3107 <p>kegg.compound: C01236</p> | |
3108 <p>bigg.metabolite: 6pgl</p> | |
3109 <p>chebi: CHEBI:16938</p> | |
3110 <p>pubchem.compound: 439452</p> | |
3111 <p>metanetx.chemical: MNXM429</p> | |
3112 <p>formula: C6H9O9P</p> | |
3113 <p>charge: -2</p> | |
3114 </body> | |
3115 </notes> | |
3116 <annotation> | |
3117 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3118 <rdf:Description rdf:about="#_24aa4d4c-882c-444d-b1e4-8191e7fe20d9"> | |
3119 <bqbiol:is> | |
3120 <rdf:Bag> | |
3121 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01236"/> | |
3122 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/6pgl"/> | |
3123 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16938"/> | |
3124 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439452"/> | |
3125 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM429"/> | |
3126 </rdf:Bag> | |
3127 </bqbiol:is> | |
3128 </rdf:Description> | |
3129 </rdf:RDF> | |
3130 </annotation> | |
3131 </species> | |
3132 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O6" hasOnlySubstanceUnits="true" id="M_m01840c" initialConcentration="0" metaid="_96ceef6d-b39c-45dc-a853-bd5aa0e6c22e" name="fructose" sboTerm="SBO:0000247"> | |
3133 <notes> | |
3134 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3135 <p>kegg.compound: C02336</p> | |
3136 <p>hmdb: HMDB00660</p> | |
3137 <p>bigg.metabolite: fru</p> | |
3138 <p>chebi: CHEBI:28645</p> | |
3139 <p>pubchem.compound: 439709</p> | |
3140 <p>metanetx.chemical: MNXM175</p> | |
3141 <p>formula: C6H12O6</p> | |
3142 </body> | |
3143 </notes> | |
3144 <annotation> | |
3145 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3146 <rdf:Description rdf:about="#_96ceef6d-b39c-45dc-a853-bd5aa0e6c22e"> | |
3147 <bqbiol:is> | |
3148 <rdf:Bag> | |
3149 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02336"/> | |
3150 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00660"/> | |
3151 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/fru"/> | |
3152 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:28645"/> | |
3153 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439709"/> | |
3154 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM175"/> | |
3155 </rdf:Bag> | |
3156 </bqbiol:is> | |
3157 </rdf:Description> | |
3158 </rdf:RDF> | |
3159 </annotation> | |
3160 </species> | |
3161 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-3" fbc:chemicalFormula="HO7P2" hasOnlySubstanceUnits="true" id="M_m02759c" initialConcentration="0" metaid="_4cb8da7d-c29f-4ff0-92dd-f4180921a1f0" name="PPi" sboTerm="SBO:0000247"> | |
3162 <notes> | |
3163 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3164 <p>kegg.compound: C00013</p> | |
3165 <p>hmdb: HMDB00250</p> | |
3166 <p>bigg.metabolite: ppi</p> | |
3167 <p>chebi: CHEBI:18361</p> | |
3168 <p>pubchem.compound: 644102</p> | |
3169 <p>metanetx.chemical: MNXM11</p> | |
3170 <p>formula: HO7P2</p> | |
3171 <p>charge: -3</p> | |
3172 </body> | |
3173 </notes> | |
3174 <annotation> | |
3175 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3176 <rdf:Description rdf:about="#_4cb8da7d-c29f-4ff0-92dd-f4180921a1f0"> | |
3177 <bqbiol:is> | |
3178 <rdf:Bag> | |
3179 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00013"/> | |
3180 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00250"/> | |
3181 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/ppi"/> | |
3182 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:18361"/> | |
3183 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/644102"/> | |
3184 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM11"/> | |
3185 </rdf:Bag> | |
3186 </bqbiol:is> | |
3187 </rdf:Description> | |
3188 </rdf:RDF> | |
3189 </annotation> | |
3190 </species> | |
3191 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C3H5O6P" hasOnlySubstanceUnits="true" id="M_m01690c" initialConcentration="0" metaid="fe9d95be-b2e5-4c74-9c43-983a56005d1e" name="DHAP" sboTerm="SBO:0000247"> | |
3192 <notes> | |
3193 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3194 <p>kegg.compound: C00111</p> | |
3195 <p>bigg.metabolite: dhap</p> | |
3196 <p>chebi: CHEBI:16108</p> | |
3197 <p>pubchem.compound: 668</p> | |
3198 <p>metanetx.chemical: MNXM77</p> | |
3199 <p>formula: C3H5O6P</p> | |
3200 <p>charge: -2</p> | |
3201 </body> | |
3202 </notes> | |
3203 <annotation> | |
3204 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3205 <rdf:Description rdf:about="#fe9d95be-b2e5-4c74-9c43-983a56005d1e"> | |
3206 <bqbiol:is> | |
3207 <rdf:Bag> | |
3208 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00111"/> | |
3209 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/dhap"/> | |
3210 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16108"/> | |
3211 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/668"/> | |
3212 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM77"/> | |
3213 </rdf:Bag> | |
3214 </bqbiol:is> | |
3215 </rdf:Description> | |
3216 </rdf:RDF> | |
3217 </annotation> | |
3218 </species> | |
3219 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H11O9P" hasOnlySubstanceUnits="true" id="M_m01322c" initialConcentration="0" metaid="ccf14f47-b931-4970-9c98-96b790907dbc" name="alpha-D-galactose-1-phosphate" sboTerm="SBO:0000247"> | |
3220 <notes> | |
3221 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3222 <p>kegg.compound: C03384</p> | |
3223 <p>bigg.metabolite: gal1p</p> | |
3224 <p>chebi: CHEBI:17973</p> | |
3225 <p>pubchem.compound: 123912</p> | |
3226 <p>metanetx.chemical: MNXM336</p> | |
3227 <p>formula: C6H11O9P</p> | |
3228 <p>charge: -2</p> | |
3229 </body> | |
3230 </notes> | |
3231 <annotation> | |
3232 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3233 <rdf:Description rdf:about="#ccf14f47-b931-4970-9c98-96b790907dbc"> | |
3234 <bqbiol:is> | |
3235 <rdf:Bag> | |
3236 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03384"/> | |
3237 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/gal1p"/> | |
3238 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17973"/> | |
3239 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/123912"/> | |
3240 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM336"/> | |
3241 </rdf:Bag> | |
3242 </bqbiol:is> | |
3243 </rdf:Description> | |
3244 </rdf:RDF> | |
3245 </annotation> | |
3246 </species> | |
3247 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C10H12N5O7P" hasOnlySubstanceUnits="true" id="M_m01334c" initialConcentration="0" metaid="d430dc71-00bc-4d61-94b8-202046401905" name="AMP" sboTerm="SBO:0000247"> | |
3248 <notes> | |
3249 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3250 <p>kegg.compound: C00020</p> | |
3251 <p>hmdb: HMDB00045</p> | |
3252 <p>bigg.metabolite: amp</p> | |
3253 <p>chebi: CHEBI:16027</p> | |
3254 <p>pubchem.compound: 6083</p> | |
3255 <p>metanetx.chemical: MNXM14</p> | |
3256 <p>formula: C10H12N5O7P</p> | |
3257 <p>charge: -2</p> | |
3258 </body> | |
3259 </notes> | |
3260 <annotation> | |
3261 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3262 <rdf:Description rdf:about="#d430dc71-00bc-4d61-94b8-202046401905"> | |
3263 <bqbiol:is> | |
3264 <rdf:Bag> | |
3265 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00020"/> | |
3266 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00045"/> | |
3267 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/amp"/> | |
3268 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16027"/> | |
3269 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/6083"/> | |
3270 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM14"/> | |
3271 </rdf:Bag> | |
3272 </bqbiol:is> | |
3273 </rdf:Description> | |
3274 </rdf:RDF> | |
3275 </annotation> | |
3276 </species> | |
3277 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C2H4O" hasOnlySubstanceUnits="true" id="M_m01249c" initialConcentration="0" metaid="b26172e9-a9bb-418f-90c4-4132af1dada8" name="acetaldehyde" sboTerm="SBO:0000247"> | |
3278 <notes> | |
3279 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3280 <p>kegg.compound: C00084</p> | |
3281 <p>hmdb: HMDB00990</p> | |
3282 <p>bigg.metabolite: acald</p> | |
3283 <p>chebi: CHEBI:15343</p> | |
3284 <p>pubchem.compound: 177</p> | |
3285 <p>metanetx.chemical: MNXM75</p> | |
3286 <p>formula: C2H4O</p> | |
3287 </body> | |
3288 </notes> | |
3289 <annotation> | |
3290 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3291 <rdf:Description rdf:about="#b26172e9-a9bb-418f-90c4-4132af1dada8"> | |
3292 <bqbiol:is> | |
3293 <rdf:Bag> | |
3294 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00084"/> | |
3295 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00990"/> | |
3296 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/acald"/> | |
3297 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15343"/> | |
3298 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/177"/> | |
3299 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM75"/> | |
3300 </rdf:Bag> | |
3301 </bqbiol:is> | |
3302 </rdf:Description> | |
3303 </rdf:RDF> | |
3304 </annotation> | |
3305 </species> | |
3306 <species boundaryCondition="false" compartment="r" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H9O9P" hasOnlySubstanceUnits="true" id="M_m01961r" initialConcentration="0" metaid="_3f0abace-5e5b-40c8-b067-d21e4368010d" name="glucono-1,5-lactone-6-phosphate" sboTerm="SBO:0000247"> | |
3307 <notes> | |
3308 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3309 <p>kegg.compound: C01236</p> | |
3310 <p>bigg.metabolite: 6pgl</p> | |
3311 <p>chebi: CHEBI:16938</p> | |
3312 <p>pubchem.compound: 439452</p> | |
3313 <p>metanetx.chemical: MNXM429</p> | |
3314 <p>formula: C6H9O9P</p> | |
3315 <p>charge: -2</p> | |
3316 </body> | |
3317 </notes> | |
3318 <annotation> | |
3319 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3320 <rdf:Description rdf:about="#_3f0abace-5e5b-40c8-b067-d21e4368010d"> | |
3321 <bqbiol:is> | |
3322 <rdf:Bag> | |
3323 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01236"/> | |
3324 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/6pgl"/> | |
3325 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16938"/> | |
3326 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439452"/> | |
3327 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM429"/> | |
3328 </rdf:Bag> | |
3329 </bqbiol:is> | |
3330 </rdf:Description> | |
3331 </rdf:RDF> | |
3332 </annotation> | |
3333 </species> | |
3334 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-4" fbc:chemicalFormula="C10H11N4O14P3" hasOnlySubstanceUnits="true" id="M_m02193c" initialConcentration="0" metaid="d86ee995-ab70-4b25-8ecf-739633917441" name="ITP" sboTerm="SBO:0000247"> | |
3335 <notes> | |
3336 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3337 <p>kegg.compound: C00081</p> | |
3338 <p>bigg.metabolite: itp</p> | |
3339 <p>chebi: CHEBI:16039</p> | |
3340 <p>pubchem.compound: 8583</p> | |
3341 <p>metanetx.chemical: MNXM423</p> | |
3342 <p>formula: C10H11N4O14P3</p> | |
3343 <p>charge: -4</p> | |
3344 </body> | |
3345 </notes> | |
3346 <annotation> | |
3347 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3348 <rdf:Description rdf:about="#d86ee995-ab70-4b25-8ecf-739633917441"> | |
3349 <bqbiol:is> | |
3350 <rdf:Bag> | |
3351 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00081"/> | |
3352 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/itp"/> | |
3353 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16039"/> | |
3354 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/8583"/> | |
3355 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM423"/> | |
3356 </rdf:Bag> | |
3357 </bqbiol:is> | |
3358 </rdf:Description> | |
3359 </rdf:RDF> | |
3360 </annotation> | |
3361 </species> | |
3362 <species boundaryCondition="false" compartment="s" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O6" hasOnlySubstanceUnits="true" id="M_m01840s" initialConcentration="0" metaid="b908e607-79da-478f-9bb1-e4ccd3243f7f" name="fructose" sboTerm="SBO:0000247"> | |
3363 <notes> | |
3364 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3365 <p>kegg.compound: C02336</p> | |
3366 <p>hmdb: HMDB00660</p> | |
3367 <p>bigg.metabolite: fru</p> | |
3368 <p>chebi: CHEBI:28645</p> | |
3369 <p>pubchem.compound: 439709</p> | |
3370 <p>metanetx.chemical: MNXM175</p> | |
3371 <p>formula: C6H12O6</p> | |
3372 </body> | |
3373 </notes> | |
3374 <annotation> | |
3375 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3376 <rdf:Description rdf:about="#b908e607-79da-478f-9bb1-e4ccd3243f7f"> | |
3377 <bqbiol:is> | |
3378 <rdf:Bag> | |
3379 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02336"/> | |
3380 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00660"/> | |
3381 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/fru"/> | |
3382 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:28645"/> | |
3383 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439709"/> | |
3384 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM175"/> | |
3385 </rdf:Bag> | |
3386 </bqbiol:is> | |
3387 </rdf:Description> | |
3388 </rdf:RDF> | |
3389 </annotation> | |
3390 </species> | |
3391 <species boundaryCondition="false" compartment="g" constant="false" fbc:charge="1" fbc:chemicalFormula="H" hasOnlySubstanceUnits="true" id="M_m02039g" initialConcentration="0" metaid="_42778420-d51a-415e-8fd5-a1e6dd29336f" name="H+" sboTerm="SBO:0000247"> | |
3392 <notes> | |
3393 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3394 <p>kegg.compound: C00080</p> | |
3395 <p>bigg.metabolite: h</p> | |
3396 <p>chebi: CHEBI:24636</p> | |
3397 <p>pubchem.compound: 1038</p> | |
3398 <p>metanetx.chemical: MNXM1</p> | |
3399 <p>formula: H</p> | |
3400 <p>charge: 1</p> | |
3401 </body> | |
3402 </notes> | |
3403 <annotation> | |
3404 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3405 <rdf:Description rdf:about="#_42778420-d51a-415e-8fd5-a1e6dd29336f"> | |
3406 <bqbiol:is> | |
3407 <rdf:Bag> | |
3408 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00080"/> | |
3409 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/h"/> | |
3410 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:24636"/> | |
3411 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/1038"/> | |
3412 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM1"/> | |
3413 </rdf:Bag> | |
3414 </bqbiol:is> | |
3415 </rdf:Description> | |
3416 </rdf:RDF> | |
3417 </annotation> | |
3418 </species> | |
3419 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-4" fbc:chemicalFormula="C7H12O13P2" hasOnlySubstanceUnits="true" id="M_m02883c" initialConcentration="0" metaid="_22c2c43e-d9ef-4b0b-ae59-18c23634ad89" name="sedoheptulose-1,7-bisphosphate" sboTerm="SBO:0000247"> | |
3420 <notes> | |
3421 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3422 <p>kegg.compound: C00447</p> | |
3423 <p>chebi: CHEBI:17969</p> | |
3424 <p>pubchem.compound: 164735</p> | |
3425 <p>metanetx.chemical: MNXM163895 || MNXM1294</p> | |
3426 <p>formula: C7H12O13P2</p> | |
3427 <p>charge: -4</p> | |
3428 </body> | |
3429 </notes> | |
3430 <annotation> | |
3431 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3432 <rdf:Description rdf:about="#_22c2c43e-d9ef-4b0b-ae59-18c23634ad89"> | |
3433 <bqbiol:is> | |
3434 <rdf:Bag> | |
3435 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00447"/> | |
3436 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17969"/> | |
3437 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/164735"/> | |
3438 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM163895"/> | |
3439 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM1294"/> | |
3440 </rdf:Bag> | |
3441 </bqbiol:is> | |
3442 </rdf:Description> | |
3443 </rdf:RDF> | |
3444 </annotation> | |
3445 </species> | |
3446 <species boundaryCondition="false" compartment="r" constant="false" fbc:charge="-3" fbc:chemicalFormula="C6H10O10P" hasOnlySubstanceUnits="true" id="M_m01169r" initialConcentration="0" metaid="_7c933ae2-cfcf-4aa9-af8d-bbf16388fed5" name="6-phospho-D-gluconate" sboTerm="SBO:0000247"> | |
3447 <notes> | |
3448 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3449 <p>kegg.compound: C00345</p> | |
3450 <p>hmdb: HMDB01316</p> | |
3451 <p>bigg.metabolite: 6pgc</p> | |
3452 <p>chebi: CHEBI:48928</p> | |
3453 <p>pubchem.compound: 91493</p> | |
3454 <p>metanetx.chemical: MNXM325</p> | |
3455 <p>formula: C6H10O10P</p> | |
3456 <p>charge: -3</p> | |
3457 </body> | |
3458 </notes> | |
3459 <annotation> | |
3460 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3461 <rdf:Description rdf:about="#_7c933ae2-cfcf-4aa9-af8d-bbf16388fed5"> | |
3462 <bqbiol:is> | |
3463 <rdf:Bag> | |
3464 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00345"/> | |
3465 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB01316"/> | |
3466 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/6pgc"/> | |
3467 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:48928"/> | |
3468 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/91493"/> | |
3469 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM325"/> | |
3470 </rdf:Bag> | |
3471 </bqbiol:is> | |
3472 </rdf:Description> | |
3473 </rdf:RDF> | |
3474 </annotation> | |
3475 </species> | |
3476 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H10O5" hasOnlySubstanceUnits="true" id="M_m02843c" initialConcentration="0" metaid="c86562cc-a38d-4105-b709-81e1ed867220" name="ribose" sboTerm="SBO:0000247"> | |
3477 <notes> | |
3478 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3479 <p>kegg.compound: C00121</p> | |
3480 <p>hmdb: HMDB00283</p> | |
3481 <p>bigg.metabolite: rib__D</p> | |
3482 <p>chebi: CHEBI:16988</p> | |
3483 <p>pubchem.compound: 5779</p> | |
3484 <p>metanetx.chemical: MNXM242</p> | |
3485 <p>formula: C5H10O5</p> | |
3486 </body> | |
3487 </notes> | |
3488 <annotation> | |
3489 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3490 <rdf:Description rdf:about="#c86562cc-a38d-4105-b709-81e1ed867220"> | |
3491 <bqbiol:is> | |
3492 <rdf:Bag> | |
3493 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00121"/> | |
3494 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00283"/> | |
3495 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/rib__D"/> | |
3496 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16988"/> | |
3497 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5779"/> | |
3498 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM242"/> | |
3499 </rdf:Bag> | |
3500 </bqbiol:is> | |
3501 </rdf:Description> | |
3502 </rdf:RDF> | |
3503 </annotation> | |
3504 </species> | |
3505 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H11O9P" hasOnlySubstanceUnits="true" id="M_m01968c" initialConcentration="0" metaid="_370aa63f-8947-4333-9372-c95e0079773c" name="glucose-6-phosphate" sboTerm="SBO:0000247"> | |
3506 <notes> | |
3507 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3508 <p>kegg.compound: C00092</p> | |
3509 <p>bigg.metabolite: g6p</p> | |
3510 <p>chebi: CHEBI:4170</p> | |
3511 <p>pubchem.compound: 5958</p> | |
3512 <p>metanetx.chemical: MNXM160</p> | |
3513 <p>formula: C6H11O9P</p> | |
3514 <p>charge: -2</p> | |
3515 </body> | |
3516 </notes> | |
3517 <annotation> | |
3518 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3519 <rdf:Description rdf:about="#_370aa63f-8947-4333-9372-c95e0079773c"> | |
3520 <bqbiol:is> | |
3521 <rdf:Bag> | |
3522 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00092"/> | |
3523 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/g6p"/> | |
3524 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:4170"/> | |
3525 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5958"/> | |
3526 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM160"/> | |
3527 </rdf:Bag> | |
3528 </bqbiol:is> | |
3529 </rdf:Description> | |
3530 </rdf:RDF> | |
3531 </annotation> | |
3532 </species> | |
3533 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="1" fbc:chemicalFormula="H" hasOnlySubstanceUnits="true" id="M_m02039c" initialConcentration="0" metaid="_455b3b9e-68d4-4ea4-b895-e4ac1cc17c0d" name="H+" sboTerm="SBO:0000247"> | |
3534 <notes> | |
3535 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3536 <p>kegg.compound: C00080</p> | |
3537 <p>bigg.metabolite: h</p> | |
3538 <p>chebi: CHEBI:24636</p> | |
3539 <p>pubchem.compound: 1038</p> | |
3540 <p>metanetx.chemical: MNXM1</p> | |
3541 <p>formula: H</p> | |
3542 <p>charge: 1</p> | |
3543 </body> | |
3544 </notes> | |
3545 <annotation> | |
3546 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3547 <rdf:Description rdf:about="#_455b3b9e-68d4-4ea4-b895-e4ac1cc17c0d"> | |
3548 <bqbiol:is> | |
3549 <rdf:Bag> | |
3550 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00080"/> | |
3551 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/h"/> | |
3552 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:24636"/> | |
3553 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/1038"/> | |
3554 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM1"/> | |
3555 </rdf:Bag> | |
3556 </bqbiol:is> | |
3557 </rdf:Description> | |
3558 </rdf:RDF> | |
3559 </annotation> | |
3560 </species> | |
3561 <species boundaryCondition="false" compartment="r" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H11O9P" hasOnlySubstanceUnits="true" id="M_m01968r" initialConcentration="0" metaid="_2245cdf3-b905-4470-896d-c12a111787e7" name="glucose-6-phosphate" sboTerm="SBO:0000247"> | |
3562 <notes> | |
3563 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3564 <p>kegg.compound: C00092</p> | |
3565 <p>bigg.metabolite: g6p</p> | |
3566 <p>chebi: CHEBI:4170</p> | |
3567 <p>pubchem.compound: 5958</p> | |
3568 <p>metanetx.chemical: MNXM160</p> | |
3569 <p>formula: C6H11O9P</p> | |
3570 <p>charge: -2</p> | |
3571 </body> | |
3572 </notes> | |
3573 <annotation> | |
3574 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3575 <rdf:Description rdf:about="#_2245cdf3-b905-4470-896d-c12a111787e7"> | |
3576 <bqbiol:is> | |
3577 <rdf:Bag> | |
3578 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00092"/> | |
3579 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/g6p"/> | |
3580 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:4170"/> | |
3581 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5958"/> | |
3582 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM160"/> | |
3583 </rdf:Bag> | |
3584 </bqbiol:is> | |
3585 </rdf:Description> | |
3586 </rdf:RDF> | |
3587 </annotation> | |
3588 </species> | |
3589 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-3" fbc:chemicalFormula="C6H10O10P" hasOnlySubstanceUnits="true" id="M_m01169c" initialConcentration="0" metaid="dfbe4e2b-1fd6-4a34-8064-53308f79888f" name="6-phospho-D-gluconate" sboTerm="SBO:0000247"> | |
3590 <notes> | |
3591 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3592 <p>kegg.compound: C00345</p> | |
3593 <p>hmdb: HMDB01316</p> | |
3594 <p>bigg.metabolite: 6pgc</p> | |
3595 <p>chebi: CHEBI:48928</p> | |
3596 <p>pubchem.compound: 91493</p> | |
3597 <p>metanetx.chemical: MNXM325</p> | |
3598 <p>formula: C6H10O10P</p> | |
3599 <p>charge: -3</p> | |
3600 </body> | |
3601 </notes> | |
3602 <annotation> | |
3603 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3604 <rdf:Description rdf:about="#dfbe4e2b-1fd6-4a34-8064-53308f79888f"> | |
3605 <bqbiol:is> | |
3606 <rdf:Bag> | |
3607 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00345"/> | |
3608 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB01316"/> | |
3609 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/6pgc"/> | |
3610 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:48928"/> | |
3611 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/91493"/> | |
3612 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM325"/> | |
3613 </rdf:Bag> | |
3614 </bqbiol:is> | |
3615 </rdf:Description> | |
3616 </rdf:RDF> | |
3617 </annotation> | |
3618 </species> | |
3619 <species boundaryCondition="false" compartment="r" constant="false" fbc:charge="1" fbc:chemicalFormula="H" hasOnlySubstanceUnits="true" id="M_m02039r" initialConcentration="0" metaid="a7079a2e-7f55-44c1-bcc2-5989ea949235" name="H+" sboTerm="SBO:0000247"> | |
3620 <notes> | |
3621 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3622 <p>kegg.compound: C00080</p> | |
3623 <p>bigg.metabolite: h</p> | |
3624 <p>chebi: CHEBI:24636</p> | |
3625 <p>pubchem.compound: 1038</p> | |
3626 <p>metanetx.chemical: MNXM1</p> | |
3627 <p>formula: H</p> | |
3628 <p>charge: 1</p> | |
3629 </body> | |
3630 </notes> | |
3631 <annotation> | |
3632 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3633 <rdf:Description rdf:about="#a7079a2e-7f55-44c1-bcc2-5989ea949235"> | |
3634 <bqbiol:is> | |
3635 <rdf:Bag> | |
3636 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00080"/> | |
3637 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/h"/> | |
3638 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:24636"/> | |
3639 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/1038"/> | |
3640 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM1"/> | |
3641 </rdf:Bag> | |
3642 </bqbiol:is> | |
3643 </rdf:Description> | |
3644 </rdf:RDF> | |
3645 </annotation> | |
3646 </species> | |
3647 <species boundaryCondition="false" compartment="s" constant="false" fbc:charge="1" fbc:chemicalFormula="H" hasOnlySubstanceUnits="true" id="M_m02039s" initialConcentration="0" metaid="_48b7ef43-d087-4f37-9392-1047b65c4dbd" name="H+" sboTerm="SBO:0000247"> | |
3648 <notes> | |
3649 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3650 <p>kegg.compound: C00080</p> | |
3651 <p>bigg.metabolite: h</p> | |
3652 <p>chebi: CHEBI:24636</p> | |
3653 <p>pubchem.compound: 1038</p> | |
3654 <p>metanetx.chemical: MNXM1</p> | |
3655 <p>formula: H</p> | |
3656 <p>charge: 1</p> | |
3657 </body> | |
3658 </notes> | |
3659 <annotation> | |
3660 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3661 <rdf:Description rdf:about="#_48b7ef43-d087-4f37-9392-1047b65c4dbd"> | |
3662 <bqbiol:is> | |
3663 <rdf:Bag> | |
3664 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00080"/> | |
3665 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/h"/> | |
3666 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:24636"/> | |
3667 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/1038"/> | |
3668 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM1"/> | |
3669 </rdf:Bag> | |
3670 </bqbiol:is> | |
3671 </rdf:Description> | |
3672 </rdf:RDF> | |
3673 </annotation> | |
3674 </species> | |
3675 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C3H5O6P" hasOnlySubstanceUnits="true" id="M_m01939c" initialConcentration="0" metaid="_6e928c86-cb07-4ee4-9da1-206e92aa5aae" name="GAP" sboTerm="SBO:0000247"> | |
3676 <notes> | |
3677 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3678 <p>kegg.compound: C00118</p> | |
3679 <p>bigg.metabolite: g3p</p> | |
3680 <p>chebi: CHEBI:29052</p> | |
3681 <p>pubchem.compound: 729</p> | |
3682 <p>metanetx.chemical: MNXM74</p> | |
3683 <p>formula: C3H5O6P</p> | |
3684 <p>charge: -2</p> | |
3685 </body> | |
3686 </notes> | |
3687 <annotation> | |
3688 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3689 <rdf:Description rdf:about="#_6e928c86-cb07-4ee4-9da1-206e92aa5aae"> | |
3690 <bqbiol:is> | |
3691 <rdf:Bag> | |
3692 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00118"/> | |
3693 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/g3p"/> | |
3694 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:29052"/> | |
3695 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/729"/> | |
3696 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM74"/> | |
3697 </rdf:Bag> | |
3698 </bqbiol:is> | |
3699 </rdf:Description> | |
3700 </rdf:RDF> | |
3701 </annotation> | |
3702 </species> | |
3703 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-4" fbc:chemicalFormula="C21H26N7O17P3" hasOnlySubstanceUnits="true" id="M_m02555c" initialConcentration="0" metaid="_4713da60-2315-4728-8c49-9d80e9d06982" name="NADPH" sboTerm="SBO:0000247"> | |
3704 <notes> | |
3705 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3706 <p>kegg.compound: C00005</p> | |
3707 <p>hmdb: HMDB00221</p> | |
3708 <p>bigg.metabolite: nadph</p> | |
3709 <p>chebi: CHEBI:16474</p> | |
3710 <p>pubchem.compound: 22833512</p> | |
3711 <p>metanetx.chemical: MNXM6</p> | |
3712 <p>formula: C21H26N7O17P3</p> | |
3713 <p>charge: -4</p> | |
3714 </body> | |
3715 </notes> | |
3716 <annotation> | |
3717 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3718 <rdf:Description rdf:about="#_4713da60-2315-4728-8c49-9d80e9d06982"> | |
3719 <bqbiol:is> | |
3720 <rdf:Bag> | |
3721 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00005"/> | |
3722 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00221"/> | |
3723 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/nadph"/> | |
3724 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16474"/> | |
3725 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/22833512"/> | |
3726 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM6"/> | |
3727 </rdf:Bag> | |
3728 </bqbiol:is> | |
3729 </rdf:Description> | |
3730 </rdf:RDF> | |
3731 </annotation> | |
3732 </species> | |
3733 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H11O9P" hasOnlySubstanceUnits="true" id="M_m01967c" initialConcentration="0" metaid="eb903c59-35de-4770-9346-d9840ea78b8b" name="glucose-1-phosphate" sboTerm="SBO:0000247"> | |
3734 <notes> | |
3735 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3736 <p>kegg.compound: C00103</p> | |
3737 <p>bigg.metabolite: g1p</p> | |
3738 <p>chebi: CHEBI:16077</p> | |
3739 <p>pubchem.compound: 65533</p> | |
3740 <p>metanetx.chemical: MNXM89588</p> | |
3741 <p>formula: C6H11O9P</p> | |
3742 <p>charge: -2</p> | |
3743 </body> | |
3744 </notes> | |
3745 <annotation> | |
3746 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3747 <rdf:Description rdf:about="#eb903c59-35de-4770-9346-d9840ea78b8b"> | |
3748 <bqbiol:is> | |
3749 <rdf:Bag> | |
3750 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00103"/> | |
3751 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/g1p"/> | |
3752 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16077"/> | |
3753 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/65533"/> | |
3754 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM89588"/> | |
3755 </rdf:Bag> | |
3756 </bqbiol:is> | |
3757 </rdf:Description> | |
3758 </rdf:RDF> | |
3759 </annotation> | |
3760 </species> | |
3761 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H10O4" hasOnlySubstanceUnits="true" id="M_m01672c" initialConcentration="0" metaid="c684250e-c857-4d7b-b61e-1695a0a407a8" name="deoxyribose" sboTerm="SBO:0000247"> | |
3762 <notes> | |
3763 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3764 <p>kegg.compound: C01801</p> | |
3765 <p>hmdb: HMDB03224</p> | |
3766 <p>bigg.metabolite: drib</p> | |
3767 <p>chebi: CHEBI:28816</p> | |
3768 <p>pubchem.compound: 22833604</p> | |
3769 <p>metanetx.chemical: MNXM90412 || MNXM2474</p> | |
3770 <p>formula: C5H10O4</p> | |
3771 </body> | |
3772 </notes> | |
3773 <annotation> | |
3774 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3775 <rdf:Description rdf:about="#c684250e-c857-4d7b-b61e-1695a0a407a8"> | |
3776 <bqbiol:is> | |
3777 <rdf:Bag> | |
3778 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01801"/> | |
3779 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB03224"/> | |
3780 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/drib"/> | |
3781 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:28816"/> | |
3782 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/22833604"/> | |
3783 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM90412"/> | |
3784 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM2474"/> | |
3785 </rdf:Bag> | |
3786 </bqbiol:is> | |
3787 </rdf:Description> | |
3788 </rdf:RDF> | |
3789 </annotation> | |
3790 </species> | |
3791 <species boundaryCondition="false" compartment="r" constant="false" fbc:charge="-4" fbc:chemicalFormula="C21H26N7O17P3" hasOnlySubstanceUnits="true" id="M_m02555r" initialConcentration="0" metaid="_9dd9e24d-3d87-43d4-a57f-7319fda9d5ae" name="NADPH" sboTerm="SBO:0000247"> | |
3792 <notes> | |
3793 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3794 <p>kegg.compound: C00005</p> | |
3795 <p>hmdb: HMDB00221</p> | |
3796 <p>bigg.metabolite: nadph</p> | |
3797 <p>chebi: CHEBI:16474</p> | |
3798 <p>pubchem.compound: 22833512</p> | |
3799 <p>metanetx.chemical: MNXM6</p> | |
3800 <p>formula: C21H26N7O17P3</p> | |
3801 <p>charge: -4</p> | |
3802 </body> | |
3803 </notes> | |
3804 <annotation> | |
3805 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3806 <rdf:Description rdf:about="#_9dd9e24d-3d87-43d4-a57f-7319fda9d5ae"> | |
3807 <bqbiol:is> | |
3808 <rdf:Bag> | |
3809 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00005"/> | |
3810 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00221"/> | |
3811 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/nadph"/> | |
3812 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16474"/> | |
3813 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/22833512"/> | |
3814 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM6"/> | |
3815 </rdf:Bag> | |
3816 </bqbiol:is> | |
3817 </rdf:Description> | |
3818 </rdf:RDF> | |
3819 </annotation> | |
3820 </species> | |
3821 <species boundaryCondition="false" compartment="s" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H8O3" hasOnlySubstanceUnits="true" id="M_m01983s" initialConcentration="0" metaid="_681859d4-f24a-406f-8efe-f13934d5ffd5" name="glycerol" sboTerm="SBO:0000247"> | |
3822 <notes> | |
3823 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3824 <p>kegg.compound: C00116</p> | |
3825 <p>hmdb: HMDB00131</p> | |
3826 <p>bigg.metabolite: glyc</p> | |
3827 <p>chebi: CHEBI:17522</p> | |
3828 <p>pubchem.compound: 753</p> | |
3829 <p>metanetx.chemical: MNXM89612</p> | |
3830 <p>formula: C3H8O3</p> | |
3831 </body> | |
3832 </notes> | |
3833 <annotation> | |
3834 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3835 <rdf:Description rdf:about="#_681859d4-f24a-406f-8efe-f13934d5ffd5"> | |
3836 <bqbiol:is> | |
3837 <rdf:Bag> | |
3838 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00116"/> | |
3839 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00131"/> | |
3840 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/glyc"/> | |
3841 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17522"/> | |
3842 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/753"/> | |
3843 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM89612"/> | |
3844 </rdf:Bag> | |
3845 </bqbiol:is> | |
3846 </rdf:Description> | |
3847 </rdf:RDF> | |
3848 </annotation> | |
3849 </species> | |
3850 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-3" fbc:chemicalFormula="C21H25N7O17P3" hasOnlySubstanceUnits="true" id="M_m02554c" initialConcentration="0" metaid="_9d6ff91d-ad3d-4e8d-9c4a-fce47e8acd53" name="NADP+" sboTerm="SBO:0000247"> | |
3851 <notes> | |
3852 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3853 <p>kegg.compound: C00006</p> | |
3854 <p>hmdb: HMDB00217</p> | |
3855 <p>bigg.metabolite: nadp</p> | |
3856 <p>chebi: CHEBI:18009</p> | |
3857 <p>pubchem.compound: 5886</p> | |
3858 <p>metanetx.chemical: MNXM5</p> | |
3859 <p>formula: C21H25N7O17P3</p> | |
3860 <p>charge: -3</p> | |
3861 </body> | |
3862 </notes> | |
3863 <annotation> | |
3864 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3865 <rdf:Description rdf:about="#_9d6ff91d-ad3d-4e8d-9c4a-fce47e8acd53"> | |
3866 <bqbiol:is> | |
3867 <rdf:Bag> | |
3868 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00006"/> | |
3869 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00217"/> | |
3870 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/nadp"/> | |
3871 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:18009"/> | |
3872 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5886"/> | |
3873 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM5"/> | |
3874 </rdf:Bag> | |
3875 </bqbiol:is> | |
3876 </rdf:Description> | |
3877 </rdf:RDF> | |
3878 </annotation> | |
3879 </species> | |
3880 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H12O5" hasOnlySubstanceUnits="true" id="M_m02841c" initialConcentration="0" metaid="eb784776-6b61-4d67-9441-2af7f5d1e57f" name="ribitol" sboTerm="SBO:0000247"> | |
3881 <notes> | |
3882 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3883 <p>kegg.compound: C00474</p> | |
3884 <p>hmdb: HMDB00508</p> | |
3885 <p>bigg.metabolite: rbt</p> | |
3886 <p>chebi: CHEBI:15963</p> | |
3887 <p>pubchem.compound: 827</p> | |
3888 <p>metanetx.chemical: MNXM1820</p> | |
3889 <p>formula: C5H12O5</p> | |
3890 </body> | |
3891 </notes> | |
3892 <annotation> | |
3893 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3894 <rdf:Description rdf:about="#eb784776-6b61-4d67-9441-2af7f5d1e57f"> | |
3895 <bqbiol:is> | |
3896 <rdf:Bag> | |
3897 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00474"/> | |
3898 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00508"/> | |
3899 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/rbt"/> | |
3900 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15963"/> | |
3901 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/827"/> | |
3902 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM1820"/> | |
3903 </rdf:Bag> | |
3904 </bqbiol:is> | |
3905 </rdf:Description> | |
3906 </rdf:RDF> | |
3907 </annotation> | |
3908 </species> | |
3909 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H11O9P" hasOnlySubstanceUnits="true" id="M_m01845c" initialConcentration="0" metaid="_435773db-71ea-408f-b0f1-852fadf7ea80" name="fructose-6-phosphate" sboTerm="SBO:0000247"> | |
3910 <notes> | |
3911 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3912 <p>kegg.compound: C00085</p> | |
3913 <p>bigg.metabolite: f6p</p> | |
3914 <p>chebi: CHEBI:15946</p> | |
3915 <p>pubchem.compound: 69507</p> | |
3916 <p>metanetx.chemical: MNXM89621 || MNXM162235</p> | |
3917 <p>formula: C6H11O9P</p> | |
3918 <p>charge: -2</p> | |
3919 </body> | |
3920 </notes> | |
3921 <annotation> | |
3922 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3923 <rdf:Description rdf:about="#_435773db-71ea-408f-b0f1-852fadf7ea80"> | |
3924 <bqbiol:is> | |
3925 <rdf:Bag> | |
3926 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00085"/> | |
3927 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/f6p"/> | |
3928 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15946"/> | |
3929 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/69507"/> | |
3930 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM89621"/> | |
3931 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM162235"/> | |
3932 </rdf:Bag> | |
3933 </bqbiol:is> | |
3934 </rdf:Description> | |
3935 </rdf:RDF> | |
3936 </annotation> | |
3937 </species> | |
3938 <species boundaryCondition="false" compartment="s" constant="false" fbc:charge="0" fbc:chemicalFormula="H2O" hasOnlySubstanceUnits="true" id="M_m02040s" initialConcentration="0" metaid="edc2812f-d50e-40df-9c9b-c62283dd5dfa" name="H2O" sboTerm="SBO:0000247"> | |
3939 <notes> | |
3940 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3941 <p>lipidmaps: LMST01040128</p> | |
3942 <p>kegg.compound: C00001</p> | |
3943 <p>hmdb: HMDB02111</p> | |
3944 <p>bigg.metabolite: h2o</p> | |
3945 <p>chebi: CHEBI:15377</p> | |
3946 <p>pubchem.compound: 962</p> | |
3947 <p>metanetx.chemical: MNXM2</p> | |
3948 <p>formula: H2O</p> | |
3949 </body> | |
3950 </notes> | |
3951 <annotation> | |
3952 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3953 <rdf:Description rdf:about="#edc2812f-d50e-40df-9c9b-c62283dd5dfa"> | |
3954 <bqbiol:is> | |
3955 <rdf:Bag> | |
3956 <rdf:li rdf:resource="https://identifiers.org/lipidmaps/LMST01040128"/> | |
3957 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00001"/> | |
3958 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB02111"/> | |
3959 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/h2o"/> | |
3960 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15377"/> | |
3961 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/962"/> | |
3962 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM2"/> | |
3963 </rdf:Bag> | |
3964 </bqbiol:is> | |
3965 </rdf:Description> | |
3966 </rdf:RDF> | |
3967 </annotation> | |
3968 </species> | |
3969 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-4" fbc:chemicalFormula="C9H11N2O15P3" hasOnlySubstanceUnits="true" id="M_m03130c" initialConcentration="0" metaid="_623bdee5-7e3f-429d-8798-39cae174c79d" name="UTP" sboTerm="SBO:0000247"> | |
3970 <notes> | |
3971 <body xmlns="http://www.w3.org/1999/xhtml"> | |
3972 <p>kegg.compound: C00075</p> | |
3973 <p>hmdb: HMDB00285</p> | |
3974 <p>bigg.metabolite: utp</p> | |
3975 <p>chebi: CHEBI:15713</p> | |
3976 <p>pubchem.compound: 6133</p> | |
3977 <p>metanetx.chemical: MNXM121</p> | |
3978 <p>formula: C9H11N2O15P3</p> | |
3979 <p>charge: -4</p> | |
3980 </body> | |
3981 </notes> | |
3982 <annotation> | |
3983 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
3984 <rdf:Description rdf:about="#_623bdee5-7e3f-429d-8798-39cae174c79d"> | |
3985 <bqbiol:is> | |
3986 <rdf:Bag> | |
3987 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00075"/> | |
3988 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00285"/> | |
3989 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/utp"/> | |
3990 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15713"/> | |
3991 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/6133"/> | |
3992 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM121"/> | |
3993 </rdf:Bag> | |
3994 </bqbiol:is> | |
3995 </rdf:Description> | |
3996 </rdf:RDF> | |
3997 </annotation> | |
3998 </species> | |
3999 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C7H13O10P" hasOnlySubstanceUnits="true" id="M_m03166c" initialConcentration="0" metaid="be62933b-1dd6-4a8b-87c9-a14eb36e9b49" name="sedoheptulose-1-phosphate" sboTerm="SBO:0000247"> | |
4000 <notes> | |
4001 <body xmlns="http://www.w3.org/1999/xhtml"> | |
4002 <p>kegg.compound: C06222</p> | |
4003 <p>chebi: CHEBI:9082</p> | |
4004 <p>metanetx.chemical: MNXM12925</p> | |
4005 <p>formula: C7H13O10P</p> | |
4006 <p>charge: -2</p> | |
4007 </body> | |
4008 </notes> | |
4009 <annotation> | |
4010 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
4011 <rdf:Description rdf:about="#be62933b-1dd6-4a8b-87c9-a14eb36e9b49"> | |
4012 <bqbiol:is> | |
4013 <rdf:Bag> | |
4014 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C06222"/> | |
4015 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:9082"/> | |
4016 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM12925"/> | |
4017 </rdf:Bag> | |
4018 </bqbiol:is> | |
4019 </rdf:Description> | |
4020 </rdf:RDF> | |
4021 </annotation> | |
4022 </species> | |
4023 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-1" fbc:chemicalFormula="C6H11O7" hasOnlySubstanceUnits="true" id="M_m01683c" initialConcentration="0" metaid="_7e64183c-bff4-44e2-bdb9-41d69f6bed98" name="D-gluconic acid" sboTerm="SBO:0000247"> | |
4024 <notes> | |
4025 <body xmlns="http://www.w3.org/1999/xhtml"> | |
4026 <p>kegg.compound: C00257</p> | |
4027 <p>hmdb: HMDB00625</p> | |
4028 <p>chebi: CHEBI:33198</p> | |
4029 <p>pubchem.compound: 10690</p> | |
4030 <p>metanetx.chemical: MNXM341</p> | |
4031 <p>formula: C6H11O7</p> | |
4032 <p>charge: -1</p> | |
4033 </body> | |
4034 </notes> | |
4035 <annotation> | |
4036 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
4037 <rdf:Description rdf:about="#_7e64183c-bff4-44e2-bdb9-41d69f6bed98"> | |
4038 <bqbiol:is> | |
4039 <rdf:Bag> | |
4040 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00257"/> | |
4041 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00625"/> | |
4042 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:33198"/> | |
4043 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/10690"/> | |
4044 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM341"/> | |
4045 </rdf:Bag> | |
4046 </bqbiol:is> | |
4047 </rdf:Description> | |
4048 </rdf:RDF> | |
4049 </annotation> | |
4050 </species> | |
4051 <species boundaryCondition="false" compartment="r" constant="false" fbc:charge="0" fbc:chemicalFormula="H2O" hasOnlySubstanceUnits="true" id="M_m02040r" initialConcentration="0" metaid="e3ae9f2d-61b6-4fc2-b932-c251c833a03e" name="H2O" sboTerm="SBO:0000247"> | |
4052 <notes> | |
4053 <body xmlns="http://www.w3.org/1999/xhtml"> | |
4054 <p>lipidmaps: LMST01040128</p> | |
4055 <p>kegg.compound: C00001</p> | |
4056 <p>hmdb: HMDB02111</p> | |
4057 <p>bigg.metabolite: h2o</p> | |
4058 <p>chebi: CHEBI:15377</p> | |
4059 <p>pubchem.compound: 962</p> | |
4060 <p>metanetx.chemical: MNXM2</p> | |
4061 <p>formula: H2O</p> | |
4062 </body> | |
4063 </notes> | |
4064 <annotation> | |
4065 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
4066 <rdf:Description rdf:about="#e3ae9f2d-61b6-4fc2-b932-c251c833a03e"> | |
4067 <bqbiol:is> | |
4068 <rdf:Bag> | |
4069 <rdf:li rdf:resource="https://identifiers.org/lipidmaps/LMST01040128"/> | |
4070 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00001"/> | |
4071 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB02111"/> | |
4072 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/h2o"/> | |
4073 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15377"/> | |
4074 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/962"/> | |
4075 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM2"/> | |
4076 </rdf:Bag> | |
4077 </bqbiol:is> | |
4078 </rdf:Description> | |
4079 </rdf:RDF> | |
4080 </annotation> | |
4081 </species> | |
4082 <species boundaryCondition="false" compartment="r" constant="false" fbc:charge="-3" fbc:chemicalFormula="C21H25N7O17P3" hasOnlySubstanceUnits="true" id="M_m02554r" initialConcentration="0" metaid="_2dffc121-cbfa-4ef2-bf72-85b96310b284" name="NADP+" sboTerm="SBO:0000247"> | |
4083 <notes> | |
4084 <body xmlns="http://www.w3.org/1999/xhtml"> | |
4085 <p>kegg.compound: C00006</p> | |
4086 <p>hmdb: HMDB00217</p> | |
4087 <p>bigg.metabolite: nadp</p> | |
4088 <p>chebi: CHEBI:18009</p> | |
4089 <p>pubchem.compound: 5886</p> | |
4090 <p>metanetx.chemical: MNXM5</p> | |
4091 <p>formula: C21H25N7O17P3</p> | |
4092 <p>charge: -3</p> | |
4093 </body> | |
4094 </notes> | |
4095 <annotation> | |
4096 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
4097 <rdf:Description rdf:about="#_2dffc121-cbfa-4ef2-bf72-85b96310b284"> | |
4098 <bqbiol:is> | |
4099 <rdf:Bag> | |
4100 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00006"/> | |
4101 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00217"/> | |
4102 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/nadp"/> | |
4103 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:18009"/> | |
4104 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5886"/> | |
4105 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM5"/> | |
4106 </rdf:Bag> | |
4107 </bqbiol:is> | |
4108 </rdf:Description> | |
4109 </rdf:RDF> | |
4110 </annotation> | |
4111 </species> | |
4112 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C5H9O7P" hasOnlySubstanceUnits="true" id="M_m00640c" initialConcentration="0" metaid="_646e6e22-6191-458f-b8cb-359247dfbf5f" name="2-deoxy-D-ribose-5-phosphate" sboTerm="SBO:0000247"> | |
4113 <notes> | |
4114 <body xmlns="http://www.w3.org/1999/xhtml"> | |
4115 <p>kegg.compound: C00673</p> | |
4116 <p>bigg.metabolite: 2dr5p</p> | |
4117 <p>chebi: CHEBI:16132</p> | |
4118 <p>pubchem.compound: 45934311</p> | |
4119 <p>metanetx.chemical: MNXM2179</p> | |
4120 <p>formula: C5H9O7P</p> | |
4121 <p>charge: -2</p> | |
4122 </body> | |
4123 </notes> | |
4124 <annotation> | |
4125 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
4126 <rdf:Description rdf:about="#_646e6e22-6191-458f-b8cb-359247dfbf5f"> | |
4127 <bqbiol:is> | |
4128 <rdf:Bag> | |
4129 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00673"/> | |
4130 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/2dr5p"/> | |
4131 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16132"/> | |
4132 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/45934311"/> | |
4133 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM2179"/> | |
4134 </rdf:Bag> | |
4135 </bqbiol:is> | |
4136 </rdf:Description> | |
4137 </rdf:RDF> | |
4138 </annotation> | |
4139 </species> | |
4140 </listOfSpecies> | |
4141 <listOfParameters> | |
4142 <parameter constant="true" id="UPPER_BOUND_1000_0" units="mmol_per_gDW_per_hr" value="1000"/> | |
4143 <parameter constant="true" id="LOWER_BOUND_1000_0" units="mmol_per_gDW_per_hr" value="-1000"/> | |
4144 <parameter constant="true" id="LOWER_BOUND_0_0" units="mmol_per_gDW_per_hr" value="0"/> | |
4145 </listOfParameters> | |
4146 <listOfReactions> | |
4147 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4831" metaid="a3b700c3-d335-4df3-bb92-f8fc04db5f3d" name="R_HMR_4831" reversible="true" sboTerm="SBO:0000176"> | |
4148 <notes> | |
4149 <body xmlns="http://www.w3.org/1999/xhtml"> | |
4150 <p>Confidence Level: 0</p> | |
4151 <p>ec-code: 1.1.99.13</p> | |
4152 <p>metanetx.reaction: MNXR107115</p> | |
4153 <p>kegg.reaction: R01680</p> | |
4154 <p>SUBSYSTEM: Galactose metabolism</p> | |
4155 <p>EC_NUMBER: 1.1.99.13</p> | |
4156 </body> | |
4157 </notes> | |
4158 <annotation> | |
4159 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
4160 <rdf:Description rdf:about="#a3b700c3-d335-4df3-bb92-f8fc04db5f3d"> | |
4161 <bqbiol:is> | |
4162 <rdf:Bag> | |
4163 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.99.13"/> | |
4164 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR107115"/> | |
4165 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01680"/> | |
4166 </rdf:Bag> | |
4167 </bqbiol:is> | |
4168 </rdf:Description> | |
4169 </rdf:RDF> | |
4170 </annotation> | |
4171 <listOfReactants> | |
4172 <speciesReference constant="true" species="M_m02552s" stoichiometry="1"/> | |
4173 <speciesReference constant="true" species="M_m02332s" stoichiometry="1"/> | |
4174 </listOfReactants> | |
4175 <listOfProducts> | |
4176 <speciesReference constant="true" species="M_m02553s" stoichiometry="1"/> | |
4177 <speciesReference constant="true" species="M_m00812s" stoichiometry="1"/> | |
4178 <speciesReference constant="true" species="M_m02039s" stoichiometry="1"/> | |
4179 </listOfProducts> | |
4180 </reaction> | |
4181 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4710" metaid="e6a0e367-66fa-4310-a86d-7dde3669eac3" name="R_HMR_4710" reversible="true" sboTerm="SBO:0000176"> | |
4182 <notes> | |
4183 <body xmlns="http://www.w3.org/1999/xhtml"> | |
4184 <p>Confidence Level: 0</p> | |
4185 <p>AUTHORS: PMID:3023765</p> | |
4186 <p>ec-code: 5.4.2.7</p> | |
4187 <p>metanetx.reaction: MNXR103116</p> | |
4188 <p>kegg.reaction: R02749</p> | |
4189 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
4190 <p>EC_NUMBER: 5.4.2.7</p> | |
4191 <p>pmids: 3023765</p> | |
4192 <p>GENE_ASSOCIATION: ( ENSG00000169299 ) OR ( ENSG00000180953 )</p> | |
4193 </body> | |
4194 </notes> | |
4195 <annotation> | |
4196 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
4197 <rdf:Description rdf:about="#e6a0e367-66fa-4310-a86d-7dde3669eac3"> | |
4198 <bqbiol:is> | |
4199 <rdf:Bag> | |
4200 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.4.2.7"/> | |
4201 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR103116"/> | |
4202 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R02749"/> | |
4203 </rdf:Bag> | |
4204 </bqbiol:is> | |
4205 <bqbiol:isDescribedBy> | |
4206 <rdf:Bag> | |
4207 <rdf:li rdf:resource="https://identifiers.org/pubmed/3023765"/> | |
4208 </rdf:Bag> | |
4209 </bqbiol:isDescribedBy> | |
4210 </rdf:Description> | |
4211 </rdf:RDF> | |
4212 </annotation> | |
4213 <fbc:geneProductAssociation> | |
4214 <fbc:or> | |
4215 <fbc:geneProductRef fbc:geneProduct="ENSG00000169299"/> | |
4216 <fbc:geneProductRef fbc:geneProduct="ENSG00000180953"/> | |
4217 </fbc:or> | |
4218 </fbc:geneProductAssociation> | |
4219 <listOfReactants> | |
4220 <speciesReference constant="true" species="M_m00639c" stoichiometry="1"/> | |
4221 </listOfReactants> | |
4222 <listOfProducts> | |
4223 <speciesReference constant="true" species="M_m00640c" stoichiometry="1"/> | |
4224 </listOfProducts> | |
4225 </reaction> | |
4226 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4832" metaid="_0a972dea-1cbc-4140-9dc6-ed7934752c06" name="R_HMR_4832" reversible="true" sboTerm="SBO:0000176"> | |
4227 <notes> | |
4228 <body xmlns="http://www.w3.org/1999/xhtml"> | |
4229 <p>Confidence Level: 0</p> | |
4230 <p>AUTHORS: PMID:3109378;UNIPROT:P16278</p> | |
4231 <p>ec-code: 3.2.1.23</p> | |
4232 <p>metanetx.reaction: MNXR109113 || MNXR105374</p> | |
4233 <p>kegg.reaction: R04783</p> | |
4234 <p>SUBSYSTEM: Galactose metabolism</p> | |
4235 <p>EC_NUMBER: 3.2.1.23</p> | |
4236 <p>pmids: 3109378</p> | |
4237 <p>GENE_ASSOCIATION: ENSG00000115850 AND ENSG00000163521 AND ENSG00000170266 AND ENSG00000188167</p> | |
4238 </body> | |
4239 </notes> | |
4240 <annotation> | |
4241 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
4242 <rdf:Description rdf:about="#_0a972dea-1cbc-4140-9dc6-ed7934752c06"> | |
4243 <bqbiol:is> | |
4244 <rdf:Bag> | |
4245 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.2.1.23"/> | |
4246 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR109113"/> | |
4247 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR105374"/> | |
4248 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R04783"/> | |
4249 </rdf:Bag> | |
4250 </bqbiol:is> | |
4251 <bqbiol:isDescribedBy> | |
4252 <rdf:Bag> | |
4253 <rdf:li rdf:resource="https://identifiers.org/pubmed/3109378"/> | |
4254 </rdf:Bag> | |
4255 </bqbiol:isDescribedBy> | |
4256 </rdf:Description> | |
4257 </rdf:RDF> | |
4258 </annotation> | |
4259 <fbc:geneProductAssociation> | |
4260 <fbc:and> | |
4261 <fbc:geneProductRef fbc:geneProduct="ENSG00000170266"/> | |
4262 <fbc:geneProductRef fbc:geneProduct="ENSG00000163521"/> | |
4263 <fbc:geneProductRef fbc:geneProduct="ENSG00000188167"/> | |
4264 <fbc:geneProductRef fbc:geneProduct="ENSG00000115850"/> | |
4265 </fbc:and> | |
4266 </fbc:geneProductAssociation> | |
4267 <listOfReactants> | |
4268 <speciesReference constant="true" species="M_m00810s" stoichiometry="1"/> | |
4269 <speciesReference constant="true" species="M_m01965s" stoichiometry="1"/> | |
4270 </listOfReactants> | |
4271 <listOfProducts> | |
4272 <speciesReference constant="true" species="M_m02040s" stoichiometry="1"/> | |
4273 <speciesReference constant="true" species="M_m00812s" stoichiometry="1"/> | |
4274 </listOfProducts> | |
4275 </reaction> | |
4276 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4315" metaid="_47e92709-8d94-4b33-a876-2890e1758a66" name="R_HMR_4315" reversible="true" sboTerm="SBO:0000176"> | |
4277 <notes> | |
4278 <body xmlns="http://www.w3.org/1999/xhtml"> | |
4279 <p>Confidence Level: 0</p> | |
4280 <p>ec-code: 1.1.1.14</p> | |
4281 <p>metanetx.reaction: MNXR104283</p> | |
4282 <p>kegg.reaction: R00875</p> | |
4283 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
4284 <p>EC_NUMBER: 1.1.1.14</p> | |
4285 <p>GENE_ASSOCIATION: ENSG00000140263</p> | |
4286 </body> | |
4287 </notes> | |
4288 <annotation> | |
4289 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
4290 <rdf:Description rdf:about="#_47e92709-8d94-4b33-a876-2890e1758a66"> | |
4291 <bqbiol:is> | |
4292 <rdf:Bag> | |
4293 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.14"/> | |
4294 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR104283"/> | |
4295 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00875"/> | |
4296 </rdf:Bag> | |
4297 </bqbiol:is> | |
4298 </rdf:Description> | |
4299 </rdf:RDF> | |
4300 </annotation> | |
4301 <fbc:geneProductAssociation> | |
4302 <fbc:geneProductRef fbc:geneProduct="ENSG00000140263"/> | |
4303 </fbc:geneProductAssociation> | |
4304 <listOfReactants> | |
4305 <speciesReference constant="true" species="M_m02552c" stoichiometry="1"/> | |
4306 <speciesReference constant="true" species="M_m01682c" stoichiometry="1"/> | |
4307 </listOfReactants> | |
4308 <listOfProducts> | |
4309 <speciesReference constant="true" species="M_m01840c" stoichiometry="1"/> | |
4310 <speciesReference constant="true" species="M_m02553c" stoichiometry="1"/> | |
4311 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
4312 </listOfProducts> | |
4313 </reaction> | |
4314 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4316" metaid="dc10854d-832c-4e85-a025-26973915eb3c" name="R_HMR_4316" reversible="true" sboTerm="SBO:0000176"> | |
4315 <notes> | |
4316 <body xmlns="http://www.w3.org/1999/xhtml"> | |
4317 <p>Confidence Level: 0</p> | |
4318 <p>ec-code: 1.1.1.21</p> | |
4319 <p>metanetx.reaction: MNXR104287</p> | |
4320 <p>kegg.reaction: R01787</p> | |
4321 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
4322 <p>EC_NUMBER: 1.1.1.21</p> | |
4323 <p>GENE_ASSOCIATION: ( ENSG00000085662 ) OR ( ENSG00000198074 )</p> | |
4324 </body> | |
4325 </notes> | |
4326 <annotation> | |
4327 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
4328 <rdf:Description rdf:about="#dc10854d-832c-4e85-a025-26973915eb3c"> | |
4329 <bqbiol:is> | |
4330 <rdf:Bag> | |
4331 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.21"/> | |
4332 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR104287"/> | |
4333 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01787"/> | |
4334 </rdf:Bag> | |
4335 </bqbiol:is> | |
4336 </rdf:Description> | |
4337 </rdf:RDF> | |
4338 </annotation> | |
4339 <fbc:geneProductAssociation> | |
4340 <fbc:or> | |
4341 <fbc:geneProductRef fbc:geneProduct="ENSG00000198074"/> | |
4342 <fbc:geneProductRef fbc:geneProduct="ENSG00000085662"/> | |
4343 </fbc:or> | |
4344 </fbc:geneProductAssociation> | |
4345 <listOfReactants> | |
4346 <speciesReference constant="true" species="M_m02554c" stoichiometry="1"/> | |
4347 <speciesReference constant="true" species="M_m01682c" stoichiometry="1"/> | |
4348 </listOfReactants> | |
4349 <listOfProducts> | |
4350 <speciesReference constant="true" species="M_m01965c" stoichiometry="1"/> | |
4351 <speciesReference constant="true" species="M_m02555c" stoichiometry="1"/> | |
4352 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
4353 </listOfProducts> | |
4354 </reaction> | |
4355 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4317" metaid="_36d1db72-1f57-4631-aff2-71a5a6395889" name="R_HMR_4317" reversible="false" sboTerm="SBO:0000176"> | |
4356 <notes> | |
4357 <body xmlns="http://www.w3.org/1999/xhtml"> | |
4358 <p>Confidence Level: 0</p> | |
4359 <p>AUTHORS: PMID:2211634</p> | |
4360 <p>ec-code: 2.7.1.-</p> | |
4361 <p>metanetx.reaction: MNXR103725</p> | |
4362 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
4363 <p>EC_NUMBER: 2.7.1.-</p> | |
4364 <p>pmids: 2211634</p> | |
4365 <p>GENE_ASSOCIATION: ( ENSG00000116199 ) OR ( ENSG00000141560 ) OR ( ENSG00000162408 ) OR ( ENSG00000167363 ) OR ( ENSG00000172456 )</p> | |
4366 </body> | |
4367 </notes> | |
4368 <annotation> | |
4369 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
4370 <rdf:Description rdf:about="#_36d1db72-1f57-4631-aff2-71a5a6395889"> | |
4371 <bqbiol:is> | |
4372 <rdf:Bag> | |
4373 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.-"/> | |
4374 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR103725"/> | |
4375 </rdf:Bag> | |
4376 </bqbiol:is> | |
4377 <bqbiol:isDescribedBy> | |
4378 <rdf:Bag> | |
4379 <rdf:li rdf:resource="https://identifiers.org/pubmed/2211634"/> | |
4380 </rdf:Bag> | |
4381 </bqbiol:isDescribedBy> | |
4382 </rdf:Description> | |
4383 </rdf:RDF> | |
4384 </annotation> | |
4385 <fbc:geneProductAssociation> | |
4386 <fbc:or> | |
4387 <fbc:geneProductRef fbc:geneProduct="ENSG00000116199"/> | |
4388 <fbc:geneProductRef fbc:geneProduct="ENSG00000141560"/> | |
4389 <fbc:geneProductRef fbc:geneProduct="ENSG00000162408"/> | |
4390 <fbc:geneProductRef fbc:geneProduct="ENSG00000172456"/> | |
4391 <fbc:geneProductRef fbc:geneProduct="ENSG00000167363"/> | |
4392 </fbc:or> | |
4393 </fbc:geneProductAssociation> | |
4394 <listOfReactants> | |
4395 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
4396 <speciesReference constant="true" species="M_m01682c" stoichiometry="1"/> | |
4397 </listOfReactants> | |
4398 <listOfProducts> | |
4399 <speciesReference constant="true" species="M_m02917c" stoichiometry="1"/> | |
4400 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
4401 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
4402 </listOfProducts> | |
4403 </reaction> | |
4404 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4318" metaid="_008e8008-7d8f-4404-bca8-d5c7e6a2b321" name="R_HMR_4318" reversible="false" sboTerm="SBO:0000176"> | |
4405 <notes> | |
4406 <body xmlns="http://www.w3.org/1999/xhtml"> | |
4407 <p>Confidence Level: 0</p> | |
4408 <p>ec-code: 2.7.1.-</p> | |
4409 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
4410 <p>EC_NUMBER: 2.7.1.-</p> | |
4411 <p>GENE_ASSOCIATION: ( ENSG00000116199 ) OR ( ENSG00000141560 ) OR ( ENSG00000162408 ) OR ( ENSG00000167363 ) OR ( ENSG00000172456 )</p> | |
4412 </body> | |
4413 </notes> | |
4414 <annotation> | |
4415 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
4416 <rdf:Description rdf:about="#_008e8008-7d8f-4404-bca8-d5c7e6a2b321"> | |
4417 <bqbiol:is> | |
4418 <rdf:Bag> | |
4419 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.-"/> | |
4420 </rdf:Bag> | |
4421 </bqbiol:is> | |
4422 </rdf:Description> | |
4423 </rdf:RDF> | |
4424 </annotation> | |
4425 <fbc:geneProductAssociation> | |
4426 <fbc:or> | |
4427 <fbc:geneProductRef fbc:geneProduct="ENSG00000116199"/> | |
4428 <fbc:geneProductRef fbc:geneProduct="ENSG00000141560"/> | |
4429 <fbc:geneProductRef fbc:geneProduct="ENSG00000162408"/> | |
4430 <fbc:geneProductRef fbc:geneProduct="ENSG00000172456"/> | |
4431 <fbc:geneProductRef fbc:geneProduct="ENSG00000167363"/> | |
4432 </fbc:or> | |
4433 </fbc:geneProductAssociation> | |
4434 <listOfReactants> | |
4435 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
4436 <speciesReference constant="true" species="M_m01840c" stoichiometry="1"/> | |
4437 </listOfReactants> | |
4438 <listOfProducts> | |
4439 <speciesReference constant="true" species="M_m01844c" stoichiometry="1"/> | |
4440 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
4441 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
4442 </listOfProducts> | |
4443 </reaction> | |
4444 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_3944" metaid="e3f7be38-4458-4c4b-9e00-ba70676d46ba" name="R_HMR_3944" reversible="false" sboTerm="SBO:0000176"> | |
4445 <notes> | |
4446 <body xmlns="http://www.w3.org/1999/xhtml"> | |
4447 <p>Confidence Level: 0</p> | |
4448 <p>AUTHORS: PMID:223665;PMID:4433565;PMID:4436332;PMID:6318818;PMID:6320876;PMID:8612650</p> | |
4449 <p>ec-code: 2.7.7.9</p> | |
4450 <p>metanetx.reaction: MNXR100022</p> | |
4451 <p>kegg.reaction: R00289</p> | |
4452 <p>bigg.reaction: GALUi</p> | |
4453 <p>SUBSYSTEM: Galactose metabolism</p> | |
4454 <p>EC_NUMBER: 2.7.7.9</p> | |
4455 <p>pmids: 223665,4433565,4436332,6318818,6320876,8612650</p> | |
4456 <p>GENE_ASSOCIATION: ENSG00000169764</p> | |
4457 </body> | |
4458 </notes> | |
4459 <annotation> | |
4460 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
4461 <rdf:Description rdf:about="#e3f7be38-4458-4c4b-9e00-ba70676d46ba"> | |
4462 <bqbiol:is> | |
4463 <rdf:Bag> | |
4464 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.7.9"/> | |
4465 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100022"/> | |
4466 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00289"/> | |
4467 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/GALUi"/> | |
4468 </rdf:Bag> | |
4469 </bqbiol:is> | |
4470 <bqbiol:isDescribedBy> | |
4471 <rdf:Bag> | |
4472 <rdf:li rdf:resource="https://identifiers.org/pubmed/223665"/> | |
4473 <rdf:li rdf:resource="https://identifiers.org/pubmed/6318818"/> | |
4474 <rdf:li rdf:resource="https://identifiers.org/pubmed/8612650"/> | |
4475 <rdf:li rdf:resource="https://identifiers.org/pubmed/6320876"/> | |
4476 <rdf:li rdf:resource="https://identifiers.org/pubmed/4433565"/> | |
4477 <rdf:li rdf:resource="https://identifiers.org/pubmed/4436332"/> | |
4478 </rdf:Bag> | |
4479 </bqbiol:isDescribedBy> | |
4480 </rdf:Description> | |
4481 </rdf:RDF> | |
4482 </annotation> | |
4483 <fbc:geneProductAssociation> | |
4484 <fbc:geneProductRef fbc:geneProduct="ENSG00000169764"/> | |
4485 </fbc:geneProductAssociation> | |
4486 <listOfReactants> | |
4487 <speciesReference constant="true" species="M_m03130c" stoichiometry="1"/> | |
4488 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
4489 <speciesReference constant="true" species="M_m01967c" stoichiometry="1"/> | |
4490 </listOfReactants> | |
4491 <listOfProducts> | |
4492 <speciesReference constant="true" species="M_m03108c" stoichiometry="1"/> | |
4493 <speciesReference constant="true" species="M_m02759c" stoichiometry="1"/> | |
4494 </listOfProducts> | |
4495 </reaction> | |
4496 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4319" metaid="_45d0d167-05cb-4738-8b64-49f3791a4688" name="R_HMR_4319" reversible="false" sboTerm="SBO:0000176"> | |
4497 <notes> | |
4498 <body xmlns="http://www.w3.org/1999/xhtml"> | |
4499 <p>Confidence Level: 0</p> | |
4500 <p>AUTHORS: PMID:16906315;PMID:7061426;PMID:7150652;PMID:8717435</p> | |
4501 <p>ec-code: 2.7.1.1</p> | |
4502 <p>metanetx.reaction: MNXR100614</p> | |
4503 <p>kegg.reaction: R00760</p> | |
4504 <p>bigg.reaction: HEX7</p> | |
4505 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
4506 <p>EC_NUMBER: 2.7.1.1</p> | |
4507 <p>pmids: 7061426,7150652,8717435,16906315</p> | |
4508 <p>GENE_ASSOCIATION: ( ENSG00000156510 ) OR ( ENSG00000156515 ) OR ( ENSG00000159399 ) OR ( ENSG00000160883 )</p> | |
4509 </body> | |
4510 </notes> | |
4511 <annotation> | |
4512 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
4513 <rdf:Description rdf:about="#_45d0d167-05cb-4738-8b64-49f3791a4688"> | |
4514 <bqbiol:is> | |
4515 <rdf:Bag> | |
4516 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.1"/> | |
4517 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100614"/> | |
4518 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00760"/> | |
4519 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/HEX7"/> | |
4520 </rdf:Bag> | |
4521 </bqbiol:is> | |
4522 <bqbiol:isDescribedBy> | |
4523 <rdf:Bag> | |
4524 <rdf:li rdf:resource="https://identifiers.org/pubmed/7150652"/> | |
4525 <rdf:li rdf:resource="https://identifiers.org/pubmed/7061426"/> | |
4526 <rdf:li rdf:resource="https://identifiers.org/pubmed/16906315"/> | |
4527 <rdf:li rdf:resource="https://identifiers.org/pubmed/8717435"/> | |
4528 </rdf:Bag> | |
4529 </bqbiol:isDescribedBy> | |
4530 </rdf:Description> | |
4531 </rdf:RDF> | |
4532 </annotation> | |
4533 <fbc:geneProductAssociation> | |
4534 <fbc:or> | |
4535 <fbc:geneProductRef fbc:geneProduct="ENSG00000159399"/> | |
4536 <fbc:geneProductRef fbc:geneProduct="ENSG00000160883"/> | |
4537 <fbc:geneProductRef fbc:geneProduct="ENSG00000156510"/> | |
4538 <fbc:geneProductRef fbc:geneProduct="ENSG00000156515"/> | |
4539 </fbc:or> | |
4540 </fbc:geneProductAssociation> | |
4541 <listOfReactants> | |
4542 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
4543 <speciesReference constant="true" species="M_m01840c" stoichiometry="1"/> | |
4544 </listOfReactants> | |
4545 <listOfProducts> | |
4546 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
4547 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
4548 <speciesReference constant="true" species="M_m01845c" stoichiometry="1"/> | |
4549 </listOfProducts> | |
4550 </reaction> | |
4551 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_RPEc" metaid="_060005cd-e77c-4aec-9a9e-9953a24e631e" name="Ribulose 5-Phosphate 3-Epimerase" reversible="true" sboTerm="SBO:0000176"> | |
4552 <notes> | |
4553 <body xmlns="http://www.w3.org/1999/xhtml"> | |
4554 <p>Confidence Level: 0</p> | |
4555 <p>AUTHORS: PMID: 4382012, PMID: 13575411, Harpers illustrated Biochemistry (2009) 28th edition pages 174-183</p> | |
4556 <p>ec-code: 5.1.3.1</p> | |
4557 <p>bigg.reaction: RPEc</p> | |
4558 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
4559 <p>EC_NUMBER: 5.1.3.1</p> | |
4560 <p>pmids: 4382012,13575411</p> | |
4561 <p>GENE_ASSOCIATION: ENSG00000197713</p> | |
4562 </body> | |
4563 </notes> | |
4564 <annotation> | |
4565 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
4566 <rdf:Description rdf:about="#_060005cd-e77c-4aec-9a9e-9953a24e631e"> | |
4567 <bqbiol:is> | |
4568 <rdf:Bag> | |
4569 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.1.3.1"/> | |
4570 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/RPEc"/> | |
4571 </rdf:Bag> | |
4572 </bqbiol:is> | |
4573 <bqbiol:isDescribedBy> | |
4574 <rdf:Bag> | |
4575 <rdf:li rdf:resource="https://identifiers.org/pubmed/13575411"/> | |
4576 <rdf:li rdf:resource="https://identifiers.org/pubmed/4382012"/> | |
4577 </rdf:Bag> | |
4578 </bqbiol:isDescribedBy> | |
4579 </rdf:Description> | |
4580 </rdf:RDF> | |
4581 </annotation> | |
4582 <fbc:geneProductAssociation> | |
4583 <fbc:geneProductRef fbc:geneProduct="ENSG00000197713"/> | |
4584 </fbc:geneProductAssociation> | |
4585 <listOfReactants> | |
4586 <speciesReference constant="true" species="M_m02846c" stoichiometry="2"/> | |
4587 </listOfReactants> | |
4588 <listOfProducts> | |
4589 <speciesReference constant="true" species="M_m01761c" stoichiometry="2"/> | |
4590 </listOfProducts> | |
4591 </reaction> | |
4592 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_GLYPHEHYc" metaid="_841ed12c-3095-4d2d-88c0-b2d51dc181bc" name="Hydrolysis of Glycylphenylalanine" reversible="true" sboTerm="SBO:0000176"> | |
4593 <notes> | |
4594 <body xmlns="http://www.w3.org/1999/xhtml"> | |
4595 <p>Confidence Level: 0</p> | |
4596 <p>AUTHORS: most probable reaction. added during gap filling.</p> | |
4597 <p>metanetx.reaction: MNXR100357</p> | |
4598 <p>bigg.reaction: GLYPHEHYc</p> | |
4599 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
4600 </body> | |
4601 </notes> | |
4602 <annotation> | |
4603 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
4604 <rdf:Description rdf:about="#_841ed12c-3095-4d2d-88c0-b2d51dc181bc"> | |
4605 <bqbiol:is> | |
4606 <rdf:Bag> | |
4607 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100357"/> | |
4608 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/GLYPHEHYc"/> | |
4609 </rdf:Bag> | |
4610 </bqbiol:is> | |
4611 </rdf:Description> | |
4612 </rdf:RDF> | |
4613 </annotation> | |
4614 <listOfReactants> | |
4615 <speciesReference constant="true" species="M_glyphe_c" stoichiometry="1"/> | |
4616 <speciesReference constant="true" species="M_m02040c" stoichiometry="1"/> | |
4617 </listOfReactants> | |
4618 <listOfProducts> | |
4619 <speciesReference constant="true" species="M_m02724c" stoichiometry="1"/> | |
4620 <speciesReference constant="true" species="M_m01986c" stoichiometry="1"/> | |
4621 </listOfProducts> | |
4622 </reaction> | |
4623 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_8762" metaid="b7a3dbfa-eb0f-42d0-890e-a21c45957a2f" name="R_HMR_8762" reversible="true" sboTerm="SBO:0000176"> | |
4624 <notes> | |
4625 <body xmlns="http://www.w3.org/1999/xhtml"> | |
4626 <p>Confidence Level: 0</p> | |
4627 <p>ec-code: 4.1.2.13</p> | |
4628 <p>metanetx.reaction: MNXR99466</p> | |
4629 <p>bigg.reaction: FBP26</p> | |
4630 <p>SUBSYSTEM: Galactose metabolism</p> | |
4631 <p>EC_NUMBER: 4.1.2.13</p> | |
4632 <p>GENE_ASSOCIATION: ( ENSG00000109107 ) OR ( ENSG00000136872 ) OR ( ENSG00000149925 ) OR ( ENSG00000285043 )</p> | |
4633 </body> | |
4634 </notes> | |
4635 <annotation> | |
4636 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
4637 <rdf:Description rdf:about="#b7a3dbfa-eb0f-42d0-890e-a21c45957a2f"> | |
4638 <bqbiol:is> | |
4639 <rdf:Bag> | |
4640 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.1.2.13"/> | |
4641 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR99466"/> | |
4642 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/FBP26"/> | |
4643 </rdf:Bag> | |
4644 </bqbiol:is> | |
4645 </rdf:Description> | |
4646 </rdf:RDF> | |
4647 </annotation> | |
4648 <fbc:geneProductAssociation> | |
4649 <fbc:or> | |
4650 <fbc:geneProductRef fbc:geneProduct="ENSG00000136872"/> | |
4651 <fbc:geneProductRef fbc:geneProduct="ENSG00000149925"/> | |
4652 <fbc:geneProductRef fbc:geneProduct="ENSG00000109107"/> | |
4653 <fbc:geneProductRef fbc:geneProduct="ENSG00000285043"/> | |
4654 </fbc:or> | |
4655 </fbc:geneProductAssociation> | |
4656 <listOfReactants> | |
4657 <speciesReference constant="true" species="M_m01746c" stoichiometry="1"/> | |
4658 </listOfReactants> | |
4659 <listOfProducts> | |
4660 <speciesReference constant="true" species="M_m01690c" stoichiometry="1"/> | |
4661 <speciesReference constant="true" species="M_m01981c" stoichiometry="1"/> | |
4662 </listOfProducts> | |
4663 </reaction> | |
4664 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_7674" metaid="_3217a74c-f7b4-467b-a857-58e20a23c963" name="R_HMR_7674" reversible="false" sboTerm="SBO:0000176"> | |
4665 <notes> | |
4666 <body xmlns="http://www.w3.org/1999/xhtml"> | |
4667 <p>Confidence Level: 0</p> | |
4668 <p>ec-code: 2.4.1.22</p> | |
4669 <p>metanetx.reaction: MNXR105080</p> | |
4670 <p>kegg.reaction: R00503</p> | |
4671 <p>bigg.reaction: UGALGTg</p> | |
4672 <p>SUBSYSTEM: Galactose metabolism</p> | |
4673 <p>EC_NUMBER: 2.4.1.22</p> | |
4674 <p>GENE_ASSOCIATION: ( ENSG00000086062 ) OR ( ENSG00000117411 ) OR ( ENSG00000167531 )</p> | |
4675 </body> | |
4676 </notes> | |
4677 <annotation> | |
4678 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
4679 <rdf:Description rdf:about="#_3217a74c-f7b4-467b-a857-58e20a23c963"> | |
4680 <bqbiol:is> | |
4681 <rdf:Bag> | |
4682 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.4.1.22"/> | |
4683 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR105080"/> | |
4684 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00503"/> | |
4685 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/UGALGTg"/> | |
4686 </rdf:Bag> | |
4687 </bqbiol:is> | |
4688 </rdf:Description> | |
4689 </rdf:RDF> | |
4690 </annotation> | |
4691 <fbc:geneProductAssociation> | |
4692 <fbc:or> | |
4693 <fbc:geneProductRef fbc:geneProduct="ENSG00000167531"/> | |
4694 <fbc:geneProductRef fbc:geneProduct="ENSG00000086062"/> | |
4695 <fbc:geneProductRef fbc:geneProduct="ENSG00000117411"/> | |
4696 </fbc:or> | |
4697 </fbc:geneProductAssociation> | |
4698 <listOfReactants> | |
4699 <speciesReference constant="true" species="M_m01965g" stoichiometry="1"/> | |
4700 <speciesReference constant="true" species="M_m03107g" stoichiometry="1"/> | |
4701 </listOfReactants> | |
4702 <listOfProducts> | |
4703 <speciesReference constant="true" species="M_m02039g" stoichiometry="1"/> | |
4704 <speciesReference constant="true" species="M_m03106g" stoichiometry="1"/> | |
4705 <speciesReference constant="true" species="M_m02332g" stoichiometry="1"/> | |
4706 </listOfProducts> | |
4707 </reaction> | |
4708 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_8761" metaid="_9b5f5c01-dd04-4b3e-a91e-008503d581a0" name="R_HMR_8761" reversible="false" sboTerm="SBO:0000176"> | |
4709 <notes> | |
4710 <body xmlns="http://www.w3.org/1999/xhtml"> | |
4711 <p>Confidence Level: 0</p> | |
4712 <p>ec-code: 2.7.1.3</p> | |
4713 <p>metanetx.reaction: MNXR100938</p> | |
4714 <p>kegg.reaction: R02927</p> | |
4715 <p>bigg.reaction: KHK3</p> | |
4716 <p>SUBSYSTEM: Galactose metabolism</p> | |
4717 <p>EC_NUMBER: 2.7.1.3</p> | |
4718 <p>GENE_ASSOCIATION: ENSG00000138030</p> | |
4719 </body> | |
4720 </notes> | |
4721 <annotation> | |
4722 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
4723 <rdf:Description rdf:about="#_9b5f5c01-dd04-4b3e-a91e-008503d581a0"> | |
4724 <bqbiol:is> | |
4725 <rdf:Bag> | |
4726 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.3"/> | |
4727 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100938"/> | |
4728 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R02927"/> | |
4729 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/KHK3"/> | |
4730 </rdf:Bag> | |
4731 </bqbiol:is> | |
4732 </rdf:Description> | |
4733 </rdf:RDF> | |
4734 </annotation> | |
4735 <fbc:geneProductAssociation> | |
4736 <fbc:geneProductRef fbc:geneProduct="ENSG00000138030"/> | |
4737 </fbc:geneProductAssociation> | |
4738 <listOfReactants> | |
4739 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
4740 <speciesReference constant="true" species="M_m01745c" stoichiometry="1"/> | |
4741 </listOfReactants> | |
4742 <listOfProducts> | |
4743 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
4744 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
4745 <speciesReference constant="true" species="M_m01746c" stoichiometry="1"/> | |
4746 </listOfProducts> | |
4747 </reaction> | |
4748 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4320" metaid="a8abfc18-6328-4a50-8b08-d17a3f28c8b2" name="R_HMR_4320" reversible="false" sboTerm="SBO:0000176"> | |
4749 <notes> | |
4750 <body xmlns="http://www.w3.org/1999/xhtml"> | |
4751 <p>Confidence Level: 0</p> | |
4752 <p>AUTHORS: PMID:10085245</p> | |
4753 <p>ec-code: 2.7.1.-</p> | |
4754 <p>metanetx.reaction: MNXR103514</p> | |
4755 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
4756 <p>EC_NUMBER: 2.7.1.-</p> | |
4757 <p>pmids: 10085245</p> | |
4758 <p>GENE_ASSOCIATION: ( ENSG00000116199 ) OR ( ENSG00000141560 ) OR ( ENSG00000162408 ) OR ( ENSG00000167363 ) OR ( ENSG00000172456 )</p> | |
4759 </body> | |
4760 </notes> | |
4761 <annotation> | |
4762 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
4763 <rdf:Description rdf:about="#a8abfc18-6328-4a50-8b08-d17a3f28c8b2"> | |
4764 <bqbiol:is> | |
4765 <rdf:Bag> | |
4766 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.-"/> | |
4767 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR103514"/> | |
4768 </rdf:Bag> | |
4769 </bqbiol:is> | |
4770 <bqbiol:isDescribedBy> | |
4771 <rdf:Bag> | |
4772 <rdf:li rdf:resource="https://identifiers.org/pubmed/10085245"/> | |
4773 </rdf:Bag> | |
4774 </bqbiol:isDescribedBy> | |
4775 </rdf:Description> | |
4776 </rdf:RDF> | |
4777 </annotation> | |
4778 <fbc:geneProductAssociation> | |
4779 <fbc:or> | |
4780 <fbc:geneProductRef fbc:geneProduct="ENSG00000116199"/> | |
4781 <fbc:geneProductRef fbc:geneProduct="ENSG00000141560"/> | |
4782 <fbc:geneProductRef fbc:geneProduct="ENSG00000162408"/> | |
4783 <fbc:geneProductRef fbc:geneProduct="ENSG00000172456"/> | |
4784 <fbc:geneProductRef fbc:geneProduct="ENSG00000167363"/> | |
4785 </fbc:or> | |
4786 </fbc:geneProductAssociation> | |
4787 <listOfReactants> | |
4788 <speciesReference constant="true" species="M_m02454c" stoichiometry="1"/> | |
4789 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
4790 </listOfReactants> | |
4791 <listOfProducts> | |
4792 <speciesReference constant="true" species="M_m01717c" stoichiometry="1"/> | |
4793 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
4794 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
4795 </listOfProducts> | |
4796 </reaction> | |
4797 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_8766" metaid="_67a27b12-ccf1-4623-a972-3aff79c6f80d" name="R_HMR_8766" reversible="true" sboTerm="SBO:0000176"> | |
4798 <notes> | |
4799 <body xmlns="http://www.w3.org/1999/xhtml"> | |
4800 <p>Confidence Level: 0</p> | |
4801 <p>ec-code: 1.1.1.21</p> | |
4802 <p>metanetx.reaction: MNXR100012</p> | |
4803 <p>kegg.reaction: R01095</p> | |
4804 <p>bigg.reaction: GALSIDEtl</p> | |
4805 <p>SUBSYSTEM: Galactose metabolism</p> | |
4806 <p>EC_NUMBER: 1.1.1.21</p> | |
4807 <p>GENE_ASSOCIATION: ( ENSG00000085662 ) OR ( ENSG00000198074 )</p> | |
4808 </body> | |
4809 </notes> | |
4810 <annotation> | |
4811 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
4812 <rdf:Description rdf:about="#_67a27b12-ccf1-4623-a972-3aff79c6f80d"> | |
4813 <bqbiol:is> | |
4814 <rdf:Bag> | |
4815 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.21"/> | |
4816 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100012"/> | |
4817 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01095"/> | |
4818 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/GALSIDEtl"/> | |
4819 </rdf:Bag> | |
4820 </bqbiol:is> | |
4821 </rdf:Description> | |
4822 </rdf:RDF> | |
4823 </annotation> | |
4824 <fbc:geneProductAssociation> | |
4825 <fbc:or> | |
4826 <fbc:geneProductRef fbc:geneProduct="ENSG00000198074"/> | |
4827 <fbc:geneProductRef fbc:geneProduct="ENSG00000085662"/> | |
4828 </fbc:or> | |
4829 </fbc:geneProductAssociation> | |
4830 <listOfReactants> | |
4831 <speciesReference constant="true" species="M_m01910c" stoichiometry="1"/> | |
4832 <speciesReference constant="true" species="M_m02555c" stoichiometry="1"/> | |
4833 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
4834 </listOfReactants> | |
4835 <listOfProducts> | |
4836 <speciesReference constant="true" species="M_m02554c" stoichiometry="1"/> | |
4837 <speciesReference constant="true" species="M_m01909c" stoichiometry="1"/> | |
4838 </listOfProducts> | |
4839 </reaction> | |
4840 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_8767" metaid="_8b416bb5-ba06-4ea8-a781-6758242e28a2" name="R_HMR_8767" reversible="false" sboTerm="SBO:0000176"> | |
4841 <notes> | |
4842 <body xmlns="http://www.w3.org/1999/xhtml"> | |
4843 <p>Confidence Level: 0</p> | |
4844 <p>ec-code: 2.7.7.12</p> | |
4845 <p>metanetx.reaction: MNXR100027</p> | |
4846 <p>kegg.reaction: R00502</p> | |
4847 <p>bigg.reaction: GALt2_2</p> | |
4848 <p>SUBSYSTEM: Galactose metabolism</p> | |
4849 <p>EC_NUMBER: 2.7.7.12</p> | |
4850 <p>GENE_ASSOCIATION: ENSG00000213930</p> | |
4851 </body> | |
4852 </notes> | |
4853 <annotation> | |
4854 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
4855 <rdf:Description rdf:about="#_8b416bb5-ba06-4ea8-a781-6758242e28a2"> | |
4856 <bqbiol:is> | |
4857 <rdf:Bag> | |
4858 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.7.12"/> | |
4859 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100027"/> | |
4860 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00502"/> | |
4861 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/GALt2_2"/> | |
4862 </rdf:Bag> | |
4863 </bqbiol:is> | |
4864 </rdf:Description> | |
4865 </rdf:RDF> | |
4866 </annotation> | |
4867 <fbc:geneProductAssociation> | |
4868 <fbc:geneProductRef fbc:geneProduct="ENSG00000213930"/> | |
4869 </fbc:geneProductAssociation> | |
4870 <listOfReactants> | |
4871 <speciesReference constant="true" species="M_m03130c" stoichiometry="1"/> | |
4872 <speciesReference constant="true" species="M_m01322c" stoichiometry="1"/> | |
4873 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
4874 </listOfReactants> | |
4875 <listOfProducts> | |
4876 <speciesReference constant="true" species="M_m02759c" stoichiometry="1"/> | |
4877 <speciesReference constant="true" species="M_m03107c" stoichiometry="1"/> | |
4878 </listOfProducts> | |
4879 </reaction> | |
4880 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_8764" metaid="_4a18991c-afe6-4ab4-9518-7eea4183c3a8" name="R_HMR_8764" reversible="false" sboTerm="SBO:0000176"> | |
4881 <notes> | |
4882 <body xmlns="http://www.w3.org/1999/xhtml"> | |
4883 <p>Confidence Level: 0</p> | |
4884 <p>ec-code: 3.2.1.108</p> | |
4885 <p>metanetx.reaction: MNXR101000</p> | |
4886 <p>kegg.reaction: R06114</p> | |
4887 <p>bigg.reaction: LACZly</p> | |
4888 <p>SUBSYSTEM: Galactose metabolism</p> | |
4889 <p>EC_NUMBER: 3.2.1.108</p> | |
4890 <p>GENE_ASSOCIATION: ENSG00000115850</p> | |
4891 </body> | |
4892 </notes> | |
4893 <annotation> | |
4894 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
4895 <rdf:Description rdf:about="#_4a18991c-afe6-4ab4-9518-7eea4183c3a8"> | |
4896 <bqbiol:is> | |
4897 <rdf:Bag> | |
4898 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.2.1.108"/> | |
4899 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR101000"/> | |
4900 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R06114"/> | |
4901 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/LACZly"/> | |
4902 </rdf:Bag> | |
4903 </bqbiol:is> | |
4904 </rdf:Description> | |
4905 </rdf:RDF> | |
4906 </annotation> | |
4907 <fbc:geneProductAssociation> | |
4908 <fbc:geneProductRef fbc:geneProduct="ENSG00000115850"/> | |
4909 </fbc:geneProductAssociation> | |
4910 <listOfReactants> | |
4911 <speciesReference constant="true" species="M_m02040l" stoichiometry="1"/> | |
4912 <speciesReference constant="true" species="M_m02332l" stoichiometry="1"/> | |
4913 </listOfReactants> | |
4914 <listOfProducts> | |
4915 <speciesReference constant="true" species="M_m01910l" stoichiometry="1"/> | |
4916 <speciesReference constant="true" species="M_m01965l" stoichiometry="1"/> | |
4917 </listOfProducts> | |
4918 </reaction> | |
4919 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4400" metaid="_24e2c246-dc4f-43cb-b817-8363e45ca0f0" name="R_HMR_4400" reversible="false" sboTerm="SBO:0000176"> | |
4920 <notes> | |
4921 <body xmlns="http://www.w3.org/1999/xhtml"> | |
4922 <p>Confidence Level: 0</p> | |
4923 <p>AUTHORS: PMID:10410995;PMID:2428310;PMID:9603974</p> | |
4924 <p>ec-code: 1.1.1.271</p> | |
4925 <p>metanetx.reaction: MNXR100108 || MNXR105384</p> | |
4926 <p>kegg.reaction: R05692</p> | |
4927 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
4928 <p>EC_NUMBER: 1.1.1.271</p> | |
4929 <p>pmids: 2428310,9603974,10410995</p> | |
4930 <p>GENE_ASSOCIATION: ENSG00000104522</p> | |
4931 </body> | |
4932 </notes> | |
4933 <annotation> | |
4934 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
4935 <rdf:Description rdf:about="#_24e2c246-dc4f-43cb-b817-8363e45ca0f0"> | |
4936 <bqbiol:is> | |
4937 <rdf:Bag> | |
4938 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.271"/> | |
4939 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100108"/> | |
4940 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR105384"/> | |
4941 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R05692"/> | |
4942 </rdf:Bag> | |
4943 </bqbiol:is> | |
4944 <bqbiol:isDescribedBy> | |
4945 <rdf:Bag> | |
4946 <rdf:li rdf:resource="https://identifiers.org/pubmed/2428310"/> | |
4947 <rdf:li rdf:resource="https://identifiers.org/pubmed/9603974"/> | |
4948 <rdf:li rdf:resource="https://identifiers.org/pubmed/10410995"/> | |
4949 </rdf:Bag> | |
4950 </bqbiol:isDescribedBy> | |
4951 </rdf:Description> | |
4952 </rdf:RDF> | |
4953 </annotation> | |
4954 <fbc:geneProductAssociation> | |
4955 <fbc:geneProductRef fbc:geneProduct="ENSG00000104522"/> | |
4956 </fbc:geneProductAssociation> | |
4957 <listOfReactants> | |
4958 <speciesReference constant="true" species="M_m01949c" stoichiometry="1"/> | |
4959 <speciesReference constant="true" species="M_m02553c" stoichiometry="1"/> | |
4960 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
4961 </listOfReactants> | |
4962 <listOfProducts> | |
4963 <speciesReference constant="true" species="M_m02552c" stoichiometry="1"/> | |
4964 <speciesReference constant="true" species="M_m01950c" stoichiometry="1"/> | |
4965 </listOfProducts> | |
4966 </reaction> | |
4967 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4565" metaid="dc55ec50-f182-42db-834f-d0cf1b380879" name="R_HMR_4565" reversible="true" sboTerm="SBO:0000176"> | |
4968 <notes> | |
4969 <body xmlns="http://www.w3.org/1999/xhtml"> | |
4970 <p>Confidence Level: 0</p> | |
4971 <p>AUTHORS: PMID:8549825;UNIPROT:P37837</p> | |
4972 <p>ec-code: 2.2.1.2</p> | |
4973 <p>metanetx.reaction: MNXR104715</p> | |
4974 <p>kegg.reaction: R08575</p> | |
4975 <p>bigg.reaction: TALA</p> | |
4976 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
4977 <p>EC_NUMBER: 2.2.1.2</p> | |
4978 <p>pmids: 8549825</p> | |
4979 <p>GENE_ASSOCIATION: ENSG00000177156</p> | |
4980 </body> | |
4981 </notes> | |
4982 <annotation> | |
4983 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
4984 <rdf:Description rdf:about="#dc55ec50-f182-42db-834f-d0cf1b380879"> | |
4985 <bqbiol:is> | |
4986 <rdf:Bag> | |
4987 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.2.1.2"/> | |
4988 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR104715"/> | |
4989 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R08575"/> | |
4990 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/TALA"/> | |
4991 </rdf:Bag> | |
4992 </bqbiol:is> | |
4993 <bqbiol:isDescribedBy> | |
4994 <rdf:Bag> | |
4995 <rdf:li rdf:resource="https://identifiers.org/pubmed/8549825"/> | |
4996 </rdf:Bag> | |
4997 </bqbiol:isDescribedBy> | |
4998 </rdf:Description> | |
4999 </rdf:RDF> | |
5000 </annotation> | |
5001 <fbc:geneProductAssociation> | |
5002 <fbc:geneProductRef fbc:geneProduct="ENSG00000177156"/> | |
5003 </fbc:geneProductAssociation> | |
5004 <listOfReactants> | |
5005 <speciesReference constant="true" species="M_m01939c" stoichiometry="1"/> | |
5006 <speciesReference constant="true" species="M_m02884c" stoichiometry="1"/> | |
5007 </listOfReactants> | |
5008 <listOfProducts> | |
5009 <speciesReference constant="true" species="M_m01785c" stoichiometry="1"/> | |
5010 <speciesReference constant="true" species="M_m01845c" stoichiometry="1"/> | |
5011 </listOfProducts> | |
5012 </reaction> | |
5013 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4841" metaid="f74d8639-e4ff-4f06-b6de-2c4de6cff989" name="R_HMR_4841" reversible="true" sboTerm="SBO:0000176"> | |
5014 <notes> | |
5015 <body xmlns="http://www.w3.org/1999/xhtml"> | |
5016 <p>Confidence Level: 0</p> | |
5017 <p>AUTHORS: PMID:15234337</p> | |
5018 <p>ec-code: 1.2.1.5</p> | |
5019 <p>metanetx.reaction: MNXR105388</p> | |
5020 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
5021 <p>EC_NUMBER: 1.2.1.5</p> | |
5022 <p>pmids: 15234337</p> | |
5023 <p>GENE_ASSOCIATION: ( ENSG00000006534 ) OR ( ENSG00000108602 ) OR ( ENSG00000132746 ) OR ( ENSG00000184254 )</p> | |
5024 </body> | |
5025 </notes> | |
5026 <annotation> | |
5027 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
5028 <rdf:Description rdf:about="#f74d8639-e4ff-4f06-b6de-2c4de6cff989"> | |
5029 <bqbiol:is> | |
5030 <rdf:Bag> | |
5031 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.2.1.5"/> | |
5032 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR105388"/> | |
5033 </rdf:Bag> | |
5034 </bqbiol:is> | |
5035 <bqbiol:isDescribedBy> | |
5036 <rdf:Bag> | |
5037 <rdf:li rdf:resource="https://identifiers.org/pubmed/15234337"/> | |
5038 </rdf:Bag> | |
5039 </bqbiol:isDescribedBy> | |
5040 </rdf:Description> | |
5041 </rdf:RDF> | |
5042 </annotation> | |
5043 <fbc:geneProductAssociation> | |
5044 <fbc:or> | |
5045 <fbc:geneProductRef fbc:geneProduct="ENSG00000108602"/> | |
5046 <fbc:geneProductRef fbc:geneProduct="ENSG00000132746"/> | |
5047 <fbc:geneProductRef fbc:geneProduct="ENSG00000184254"/> | |
5048 <fbc:geneProductRef fbc:geneProduct="ENSG00000006534"/> | |
5049 </fbc:or> | |
5050 </fbc:geneProductAssociation> | |
5051 <listOfReactants> | |
5052 <speciesReference constant="true" species="M_m02553c" stoichiometry="1"/> | |
5053 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
5054 <speciesReference constant="true" species="M_m02843c" stoichiometry="1"/> | |
5055 </listOfReactants> | |
5056 <listOfProducts> | |
5057 <speciesReference constant="true" species="M_m02552c" stoichiometry="1"/> | |
5058 <speciesReference constant="true" species="M_m02841c" stoichiometry="1"/> | |
5059 </listOfProducts> | |
5060 </reaction> | |
5061 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4401" metaid="_784dbb17-65c3-4806-8d58-6101b6f50cb1" name="R_HMR_4401" reversible="true" sboTerm="SBO:0000176"> | |
5062 <notes> | |
5063 <body xmlns="http://www.w3.org/1999/xhtml"> | |
5064 <p>Confidence Level: 0</p> | |
5065 <p>AUTHORS: PMID:5646162;PMID:6251080</p> | |
5066 <p>ec-code: 2.7.7.30</p> | |
5067 <p>metanetx.reaction: MNXR99061</p> | |
5068 <p>kegg.reaction: R01951</p> | |
5069 <p>bigg.reaction: F1PGT</p> | |
5070 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
5071 <p>EC_NUMBER: 2.7.7.30</p> | |
5072 <p>pmids: 5646162,6251080</p> | |
5073 <p>GENE_ASSOCIATION: ( ENSG00000116783 ) OR ( ENSG00000254685 ) OR ( ENSG00000259030 )</p> | |
5074 </body> | |
5075 </notes> | |
5076 <annotation> | |
5077 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
5078 <rdf:Description rdf:about="#_784dbb17-65c3-4806-8d58-6101b6f50cb1"> | |
5079 <bqbiol:is> | |
5080 <rdf:Bag> | |
5081 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.7.30"/> | |
5082 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR99061"/> | |
5083 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01951"/> | |
5084 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/F1PGT"/> | |
5085 </rdf:Bag> | |
5086 </bqbiol:is> | |
5087 <bqbiol:isDescribedBy> | |
5088 <rdf:Bag> | |
5089 <rdf:li rdf:resource="https://identifiers.org/pubmed/5646162"/> | |
5090 <rdf:li rdf:resource="https://identifiers.org/pubmed/6251080"/> | |
5091 </rdf:Bag> | |
5092 </bqbiol:isDescribedBy> | |
5093 </rdf:Description> | |
5094 </rdf:RDF> | |
5095 </annotation> | |
5096 <fbc:geneProductAssociation> | |
5097 <fbc:or> | |
5098 <fbc:geneProductRef fbc:geneProduct="ENSG00000116783"/> | |
5099 <fbc:geneProductRef fbc:geneProduct="ENSG00000254685"/> | |
5100 <fbc:geneProductRef fbc:geneProduct="ENSG00000259030"/> | |
5101 </fbc:or> | |
5102 </fbc:geneProductAssociation> | |
5103 <listOfReactants> | |
5104 <speciesReference constant="true" species="M_m01950c" stoichiometry="1"/> | |
5105 <speciesReference constant="true" species="M_m02759c" stoichiometry="1"/> | |
5106 </listOfReactants> | |
5107 <listOfProducts> | |
5108 <speciesReference constant="true" species="M_m02034c" stoichiometry="1"/> | |
5109 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
5110 <speciesReference constant="true" species="M_m02372c" stoichiometry="1"/> | |
5111 </listOfProducts> | |
5112 </reaction> | |
5113 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_RE1342C" metaid="_35970be8-355d-4991-bcbd-bf773e56c260" name="Aldehyde Reductase" reversible="true" sboTerm="SBO:0000176"> | |
5114 <notes> | |
5115 <body xmlns="http://www.w3.org/1999/xhtml"> | |
5116 <p>Confidence Level: 0</p> | |
5117 <p>AUTHORS: PMID:9537432</p> | |
5118 <p>ec-code: 1.1.1.21</p> | |
5119 <p>metanetx.reaction: MNXR103511</p> | |
5120 <p>bigg.reaction: RE1342C</p> | |
5121 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
5122 <p>EC_NUMBER: 1.1.1.21</p> | |
5123 <p>pmids: 9537432</p> | |
5124 </body> | |
5125 </notes> | |
5126 <annotation> | |
5127 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
5128 <rdf:Description rdf:about="#_35970be8-355d-4991-bcbd-bf773e56c260"> | |
5129 <bqbiol:is> | |
5130 <rdf:Bag> | |
5131 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.21"/> | |
5132 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR103511"/> | |
5133 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/RE1342C"/> | |
5134 </rdf:Bag> | |
5135 </bqbiol:is> | |
5136 <bqbiol:isDescribedBy> | |
5137 <rdf:Bag> | |
5138 <rdf:li rdf:resource="https://identifiers.org/pubmed/9537432"/> | |
5139 </rdf:Bag> | |
5140 </bqbiol:isDescribedBy> | |
5141 </rdf:Description> | |
5142 </rdf:RDF> | |
5143 </annotation> | |
5144 <listOfReactants> | |
5145 <speciesReference constant="true" species="M_m02552c" stoichiometry="1"/> | |
5146 <speciesReference constant="true" species="M_m01682c" stoichiometry="1"/> | |
5147 </listOfReactants> | |
5148 <listOfProducts> | |
5149 <speciesReference constant="true" species="M_m02553c" stoichiometry="1"/> | |
5150 <speciesReference constant="true" species="M_m01965c" stoichiometry="1"/> | |
5151 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
5152 </listOfProducts> | |
5153 </reaction> | |
5154 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4402" metaid="f3a0a958-fed9-477e-ae39-8cdedad1f5bc" name="R_HMR_4402" reversible="true" sboTerm="SBO:0000176"> | |
5155 <notes> | |
5156 <body xmlns="http://www.w3.org/1999/xhtml"> | |
5157 <p>Confidence Level: 0</p> | |
5158 <p>AUTHORS: PMID:12056818;PMID:12413479</p> | |
5159 <p>ec-code: 2.7.1.52</p> | |
5160 <p>metanetx.reaction: MNXR99595 || MNXR107992</p> | |
5161 <p>kegg.reaction: R03161</p> | |
5162 <p>bigg.reaction: FK</p> | |
5163 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
5164 <p>EC_NUMBER: 2.7.1.52</p> | |
5165 <p>pmids: 12056818,12413479</p> | |
5166 <p>GENE_ASSOCIATION: ENSG00000157353</p> | |
5167 </body> | |
5168 </notes> | |
5169 <annotation> | |
5170 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
5171 <rdf:Description rdf:about="#f3a0a958-fed9-477e-ae39-8cdedad1f5bc"> | |
5172 <bqbiol:is> | |
5173 <rdf:Bag> | |
5174 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.52"/> | |
5175 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR99595"/> | |
5176 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR107992"/> | |
5177 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R03161"/> | |
5178 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/FK"/> | |
5179 </rdf:Bag> | |
5180 </bqbiol:is> | |
5181 <bqbiol:isDescribedBy> | |
5182 <rdf:Bag> | |
5183 <rdf:li rdf:resource="https://identifiers.org/pubmed/12056818"/> | |
5184 <rdf:li rdf:resource="https://identifiers.org/pubmed/12413479"/> | |
5185 </rdf:Bag> | |
5186 </bqbiol:isDescribedBy> | |
5187 </rdf:Description> | |
5188 </rdf:RDF> | |
5189 </annotation> | |
5190 <fbc:geneProductAssociation> | |
5191 <fbc:geneProductRef fbc:geneProduct="ENSG00000157353"/> | |
5192 </fbc:geneProductAssociation> | |
5193 <listOfReactants> | |
5194 <speciesReference constant="true" species="M_m01159c" stoichiometry="1"/> | |
5195 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
5196 </listOfReactants> | |
5197 <listOfProducts> | |
5198 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
5199 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
5200 <speciesReference constant="true" species="M_m02372c" stoichiometry="1"/> | |
5201 </listOfProducts> | |
5202 </reaction> | |
5203 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4567" metaid="_9ff90316-748a-4f8a-91f7-86e61fbd681e" name="R_HMR_4567" reversible="true" sboTerm="SBO:0000176"> | |
5204 <notes> | |
5205 <body xmlns="http://www.w3.org/1999/xhtml"> | |
5206 <p>Confidence Level: 0</p> | |
5207 <p>AUTHORS: PMID:4084320;PMID:4272358</p> | |
5208 <p>ec-code: 2.7.1.11</p> | |
5209 <p>metanetx.reaction: MNXR105338 || MNXR102510</p> | |
5210 <p>kegg.reaction: R01843</p> | |
5211 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
5212 <p>EC_NUMBER: 2.7.1.11</p> | |
5213 <p>pmids: 4084320,4272358</p> | |
5214 <p>GENE_ASSOCIATION: ( ENSG00000067057 ) OR ( ENSG00000141959 ) OR ( ENSG00000152556 )</p> | |
5215 </body> | |
5216 </notes> | |
5217 <annotation> | |
5218 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
5219 <rdf:Description rdf:about="#_9ff90316-748a-4f8a-91f7-86e61fbd681e"> | |
5220 <bqbiol:is> | |
5221 <rdf:Bag> | |
5222 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.11"/> | |
5223 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR105338"/> | |
5224 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR102510"/> | |
5225 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01843"/> | |
5226 </rdf:Bag> | |
5227 </bqbiol:is> | |
5228 <bqbiol:isDescribedBy> | |
5229 <rdf:Bag> | |
5230 <rdf:li rdf:resource="https://identifiers.org/pubmed/4272358"/> | |
5231 <rdf:li rdf:resource="https://identifiers.org/pubmed/4084320"/> | |
5232 </rdf:Bag> | |
5233 </bqbiol:isDescribedBy> | |
5234 </rdf:Description> | |
5235 </rdf:RDF> | |
5236 </annotation> | |
5237 <fbc:geneProductAssociation> | |
5238 <fbc:or> | |
5239 <fbc:geneProductRef fbc:geneProduct="ENSG00000067057"/> | |
5240 <fbc:geneProductRef fbc:geneProduct="ENSG00000141959"/> | |
5241 <fbc:geneProductRef fbc:geneProduct="ENSG00000152556"/> | |
5242 </fbc:or> | |
5243 </fbc:geneProductAssociation> | |
5244 <listOfReactants> | |
5245 <speciesReference constant="true" species="M_m02883c" stoichiometry="1"/> | |
5246 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
5247 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
5248 </listOfReactants> | |
5249 <listOfProducts> | |
5250 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
5251 <speciesReference constant="true" species="M_m02884c" stoichiometry="1"/> | |
5252 </listOfProducts> | |
5253 </reaction> | |
5254 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4403" metaid="_41178734-fe7b-47f2-b84a-e69e20728adb" name="R_HMR_4403" reversible="false" sboTerm="SBO:0000176"> | |
5255 <notes> | |
5256 <body xmlns="http://www.w3.org/1999/xhtml"> | |
5257 <p>Confidence Level: 0</p> | |
5258 <p>AUTHORS: PMID:457669;PMID:5050937</p> | |
5259 <p>ec-code: 5.3.1.25</p> | |
5260 <p>metanetx.reaction: MNXR99468 || MNXR107994</p> | |
5261 <p>kegg.reaction: R03163</p> | |
5262 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
5263 <p>EC_NUMBER: 5.3.1.25</p> | |
5264 <p>pmids: 457669,5050937</p> | |
5265 </body> | |
5266 </notes> | |
5267 <annotation> | |
5268 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
5269 <rdf:Description rdf:about="#_41178734-fe7b-47f2-b84a-e69e20728adb"> | |
5270 <bqbiol:is> | |
5271 <rdf:Bag> | |
5272 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.3.1.25"/> | |
5273 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR99468"/> | |
5274 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR107994"/> | |
5275 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R03163"/> | |
5276 </rdf:Bag> | |
5277 </bqbiol:is> | |
5278 <bqbiol:isDescribedBy> | |
5279 <rdf:Bag> | |
5280 <rdf:li rdf:resource="https://identifiers.org/pubmed/457669"/> | |
5281 <rdf:li rdf:resource="https://identifiers.org/pubmed/5050937"/> | |
5282 </rdf:Bag> | |
5283 </bqbiol:isDescribedBy> | |
5284 </rdf:Description> | |
5285 </rdf:RDF> | |
5286 </annotation> | |
5287 <listOfReactants> | |
5288 <speciesReference constant="true" species="M_m01159c" stoichiometry="1"/> | |
5289 </listOfReactants> | |
5290 <listOfProducts> | |
5291 <speciesReference constant="true" species="M_m02373c" stoichiometry="1"/> | |
5292 </listOfProducts> | |
5293 </reaction> | |
5294 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4568" metaid="_414cb744-0f0d-4837-b547-ca5fc7b2529a" name="R_HMR_4568" reversible="true" sboTerm="SBO:0000176"> | |
5295 <notes> | |
5296 <body xmlns="http://www.w3.org/1999/xhtml"> | |
5297 <p>Confidence Level: 0</p> | |
5298 <p>AUTHORS: PMID:11945275</p> | |
5299 <p>ec-code: 2.7.1.11</p> | |
5300 <p>metanetx.reaction: MNXR105339</p> | |
5301 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
5302 <p>EC_NUMBER: 2.7.1.11</p> | |
5303 <p>pmids: 11945275</p> | |
5304 <p>GENE_ASSOCIATION: ( ENSG00000067057 ) OR ( ENSG00000141959 ) OR ( ENSG00000152556 )</p> | |
5305 </body> | |
5306 </notes> | |
5307 <annotation> | |
5308 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
5309 <rdf:Description rdf:about="#_414cb744-0f0d-4837-b547-ca5fc7b2529a"> | |
5310 <bqbiol:is> | |
5311 <rdf:Bag> | |
5312 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.11"/> | |
5313 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR105339"/> | |
5314 </rdf:Bag> | |
5315 </bqbiol:is> | |
5316 <bqbiol:isDescribedBy> | |
5317 <rdf:Bag> | |
5318 <rdf:li rdf:resource="https://identifiers.org/pubmed/11945275"/> | |
5319 </rdf:Bag> | |
5320 </bqbiol:isDescribedBy> | |
5321 </rdf:Description> | |
5322 </rdf:RDF> | |
5323 </annotation> | |
5324 <fbc:geneProductAssociation> | |
5325 <fbc:or> | |
5326 <fbc:geneProductRef fbc:geneProduct="ENSG00000067057"/> | |
5327 <fbc:geneProductRef fbc:geneProduct="ENSG00000141959"/> | |
5328 <fbc:geneProductRef fbc:geneProduct="ENSG00000152556"/> | |
5329 </fbc:or> | |
5330 </fbc:geneProductAssociation> | |
5331 <listOfReactants> | |
5332 <speciesReference constant="true" species="M_m03106c" stoichiometry="1"/> | |
5333 <speciesReference constant="true" species="M_m02883c" stoichiometry="1"/> | |
5334 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
5335 </listOfReactants> | |
5336 <listOfProducts> | |
5337 <speciesReference constant="true" species="M_m03130c" stoichiometry="1"/> | |
5338 <speciesReference constant="true" species="M_m02884c" stoichiometry="1"/> | |
5339 </listOfProducts> | |
5340 </reaction> | |
5341 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4128" metaid="_093ee677-4ba5-4528-856e-60f371fedfe8" name="R_HMR_4128" reversible="true" sboTerm="SBO:0000176"> | |
5342 <notes> | |
5343 <body xmlns="http://www.w3.org/1999/xhtml"> | |
5344 <p>Confidence Level: 0</p> | |
5345 <p>AUTHORS: PMID:191453;PMID:845161</p> | |
5346 <p>ec-code: 5.1.3.2</p> | |
5347 <p>metanetx.reaction: MNXR105057</p> | |
5348 <p>kegg.reaction: R00291</p> | |
5349 <p>bigg.reaction: UDPG4E</p> | |
5350 <p>SUBSYSTEM: Galactose metabolism</p> | |
5351 <p>EC_NUMBER: 5.1.3.2</p> | |
5352 <p>pmids: 191453,845161</p> | |
5353 <p>GENE_ASSOCIATION: ENSG00000117308</p> | |
5354 </body> | |
5355 </notes> | |
5356 <annotation> | |
5357 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
5358 <rdf:Description rdf:about="#_093ee677-4ba5-4528-856e-60f371fedfe8"> | |
5359 <bqbiol:is> | |
5360 <rdf:Bag> | |
5361 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.1.3.2"/> | |
5362 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR105057"/> | |
5363 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00291"/> | |
5364 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/UDPG4E"/> | |
5365 </rdf:Bag> | |
5366 </bqbiol:is> | |
5367 <bqbiol:isDescribedBy> | |
5368 <rdf:Bag> | |
5369 <rdf:li rdf:resource="https://identifiers.org/pubmed/845161"/> | |
5370 <rdf:li rdf:resource="https://identifiers.org/pubmed/191453"/> | |
5371 </rdf:Bag> | |
5372 </bqbiol:isDescribedBy> | |
5373 </rdf:Description> | |
5374 </rdf:RDF> | |
5375 </annotation> | |
5376 <fbc:geneProductAssociation> | |
5377 <fbc:geneProductRef fbc:geneProduct="ENSG00000117308"/> | |
5378 </fbc:geneProductAssociation> | |
5379 <listOfReactants> | |
5380 <speciesReference constant="true" species="M_m03107c" stoichiometry="1"/> | |
5381 </listOfReactants> | |
5382 <listOfProducts> | |
5383 <speciesReference constant="true" species="M_m03108c" stoichiometry="1"/> | |
5384 </listOfProducts> | |
5385 </reaction> | |
5386 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_8768" metaid="_8bcb4fd6-2dbe-4ec7-a1ff-10766373c9c1" name="R_HMR_8768" reversible="false" sboTerm="SBO:0000176"> | |
5387 <notes> | |
5388 <body xmlns="http://www.w3.org/1999/xhtml"> | |
5389 <p>Confidence Level: 0</p> | |
5390 <p>ec-code: 1.1.1.271</p> | |
5391 <p>metanetx.reaction: MNXR100108</p> | |
5392 <p>kegg.reaction: R05692</p> | |
5393 <p>bigg.reaction: GFUCS</p> | |
5394 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
5395 <p>EC_NUMBER: 1.1.1.271</p> | |
5396 <p>GENE_ASSOCIATION: ENSG00000104522</p> | |
5397 </body> | |
5398 </notes> | |
5399 <annotation> | |
5400 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
5401 <rdf:Description rdf:about="#_8bcb4fd6-2dbe-4ec7-a1ff-10766373c9c1"> | |
5402 <bqbiol:is> | |
5403 <rdf:Bag> | |
5404 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.271"/> | |
5405 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100108"/> | |
5406 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R05692"/> | |
5407 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/GFUCS"/> | |
5408 </rdf:Bag> | |
5409 </bqbiol:is> | |
5410 </rdf:Description> | |
5411 </rdf:RDF> | |
5412 </annotation> | |
5413 <fbc:geneProductAssociation> | |
5414 <fbc:geneProductRef fbc:geneProduct="ENSG00000104522"/> | |
5415 </fbc:geneProductAssociation> | |
5416 <listOfReactants> | |
5417 <speciesReference constant="true" species="M_m01949c" stoichiometry="1"/> | |
5418 <speciesReference constant="true" species="M_m02555c" stoichiometry="1"/> | |
5419 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
5420 </listOfReactants> | |
5421 <listOfProducts> | |
5422 <speciesReference constant="true" species="M_m01950c" stoichiometry="1"/> | |
5423 <speciesReference constant="true" species="M_m02554c" stoichiometry="1"/> | |
5424 </listOfProducts> | |
5425 </reaction> | |
5426 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4404" metaid="_53153327-0fb7-4573-bd62-024a6dbd9d90" name="R_HMR_4404" reversible="true" sboTerm="SBO:0000176"> | |
5427 <notes> | |
5428 <body xmlns="http://www.w3.org/1999/xhtml"> | |
5429 <p>Confidence Level: 0</p> | |
5430 <p>AUTHORS: PMID:234468;PMID:2495942;PMID:2843500;PMID:3089282;PMID:5141430;PMID:7115375;PMID:7154948;PMID:9924800</p> | |
5431 <p>ec-code: 2.2.1.1</p> | |
5432 <p>metanetx.reaction: MNXR104869 || MNXR106812</p> | |
5433 <p>kegg.reaction: R01067</p> | |
5434 <p>bigg.reaction: TKT2</p> | |
5435 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
5436 <p>EC_NUMBER: 2.2.1.1</p> | |
5437 <p>pmids: 234468,2495942,2843500,3089282,5141430,7115375,7154948,9924800</p> | |
5438 <p>GENE_ASSOCIATION: ( ENSG00000007350 ) OR ( ENSG00000151005 ) OR ( ENSG00000163931 )</p> | |
5439 </body> | |
5440 </notes> | |
5441 <annotation> | |
5442 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
5443 <rdf:Description rdf:about="#_53153327-0fb7-4573-bd62-024a6dbd9d90"> | |
5444 <bqbiol:is> | |
5445 <rdf:Bag> | |
5446 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.2.1.1"/> | |
5447 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR104869"/> | |
5448 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR106812"/> | |
5449 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01067"/> | |
5450 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/TKT2"/> | |
5451 </rdf:Bag> | |
5452 </bqbiol:is> | |
5453 <bqbiol:isDescribedBy> | |
5454 <rdf:Bag> | |
5455 <rdf:li rdf:resource="https://identifiers.org/pubmed/2495942"/> | |
5456 <rdf:li rdf:resource="https://identifiers.org/pubmed/7115375"/> | |
5457 <rdf:li rdf:resource="https://identifiers.org/pubmed/234468"/> | |
5458 <rdf:li rdf:resource="https://identifiers.org/pubmed/2843500"/> | |
5459 <rdf:li rdf:resource="https://identifiers.org/pubmed/9924800"/> | |
5460 <rdf:li rdf:resource="https://identifiers.org/pubmed/5141430"/> | |
5461 <rdf:li rdf:resource="https://identifiers.org/pubmed/7154948"/> | |
5462 <rdf:li rdf:resource="https://identifiers.org/pubmed/3089282"/> | |
5463 </rdf:Bag> | |
5464 </bqbiol:isDescribedBy> | |
5465 </rdf:Description> | |
5466 </rdf:RDF> | |
5467 </annotation> | |
5468 <fbc:geneProductAssociation> | |
5469 <fbc:or> | |
5470 <fbc:geneProductRef fbc:geneProduct="ENSG00000163931"/> | |
5471 <fbc:geneProductRef fbc:geneProduct="ENSG00000007350"/> | |
5472 <fbc:geneProductRef fbc:geneProduct="ENSG00000151005"/> | |
5473 </fbc:or> | |
5474 </fbc:geneProductAssociation> | |
5475 <listOfReactants> | |
5476 <speciesReference constant="true" species="M_m01761c" stoichiometry="1"/> | |
5477 <speciesReference constant="true" species="M_m01785c" stoichiometry="1"/> | |
5478 </listOfReactants> | |
5479 <listOfProducts> | |
5480 <speciesReference constant="true" species="M_m01939c" stoichiometry="1"/> | |
5481 <speciesReference constant="true" species="M_m01845c" stoichiometry="1"/> | |
5482 </listOfProducts> | |
5483 </reaction> | |
5484 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4490" metaid="f0088831-0d71-400f-b3b3-78d25c47e1f4" name="R_HMR_4490" reversible="false" sboTerm="SBO:0000176"> | |
5485 <notes> | |
5486 <body xmlns="http://www.w3.org/1999/xhtml"> | |
5487 <p>Confidence Level: 0</p> | |
5488 <p>AUTHORS: PMID:16906315;PMID:7061426;PMID:7150652;PMID:8717435</p> | |
5489 <p>ec-code: 2.7.1.1</p> | |
5490 <p>metanetx.reaction: MNXR95795</p> | |
5491 <p>kegg.reaction: R01326</p> | |
5492 <p>bigg.reaction: HEX4</p> | |
5493 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
5494 <p>EC_NUMBER: 2.7.1.1</p> | |
5495 <p>pmids: 7061426,7150652,8717435,16906315</p> | |
5496 <p>GENE_ASSOCIATION: ( ENSG00000156510 ) OR ( ENSG00000156515 ) OR ( ENSG00000159399 ) OR ( ENSG00000160883 )</p> | |
5497 </body> | |
5498 </notes> | |
5499 <annotation> | |
5500 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
5501 <rdf:Description rdf:about="#f0088831-0d71-400f-b3b3-78d25c47e1f4"> | |
5502 <bqbiol:is> | |
5503 <rdf:Bag> | |
5504 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.1"/> | |
5505 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR95795"/> | |
5506 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01326"/> | |
5507 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/HEX4"/> | |
5508 </rdf:Bag> | |
5509 </bqbiol:is> | |
5510 <bqbiol:isDescribedBy> | |
5511 <rdf:Bag> | |
5512 <rdf:li rdf:resource="https://identifiers.org/pubmed/7150652"/> | |
5513 <rdf:li rdf:resource="https://identifiers.org/pubmed/7061426"/> | |
5514 <rdf:li rdf:resource="https://identifiers.org/pubmed/16906315"/> | |
5515 <rdf:li rdf:resource="https://identifiers.org/pubmed/8717435"/> | |
5516 </rdf:Bag> | |
5517 </bqbiol:isDescribedBy> | |
5518 </rdf:Description> | |
5519 </rdf:RDF> | |
5520 </annotation> | |
5521 <fbc:geneProductAssociation> | |
5522 <fbc:or> | |
5523 <fbc:geneProductRef fbc:geneProduct="ENSG00000159399"/> | |
5524 <fbc:geneProductRef fbc:geneProduct="ENSG00000160883"/> | |
5525 <fbc:geneProductRef fbc:geneProduct="ENSG00000156510"/> | |
5526 <fbc:geneProductRef fbc:geneProduct="ENSG00000156515"/> | |
5527 </fbc:or> | |
5528 </fbc:geneProductAssociation> | |
5529 <listOfReactants> | |
5530 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
5531 <speciesReference constant="true" species="M_m02453c" stoichiometry="1"/> | |
5532 </listOfReactants> | |
5533 <listOfProducts> | |
5534 <speciesReference constant="true" species="M_m02455c" stoichiometry="1"/> | |
5535 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
5536 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
5537 </listOfProducts> | |
5538 </reaction> | |
5539 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4052" metaid="f3773fb2-a697-4ad0-b9c8-70f626e44da0" name="R_HMR_4052" reversible="false" sboTerm="SBO:0000176"> | |
5540 <notes> | |
5541 <body xmlns="http://www.w3.org/1999/xhtml"> | |
5542 <p>Confidence Level: 0</p> | |
5543 <p>AUTHORS: PMID:11101685;PMID:7572345</p> | |
5544 <p>ec-code: 2.7.6.1</p> | |
5545 <p>metanetx.reaction: MNXR106802 || MNXR103215</p> | |
5546 <p>kegg.reaction: R01049</p> | |
5547 <p>bigg.reaction: PRPPS</p> | |
5548 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
5549 <p>EC_NUMBER: 2.7.6.1</p> | |
5550 <p>pmids: 7572345,11101685</p> | |
5551 <p>GENE_ASSOCIATION: ( ENSG00000101911 ) OR ( ENSG00000147224 ) OR ( ENSG00000229937 )</p> | |
5552 </body> | |
5553 </notes> | |
5554 <annotation> | |
5555 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
5556 <rdf:Description rdf:about="#f3773fb2-a697-4ad0-b9c8-70f626e44da0"> | |
5557 <bqbiol:is> | |
5558 <rdf:Bag> | |
5559 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.6.1"/> | |
5560 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR106802"/> | |
5561 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR103215"/> | |
5562 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01049"/> | |
5563 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/PRPPS"/> | |
5564 </rdf:Bag> | |
5565 </bqbiol:is> | |
5566 <bqbiol:isDescribedBy> | |
5567 <rdf:Bag> | |
5568 <rdf:li rdf:resource="https://identifiers.org/pubmed/7572345"/> | |
5569 <rdf:li rdf:resource="https://identifiers.org/pubmed/11101685"/> | |
5570 </rdf:Bag> | |
5571 </bqbiol:isDescribedBy> | |
5572 </rdf:Description> | |
5573 </rdf:RDF> | |
5574 </annotation> | |
5575 <fbc:geneProductAssociation> | |
5576 <fbc:or> | |
5577 <fbc:geneProductRef fbc:geneProduct="ENSG00000147224"/> | |
5578 <fbc:geneProductRef fbc:geneProduct="ENSG00000229937"/> | |
5579 <fbc:geneProductRef fbc:geneProduct="ENSG00000101911"/> | |
5580 </fbc:or> | |
5581 </fbc:geneProductAssociation> | |
5582 <listOfReactants> | |
5583 <speciesReference constant="true" species="M_m02845c" stoichiometry="1"/> | |
5584 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
5585 </listOfReactants> | |
5586 <listOfProducts> | |
5587 <speciesReference constant="true" species="M_m01334c" stoichiometry="1"/> | |
5588 <speciesReference constant="true" species="M_m02806c" stoichiometry="1"/> | |
5589 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
5590 </listOfProducts> | |
5591 </reaction> | |
5592 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4130" metaid="a1e6f11c-2c01-45d7-aa41-39764568a681" name="R_HMR_4130" reversible="false" sboTerm="SBO:0000176"> | |
5593 <notes> | |
5594 <body xmlns="http://www.w3.org/1999/xhtml"> | |
5595 <p>Confidence Level: 0</p> | |
5596 <p>ec-code: 2.7.1.6</p> | |
5597 <p>metanetx.reaction: MNXR99985</p> | |
5598 <p>bigg.reaction: GALKr</p> | |
5599 <p>SUBSYSTEM: Galactose metabolism</p> | |
5600 <p>EC_NUMBER: 2.7.1.6</p> | |
5601 <p>GENE_ASSOCIATION: ( ENSG00000108479 ) OR ( ENSG00000156958 )</p> | |
5602 </body> | |
5603 </notes> | |
5604 <annotation> | |
5605 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
5606 <rdf:Description rdf:about="#a1e6f11c-2c01-45d7-aa41-39764568a681"> | |
5607 <bqbiol:is> | |
5608 <rdf:Bag> | |
5609 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.6"/> | |
5610 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR99985"/> | |
5611 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/GALKr"/> | |
5612 </rdf:Bag> | |
5613 </bqbiol:is> | |
5614 </rdf:Description> | |
5615 </rdf:RDF> | |
5616 </annotation> | |
5617 <fbc:geneProductAssociation> | |
5618 <fbc:or> | |
5619 <fbc:geneProductRef fbc:geneProduct="ENSG00000108479"/> | |
5620 <fbc:geneProductRef fbc:geneProduct="ENSG00000156958"/> | |
5621 </fbc:or> | |
5622 </fbc:geneProductAssociation> | |
5623 <listOfReactants> | |
5624 <speciesReference constant="true" species="M_m01910c" stoichiometry="1"/> | |
5625 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
5626 </listOfReactants> | |
5627 <listOfProducts> | |
5628 <speciesReference constant="true" species="M_m01322c" stoichiometry="1"/> | |
5629 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
5630 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
5631 </listOfProducts> | |
5632 </reaction> | |
5633 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_8653" metaid="_22f2d06f-d7c0-4287-a929-46293b17c7af" name="R_HMR_8653" reversible="true" sboTerm="SBO:0000176"> | |
5634 <notes> | |
5635 <body xmlns="http://www.w3.org/1999/xhtml"> | |
5636 <p>Confidence Level: 0</p> | |
5637 <p>ec-code: 3.1.1.31</p> | |
5638 <p>metanetx.reaction: MNXR99907</p> | |
5639 <p>kegg.reaction: R10520</p> | |
5640 <p>bigg.reaction: G6PDH2r</p> | |
5641 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
5642 <p>EC_NUMBER: 3.1.1.31</p> | |
5643 <p>GENE_ASSOCIATION: ( ENSG00000049239 ) OR ( ENSG00000130313 )</p> | |
5644 </body> | |
5645 </notes> | |
5646 <annotation> | |
5647 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
5648 <rdf:Description rdf:about="#_22f2d06f-d7c0-4287-a929-46293b17c7af"> | |
5649 <bqbiol:is> | |
5650 <rdf:Bag> | |
5651 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.1.1.31"/> | |
5652 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR99907"/> | |
5653 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R10520"/> | |
5654 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/G6PDH2r"/> | |
5655 </rdf:Bag> | |
5656 </bqbiol:is> | |
5657 </rdf:Description> | |
5658 </rdf:RDF> | |
5659 </annotation> | |
5660 <fbc:geneProductAssociation> | |
5661 <fbc:or> | |
5662 <fbc:geneProductRef fbc:geneProduct="ENSG00000049239"/> | |
5663 <fbc:geneProductRef fbc:geneProduct="ENSG00000130313"/> | |
5664 </fbc:or> | |
5665 </fbc:geneProductAssociation> | |
5666 <listOfReactants> | |
5667 <speciesReference constant="true" species="M_m01961r" stoichiometry="1"/> | |
5668 <speciesReference constant="true" species="M_m02553r" stoichiometry="1"/> | |
5669 <speciesReference constant="true" species="M_m02039r" stoichiometry="1"/> | |
5670 </listOfReactants> | |
5671 <listOfProducts> | |
5672 <speciesReference constant="true" species="M_m01968r" stoichiometry="1"/> | |
5673 <speciesReference constant="true" species="M_m02552r" stoichiometry="1"/> | |
5674 </listOfProducts> | |
5675 </reaction> | |
5676 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4131" metaid="fba7f9cd-fa2b-4c7a-a4a5-02318cc57a68" name="R_HMR_4131" reversible="true" sboTerm="SBO:0000176"> | |
5677 <notes> | |
5678 <body xmlns="http://www.w3.org/1999/xhtml"> | |
5679 <p>Confidence Level: 0</p> | |
5680 <p>ec-code: 2.7.7.12</p> | |
5681 <p>metanetx.reaction: MNXR105090</p> | |
5682 <p>kegg.reaction: R00955</p> | |
5683 <p>bigg.reaction: UGLT</p> | |
5684 <p>SUBSYSTEM: Galactose metabolism</p> | |
5685 <p>EC_NUMBER: 2.7.7.12</p> | |
5686 <p>GENE_ASSOCIATION: ENSG00000213930</p> | |
5687 </body> | |
5688 </notes> | |
5689 <annotation> | |
5690 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
5691 <rdf:Description rdf:about="#fba7f9cd-fa2b-4c7a-a4a5-02318cc57a68"> | |
5692 <bqbiol:is> | |
5693 <rdf:Bag> | |
5694 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.7.12"/> | |
5695 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR105090"/> | |
5696 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00955"/> | |
5697 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/UGLT"/> | |
5698 </rdf:Bag> | |
5699 </bqbiol:is> | |
5700 </rdf:Description> | |
5701 </rdf:RDF> | |
5702 </annotation> | |
5703 <fbc:geneProductAssociation> | |
5704 <fbc:geneProductRef fbc:geneProduct="ENSG00000213930"/> | |
5705 </fbc:geneProductAssociation> | |
5706 <listOfReactants> | |
5707 <speciesReference constant="true" species="M_m03107c" stoichiometry="1"/> | |
5708 <speciesReference constant="true" species="M_m01967c" stoichiometry="1"/> | |
5709 </listOfReactants> | |
5710 <listOfProducts> | |
5711 <speciesReference constant="true" species="M_m03108c" stoichiometry="1"/> | |
5712 <speciesReference constant="true" species="M_m01322c" stoichiometry="1"/> | |
5713 </listOfProducts> | |
5714 </reaction> | |
5715 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4297" metaid="c5cf5503-7811-4ea5-b3d5-159879fdbf6a" name="R_HMR_4297" reversible="false" sboTerm="SBO:0000176"> | |
5716 <notes> | |
5717 <body xmlns="http://www.w3.org/1999/xhtml"> | |
5718 <p>Confidence Level: 0</p> | |
5719 <p>AUTHORS: PMID:7506254;PMID:7688733</p> | |
5720 <p>ec-code: 2.7.1.105</p> | |
5721 <p>metanetx.reaction: MNXR102508</p> | |
5722 <p>kegg.reaction: R00757</p> | |
5723 <p>bigg.reaction: PFK26</p> | |
5724 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
5725 <p>EC_NUMBER: 2.7.1.105</p> | |
5726 <p>pmids: 7506254,7688733</p> | |
5727 <p>GENE_ASSOCIATION: ( ENSG00000114268 ) OR ( ENSG00000123836 ) OR ( ENSG00000158571 ) OR ( ENSG00000170525 )</p> | |
5728 </body> | |
5729 </notes> | |
5730 <annotation> | |
5731 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
5732 <rdf:Description rdf:about="#c5cf5503-7811-4ea5-b3d5-159879fdbf6a"> | |
5733 <bqbiol:is> | |
5734 <rdf:Bag> | |
5735 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.105"/> | |
5736 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR102508"/> | |
5737 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00757"/> | |
5738 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/PFK26"/> | |
5739 </rdf:Bag> | |
5740 </bqbiol:is> | |
5741 <bqbiol:isDescribedBy> | |
5742 <rdf:Bag> | |
5743 <rdf:li rdf:resource="https://identifiers.org/pubmed/7688733"/> | |
5744 <rdf:li rdf:resource="https://identifiers.org/pubmed/7506254"/> | |
5745 </rdf:Bag> | |
5746 </bqbiol:isDescribedBy> | |
5747 </rdf:Description> | |
5748 </rdf:RDF> | |
5749 </annotation> | |
5750 <fbc:geneProductAssociation> | |
5751 <fbc:or> | |
5752 <fbc:geneProductRef fbc:geneProduct="ENSG00000123836"/> | |
5753 <fbc:geneProductRef fbc:geneProduct="ENSG00000170525"/> | |
5754 <fbc:geneProductRef fbc:geneProduct="ENSG00000114268"/> | |
5755 <fbc:geneProductRef fbc:geneProduct="ENSG00000158571"/> | |
5756 </fbc:or> | |
5757 </fbc:geneProductAssociation> | |
5758 <listOfReactants> | |
5759 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
5760 <speciesReference constant="true" species="M_m01845c" stoichiometry="1"/> | |
5761 </listOfReactants> | |
5762 <listOfProducts> | |
5763 <speciesReference constant="true" species="M_m01843c" stoichiometry="1"/> | |
5764 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
5765 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
5766 </listOfProducts> | |
5767 </reaction> | |
5768 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4132" metaid="_7fd1e0ad-5113-42aa-963e-6215ef481843" name="R_HMR_4132" reversible="false" sboTerm="SBO:0000176"> | |
5769 <notes> | |
5770 <body xmlns="http://www.w3.org/1999/xhtml"> | |
5771 <p>Confidence Level: 0</p> | |
5772 <p>AUTHORS: PMID:10993714</p> | |
5773 <p>ec-code: 2.7.7.12</p> | |
5774 <p>metanetx.reaction: MNXR105090</p> | |
5775 <p>kegg.reaction: R00955</p> | |
5776 <p>SUBSYSTEM: Galactose metabolism</p> | |
5777 <p>EC_NUMBER: 2.7.7.12</p> | |
5778 <p>pmids: 10993714</p> | |
5779 <p>GENE_ASSOCIATION: ENSG00000213930</p> | |
5780 </body> | |
5781 </notes> | |
5782 <annotation> | |
5783 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
5784 <rdf:Description rdf:about="#_7fd1e0ad-5113-42aa-963e-6215ef481843"> | |
5785 <bqbiol:is> | |
5786 <rdf:Bag> | |
5787 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.7.12"/> | |
5788 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR105090"/> | |
5789 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00955"/> | |
5790 </rdf:Bag> | |
5791 </bqbiol:is> | |
5792 <bqbiol:isDescribedBy> | |
5793 <rdf:Bag> | |
5794 <rdf:li rdf:resource="https://identifiers.org/pubmed/10993714"/> | |
5795 </rdf:Bag> | |
5796 </bqbiol:isDescribedBy> | |
5797 </rdf:Description> | |
5798 </rdf:RDF> | |
5799 </annotation> | |
5800 <fbc:geneProductAssociation> | |
5801 <fbc:geneProductRef fbc:geneProduct="ENSG00000213930"/> | |
5802 </fbc:geneProductAssociation> | |
5803 <listOfReactants> | |
5804 <speciesReference constant="true" species="M_m01911c" stoichiometry="1"/> | |
5805 <speciesReference constant="true" species="M_m03108c" stoichiometry="1"/> | |
5806 </listOfReactants> | |
5807 <listOfProducts> | |
5808 <speciesReference constant="true" species="M_m03107c" stoichiometry="1"/> | |
5809 <speciesReference constant="true" species="M_m01967c" stoichiometry="1"/> | |
5810 </listOfProducts> | |
5811 </reaction> | |
5812 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_0454" metaid="c76ba226-384c-4b57-84b2-6140f038c756" name="R_HMR_0454" reversible="false" sboTerm="SBO:0000176"> | |
5813 <notes> | |
5814 <body xmlns="http://www.w3.org/1999/xhtml"> | |
5815 <p>Confidence Level: 0</p> | |
5816 <p>AUTHORS: PMID:12125098</p> | |
5817 <p>ec-code: 2.7.1.28</p> | |
5818 <p>metanetx.reaction: MNXR104940</p> | |
5819 <p>kegg.reaction: R01059</p> | |
5820 <p>bigg.reaction: TRIOK</p> | |
5821 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
5822 <p>EC_NUMBER: 2.7.1.28</p> | |
5823 <p>pmids: 12125098</p> | |
5824 </body> | |
5825 </notes> | |
5826 <annotation> | |
5827 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
5828 <rdf:Description rdf:about="#c76ba226-384c-4b57-84b2-6140f038c756"> | |
5829 <bqbiol:is> | |
5830 <rdf:Bag> | |
5831 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.28"/> | |
5832 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR104940"/> | |
5833 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01059"/> | |
5834 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/TRIOK"/> | |
5835 </rdf:Bag> | |
5836 </bqbiol:is> | |
5837 <bqbiol:isDescribedBy> | |
5838 <rdf:Bag> | |
5839 <rdf:li rdf:resource="https://identifiers.org/pubmed/12125098"/> | |
5840 </rdf:Bag> | |
5841 </bqbiol:isDescribedBy> | |
5842 </rdf:Description> | |
5843 </rdf:RDF> | |
5844 </annotation> | |
5845 <listOfReactants> | |
5846 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
5847 <speciesReference constant="true" species="M_m01981c" stoichiometry="1"/> | |
5848 </listOfReactants> | |
5849 <listOfProducts> | |
5850 <speciesReference constant="true" species="M_m01939c" stoichiometry="1"/> | |
5851 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
5852 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
5853 </listOfProducts> | |
5854 </reaction> | |
5855 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4774" metaid="_3d04496d-3c88-44ef-a0f4-1566551ef2a7" name="R_HMR_4774" reversible="true" sboTerm="SBO:0000176"> | |
5856 <notes> | |
5857 <body xmlns="http://www.w3.org/1999/xhtml"> | |
5858 <p>Confidence Level: 0</p> | |
5859 <p>AUTHORS: PMID:131802;PMID:1810251;PMID:193556;PMID:2987258;PMID:6091737</p> | |
5860 <p>ec-code: 2.7.1.11</p> | |
5861 <p>metanetx.reaction: MNXR108039 || MNXR105355</p> | |
5862 <p>kegg.reaction: R03237</p> | |
5863 <p>SUBSYSTEM: Galactose metabolism</p> | |
5864 <p>EC_NUMBER: 2.7.1.11</p> | |
5865 <p>pmids: 131802,193556,1810251,2987258,6091737</p> | |
5866 <p>GENE_ASSOCIATION: ( ENSG00000067057 ) OR ( ENSG00000141959 ) OR ( ENSG00000152556 )</p> | |
5867 </body> | |
5868 </notes> | |
5869 <annotation> | |
5870 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
5871 <rdf:Description rdf:about="#_3d04496d-3c88-44ef-a0f4-1566551ef2a7"> | |
5872 <bqbiol:is> | |
5873 <rdf:Bag> | |
5874 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.11"/> | |
5875 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR108039"/> | |
5876 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR105355"/> | |
5877 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R03237"/> | |
5878 </rdf:Bag> | |
5879 </bqbiol:is> | |
5880 <bqbiol:isDescribedBy> | |
5881 <rdf:Bag> | |
5882 <rdf:li rdf:resource="https://identifiers.org/pubmed/1810251"/> | |
5883 <rdf:li rdf:resource="https://identifiers.org/pubmed/6091737"/> | |
5884 <rdf:li rdf:resource="https://identifiers.org/pubmed/193556"/> | |
5885 <rdf:li rdf:resource="https://identifiers.org/pubmed/2987258"/> | |
5886 <rdf:li rdf:resource="https://identifiers.org/pubmed/131802"/> | |
5887 </rdf:Bag> | |
5888 </bqbiol:isDescribedBy> | |
5889 </rdf:Description> | |
5890 </rdf:RDF> | |
5891 </annotation> | |
5892 <fbc:geneProductAssociation> | |
5893 <fbc:or> | |
5894 <fbc:geneProductRef fbc:geneProduct="ENSG00000067057"/> | |
5895 <fbc:geneProductRef fbc:geneProduct="ENSG00000141959"/> | |
5896 <fbc:geneProductRef fbc:geneProduct="ENSG00000152556"/> | |
5897 </fbc:or> | |
5898 </fbc:geneProductAssociation> | |
5899 <listOfReactants> | |
5900 <speciesReference constant="true" species="M_m01424c" stoichiometry="1"/> | |
5901 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
5902 <speciesReference constant="true" species="M_m02955c" stoichiometry="1"/> | |
5903 </listOfReactants> | |
5904 <listOfProducts> | |
5905 <speciesReference constant="true" species="M_m01623c" stoichiometry="1"/> | |
5906 <speciesReference constant="true" species="M_m01746c" stoichiometry="1"/> | |
5907 </listOfProducts> | |
5908 </reaction> | |
5909 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4775" metaid="b71ca27b-2233-4904-bf68-12c5c97c9300" name="R_HMR_4775" reversible="true" sboTerm="SBO:0000176"> | |
5910 <notes> | |
5911 <body xmlns="http://www.w3.org/1999/xhtml"> | |
5912 <p>Confidence Level: 0</p> | |
5913 <p>AUTHORS: PMID:131802;PMID:1810251</p> | |
5914 <p>ec-code: 2.7.1.11</p> | |
5915 <p>metanetx.reaction: MNXR105356 || MNXR108041</p> | |
5916 <p>kegg.reaction: R03239</p> | |
5917 <p>SUBSYSTEM: Galactose metabolism</p> | |
5918 <p>EC_NUMBER: 2.7.1.11</p> | |
5919 <p>pmids: 131802,1810251</p> | |
5920 <p>GENE_ASSOCIATION: ( ENSG00000067057 ) OR ( ENSG00000141959 ) OR ( ENSG00000152556 )</p> | |
5921 </body> | |
5922 </notes> | |
5923 <annotation> | |
5924 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
5925 <rdf:Description rdf:about="#b71ca27b-2233-4904-bf68-12c5c97c9300"> | |
5926 <bqbiol:is> | |
5927 <rdf:Bag> | |
5928 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.11"/> | |
5929 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR105356"/> | |
5930 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR108041"/> | |
5931 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R03239"/> | |
5932 </rdf:Bag> | |
5933 </bqbiol:is> | |
5934 <bqbiol:isDescribedBy> | |
5935 <rdf:Bag> | |
5936 <rdf:li rdf:resource="https://identifiers.org/pubmed/1810251"/> | |
5937 <rdf:li rdf:resource="https://identifiers.org/pubmed/131802"/> | |
5938 </rdf:Bag> | |
5939 </bqbiol:isDescribedBy> | |
5940 </rdf:Description> | |
5941 </rdf:RDF> | |
5942 </annotation> | |
5943 <fbc:geneProductAssociation> | |
5944 <fbc:or> | |
5945 <fbc:geneProductRef fbc:geneProduct="ENSG00000067057"/> | |
5946 <fbc:geneProductRef fbc:geneProduct="ENSG00000141959"/> | |
5947 <fbc:geneProductRef fbc:geneProduct="ENSG00000152556"/> | |
5948 </fbc:or> | |
5949 </fbc:geneProductAssociation> | |
5950 <listOfReactants> | |
5951 <speciesReference constant="true" species="M_m02193c" stoichiometry="1"/> | |
5952 <speciesReference constant="true" species="M_m01746c" stoichiometry="1"/> | |
5953 </listOfReactants> | |
5954 <listOfProducts> | |
5955 <speciesReference constant="true" species="M_m02161c" stoichiometry="1"/> | |
5956 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
5957 <speciesReference constant="true" species="M_m02955c" stoichiometry="1"/> | |
5958 </listOfProducts> | |
5959 </reaction> | |
5960 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4414" metaid="b4722a38-261b-454e-93b5-c84c4aa10035" name="R_HMR_4414" reversible="false" sboTerm="SBO:0000176"> | |
5961 <notes> | |
5962 <body xmlns="http://www.w3.org/1999/xhtml"> | |
5963 <p>Confidence Level: 0</p> | |
5964 <p>AUTHORS: PMID:8908517</p> | |
5965 <p>ec-code: 2.7.1.6</p> | |
5966 <p>metanetx.reaction: MNXR99985</p> | |
5967 <p>kegg.reaction: R01092</p> | |
5968 <p>SUBSYSTEM: Galactose metabolism</p> | |
5969 <p>EC_NUMBER: 2.7.1.6</p> | |
5970 <p>pmids: 8908517</p> | |
5971 <p>GENE_ASSOCIATION: ( ENSG00000108479 ) OR ( ENSG00000156958 ) OR ( ENSG00000166262 )</p> | |
5972 </body> | |
5973 </notes> | |
5974 <annotation> | |
5975 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
5976 <rdf:Description rdf:about="#b4722a38-261b-454e-93b5-c84c4aa10035"> | |
5977 <bqbiol:is> | |
5978 <rdf:Bag> | |
5979 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.6"/> | |
5980 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR99985"/> | |
5981 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01092"/> | |
5982 </rdf:Bag> | |
5983 </bqbiol:is> | |
5984 <bqbiol:isDescribedBy> | |
5985 <rdf:Bag> | |
5986 <rdf:li rdf:resource="https://identifiers.org/pubmed/8908517"/> | |
5987 </rdf:Bag> | |
5988 </bqbiol:isDescribedBy> | |
5989 </rdf:Description> | |
5990 </rdf:RDF> | |
5991 </annotation> | |
5992 <fbc:geneProductAssociation> | |
5993 <fbc:or> | |
5994 <fbc:geneProductRef fbc:geneProduct="ENSG00000108479"/> | |
5995 <fbc:geneProductRef fbc:geneProduct="ENSG00000156958"/> | |
5996 <fbc:geneProductRef fbc:geneProduct="ENSG00000166262"/> | |
5997 </fbc:or> | |
5998 </fbc:geneProductAssociation> | |
5999 <listOfReactants> | |
6000 <speciesReference constant="true" species="M_m01910c" stoichiometry="1"/> | |
6001 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
6002 </listOfReactants> | |
6003 <listOfProducts> | |
6004 <speciesReference constant="true" species="M_m01911c" stoichiometry="1"/> | |
6005 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
6006 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
6007 </listOfProducts> | |
6008 </reaction> | |
6009 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4415" metaid="_0e1118fe-ec5c-4f40-b7ba-0a043f91a0d0" name="R_HMR_4415" reversible="false" sboTerm="SBO:0000176"> | |
6010 <notes> | |
6011 <body xmlns="http://www.w3.org/1999/xhtml"> | |
6012 <p>Confidence Level: 0</p> | |
6013 <p>AUTHORS: PMID:6786877</p> | |
6014 <p>ec-code: 3.2.1.108 || 3.2.1.23</p> | |
6015 <p>metanetx.reaction: MNXR101000</p> | |
6016 <p>kegg.reaction: R01100</p> | |
6017 <p>bigg.reaction: LACZe</p> | |
6018 <p>SUBSYSTEM: Galactose metabolism</p> | |
6019 <p>EC_NUMBER: 3.2.1.23;3.2.1.108</p> | |
6020 <p>pmids: 6786877</p> | |
6021 <p>GENE_ASSOCIATION: ENSG00000115850 AND ENSG00000163521 AND ENSG00000170266 AND ENSG00000188167</p> | |
6022 </body> | |
6023 </notes> | |
6024 <annotation> | |
6025 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
6026 <rdf:Description rdf:about="#_0e1118fe-ec5c-4f40-b7ba-0a043f91a0d0"> | |
6027 <bqbiol:is> | |
6028 <rdf:Bag> | |
6029 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.2.1.108"/> | |
6030 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.2.1.23"/> | |
6031 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR101000"/> | |
6032 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01100"/> | |
6033 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/LACZe"/> | |
6034 </rdf:Bag> | |
6035 </bqbiol:is> | |
6036 <bqbiol:isDescribedBy> | |
6037 <rdf:Bag> | |
6038 <rdf:li rdf:resource="https://identifiers.org/pubmed/6786877"/> | |
6039 </rdf:Bag> | |
6040 </bqbiol:isDescribedBy> | |
6041 </rdf:Description> | |
6042 </rdf:RDF> | |
6043 </annotation> | |
6044 <fbc:geneProductAssociation> | |
6045 <fbc:and> | |
6046 <fbc:geneProductRef fbc:geneProduct="ENSG00000170266"/> | |
6047 <fbc:geneProductRef fbc:geneProduct="ENSG00000163521"/> | |
6048 <fbc:geneProductRef fbc:geneProduct="ENSG00000188167"/> | |
6049 <fbc:geneProductRef fbc:geneProduct="ENSG00000115850"/> | |
6050 </fbc:and> | |
6051 </fbc:geneProductAssociation> | |
6052 <listOfReactants> | |
6053 <speciesReference constant="true" species="M_m02040s" stoichiometry="1"/> | |
6054 <speciesReference constant="true" species="M_m02332s" stoichiometry="1"/> | |
6055 </listOfReactants> | |
6056 <listOfProducts> | |
6057 <speciesReference constant="true" species="M_m01910s" stoichiometry="1"/> | |
6058 <speciesReference constant="true" species="M_m01965s" stoichiometry="1"/> | |
6059 </listOfProducts> | |
6060 </reaction> | |
6061 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4416" metaid="b1a0bbd3-03c8-481d-87b1-808aebb90ef2" name="R_HMR_4416" reversible="false" sboTerm="SBO:0000176"> | |
6062 <notes> | |
6063 <body xmlns="http://www.w3.org/1999/xhtml"> | |
6064 <p>Confidence Level: 0</p> | |
6065 <p>AUTHORS: PMID:3569296</p> | |
6066 <p>ec-code: 3.2.1.23 || 3.2.1.22</p> | |
6067 <p>metanetx.reaction: MNXR100115</p> | |
6068 <p>kegg.reaction: R01104</p> | |
6069 <p>SUBSYSTEM: Galactose metabolism</p> | |
6070 <p>EC_NUMBER: 3.2.1.22;3.2.1.23</p> | |
6071 <p>pmids: 3569296</p> | |
6072 <p>GENE_ASSOCIATION: ( ENSG00000102393 ) OR ( ENSG00000170266 ) OR ( ENSG00000241343 )</p> | |
6073 </body> | |
6074 </notes> | |
6075 <annotation> | |
6076 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
6077 <rdf:Description rdf:about="#b1a0bbd3-03c8-481d-87b1-808aebb90ef2"> | |
6078 <bqbiol:is> | |
6079 <rdf:Bag> | |
6080 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.2.1.23"/> | |
6081 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.2.1.22"/> | |
6082 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100115"/> | |
6083 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01104"/> | |
6084 </rdf:Bag> | |
6085 </bqbiol:is> | |
6086 <bqbiol:isDescribedBy> | |
6087 <rdf:Bag> | |
6088 <rdf:li rdf:resource="https://identifiers.org/pubmed/3569296"/> | |
6089 </rdf:Bag> | |
6090 </bqbiol:isDescribedBy> | |
6091 </rdf:Description> | |
6092 </rdf:RDF> | |
6093 </annotation> | |
6094 <fbc:geneProductAssociation> | |
6095 <fbc:or> | |
6096 <fbc:geneProductRef fbc:geneProduct="ENSG00000102393"/> | |
6097 <fbc:geneProductRef fbc:geneProduct="ENSG00000170266"/> | |
6098 <fbc:geneProductRef fbc:geneProduct="ENSG00000241343"/> | |
6099 </fbc:or> | |
6100 </fbc:geneProductAssociation> | |
6101 <listOfReactants> | |
6102 <speciesReference constant="true" species="M_m02040s" stoichiometry="1"/> | |
6103 <speciesReference constant="true" species="M_m01913s" stoichiometry="1"/> | |
6104 </listOfReactants> | |
6105 <listOfProducts> | |
6106 <speciesReference constant="true" species="M_m01910s" stoichiometry="1"/> | |
6107 <speciesReference constant="true" species="M_m01983s" stoichiometry="1"/> | |
6108 </listOfProducts> | |
6109 </reaction> | |
6110 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_FBA5" metaid="f429561f-98d2-434a-860a-ddff29f21ebd" name="D-Tagatose 1-Phosphate D-Glyceraldehyde-3-Phosphate-Lyase" reversible="true" sboTerm="SBO:0000176"> | |
6111 <notes> | |
6112 <body xmlns="http://www.w3.org/1999/xhtml"> | |
6113 <p>Confidence Level: 0</p> | |
6114 <p>AUTHORS: PMID:2996495,PMID:6284103,PMID:6298387</p> | |
6115 <p>ec-code: 4.1.2.13</p> | |
6116 <p>metanetx.reaction: MNXR99463</p> | |
6117 <p>bigg.reaction: FBA5</p> | |
6118 <p>SUBSYSTEM: Galactose metabolism</p> | |
6119 <p>EC_NUMBER: 4.1.2.13</p> | |
6120 <p>pmids: 2996495,6284103,6298387</p> | |
6121 <p>GENE_ASSOCIATION: ENSG00000136872</p> | |
6122 </body> | |
6123 </notes> | |
6124 <annotation> | |
6125 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
6126 <rdf:Description rdf:about="#f429561f-98d2-434a-860a-ddff29f21ebd"> | |
6127 <bqbiol:is> | |
6128 <rdf:Bag> | |
6129 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.1.2.13"/> | |
6130 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR99463"/> | |
6131 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/FBA5"/> | |
6132 </rdf:Bag> | |
6133 </bqbiol:is> | |
6134 <bqbiol:isDescribedBy> | |
6135 <rdf:Bag> | |
6136 <rdf:li rdf:resource="https://identifiers.org/pubmed/2996495"/> | |
6137 <rdf:li rdf:resource="https://identifiers.org/pubmed/6298387"/> | |
6138 <rdf:li rdf:resource="https://identifiers.org/pubmed/6284103"/> | |
6139 </rdf:Bag> | |
6140 </bqbiol:isDescribedBy> | |
6141 </rdf:Description> | |
6142 </rdf:RDF> | |
6143 </annotation> | |
6144 <fbc:geneProductAssociation> | |
6145 <fbc:geneProductRef fbc:geneProduct="ENSG00000136872"/> | |
6146 </fbc:geneProductAssociation> | |
6147 <listOfReactants> | |
6148 <speciesReference constant="true" species="M_tag1p_D_c" stoichiometry="1"/> | |
6149 </listOfReactants> | |
6150 <listOfProducts> | |
6151 <speciesReference constant="true" species="M_m01690c" stoichiometry="1"/> | |
6152 <speciesReference constant="true" species="M_m01981c" stoichiometry="1"/> | |
6153 </listOfProducts> | |
6154 </reaction> | |
6155 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_PGLc" metaid="_3648fd3f-6668-495c-b2e0-e7ce9105a0bd" name="6-Phosphogluconolactonase" reversible="false" sboTerm="SBO:0000176"> | |
6156 <notes> | |
6157 <body xmlns="http://www.w3.org/1999/xhtml"> | |
6158 <p>Confidence Level: 0</p> | |
6159 <p>AUTHORS: PMID: 4382012, PMID: 13575411, Harpers illustrated Biochemistry (2009) 28th edition pages 174-183</p> | |
6160 <p>ec-code: 3.1.1.31</p> | |
6161 <p>bigg.reaction: PGLc</p> | |
6162 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
6163 <p>EC_NUMBER: 3.1.1.31</p> | |
6164 <p>pmids: 4382012,13575411</p> | |
6165 <p>GENE_ASSOCIATION: ENSG00000130313</p> | |
6166 </body> | |
6167 </notes> | |
6168 <annotation> | |
6169 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
6170 <rdf:Description rdf:about="#_3648fd3f-6668-495c-b2e0-e7ce9105a0bd"> | |
6171 <bqbiol:is> | |
6172 <rdf:Bag> | |
6173 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.1.1.31"/> | |
6174 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/PGLc"/> | |
6175 </rdf:Bag> | |
6176 </bqbiol:is> | |
6177 <bqbiol:isDescribedBy> | |
6178 <rdf:Bag> | |
6179 <rdf:li rdf:resource="https://identifiers.org/pubmed/13575411"/> | |
6180 <rdf:li rdf:resource="https://identifiers.org/pubmed/4382012"/> | |
6181 </rdf:Bag> | |
6182 </bqbiol:isDescribedBy> | |
6183 </rdf:Description> | |
6184 </rdf:RDF> | |
6185 </annotation> | |
6186 <fbc:geneProductAssociation> | |
6187 <fbc:geneProductRef fbc:geneProduct="ENSG00000130313"/> | |
6188 </fbc:geneProductAssociation> | |
6189 <listOfReactants> | |
6190 <speciesReference constant="true" species="M_m02040c" stoichiometry="3"/> | |
6191 <speciesReference constant="true" species="M_m01961c" stoichiometry="3"/> | |
6192 </listOfReactants> | |
6193 <listOfProducts> | |
6194 <speciesReference constant="true" species="M_m01169c" stoichiometry="3"/> | |
6195 <speciesReference constant="true" species="M_m02039c" stoichiometry="3"/> | |
6196 </listOfProducts> | |
6197 </reaction> | |
6198 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4383" metaid="_0ea26d9f-b8bd-4193-8626-31efb5856906" name="R_HMR_4383" reversible="true" sboTerm="SBO:0000176"> | |
6199 <notes> | |
6200 <body xmlns="http://www.w3.org/1999/xhtml"> | |
6201 <p>Confidence Level: 0</p> | |
6202 <p>AUTHORS: PMID:10571009;PMID:12231825;PMID:15033941;PMID:2085314;PMID:7702210;PMID:8381960</p> | |
6203 <p>ec-code: 5.3.1.8</p> | |
6204 <p>metanetx.reaction: MNXR106679 || MNXR101382</p> | |
6205 <p>kegg.reaction: R00772</p> | |
6206 <p>bigg.reaction: MAN6PI</p> | |
6207 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
6208 <p>EC_NUMBER: 5.3.1.8</p> | |
6209 <p>pmids: 2085314,7702210,8381960,10571009,12231825,15033941</p> | |
6210 <p>GENE_ASSOCIATION: ENSG00000178802</p> | |
6211 </body> | |
6212 </notes> | |
6213 <annotation> | |
6214 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
6215 <rdf:Description rdf:about="#_0ea26d9f-b8bd-4193-8626-31efb5856906"> | |
6216 <bqbiol:is> | |
6217 <rdf:Bag> | |
6218 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.3.1.8"/> | |
6219 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR106679"/> | |
6220 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR101382"/> | |
6221 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00772"/> | |
6222 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/MAN6PI"/> | |
6223 </rdf:Bag> | |
6224 </bqbiol:is> | |
6225 <bqbiol:isDescribedBy> | |
6226 <rdf:Bag> | |
6227 <rdf:li rdf:resource="https://identifiers.org/pubmed/10571009"/> | |
6228 <rdf:li rdf:resource="https://identifiers.org/pubmed/15033941"/> | |
6229 <rdf:li rdf:resource="https://identifiers.org/pubmed/7702210"/> | |
6230 <rdf:li rdf:resource="https://identifiers.org/pubmed/8381960"/> | |
6231 <rdf:li rdf:resource="https://identifiers.org/pubmed/12231825"/> | |
6232 <rdf:li rdf:resource="https://identifiers.org/pubmed/2085314"/> | |
6233 </rdf:Bag> | |
6234 </bqbiol:isDescribedBy> | |
6235 </rdf:Description> | |
6236 </rdf:RDF> | |
6237 </annotation> | |
6238 <fbc:geneProductAssociation> | |
6239 <fbc:geneProductRef fbc:geneProduct="ENSG00000178802"/> | |
6240 </fbc:geneProductAssociation> | |
6241 <listOfReactants> | |
6242 <speciesReference constant="true" species="M_m01845c" stoichiometry="1"/> | |
6243 </listOfReactants> | |
6244 <listOfProducts> | |
6245 <speciesReference constant="true" species="M_m02455c" stoichiometry="1"/> | |
6246 </listOfProducts> | |
6247 </reaction> | |
6248 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_GNDc" metaid="ef163958-45f6-498d-acb0-0e2d72945b19" name="Phosphogluconate Dehydrogenase" reversible="false" sboTerm="SBO:0000176"> | |
6249 <notes> | |
6250 <body xmlns="http://www.w3.org/1999/xhtml"> | |
6251 <p>Confidence Level: 0</p> | |
6252 <p>AUTHORS: PMID: 4382012, PMID: 13575411, Harpers illustrated Biochemistry (2009) 28th edition pages 174-183</p> | |
6253 <p>ec-code: 1.1.1.44</p> | |
6254 <p>bigg.reaction: GNDc</p> | |
6255 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
6256 <p>EC_NUMBER: 1.1.1.44</p> | |
6257 <p>pmids: 4382012,13575411</p> | |
6258 <p>GENE_ASSOCIATION: ENSG00000142657</p> | |
6259 </body> | |
6260 </notes> | |
6261 <annotation> | |
6262 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
6263 <rdf:Description rdf:about="#ef163958-45f6-498d-acb0-0e2d72945b19"> | |
6264 <bqbiol:is> | |
6265 <rdf:Bag> | |
6266 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.44"/> | |
6267 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/GNDc"/> | |
6268 </rdf:Bag> | |
6269 </bqbiol:is> | |
6270 <bqbiol:isDescribedBy> | |
6271 <rdf:Bag> | |
6272 <rdf:li rdf:resource="https://identifiers.org/pubmed/13575411"/> | |
6273 <rdf:li rdf:resource="https://identifiers.org/pubmed/4382012"/> | |
6274 </rdf:Bag> | |
6275 </bqbiol:isDescribedBy> | |
6276 </rdf:Description> | |
6277 </rdf:RDF> | |
6278 </annotation> | |
6279 <fbc:geneProductAssociation> | |
6280 <fbc:geneProductRef fbc:geneProduct="ENSG00000142657"/> | |
6281 </fbc:geneProductAssociation> | |
6282 <listOfReactants> | |
6283 <speciesReference constant="true" species="M_m01169c" stoichiometry="3"/> | |
6284 <speciesReference constant="true" species="M_m02554c" stoichiometry="3"/> | |
6285 </listOfReactants> | |
6286 <listOfProducts> | |
6287 <speciesReference constant="true" species="M_m02846c" stoichiometry="3"/> | |
6288 <speciesReference constant="true" species="M_m02555c" stoichiometry="3"/> | |
6289 <speciesReference constant="true" species="M_m01596c" stoichiometry="3"/> | |
6290 </listOfProducts> | |
6291 </reaction> | |
6292 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4385" metaid="_83fb9834-0745-47d2-b88f-9cb966a0eefd" name="R_HMR_4385" reversible="false" sboTerm="SBO:0000176"> | |
6293 <notes> | |
6294 <body xmlns="http://www.w3.org/1999/xhtml"> | |
6295 <p>Confidence Level: 0</p> | |
6296 <p>AUTHORS: PMID:10593562;PMID:12889654;PMID:15361947</p> | |
6297 <p>ec-code: 5.4.2.8</p> | |
6298 <p>metanetx.reaction: MNXR101729</p> | |
6299 <p>kegg.reaction: R01818</p> | |
6300 <p>bigg.reaction: PMANM</p> | |
6301 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
6302 <p>EC_NUMBER: 5.4.2.8</p> | |
6303 <p>pmids: 10593562,12889654,15361947</p> | |
6304 <p>GENE_ASSOCIATION: ( ENSG00000100413 ) OR ( ENSG00000100417 ) OR ( ENSG00000140650 )</p> | |
6305 </body> | |
6306 </notes> | |
6307 <annotation> | |
6308 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
6309 <rdf:Description rdf:about="#_83fb9834-0745-47d2-b88f-9cb966a0eefd"> | |
6310 <bqbiol:is> | |
6311 <rdf:Bag> | |
6312 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.4.2.8"/> | |
6313 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR101729"/> | |
6314 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01818"/> | |
6315 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/PMANM"/> | |
6316 </rdf:Bag> | |
6317 </bqbiol:is> | |
6318 <bqbiol:isDescribedBy> | |
6319 <rdf:Bag> | |
6320 <rdf:li rdf:resource="https://identifiers.org/pubmed/15361947"/> | |
6321 <rdf:li rdf:resource="https://identifiers.org/pubmed/12889654"/> | |
6322 <rdf:li rdf:resource="https://identifiers.org/pubmed/10593562"/> | |
6323 </rdf:Bag> | |
6324 </bqbiol:isDescribedBy> | |
6325 </rdf:Description> | |
6326 </rdf:RDF> | |
6327 </annotation> | |
6328 <fbc:geneProductAssociation> | |
6329 <fbc:or> | |
6330 <fbc:geneProductRef fbc:geneProduct="ENSG00000140650"/> | |
6331 <fbc:geneProductRef fbc:geneProduct="ENSG00000100417"/> | |
6332 <fbc:geneProductRef fbc:geneProduct="ENSG00000100413"/> | |
6333 </fbc:or> | |
6334 </fbc:geneProductAssociation> | |
6335 <listOfReactants> | |
6336 <speciesReference constant="true" species="M_m02455c" stoichiometry="1"/> | |
6337 </listOfReactants> | |
6338 <listOfProducts> | |
6339 <speciesReference constant="true" species="M_m02454c" stoichiometry="1"/> | |
6340 </listOfProducts> | |
6341 </reaction> | |
6342 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4386" metaid="_1b139dd2-60dd-4d29-b9db-c7cd0c97d62b" name="R_HMR_4386" reversible="false" sboTerm="SBO:0000176"> | |
6343 <notes> | |
6344 <body xmlns="http://www.w3.org/1999/xhtml"> | |
6345 <p>Confidence Level: 0</p> | |
6346 <p>AUTHORS: PMID:13876695</p> | |
6347 <p>ec-code: 2.7.7.13 || 2.7.7.22</p> | |
6348 <p>metanetx.reaction: MNXR101376</p> | |
6349 <p>kegg.reaction: R00883</p> | |
6350 <p>bigg.reaction: MAN1PT2</p> | |
6351 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
6352 <p>EC_NUMBER: 2.7.7.22;2.7.7.13</p> | |
6353 <p>pmids: 13876695</p> | |
6354 <p>GENE_ASSOCIATION: ( ENSG00000144591 ) OR ( ENSG00000164068 ) OR ( ENSG00000173540 ) OR ( ENSG00000176020 )</p> | |
6355 </body> | |
6356 </notes> | |
6357 <annotation> | |
6358 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
6359 <rdf:Description rdf:about="#_1b139dd2-60dd-4d29-b9db-c7cd0c97d62b"> | |
6360 <bqbiol:is> | |
6361 <rdf:Bag> | |
6362 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.7.13"/> | |
6363 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.7.22"/> | |
6364 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR101376"/> | |
6365 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00883"/> | |
6366 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/MAN1PT2"/> | |
6367 </rdf:Bag> | |
6368 </bqbiol:is> | |
6369 <bqbiol:isDescribedBy> | |
6370 <rdf:Bag> | |
6371 <rdf:li rdf:resource="https://identifiers.org/pubmed/13876695"/> | |
6372 </rdf:Bag> | |
6373 </bqbiol:isDescribedBy> | |
6374 </rdf:Description> | |
6375 </rdf:RDF> | |
6376 </annotation> | |
6377 <fbc:geneProductAssociation> | |
6378 <fbc:or> | |
6379 <fbc:geneProductRef fbc:geneProduct="ENSG00000164068"/> | |
6380 <fbc:geneProductRef fbc:geneProduct="ENSG00000176020"/> | |
6381 <fbc:geneProductRef fbc:geneProduct="ENSG00000173540"/> | |
6382 <fbc:geneProductRef fbc:geneProduct="ENSG00000144591"/> | |
6383 </fbc:or> | |
6384 </fbc:geneProductAssociation> | |
6385 <listOfReactants> | |
6386 <speciesReference constant="true" species="M_m01948c" stoichiometry="1"/> | |
6387 <speciesReference constant="true" species="M_m02454c" stoichiometry="1"/> | |
6388 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
6389 </listOfReactants> | |
6390 <listOfProducts> | |
6391 <speciesReference constant="true" species="M_m01951c" stoichiometry="1"/> | |
6392 <speciesReference constant="true" species="M_m02751c" stoichiometry="1"/> | |
6393 </listOfProducts> | |
6394 </reaction> | |
6395 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_ABTD1" metaid="_030d6c02-c016-4e4d-a3a0-100f8b573715" name="L-Arabinitol 4-Dehydrogenase" reversible="true" sboTerm="SBO:0000176"> | |
6396 <notes> | |
6397 <body xmlns="http://www.w3.org/1999/xhtml"> | |
6398 <p>Confidence Level: 0</p> | |
6399 <p>AUTHORS: PMID: 16435225</p> | |
6400 <p>ec-code: 3.1.1.4</p> | |
6401 <p>bigg.reaction: ABTD1</p> | |
6402 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
6403 <p>EC_NUMBER: 3.1.1.4</p> | |
6404 <p>pmids: 16435225</p> | |
6405 </body> | |
6406 </notes> | |
6407 <annotation> | |
6408 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
6409 <rdf:Description rdf:about="#_030d6c02-c016-4e4d-a3a0-100f8b573715"> | |
6410 <bqbiol:is> | |
6411 <rdf:Bag> | |
6412 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.1.1.4"/> | |
6413 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/ABTD1"/> | |
6414 </rdf:Bag> | |
6415 </bqbiol:is> | |
6416 <bqbiol:isDescribedBy> | |
6417 <rdf:Bag> | |
6418 <rdf:li rdf:resource="https://identifiers.org/pubmed/16435225"/> | |
6419 </rdf:Bag> | |
6420 </bqbiol:isDescribedBy> | |
6421 </rdf:Description> | |
6422 </rdf:RDF> | |
6423 </annotation> | |
6424 <listOfReactants> | |
6425 <speciesReference constant="true" species="M_m02552c" stoichiometry="1"/> | |
6426 <speciesReference constant="true" species="M_abt_D_c" stoichiometry="1"/> | |
6427 </listOfReactants> | |
6428 <listOfProducts> | |
6429 <speciesReference constant="true" species="M_m02553c" stoichiometry="1"/> | |
6430 <speciesReference constant="true" species="M_m02425c" stoichiometry="1"/> | |
6431 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
6432 </listOfProducts> | |
6433 </reaction> | |
6434 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4387" metaid="_642e9305-23e4-4e3a-b6ef-fe32f9051987" name="R_HMR_4387" reversible="false" sboTerm="SBO:0000176"> | |
6435 <notes> | |
6436 <body xmlns="http://www.w3.org/1999/xhtml"> | |
6437 <p>Confidence Level: 0</p> | |
6438 <p>AUTHORS: PMID:10025667;PMID:8549746;PMID:9451026</p> | |
6439 <p>ec-code: 2.7.7.13</p> | |
6440 <p>metanetx.reaction: MNXR101375</p> | |
6441 <p>kegg.reaction: R00885</p> | |
6442 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
6443 <p>EC_NUMBER: 2.7.7.13</p> | |
6444 <p>pmids: 8549746,9451026,10025667</p> | |
6445 <p>GENE_ASSOCIATION: ( ENSG00000144591 ) OR ( ENSG00000173540 ) OR ( ENSG00000176020 )</p> | |
6446 </body> | |
6447 </notes> | |
6448 <annotation> | |
6449 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
6450 <rdf:Description rdf:about="#_642e9305-23e4-4e3a-b6ef-fe32f9051987"> | |
6451 <bqbiol:is> | |
6452 <rdf:Bag> | |
6453 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.7.13"/> | |
6454 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR101375"/> | |
6455 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00885"/> | |
6456 </rdf:Bag> | |
6457 </bqbiol:is> | |
6458 <bqbiol:isDescribedBy> | |
6459 <rdf:Bag> | |
6460 <rdf:li rdf:resource="https://identifiers.org/pubmed/8549746"/> | |
6461 <rdf:li rdf:resource="https://identifiers.org/pubmed/9451026"/> | |
6462 <rdf:li rdf:resource="https://identifiers.org/pubmed/10025667"/> | |
6463 </rdf:Bag> | |
6464 </bqbiol:isDescribedBy> | |
6465 </rdf:Description> | |
6466 </rdf:RDF> | |
6467 </annotation> | |
6468 <fbc:geneProductAssociation> | |
6469 <fbc:or> | |
6470 <fbc:geneProductRef fbc:geneProduct="ENSG00000176020"/> | |
6471 <fbc:geneProductRef fbc:geneProduct="ENSG00000173540"/> | |
6472 <fbc:geneProductRef fbc:geneProduct="ENSG00000144591"/> | |
6473 </fbc:or> | |
6474 </fbc:geneProductAssociation> | |
6475 <listOfReactants> | |
6476 <speciesReference constant="true" species="M_m02454c" stoichiometry="1"/> | |
6477 <speciesReference constant="true" species="M_m02034c" stoichiometry="1"/> | |
6478 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
6479 </listOfReactants> | |
6480 <listOfProducts> | |
6481 <speciesReference constant="true" species="M_m01951c" stoichiometry="1"/> | |
6482 <speciesReference constant="true" species="M_m02759c" stoichiometry="1"/> | |
6483 </listOfProducts> | |
6484 </reaction> | |
6485 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_9799" metaid="_57352ce2-7ff7-4510-8c37-fe046275ab37" name="R_HMR_9799" reversible="true" sboTerm="SBO:0000176"> | |
6486 <notes> | |
6487 <body xmlns="http://www.w3.org/1999/xhtml"> | |
6488 <p>Confidence Level: 0</p> | |
6489 <p>ec-code: 2.7.1.14</p> | |
6490 <p>metanetx.reaction: MNXR107202</p> | |
6491 <p>kegg.reaction: R01844</p> | |
6492 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
6493 <p>EC_NUMBER: 2.7.1.14</p> | |
6494 <p>GENE_ASSOCIATION: ENSG00000197417</p> | |
6495 </body> | |
6496 </notes> | |
6497 <annotation> | |
6498 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
6499 <rdf:Description rdf:about="#_57352ce2-7ff7-4510-8c37-fe046275ab37"> | |
6500 <bqbiol:is> | |
6501 <rdf:Bag> | |
6502 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.14"/> | |
6503 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR107202"/> | |
6504 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01844"/> | |
6505 </rdf:Bag> | |
6506 </bqbiol:is> | |
6507 </rdf:Description> | |
6508 </rdf:RDF> | |
6509 </annotation> | |
6510 <fbc:geneProductAssociation> | |
6511 <fbc:geneProductRef fbc:geneProduct="ENSG00000197417"/> | |
6512 </fbc:geneProductAssociation> | |
6513 <listOfReactants> | |
6514 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
6515 <speciesReference constant="true" species="M_m03165c" stoichiometry="1"/> | |
6516 </listOfReactants> | |
6517 <listOfProducts> | |
6518 <speciesReference constant="true" species="M_m02884c" stoichiometry="1"/> | |
6519 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
6520 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
6521 </listOfProducts> | |
6522 </reaction> | |
6523 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4303" metaid="_073189d4-50c2-4cf1-b826-23bdb07507f8" name="R_HMR_4303" reversible="false" sboTerm="SBO:0000176"> | |
6524 <notes> | |
6525 <body xmlns="http://www.w3.org/1999/xhtml"> | |
6526 <p>Confidence Level: 0</p> | |
6527 <p>AUTHORS: PMID:12055199</p> | |
6528 <p>ec-code: 3.2.1.48 || 3.2.1.10 || 3.2.1.20</p> | |
6529 <p>metanetx.reaction: MNXR104638</p> | |
6530 <p>kegg.reaction: R00801</p> | |
6531 <p>bigg.reaction: SUCRe</p> | |
6532 <p>SUBSYSTEM: Galactose metabolism</p> | |
6533 <p>EC_NUMBER: 3.2.1.10;3.2.1.20;3.2.1.48</p> | |
6534 <p>pmids: 12055199</p> | |
6535 <p>GENE_ASSOCIATION: ( ENSG00000090402 ) OR ( ENSG00000171298 ) OR ( ENSG00000214013 ) OR ( ENSG00000257335 )</p> | |
6536 </body> | |
6537 </notes> | |
6538 <annotation> | |
6539 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
6540 <rdf:Description rdf:about="#_073189d4-50c2-4cf1-b826-23bdb07507f8"> | |
6541 <bqbiol:is> | |
6542 <rdf:Bag> | |
6543 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.2.1.48"/> | |
6544 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.2.1.10"/> | |
6545 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.2.1.20"/> | |
6546 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR104638"/> | |
6547 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00801"/> | |
6548 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/SUCRe"/> | |
6549 </rdf:Bag> | |
6550 </bqbiol:is> | |
6551 <bqbiol:isDescribedBy> | |
6552 <rdf:Bag> | |
6553 <rdf:li rdf:resource="https://identifiers.org/pubmed/12055199"/> | |
6554 </rdf:Bag> | |
6555 </bqbiol:isDescribedBy> | |
6556 </rdf:Description> | |
6557 </rdf:RDF> | |
6558 </annotation> | |
6559 <fbc:geneProductAssociation> | |
6560 <fbc:or> | |
6561 <fbc:geneProductRef fbc:geneProduct="ENSG00000171298"/> | |
6562 <fbc:geneProductRef fbc:geneProduct="ENSG00000257335"/> | |
6563 <fbc:geneProductRef fbc:geneProduct="ENSG00000090402"/> | |
6564 <fbc:geneProductRef fbc:geneProduct="ENSG00000214013"/> | |
6565 </fbc:or> | |
6566 </fbc:geneProductAssociation> | |
6567 <listOfReactants> | |
6568 <speciesReference constant="true" species="M_m02040s" stoichiometry="1"/> | |
6569 <speciesReference constant="true" species="M_m02945s" stoichiometry="1"/> | |
6570 </listOfReactants> | |
6571 <listOfProducts> | |
6572 <speciesReference constant="true" species="M_m01965s" stoichiometry="1"/> | |
6573 <speciesReference constant="true" species="M_m01840s" stoichiometry="1"/> | |
6574 </listOfProducts> | |
6575 </reaction> | |
6576 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4501" metaid="_94343e1c-c62d-4149-953b-237ef55a08ca" name="R_HMR_4501" reversible="true" sboTerm="SBO:0000176"> | |
6577 <notes> | |
6578 <body xmlns="http://www.w3.org/1999/xhtml"> | |
6579 <p>Confidence Level: 0</p> | |
6580 <p>AUTHORS: PMID:13385248;PMID:2495942;UNIPROT:P29401</p> | |
6581 <p>ec-code: 2.2.1.1</p> | |
6582 <p>metanetx.reaction: MNXR107105 || MNXR104868</p> | |
6583 <p>kegg.reaction: R01641</p> | |
6584 <p>bigg.reaction: TKT1</p> | |
6585 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
6586 <p>EC_NUMBER: 2.2.1.1</p> | |
6587 <p>pmids: 2495942,13385248</p> | |
6588 <p>GENE_ASSOCIATION: ( ENSG00000007350 ) OR ( ENSG00000151005 ) OR ( ENSG00000163931 )</p> | |
6589 </body> | |
6590 </notes> | |
6591 <annotation> | |
6592 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
6593 <rdf:Description rdf:about="#_94343e1c-c62d-4149-953b-237ef55a08ca"> | |
6594 <bqbiol:is> | |
6595 <rdf:Bag> | |
6596 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.2.1.1"/> | |
6597 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR107105"/> | |
6598 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR104868"/> | |
6599 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01641"/> | |
6600 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/TKT1"/> | |
6601 </rdf:Bag> | |
6602 </bqbiol:is> | |
6603 <bqbiol:isDescribedBy> | |
6604 <rdf:Bag> | |
6605 <rdf:li rdf:resource="https://identifiers.org/pubmed/2495942"/> | |
6606 <rdf:li rdf:resource="https://identifiers.org/pubmed/13385248"/> | |
6607 </rdf:Bag> | |
6608 </bqbiol:isDescribedBy> | |
6609 </rdf:Description> | |
6610 </rdf:RDF> | |
6611 </annotation> | |
6612 <fbc:geneProductAssociation> | |
6613 <fbc:or> | |
6614 <fbc:geneProductRef fbc:geneProduct="ENSG00000163931"/> | |
6615 <fbc:geneProductRef fbc:geneProduct="ENSG00000007350"/> | |
6616 <fbc:geneProductRef fbc:geneProduct="ENSG00000151005"/> | |
6617 </fbc:or> | |
6618 </fbc:geneProductAssociation> | |
6619 <listOfReactants> | |
6620 <speciesReference constant="true" species="M_m02845c" stoichiometry="1"/> | |
6621 <speciesReference constant="true" species="M_m01761c" stoichiometry="1"/> | |
6622 </listOfReactants> | |
6623 <listOfProducts> | |
6624 <speciesReference constant="true" species="M_m01939c" stoichiometry="1"/> | |
6625 <speciesReference constant="true" species="M_m02884c" stoichiometry="1"/> | |
6626 </listOfProducts> | |
6627 </reaction> | |
6628 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4304" metaid="_4a19056f-9291-4536-aee2-1f674e94327c" name="R_HMR_4304" reversible="false" sboTerm="SBO:0000176"> | |
6629 <notes> | |
6630 <body xmlns="http://www.w3.org/1999/xhtml"> | |
6631 <p>Confidence Level: 0</p> | |
6632 <p>AUTHORS: PMID:15774558;PMID:16756494;PMID:2753047;PMID:4169027</p> | |
6633 <p>ec-code: 1.1.1.49</p> | |
6634 <p>metanetx.reaction: MNXR99907</p> | |
6635 <p>kegg.reaction: R00835</p> | |
6636 <p>bigg.reaction: G6PDH2er</p> | |
6637 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
6638 <p>EC_NUMBER: 1.1.1.49</p> | |
6639 <p>pmids: 2753047,4169027,15774558,16756494</p> | |
6640 <p>GENE_ASSOCIATION: ENSG00000160211</p> | |
6641 </body> | |
6642 </notes> | |
6643 <annotation> | |
6644 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
6645 <rdf:Description rdf:about="#_4a19056f-9291-4536-aee2-1f674e94327c"> | |
6646 <bqbiol:is> | |
6647 <rdf:Bag> | |
6648 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.49"/> | |
6649 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR99907"/> | |
6650 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00835"/> | |
6651 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/G6PDH2er"/> | |
6652 </rdf:Bag> | |
6653 </bqbiol:is> | |
6654 <bqbiol:isDescribedBy> | |
6655 <rdf:Bag> | |
6656 <rdf:li rdf:resource="https://identifiers.org/pubmed/16756494"/> | |
6657 <rdf:li rdf:resource="https://identifiers.org/pubmed/4169027"/> | |
6658 <rdf:li rdf:resource="https://identifiers.org/pubmed/2753047"/> | |
6659 <rdf:li rdf:resource="https://identifiers.org/pubmed/15774558"/> | |
6660 </rdf:Bag> | |
6661 </bqbiol:isDescribedBy> | |
6662 </rdf:Description> | |
6663 </rdf:RDF> | |
6664 </annotation> | |
6665 <fbc:geneProductAssociation> | |
6666 <fbc:geneProductRef fbc:geneProduct="ENSG00000160211"/> | |
6667 </fbc:geneProductAssociation> | |
6668 <listOfReactants> | |
6669 <speciesReference constant="true" species="M_m01968r" stoichiometry="1"/> | |
6670 <speciesReference constant="true" species="M_m02554r" stoichiometry="1"/> | |
6671 </listOfReactants> | |
6672 <listOfProducts> | |
6673 <speciesReference constant="true" species="M_m01961r" stoichiometry="1"/> | |
6674 <speciesReference constant="true" species="M_m02555r" stoichiometry="1"/> | |
6675 <speciesReference constant="true" species="M_m02039r" stoichiometry="1"/> | |
6676 </listOfProducts> | |
6677 </reaction> | |
6678 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4623" metaid="_977981ea-549f-4af8-8bc9-8f06a599033d" name="R_HMR_4623" reversible="false" sboTerm="SBO:0000176"> | |
6679 <notes> | |
6680 <body xmlns="http://www.w3.org/1999/xhtml"> | |
6681 <p>Confidence Level: 0</p> | |
6682 <p>AUTHORS: PMID:3858849;PMID:3932573;PMID:6852020;PMID:971315</p> | |
6683 <p>ec-code: 3.1.1.31</p> | |
6684 <p>metanetx.reaction: MNXR102539</p> | |
6685 <p>kegg.reaction: R02035</p> | |
6686 <p>bigg.reaction: PGLer</p> | |
6687 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
6688 <p>EC_NUMBER: 3.1.1.31</p> | |
6689 <p>pmids: 971315,3858849,3932573,6852020</p> | |
6690 <p>GENE_ASSOCIATION: ( ENSG00000049239 ) OR ( ENSG00000130313 )</p> | |
6691 </body> | |
6692 </notes> | |
6693 <annotation> | |
6694 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
6695 <rdf:Description rdf:about="#_977981ea-549f-4af8-8bc9-8f06a599033d"> | |
6696 <bqbiol:is> | |
6697 <rdf:Bag> | |
6698 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.1.1.31"/> | |
6699 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR102539"/> | |
6700 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R02035"/> | |
6701 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/PGLer"/> | |
6702 </rdf:Bag> | |
6703 </bqbiol:is> | |
6704 <bqbiol:isDescribedBy> | |
6705 <rdf:Bag> | |
6706 <rdf:li rdf:resource="https://identifiers.org/pubmed/3932573"/> | |
6707 <rdf:li rdf:resource="https://identifiers.org/pubmed/3858849"/> | |
6708 <rdf:li rdf:resource="https://identifiers.org/pubmed/6852020"/> | |
6709 <rdf:li rdf:resource="https://identifiers.org/pubmed/971315"/> | |
6710 </rdf:Bag> | |
6711 </bqbiol:isDescribedBy> | |
6712 </rdf:Description> | |
6713 </rdf:RDF> | |
6714 </annotation> | |
6715 <fbc:geneProductAssociation> | |
6716 <fbc:or> | |
6717 <fbc:geneProductRef fbc:geneProduct="ENSG00000049239"/> | |
6718 <fbc:geneProductRef fbc:geneProduct="ENSG00000130313"/> | |
6719 </fbc:or> | |
6720 </fbc:geneProductAssociation> | |
6721 <listOfReactants> | |
6722 <speciesReference constant="true" species="M_m01961r" stoichiometry="1"/> | |
6723 <speciesReference constant="true" species="M_m02040r" stoichiometry="1"/> | |
6724 </listOfReactants> | |
6725 <listOfProducts> | |
6726 <speciesReference constant="true" species="M_m01169r" stoichiometry="1"/> | |
6727 <speciesReference constant="true" species="M_m02039r" stoichiometry="1"/> | |
6728 </listOfProducts> | |
6729 </reaction> | |
6730 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4306" metaid="c51de190-dee0-491f-93ed-9eebe9f571ff" name="R_HMR_4306" reversible="true" sboTerm="SBO:0000176"> | |
6731 <notes> | |
6732 <body xmlns="http://www.w3.org/1999/xhtml"> | |
6733 <p>Confidence Level: 0</p> | |
6734 <p>AUTHORS: PMID:15774558;PMID:16756494;PMID:2753047;PMID:4169027</p> | |
6735 <p>ec-code: 1.1.1.49</p> | |
6736 <p>metanetx.reaction: MNXR99907</p> | |
6737 <p>kegg.reaction: R00835</p> | |
6738 <p>bigg.reaction: G6PDH2r</p> | |
6739 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
6740 <p>EC_NUMBER: 1.1.1.49</p> | |
6741 <p>pmids: 2753047,4169027,15774558,16756494</p> | |
6742 <p>GENE_ASSOCIATION: ENSG00000160211</p> | |
6743 </body> | |
6744 </notes> | |
6745 <annotation> | |
6746 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
6747 <rdf:Description rdf:about="#c51de190-dee0-491f-93ed-9eebe9f571ff"> | |
6748 <bqbiol:is> | |
6749 <rdf:Bag> | |
6750 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.49"/> | |
6751 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR99907"/> | |
6752 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00835"/> | |
6753 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/G6PDH2r"/> | |
6754 </rdf:Bag> | |
6755 </bqbiol:is> | |
6756 <bqbiol:isDescribedBy> | |
6757 <rdf:Bag> | |
6758 <rdf:li rdf:resource="https://identifiers.org/pubmed/16756494"/> | |
6759 <rdf:li rdf:resource="https://identifiers.org/pubmed/4169027"/> | |
6760 <rdf:li rdf:resource="https://identifiers.org/pubmed/2753047"/> | |
6761 <rdf:li rdf:resource="https://identifiers.org/pubmed/15774558"/> | |
6762 </rdf:Bag> | |
6763 </bqbiol:isDescribedBy> | |
6764 </rdf:Description> | |
6765 </rdf:RDF> | |
6766 </annotation> | |
6767 <fbc:geneProductAssociation> | |
6768 <fbc:geneProductRef fbc:geneProduct="ENSG00000160211"/> | |
6769 </fbc:geneProductAssociation> | |
6770 <listOfReactants> | |
6771 <speciesReference constant="true" species="M_m01961c" stoichiometry="1"/> | |
6772 <speciesReference constant="true" species="M_m02555c" stoichiometry="1"/> | |
6773 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
6774 </listOfReactants> | |
6775 <listOfProducts> | |
6776 <speciesReference constant="true" species="M_m02554c" stoichiometry="1"/> | |
6777 <speciesReference constant="true" species="M_m01968c" stoichiometry="1"/> | |
6778 </listOfProducts> | |
6779 </reaction> | |
6780 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4625" metaid="ce25ac8c-d5cd-45bf-aa0f-b5091cc8f920" name="R_HMR_4625" reversible="false" sboTerm="SBO:0000176"> | |
6781 <notes> | |
6782 <body xmlns="http://www.w3.org/1999/xhtml"> | |
6783 <p>Confidence Level: 0</p> | |
6784 <p>AUTHORS: PMID:3858849;PMID:3932573;PMID:6852020;PMID:971315</p> | |
6785 <p>ec-code: 3.1.1.31</p> | |
6786 <p>metanetx.reaction: MNXR102539</p> | |
6787 <p>kegg.reaction: R02035</p> | |
6788 <p>bigg.reaction: PGL</p> | |
6789 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
6790 <p>EC_NUMBER: 3.1.1.31</p> | |
6791 <p>pmids: 971315,3858849,3932573,6852020</p> | |
6792 <p>GENE_ASSOCIATION: ( ENSG00000049239 ) OR ( ENSG00000130313 )</p> | |
6793 </body> | |
6794 </notes> | |
6795 <annotation> | |
6796 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
6797 <rdf:Description rdf:about="#ce25ac8c-d5cd-45bf-aa0f-b5091cc8f920"> | |
6798 <bqbiol:is> | |
6799 <rdf:Bag> | |
6800 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.1.1.31"/> | |
6801 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR102539"/> | |
6802 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R02035"/> | |
6803 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/PGL"/> | |
6804 </rdf:Bag> | |
6805 </bqbiol:is> | |
6806 <bqbiol:isDescribedBy> | |
6807 <rdf:Bag> | |
6808 <rdf:li rdf:resource="https://identifiers.org/pubmed/3932573"/> | |
6809 <rdf:li rdf:resource="https://identifiers.org/pubmed/3858849"/> | |
6810 <rdf:li rdf:resource="https://identifiers.org/pubmed/6852020"/> | |
6811 <rdf:li rdf:resource="https://identifiers.org/pubmed/971315"/> | |
6812 </rdf:Bag> | |
6813 </bqbiol:isDescribedBy> | |
6814 </rdf:Description> | |
6815 </rdf:RDF> | |
6816 </annotation> | |
6817 <fbc:geneProductAssociation> | |
6818 <fbc:or> | |
6819 <fbc:geneProductRef fbc:geneProduct="ENSG00000049239"/> | |
6820 <fbc:geneProductRef fbc:geneProduct="ENSG00000130313"/> | |
6821 </fbc:or> | |
6822 </fbc:geneProductAssociation> | |
6823 <listOfReactants> | |
6824 <speciesReference constant="true" species="M_m02040c" stoichiometry="1"/> | |
6825 <speciesReference constant="true" species="M_m01961c" stoichiometry="1"/> | |
6826 </listOfReactants> | |
6827 <listOfProducts> | |
6828 <speciesReference constant="true" species="M_m01169c" stoichiometry="1"/> | |
6829 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
6830 </listOfProducts> | |
6831 </reaction> | |
6832 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4706" metaid="_76f44f32-e827-409c-9f89-d39564cf363b" name="R_HMR_4706" reversible="false" sboTerm="SBO:0000176"> | |
6833 <notes> | |
6834 <body xmlns="http://www.w3.org/1999/xhtml"> | |
6835 <p>Confidence Level: 0</p> | |
6836 <p>AUTHORS: PMID:11245921;PMID:12379646;PMID:15170386;PMID:15581487;PMID:16316985;PMID:2837207</p> | |
6837 <p>ec-code: 3.1.3.46 || 3.1.3.11</p> | |
6838 <p>metanetx.reaction: MNXR106671 || MNXR99466</p> | |
6839 <p>kegg.reaction: R00763</p> | |
6840 <p>bigg.reaction: FBP26</p> | |
6841 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
6842 <p>EC_NUMBER: 3.1.3.46;3.1.3.11</p> | |
6843 <p>pmids: 2837207,11245921,12379646,15170386,15581487,16316985</p> | |
6844 <p>GENE_ASSOCIATION: ( ENSG00000078237 ) OR ( ENSG00000108813 ) OR ( ENSG00000114268 ) OR ( ENSG00000123836 ) OR ( ENSG00000158571 ) OR ( ENSG00000170525 )</p> | |
6845 </body> | |
6846 </notes> | |
6847 <annotation> | |
6848 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
6849 <rdf:Description rdf:about="#_76f44f32-e827-409c-9f89-d39564cf363b"> | |
6850 <bqbiol:is> | |
6851 <rdf:Bag> | |
6852 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.1.3.46"/> | |
6853 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.1.3.11"/> | |
6854 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR106671"/> | |
6855 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR99466"/> | |
6856 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00763"/> | |
6857 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/FBP26"/> | |
6858 </rdf:Bag> | |
6859 </bqbiol:is> | |
6860 <bqbiol:isDescribedBy> | |
6861 <rdf:Bag> | |
6862 <rdf:li rdf:resource="https://identifiers.org/pubmed/16316985"/> | |
6863 <rdf:li rdf:resource="https://identifiers.org/pubmed/12379646"/> | |
6864 <rdf:li rdf:resource="https://identifiers.org/pubmed/15581487"/> | |
6865 <rdf:li rdf:resource="https://identifiers.org/pubmed/15170386"/> | |
6866 <rdf:li rdf:resource="https://identifiers.org/pubmed/11245921"/> | |
6867 <rdf:li rdf:resource="https://identifiers.org/pubmed/2837207"/> | |
6868 </rdf:Bag> | |
6869 </bqbiol:isDescribedBy> | |
6870 </rdf:Description> | |
6871 </rdf:RDF> | |
6872 </annotation> | |
6873 <fbc:geneProductAssociation> | |
6874 <fbc:or> | |
6875 <fbc:geneProductRef fbc:geneProduct="ENSG00000123836"/> | |
6876 <fbc:geneProductRef fbc:geneProduct="ENSG00000170525"/> | |
6877 <fbc:geneProductRef fbc:geneProduct="ENSG00000108813"/> | |
6878 <fbc:geneProductRef fbc:geneProduct="ENSG00000158571"/> | |
6879 <fbc:geneProductRef fbc:geneProduct="ENSG00000078237"/> | |
6880 <fbc:geneProductRef fbc:geneProduct="ENSG00000114268"/> | |
6881 </fbc:or> | |
6882 </fbc:geneProductAssociation> | |
6883 <listOfReactants> | |
6884 <speciesReference constant="true" species="M_m02040c" stoichiometry="1"/> | |
6885 <speciesReference constant="true" species="M_m01843c" stoichiometry="1"/> | |
6886 </listOfReactants> | |
6887 <listOfProducts> | |
6888 <speciesReference constant="true" species="M_m02751c" stoichiometry="1"/> | |
6889 <speciesReference constant="true" species="M_m01845c" stoichiometry="1"/> | |
6890 </listOfProducts> | |
6891 </reaction> | |
6892 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_G6PDH2c" metaid="_65f65765-bf14-48a2-8308-72aa949d0dd7" name="Glucose 6-Phosphate Dehydrogenase" reversible="false" sboTerm="SBO:0000176"> | |
6893 <notes> | |
6894 <body xmlns="http://www.w3.org/1999/xhtml"> | |
6895 <p>Confidence Level: 0</p> | |
6896 <p>AUTHORS: PMID: 4382012, PMID: 13575411, Harpers illustrated Biochemistry (2009) 28th edition pages 174-183</p> | |
6897 <p>bigg.reaction: G6PDH2c</p> | |
6898 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
6899 <p>pmids: 4382012,13575411</p> | |
6900 <p>GENE_ASSOCIATION: ENSG00000160211</p> | |
6901 </body> | |
6902 </notes> | |
6903 <annotation> | |
6904 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
6905 <rdf:Description rdf:about="#_65f65765-bf14-48a2-8308-72aa949d0dd7"> | |
6906 <bqbiol:is> | |
6907 <rdf:Bag> | |
6908 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/G6PDH2c"/> | |
6909 </rdf:Bag> | |
6910 </bqbiol:is> | |
6911 <bqbiol:isDescribedBy> | |
6912 <rdf:Bag> | |
6913 <rdf:li rdf:resource="https://identifiers.org/pubmed/13575411"/> | |
6914 <rdf:li rdf:resource="https://identifiers.org/pubmed/4382012"/> | |
6915 </rdf:Bag> | |
6916 </bqbiol:isDescribedBy> | |
6917 </rdf:Description> | |
6918 </rdf:RDF> | |
6919 </annotation> | |
6920 <fbc:geneProductAssociation> | |
6921 <fbc:geneProductRef fbc:geneProduct="ENSG00000160211"/> | |
6922 </fbc:geneProductAssociation> | |
6923 <listOfReactants> | |
6924 <speciesReference constant="true" species="M_m02554c" stoichiometry="3"/> | |
6925 <speciesReference constant="true" species="M_m01968c" stoichiometry="3"/> | |
6926 </listOfReactants> | |
6927 <listOfProducts> | |
6928 <speciesReference constant="true" species="M_m01961c" stoichiometry="3"/> | |
6929 <speciesReference constant="true" species="M_m02555c" stoichiometry="3"/> | |
6930 <speciesReference constant="true" species="M_m02039c" stoichiometry="3"/> | |
6931 </listOfProducts> | |
6932 </reaction> | |
6933 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_8074" metaid="c6249ea1-2eba-44b9-b389-c3bb870070af" name="R_HMR_8074" reversible="false" sboTerm="SBO:0000176"> | |
6934 <notes> | |
6935 <body xmlns="http://www.w3.org/1999/xhtml"> | |
6936 <p>Confidence Level: 0</p> | |
6937 <p>ec-code: 2.7.1.15</p> | |
6938 <p>metanetx.reaction: MNXR97787</p> | |
6939 <p>kegg.reaction: R02750</p> | |
6940 <p>bigg.reaction: DRPA</p> | |
6941 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
6942 <p>EC_NUMBER: 2.7.1.15</p> | |
6943 <p>GENE_ASSOCIATION: ( ENSG00000158019 ) OR ( ENSG00000171174 )</p> | |
6944 </body> | |
6945 </notes> | |
6946 <annotation> | |
6947 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
6948 <rdf:Description rdf:about="#c6249ea1-2eba-44b9-b389-c3bb870070af"> | |
6949 <bqbiol:is> | |
6950 <rdf:Bag> | |
6951 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.15"/> | |
6952 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR97787"/> | |
6953 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R02750"/> | |
6954 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/DRPA"/> | |
6955 </rdf:Bag> | |
6956 </bqbiol:is> | |
6957 </rdf:Description> | |
6958 </rdf:RDF> | |
6959 </annotation> | |
6960 <fbc:geneProductAssociation> | |
6961 <fbc:or> | |
6962 <fbc:geneProductRef fbc:geneProduct="ENSG00000171174"/> | |
6963 <fbc:geneProductRef fbc:geneProduct="ENSG00000158019"/> | |
6964 </fbc:or> | |
6965 </fbc:geneProductAssociation> | |
6966 <listOfReactants> | |
6967 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
6968 <speciesReference constant="true" species="M_m01672c" stoichiometry="1"/> | |
6969 </listOfReactants> | |
6970 <listOfProducts> | |
6971 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
6972 <speciesReference constant="true" species="M_m00640c" stoichiometry="1"/> | |
6973 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
6974 </listOfProducts> | |
6975 </reaction> | |
6976 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4350" metaid="cd869f58-5452-4226-8cfe-b859d4054a8f" name="R_HMR_4350" reversible="true" sboTerm="SBO:0000176"> | |
6977 <notes> | |
6978 <body xmlns="http://www.w3.org/1999/xhtml"> | |
6979 <p>Confidence Level: 0</p> | |
6980 <p>AUTHORS: PMID:13295274;PMID:17618002</p> | |
6981 <p>ec-code: 2.7.1.15</p> | |
6982 <p>metanetx.reaction: MNXR106804 || MNXR103431</p> | |
6983 <p>kegg.reaction: R01051</p> | |
6984 <p>bigg.reaction: RBK</p> | |
6985 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
6986 <p>EC_NUMBER: 2.7.1.15</p> | |
6987 <p>pmids: 13295274,17618002</p> | |
6988 <p>GENE_ASSOCIATION: ( ENSG00000158019 ) OR ( ENSG00000171174 )</p> | |
6989 </body> | |
6990 </notes> | |
6991 <annotation> | |
6992 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
6993 <rdf:Description rdf:about="#cd869f58-5452-4226-8cfe-b859d4054a8f"> | |
6994 <bqbiol:is> | |
6995 <rdf:Bag> | |
6996 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.15"/> | |
6997 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR106804"/> | |
6998 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR103431"/> | |
6999 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01051"/> | |
7000 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/RBK"/> | |
7001 </rdf:Bag> | |
7002 </bqbiol:is> | |
7003 <bqbiol:isDescribedBy> | |
7004 <rdf:Bag> | |
7005 <rdf:li rdf:resource="https://identifiers.org/pubmed/13295274"/> | |
7006 <rdf:li rdf:resource="https://identifiers.org/pubmed/17618002"/> | |
7007 </rdf:Bag> | |
7008 </bqbiol:isDescribedBy> | |
7009 </rdf:Description> | |
7010 </rdf:RDF> | |
7011 </annotation> | |
7012 <fbc:geneProductAssociation> | |
7013 <fbc:or> | |
7014 <fbc:geneProductRef fbc:geneProduct="ENSG00000171174"/> | |
7015 <fbc:geneProductRef fbc:geneProduct="ENSG00000158019"/> | |
7016 </fbc:or> | |
7017 </fbc:geneProductAssociation> | |
7018 <listOfReactants> | |
7019 <speciesReference constant="true" species="M_m02845c" stoichiometry="1"/> | |
7020 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
7021 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
7022 </listOfReactants> | |
7023 <listOfProducts> | |
7024 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
7025 <speciesReference constant="true" species="M_m02843c" stoichiometry="1"/> | |
7026 </listOfProducts> | |
7027 </reaction> | |
7028 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_KHK3" metaid="_2f83a279-1e91-4c20-ab35-0fbd94c31885" name="Ketohexokinase (D-Tagatose)" reversible="false" sboTerm="SBO:0000176"> | |
7029 <notes> | |
7030 <body xmlns="http://www.w3.org/1999/xhtml"> | |
7031 <p>Confidence Level: 0</p> | |
7032 <p>AUTHORS: PMID:2996495,PMID:6284103,PMID:6298387</p> | |
7033 <p>ec-code: 2.7.1.3</p> | |
7034 <p>metanetx.reaction: MNXR100938</p> | |
7035 <p>bigg.reaction: KHK3</p> | |
7036 <p>SUBSYSTEM: Galactose metabolism</p> | |
7037 <p>EC_NUMBER: 2.7.1.3</p> | |
7038 <p>pmids: 2996495,6284103,6298387</p> | |
7039 <p>GENE_ASSOCIATION: ENSG00000138030</p> | |
7040 </body> | |
7041 </notes> | |
7042 <annotation> | |
7043 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
7044 <rdf:Description rdf:about="#_2f83a279-1e91-4c20-ab35-0fbd94c31885"> | |
7045 <bqbiol:is> | |
7046 <rdf:Bag> | |
7047 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.3"/> | |
7048 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100938"/> | |
7049 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/KHK3"/> | |
7050 </rdf:Bag> | |
7051 </bqbiol:is> | |
7052 <bqbiol:isDescribedBy> | |
7053 <rdf:Bag> | |
7054 <rdf:li rdf:resource="https://identifiers.org/pubmed/2996495"/> | |
7055 <rdf:li rdf:resource="https://identifiers.org/pubmed/6298387"/> | |
7056 <rdf:li rdf:resource="https://identifiers.org/pubmed/6284103"/> | |
7057 </rdf:Bag> | |
7058 </bqbiol:isDescribedBy> | |
7059 </rdf:Description> | |
7060 </rdf:RDF> | |
7061 </annotation> | |
7062 <fbc:geneProductAssociation> | |
7063 <fbc:geneProductRef fbc:geneProduct="ENSG00000138030"/> | |
7064 </fbc:geneProductAssociation> | |
7065 <listOfReactants> | |
7066 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
7067 <speciesReference constant="true" species="M_m01745c" stoichiometry="1"/> | |
7068 </listOfReactants> | |
7069 <listOfProducts> | |
7070 <speciesReference constant="true" species="M_tag1p_D_c" stoichiometry="1"/> | |
7071 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
7072 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
7073 </listOfProducts> | |
7074 </reaction> | |
7075 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4351" metaid="_6bfc4346-8d59-4fd8-af6b-41405b4de8a1" name="R_HMR_4351" reversible="true" sboTerm="SBO:0000176"> | |
7076 <notes> | |
7077 <body xmlns="http://www.w3.org/1999/xhtml"> | |
7078 <p>Confidence Level: 0</p> | |
7079 <p>AUTHORS: PMID:14690456;PMID:14988808;PMID:15234337;PMID:2843500</p> | |
7080 <p>ec-code: 5.3.1.6</p> | |
7081 <p>metanetx.reaction: MNXR104084 || MNXR106809</p> | |
7082 <p>kegg.reaction: R01056</p> | |
7083 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
7084 <p>EC_NUMBER: 5.3.1.6</p> | |
7085 <p>pmids: 2843500,14690456,14988808,15234337</p> | |
7086 <p>GENE_ASSOCIATION: ENSG00000153574</p> | |
7087 </body> | |
7088 </notes> | |
7089 <annotation> | |
7090 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
7091 <rdf:Description rdf:about="#_6bfc4346-8d59-4fd8-af6b-41405b4de8a1"> | |
7092 <bqbiol:is> | |
7093 <rdf:Bag> | |
7094 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.3.1.6"/> | |
7095 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR104084"/> | |
7096 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR106809"/> | |
7097 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01056"/> | |
7098 </rdf:Bag> | |
7099 </bqbiol:is> | |
7100 <bqbiol:isDescribedBy> | |
7101 <rdf:Bag> | |
7102 <rdf:li rdf:resource="https://identifiers.org/pubmed/2843500"/> | |
7103 <rdf:li rdf:resource="https://identifiers.org/pubmed/14690456"/> | |
7104 <rdf:li rdf:resource="https://identifiers.org/pubmed/15234337"/> | |
7105 <rdf:li rdf:resource="https://identifiers.org/pubmed/14988808"/> | |
7106 </rdf:Bag> | |
7107 </bqbiol:isDescribedBy> | |
7108 </rdf:Description> | |
7109 </rdf:RDF> | |
7110 </annotation> | |
7111 <fbc:geneProductAssociation> | |
7112 <fbc:geneProductRef fbc:geneProduct="ENSG00000153574"/> | |
7113 </fbc:geneProductAssociation> | |
7114 <listOfReactants> | |
7115 <speciesReference constant="true" species="M_m02845r" stoichiometry="1"/> | |
7116 </listOfReactants> | |
7117 <listOfProducts> | |
7118 <speciesReference constant="true" species="M_m02846r" stoichiometry="1"/> | |
7119 </listOfProducts> | |
7120 </reaction> | |
7121 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4473" metaid="c7c1f092-4aea-48a2-8d25-feb3f47ea431" name="R_HMR_4473" reversible="false" sboTerm="SBO:0000176"> | |
7122 <notes> | |
7123 <body xmlns="http://www.w3.org/1999/xhtml"> | |
7124 <p>Confidence Level: 0</p> | |
7125 <p>AUTHORS: PMID:12398160;PMID:1504088;PMID:15558954;PMID:16756494;PMID:2753047;PMID:3943305;PMID:6212636;PMID:7194116;PMID:7225115;PMID:7623792</p> | |
7126 <p>ec-code: 1.1.1.44</p> | |
7127 <p>metanetx.reaction: MNXR100389</p> | |
7128 <p>kegg.reaction: R01528</p> | |
7129 <p>bigg.reaction: GNDer</p> | |
7130 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
7131 <p>EC_NUMBER: 1.1.1.44</p> | |
7132 <p>pmids: 1504088,2753047,3943305,6212636,7194116,7225115,7623792,12398160,15558954,16756494</p> | |
7133 <p>GENE_ASSOCIATION: ENSG00000142657</p> | |
7134 </body> | |
7135 </notes> | |
7136 <annotation> | |
7137 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
7138 <rdf:Description rdf:about="#c7c1f092-4aea-48a2-8d25-feb3f47ea431"> | |
7139 <bqbiol:is> | |
7140 <rdf:Bag> | |
7141 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.44"/> | |
7142 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100389"/> | |
7143 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01528"/> | |
7144 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/GNDer"/> | |
7145 </rdf:Bag> | |
7146 </bqbiol:is> | |
7147 <bqbiol:isDescribedBy> | |
7148 <rdf:Bag> | |
7149 <rdf:li rdf:resource="https://identifiers.org/pubmed/16756494"/> | |
7150 <rdf:li rdf:resource="https://identifiers.org/pubmed/6212636"/> | |
7151 <rdf:li rdf:resource="https://identifiers.org/pubmed/7623792"/> | |
7152 <rdf:li rdf:resource="https://identifiers.org/pubmed/3943305"/> | |
7153 <rdf:li rdf:resource="https://identifiers.org/pubmed/7225115"/> | |
7154 <rdf:li rdf:resource="https://identifiers.org/pubmed/15558954"/> | |
7155 <rdf:li rdf:resource="https://identifiers.org/pubmed/7194116"/> | |
7156 <rdf:li rdf:resource="https://identifiers.org/pubmed/12398160"/> | |
7157 <rdf:li rdf:resource="https://identifiers.org/pubmed/2753047"/> | |
7158 <rdf:li rdf:resource="https://identifiers.org/pubmed/1504088"/> | |
7159 </rdf:Bag> | |
7160 </bqbiol:isDescribedBy> | |
7161 </rdf:Description> | |
7162 </rdf:RDF> | |
7163 </annotation> | |
7164 <fbc:geneProductAssociation> | |
7165 <fbc:geneProductRef fbc:geneProduct="ENSG00000142657"/> | |
7166 </fbc:geneProductAssociation> | |
7167 <listOfReactants> | |
7168 <speciesReference constant="true" species="M_m01169r" stoichiometry="1"/> | |
7169 <speciesReference constant="true" species="M_m02554r" stoichiometry="1"/> | |
7170 </listOfReactants> | |
7171 <listOfProducts> | |
7172 <speciesReference constant="true" species="M_m02846r" stoichiometry="1"/> | |
7173 <speciesReference constant="true" species="M_m02555r" stoichiometry="1"/> | |
7174 <speciesReference constant="true" species="M_m01596r" stoichiometry="1"/> | |
7175 </listOfProducts> | |
7176 </reaction> | |
7177 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4352" metaid="be77e7e9-9978-4d8f-9533-2dd900d0bde5" name="R_HMR_4352" reversible="true" sboTerm="SBO:0000176"> | |
7178 <notes> | |
7179 <body xmlns="http://www.w3.org/1999/xhtml"> | |
7180 <p>Confidence Level: 0</p> | |
7181 <p>AUTHORS: PMID:14690456;PMID:14988808;PMID:15234337;PMID:2843500</p> | |
7182 <p>ec-code: 5.3.1.6</p> | |
7183 <p>metanetx.reaction: MNXR104084 || MNXR106809</p> | |
7184 <p>kegg.reaction: R01056</p> | |
7185 <p>bigg.reaction: RPI</p> | |
7186 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
7187 <p>EC_NUMBER: 5.3.1.6</p> | |
7188 <p>pmids: 2843500,14690456,14988808,15234337</p> | |
7189 <p>GENE_ASSOCIATION: ENSG00000153574</p> | |
7190 </body> | |
7191 </notes> | |
7192 <annotation> | |
7193 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
7194 <rdf:Description rdf:about="#be77e7e9-9978-4d8f-9533-2dd900d0bde5"> | |
7195 <bqbiol:is> | |
7196 <rdf:Bag> | |
7197 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.3.1.6"/> | |
7198 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR104084"/> | |
7199 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR106809"/> | |
7200 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01056"/> | |
7201 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/RPI"/> | |
7202 </rdf:Bag> | |
7203 </bqbiol:is> | |
7204 <bqbiol:isDescribedBy> | |
7205 <rdf:Bag> | |
7206 <rdf:li rdf:resource="https://identifiers.org/pubmed/2843500"/> | |
7207 <rdf:li rdf:resource="https://identifiers.org/pubmed/14690456"/> | |
7208 <rdf:li rdf:resource="https://identifiers.org/pubmed/15234337"/> | |
7209 <rdf:li rdf:resource="https://identifiers.org/pubmed/14988808"/> | |
7210 </rdf:Bag> | |
7211 </bqbiol:isDescribedBy> | |
7212 </rdf:Description> | |
7213 </rdf:RDF> | |
7214 </annotation> | |
7215 <fbc:geneProductAssociation> | |
7216 <fbc:geneProductRef fbc:geneProduct="ENSG00000153574"/> | |
7217 </fbc:geneProductAssociation> | |
7218 <listOfReactants> | |
7219 <speciesReference constant="true" species="M_m02845c" stoichiometry="1"/> | |
7220 </listOfReactants> | |
7221 <listOfProducts> | |
7222 <speciesReference constant="true" species="M_m02846c" stoichiometry="1"/> | |
7223 </listOfProducts> | |
7224 </reaction> | |
7225 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4474" metaid="_83d5dfd1-ca06-416b-8f50-068a6b157458" name="R_HMR_4474" reversible="false" sboTerm="SBO:0000176"> | |
7226 <notes> | |
7227 <body xmlns="http://www.w3.org/1999/xhtml"> | |
7228 <p>Confidence Level: 0</p> | |
7229 <p>AUTHORS: PMID:12398160;PMID:1504088;PMID:15558954;PMID:16756494;PMID:2753047;PMID:3943305;PMID:6212636;PMID:7194116;PMID:7225115;PMID:7623792</p> | |
7230 <p>ec-code: 1.1.1.44</p> | |
7231 <p>metanetx.reaction: MNXR100389</p> | |
7232 <p>kegg.reaction: R01528</p> | |
7233 <p>bigg.reaction: GND</p> | |
7234 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
7235 <p>EC_NUMBER: 1.1.1.44</p> | |
7236 <p>pmids: 1504088,2753047,3943305,6212636,7194116,7225115,7623792,12398160,15558954,16756494</p> | |
7237 <p>GENE_ASSOCIATION: ENSG00000142657</p> | |
7238 </body> | |
7239 </notes> | |
7240 <annotation> | |
7241 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
7242 <rdf:Description rdf:about="#_83d5dfd1-ca06-416b-8f50-068a6b157458"> | |
7243 <bqbiol:is> | |
7244 <rdf:Bag> | |
7245 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.44"/> | |
7246 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100389"/> | |
7247 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01528"/> | |
7248 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/GND"/> | |
7249 </rdf:Bag> | |
7250 </bqbiol:is> | |
7251 <bqbiol:isDescribedBy> | |
7252 <rdf:Bag> | |
7253 <rdf:li rdf:resource="https://identifiers.org/pubmed/16756494"/> | |
7254 <rdf:li rdf:resource="https://identifiers.org/pubmed/6212636"/> | |
7255 <rdf:li rdf:resource="https://identifiers.org/pubmed/7623792"/> | |
7256 <rdf:li rdf:resource="https://identifiers.org/pubmed/3943305"/> | |
7257 <rdf:li rdf:resource="https://identifiers.org/pubmed/7225115"/> | |
7258 <rdf:li rdf:resource="https://identifiers.org/pubmed/15558954"/> | |
7259 <rdf:li rdf:resource="https://identifiers.org/pubmed/7194116"/> | |
7260 <rdf:li rdf:resource="https://identifiers.org/pubmed/12398160"/> | |
7261 <rdf:li rdf:resource="https://identifiers.org/pubmed/2753047"/> | |
7262 <rdf:li rdf:resource="https://identifiers.org/pubmed/1504088"/> | |
7263 </rdf:Bag> | |
7264 </bqbiol:isDescribedBy> | |
7265 </rdf:Description> | |
7266 </rdf:RDF> | |
7267 </annotation> | |
7268 <fbc:geneProductAssociation> | |
7269 <fbc:geneProductRef fbc:geneProduct="ENSG00000142657"/> | |
7270 </fbc:geneProductAssociation> | |
7271 <listOfReactants> | |
7272 <speciesReference constant="true" species="M_m01169c" stoichiometry="1"/> | |
7273 <speciesReference constant="true" species="M_m02554c" stoichiometry="1"/> | |
7274 </listOfReactants> | |
7275 <listOfProducts> | |
7276 <speciesReference constant="true" species="M_m02846c" stoichiometry="1"/> | |
7277 <speciesReference constant="true" species="M_m02555c" stoichiometry="1"/> | |
7278 <speciesReference constant="true" species="M_m01596c" stoichiometry="1"/> | |
7279 </listOfProducts> | |
7280 </reaction> | |
7281 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_9800" metaid="_329c99c1-064e-4527-a8da-785581323147" name="R_HMR_9800" reversible="true" sboTerm="SBO:0000176"> | |
7282 <notes> | |
7283 <body xmlns="http://www.w3.org/1999/xhtml"> | |
7284 <p>Confidence Level: 0</p> | |
7285 <p>ec-code: 2.7.1.3</p> | |
7286 <p>metanetx.reaction: MNXR108451</p> | |
7287 <p>kegg.reaction: R03819</p> | |
7288 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
7289 <p>EC_NUMBER: 2.7.1.3</p> | |
7290 <p>GENE_ASSOCIATION: ENSG00000138030</p> | |
7291 </body> | |
7292 </notes> | |
7293 <annotation> | |
7294 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
7295 <rdf:Description rdf:about="#_329c99c1-064e-4527-a8da-785581323147"> | |
7296 <bqbiol:is> | |
7297 <rdf:Bag> | |
7298 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.3"/> | |
7299 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR108451"/> | |
7300 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R03819"/> | |
7301 </rdf:Bag> | |
7302 </bqbiol:is> | |
7303 </rdf:Description> | |
7304 </rdf:RDF> | |
7305 </annotation> | |
7306 <fbc:geneProductAssociation> | |
7307 <fbc:geneProductRef fbc:geneProduct="ENSG00000138030"/> | |
7308 </fbc:geneProductAssociation> | |
7309 <listOfReactants> | |
7310 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
7311 <speciesReference constant="true" species="M_m03165c" stoichiometry="1"/> | |
7312 </listOfReactants> | |
7313 <listOfProducts> | |
7314 <speciesReference constant="true" species="M_m03166c" stoichiometry="1"/> | |
7315 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
7316 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
7317 </listOfProducts> | |
7318 </reaction> | |
7319 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4398" metaid="c2e9d022-c156-4c88-a796-2bc148714535" name="R_HMR_4398" reversible="true" sboTerm="SBO:0000176"> | |
7320 <notes> | |
7321 <body xmlns="http://www.w3.org/1999/xhtml"> | |
7322 <p>Confidence Level: 0</p> | |
7323 <p>AUTHORS: PMID:4989681;PMID:9226884</p> | |
7324 <p>ec-code: 4.1.2.4</p> | |
7325 <p>metanetx.reaction: MNXR97787</p> | |
7326 <p>kegg.reaction: R01066</p> | |
7327 <p>bigg.reaction: DRPA</p> | |
7328 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
7329 <p>EC_NUMBER: 4.1.2.4</p> | |
7330 <p>pmids: 4989681,9226884</p> | |
7331 <p>GENE_ASSOCIATION: ENSG00000023697</p> | |
7332 </body> | |
7333 </notes> | |
7334 <annotation> | |
7335 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
7336 <rdf:Description rdf:about="#c2e9d022-c156-4c88-a796-2bc148714535"> | |
7337 <bqbiol:is> | |
7338 <rdf:Bag> | |
7339 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.1.2.4"/> | |
7340 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR97787"/> | |
7341 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01066"/> | |
7342 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/DRPA"/> | |
7343 </rdf:Bag> | |
7344 </bqbiol:is> | |
7345 <bqbiol:isDescribedBy> | |
7346 <rdf:Bag> | |
7347 <rdf:li rdf:resource="https://identifiers.org/pubmed/9226884"/> | |
7348 <rdf:li rdf:resource="https://identifiers.org/pubmed/4989681"/> | |
7349 </rdf:Bag> | |
7350 </bqbiol:isDescribedBy> | |
7351 </rdf:Description> | |
7352 </rdf:RDF> | |
7353 </annotation> | |
7354 <fbc:geneProductAssociation> | |
7355 <fbc:geneProductRef fbc:geneProduct="ENSG00000023697"/> | |
7356 </fbc:geneProductAssociation> | |
7357 <listOfReactants> | |
7358 <speciesReference constant="true" species="M_m00640c" stoichiometry="1"/> | |
7359 </listOfReactants> | |
7360 <listOfProducts> | |
7361 <speciesReference constant="true" species="M_m01939c" stoichiometry="1"/> | |
7362 <speciesReference constant="true" species="M_m01249c" stoichiometry="1"/> | |
7363 </listOfProducts> | |
7364 </reaction> | |
7365 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4354" metaid="f7108fb4-b7e5-49a3-ada1-a6024a22b77c" name="R_HMR_4354" reversible="true" sboTerm="SBO:0000176"> | |
7366 <notes> | |
7367 <body xmlns="http://www.w3.org/1999/xhtml"> | |
7368 <p>Confidence Level: 0</p> | |
7369 <p>AUTHORS: PMID:14953458;PMID:3023765;PMID:5769188;PMID:8050998</p> | |
7370 <p>ec-code: 5.4.2.2 || 5.4.2.7</p> | |
7371 <p>metanetx.reaction: MNXR106810 || MNXR103115</p> | |
7372 <p>kegg.reaction: R01057</p> | |
7373 <p>bigg.reaction: PPM</p> | |
7374 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
7375 <p>EC_NUMBER: 5.4.2.2;5.4.2.7</p> | |
7376 <p>pmids: 3023765,5769188,8050998,14953458</p> | |
7377 <p>GENE_ASSOCIATION: ( ENSG00000079739 ) OR ( ENSG00000169299 )</p> | |
7378 </body> | |
7379 </notes> | |
7380 <annotation> | |
7381 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
7382 <rdf:Description rdf:about="#f7108fb4-b7e5-49a3-ada1-a6024a22b77c"> | |
7383 <bqbiol:is> | |
7384 <rdf:Bag> | |
7385 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.4.2.2"/> | |
7386 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.4.2.7"/> | |
7387 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR106810"/> | |
7388 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR103115"/> | |
7389 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01057"/> | |
7390 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/PPM"/> | |
7391 </rdf:Bag> | |
7392 </bqbiol:is> | |
7393 <bqbiol:isDescribedBy> | |
7394 <rdf:Bag> | |
7395 <rdf:li rdf:resource="https://identifiers.org/pubmed/14953458"/> | |
7396 <rdf:li rdf:resource="https://identifiers.org/pubmed/3023765"/> | |
7397 <rdf:li rdf:resource="https://identifiers.org/pubmed/5769188"/> | |
7398 <rdf:li rdf:resource="https://identifiers.org/pubmed/8050998"/> | |
7399 </rdf:Bag> | |
7400 </bqbiol:isDescribedBy> | |
7401 </rdf:Description> | |
7402 </rdf:RDF> | |
7403 </annotation> | |
7404 <fbc:geneProductAssociation> | |
7405 <fbc:or> | |
7406 <fbc:geneProductRef fbc:geneProduct="ENSG00000169299"/> | |
7407 <fbc:geneProductRef fbc:geneProduct="ENSG00000079739"/> | |
7408 </fbc:or> | |
7409 </fbc:geneProductAssociation> | |
7410 <listOfReactants> | |
7411 <speciesReference constant="true" species="M_m02844c" stoichiometry="1"/> | |
7412 </listOfReactants> | |
7413 <listOfProducts> | |
7414 <speciesReference constant="true" species="M_m02845c" stoichiometry="1"/> | |
7415 </listOfProducts> | |
7416 </reaction> | |
7417 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4310" metaid="_9239b4c7-a967-4956-b094-a7de9aff2cba" name="R_HMR_4310" reversible="false" sboTerm="SBO:0000176"> | |
7418 <notes> | |
7419 <body xmlns="http://www.w3.org/1999/xhtml"> | |
7420 <p>Confidence Level: 0</p> | |
7421 <p>AUTHORS: PMID:2996495;PMID:7833921</p> | |
7422 <p>ec-code: 2.7.1.3</p> | |
7423 <p>metanetx.reaction: MNXR100936</p> | |
7424 <p>kegg.reaction: R00866</p> | |
7425 <p>bigg.reaction: KHK</p> | |
7426 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
7427 <p>EC_NUMBER: 2.7.1.3</p> | |
7428 <p>pmids: 2996495,7833921</p> | |
7429 <p>GENE_ASSOCIATION: ENSG00000138030</p> | |
7430 </body> | |
7431 </notes> | |
7432 <annotation> | |
7433 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
7434 <rdf:Description rdf:about="#_9239b4c7-a967-4956-b094-a7de9aff2cba"> | |
7435 <bqbiol:is> | |
7436 <rdf:Bag> | |
7437 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.3"/> | |
7438 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100936"/> | |
7439 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00866"/> | |
7440 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/KHK"/> | |
7441 </rdf:Bag> | |
7442 </bqbiol:is> | |
7443 <bqbiol:isDescribedBy> | |
7444 <rdf:Bag> | |
7445 <rdf:li rdf:resource="https://identifiers.org/pubmed/2996495"/> | |
7446 <rdf:li rdf:resource="https://identifiers.org/pubmed/7833921"/> | |
7447 </rdf:Bag> | |
7448 </bqbiol:isDescribedBy> | |
7449 </rdf:Description> | |
7450 </rdf:RDF> | |
7451 </annotation> | |
7452 <fbc:geneProductAssociation> | |
7453 <fbc:geneProductRef fbc:geneProduct="ENSG00000138030"/> | |
7454 </fbc:geneProductAssociation> | |
7455 <listOfReactants> | |
7456 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
7457 <speciesReference constant="true" species="M_m01840c" stoichiometry="1"/> | |
7458 </listOfReactants> | |
7459 <listOfProducts> | |
7460 <speciesReference constant="true" species="M_m01842c" stoichiometry="1"/> | |
7461 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
7462 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
7463 </listOfProducts> | |
7464 </reaction> | |
7465 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4476" metaid="_9560c25f-9d92-4a3c-bfbb-374877a611c3" name="R_HMR_4476" reversible="true" sboTerm="SBO:0000176"> | |
7466 <notes> | |
7467 <body xmlns="http://www.w3.org/1999/xhtml"> | |
7468 <p>Confidence Level: 0</p> | |
7469 <p>AUTHORS: PMID:10978316</p> | |
7470 <p>ec-code: 2.3.1.57</p> | |
7471 <p>metanetx.reaction: MNXR100390</p> | |
7472 <p>kegg.reaction: R01737</p> | |
7473 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
7474 <p>EC_NUMBER: 2.3.1.57</p> | |
7475 <p>pmids: 10978316</p> | |
7476 <p>GENE_ASSOCIATION: ( ENSG00000130066 ) OR ( ENSG00000141504 )</p> | |
7477 </body> | |
7478 </notes> | |
7479 <annotation> | |
7480 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
7481 <rdf:Description rdf:about="#_9560c25f-9d92-4a3c-bfbb-374877a611c3"> | |
7482 <bqbiol:is> | |
7483 <rdf:Bag> | |
7484 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.3.1.57"/> | |
7485 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100390"/> | |
7486 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01737"/> | |
7487 </rdf:Bag> | |
7488 </bqbiol:is> | |
7489 <bqbiol:isDescribedBy> | |
7490 <rdf:Bag> | |
7491 <rdf:li rdf:resource="https://identifiers.org/pubmed/10978316"/> | |
7492 </rdf:Bag> | |
7493 </bqbiol:isDescribedBy> | |
7494 </rdf:Description> | |
7495 </rdf:RDF> | |
7496 </annotation> | |
7497 <fbc:geneProductAssociation> | |
7498 <fbc:or> | |
7499 <fbc:geneProductRef fbc:geneProduct="ENSG00000141504"/> | |
7500 <fbc:geneProductRef fbc:geneProduct="ENSG00000130066"/> | |
7501 </fbc:or> | |
7502 </fbc:geneProductAssociation> | |
7503 <listOfReactants> | |
7504 <speciesReference constant="true" species="M_m01169c" stoichiometry="1"/> | |
7505 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
7506 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
7507 </listOfReactants> | |
7508 <listOfProducts> | |
7509 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
7510 <speciesReference constant="true" species="M_m01683c" stoichiometry="1"/> | |
7511 </listOfProducts> | |
7512 </reaction> | |
7513 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4399" metaid="_961e9144-e77b-430b-8dd8-8001acf778ea" name="R_HMR_4399" reversible="false" sboTerm="SBO:0000176"> | |
7514 <notes> | |
7515 <body xmlns="http://www.w3.org/1999/xhtml"> | |
7516 <p>Confidence Level: 0</p> | |
7517 <p>AUTHORS: PMID:9893952</p> | |
7518 <p>ec-code: 4.2.1.47</p> | |
7519 <p>metanetx.reaction: MNXR100377</p> | |
7520 <p>kegg.reaction: R00888</p> | |
7521 <p>bigg.reaction: GMAND</p> | |
7522 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
7523 <p>EC_NUMBER: 4.2.1.47</p> | |
7524 <p>pmids: 9893952</p> | |
7525 <p>GENE_ASSOCIATION: ENSG00000112699</p> | |
7526 </body> | |
7527 </notes> | |
7528 <annotation> | |
7529 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
7530 <rdf:Description rdf:about="#_961e9144-e77b-430b-8dd8-8001acf778ea"> | |
7531 <bqbiol:is> | |
7532 <rdf:Bag> | |
7533 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.2.1.47"/> | |
7534 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100377"/> | |
7535 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00888"/> | |
7536 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/GMAND"/> | |
7537 </rdf:Bag> | |
7538 </bqbiol:is> | |
7539 <bqbiol:isDescribedBy> | |
7540 <rdf:Bag> | |
7541 <rdf:li rdf:resource="https://identifiers.org/pubmed/9893952"/> | |
7542 </rdf:Bag> | |
7543 </bqbiol:isDescribedBy> | |
7544 </rdf:Description> | |
7545 </rdf:RDF> | |
7546 </annotation> | |
7547 <fbc:geneProductAssociation> | |
7548 <fbc:geneProductRef fbc:geneProduct="ENSG00000112699"/> | |
7549 </fbc:geneProductAssociation> | |
7550 <listOfReactants> | |
7551 <speciesReference constant="true" species="M_m01951c" stoichiometry="1"/> | |
7552 </listOfReactants> | |
7553 <listOfProducts> | |
7554 <speciesReference constant="true" species="M_m02040c" stoichiometry="1"/> | |
7555 <speciesReference constant="true" species="M_m01949c" stoichiometry="1"/> | |
7556 </listOfProducts> | |
7557 </reaction> | |
7558 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4477" metaid="_44d922a9-9c8a-409b-b662-408d43f39b21" name="R_HMR_4477" reversible="true" sboTerm="SBO:0000176"> | |
7559 <notes> | |
7560 <body xmlns="http://www.w3.org/1999/xhtml"> | |
7561 <p>Confidence Level: 0</p> | |
7562 <p>AUTHORS: PMID:15234337;PMID:234468;PMID:2843500</p> | |
7563 <p>ec-code: 5.1.3.1</p> | |
7564 <p>metanetx.reaction: MNXR104083</p> | |
7565 <p>kegg.reaction: R01529</p> | |
7566 <p>bigg.reaction: RPE</p> | |
7567 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
7568 <p>EC_NUMBER: 5.1.3.1</p> | |
7569 <p>pmids: 234468,2843500,15234337</p> | |
7570 <p>GENE_ASSOCIATION: ( ENSG00000197713 ) OR ( ENSG00000235376 )</p> | |
7571 </body> | |
7572 </notes> | |
7573 <annotation> | |
7574 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
7575 <rdf:Description rdf:about="#_44d922a9-9c8a-409b-b662-408d43f39b21"> | |
7576 <bqbiol:is> | |
7577 <rdf:Bag> | |
7578 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.1.3.1"/> | |
7579 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR104083"/> | |
7580 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01529"/> | |
7581 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/RPE"/> | |
7582 </rdf:Bag> | |
7583 </bqbiol:is> | |
7584 <bqbiol:isDescribedBy> | |
7585 <rdf:Bag> | |
7586 <rdf:li rdf:resource="https://identifiers.org/pubmed/234468"/> | |
7587 <rdf:li rdf:resource="https://identifiers.org/pubmed/2843500"/> | |
7588 <rdf:li rdf:resource="https://identifiers.org/pubmed/15234337"/> | |
7589 </rdf:Bag> | |
7590 </bqbiol:isDescribedBy> | |
7591 </rdf:Description> | |
7592 </rdf:RDF> | |
7593 </annotation> | |
7594 <fbc:geneProductAssociation> | |
7595 <fbc:or> | |
7596 <fbc:geneProductRef fbc:geneProduct="ENSG00000197713"/> | |
7597 <fbc:geneProductRef fbc:geneProduct="ENSG00000235376"/> | |
7598 </fbc:or> | |
7599 </fbc:geneProductAssociation> | |
7600 <listOfReactants> | |
7601 <speciesReference constant="true" species="M_m01761c" stoichiometry="1"/> | |
7602 </listOfReactants> | |
7603 <listOfProducts> | |
7604 <speciesReference constant="true" species="M_m02846c" stoichiometry="1"/> | |
7605 </listOfProducts> | |
7606 </reaction> | |
7607 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4356" metaid="e6efa094-5aeb-412c-8390-f6707d0794e0" name="R_HMR_4356" reversible="false" sboTerm="SBO:0000176"> | |
7608 <notes> | |
7609 <body xmlns="http://www.w3.org/1999/xhtml"> | |
7610 <p>Confidence Level: 0</p> | |
7611 <p>AUTHORS: PMID:5114731;PMID:5655259;PMID:6054986</p> | |
7612 <p>ec-code: 4.1.2.13</p> | |
7613 <p>metanetx.reaction: MNXR99460</p> | |
7614 <p>kegg.reaction: R02568</p> | |
7615 <p>bigg.reaction: FBA2</p> | |
7616 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
7617 <p>EC_NUMBER: 4.1.2.13</p> | |
7618 <p>pmids: 5114731,5655259,6054986</p> | |
7619 <p>GENE_ASSOCIATION: ( ENSG00000109107 ) OR ( ENSG00000136872 ) OR ( ENSG00000149925 ) OR ( ENSG00000285043 )</p> | |
7620 </body> | |
7621 </notes> | |
7622 <annotation> | |
7623 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
7624 <rdf:Description rdf:about="#e6efa094-5aeb-412c-8390-f6707d0794e0"> | |
7625 <bqbiol:is> | |
7626 <rdf:Bag> | |
7627 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.1.2.13"/> | |
7628 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR99460"/> | |
7629 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R02568"/> | |
7630 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/FBA2"/> | |
7631 </rdf:Bag> | |
7632 </bqbiol:is> | |
7633 <bqbiol:isDescribedBy> | |
7634 <rdf:Bag> | |
7635 <rdf:li rdf:resource="https://identifiers.org/pubmed/5114731"/> | |
7636 <rdf:li rdf:resource="https://identifiers.org/pubmed/6054986"/> | |
7637 <rdf:li rdf:resource="https://identifiers.org/pubmed/5655259"/> | |
7638 </rdf:Bag> | |
7639 </bqbiol:isDescribedBy> | |
7640 </rdf:Description> | |
7641 </rdf:RDF> | |
7642 </annotation> | |
7643 <fbc:geneProductAssociation> | |
7644 <fbc:or> | |
7645 <fbc:geneProductRef fbc:geneProduct="ENSG00000136872"/> | |
7646 <fbc:geneProductRef fbc:geneProduct="ENSG00000149925"/> | |
7647 <fbc:geneProductRef fbc:geneProduct="ENSG00000109107"/> | |
7648 <fbc:geneProductRef fbc:geneProduct="ENSG00000285043"/> | |
7649 </fbc:or> | |
7650 </fbc:geneProductAssociation> | |
7651 <listOfReactants> | |
7652 <speciesReference constant="true" species="M_m01690c" stoichiometry="1"/> | |
7653 <speciesReference constant="true" species="M_m01981c" stoichiometry="1"/> | |
7654 </listOfReactants> | |
7655 <listOfProducts> | |
7656 <speciesReference constant="true" species="M_m01842c" stoichiometry="1"/> | |
7657 </listOfProducts> | |
7658 </reaction> | |
7659 </listOfReactions> | |
7660 </model> | |
7661 </sbml> |