Mercurial > repos > metexplore > met4j
comparison tools/convert/FbcToNotes/test-data/buc.xml @ 0:dcd16521b969 draft
planemo upload for repository https://forgemia.inra.fr/metexplore/met4j-galaxy commit 5dab0a2d83a1fdd7a1878a50ba0f24e752505393
| author | metexplore |
|---|---|
| date | Fri, 10 Jun 2022 10:31:34 +0000 |
| parents | |
| children |
comparison
equal
deleted
inserted
replaced
| -1:000000000000 | 0:dcd16521b969 |
|---|---|
| 1 <?xml version="1.0" encoding="UTF-8"?> | |
| 2 <sbml fbc:required="false" groups:required="false" level="3" version="2" xmlns="http://www.sbml.org/sbml/level3/version2/core" xmlns:fbc="http://www.sbml.org/sbml/level3/version1/fbc/version2" xmlns:groups="http://www.sbml.org/sbml/level3/version1/groups/version1"> | |
| 3 <model fbc:strict="true" id="buc" metaid="buc" name="Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 4 <fbc:listOfGeneProducts> | |
| 5 <fbc:geneProduct fbc:id="buc_BU293" fbc:label="buc_BU293" fbc:name="buc_BU293" metaid="_3b5f29b7-7d2a-4855-93b8-7c90d14d0ab3"/> | |
| 6 <fbc:geneProduct fbc:id="buc_BU051" fbc:label="buc_BU051" fbc:name="buc_BU051" metaid="_8a589982-8208-4c05-bc37-97d713484725"/> | |
| 7 <fbc:geneProduct fbc:id="buc_BUpT04" fbc:label="buc_BUpT04" fbc:name="buc_BUpT04" metaid="_3a2826c8-559c-49db-8e70-9af02879cbdb"/> | |
| 8 <fbc:geneProduct fbc:id="buc_BU291" fbc:label="buc_BU291" fbc:name="buc_BU291" metaid="_85548c7c-4cf5-4109-ab4b-bd0a6361c04b"/> | |
| 9 <fbc:geneProduct fbc:id="buc_BU170" fbc:label="buc_BU170" fbc:name="buc_BU170" metaid="_8f006f07-a581-4cab-b1aa-f8d9f38dc0f9"/> | |
| 10 <fbc:geneProduct fbc:id="buc_BUpT02" fbc:label="buc_BUpT02" fbc:name="buc_BUpT02" metaid="cf85bb50-9322-4868-9902-03ee9365d0e6"/> | |
| 11 <fbc:geneProduct fbc:id="buc_BU292" fbc:label="buc_BU292" fbc:name="buc_BU292" metaid="_3c5b7024-2d3c-42ae-864e-e02d4e71f1e9"/> | |
| 12 <fbc:geneProduct fbc:id="buc_BU050" fbc:label="buc_BU050" fbc:name="buc_BU050" metaid="c77a76da-75c5-4122-b882-98c2116484e6"/> | |
| 13 <fbc:geneProduct fbc:id="buc_BU176" fbc:label="buc_BU176" fbc:name="buc_BU176" metaid="_8c90399e-5172-4f88-82b3-e0eaf422539a"/> | |
| 14 <fbc:geneProduct fbc:id="buc_BU298" fbc:label="buc_BU298" fbc:name="buc_BU298" metaid="_852f4d50-98a9-497e-9f57-3736f27f524f"/> | |
| 15 <fbc:geneProduct fbc:id="buc_BU174" fbc:label="buc_BU174" fbc:name="buc_BU174" metaid="e7c0475f-0389-402f-9044-d716fea29b35"/> | |
| 16 <fbc:geneProduct fbc:id="buc_BU175" fbc:label="buc_BU175" fbc:name="buc_BU175" metaid="c2d2667e-10da-41c1-b5ac-11180100406d"/> | |
| 17 <fbc:geneProduct fbc:id="buc_BU054" fbc:label="buc_BU054" fbc:name="buc_BU054" metaid="_9e5390cf-8fe6-4103-84e3-5f5811ea6180"/> | |
| 18 <fbc:geneProduct fbc:id="buc_BUpL04" fbc:label="buc_BUpL04" fbc:name="buc_BUpL04" metaid="aee65279-ea43-4153-8560-5d373615bbd4"/> | |
| 19 <fbc:geneProduct fbc:id="buc_BUpL05" fbc:label="buc_BUpL05" fbc:name="buc_BUpL05" metaid="_6fb2a307-08e7-4f59-95f5-d0ceb27321b1"/> | |
| 20 <fbc:geneProduct fbc:id="buc_BU290" fbc:label="buc_BU290" fbc:name="buc_BU290" metaid="_377460d5-e612-4055-a588-1b203582963a"/> | |
| 21 <fbc:geneProduct fbc:id="buc_BUpT01" fbc:label="buc_BUpT01" fbc:name="buc_BUpT01" metaid="_4d2fcfa4-9f8c-4842-a321-20ae0759bf25"/> | |
| 22 <fbc:geneProduct fbc:id="buc_BUpL06" fbc:label="buc_BUpL06" fbc:name="buc_BUpL06" metaid="ad75dc9b-6e4c-4cc9-98cf-e7f804972240"/> | |
| 23 <fbc:geneProduct fbc:id="buc_BUpL07" fbc:label="buc_BUpL07" fbc:name="buc_BUpL07" metaid="_5aac7d7b-3348-4513-ab18-d47f1e36ed94"/> | |
| 24 <fbc:geneProduct fbc:id="buc_BU059" fbc:label="buc_BU059" fbc:name="buc_BU059" metaid="ed03e996-5fc7-4f90-844a-a0c796dbf309"/> | |
| 25 <fbc:geneProduct fbc:id="buc_BU178" fbc:label="buc_BU178" fbc:name="buc_BU178" metaid="a07f353e-0e3c-4d70-bb5e-f7a0e2cf1fb9"/> | |
| 26 <fbc:geneProduct fbc:id="buc_BU179" fbc:label="buc_BU179" fbc:name="buc_BU179" metaid="_9d769994-4e9d-4748-b87b-7d733fff66fe"/> | |
| 27 <fbc:geneProduct fbc:id="buc_BU062" fbc:label="buc_BU062" fbc:name="buc_BU062" metaid="_1847b7b2-6229-4b90-aa24-9a0a474c604d"/> | |
| 28 <fbc:geneProduct fbc:id="buc_BU063" fbc:label="buc_BU063" fbc:name="buc_BU063" metaid="_02cb5b81-b8f2-4415-ad27-9a55199a6dc1"/> | |
| 29 <fbc:geneProduct fbc:id="buc_BU066" fbc:label="buc_BU066" fbc:name="buc_BU066" metaid="ad17e3c7-859a-4246-8c45-b6f74c3afdef"/> | |
| 30 <fbc:geneProduct fbc:id="buc_BU185" fbc:label="buc_BU185" fbc:name="buc_BU185" metaid="e9ef2a88-b64b-4ef5-ba3f-35e1eb3dc17d"/> | |
| 31 <fbc:geneProduct fbc:id="buc_BU194" fbc:label="buc_BU194" fbc:name="buc_BU194" metaid="_53457949-997a-4598-9210-1a1d44dec528"/> | |
| 32 <fbc:geneProduct fbc:id="buc_BU195" fbc:label="buc_BU195" fbc:name="buc_BU195" metaid="ac94566d-f81a-4442-acd2-365c368d9c9c"/> | |
| 33 <fbc:geneProduct fbc:id="buc_BU192" fbc:label="buc_BU192" fbc:name="buc_BU192" metaid="_28ed9517-95c7-4057-b08c-00e1d645b82c"/> | |
| 34 <fbc:geneProduct fbc:id="buc_BU193" fbc:label="buc_BU193" fbc:name="buc_BU193" metaid="_64baa404-d482-4a9e-967f-7444b465fb58"/> | |
| 35 <fbc:geneProduct fbc:id="buc_BU196" fbc:label="buc_BU196" fbc:name="buc_BU196" metaid="fb92abcf-642a-4fe7-8cfa-18c05904669b"/> | |
| 36 <fbc:geneProduct fbc:id="buc_BU197" fbc:label="buc_BU197" fbc:name="buc_BU197" metaid="d0890ce5-71ab-4331-a8fb-b48cd19d70a1"/> | |
| 37 <fbc:geneProduct fbc:id="buc_BU070" fbc:label="buc_BU070" fbc:name="buc_BU070" metaid="_15bc930f-80e1-460a-9d02-ce431b372761"/> | |
| 38 <fbc:geneProduct fbc:id="buc_BU408" fbc:label="buc_BU408" fbc:name="buc_BU408" metaid="_546da19a-dce7-49c0-91cc-8af24109b170"/> | |
| 39 <fbc:geneProduct fbc:id="buc_BU407" fbc:label="buc_BU407" fbc:name="buc_BU407" metaid="_460c568a-f23f-4dcb-9842-b05788785a5a"/> | |
| 40 <fbc:geneProduct fbc:id="buc_BU403" fbc:label="buc_BU403" fbc:name="buc_BU403" metaid="_5b28771f-a2fa-4f06-ac75-55704ef469bb"/> | |
| 41 <fbc:geneProduct fbc:id="buc_BU095" fbc:label="buc_BU095" fbc:name="buc_BU095" metaid="_3774cee3-4d53-4aa6-9cab-22ce16a968e3"/> | |
| 42 <fbc:geneProduct fbc:id="buc_BU096" fbc:label="buc_BU096" fbc:name="buc_BU096" metaid="c6eae0d7-bef8-4be0-9f9b-440736e50c0a"/> | |
| 43 <fbc:geneProduct fbc:id="buc_BU093" fbc:label="buc_BU093" fbc:name="buc_BU093" metaid="b81028fb-ddf1-4115-a873-858a5ecdd642"/> | |
| 44 <fbc:geneProduct fbc:id="buc_BU094" fbc:label="buc_BU094" fbc:name="buc_BU094" metaid="_682416f5-d00b-4011-b339-173981cb309b"/> | |
| 45 <fbc:geneProduct fbc:id="buc_BU099" fbc:label="buc_BU099" fbc:name="buc_BU099" metaid="d3b8d0d3-8382-4c76-bb92-140db436a1fb"/> | |
| 46 <fbc:geneProduct fbc:id="buc_BU097" fbc:label="buc_BU097" fbc:name="buc_BU097" metaid="cb91e5dd-aecb-40d1-bd82-9eadb9a1ea50"/> | |
| 47 <fbc:geneProduct fbc:id="buc_BU092" fbc:label="buc_BU092" fbc:name="buc_BU092" metaid="_20a2dd46-edb9-49fe-a926-bc9ccc1fa18a"/> | |
| 48 <fbc:geneProduct fbc:id="buc_BU419" fbc:label="buc_BU419" fbc:name="buc_BU419" metaid="_8ed2db87-2e91-42f5-835c-e2cfec2e5217"/> | |
| 49 <fbc:geneProduct fbc:id="buc_BU417" fbc:label="buc_BU417" fbc:name="buc_BU417" metaid="d31f8224-e913-4b80-aec3-a588db99f2de"/> | |
| 50 <fbc:geneProduct fbc:id="buc_BU538" fbc:label="buc_BU538" fbc:name="buc_BU538" metaid="add9714b-94f2-4a6f-8a2c-0be56b40333c"/> | |
| 51 <fbc:geneProduct fbc:id="buc_BU539" fbc:label="buc_BU539" fbc:name="buc_BU539" metaid="_448288a4-4de7-4bc2-8a00-38a754cb8d93"/> | |
| 52 <fbc:geneProduct fbc:id="buc_BU411" fbc:label="buc_BU411" fbc:name="buc_BU411" metaid="_1f5b7b58-1814-4464-add4-3090de8fead7"/> | |
| 53 <fbc:geneProduct fbc:id="buc_BU415" fbc:label="buc_BU415" fbc:name="buc_BU415" metaid="_0b530d4a-b2cf-4ef9-81f7-042cc9cb08bb"/> | |
| 54 <fbc:geneProduct fbc:id="buc_BU536" fbc:label="buc_BU536" fbc:name="buc_BU536" metaid="f18113af-8195-421f-a075-a62db80b64c3"/> | |
| 55 <fbc:geneProduct fbc:id="buc_BU537" fbc:label="buc_BU537" fbc:name="buc_BU537" metaid="_33c3112b-dd59-4053-b6f0-3abb7789bf7f"/> | |
| 56 <fbc:geneProduct fbc:id="buc_BU416" fbc:label="buc_BU416" fbc:name="buc_BU416" metaid="a3ba75e1-23ac-4fe7-ad4b-ffef1b267c72"/> | |
| 57 <fbc:geneProduct fbc:id="buc_BU534" fbc:label="buc_BU534" fbc:name="buc_BU534" metaid="f54ccb05-3a59-4d1b-92da-95030e345209"/> | |
| 58 <fbc:geneProduct fbc:id="buc_BU307" fbc:label="buc_BU307" fbc:name="buc_BU307" metaid="_9a6760c7-af79-4fef-a857-bdbe55c472c8"/> | |
| 59 <fbc:geneProduct fbc:id="buc_BU428" fbc:label="buc_BU428" fbc:name="buc_BU428" metaid="cb8413d3-495a-4bbe-aa49-df1a3f29130a"/> | |
| 60 <fbc:geneProduct fbc:id="buc_BU422" fbc:label="buc_BU422" fbc:name="buc_BU422" metaid="a0f86695-9967-4a35-b4fa-e7b04e191fe2"/> | |
| 61 <fbc:geneProduct fbc:id="buc_BU423" fbc:label="buc_BU423" fbc:name="buc_BU423" metaid="c3274970-68f6-4f35-bd31-2154d3bc23df"/> | |
| 62 <fbc:geneProduct fbc:id="buc_BU302" fbc:label="buc_BU302" fbc:name="buc_BU302" metaid="_2865acd7-fcac-459b-ac6a-bf924ded9cf4"/> | |
| 63 <fbc:geneProduct fbc:id="buc_BU541" fbc:label="buc_BU541" fbc:name="buc_BU541" metaid="_44a717bd-e9f6-4119-8991-428ea7308674"/> | |
| 64 <fbc:geneProduct fbc:id="buc_BU420" fbc:label="buc_BU420" fbc:name="buc_BU420" metaid="_60051aab-2c63-477a-859e-5f88ddda14c0"/> | |
| 65 <fbc:geneProduct fbc:id="buc_BU542" fbc:label="buc_BU542" fbc:name="buc_BU542" metaid="dffd4c16-1467-4e98-89ad-a93378a1ed65"/> | |
| 66 <fbc:geneProduct fbc:id="buc_BU305" fbc:label="buc_BU305" fbc:name="buc_BU305" metaid="_80ea57b0-084b-444c-9b88-55b8ed9eccaa"/> | |
| 67 <fbc:geneProduct fbc:id="buc_BU426" fbc:label="buc_BU426" fbc:name="buc_BU426" metaid="fd9f263b-7fd8-4a92-ba93-72dec5843c18"/> | |
| 68 <fbc:geneProduct fbc:id="buc_BU547" fbc:label="buc_BU547" fbc:name="buc_BU547" metaid="_96146e23-dfb2-408f-9ad0-fb138105cd3a"/> | |
| 69 <fbc:geneProduct fbc:id="buc_BU427" fbc:label="buc_BU427" fbc:name="buc_BU427" metaid="_7c1243b4-ad3c-4760-9f5e-2e568420a36f"/> | |
| 70 <fbc:geneProduct fbc:id="buc_BU424" fbc:label="buc_BU424" fbc:name="buc_BU424" metaid="f0d22546-3ac6-4c10-83f1-44e45a481f7d"/> | |
| 71 <fbc:geneProduct fbc:id="buc_BU303" fbc:label="buc_BU303" fbc:name="buc_BU303" metaid="_82da7c4e-087f-490a-84c5-1d82f10c84fc"/> | |
| 72 <fbc:geneProduct fbc:id="buc_BU304" fbc:label="buc_BU304" fbc:name="buc_BU304" metaid="_139ac08a-2d72-4b9a-9e0c-86066a4a4da9"/> | |
| 73 <fbc:geneProduct fbc:id="buc_BU425" fbc:label="buc_BU425" fbc:name="buc_BU425" metaid="b9638ec6-73d5-4eb4-98d2-8bb9f9b64b11"/> | |
| 74 <fbc:geneProduct fbc:id="buc_BU319" fbc:label="buc_BU319" fbc:name="buc_BU319" metaid="a0c65ece-a200-492d-9a53-06107f0b1788"/> | |
| 75 <fbc:geneProduct fbc:id="buc_BU312" fbc:label="buc_BU312" fbc:name="buc_BU312" metaid="_5bcb9e77-684b-479b-826a-a20bb6135239"/> | |
| 76 <fbc:geneProduct fbc:id="buc_BU554" fbc:label="buc_BU554" fbc:name="buc_BU554" metaid="_04b96e19-f2aa-4d61-8977-8c98a84849cc"/> | |
| 77 <fbc:geneProduct fbc:id="buc_BU434" fbc:label="buc_BU434" fbc:name="buc_BU434" metaid="a7719f61-a4bf-48e5-a40c-4d54fc2a548f"/> | |
| 78 <fbc:geneProduct fbc:id="buc_BU313" fbc:label="buc_BU313" fbc:name="buc_BU313" metaid="a91ac7f8-3f7b-4b7f-aa48-bb8fd61dbf33"/> | |
| 79 <fbc:geneProduct fbc:id="buc_BU311" fbc:label="buc_BU311" fbc:name="buc_BU311" metaid="eea12f05-d1b4-4832-8b1f-a19745be3f18"/> | |
| 80 <fbc:geneProduct fbc:id="buc_BU316" fbc:label="buc_BU316" fbc:name="buc_BU316" metaid="ebf10df5-774e-4ef2-b2e1-a9bdb3d85315"/> | |
| 81 <fbc:geneProduct fbc:id="buc_BU437" fbc:label="buc_BU437" fbc:name="buc_BU437" metaid="_8e870107-04a2-4a09-bbc6-d1da7a3b65cc"/> | |
| 82 <fbc:geneProduct fbc:id="buc_BU438" fbc:label="buc_BU438" fbc:name="buc_BU438" metaid="_4bcce24e-faee-432a-9654-4cd1bdff9b79"/> | |
| 83 <fbc:geneProduct fbc:id="buc_BU559" fbc:label="buc_BU559" fbc:name="buc_BU559" metaid="_6a35ffca-d484-4c9d-af35-4398c1baf409"/> | |
| 84 <fbc:geneProduct fbc:id="buc_BU314" fbc:label="buc_BU314" fbc:name="buc_BU314" metaid="_7633ffa5-e346-4b63-8d95-14e6a5665e12"/> | |
| 85 <fbc:geneProduct fbc:id="buc_BU440" fbc:label="buc_BU440" fbc:name="buc_BU440" metaid="_9862ec6e-ed2d-470c-8d24-9c7f7e1e83a5"/> | |
| 86 <fbc:geneProduct fbc:id="buc_BU561" fbc:label="buc_BU561" fbc:name="buc_BU561" metaid="fc823ce9-f8ab-4c28-a26c-b3fc842cfbff"/> | |
| 87 <fbc:geneProduct fbc:id="buc_BU320" fbc:label="buc_BU320" fbc:name="buc_BU320" metaid="b31042f8-74f1-4454-8227-23caaca4c8d3"/> | |
| 88 <fbc:geneProduct fbc:id="buc_BU560" fbc:label="buc_BU560" fbc:name="buc_BU560" metaid="_4706e1dc-304a-48f1-bf2c-0f99281b393f"/> | |
| 89 <fbc:geneProduct fbc:id="buc_BU208" fbc:label="buc_BU208" fbc:name="buc_BU208" metaid="a899712e-9161-468b-bdce-7a4b760a4e15"/> | |
| 90 <fbc:geneProduct fbc:id="buc_BU209" fbc:label="buc_BU209" fbc:name="buc_BU209" metaid="_2cffff27-8472-4ca9-bae5-a541a6e7268a"/> | |
| 91 <fbc:geneProduct fbc:id="buc_BU444" fbc:label="buc_BU444" fbc:name="buc_BU444" metaid="_3fecda53-d1a5-4528-a74a-154b9845c1e8"/> | |
| 92 <fbc:geneProduct fbc:id="buc_BU566" fbc:label="buc_BU566" fbc:name="buc_BU566" metaid="e9577a3d-ecd5-4369-ad5d-2f4b29d7c5ea"/> | |
| 93 <fbc:geneProduct fbc:id="buc_BU203" fbc:label="buc_BU203" fbc:name="buc_BU203" metaid="_3d4163d4-70c1-4553-b600-ccf3875f2b36"/> | |
| 94 <fbc:geneProduct fbc:id="buc_BU206" fbc:label="buc_BU206" fbc:name="buc_BU206" metaid="a53c17d7-879c-44dc-96ff-1a58f52191de"/> | |
| 95 <fbc:geneProduct fbc:id="buc_BU448" fbc:label="buc_BU448" fbc:name="buc_BU448" metaid="_194238cb-455a-4d80-a78e-49e67f443234"/> | |
| 96 <fbc:geneProduct fbc:id="buc_BU569" fbc:label="buc_BU569" fbc:name="buc_BU569" metaid="_6f2a0867-f3c5-4a96-ae50-06b53eb5cb3d"/> | |
| 97 <fbc:geneProduct fbc:id="buc_BU207" fbc:label="buc_BU207" fbc:name="buc_BU207" metaid="_722aa4af-0b54-4d82-b4f6-950836a3d260"/> | |
| 98 <fbc:geneProduct fbc:id="buc_BU204" fbc:label="buc_BU204" fbc:name="buc_BU204" metaid="ab678102-bc74-466d-8375-9f3de586f539"/> | |
| 99 <fbc:geneProduct fbc:id="buc_BU446" fbc:label="buc_BU446" fbc:name="buc_BU446" metaid="_44d6ed38-0d8c-45fe-8909-342813de98ec"/> | |
| 100 <fbc:geneProduct fbc:id="buc_BU205" fbc:label="buc_BU205" fbc:name="buc_BU205" metaid="ce836cf1-c658-4f41-ac0c-257e90186bc8"/> | |
| 101 <fbc:geneProduct fbc:id="buc_BU451" fbc:label="buc_BU451" fbc:name="buc_BU451" metaid="_8c4582fb-5384-4221-a9ae-07fa34526d54"/> | |
| 102 <fbc:geneProduct fbc:id="buc_BU572" fbc:label="buc_BU572" fbc:name="buc_BU572" metaid="_7a5a05aa-4e44-409c-8e80-e184b7fa1e6a"/> | |
| 103 <fbc:geneProduct fbc:id="buc_BU573" fbc:label="buc_BU573" fbc:name="buc_BU573" metaid="_36f153b8-2415-4037-b82a-1bd55026a7e6"/> | |
| 104 <fbc:geneProduct fbc:id="buc_BU210" fbc:label="buc_BU210" fbc:name="buc_BU210" metaid="d87de72d-f979-455b-a6ae-bb0ab295e49a"/> | |
| 105 <fbc:geneProduct fbc:id="buc_BU450" fbc:label="buc_BU450" fbc:name="buc_BU450" metaid="_543bca34-320e-459b-9b39-198c74bfa74f"/> | |
| 106 <fbc:geneProduct fbc:id="buc_BU571" fbc:label="buc_BU571" fbc:name="buc_BU571" metaid="_747363b2-4e49-48e7-b647-b83a84466b8a"/> | |
| 107 <fbc:geneProduct fbc:id="buc_BU219" fbc:label="buc_BU219" fbc:name="buc_BU219" metaid="_23e8dff6-257d-4cb0-95f6-08a05d029e94"/> | |
| 108 <fbc:geneProduct fbc:id="buc_BU334" fbc:label="buc_BU334" fbc:name="buc_BU334" metaid="fe035f5a-cbd6-4e98-bf37-d98795f7bca4"/> | |
| 109 <fbc:geneProduct fbc:id="buc_BU456" fbc:label="buc_BU456" fbc:name="buc_BU456" metaid="f2436549-58c7-4d3e-be06-e7246898ebb4"/> | |
| 110 <fbc:geneProduct fbc:id="buc_BU459" fbc:label="buc_BU459" fbc:name="buc_BU459" metaid="c2a1b03d-97c5-4a72-a522-c27dfd402e48"/> | |
| 111 <fbc:geneProduct fbc:id="buc_BU218" fbc:label="buc_BU218" fbc:name="buc_BU218" metaid="c148c15f-a008-4c16-95bc-b130d3d6f146"/> | |
| 112 <fbc:geneProduct fbc:id="buc_BU215" fbc:label="buc_BU215" fbc:name="buc_BU215" metaid="f084e7fe-b5a0-45ff-8660-d93117a7b932"/> | |
| 113 <fbc:geneProduct fbc:id="buc_BU216" fbc:label="buc_BU216" fbc:name="buc_BU216" metaid="_1b58f541-5064-4b2a-a629-a36de7740b2c"/> | |
| 114 <fbc:geneProduct fbc:id="buc_BU462" fbc:label="buc_BU462" fbc:name="buc_BU462" metaid="_5a159a60-3d4d-4fed-ba97-0a5b69fe295a"/> | |
| 115 <fbc:geneProduct fbc:id="buc_BU583" fbc:label="buc_BU583" fbc:name="buc_BU583" metaid="ce91e593-399d-4182-99a4-040fb3f146c7"/> | |
| 116 <fbc:geneProduct fbc:id="buc_BU220" fbc:label="buc_BU220" fbc:name="buc_BU220" metaid="a6b3c601-e215-45dd-8a5e-49a3eec4daed"/> | |
| 117 <fbc:geneProduct fbc:id="buc_BU221" fbc:label="buc_BU221" fbc:name="buc_BU221" metaid="a1f846f4-eb67-423b-bc46-5e8b9fb0350b"/> | |
| 118 <fbc:geneProduct fbc:id="buc_BU100" fbc:label="buc_BU100" fbc:name="buc_BU100" metaid="eb94b844-5369-4938-80fc-21832d59e431"/> | |
| 119 <fbc:geneProduct fbc:id="buc_BU460" fbc:label="buc_BU460" fbc:name="buc_BU460" metaid="d9b5835c-680d-4a0b-8267-6248a551ab19"/> | |
| 120 <fbc:geneProduct fbc:id="buc_BU461" fbc:label="buc_BU461" fbc:name="buc_BU461" metaid="_73522a52-43ff-4fb0-9090-6d5f685f8458"/> | |
| 121 <fbc:geneProduct fbc:id="buc_BU109" fbc:label="buc_BU109" fbc:name="buc_BU109" metaid="_8acbaa69-3b05-43c1-8e66-ee671c9051a7"/> | |
| 122 <fbc:geneProduct fbc:id="buc_BU103" fbc:label="buc_BU103" fbc:name="buc_BU103" metaid="_4a7ece5d-75fc-49ac-9fb6-1fec078e735c"/> | |
| 123 <fbc:geneProduct fbc:id="buc_BU225" fbc:label="buc_BU225" fbc:name="buc_BU225" metaid="_3796a08f-e6dd-4fa3-96b7-40e8c9de44d3"/> | |
| 124 <fbc:geneProduct fbc:id="buc_BU104" fbc:label="buc_BU104" fbc:name="buc_BU104" metaid="bb1a41aa-4b3a-4cfa-8796-a86b057d1d91"/> | |
| 125 <fbc:geneProduct fbc:id="buc_BU464" fbc:label="buc_BU464" fbc:name="buc_BU464" metaid="f2d17689-ded3-44be-9775-a7088f56faa2"/> | |
| 126 <fbc:geneProduct fbc:id="buc_BU101" fbc:label="buc_BU101" fbc:name="buc_BU101" metaid="b830090e-2e37-4eaf-8c37-3fb27ef7c0b5"/> | |
| 127 <fbc:geneProduct fbc:id="buc_BU465" fbc:label="buc_BU465" fbc:name="buc_BU465" metaid="_3282ed63-c1ce-43a7-8f94-1699e563946c"/> | |
| 128 <fbc:geneProduct fbc:id="buc_BU102" fbc:label="buc_BU102" fbc:name="buc_BU102" metaid="_04ee94bc-ddaf-4830-af42-f9cd362a19b5"/> | |
| 129 <fbc:geneProduct fbc:id="buc_BU107" fbc:label="buc_BU107" fbc:name="buc_BU107" metaid="_8169bf20-cfda-4e98-9907-d26bfd3fefd7"/> | |
| 130 <fbc:geneProduct fbc:id="buc_BU229" fbc:label="buc_BU229" fbc:name="buc_BU229" metaid="_2c59afb2-5a45-42c8-9476-705ff5d56354"/> | |
| 131 <fbc:geneProduct fbc:id="buc_BU108" fbc:label="buc_BU108" fbc:name="buc_BU108" metaid="_672542db-3ac6-4e69-bba1-2b46feab7dea"/> | |
| 132 <fbc:geneProduct fbc:id="buc_BU589" fbc:label="buc_BU589" fbc:name="buc_BU589" metaid="a2e622bf-1bcf-4e9b-b9f0-9055847e81f3"/> | |
| 133 <fbc:geneProduct fbc:id="buc_BU468" fbc:label="buc_BU468" fbc:name="buc_BU468" metaid="a1e8494e-1573-4d42-9d8b-2fd7aab2f7a0"/> | |
| 134 <fbc:geneProduct fbc:id="buc_BU226" fbc:label="buc_BU226" fbc:name="buc_BU226" metaid="_47538f5b-f82d-4d39-95ca-c5b0fe7a689a"/> | |
| 135 <fbc:geneProduct fbc:id="buc_BU105" fbc:label="buc_BU105" fbc:name="buc_BU105" metaid="bcc05203-a49f-4d43-a886-0be3f2659e4a"/> | |
| 136 <fbc:geneProduct fbc:id="buc_BU106" fbc:label="buc_BU106" fbc:name="buc_BU106" metaid="fd3069b9-f2a6-4e98-b81c-47e90cd6af2a"/> | |
| 137 <fbc:geneProduct fbc:id="buc_BU591" fbc:label="buc_BU591" fbc:name="buc_BU591" metaid="_4bbffecb-2763-4001-beff-4914ca63ad07"/> | |
| 138 <fbc:geneProduct fbc:id="buc_BU352" fbc:label="buc_BU352" fbc:name="buc_BU352" metaid="_4ac80291-f395-4aeb-ad40-9927fcc58b95"/> | |
| 139 <fbc:geneProduct fbc:id="buc_BU353" fbc:label="buc_BU353" fbc:name="buc_BU353" metaid="_6c59a6ca-6f13-4c0b-a5fb-1f498ba5bb65"/> | |
| 140 <fbc:geneProduct fbc:id="buc_BU351" fbc:label="buc_BU351" fbc:name="buc_BU351" metaid="acf73e9c-46ba-4782-b5c1-36e08fe274e5"/> | |
| 141 <fbc:geneProduct fbc:id="buc_BU235" fbc:label="buc_BU235" fbc:name="buc_BU235" metaid="_346201fa-76ce-4e3d-b2f9-02dedff75e3d"/> | |
| 142 <fbc:geneProduct fbc:id="buc_BU356" fbc:label="buc_BU356" fbc:name="buc_BU356" metaid="_35109efa-fa1d-40b2-8899-c24a3e16ca55"/> | |
| 143 <fbc:geneProduct fbc:id="buc_BU236" fbc:label="buc_BU236" fbc:name="buc_BU236" metaid="_94aa4736-8c62-4660-bded-fca7ccedbfed"/> | |
| 144 <fbc:geneProduct fbc:id="buc_BU599" fbc:label="buc_BU599" fbc:name="buc_BU599" metaid="_91e64091-ba30-48f5-a424-664f10dfeeeb"/> | |
| 145 <fbc:geneProduct fbc:id="buc_BU112" fbc:label="buc_BU112" fbc:name="buc_BU112" metaid="c38a2f7c-aa85-49e6-b742-e90b0ca548a7"/> | |
| 146 <fbc:geneProduct fbc:id="buc_BU233" fbc:label="buc_BU233" fbc:name="buc_BU233" metaid="_7c2fd668-8dae-4bff-b6bd-af293719b4ef"/> | |
| 147 <fbc:geneProduct fbc:id="buc_BU239" fbc:label="buc_BU239" fbc:name="buc_BU239" metaid="a836bd99-94a0-43b0-a23c-dee82682baab"/> | |
| 148 <fbc:geneProduct fbc:id="buc_BU360" fbc:label="buc_BU360" fbc:name="buc_BU360" metaid="_6e9e35fd-71f3-4292-b0ca-e795c1c1404c"/> | |
| 149 <fbc:geneProduct fbc:id="buc_BU484" fbc:label="buc_BU484" fbc:name="buc_BU484" metaid="fe6e994f-517c-46e2-b215-b328f29e5f5a"/> | |
| 150 <fbc:geneProduct fbc:id="buc_BU242" fbc:label="buc_BU242" fbc:name="buc_BU242" metaid="a9984b09-64db-4b5d-bb2d-fc2444c82353"/> | |
| 151 <fbc:geneProduct fbc:id="buc_BU121" fbc:label="buc_BU121" fbc:name="buc_BU121" metaid="ccd9b42e-21af-45f0-adf1-6caa987e85cc"/> | |
| 152 <fbc:geneProduct fbc:id="buc_BU361" fbc:label="buc_BU361" fbc:name="buc_BU361" metaid="d793389f-5dd6-4c09-b585-8d7fc3213012"/> | |
| 153 <fbc:geneProduct fbc:id="buc_BU362" fbc:label="buc_BU362" fbc:name="buc_BU362" metaid="f9aa60b0-89ca-473a-b96b-08155943de50"/> | |
| 154 <fbc:geneProduct fbc:id="buc_BU246" fbc:label="buc_BU246" fbc:name="buc_BU246" metaid="b05a09d2-bfa4-44e4-b60d-fb27e022f810"/> | |
| 155 <fbc:geneProduct fbc:id="buc_BU367" fbc:label="buc_BU367" fbc:name="buc_BU367" metaid="_59cb9d8b-51ce-48c5-9e4c-16abc5e57142"/> | |
| 156 <fbc:geneProduct fbc:id="buc_BU125" fbc:label="buc_BU125" fbc:name="buc_BU125" metaid="f1fb3089-108e-4e7f-9556-38629a437e48"/> | |
| 157 <fbc:geneProduct fbc:id="buc_BU368" fbc:label="buc_BU368" fbc:name="buc_BU368" metaid="_51542aff-18eb-45ac-8458-b56628fc419c"/> | |
| 158 <fbc:geneProduct fbc:id="buc_BU486" fbc:label="buc_BU486" fbc:name="buc_BU486" metaid="_6879bdef-60c1-4484-a5f0-0614cd51c719"/> | |
| 159 <fbc:geneProduct fbc:id="buc_BU124" fbc:label="buc_BU124" fbc:name="buc_BU124" metaid="_6a57b2ba-9b6b-4e20-ba34-9d078e995160"/> | |
| 160 <fbc:geneProduct fbc:id="buc_BU487" fbc:label="buc_BU487" fbc:name="buc_BU487" metaid="ba6c30ed-f6a9-42bd-99da-a301119ed6a5"/> | |
| 161 <fbc:geneProduct fbc:id="buc_BU366" fbc:label="buc_BU366" fbc:name="buc_BU366" metaid="c1da07c9-cf44-4f1c-8a07-95ba544ee97f"/> | |
| 162 <fbc:geneProduct fbc:id="buc_BU129" fbc:label="buc_BU129" fbc:name="buc_BU129" metaid="cfcf6a77-d143-48ee-9d93-e06a12bf738e"/> | |
| 163 <fbc:geneProduct fbc:id="buc_BU369" fbc:label="buc_BU369" fbc:name="buc_BU369" metaid="_04876ee9-a35c-46ae-a50b-8a198a207929"/> | |
| 164 <fbc:geneProduct fbc:id="buc_BU370" fbc:label="buc_BU370" fbc:name="buc_BU370" metaid="b6027949-919d-4345-88f2-e6e50f32be47"/> | |
| 165 <fbc:geneProduct fbc:id="buc_BU250" fbc:label="buc_BU250" fbc:name="buc_BU250" metaid="_3c9e9166-b157-4815-88d3-a41cb62a8b59"/> | |
| 166 <fbc:geneProduct fbc:id="buc_BU251" fbc:label="buc_BU251" fbc:name="buc_BU251" metaid="f91a8345-737e-4a64-aa94-8622d00d8e51"/> | |
| 167 <fbc:geneProduct fbc:id="buc_BU493" fbc:label="buc_BU493" fbc:name="buc_BU493" metaid="_8fb0bd2f-afca-4387-8959-2a2d793aee59"/> | |
| 168 <fbc:geneProduct fbc:id="buc_BU130" fbc:label="buc_BU130" fbc:name="buc_BU130" metaid="_7a09e314-26d2-4fb8-ab89-b188a42164b9"/> | |
| 169 <fbc:geneProduct fbc:id="buc_BU136" fbc:label="buc_BU136" fbc:name="buc_BU136" metaid="_66d71e53-eced-4bff-ba51-a02f46b4ab49"/> | |
| 170 <fbc:geneProduct fbc:id="buc_BU497" fbc:label="buc_BU497" fbc:name="buc_BU497" metaid="_25b19002-1c12-4400-a1d4-dcebfa6c2c94"/> | |
| 171 <fbc:geneProduct fbc:id="buc_BU135" fbc:label="buc_BU135" fbc:name="buc_BU135" metaid="_2b99fc3a-e65a-400d-8179-7fb1a6f6d5b6"/> | |
| 172 <fbc:geneProduct fbc:id="buc_BU256" fbc:label="buc_BU256" fbc:name="buc_BU256" metaid="ba782391-c506-482d-85f7-a4bc4dea4cd7"/> | |
| 173 <fbc:geneProduct fbc:id="buc_BU381" fbc:label="buc_BU381" fbc:name="buc_BU381" metaid="_8a1e1a18-80b7-4dc3-aa9f-95898a7ad8e4"/> | |
| 174 <fbc:geneProduct fbc:id="buc_BU143" fbc:label="buc_BU143" fbc:name="buc_BU143" metaid="e9b6f1cd-1a00-4d12-a867-703ac47e42c1"/> | |
| 175 <fbc:geneProduct fbc:id="buc_BU265" fbc:label="buc_BU265" fbc:name="buc_BU265" metaid="_2bed9326-77d3-42cf-b5f2-9b822656b49f"/> | |
| 176 <fbc:geneProduct fbc:id="buc_BU144" fbc:label="buc_BU144" fbc:name="buc_BU144" metaid="_0b7f4234-21fb-412e-b5b3-2503c17e53bb"/> | |
| 177 <fbc:geneProduct fbc:id="buc_BU386" fbc:label="buc_BU386" fbc:name="buc_BU386" metaid="_009a1d90-a732-47ea-a126-72204625410e"/> | |
| 178 <fbc:geneProduct fbc:id="buc_BU263" fbc:label="buc_BU263" fbc:name="buc_BU263" metaid="_89ce79c5-4f13-4194-b960-639d350e48c3"/> | |
| 179 <fbc:geneProduct fbc:id="buc_BU142" fbc:label="buc_BU142" fbc:name="buc_BU142" metaid="_23b033da-9f80-4013-9bd6-7fb478853863"/> | |
| 180 <fbc:geneProduct fbc:id="buc_BU268" fbc:label="buc_BU268" fbc:name="buc_BU268" metaid="_9e871cf1-e794-4ccb-9a3c-a73c4aa38df4"/> | |
| 181 <fbc:geneProduct fbc:id="buc_BU147" fbc:label="buc_BU147" fbc:name="buc_BU147" metaid="_81b54523-bdcc-41d9-af38-805edf693a83"/> | |
| 182 <fbc:geneProduct fbc:id="buc_BU026" fbc:label="buc_BU026" fbc:name="buc_BU026" metaid="_627d359d-5958-45b2-9c51-564fc46e1922"/> | |
| 183 <fbc:geneProduct fbc:id="buc_BU269" fbc:label="buc_BU269" fbc:name="buc_BU269" metaid="_90167b66-c0ac-4c79-8eb9-316767e6871d"/> | |
| 184 <fbc:geneProduct fbc:id="buc_BU027" fbc:label="buc_BU027" fbc:name="buc_BU027" metaid="_8370e9c5-0ff0-40b3-ac34-e30e283c7bb8"/> | |
| 185 <fbc:geneProduct fbc:id="buc_BU145" fbc:label="buc_BU145" fbc:name="buc_BU145" metaid="a30d204c-a552-4250-a627-62df51db5154"/> | |
| 186 <fbc:geneProduct fbc:id="buc_BU146" fbc:label="buc_BU146" fbc:name="buc_BU146" metaid="_69b67252-0a28-4d51-9a23-ebb05f8b532c"/> | |
| 187 <fbc:geneProduct fbc:id="buc_BU149" fbc:label="buc_BU149" fbc:name="buc_BU149" metaid="cbe3d172-bea5-4c00-9829-7dc78d96cc30"/> | |
| 188 <fbc:geneProduct fbc:id="buc_BU271" fbc:label="buc_BU271" fbc:name="buc_BU271" metaid="e7e2f771-26cd-4a87-8540-329601dd5656"/> | |
| 189 <fbc:geneProduct fbc:id="buc_BU150" fbc:label="buc_BU150" fbc:name="buc_BU150" metaid="_62a70b50-fa10-4550-a7bb-d25581fc2c6e"/> | |
| 190 <fbc:geneProduct fbc:id="buc_BU392" fbc:label="buc_BU392" fbc:name="buc_BU392" metaid="bc0c34b0-d015-4126-ad81-54e1a7d9bf69"/> | |
| 191 <fbc:geneProduct fbc:id="buc_BU030" fbc:label="buc_BU030" fbc:name="buc_BU030" metaid="_9d333d11-648c-48f5-9bbd-9753cd184c8e"/> | |
| 192 <fbc:geneProduct fbc:id="buc_BU270" fbc:label="buc_BU270" fbc:name="buc_BU270" metaid="_1a95acb4-6393-4999-b6b5-dacbef18d6fc"/> | |
| 193 <fbc:geneProduct fbc:id="buc_BU031" fbc:label="buc_BU031" fbc:name="buc_BU031" metaid="_1220cb2e-2ce0-4f4b-9695-a80bf79f2f43"/> | |
| 194 <fbc:geneProduct fbc:id="buc_BU273" fbc:label="buc_BU273" fbc:name="buc_BU273" metaid="a3f21562-8078-447c-883b-ea70cbb8175a"/> | |
| 195 <fbc:geneProduct fbc:id="buc_BU279" fbc:label="buc_BU279" fbc:name="buc_BU279" metaid="dd45318c-5266-4952-bb9c-eda3b77dc4df"/> | |
| 196 <fbc:geneProduct fbc:id="buc_BU277" fbc:label="buc_BU277" fbc:name="buc_BU277" metaid="_48193662-f618-453a-b702-43f06492305c"/> | |
| 197 <fbc:geneProduct fbc:id="buc_BU278" fbc:label="buc_BU278" fbc:name="buc_BU278" metaid="_73c67e60-cfe1-4ef8-b53e-879e8dbd2cfa"/> | |
| 198 <fbc:geneProduct fbc:id="buc_BU399" fbc:label="buc_BU399" fbc:name="buc_BU399" metaid="bbd39409-548d-41a3-a454-19ac6d3a0c31"/> | |
| 199 <fbc:geneProduct fbc:id="buc_BU280" fbc:label="buc_BU280" fbc:name="buc_BU280" metaid="c9ca22f0-dfff-4b52-9bca-1214940b7091"/> | |
| 200 <fbc:geneProduct fbc:id="buc_BU287" fbc:label="buc_BU287" fbc:name="buc_BU287" metaid="_23f63a19-dd94-49dd-81d0-ab1226750e41"/> | |
| 201 <fbc:geneProduct fbc:id="buc_BU045" fbc:label="buc_BU045" fbc:name="buc_BU045" metaid="_8d3747ee-adb6-47c1-bd8b-a942f601ac88"/> | |
| 202 <fbc:geneProduct fbc:id="buc_BU285" fbc:label="buc_BU285" fbc:name="buc_BU285" metaid="_40ab6cbf-767f-42aa-9602-f6f42b4dc7d2"/> | |
| 203 <fbc:geneProduct fbc:id="buc_BU169" fbc:label="buc_BU169" fbc:name="buc_BU169" metaid="bb1ab25f-09ce-49af-b831-4b4d10ad802a"/> | |
| 204 <fbc:geneProduct fbc:id="buc_BU048" fbc:label="buc_BU048" fbc:name="buc_BU048" metaid="_7f5a3b87-ec30-4f70-9f28-f0d2f01bbc43"/> | |
| 205 <fbc:geneProduct fbc:id="buc_BU049" fbc:label="buc_BU049" fbc:name="buc_BU049" metaid="b6520c3a-80f5-4e5a-99a9-0756ff818d75"/> | |
| 206 <fbc:geneProduct fbc:id="buc_BU046" fbc:label="buc_BU046" fbc:name="buc_BU046" metaid="_5c52823f-72c5-4655-b535-5391d76a2213"/> | |
| 207 <fbc:geneProduct fbc:id="buc_BU167" fbc:label="buc_BU167" fbc:name="buc_BU167" metaid="_74513703-bb8c-45bc-b201-c348b69c38e1"/> | |
| 208 <fbc:geneProduct fbc:id="buc_BU288" fbc:label="buc_BU288" fbc:name="buc_BU288" metaid="aa97b131-6bb3-4c0a-96c2-e74a16fed69a"/> | |
| 209 <fbc:geneProduct fbc:id="buc_BU289" fbc:label="buc_BU289" fbc:name="buc_BU289" metaid="c00e7eef-ecea-4e7c-8a93-e9d755739a34"/> | |
| 210 <fbc:geneProduct fbc:id="buc_BU047" fbc:label="buc_BU047" fbc:name="buc_BU047" metaid="_623e68a6-4d11-4a85-a1e2-0358e6d0c5b8"/> | |
| 211 <fbc:geneProduct fbc:id="buc_BU602" fbc:label="buc_BU602" fbc:name="buc_BU602" metaid="_2f0dd0dc-8f43-45cc-ba9b-1716297b8806"/> | |
| 212 <fbc:geneProduct fbc:id="buc_BU600" fbc:label="buc_BU600" fbc:name="buc_BU600" metaid="b6268f10-fcdb-4dd5-b56c-72a6d9c210a4"/> | |
| 213 </fbc:listOfGeneProducts> | |
| 214 <groups:listOfGroups> | |
| 215 <groups:group groups:id="buc00230" groups:kind="classification" groups:name="Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 216 <groups:listOfMembers> | |
| 217 <groups:member groups:idRef="R00529"/> | |
| 218 <groups:member groups:idRef="R00509"/> | |
| 219 <groups:member groups:idRef="R01135"/> | |
| 220 <groups:member groups:idRef="R02147"/> | |
| 221 <groups:member groups:idRef="R00125"/> | |
| 222 <groups:member groups:idRef="R00127"/> | |
| 223 <groups:member groups:idRef="R02748"/> | |
| 224 <groups:member groups:idRef="R01083"/> | |
| 225 <groups:member groups:idRef="R02297"/> | |
| 226 <groups:member groups:idRef="R01561"/> | |
| 227 <groups:member groups:idRef="R02090"/> | |
| 228 <groups:member groups:idRef="R01969"/> | |
| 229 <groups:member groups:idRef="R00332"/> | |
| 230 <groups:member groups:idRef="R04559"/> | |
| 231 <groups:member groups:idRef="R01049"/> | |
| 232 <groups:member groups:idRef="R01863"/> | |
| 233 <groups:member groups:idRef="R02557"/> | |
| 234 <groups:member groups:idRef="R01127"/> | |
| 235 <groups:member groups:idRef="R02017"/> | |
| 236 <groups:member groups:idRef="R02019"/> | |
| 237 <groups:member groups:idRef="R01547"/> | |
| 238 <groups:member groups:idRef="R01229"/> | |
| 239 <groups:member groups:idRef="R02142"/> | |
| 240 <groups:member groups:idRef="R04560"/> | |
| 241 <groups:member groups:idRef="R01132"/> | |
| 242 <groups:member groups:idRef="R12852"/> | |
| 243 <groups:member groups:idRef="R12851"/> | |
| 244 <groups:member groups:idRef="R01134"/> | |
| 245 <groups:member groups:idRef="R01057"/> | |
| 246 </groups:listOfMembers> | |
| 247 </groups:group> | |
| 248 <groups:group groups:id="buc00670" groups:kind="classification" groups:name="One carbon pool by folate - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 249 <groups:listOfMembers> | |
| 250 <groups:member groups:idRef="R00945"/> | |
| 251 <groups:member groups:idRef="R00936"/> | |
| 252 <groups:member groups:idRef="R00937"/> | |
| 253 <groups:member groups:idRef="R00939"/> | |
| 254 <groups:member groups:idRef="R02236"/> | |
| 255 <groups:member groups:idRef="R03940"/> | |
| 256 <groups:member groups:idRef="R02235"/> | |
| 257 <groups:member groups:idRef="R01655"/> | |
| 258 <groups:member groups:idRef="R00940"/> | |
| 259 <groups:member groups:idRef="R07168"/> | |
| 260 <groups:member groups:idRef="R04560"/> | |
| 261 <groups:member groups:idRef="R01220"/> | |
| 262 <groups:member groups:idRef="R02101"/> | |
| 263 </groups:listOfMembers> | |
| 264 </groups:group> | |
| 265 <groups:group groups:id="buc00790" groups:kind="classification" groups:name="Folate biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 266 <groups:listOfMembers> | |
| 267 <groups:member groups:idRef="R00936"/> | |
| 268 <groups:member groups:idRef="R11765"/> | |
| 269 <groups:member groups:idRef="R04241"/> | |
| 270 <groups:member groups:idRef="R00937"/> | |
| 271 <groups:member groups:idRef="R00939"/> | |
| 272 <groups:member groups:idRef="R02236"/> | |
| 273 <groups:member groups:idRef="R02235"/> | |
| 274 <groups:member groups:idRef="R02237"/> | |
| 275 <groups:member groups:idRef="R00940"/> | |
| 276 <groups:member groups:idRef="R00942"/> | |
| 277 <groups:member groups:idRef="R00425"/> | |
| 278 </groups:listOfMembers> | |
| 279 </groups:group> | |
| 280 <groups:group groups:id="buc01120" groups:kind="classification" groups:name="Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 281 <groups:listOfMembers> | |
| 282 <groups:member groups:idRef="R00209"/> | |
| 283 <groups:member groups:idRef="R00529"/> | |
| 284 <groups:member groups:idRef="R00200"/> | |
| 285 <groups:member groups:idRef="R01773"/> | |
| 286 <groups:member groups:idRef="R01015"/> | |
| 287 <groups:member groups:idRef="R00762"/> | |
| 288 <groups:member groups:idRef="R01775"/> | |
| 289 <groups:member groups:idRef="R01655"/> | |
| 290 <groups:member groups:idRef="R00206"/> | |
| 291 <groups:member groups:idRef="R01061"/> | |
| 292 <groups:member groups:idRef="R02073"/> | |
| 293 <groups:member groups:idRef="R07168"/> | |
| 294 <groups:member groups:idRef="R01063"/> | |
| 295 <groups:member groups:idRef="R03321"/> | |
| 296 <groups:member groups:idRef="R01220"/> | |
| 297 <groups:member groups:idRef="R00451"/> | |
| 298 <groups:member groups:idRef="R01067"/> | |
| 299 <groups:member groups:idRef="R02035"/> | |
| 300 <groups:member groups:idRef="R01068"/> | |
| 301 <groups:member groups:idRef="R04173"/> | |
| 302 <groups:member groups:idRef="R01528"/> | |
| 303 <groups:member groups:idRef="R02739"/> | |
| 304 <groups:member groups:idRef="R01529"/> | |
| 305 <groups:member groups:idRef="R01641"/> | |
| 306 <groups:member groups:idRef="R01049"/> | |
| 307 <groups:member groups:idRef="R02735"/> | |
| 308 <groups:member groups:idRef="R05805"/> | |
| 309 <groups:member groups:idRef="R00315"/> | |
| 310 <groups:member groups:idRef="R02734"/> | |
| 311 <groups:member groups:idRef="R00756"/> | |
| 312 <groups:member groups:idRef="R03947"/> | |
| 313 <groups:member groups:idRef="R02736"/> | |
| 314 <groups:member groups:idRef="R02021"/> | |
| 315 <groups:member groups:idRef="R00480"/> | |
| 316 <groups:member groups:idRef="R00084"/> | |
| 317 <groups:member groups:idRef="R05578"/> | |
| 318 <groups:member groups:idRef="R02740"/> | |
| 319 <groups:member groups:idRef="R01056"/> | |
| 320 <groups:member groups:idRef="R01771"/> | |
| 321 <groups:member groups:idRef="R04365"/> | |
| 322 <groups:member groups:idRef="R09099"/> | |
| 323 <groups:member groups:idRef="R03194"/> | |
| 324 <groups:member groups:idRef="R00945"/> | |
| 325 <groups:member groups:idRef="R01518"/> | |
| 326 <groups:member groups:idRef="R00508"/> | |
| 327 <groups:member groups:idRef="R00509"/> | |
| 328 <groups:member groups:idRef="R00586"/> | |
| 329 <groups:member groups:idRef="R00861"/> | |
| 330 <groups:member groups:idRef="R01830"/> | |
| 331 <groups:member groups:idRef="R02568"/> | |
| 332 <groups:member groups:idRef="R01512"/> | |
| 333 <groups:member groups:idRef="R08549"/> | |
| 334 <groups:member groups:idRef="R04198"/> | |
| 335 <groups:member groups:idRef="R10866"/> | |
| 336 <groups:member groups:idRef="R04199"/> | |
| 337 <groups:member groups:idRef="R10146"/> | |
| 338 <groups:member groups:idRef="R00230"/> | |
| 339 <groups:member groups:idRef="R10147"/> | |
| 340 <groups:member groups:idRef="R10221"/> | |
| 341 <groups:member groups:idRef="R04475"/> | |
| 342 <groups:member groups:idRef="R00199"/> | |
| 343 <groups:member groups:idRef="R10907"/> | |
| 344 <groups:member groups:idRef="R09084"/> | |
| 345 <groups:member groups:idRef="R02291"/> | |
| 346 <groups:member groups:idRef="R00858"/> | |
| 347 <groups:member groups:idRef="R01827"/> | |
| 348 <groups:member groups:idRef="R00859"/> | |
| 349 <groups:member groups:idRef="R01829"/> | |
| 350 <groups:member groups:idRef="R00530"/> | |
| 351 <groups:member groups:idRef="R00212"/> | |
| 352 <groups:member groups:idRef="R04779"/> | |
| 353 <groups:member groups:idRef="R01224"/> | |
| 354 <groups:member groups:idRef="R01466"/> | |
| 355 <groups:member groups:idRef="R00897"/> | |
| 356 <groups:member groups:idRef="R00658"/> | |
| 357 <groups:member groups:idRef="R01196"/> | |
| 358 <groups:member groups:idRef="R04780"/> | |
| 359 <groups:member groups:idRef="R01197"/> | |
| 360 <groups:member groups:idRef="R01070"/> | |
| 361 </groups:listOfMembers> | |
| 362 </groups:group> | |
| 363 <groups:group groups:id="buc00470" groups:kind="classification" groups:name="D-Amino acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 364 <groups:listOfMembers> | |
| 365 <groups:member groups:idRef="R00260"/> | |
| 366 <groups:member groups:idRef="R00451"/> | |
| 367 <groups:member groups:idRef="R02783"/> | |
| 368 <groups:member groups:idRef="R02735"/> | |
| 369 </groups:listOfMembers> | |
| 370 </groups:group> | |
| 371 <groups:group groups:id="buc01240" groups:kind="classification" groups:name="Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 372 <groups:listOfMembers> | |
| 373 <groups:member groups:idRef="R01135"/> | |
| 374 <groups:member groups:idRef="R01655"/> | |
| 375 <groups:member groups:idRef="R02864"/> | |
| 376 <groups:member groups:idRef="R00127"/> | |
| 377 <groups:member groups:idRef="R01218"/> | |
| 378 <groups:member groups:idRef="R00965"/> | |
| 379 <groups:member groups:idRef="R12428"/> | |
| 380 <groups:member groups:idRef="R12427"/> | |
| 381 <groups:member groups:idRef="R00130"/> | |
| 382 <groups:member groups:idRef="R12424"/> | |
| 383 <groups:member groups:idRef="R02473"/> | |
| 384 <groups:member groups:idRef="R01220"/> | |
| 385 <groups:member groups:idRef="R12423"/> | |
| 386 <groups:member groups:idRef="R00571"/> | |
| 387 <groups:member groups:idRef="R10122"/> | |
| 388 <groups:member groups:idRef="R00177"/> | |
| 389 <groups:member groups:idRef="R00573"/> | |
| 390 <groups:member groups:idRef="R07281"/> | |
| 391 <groups:member groups:idRef="R10120"/> | |
| 392 <groups:member groups:idRef="R00158"/> | |
| 393 <groups:member groups:idRef="R01724"/> | |
| 394 <groups:member groups:idRef="R03947"/> | |
| 395 <groups:member groups:idRef="R12934"/> | |
| 396 <groups:member groups:idRef="R10118"/> | |
| 397 <groups:member groups:idRef="R00161"/> | |
| 398 <groups:member groups:idRef="R00084"/> | |
| 399 <groups:member groups:idRef="R10115"/> | |
| 400 <groups:member groups:idRef="R03231"/> | |
| 401 <groups:member groups:idRef="R04241"/> | |
| 402 <groups:member groups:idRef="R10116"/> | |
| 403 <groups:member groups:idRef="R03035"/> | |
| 404 <groups:member groups:idRef="R05578"/> | |
| 405 <groups:member groups:idRef="R03194"/> | |
| 406 <groups:member groups:idRef="R10119"/> | |
| 407 <groups:member groups:idRef="R00549"/> | |
| 408 <groups:member groups:idRef="R00945"/> | |
| 409 <groups:member groups:idRef="R00189"/> | |
| 410 <groups:member groups:idRef="R01993"/> | |
| 411 <groups:member groups:idRef="R03459"/> | |
| 412 <groups:member groups:idRef="R03458"/> | |
| 413 <groups:member groups:idRef="R00104"/> | |
| 414 <groups:member groups:idRef="R00940"/> | |
| 415 <groups:member groups:idRef="R00425"/> | |
| 416 <groups:member groups:idRef="R00942"/> | |
| 417 <groups:member groups:idRef="R07618"/> | |
| 418 <groups:member groups:idRef="R01083"/> | |
| 419 <groups:member groups:idRef="R05085"/> | |
| 420 <groups:member groups:idRef="R07460"/> | |
| 421 <groups:member groups:idRef="R03182"/> | |
| 422 <groups:member groups:idRef="R01869"/> | |
| 423 <groups:member groups:idRef="R00936"/> | |
| 424 <groups:member groups:idRef="R00617"/> | |
| 425 <groups:member groups:idRef="R00937"/> | |
| 426 <groups:member groups:idRef="R00939"/> | |
| 427 <groups:member groups:idRef="R02236"/> | |
| 428 <groups:member groups:idRef="R00497"/> | |
| 429 <groups:member groups:idRef="R00894"/> | |
| 430 <groups:member groups:idRef="R03005"/> | |
| 431 <groups:member groups:idRef="R02235"/> | |
| 432 <groups:member groups:idRef="R00333"/> | |
| 433 <groups:member groups:idRef="R00575"/> | |
| 434 <groups:member groups:idRef="R04457"/> | |
| 435 <groups:member groups:idRef="R00257"/> | |
| 436 <groups:member groups:idRef="R01226"/> | |
| 437 <groups:member groups:idRef="R02237"/> | |
| 438 <groups:member groups:idRef="R01867"/> | |
| 439 <groups:member groups:idRef="R01868"/> | |
| 440 <groups:member groups:idRef="R07411"/> | |
| 441 <groups:member groups:idRef="R10699"/> | |
| 442 <groups:member groups:idRef="R00066"/> | |
| 443 <groups:member groups:idRef="R01078"/> | |
| 444 <groups:member groups:idRef="R01397"/> | |
| 445 <groups:member groups:idRef="R01870"/> | |
| 446 </groups:listOfMembers> | |
| 447 </groups:group> | |
| 448 <groups:group groups:id="buc00030" groups:kind="classification" groups:name="Pentose phosphate pathway - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 449 <groups:listOfMembers> | |
| 450 <groups:member groups:idRef="R02739"/> | |
| 451 <groups:member groups:idRef="R01528"/> | |
| 452 <groups:member groups:idRef="R02749"/> | |
| 453 <groups:member groups:idRef="R01529"/> | |
| 454 <groups:member groups:idRef="R01827"/> | |
| 455 <groups:member groups:idRef="R01641"/> | |
| 456 <groups:member groups:idRef="R04779"/> | |
| 457 <groups:member groups:idRef="R01049"/> | |
| 458 <groups:member groups:idRef="R01830"/> | |
| 459 <groups:member groups:idRef="R02736"/> | |
| 460 <groups:member groups:idRef="R01056"/> | |
| 461 <groups:member groups:idRef="R02740"/> | |
| 462 <groups:member groups:idRef="R10221"/> | |
| 463 <groups:member groups:idRef="R01057"/> | |
| 464 <groups:member groups:idRef="R02035"/> | |
| 465 <groups:member groups:idRef="R10907"/> | |
| 466 <groups:member groups:idRef="R01070"/> | |
| 467 </groups:listOfMembers> | |
| 468 </groups:group> | |
| 469 <groups:group groups:id="buc00270" groups:kind="classification" groups:name="Cysteine and methionine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 470 <groups:listOfMembers> | |
| 471 <groups:member groups:idRef="R00178"/> | |
| 472 <groups:member groups:idRef="R01773"/> | |
| 473 <groups:member groups:idRef="R04405"/> | |
| 474 <groups:member groups:idRef="R00586"/> | |
| 475 <groups:member groups:idRef="R01401"/> | |
| 476 <groups:member groups:idRef="R01775"/> | |
| 477 <groups:member groups:idRef="R01920"/> | |
| 478 <groups:member groups:idRef="R00897"/> | |
| 479 <groups:member groups:idRef="R00194"/> | |
| 480 <groups:member groups:idRef="R00480"/> | |
| 481 <groups:member groups:idRef="R10993"/> | |
| 482 <groups:member groups:idRef="R10994"/> | |
| 483 <groups:member groups:idRef="R00177"/> | |
| 484 <groups:member groups:idRef="R04173"/> | |
| 485 <groups:member groups:idRef="R07274"/> | |
| 486 <groups:member groups:idRef="R02291"/> | |
| 487 </groups:listOfMembers> | |
| 488 </groups:group> | |
| 489 <groups:group groups:id="buc00500" groups:kind="classification" groups:name="Starch and sucrose metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 490 <groups:listOfMembers> | |
| 491 <groups:member groups:idRef="R04111"/> | |
| 492 <groups:member groups:idRef="R02780"/> | |
| 493 <groups:member groups:idRef="R00771"/> | |
| 494 </groups:listOfMembers> | |
| 495 </groups:group> | |
| 496 <groups:group groups:id="buc00620" groups:kind="classification" groups:name="Pyruvate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 497 <groups:listOfMembers> | |
| 498 <groups:member groups:idRef="R02320"/> | |
| 499 <groups:member groups:idRef="R00230"/> | |
| 500 <groups:member groups:idRef="R00200"/> | |
| 501 <groups:member groups:idRef="R01213"/> | |
| 502 <groups:member groups:idRef="R00014"/> | |
| 503 <groups:member groups:idRef="R02569"/> | |
| 504 <groups:member groups:idRef="R00315"/> | |
| 505 <groups:member groups:idRef="R03270"/> | |
| 506 <groups:member groups:idRef="R01736"/> | |
| 507 <groups:member groups:idRef="R07618"/> | |
| 508 </groups:listOfMembers> | |
| 509 </groups:group> | |
| 510 <groups:group groups:id="buc00785" groups:kind="classification" groups:name="Lipoic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 511 <groups:listOfMembers> | |
| 512 <groups:member groups:idRef="R12428"/> | |
| 513 <groups:member groups:idRef="R12427"/> | |
| 514 <groups:member groups:idRef="R12424"/> | |
| 515 <groups:member groups:idRef="R12423"/> | |
| 516 </groups:listOfMembers> | |
| 517 </groups:group> | |
| 518 <groups:group groups:id="buc00300" groups:kind="classification" groups:name="Lysine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 519 <groups:listOfMembers> | |
| 520 <groups:member groups:idRef="R01773"/> | |
| 521 <groups:member groups:idRef="R01775"/> | |
| 522 <groups:member groups:idRef="R02788"/> | |
| 523 <groups:member groups:idRef="R04617"/> | |
| 524 <groups:member groups:idRef="R02735"/> | |
| 525 <groups:member groups:idRef="R02734"/> | |
| 526 <groups:member groups:idRef="R04198"/> | |
| 527 <groups:member groups:idRef="R04199"/> | |
| 528 <groups:member groups:idRef="R00480"/> | |
| 529 <groups:member groups:idRef="R10147"/> | |
| 530 <groups:member groups:idRef="R04365"/> | |
| 531 <groups:member groups:idRef="R04475"/> | |
| 532 <groups:member groups:idRef="R00451"/> | |
| 533 <groups:member groups:idRef="R02291"/> | |
| 534 </groups:listOfMembers> | |
| 535 </groups:group> | |
| 536 <groups:group groups:id="buc00740" groups:kind="classification" groups:name="Riboflavin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 537 <groups:listOfMembers> | |
| 538 <groups:member groups:idRef="R00549"/> | |
| 539 <groups:member groups:idRef="R00161"/> | |
| 540 <groups:member groups:idRef="R00066"/> | |
| 541 <groups:member groups:idRef="R07281"/> | |
| 542 <groups:member groups:idRef="R04457"/> | |
| 543 <groups:member groups:idRef="R03459"/> | |
| 544 <groups:member groups:idRef="R03458"/> | |
| 545 <groups:member groups:idRef="R00425"/> | |
| 546 </groups:listOfMembers> | |
| 547 </groups:group> | |
| 548 <groups:group groups:id="buc00860" groups:kind="classification" groups:name="Porphyrin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 549 <groups:listOfMembers> | |
| 550 <groups:member groups:idRef="R07411"/> | |
| 551 <groups:member groups:idRef="R00084"/> | |
| 552 <groups:member groups:idRef="R05578"/> | |
| 553 <groups:member groups:idRef="R02864"/> | |
| 554 <groups:member groups:idRef="R03947"/> | |
| 555 <groups:member groups:idRef="R03194"/> | |
| 556 </groups:listOfMembers> | |
| 557 </groups:group> | |
| 558 <groups:group groups:id="buc00540" groups:kind="classification" groups:name="Lipopolysaccharide biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 559 <groups:listOfMembers> | |
| 560 <groups:member groups:idRef="R09769"/> | |
| 561 <groups:member groups:idRef="R05645"/> | |
| 562 </groups:listOfMembers> | |
| 563 </groups:group> | |
| 564 <groups:group groups:id="buc00220" groups:kind="classification" groups:name="Arginine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 565 <groups:listOfMembers> | |
| 566 <groups:member groups:idRef="R02283"/> | |
| 567 <groups:member groups:idRef="R09107"/> | |
| 568 <groups:member groups:idRef="R01086"/> | |
| 569 <groups:member groups:idRef="R03443"/> | |
| 570 <groups:member groups:idRef="R01398"/> | |
| 571 <groups:member groups:idRef="R00259"/> | |
| 572 <groups:member groups:idRef="R01954"/> | |
| 573 <groups:member groups:idRef="R02649"/> | |
| 574 <groups:member groups:idRef="R00669"/> | |
| 575 </groups:listOfMembers> | |
| 576 </groups:group> | |
| 577 <groups:group groups:id="buc00660" groups:kind="classification" groups:name="C5-Branched dibasic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 578 <groups:listOfMembers> | |
| 579 <groups:member groups:idRef="R03896"/> | |
| 580 <groups:member groups:idRef="R00994"/> | |
| 581 <groups:member groups:idRef="R03898"/> | |
| 582 <groups:member groups:idRef="R00226"/> | |
| 583 </groups:listOfMembers> | |
| 584 </groups:group> | |
| 585 <groups:group groups:id="buc01232" groups:kind="classification" groups:name="Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 586 <groups:listOfMembers> | |
| 587 <groups:member groups:idRef="R01135"/> | |
| 588 <groups:member groups:idRef="R02147"/> | |
| 589 <groups:member groups:idRef="R02325"/> | |
| 590 <groups:member groups:idRef="R00127"/> | |
| 591 <groups:member groups:idRef="R02748"/> | |
| 592 <groups:member groups:idRef="R01083"/> | |
| 593 <groups:member groups:idRef="R02098"/> | |
| 594 <groups:member groups:idRef="R01561"/> | |
| 595 <groups:member groups:idRef="R02297"/> | |
| 596 <groups:member groups:idRef="R00571"/> | |
| 597 <groups:member groups:idRef="R00573"/> | |
| 598 <groups:member groups:idRef="R02090"/> | |
| 599 <groups:member groups:idRef="R02094"/> | |
| 600 <groups:member groups:idRef="R01969"/> | |
| 601 <groups:member groups:idRef="R00332"/> | |
| 602 <groups:member groups:idRef="R00333"/> | |
| 603 <groups:member groups:idRef="R02557"/> | |
| 604 <groups:member groups:idRef="R01863"/> | |
| 605 <groups:member groups:idRef="R00158"/> | |
| 606 <groups:member groups:idRef="R02018"/> | |
| 607 <groups:member groups:idRef="R02017"/> | |
| 608 <groups:member groups:idRef="R06613"/> | |
| 609 <groups:member groups:idRef="R01547"/> | |
| 610 <groups:member groups:idRef="R02019"/> | |
| 611 <groups:member groups:idRef="R01229"/> | |
| 612 <groups:member groups:idRef="R02142"/> | |
| 613 <groups:member groups:idRef="R02100"/> | |
| 614 <groups:member groups:idRef="R01132"/> | |
| 615 <groups:member groups:idRef="R01134"/> | |
| 616 <groups:member groups:idRef="R02024"/> | |
| 617 <groups:member groups:idRef="R02101"/> | |
| 618 </groups:listOfMembers> | |
| 619 </groups:group> | |
| 620 <groups:group groups:id="buc00900" groups:kind="classification" groups:name="Terpenoid backbone biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 621 <groups:listOfMembers> | |
| 622 <groups:member groups:idRef="R08689"/> | |
| 623 <groups:member groups:idRef="R06447"/> | |
| 624 <groups:member groups:idRef="R05688"/> | |
| 625 <groups:member groups:idRef="R05633"/> | |
| 626 <groups:member groups:idRef="R02003"/> | |
| 627 <groups:member groups:idRef="R05884"/> | |
| 628 <groups:member groups:idRef="R05636"/> | |
| 629 <groups:member groups:idRef="R05637"/> | |
| 630 <groups:member groups:idRef="R05634"/> | |
| 631 <groups:member groups:idRef="R08210"/> | |
| 632 <groups:member groups:idRef="R10859"/> | |
| 633 <groups:member groups:idRef="R01658"/> | |
| 634 </groups:listOfMembers> | |
| 635 </groups:group> | |
| 636 <groups:group groups:id="buc00240" groups:kind="classification" groups:name="Pyrimidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 637 <groups:listOfMembers> | |
| 638 <groups:member groups:idRef="R01993"/> | |
| 639 <groups:member groups:idRef="R00575"/> | |
| 640 <groups:member groups:idRef="R02018"/> | |
| 641 <groups:member groups:idRef="R00158"/> | |
| 642 <groups:member groups:idRef="R02325"/> | |
| 643 <groups:member groups:idRef="R00965"/> | |
| 644 <groups:member groups:idRef="R01868"/> | |
| 645 <groups:member groups:idRef="R02098"/> | |
| 646 <groups:member groups:idRef="R02100"/> | |
| 647 <groups:member groups:idRef="R00571"/> | |
| 648 <groups:member groups:idRef="R01397"/> | |
| 649 <groups:member groups:idRef="R01870"/> | |
| 650 <groups:member groups:idRef="R00573"/> | |
| 651 <groups:member groups:idRef="R02024"/> | |
| 652 <groups:member groups:idRef="R02101"/> | |
| 653 <groups:member groups:idRef="R02094"/> | |
| 654 </groups:listOfMembers> | |
| 655 </groups:group> | |
| 656 <groups:group groups:id="buc00680" groups:kind="classification" groups:name="Methane metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 657 <groups:listOfMembers> | |
| 658 <groups:member groups:idRef="R00945"/> | |
| 659 <groups:member groups:idRef="R01518"/> | |
| 660 <groups:member groups:idRef="R00230"/> | |
| 661 <groups:member groups:idRef="R01068"/> | |
| 662 <groups:member groups:idRef="R09099"/> | |
| 663 <groups:member groups:idRef="R04173"/> | |
| 664 <groups:member groups:idRef="R00315"/> | |
| 665 <groups:member groups:idRef="R00756"/> | |
| 666 <groups:member groups:idRef="R00658"/> | |
| 667 </groups:listOfMembers> | |
| 668 </groups:group> | |
| 669 <groups:group groups:id="buc00480" groups:kind="classification" groups:name="Glutathione metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 670 <groups:listOfMembers> | |
| 671 <groups:member groups:idRef="R01528"/> | |
| 672 <groups:member groups:idRef="R08359"/> | |
| 673 <groups:member groups:idRef="R04951"/> | |
| 674 <groups:member groups:idRef="R00497"/> | |
| 675 <groups:member groups:idRef="R00894"/> | |
| 676 <groups:member groups:idRef="R01920"/> | |
| 677 <groups:member groups:idRef="R00899"/> | |
| 678 <groups:member groups:idRef="R02736"/> | |
| 679 </groups:listOfMembers> | |
| 680 </groups:group> | |
| 681 <groups:group groups:id="buc01250" groups:kind="classification" groups:name="Biosynthesis of nucleotide sugars - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 682 <groups:listOfMembers> | |
| 683 <groups:member groups:idRef="R05332"/> | |
| 684 <groups:member groups:idRef="R09769"/> | |
| 685 <groups:member groups:idRef="R02740"/> | |
| 686 <groups:member groups:idRef="R00660"/> | |
| 687 <groups:member groups:idRef="R05645"/> | |
| 688 <groups:member groups:idRef="R03192"/> | |
| 689 <groups:member groups:idRef="R00416"/> | |
| 690 <groups:member groups:idRef="R00768"/> | |
| 691 <groups:member groups:idRef="R02060"/> | |
| 692 </groups:listOfMembers> | |
| 693 </groups:group> | |
| 694 <groups:group groups:id="buc00280" groups:kind="classification" groups:name="Valine, leucine and isoleucine degradation - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 695 <groups:listOfMembers> | |
| 696 <groups:member groups:idRef="R07618"/> | |
| 697 </groups:listOfMembers> | |
| 698 </groups:group> | |
| 699 <groups:group groups:id="buc00630" groups:kind="classification" groups:name="Glyoxylate and dicarboxylate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 700 <groups:listOfMembers> | |
| 701 <groups:member groups:idRef="R00945"/> | |
| 702 <groups:member groups:idRef="R01221"/> | |
| 703 </groups:listOfMembers> | |
| 704 </groups:group> | |
| 705 <groups:group groups:id="buc00552" groups:kind="classification" groups:name="Teichoic acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 706 <groups:listOfMembers> | |
| 707 <groups:member groups:idRef="R05627"/> | |
| 708 </groups:listOfMembers> | |
| 709 </groups:group> | |
| 710 <groups:group groups:id="buc00750" groups:kind="classification" groups:name="Vitamin B6 metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 711 <groups:listOfMembers> | |
| 712 <groups:member groups:idRef="R05085"/> | |
| 713 <groups:member groups:idRef="R05086"/> | |
| 714 </groups:listOfMembers> | |
| 715 </groups:group> | |
| 716 <groups:group groups:id="buc00430" groups:kind="classification" groups:name="Taurine and hypotaurine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 717 <groups:listOfMembers> | |
| 718 <groups:member groups:idRef="R00230"/> | |
| 719 <groups:member groups:idRef="R00315"/> | |
| 720 </groups:listOfMembers> | |
| 721 </groups:group> | |
| 722 <groups:group groups:id="buc01200" groups:kind="classification" groups:name="Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 723 <groups:listOfMembers> | |
| 724 <groups:member groups:idRef="R00945"/> | |
| 725 <groups:member groups:idRef="R01518"/> | |
| 726 <groups:member groups:idRef="R00209"/> | |
| 727 <groups:member groups:idRef="R00200"/> | |
| 728 <groups:member groups:idRef="R01015"/> | |
| 729 <groups:member groups:idRef="R00586"/> | |
| 730 <groups:member groups:idRef="R01830"/> | |
| 731 <groups:member groups:idRef="R01512"/> | |
| 732 <groups:member groups:idRef="R01655"/> | |
| 733 <groups:member groups:idRef="R08549"/> | |
| 734 <groups:member groups:idRef="R01061"/> | |
| 735 <groups:member groups:idRef="R07168"/> | |
| 736 <groups:member groups:idRef="R01063"/> | |
| 737 <groups:member groups:idRef="R01220"/> | |
| 738 <groups:member groups:idRef="R00230"/> | |
| 739 <groups:member groups:idRef="R10221"/> | |
| 740 <groups:member groups:idRef="R01221"/> | |
| 741 <groups:member groups:idRef="R01067"/> | |
| 742 <groups:member groups:idRef="R02035"/> | |
| 743 <groups:member groups:idRef="R01068"/> | |
| 744 <groups:member groups:idRef="R10907"/> | |
| 745 <groups:member groups:idRef="R04173"/> | |
| 746 <groups:member groups:idRef="R01528"/> | |
| 747 <groups:member groups:idRef="R01529"/> | |
| 748 <groups:member groups:idRef="R01827"/> | |
| 749 <groups:member groups:idRef="R01829"/> | |
| 750 <groups:member groups:idRef="R01641"/> | |
| 751 <groups:member groups:idRef="R01049"/> | |
| 752 <groups:member groups:idRef="R00897"/> | |
| 753 <groups:member groups:idRef="R00315"/> | |
| 754 <groups:member groups:idRef="R02736"/> | |
| 755 <groups:member groups:idRef="R00658"/> | |
| 756 <groups:member groups:idRef="R02740"/> | |
| 757 <groups:member groups:idRef="R01056"/> | |
| 758 </groups:listOfMembers> | |
| 759 </groups:group> | |
| 760 <groups:group groups:id="buc00550" groups:kind="classification" groups:name="Peptidoglycan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 761 <groups:listOfMembers> | |
| 762 <groups:member groups:idRef="R02788"/> | |
| 763 <groups:member groups:idRef="R04617"/> | |
| 764 <groups:member groups:idRef="R05629"/> | |
| 765 <groups:member groups:idRef="R05627"/> | |
| 766 <groups:member groups:idRef="R05662"/> | |
| 767 <groups:member groups:idRef="R04573"/> | |
| 768 <groups:member groups:idRef="R05032"/> | |
| 769 <groups:member groups:idRef="R06447"/> | |
| 770 <groups:member groups:idRef="R05630"/> | |
| 771 <groups:member groups:idRef="R00660"/> | |
| 772 <groups:member groups:idRef="R02783"/> | |
| 773 <groups:member groups:idRef="R03192"/> | |
| 774 <groups:member groups:idRef="R03191"/> | |
| 775 <groups:member groups:idRef="R03193"/> | |
| 776 </groups:listOfMembers> | |
| 777 </groups:group> | |
| 778 <groups:group groups:id="buc00999" groups:kind="classification" groups:name="Biosynthesis of various plant secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 779 <groups:listOfMembers> | |
| 780 <groups:member groups:idRef="R12885"/> | |
| 781 <groups:member groups:idRef="R00177"/> | |
| 782 </groups:listOfMembers> | |
| 783 </groups:group> | |
| 784 <groups:group groups:id="buc00450" groups:kind="classification" groups:name="Selenocompound metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 785 <groups:listOfMembers> | |
| 786 <groups:member groups:idRef="R04929"/> | |
| 787 <groups:member groups:idRef="R03596"/> | |
| 788 <groups:member groups:idRef="R04773"/> | |
| 789 <groups:member groups:idRef="R09365"/> | |
| 790 <groups:member groups:idRef="R09372"/> | |
| 791 </groups:listOfMembers> | |
| 792 </groups:group> | |
| 793 <groups:group groups:id="buc00010" groups:kind="classification" groups:name="Glycolysis / Gluconeogenesis - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 794 <groups:listOfMembers> | |
| 795 <groups:member groups:idRef="R02739"/> | |
| 796 <groups:member groups:idRef="R01518"/> | |
| 797 <groups:member groups:idRef="R02738"/> | |
| 798 <groups:member groups:idRef="R00200"/> | |
| 799 <groups:member groups:idRef="R00014"/> | |
| 800 <groups:member groups:idRef="R01015"/> | |
| 801 <groups:member groups:idRef="R04779"/> | |
| 802 <groups:member groups:idRef="R01512"/> | |
| 803 <groups:member groups:idRef="R02569"/> | |
| 804 <groups:member groups:idRef="R00658"/> | |
| 805 <groups:member groups:idRef="R07618"/> | |
| 806 <groups:member groups:idRef="R01061"/> | |
| 807 <groups:member groups:idRef="R04394"/> | |
| 808 <groups:member groups:idRef="R05132"/> | |
| 809 <groups:member groups:idRef="R03321"/> | |
| 810 <groups:member groups:idRef="R02740"/> | |
| 811 <groups:member groups:idRef="R01070"/> | |
| 812 <groups:member groups:idRef="R03270"/> | |
| 813 </groups:listOfMembers> | |
| 814 </groups:group> | |
| 815 <groups:group groups:id="buc00051" groups:kind="classification" groups:name="Fructose and mannose metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 816 <groups:listOfMembers> | |
| 817 <groups:member groups:idRef="R04779"/> | |
| 818 <groups:member groups:idRef="R01015"/> | |
| 819 <groups:member groups:idRef="R02568"/> | |
| 820 <groups:member groups:idRef="R02704"/> | |
| 821 <groups:member groups:idRef="R01070"/> | |
| 822 <groups:member groups:idRef="R02703"/> | |
| 823 </groups:listOfMembers> | |
| 824 </groups:group> | |
| 825 <groups:group groups:id="buc00250" groups:kind="classification" groups:name="Alanine, aspartate and glutamate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 826 <groups:listOfMembers> | |
| 827 <groups:member groups:idRef="R01083"/> | |
| 828 <groups:member groups:idRef="R01086"/> | |
| 829 <groups:member groups:idRef="R01397"/> | |
| 830 <groups:member groups:idRef="R01135"/> | |
| 831 <groups:member groups:idRef="R00575"/> | |
| 832 <groups:member groups:idRef="R01954"/> | |
| 833 <groups:member groups:idRef="R00768"/> | |
| 834 </groups:listOfMembers> | |
| 835 </groups:group> | |
| 836 <groups:group groups:id="buc00290" groups:kind="classification" groups:name="Valine, leucine and isoleucine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 837 <groups:listOfMembers> | |
| 838 <groups:member groups:idRef="R04426"/> | |
| 839 <groups:member groups:idRef="R03896"/> | |
| 840 <groups:member groups:idRef="R01213"/> | |
| 841 <groups:member groups:idRef="R00994"/> | |
| 842 <groups:member groups:idRef="R03898"/> | |
| 843 <groups:member groups:idRef="R00226"/> | |
| 844 <groups:member groups:idRef="R08648"/> | |
| 845 <groups:member groups:idRef="R03968"/> | |
| 846 <groups:member groups:idRef="R04440"/> | |
| 847 <groups:member groups:idRef="R05068"/> | |
| 848 <groups:member groups:idRef="R04001"/> | |
| 849 <groups:member groups:idRef="R04441"/> | |
| 850 <groups:member groups:idRef="R05069"/> | |
| 851 <groups:member groups:idRef="R05070"/> | |
| 852 <groups:member groups:idRef="R05071"/> | |
| 853 </groups:listOfMembers> | |
| 854 </groups:group> | |
| 855 <groups:group groups:id="buc00920" groups:kind="classification" groups:name="Sulfur metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 856 <groups:listOfMembers> | |
| 857 <groups:member groups:idRef="R00858"/> | |
| 858 <groups:member groups:idRef="R00529"/> | |
| 859 <groups:member groups:idRef="R02021"/> | |
| 860 <groups:member groups:idRef="R00508"/> | |
| 861 <groups:member groups:idRef="R00509"/> | |
| 862 <groups:member groups:idRef="R00586"/> | |
| 863 <groups:member groups:idRef="R00897"/> | |
| 864 </groups:listOfMembers> | |
| 865 </groups:group> | |
| 866 <groups:group groups:id="buc00400" groups:kind="classification" groups:name="Phenylalanine, tyrosine and tryptophan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 867 <groups:listOfMembers> | |
| 868 <groups:member groups:idRef="R03509"/> | |
| 869 <groups:member groups:idRef="R01715"/> | |
| 870 <groups:member groups:idRef="R03508"/> | |
| 871 <groups:member groups:idRef="R01826"/> | |
| 872 <groups:member groups:idRef="R02412"/> | |
| 873 <groups:member groups:idRef="R00674"/> | |
| 874 <groups:member groups:idRef="R02722"/> | |
| 875 <groups:member groups:idRef="R02413"/> | |
| 876 <groups:member groups:idRef="R00985"/> | |
| 877 <groups:member groups:idRef="R00986"/> | |
| 878 <groups:member groups:idRef="R00734"/> | |
| 879 <groups:member groups:idRef="R01714"/> | |
| 880 <groups:member groups:idRef="R03460"/> | |
| 881 <groups:member groups:idRef="R01073"/> | |
| 882 <groups:member groups:idRef="R02340"/> | |
| 883 <groups:member groups:idRef="R01373"/> | |
| 884 <groups:member groups:idRef="R00691"/> | |
| 885 <groups:member groups:idRef="R00694"/> | |
| 886 <groups:member groups:idRef="R03084"/> | |
| 887 <groups:member groups:idRef="R03083"/> | |
| 888 </groups:listOfMembers> | |
| 889 </groups:group> | |
| 890 <groups:group groups:id="buc00520" groups:kind="classification" groups:name="Amino sugar and nucleotide sugar metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 891 <groups:listOfMembers> | |
| 892 <groups:member groups:idRef="R05199"/> | |
| 893 <groups:member groups:idRef="R05332"/> | |
| 894 <groups:member groups:idRef="R02738"/> | |
| 895 <groups:member groups:idRef="R08559"/> | |
| 896 <groups:member groups:idRef="R00660"/> | |
| 897 <groups:member groups:idRef="R02740"/> | |
| 898 <groups:member groups:idRef="R03192"/> | |
| 899 <groups:member groups:idRef="R03191"/> | |
| 900 <groups:member groups:idRef="R00416"/> | |
| 901 <groups:member groups:idRef="R02060"/> | |
| 902 <groups:member groups:idRef="R00768"/> | |
| 903 </groups:listOfMembers> | |
| 904 </groups:group> | |
| 905 <groups:group groups:id="buc00640" groups:kind="classification" groups:name="Propanoate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 906 <groups:listOfMembers> | |
| 907 <groups:member groups:idRef="R01353"/> | |
| 908 <groups:member groups:idRef="R00921"/> | |
| 909 <groups:member groups:idRef="R07618"/> | |
| 910 </groups:listOfMembers> | |
| 911 </groups:group> | |
| 912 <groups:group groups:id="buc01212" groups:kind="classification" groups:name="Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 913 <groups:listOfMembers> | |
| 914 <groups:member groups:idRef="R04724"/> | |
| 915 <groups:member groups:idRef="R04966"/> | |
| 916 <groups:member groups:idRef="R04963"/> | |
| 917 <groups:member groups:idRef="R04964"/> | |
| 918 <groups:member groups:idRef="R04969"/> | |
| 919 <groups:member groups:idRef="R04725"/> | |
| 920 <groups:member groups:idRef="R04967"/> | |
| 921 <groups:member groups:idRef="R04429"/> | |
| 922 <groups:member groups:idRef="R04726"/> | |
| 923 <groups:member groups:idRef="R04968"/> | |
| 924 <groups:member groups:idRef="R07763"/> | |
| 925 <groups:member groups:idRef="R04430"/> | |
| 926 <groups:member groups:idRef="R07762"/> | |
| 927 <groups:member groups:idRef="R04533"/> | |
| 928 <groups:member groups:idRef="R04970"/> | |
| 929 <groups:member groups:idRef="R07765"/> | |
| 930 <groups:member groups:idRef="R04355"/> | |
| 931 <groups:member groups:idRef="R04536"/> | |
| 932 <groups:member groups:idRef="R04955"/> | |
| 933 <groups:member groups:idRef="R04952"/> | |
| 934 <groups:member groups:idRef="R04534"/> | |
| 935 <groups:member groups:idRef="R04953"/> | |
| 936 <groups:member groups:idRef="R04958"/> | |
| 937 <groups:member groups:idRef="R04959"/> | |
| 938 <groups:member groups:idRef="R04956"/> | |
| 939 <groups:member groups:idRef="R04957"/> | |
| 940 <groups:member groups:idRef="R04961"/> | |
| 941 <groups:member groups:idRef="R04543"/> | |
| 942 <groups:member groups:idRef="R04962"/> | |
| 943 <groups:member groups:idRef="R04566"/> | |
| 944 <groups:member groups:idRef="R04960"/> | |
| 945 </groups:listOfMembers> | |
| 946 </groups:group> | |
| 947 <groups:group groups:id="buc00562" groups:kind="classification" groups:name="Inositol phosphate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 948 <groups:listOfMembers> | |
| 949 <groups:member groups:idRef="R01185"/> | |
| 950 <groups:member groups:idRef="R01186"/> | |
| 951 <groups:member groups:idRef="R01187"/> | |
| 952 <groups:member groups:idRef="R01015"/> | |
| 953 </groups:listOfMembers> | |
| 954 </groups:group> | |
| 955 <groups:group groups:id="buc00760" groups:kind="classification" groups:name="Nicotinate and nicotinamide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 956 <groups:listOfMembers> | |
| 957 <groups:member groups:idRef="R02294"/> | |
| 958 <groups:member groups:idRef="R02295"/> | |
| 959 <groups:member groups:idRef="R00189"/> | |
| 960 <groups:member groups:idRef="R03005"/> | |
| 961 <groups:member groups:idRef="R00137"/> | |
| 962 <groups:member groups:idRef="R00104"/> | |
| 963 <groups:member groups:idRef="R01724"/> | |
| 964 </groups:listOfMembers> | |
| 965 </groups:group> | |
| 966 <groups:group groups:id="buc01210" groups:kind="classification" groups:name="2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 967 <groups:listOfMembers> | |
| 968 <groups:member groups:idRef="R04426"/> | |
| 969 <groups:member groups:idRef="R01652"/> | |
| 970 <groups:member groups:idRef="R03896"/> | |
| 971 <groups:member groups:idRef="R01213"/> | |
| 972 <groups:member groups:idRef="R10052"/> | |
| 973 <groups:member groups:idRef="R03898"/> | |
| 974 <groups:member groups:idRef="R00226"/> | |
| 975 <groups:member groups:idRef="R08648"/> | |
| 976 <groups:member groups:idRef="R02649"/> | |
| 977 <groups:member groups:idRef="R08628"/> | |
| 978 <groups:member groups:idRef="R00669"/> | |
| 979 <groups:member groups:idRef="R10170"/> | |
| 980 <groups:member groups:idRef="R05068"/> | |
| 981 <groups:member groups:idRef="R08634"/> | |
| 982 <groups:member groups:idRef="R05069"/> | |
| 983 <groups:member groups:idRef="R03443"/> | |
| 984 <groups:member groups:idRef="R02291"/> | |
| 985 <groups:member groups:idRef="R00994"/> | |
| 986 <groups:member groups:idRef="R00259"/> | |
| 987 <groups:member groups:idRef="R03968"/> | |
| 988 <groups:member groups:idRef="R02283"/> | |
| 989 <groups:member groups:idRef="R04440"/> | |
| 990 <groups:member groups:idRef="R02282"/> | |
| 991 <groups:member groups:idRef="R04441"/> | |
| 992 <groups:member groups:idRef="R04001"/> | |
| 993 <groups:member groups:idRef="R08645"/> | |
| 994 <groups:member groups:idRef="R08624"/> | |
| 995 <groups:member groups:idRef="R08641"/> | |
| 996 <groups:member groups:idRef="R08620"/> | |
| 997 <groups:member groups:idRef="R05070"/> | |
| 998 <groups:member groups:idRef="R05071"/> | |
| 999 </groups:listOfMembers> | |
| 1000 </groups:group> | |
| 1001 <groups:group groups:id="buc00020" groups:kind="classification" groups:name="Citrate cycle (TCA cycle) - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 1002 <groups:listOfMembers> | |
| 1003 <groups:member groups:idRef="R02570"/> | |
| 1004 <groups:member groups:idRef="R00014"/> | |
| 1005 <groups:member groups:idRef="R03316"/> | |
| 1006 <groups:member groups:idRef="R00621"/> | |
| 1007 <groups:member groups:idRef="R02569"/> | |
| 1008 <groups:member groups:idRef="R07618"/> | |
| 1009 <groups:member groups:idRef="R03270"/> | |
| 1010 </groups:listOfMembers> | |
| 1011 </groups:group> | |
| 1012 <groups:group groups:id="buc00340" groups:kind="classification" groups:name="Histidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 1013 <groups:listOfMembers> | |
| 1014 <groups:member groups:idRef="R01163"/> | |
| 1015 <groups:member groups:idRef="R03013"/> | |
| 1016 <groups:member groups:idRef="R04037"/> | |
| 1017 <groups:member groups:idRef="R03012"/> | |
| 1018 <groups:member groups:idRef="R03243"/> | |
| 1019 <groups:member groups:idRef="R04640"/> | |
| 1020 <groups:member groups:idRef="R04035"/> | |
| 1021 <groups:member groups:idRef="R03457"/> | |
| 1022 <groups:member groups:idRef="R04558"/> | |
| 1023 <groups:member groups:idRef="R01071"/> | |
| 1024 </groups:listOfMembers> | |
| 1025 </groups:group> | |
| 1026 <groups:group groups:id="buc00780" groups:kind="classification" groups:name="Biotin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 1027 <groups:listOfMembers> | |
| 1028 <groups:member groups:idRef="R12934"/> | |
| 1029 <groups:member groups:idRef="R10118"/> | |
| 1030 <groups:member groups:idRef="R03231"/> | |
| 1031 <groups:member groups:idRef="R10115"/> | |
| 1032 <groups:member groups:idRef="R10116"/> | |
| 1033 <groups:member groups:idRef="R01078"/> | |
| 1034 <groups:member groups:idRef="R10122"/> | |
| 1035 <groups:member groups:idRef="R10120"/> | |
| 1036 <groups:member groups:idRef="R10119"/> | |
| 1037 <groups:member groups:idRef="R03182"/> | |
| 1038 </groups:listOfMembers> | |
| 1039 </groups:group> | |
| 1040 <groups:group groups:id="buc01110" groups:kind="classification" groups:name="Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 1041 <groups:listOfMembers> | |
| 1042 <groups:member groups:idRef="R00209"/> | |
| 1043 <groups:member groups:idRef="R00729"/> | |
| 1044 <groups:member groups:idRef="R00200"/> | |
| 1045 <groups:member groups:idRef="R01773"/> | |
| 1046 <groups:member groups:idRef="R01015"/> | |
| 1047 <groups:member groups:idRef="R04405"/> | |
| 1048 <groups:member groups:idRef="R01775"/> | |
| 1049 <groups:member groups:idRef="R02864"/> | |
| 1050 <groups:member groups:idRef="R00688"/> | |
| 1051 <groups:member groups:idRef="R01658"/> | |
| 1052 <groups:member groups:idRef="R01933"/> | |
| 1053 <groups:member groups:idRef="R02073"/> | |
| 1054 <groups:member groups:idRef="R05068"/> | |
| 1055 <groups:member groups:idRef="R03321"/> | |
| 1056 <groups:member groups:idRef="R02474"/> | |
| 1057 <groups:member groups:idRef="R00691"/> | |
| 1058 <groups:member groups:idRef="R00692"/> | |
| 1059 <groups:member groups:idRef="R02473"/> | |
| 1060 <groups:member groups:idRef="R00451"/> | |
| 1061 <groups:member groups:idRef="R05069"/> | |
| 1062 <groups:member groups:idRef="R00694"/> | |
| 1063 <groups:member groups:idRef="R03443"/> | |
| 1064 <groups:member groups:idRef="R00177"/> | |
| 1065 <groups:member groups:idRef="R08210"/> | |
| 1066 <groups:member groups:idRef="R02739"/> | |
| 1067 <groups:member groups:idRef="R01528"/> | |
| 1068 <groups:member groups:idRef="R01529"/> | |
| 1069 <groups:member groups:idRef="R01641"/> | |
| 1070 <groups:member groups:idRef="R00674"/> | |
| 1071 <groups:member groups:idRef="R01127"/> | |
| 1072 <groups:member groups:idRef="R02735"/> | |
| 1073 <groups:member groups:idRef="R03947"/> | |
| 1074 <groups:member groups:idRef="R02736"/> | |
| 1075 <groups:member groups:idRef="R04001"/> | |
| 1076 <groups:member groups:idRef="R08689"/> | |
| 1077 <groups:member groups:idRef="R02340"/> | |
| 1078 <groups:member groups:idRef="R00161"/> | |
| 1079 <groups:member groups:idRef="R01373"/> | |
| 1080 <groups:member groups:idRef="R05578"/> | |
| 1081 <groups:member groups:idRef="R02740"/> | |
| 1082 <groups:member groups:idRef="R04640"/> | |
| 1083 <groups:member groups:idRef="R01771"/> | |
| 1084 <groups:member groups:idRef="R09254"/> | |
| 1085 <groups:member groups:idRef="R01715"/> | |
| 1086 <groups:member groups:idRef="R05636"/> | |
| 1087 <groups:member groups:idRef="R06847"/> | |
| 1088 <groups:member groups:idRef="R04426"/> | |
| 1089 <groups:member groups:idRef="R03457"/> | |
| 1090 <groups:member groups:idRef="R05637"/> | |
| 1091 <groups:member groups:idRef="R00586"/> | |
| 1092 <groups:member groups:idRef="R01830"/> | |
| 1093 <groups:member groups:idRef="R05634"/> | |
| 1094 <groups:member groups:idRef="R03459"/> | |
| 1095 <groups:member groups:idRef="R03458"/> | |
| 1096 <groups:member groups:idRef="R00985"/> | |
| 1097 <groups:member groups:idRef="R00226"/> | |
| 1098 <groups:member groups:idRef="R00986"/> | |
| 1099 <groups:member groups:idRef="R01954"/> | |
| 1100 <groups:member groups:idRef="R02649"/> | |
| 1101 <groups:member groups:idRef="R01714"/> | |
| 1102 <groups:member groups:idRef="R03460"/> | |
| 1103 <groups:member groups:idRef="R01163"/> | |
| 1104 <groups:member groups:idRef="R06975"/> | |
| 1105 <groups:member groups:idRef="R04037"/> | |
| 1106 <groups:member groups:idRef="R10147"/> | |
| 1107 <groups:member groups:idRef="R12049"/> | |
| 1108 <groups:member groups:idRef="R04035"/> | |
| 1109 <groups:member groups:idRef="R00199"/> | |
| 1110 <groups:member groups:idRef="R05884"/> | |
| 1111 <groups:member groups:idRef="R01826"/> | |
| 1112 <groups:member groups:idRef="R01827"/> | |
| 1113 <groups:member groups:idRef="R04779"/> | |
| 1114 <groups:member groups:idRef="R00333"/> | |
| 1115 <groups:member groups:idRef="R00734"/> | |
| 1116 <groups:member groups:idRef="R03968"/> | |
| 1117 <groups:member groups:idRef="R07411"/> | |
| 1118 <groups:member groups:idRef="R04780"/> | |
| 1119 <groups:member groups:idRef="R06447"/> | |
| 1120 <groups:member groups:idRef="R05633"/> | |
| 1121 <groups:member groups:idRef="R09830"/> | |
| 1122 <groups:member groups:idRef="R08620"/> | |
| 1123 <groups:member groups:idRef="R02003"/> | |
| 1124 <groups:member groups:idRef="R00066"/> | |
| 1125 <groups:member groups:idRef="R01398"/> | |
| 1126 <groups:member groups:idRef="R05070"/> | |
| 1127 <groups:member groups:idRef="R05071"/> | |
| 1128 <groups:member groups:idRef="R00529"/> | |
| 1129 <groups:member groups:idRef="R01213"/> | |
| 1130 <groups:member groups:idRef="R00127"/> | |
| 1131 <groups:member groups:idRef="R08648"/> | |
| 1132 <groups:member groups:idRef="R01061"/> | |
| 1133 <groups:member groups:idRef="R01063"/> | |
| 1134 <groups:member groups:idRef="R03243"/> | |
| 1135 <groups:member groups:idRef="R01187"/> | |
| 1136 <groups:member groups:idRef="R01221"/> | |
| 1137 <groups:member groups:idRef="R02035"/> | |
| 1138 <groups:member groups:idRef="R00650"/> | |
| 1139 <groups:member groups:idRef="R00771"/> | |
| 1140 <groups:member groups:idRef="R07281"/> | |
| 1141 <groups:member groups:idRef="R04173"/> | |
| 1142 <groups:member groups:idRef="R03084"/> | |
| 1143 <groups:member groups:idRef="R03083"/> | |
| 1144 <groups:member groups:idRef="R06590"/> | |
| 1145 <groups:member groups:idRef="R03509"/> | |
| 1146 <groups:member groups:idRef="R03508"/> | |
| 1147 <groups:member groups:idRef="R02412"/> | |
| 1148 <groups:member groups:idRef="R04558"/> | |
| 1149 <groups:member groups:idRef="R04559"/> | |
| 1150 <groups:member groups:idRef="R01049"/> | |
| 1151 <groups:member groups:idRef="R02413"/> | |
| 1152 <groups:member groups:idRef="R02415"/> | |
| 1153 <groups:member groups:idRef="R04440"/> | |
| 1154 <groups:member groups:idRef="R07279"/> | |
| 1155 <groups:member groups:idRef="R04441"/> | |
| 1156 <groups:member groups:idRef="R00480"/> | |
| 1157 <groups:member groups:idRef="R02142"/> | |
| 1158 <groups:member groups:idRef="R00084"/> | |
| 1159 <groups:member groups:idRef="R04560"/> | |
| 1160 <groups:member groups:idRef="R02143"/> | |
| 1161 <groups:member groups:idRef="R01056"/> | |
| 1162 <groups:member groups:idRef="R00122"/> | |
| 1163 <groups:member groups:idRef="R03194"/> | |
| 1164 <groups:member groups:idRef="R00945"/> | |
| 1165 <groups:member groups:idRef="R00549"/> | |
| 1166 <groups:member groups:idRef="R01518"/> | |
| 1167 <groups:member groups:idRef="R00946"/> | |
| 1168 <groups:member groups:idRef="R02722"/> | |
| 1169 <groups:member groups:idRef="R01512"/> | |
| 1170 <groups:member groups:idRef="R08549"/> | |
| 1171 <groups:member groups:idRef="R00425"/> | |
| 1172 <groups:member groups:idRef="R00669"/> | |
| 1173 <groups:member groups:idRef="R04198"/> | |
| 1174 <groups:member groups:idRef="R04199"/> | |
| 1175 <groups:member groups:idRef="R01086"/> | |
| 1176 <groups:member groups:idRef="R05688"/> | |
| 1177 <groups:member groups:idRef="R02297"/> | |
| 1178 <groups:member groups:idRef="R10221"/> | |
| 1179 <groups:member groups:idRef="R01122"/> | |
| 1180 <groups:member groups:idRef="R10907"/> | |
| 1181 <groups:member groups:idRef="R09084"/> | |
| 1182 <groups:member groups:idRef="R02291"/> | |
| 1183 <groups:member groups:idRef="R11671"/> | |
| 1184 <groups:member groups:idRef="R01466"/> | |
| 1185 <groups:member groups:idRef="R04457"/> | |
| 1186 <groups:member groups:idRef="R01226"/> | |
| 1187 <groups:member groups:idRef="R00259"/> | |
| 1188 <groups:member groups:idRef="R00897"/> | |
| 1189 <groups:member groups:idRef="R00658"/> | |
| 1190 <groups:member groups:idRef="R02283"/> | |
| 1191 <groups:member groups:idRef="R01073"/> | |
| 1192 <groups:member groups:idRef="R01196"/> | |
| 1193 <groups:member groups:idRef="R01197"/> | |
| 1194 <groups:member groups:idRef="R03013"/> | |
| 1195 <groups:member groups:idRef="R03012"/> | |
| 1196 <groups:member groups:idRef="R01070"/> | |
| 1197 <groups:member groups:idRef="R01071"/> | |
| 1198 </groups:listOfMembers> | |
| 1199 </groups:group> | |
| 1200 <groups:group groups:id="buc01230" groups:kind="classification" groups:name="Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 1201 <groups:listOfMembers> | |
| 1202 <groups:member groups:idRef="R00200"/> | |
| 1203 <groups:member groups:idRef="R01773"/> | |
| 1204 <groups:member groups:idRef="R01015"/> | |
| 1205 <groups:member groups:idRef="R01213"/> | |
| 1206 <groups:member groups:idRef="R04405"/> | |
| 1207 <groups:member groups:idRef="R10052"/> | |
| 1208 <groups:member groups:idRef="R01775"/> | |
| 1209 <groups:member groups:idRef="R08648"/> | |
| 1210 <groups:member groups:idRef="R10170"/> | |
| 1211 <groups:member groups:idRef="R01061"/> | |
| 1212 <groups:member groups:idRef="R09107"/> | |
| 1213 <groups:member groups:idRef="R01063"/> | |
| 1214 <groups:member groups:idRef="R03243"/> | |
| 1215 <groups:member groups:idRef="R00451"/> | |
| 1216 <groups:member groups:idRef="R03443"/> | |
| 1217 <groups:member groups:idRef="R00177"/> | |
| 1218 <groups:member groups:idRef="R04173"/> | |
| 1219 <groups:member groups:idRef="R03084"/> | |
| 1220 <groups:member groups:idRef="R03083"/> | |
| 1221 <groups:member groups:idRef="R03509"/> | |
| 1222 <groups:member groups:idRef="R01529"/> | |
| 1223 <groups:member groups:idRef="R03508"/> | |
| 1224 <groups:member groups:idRef="R01641"/> | |
| 1225 <groups:member groups:idRef="R04558"/> | |
| 1226 <groups:member groups:idRef="R02412"/> | |
| 1227 <groups:member groups:idRef="R01049"/> | |
| 1228 <groups:member groups:idRef="R00994"/> | |
| 1229 <groups:member groups:idRef="R02413"/> | |
| 1230 <groups:member groups:idRef="R02735"/> | |
| 1231 <groups:member groups:idRef="R02734"/> | |
| 1232 <groups:member groups:idRef="R04441"/> | |
| 1233 <groups:member groups:idRef="R00480"/> | |
| 1234 <groups:member groups:idRef="R01373"/> | |
| 1235 <groups:member groups:idRef="R01056"/> | |
| 1236 <groups:member groups:idRef="R01771"/> | |
| 1237 <groups:member groups:idRef="R04365"/> | |
| 1238 <groups:member groups:idRef="R04640"/> | |
| 1239 <groups:member groups:idRef="R00945"/> | |
| 1240 <groups:member groups:idRef="R01715"/> | |
| 1241 <groups:member groups:idRef="R01518"/> | |
| 1242 <groups:member groups:idRef="R00946"/> | |
| 1243 <groups:member groups:idRef="R03457"/> | |
| 1244 <groups:member groups:idRef="R00586"/> | |
| 1245 <groups:member groups:idRef="R01158"/> | |
| 1246 <groups:member groups:idRef="R01830"/> | |
| 1247 <groups:member groups:idRef="R02722"/> | |
| 1248 <groups:member groups:idRef="R01512"/> | |
| 1249 <groups:member groups:idRef="R00226"/> | |
| 1250 <groups:member groups:idRef="R00985"/> | |
| 1251 <groups:member groups:idRef="R01954"/> | |
| 1252 <groups:member groups:idRef="R00986"/> | |
| 1253 <groups:member groups:idRef="R02649"/> | |
| 1254 <groups:member groups:idRef="R00669"/> | |
| 1255 <groups:member groups:idRef="R01714"/> | |
| 1256 <groups:member groups:idRef="R04198"/> | |
| 1257 <groups:member groups:idRef="R03460"/> | |
| 1258 <groups:member groups:idRef="R04199"/> | |
| 1259 <groups:member groups:idRef="R00194"/> | |
| 1260 <groups:member groups:idRef="R01086"/> | |
| 1261 <groups:member groups:idRef="R04037"/> | |
| 1262 <groups:member groups:idRef="R10147"/> | |
| 1263 <groups:member groups:idRef="R04475"/> | |
| 1264 <groups:member groups:idRef="R04035"/> | |
| 1265 <groups:member groups:idRef="R09084"/> | |
| 1266 <groups:member groups:idRef="R02291"/> | |
| 1267 <groups:member groups:idRef="R01826"/> | |
| 1268 <groups:member groups:idRef="R01827"/> | |
| 1269 <groups:member groups:idRef="R04779"/> | |
| 1270 <groups:member groups:idRef="R01466"/> | |
| 1271 <groups:member groups:idRef="R00897"/> | |
| 1272 <groups:member groups:idRef="R00259"/> | |
| 1273 <groups:member groups:idRef="R00658"/> | |
| 1274 <groups:member groups:idRef="R02283"/> | |
| 1275 <groups:member groups:idRef="R02282"/> | |
| 1276 <groups:member groups:idRef="R01073"/> | |
| 1277 <groups:member groups:idRef="R03013"/> | |
| 1278 <groups:member groups:idRef="R01398"/> | |
| 1279 <groups:member groups:idRef="R05070"/> | |
| 1280 <groups:member groups:idRef="R01070"/> | |
| 1281 <groups:member groups:idRef="R01071"/> | |
| 1282 </groups:listOfMembers> | |
| 1283 </groups:group> | |
| 1284 <groups:group groups:id="buc00261" groups:kind="classification" groups:name="Monobactam biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 1285 <groups:listOfMembers> | |
| 1286 <groups:member groups:idRef="R04198"/> | |
| 1287 <groups:member groups:idRef="R04199"/> | |
| 1288 <groups:member groups:idRef="R00480"/> | |
| 1289 <groups:member groups:idRef="R00529"/> | |
| 1290 <groups:member groups:idRef="R10147"/> | |
| 1291 </groups:listOfMembers> | |
| 1292 </groups:group> | |
| 1293 <groups:group groups:id="buc00260" groups:kind="classification" groups:name="Glycine, serine and threonine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 1294 <groups:listOfMembers> | |
| 1295 <groups:member groups:idRef="R00945"/> | |
| 1296 <groups:member groups:idRef="R01518"/> | |
| 1297 <groups:member groups:idRef="R00480"/> | |
| 1298 <groups:member groups:idRef="R01771"/> | |
| 1299 <groups:member groups:idRef="R01773"/> | |
| 1300 <groups:member groups:idRef="R01466"/> | |
| 1301 <groups:member groups:idRef="R01775"/> | |
| 1302 <groups:member groups:idRef="R02722"/> | |
| 1303 <groups:member groups:idRef="R04173"/> | |
| 1304 <groups:member groups:idRef="R03815"/> | |
| 1305 <groups:member groups:idRef="R02291"/> | |
| 1306 </groups:listOfMembers> | |
| 1307 </groups:group> | |
| 1308 <groups:group groups:id="buc00061" groups:kind="classification" groups:name="Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 1309 <groups:listOfMembers> | |
| 1310 <groups:member groups:idRef="R04966"/> | |
| 1311 <groups:member groups:idRef="R04724"/> | |
| 1312 <groups:member groups:idRef="R04963"/> | |
| 1313 <groups:member groups:idRef="R04964"/> | |
| 1314 <groups:member groups:idRef="R04969"/> | |
| 1315 <groups:member groups:idRef="R02768"/> | |
| 1316 <groups:member groups:idRef="R02767"/> | |
| 1317 <groups:member groups:idRef="R04967"/> | |
| 1318 <groups:member groups:idRef="R04725"/> | |
| 1319 <groups:member groups:idRef="R04968"/> | |
| 1320 <groups:member groups:idRef="R04726"/> | |
| 1321 <groups:member groups:idRef="R04429"/> | |
| 1322 <groups:member groups:idRef="R07763"/> | |
| 1323 <groups:member groups:idRef="R04430"/> | |
| 1324 <groups:member groups:idRef="R07762"/> | |
| 1325 <groups:member groups:idRef="R04533"/> | |
| 1326 <groups:member groups:idRef="R07765"/> | |
| 1327 <groups:member groups:idRef="R04970"/> | |
| 1328 <groups:member groups:idRef="R04355"/> | |
| 1329 <groups:member groups:idRef="R04536"/> | |
| 1330 <groups:member groups:idRef="R04955"/> | |
| 1331 <groups:member groups:idRef="R04534"/> | |
| 1332 <groups:member groups:idRef="R04952"/> | |
| 1333 <groups:member groups:idRef="R04953"/> | |
| 1334 <groups:member groups:idRef="R04958"/> | |
| 1335 <groups:member groups:idRef="R01403"/> | |
| 1336 <groups:member groups:idRef="R04959"/> | |
| 1337 <groups:member groups:idRef="R01404"/> | |
| 1338 <groups:member groups:idRef="R04956"/> | |
| 1339 <groups:member groups:idRef="R04957"/> | |
| 1340 <groups:member groups:idRef="R04543"/> | |
| 1341 <groups:member groups:idRef="R04961"/> | |
| 1342 <groups:member groups:idRef="R04566"/> | |
| 1343 <groups:member groups:idRef="R04962"/> | |
| 1344 <groups:member groups:idRef="R04960"/> | |
| 1345 </groups:listOfMembers> | |
| 1346 </groups:group> | |
| 1347 <groups:group groups:id="buc00730" groups:kind="classification" groups:name="Thiamine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 1348 <groups:listOfMembers> | |
| 1349 <groups:member groups:idRef="R00617"/> | |
| 1350 <groups:member groups:idRef="R05636"/> | |
| 1351 <groups:member groups:idRef="R07460"/> | |
| 1352 <groups:member groups:idRef="R11319"/> | |
| 1353 </groups:listOfMembers> | |
| 1354 </groups:group> | |
| 1355 <groups:group groups:id="buc00970" groups:kind="classification" groups:name="Aminoacyl-tRNA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 1356 <groups:listOfMembers> | |
| 1357 <groups:member groups:idRef="R02918"/> | |
| 1358 <groups:member groups:idRef="R03655"/> | |
| 1359 <groups:member groups:idRef="R03654"/> | |
| 1360 <groups:member groups:idRef="R03665"/> | |
| 1361 <groups:member groups:idRef="R03038"/> | |
| 1362 <groups:member groups:idRef="R03940"/> | |
| 1363 <groups:member groups:idRef="R03646"/> | |
| 1364 <groups:member groups:idRef="R03657"/> | |
| 1365 <groups:member groups:idRef="R03656"/> | |
| 1366 <groups:member groups:idRef="R03648"/> | |
| 1367 <groups:member groups:idRef="R03659"/> | |
| 1368 <groups:member groups:idRef="R03658"/> | |
| 1369 <groups:member groups:idRef="R03660"/> | |
| 1370 <groups:member groups:idRef="R08218"/> | |
| 1371 <groups:member groups:idRef="R05577"/> | |
| 1372 <groups:member groups:idRef="R03662"/> | |
| 1373 <groups:member groups:idRef="R03650"/> | |
| 1374 <groups:member groups:idRef="R03661"/> | |
| 1375 <groups:member groups:idRef="R05578"/> | |
| 1376 <groups:member groups:idRef="R03664"/> | |
| 1377 <groups:member groups:idRef="R03652"/> | |
| 1378 <groups:member groups:idRef="R03663"/> | |
| 1379 </groups:listOfMembers> | |
| 1380 </groups:group> | |
| 1381 <groups:group groups:id="buc00330" groups:kind="classification" groups:name="Arginine and proline metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 1382 <groups:listOfMembers> | |
| 1383 <groups:member groups:idRef="R00178"/> | |
| 1384 <groups:member groups:idRef="R01920"/> | |
| 1385 </groups:listOfMembers> | |
| 1386 </groups:group> | |
| 1387 <groups:group groups:id="buc00770" groups:kind="classification" groups:name="Pantothenate and CoA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 1388 <groups:listOfMembers> | |
| 1389 <groups:member groups:idRef="R04441"/> | |
| 1390 <groups:member groups:idRef="R00130"/> | |
| 1391 <groups:member groups:idRef="R03035"/> | |
| 1392 <groups:member groups:idRef="R02473"/> | |
| 1393 <groups:member groups:idRef="R01226"/> | |
| 1394 <groups:member groups:idRef="R00226"/> | |
| 1395 <groups:member groups:idRef="R01625"/> | |
| 1396 <groups:member groups:idRef="R04439"/> | |
| 1397 </groups:listOfMembers> | |
| 1398 </groups:group> | |
| 1399 <groups:group groups:id="buc01100" groups:kind="classification" groups:name="Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)"> | |
| 1400 <groups:listOfMembers> | |
| 1401 <groups:member groups:idRef="R00209"/> | |
| 1402 <groups:member groups:idRef="R02749"/> | |
| 1403 <groups:member groups:idRef="R00200"/> | |
| 1404 <groups:member groups:idRef="R01773"/> | |
| 1405 <groups:member groups:idRef="R01775"/> | |
| 1406 <groups:member groups:idRef="R01655"/> | |
| 1407 <groups:member groups:idRef="R02864"/> | |
| 1408 <groups:member groups:idRef="R00688"/> | |
| 1409 <groups:member groups:idRef="R00689"/> | |
| 1410 <groups:member groups:idRef="R00206"/> | |
| 1411 <groups:member groups:idRef="R01658"/> | |
| 1412 <groups:member groups:idRef="R02748"/> | |
| 1413 <groups:member groups:idRef="R00328"/> | |
| 1414 <groups:member groups:idRef="R12428"/> | |
| 1415 <groups:member groups:idRef="R07763"/> | |
| 1416 <groups:member groups:idRef="R02073"/> | |
| 1417 <groups:member groups:idRef="R12427"/> | |
| 1418 <groups:member groups:idRef="R07762"/> | |
| 1419 <groups:member groups:idRef="R00691"/> | |
| 1420 <groups:member groups:idRef="R12424"/> | |
| 1421 <groups:member groups:idRef="R00692"/> | |
| 1422 <groups:member groups:idRef="R00571"/> | |
| 1423 <groups:member groups:idRef="R12423"/> | |
| 1424 <groups:member groups:idRef="R00451"/> | |
| 1425 <groups:member groups:idRef="R10122"/> | |
| 1426 <groups:member groups:idRef="R07765"/> | |
| 1427 <groups:member groups:idRef="R00694"/> | |
| 1428 <groups:member groups:idRef="R00573"/> | |
| 1429 <groups:member groups:idRef="R01528"/> | |
| 1430 <groups:member groups:idRef="R02739"/> | |
| 1431 <groups:member groups:idRef="R01529"/> | |
| 1432 <groups:member groups:idRef="R01641"/> | |
| 1433 <groups:member groups:idRef="R00673"/> | |
| 1434 <groups:member groups:idRef="R10120"/> | |
| 1435 <groups:member groups:idRef="R03940"/> | |
| 1436 <groups:member groups:idRef="R00674"/> | |
| 1437 <groups:member groups:idRef="R01401"/> | |
| 1438 <groups:member groups:idRef="R02735"/> | |
| 1439 <groups:member groups:idRef="R00315"/> | |
| 1440 <groups:member groups:idRef="R02734"/> | |
| 1441 <groups:member groups:idRef="R03947"/> | |
| 1442 <groups:member groups:idRef="R02736"/> | |
| 1443 <groups:member groups:idRef="R00317"/> | |
| 1444 <groups:member groups:idRef="R05332"/> | |
| 1445 <groups:member groups:idRef="R10118"/> | |
| 1446 <groups:member groups:idRef="R10115"/> | |
| 1447 <groups:member groups:idRef="R10116"/> | |
| 1448 <groups:member groups:idRef="R03035"/> | |
| 1449 <groups:member groups:idRef="R04125"/> | |
| 1450 <groups:member groups:idRef="R01770"/> | |
| 1451 <groups:member groups:idRef="R05578"/> | |
| 1452 <groups:member groups:idRef="R02740"/> | |
| 1453 <groups:member groups:idRef="R01771"/> | |
| 1454 <groups:member groups:idRef="R04365"/> | |
| 1455 <groups:member groups:idRef="R00320"/> | |
| 1456 <groups:member groups:idRef="R03036"/> | |
| 1457 <groups:member groups:idRef="R09254"/> | |
| 1458 <groups:member groups:idRef="R10119"/> | |
| 1459 <groups:member groups:idRef="R02060"/> | |
| 1460 <groups:member groups:idRef="R00586"/> | |
| 1461 <groups:member groups:idRef="R00103"/> | |
| 1462 <groups:member groups:idRef="R01677"/> | |
| 1463 <groups:member groups:idRef="R00104"/> | |
| 1464 <groups:member groups:idRef="R00226"/> | |
| 1465 <groups:member groups:idRef="R12691"/> | |
| 1466 <groups:member groups:idRef="R02767"/> | |
| 1467 <groups:member groups:idRef="R02649"/> | |
| 1468 <groups:member groups:idRef="R02098"/> | |
| 1469 <groups:member groups:idRef="R04037"/> | |
| 1470 <groups:member groups:idRef="R10146"/> | |
| 1471 <groups:member groups:idRef="R10147"/> | |
| 1472 <groups:member groups:idRef="R01561"/> | |
| 1473 <groups:member groups:idRef="R00230"/> | |
| 1474 <groups:member groups:idRef="R04951"/> | |
| 1475 <groups:member groups:idRef="R04035"/> | |
| 1476 <groups:member groups:idRef="R02090"/> | |
| 1477 <groups:member groups:idRef="R02092"/> | |
| 1478 <groups:member groups:idRef="R02094"/> | |
| 1479 <groups:member groups:idRef="R03182"/> | |
| 1480 <groups:member groups:idRef="R00332"/> | |
| 1481 <groups:member groups:idRef="R00212"/> | |
| 1482 <groups:member groups:idRef="R00575"/> | |
| 1483 <groups:member groups:idRef="R01547"/> | |
| 1484 <groups:member groups:idRef="R01669"/> | |
| 1485 <groups:member groups:idRef="R07411"/> | |
| 1486 <groups:member groups:idRef="R09830"/> | |
| 1487 <groups:member groups:idRef="R01858"/> | |
| 1488 <groups:member groups:idRef="R00529"/> | |
| 1489 <groups:member groups:idRef="R00761"/> | |
| 1490 <groups:member groups:idRef="R03237"/> | |
| 1491 <groups:member groups:idRef="R00762"/> | |
| 1492 <groups:member groups:idRef="R02147"/> | |
| 1493 <groups:member groups:idRef="R03236"/> | |
| 1494 <groups:member groups:idRef="R02821"/> | |
| 1495 <groups:member groups:idRef="R04325"/> | |
| 1496 <groups:member groups:idRef="R03239"/> | |
| 1497 <groups:member groups:idRef="R03238"/> | |
| 1498 <groups:member groups:idRef="R02704"/> | |
| 1499 <groups:member groups:idRef="R00768"/> | |
| 1500 <groups:member groups:idRef="R01857"/> | |
| 1501 <groups:member groups:idRef="R02703"/> | |
| 1502 <groups:member groups:idRef="R01736"/> | |
| 1503 <groups:member groups:idRef="R01061"/> | |
| 1504 <groups:member groups:idRef="R04573"/> | |
| 1505 <groups:member groups:idRef="R05662"/> | |
| 1506 <groups:member groups:idRef="R07168"/> | |
| 1507 <groups:member groups:idRef="R09107"/> | |
| 1508 <groups:member groups:idRef="R01063"/> | |
| 1509 <groups:member groups:idRef="R01185"/> | |
| 1510 <groups:member groups:idRef="R01186"/> | |
| 1511 <groups:member groups:idRef="R01187"/> | |
| 1512 <groups:member groups:idRef="R03243"/> | |
| 1513 <groups:member groups:idRef="R01067"/> | |
| 1514 <groups:member groups:idRef="R03004"/> | |
| 1515 <groups:member groups:idRef="R02035"/> | |
| 1516 <groups:member groups:idRef="R00650"/> | |
| 1517 <groups:member groups:idRef="R00771"/> | |
| 1518 <groups:member groups:idRef="R01068"/> | |
| 1519 <groups:member groups:idRef="R07281"/> | |
| 1520 <groups:member groups:idRef="R01969"/> | |
| 1521 <groups:member groups:idRef="R04558"/> | |
| 1522 <groups:member groups:idRef="R04559"/> | |
| 1523 <groups:member groups:idRef="R05645"/> | |
| 1524 <groups:member groups:idRef="R01049"/> | |
| 1525 <groups:member groups:idRef="R00994"/> | |
| 1526 <groups:member groups:idRef="R02018"/> | |
| 1527 <groups:member groups:idRef="R02017"/> | |
| 1528 <groups:member groups:idRef="R06613"/> | |
| 1529 <groups:member groups:idRef="R02019"/> | |
| 1530 <groups:member groups:idRef="R00756"/> | |
| 1531 <groups:member groups:idRef="R01724"/> | |
| 1532 <groups:member groups:idRef="R07279"/> | |
| 1533 <groups:member groups:idRef="R04441"/> | |
| 1534 <groups:member groups:idRef="R03231"/> | |
| 1535 <groups:member groups:idRef="R00084"/> | |
| 1536 <groups:member groups:idRef="R02142"/> | |
| 1537 <groups:member groups:idRef="R02021"/> | |
| 1538 <groups:member groups:idRef="R11765"/> | |
| 1539 <groups:member groups:idRef="R04560"/> | |
| 1540 <groups:member groups:idRef="R04566"/> | |
| 1541 <groups:member groups:idRef="R02143"/> | |
| 1542 <groups:member groups:idRef="R01056"/> | |
| 1543 <groups:member groups:idRef="R02024"/> | |
| 1544 <groups:member groups:idRef="R01057"/> | |
| 1545 <groups:member groups:idRef="R07390"/> | |
| 1546 <groups:member groups:idRef="R07274"/> | |
| 1547 <groups:member groups:idRef="R00549"/> | |
| 1548 <groups:member groups:idRef="R01518"/> | |
| 1549 <groups:member groups:idRef="R01993"/> | |
| 1550 <groups:member groups:idRef="R02722"/> | |
| 1551 <groups:member groups:idRef="R01512"/> | |
| 1552 <groups:member groups:idRef="R00425"/> | |
| 1553 <groups:member groups:idRef="R00669"/> | |
| 1554 <groups:member groups:idRef="R00548"/> | |
| 1555 <groups:member groups:idRef="R07618"/> | |
| 1556 <groups:member groups:idRef="R01083"/> | |
| 1557 <groups:member groups:idRef="R02294"/> | |
| 1558 <groups:member groups:idRef="R01086"/> | |
| 1559 <groups:member groups:idRef="R02295"/> | |
| 1560 <groups:member groups:idRef="R05688"/> | |
| 1561 <groups:member groups:idRef="R02297"/> | |
| 1562 <groups:member groups:idRef="R10221"/> | |
| 1563 <groups:member groups:idRef="R04475"/> | |
| 1564 <groups:member groups:idRef="R00550"/> | |
| 1565 <groups:member groups:idRef="R04355"/> | |
| 1566 <groups:member groups:idRef="R10907"/> | |
| 1567 <groups:member groups:idRef="R09365"/> | |
| 1568 <groups:member groups:idRef="R02291"/> | |
| 1569 <groups:member groups:idRef="R11319"/> | |
| 1570 <groups:member groups:idRef="R01869"/> | |
| 1571 <groups:member groups:idRef="R00530"/> | |
| 1572 <groups:member groups:idRef="R00531"/> | |
| 1573 <groups:member groups:idRef="R00894"/> | |
| 1574 <groups:member groups:idRef="R03005"/> | |
| 1575 <groups:member groups:idRef="R01863"/> | |
| 1576 <groups:member groups:idRef="R04457"/> | |
| 1577 <groups:member groups:idRef="R00897"/> | |
| 1578 <groups:member groups:idRef="R01867"/> | |
| 1579 <groups:member groups:idRef="R00899"/> | |
| 1580 <groups:member groups:idRef="R01625"/> | |
| 1581 <groups:member groups:idRef="R00658"/> | |
| 1582 <groups:member groups:idRef="R00416"/> | |
| 1583 <groups:member groups:idRef="R01868"/> | |
| 1584 <groups:member groups:idRef="R02283"/> | |
| 1585 <groups:member groups:idRef="R01073"/> | |
| 1586 <groups:member groups:idRef="R02282"/> | |
| 1587 <groups:member groups:idRef="R01196"/> | |
| 1588 <groups:member groups:idRef="R10699"/> | |
| 1589 <groups:member groups:idRef="R03013"/> | |
| 1590 <groups:member groups:idRef="R01197"/> | |
| 1591 <groups:member groups:idRef="R03012"/> | |
| 1592 <groups:member groups:idRef="R00660"/> | |
| 1593 <groups:member groups:idRef="R01870"/> | |
| 1594 <groups:member groups:idRef="R01078"/> | |
| 1595 <groups:member groups:idRef="R02167"/> | |
| 1596 <groups:member groups:idRef="R01070"/> | |
| 1597 <groups:member groups:idRef="R01071"/> | |
| 1598 <groups:member groups:idRef="R00729"/> | |
| 1599 <groups:member groups:idRef="R01135"/> | |
| 1600 <groups:member groups:idRef="R01015"/> | |
| 1601 <groups:member groups:idRef="R04405"/> | |
| 1602 <groups:member groups:idRef="R01137"/> | |
| 1603 <groups:member groups:idRef="R01138"/> | |
| 1604 <groups:member groups:idRef="R11062"/> | |
| 1605 <groups:member groups:idRef="R01933"/> | |
| 1606 <groups:member groups:idRef="R00965"/> | |
| 1607 <groups:member groups:idRef="R08574"/> | |
| 1608 <groups:member groups:idRef="R02474"/> | |
| 1609 <groups:member groups:idRef="R03321"/> | |
| 1610 <groups:member groups:idRef="R04533"/> | |
| 1611 <groups:member groups:idRef="R02473"/> | |
| 1612 <groups:member groups:idRef="R00177"/> | |
| 1613 <groups:member groups:idRef="R03443"/> | |
| 1614 <groups:member groups:idRef="R04773"/> | |
| 1615 <groups:member groups:idRef="R01245"/> | |
| 1616 <groups:member groups:idRef="R00158"/> | |
| 1617 <groups:member groups:idRef="R01127"/> | |
| 1618 <groups:member groups:idRef="R01920"/> | |
| 1619 <groups:member groups:idRef="R12934"/> | |
| 1620 <groups:member groups:idRef="R08689"/> | |
| 1621 <groups:member groups:idRef="R00160"/> | |
| 1622 <groups:member groups:idRef="R12933"/> | |
| 1623 <groups:member groups:idRef="R00161"/> | |
| 1624 <groups:member groups:idRef="R02340"/> | |
| 1625 <groups:member groups:idRef="R01373"/> | |
| 1626 <groups:member groups:idRef="R02100"/> | |
| 1627 <groups:member groups:idRef="R10993"/> | |
| 1628 <groups:member groups:idRef="R01132"/> | |
| 1629 <groups:member groups:idRef="R10994"/> | |
| 1630 <groups:member groups:idRef="R04640"/> | |
| 1631 <groups:member groups:idRef="R02101"/> | |
| 1632 <groups:member groups:idRef="R01134"/> | |
| 1633 <groups:member groups:idRef="R09099"/> | |
| 1634 <groups:member groups:idRef="R01715"/> | |
| 1635 <groups:member groups:idRef="R00508"/> | |
| 1636 <groups:member groups:idRef="R00509"/> | |
| 1637 <groups:member groups:idRef="R03457"/> | |
| 1638 <groups:member groups:idRef="R06847"/> | |
| 1639 <groups:member groups:idRef="R04426"/> | |
| 1640 <groups:member groups:idRef="R05636"/> | |
| 1641 <groups:member groups:idRef="R00189"/> | |
| 1642 <groups:member groups:idRef="R05637"/> | |
| 1643 <groups:member groups:idRef="R00861"/> | |
| 1644 <groups:member groups:idRef="R05634"/> | |
| 1645 <groups:member groups:idRef="R03459"/> | |
| 1646 <groups:member groups:idRef="R01830"/> | |
| 1647 <groups:member groups:idRef="R03458"/> | |
| 1648 <groups:member groups:idRef="R00985"/> | |
| 1649 <groups:member groups:idRef="R00986"/> | |
| 1650 <groups:member groups:idRef="R01954"/> | |
| 1651 <groups:member groups:idRef="R01714"/> | |
| 1652 <groups:member groups:idRef="R04429"/> | |
| 1653 <groups:member groups:idRef="R03460"/> | |
| 1654 <groups:member groups:idRef="R04430"/> | |
| 1655 <groups:member groups:idRef="R00194"/> | |
| 1656 <groups:member groups:idRef="R01163"/> | |
| 1657 <groups:member groups:idRef="R06975"/> | |
| 1658 <groups:member groups:idRef="R12049"/> | |
| 1659 <groups:member groups:idRef="R00199"/> | |
| 1660 <groups:member groups:idRef="R05884"/> | |
| 1661 <groups:member groups:idRef="R12608"/> | |
| 1662 <groups:member groups:idRef="R05085"/> | |
| 1663 <groups:member groups:idRef="R00615"/> | |
| 1664 <groups:member groups:idRef="R01826"/> | |
| 1665 <groups:member groups:idRef="R00858"/> | |
| 1666 <groups:member groups:idRef="R00616"/> | |
| 1667 <groups:member groups:idRef="R00859"/> | |
| 1668 <groups:member groups:idRef="R01827"/> | |
| 1669 <groups:member groups:idRef="R00617"/> | |
| 1670 <groups:member groups:idRef="R00618"/> | |
| 1671 <groups:member groups:idRef="R01829"/> | |
| 1672 <groups:member groups:idRef="R00178"/> | |
| 1673 <groups:member groups:idRef="R04536"/> | |
| 1674 <groups:member groups:idRef="R02236"/> | |
| 1675 <groups:member groups:idRef="R04779"/> | |
| 1676 <groups:member groups:idRef="R02235"/> | |
| 1677 <groups:member groups:idRef="R04534"/> | |
| 1678 <groups:member groups:idRef="R02237"/> | |
| 1679 <groups:member groups:idRef="R05629"/> | |
| 1680 <groups:member groups:idRef="R00734"/> | |
| 1681 <groups:member groups:idRef="R04780"/> | |
| 1682 <groups:member groups:idRef="R01273"/> | |
| 1683 <groups:member groups:idRef="R04543"/> | |
| 1684 <groups:member groups:idRef="R05633"/> | |
| 1685 <groups:member groups:idRef="R02003"/> | |
| 1686 <groups:member groups:idRef="R00066"/> | |
| 1687 <groups:member groups:idRef="R05630"/> | |
| 1688 <groups:member groups:idRef="R01397"/> | |
| 1689 <groups:member groups:idRef="R01398"/> | |
| 1690 <groups:member groups:idRef="R05070"/> | |
| 1691 <groups:member groups:idRef="R01213"/> | |
| 1692 <groups:member groups:idRef="R04966"/> | |
| 1693 <groups:member groups:idRef="R04724"/> | |
| 1694 <groups:member groups:idRef="R04963"/> | |
| 1695 <groups:member groups:idRef="R00125"/> | |
| 1696 <groups:member groups:idRef="R02788"/> | |
| 1697 <groups:member groups:idRef="R04964"/> | |
| 1698 <groups:member groups:idRef="R00126"/> | |
| 1699 <groups:member groups:idRef="R08648"/> | |
| 1700 <groups:member groups:idRef="R04969"/> | |
| 1701 <groups:member groups:idRef="R00127"/> | |
| 1702 <groups:member groups:idRef="R01217"/> | |
| 1703 <groups:member groups:idRef="R04967"/> | |
| 1704 <groups:member groups:idRef="R04725"/> | |
| 1705 <groups:member groups:idRef="R01218"/> | |
| 1706 <groups:member groups:idRef="R00921"/> | |
| 1707 <groups:member groups:idRef="R04968"/> | |
| 1708 <groups:member groups:idRef="R04726"/> | |
| 1709 <groups:member groups:idRef="R00130"/> | |
| 1710 <groups:member groups:idRef="R01220"/> | |
| 1711 <groups:member groups:idRef="R04970"/> | |
| 1712 <groups:member groups:idRef="R01221"/> | |
| 1713 <groups:member groups:idRef="R10046"/> | |
| 1714 <groups:member groups:idRef="R04173"/> | |
| 1715 <groups:member groups:idRef="R03084"/> | |
| 1716 <groups:member groups:idRef="R03083"/> | |
| 1717 <groups:member groups:idRef="R03509"/> | |
| 1718 <groups:member groups:idRef="R03508"/> | |
| 1719 <groups:member groups:idRef="R02412"/> | |
| 1720 <groups:member groups:idRef="R00112"/> | |
| 1721 <groups:member groups:idRef="R04955"/> | |
| 1722 <groups:member groups:idRef="R04952"/> | |
| 1723 <groups:member groups:idRef="R02413"/> | |
| 1724 <groups:member groups:idRef="R04953"/> | |
| 1725 <groups:member groups:idRef="R04958"/> | |
| 1726 <groups:member groups:idRef="R05805"/> | |
| 1727 <groups:member groups:idRef="R02415"/> | |
| 1728 <groups:member groups:idRef="R04959"/> | |
| 1729 <groups:member groups:idRef="R04956"/> | |
| 1730 <groups:member groups:idRef="R04957"/> | |
| 1731 <groups:member groups:idRef="R00480"/> | |
| 1732 <groups:member groups:idRef="R04961"/> | |
| 1733 <groups:member groups:idRef="R04962"/> | |
| 1734 <groups:member groups:idRef="R00484"/> | |
| 1735 <groups:member groups:idRef="R04960"/> | |
| 1736 <groups:member groups:idRef="R00122"/> | |
| 1737 <groups:member groups:idRef="R02783"/> | |
| 1738 <groups:member groups:idRef="R03192"/> | |
| 1739 <groups:member groups:idRef="R03191"/> | |
| 1740 <groups:member groups:idRef="R03194"/> | |
| 1741 <groups:member groups:idRef="R03193"/> | |
| 1742 <groups:member groups:idRef="R00945"/> | |
| 1743 <groups:member groups:idRef="R00946"/> | |
| 1744 <groups:member groups:idRef="R03896"/> | |
| 1745 <groups:member groups:idRef="R02568"/> | |
| 1746 <groups:member groups:idRef="R02325"/> | |
| 1747 <groups:member groups:idRef="R00940"/> | |
| 1748 <groups:member groups:idRef="R03898"/> | |
| 1749 <groups:member groups:idRef="R00941"/> | |
| 1750 <groups:member groups:idRef="R08549"/> | |
| 1751 <groups:member groups:idRef="R00943"/> | |
| 1752 <groups:member groups:idRef="R00944"/> | |
| 1753 <groups:member groups:idRef="R04198"/> | |
| 1754 <groups:member groups:idRef="R10866"/> | |
| 1755 <groups:member groups:idRef="R04199"/> | |
| 1756 <groups:member groups:idRef="R09769"/> | |
| 1757 <groups:member groups:idRef="R01122"/> | |
| 1758 <groups:member groups:idRef="R00155"/> | |
| 1759 <groups:member groups:idRef="R09084"/> | |
| 1760 <groups:member groups:idRef="R07460"/> | |
| 1761 <groups:member groups:idRef="R00936"/> | |
| 1762 <groups:member groups:idRef="R00937"/> | |
| 1763 <groups:member groups:idRef="R00939"/> | |
| 1764 <groups:member groups:idRef="R00497"/> | |
| 1765 <groups:member groups:idRef="R01466"/> | |
| 1766 <groups:member groups:idRef="R01224"/> | |
| 1767 <groups:member groups:idRef="R00257"/> | |
| 1768 <groups:member groups:idRef="R01225"/> | |
| 1769 <groups:member groups:idRef="R02557"/> | |
| 1770 <groups:member groups:idRef="R01226"/> | |
| 1771 <groups:member groups:idRef="R00137"/> | |
| 1772 <groups:member groups:idRef="R00259"/> | |
| 1773 <groups:member groups:idRef="R04617"/> | |
| 1774 <groups:member groups:idRef="R01229"/> | |
| 1775 <groups:member groups:idRef="R00260"/> | |
| 1776 <groups:member groups:idRef="R05032"/> | |
| 1777 <groups:member groups:idRef="R02320"/> | |
| 1778 <groups:member groups:idRef="R01353"/> | |
| 1779 <groups:member groups:idRef="R03652"/> | |
| 1780 <groups:member groups:idRef="R10859"/> | |
| 1781 </groups:listOfMembers> | |
| 1782 </groups:group> | |
| 1783 </groups:listOfGroups> | |
| 1784 <listOfUnitDefinitions> | |
| 1785 <unitDefinition id="mmol_per_gDW_per_hr" name="mmol_per_gDW_per_hr"> | |
| 1786 <listOfUnits> | |
| 1787 <unit exponent="-1" kind="gram" multiplier="1" scale="0"/> | |
| 1788 <unit exponent="1" kind="mole" multiplier="1" scale="-3"/> | |
| 1789 <unit exponent="-1" kind="second" multiplier="0.00027777" scale="0"/> | |
| 1790 </listOfUnits> | |
| 1791 </unitDefinition> | |
| 1792 </listOfUnitDefinitions> | |
| 1793 <listOfCompartments> | |
| 1794 <compartment constant="false" id="default" metaid="_73996643-92bc-4fd4-afc0-ed215e6ed969" name="default"/> | |
| 1795 </listOfCompartments> | |
| 1796 <listOfSpecies> | |
| 1797 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C01635" metaid="_3cab2fbe-3b64-427e-8ab8-54e13aff4717" name="tRNA(Ala)" sboTerm="SBO:0000240"> | |
| 1798 <notes> | |
| 1799 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1800 <p>kegg.compound: C01635</p> | |
| 1801 <p>PubChem: 4784</p> | |
| 1802 <p>ChEBI: 29170</p> | |
| 1803 </body> | |
| 1804 </notes> | |
| 1805 <annotation> | |
| 1806 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1807 <rdf:Description rdf:about="#_3cab2fbe-3b64-427e-8ab8-54e13aff4717"> | |
| 1808 <bqbiol:is> | |
| 1809 <rdf:Bag> | |
| 1810 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01635"/> | |
| 1811 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29170"/> | |
| 1812 </rdf:Bag> | |
| 1813 </bqbiol:is> | |
| 1814 </rdf:Description> | |
| 1815 </rdf:RDF> | |
| 1816 </annotation> | |
| 1817 </species> | |
| 1818 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C01636" metaid="_998c924e-4eca-489c-86d7-eb0aa332dc15" name="tRNA(Arg)" sboTerm="SBO:0000240"> | |
| 1819 <notes> | |
| 1820 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1821 <p>kegg.compound: C01636</p> | |
| 1822 <p>PubChem: 4785</p> | |
| 1823 <p>ChEBI: 29171</p> | |
| 1824 </body> | |
| 1825 </notes> | |
| 1826 <annotation> | |
| 1827 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1828 <rdf:Description rdf:about="#_998c924e-4eca-489c-86d7-eb0aa332dc15"> | |
| 1829 <bqbiol:is> | |
| 1830 <rdf:Bag> | |
| 1831 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01636"/> | |
| 1832 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29171"/> | |
| 1833 </rdf:Bag> | |
| 1834 </bqbiol:is> | |
| 1835 </rdf:Description> | |
| 1836 </rdf:RDF> | |
| 1837 </annotation> | |
| 1838 </species> | |
| 1839 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C01637" metaid="_676c76ad-afa8-4404-85a8-068ea65aa6ad" name="tRNA(Asn)" sboTerm="SBO:0000240"> | |
| 1840 <notes> | |
| 1841 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1842 <p>kegg.compound: C01637</p> | |
| 1843 <p>PubChem: 4786</p> | |
| 1844 <p>ChEBI: 29172</p> | |
| 1845 </body> | |
| 1846 </notes> | |
| 1847 <annotation> | |
| 1848 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1849 <rdf:Description rdf:about="#_676c76ad-afa8-4404-85a8-068ea65aa6ad"> | |
| 1850 <bqbiol:is> | |
| 1851 <rdf:Bag> | |
| 1852 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01637"/> | |
| 1853 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29172"/> | |
| 1854 </rdf:Bag> | |
| 1855 </bqbiol:is> | |
| 1856 </rdf:Description> | |
| 1857 </rdf:RDF> | |
| 1858 </annotation> | |
| 1859 </species> | |
| 1860 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C01638" metaid="d628590f-0681-4c7e-a9ec-6c560bd7d329" name="tRNA(Asp)" sboTerm="SBO:0000240"> | |
| 1861 <notes> | |
| 1862 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1863 <p>kegg.compound: C01638</p> | |
| 1864 <p>PubChem: 4787</p> | |
| 1865 <p>ChEBI: 29186</p> | |
| 1866 </body> | |
| 1867 </notes> | |
| 1868 <annotation> | |
| 1869 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1870 <rdf:Description rdf:about="#d628590f-0681-4c7e-a9ec-6c560bd7d329"> | |
| 1871 <bqbiol:is> | |
| 1872 <rdf:Bag> | |
| 1873 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01638"/> | |
| 1874 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29186"/> | |
| 1875 </rdf:Bag> | |
| 1876 </bqbiol:is> | |
| 1877 </rdf:Description> | |
| 1878 </rdf:RDF> | |
| 1879 </annotation> | |
| 1880 </species> | |
| 1881 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C01639" metaid="b7c6c4f2-9165-4900-94df-31c8d292b519" name="tRNA(Cys)" sboTerm="SBO:0000240"> | |
| 1882 <notes> | |
| 1883 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1884 <p>kegg.compound: C01639</p> | |
| 1885 <p>PubChem: 4788</p> | |
| 1886 <p>ChEBI: 29167</p> | |
| 1887 </body> | |
| 1888 </notes> | |
| 1889 <annotation> | |
| 1890 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1891 <rdf:Description rdf:about="#b7c6c4f2-9165-4900-94df-31c8d292b519"> | |
| 1892 <bqbiol:is> | |
| 1893 <rdf:Bag> | |
| 1894 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01639"/> | |
| 1895 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29167"/> | |
| 1896 </rdf:Bag> | |
| 1897 </bqbiol:is> | |
| 1898 </rdf:Description> | |
| 1899 </rdf:RDF> | |
| 1900 </annotation> | |
| 1901 </species> | |
| 1902 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C2H3OSR" hasOnlySubstanceUnits="false" id="C03939" metaid="_89a7145c-b09d-477d-be1a-0fe482dc72fd" name="Acetyl-[acyl-carrier protein]" sboTerm="SBO:0000240"> | |
| 1903 <notes> | |
| 1904 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1905 <p>kegg.compound: C03939</p> | |
| 1906 <p>PubChem: 6663</p> | |
| 1907 <p>ChEBI: 17093</p> | |
| 1908 <p>formula: C2H3OSR</p> | |
| 1909 </body> | |
| 1910 </notes> | |
| 1911 <annotation> | |
| 1912 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1913 <rdf:Description rdf:about="#_89a7145c-b09d-477d-be1a-0fe482dc72fd"> | |
| 1914 <bqbiol:is> | |
| 1915 <rdf:Bag> | |
| 1916 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03939"/> | |
| 1917 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17093"/> | |
| 1918 </rdf:Bag> | |
| 1919 </bqbiol:is> | |
| 1920 </rdf:Description> | |
| 1921 </rdf:RDF> | |
| 1922 </annotation> | |
| 1923 </species> | |
| 1924 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C14H26N3O17P3" hasOnlySubstanceUnits="false" id="C11436" metaid="ff0ecf9e-fd12-4f7d-b8a5-f6638dc60e5a" name="2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol" sboTerm="SBO:0000240"> | |
| 1925 <notes> | |
| 1926 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1927 <p>kegg.compound: C11436</p> | |
| 1928 <p>PubChem: 13608</p> | |
| 1929 <p>3DMET: B04264</p> | |
| 1930 <p>PDB-CCD: SUD</p> | |
| 1931 <p>ChEBI: 16840</p> | |
| 1932 <p>NIKKAJI: J1.304.453H</p> | |
| 1933 <p>formula: C14H26N3O17P3</p> | |
| 1934 <p>weight: 601.2874</p> | |
| 1935 </body> | |
| 1936 </notes> | |
| 1937 <annotation> | |
| 1938 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1939 <rdf:Description rdf:about="#ff0ecf9e-fd12-4f7d-b8a5-f6638dc60e5a"> | |
| 1940 <bqbiol:is> | |
| 1941 <rdf:Bag> | |
| 1942 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C11436"/> | |
| 1943 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04264"/> | |
| 1944 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/SUD"/> | |
| 1945 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16840"/> | |
| 1946 </rdf:Bag> | |
| 1947 </bqbiol:is> | |
| 1948 </rdf:Description> | |
| 1949 </rdf:RDF> | |
| 1950 </annotation> | |
| 1951 </species> | |
| 1952 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H11O7P" hasOnlySubstanceUnits="false" id="C11437" metaid="_73f76aaa-c36a-45ea-b018-5f20df83a6d8" name="1-Deoxy-D-xylulose 5-phosphate" sboTerm="SBO:0000240"> | |
| 1953 <notes> | |
| 1954 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1955 <p>kegg.compound: C11437</p> | |
| 1956 <p>KNApSAcK: C00007292</p> | |
| 1957 <p>PubChem: 13609</p> | |
| 1958 <p>3DMET: B04265</p> | |
| 1959 <p>PDB-CCD: DXP</p> | |
| 1960 <p>ChEBI: 16493</p> | |
| 1961 <p>NIKKAJI: J866.535D</p> | |
| 1962 <p>formula: C5H11O7P</p> | |
| 1963 <p>weight: 214.1104</p> | |
| 1964 </body> | |
| 1965 </notes> | |
| 1966 <annotation> | |
| 1967 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1968 <rdf:Description rdf:about="#_73f76aaa-c36a-45ea-b018-5f20df83a6d8"> | |
| 1969 <bqbiol:is> | |
| 1970 <rdf:Bag> | |
| 1971 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C11437"/> | |
| 1972 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007292"/> | |
| 1973 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04265"/> | |
| 1974 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/DXP"/> | |
| 1975 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16493"/> | |
| 1976 </rdf:Bag> | |
| 1977 </bqbiol:is> | |
| 1978 </rdf:Description> | |
| 1979 </rdf:RDF> | |
| 1980 </annotation> | |
| 1981 </species> | |
| 1982 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H13O7P" hasOnlySubstanceUnits="false" id="C11434" metaid="_234b8b69-8541-4510-9ae3-365cca53490c" name="2-C-Methyl-D-erythritol 4-phosphate" sboTerm="SBO:0000240"> | |
| 1983 <notes> | |
| 1984 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1985 <p>kegg.compound: C11434</p> | |
| 1986 <p>KNApSAcK: C00007297</p> | |
| 1987 <p>PubChem: 13606</p> | |
| 1988 <p>3DMET: B04262</p> | |
| 1989 <p>ChEBI: 17764</p> | |
| 1990 <p>NIKKAJI: J865.583I</p> | |
| 1991 <p>formula: C5H13O7P</p> | |
| 1992 <p>weight: 216.1263</p> | |
| 1993 </body> | |
| 1994 </notes> | |
| 1995 <annotation> | |
| 1996 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1997 <rdf:Description rdf:about="#_234b8b69-8541-4510-9ae3-365cca53490c"> | |
| 1998 <bqbiol:is> | |
| 1999 <rdf:Bag> | |
| 2000 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C11434"/> | |
| 2001 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007297"/> | |
| 2002 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04262"/> | |
| 2003 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17764"/> | |
| 2004 </rdf:Bag> | |
| 2005 </bqbiol:is> | |
| 2006 </rdf:Description> | |
| 2007 </rdf:RDF> | |
| 2008 </annotation> | |
| 2009 </species> | |
| 2010 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C14H25N3O14P2" hasOnlySubstanceUnits="false" id="C11435" metaid="_52a3a2ec-0e28-4b7b-afdd-b83a8cf36c9b" name="4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol" sboTerm="SBO:0000240"> | |
| 2011 <notes> | |
| 2012 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2013 <p>kegg.compound: C11435</p> | |
| 2014 <p>KNApSAcK: C00034394</p> | |
| 2015 <p>PubChem: 13607</p> | |
| 2016 <p>3DMET: B04263</p> | |
| 2017 <p>PDB-CCD: CDM</p> | |
| 2018 <p>ChEBI: 16578</p> | |
| 2019 <p>NIKKAJI: J1.231.800F</p> | |
| 2020 <p>formula: C14H25N3O14P2</p> | |
| 2021 <p>weight: 521.3075</p> | |
| 2022 </body> | |
| 2023 </notes> | |
| 2024 <annotation> | |
| 2025 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2026 <rdf:Description rdf:about="#_52a3a2ec-0e28-4b7b-afdd-b83a8cf36c9b"> | |
| 2027 <bqbiol:is> | |
| 2028 <rdf:Bag> | |
| 2029 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C11435"/> | |
| 2030 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00034394"/> | |
| 2031 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04263"/> | |
| 2032 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/CDM"/> | |
| 2033 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16578"/> | |
| 2034 </rdf:Bag> | |
| 2035 </bqbiol:is> | |
| 2036 </rdf:Description> | |
| 2037 </rdf:RDF> | |
| 2038 </annotation> | |
| 2039 </species> | |
| 2040 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H20N2O4" hasOnlySubstanceUnits="false" id="C22458" metaid="_4c6e93d6-7c46-4fe2-ad91-9c31cc92c8c4" name="8-Amino-7-(carboxyamino)nonanoate" sboTerm="SBO:0000240"> | |
| 2041 <notes> | |
| 2042 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2043 <p>kegg.compound: C22458</p> | |
| 2044 <p>formula: C10H20N2O4</p> | |
| 2045 <p>weight: 232.2768</p> | |
| 2046 </body> | |
| 2047 </notes> | |
| 2048 <annotation> | |
| 2049 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2050 <rdf:Description rdf:about="#_4c6e93d6-7c46-4fe2-ad91-9c31cc92c8c4"> | |
| 2051 <bqbiol:is> | |
| 2052 <rdf:Bag> | |
| 2053 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C22458"/> | |
| 2054 </rdf:Bag> | |
| 2055 </bqbiol:is> | |
| 2056 </rdf:Description> | |
| 2057 </rdf:RDF> | |
| 2058 </annotation> | |
| 2059 </species> | |
| 2060 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C8H14N2O5S" hasOnlySubstanceUnits="false" id="C00669" metaid="_853010cb-4224-42c0-a596-ef35a556794e" name="gamma-L-Glutamyl-L-cysteine" sboTerm="SBO:0000240"> | |
| 2061 <notes> | |
| 2062 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2063 <p>kegg.compound: C00669</p> | |
| 2064 <p>KNApSAcK: C00007507</p> | |
| 2065 <p>CAS: 636-58-8</p> | |
| 2066 <p>PubChem: 3938</p> | |
| 2067 <p>3DMET: B01305</p> | |
| 2068 <p>PDB-CCD: 3GC</p> | |
| 2069 <p>ChEBI: 17515</p> | |
| 2070 <p>NIKKAJI: J40.069F</p> | |
| 2071 <p>formula: C8H14N2O5S</p> | |
| 2072 <p>weight: 250.2722</p> | |
| 2073 </body> | |
| 2074 </notes> | |
| 2075 <annotation> | |
| 2076 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2077 <rdf:Description rdf:about="#_853010cb-4224-42c0-a596-ef35a556794e"> | |
| 2078 <bqbiol:is> | |
| 2079 <rdf:Bag> | |
| 2080 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00669"/> | |
| 2081 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007507"/> | |
| 2082 <rdf:li rdf:resource="https://identifiers.org/CAS/636-58-8"/> | |
| 2083 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01305"/> | |
| 2084 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/3GC"/> | |
| 2085 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17515"/> | |
| 2086 </rdf:Bag> | |
| 2087 </bqbiol:is> | |
| 2088 </rdf:Description> | |
| 2089 </rdf:RDF> | |
| 2090 </annotation> | |
| 2091 </species> | |
| 2092 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H13O9P" hasOnlySubstanceUnits="false" id="C00668" metaid="_808eef10-9561-481e-92f5-7bb3bd5ff830" name="alpha-D-Glucose 6-phosphate" sboTerm="SBO:0000240"> | |
| 2093 <notes> | |
| 2094 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2095 <p>kegg.compound: C00668</p> | |
| 2096 <p>PubChem: 3937</p> | |
| 2097 <p>3DMET: B01304</p> | |
| 2098 <p>PDB-CCD: G6P</p> | |
| 2099 <p>ChEBI: 17665</p> | |
| 2100 <p>NIKKAJI: J40.066A</p> | |
| 2101 <p>formula: C6H13O9P</p> | |
| 2102 <p>weight: 260.1358</p> | |
| 2103 </body> | |
| 2104 </notes> | |
| 2105 <annotation> | |
| 2106 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2107 <rdf:Description rdf:about="#_808eef10-9561-481e-92f5-7bb3bd5ff830"> | |
| 2108 <bqbiol:is> | |
| 2109 <rdf:Bag> | |
| 2110 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00668"/> | |
| 2111 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01304"/> | |
| 2112 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/G6P"/> | |
| 2113 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17665"/> | |
| 2114 </rdf:Bag> | |
| 2115 </bqbiol:is> | |
| 2116 </rdf:Description> | |
| 2117 </rdf:RDF> | |
| 2118 </annotation> | |
| 2119 </species> | |
| 2120 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H14N2O4" hasOnlySubstanceUnits="false" id="C00666" metaid="_596e35ae-32ca-423e-89eb-f3a0a217fe1a" name="LL-2,6-Diaminoheptanedioate" sboTerm="SBO:0000240"> | |
| 2121 <notes> | |
| 2122 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2123 <p>kegg.compound: C00666</p> | |
| 2124 <p>KNApSAcK: C00007596</p> | |
| 2125 <p>PubChem: 3935</p> | |
| 2126 <p>3DMET: B01303</p> | |
| 2127 <p>ChEBI: 16026 47031</p> | |
| 2128 <p>LIPIDMAPS: LMFA01170102</p> | |
| 2129 <p>NIKKAJI: J81.742B</p> | |
| 2130 <p>formula: C7H14N2O4</p> | |
| 2131 <p>weight: 190.1971</p> | |
| 2132 </body> | |
| 2133 </notes> | |
| 2134 <annotation> | |
| 2135 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2136 <rdf:Description rdf:about="#_596e35ae-32ca-423e-89eb-f3a0a217fe1a"> | |
| 2137 <bqbiol:is> | |
| 2138 <rdf:Bag> | |
| 2139 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00666"/> | |
| 2140 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007596"/> | |
| 2141 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01303"/> | |
| 2142 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16026 47031"/> | |
| 2143 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA01170102"/> | |
| 2144 </rdf:Bag> | |
| 2145 </bqbiol:is> | |
| 2146 </rdf:Description> | |
| 2147 </rdf:RDF> | |
| 2148 </annotation> | |
| 2149 </species> | |
| 2150 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C00787" metaid="a2bd50f6-0ea2-4b10-a8da-f59fc33b35ce" name="tRNA(Tyr)" sboTerm="SBO:0000240"> | |
| 2151 <notes> | |
| 2152 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2153 <p>kegg.compound: C00787</p> | |
| 2154 <p>PubChem: 4045</p> | |
| 2155 <p>ChEBI: 29182</p> | |
| 2156 </body> | |
| 2157 </notes> | |
| 2158 <annotation> | |
| 2159 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2160 <rdf:Description rdf:about="#a2bd50f6-0ea2-4b10-a8da-f59fc33b35ce"> | |
| 2161 <bqbiol:is> | |
| 2162 <rdf:Bag> | |
| 2163 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00787"/> | |
| 2164 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29182"/> | |
| 2165 </rdf:Bag> | |
| 2166 </bqbiol:is> | |
| 2167 </rdf:Description> | |
| 2168 </rdf:RDF> | |
| 2169 </annotation> | |
| 2170 </species> | |
| 2171 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H11O7P" hasOnlySubstanceUnits="false" id="C00673" metaid="_59374b64-2feb-412f-9c54-bd4498e18294" name="2-Deoxy-D-ribose 5-phosphate" sboTerm="SBO:0000240"> | |
| 2172 <notes> | |
| 2173 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2174 <p>kegg.compound: C00673</p> | |
| 2175 <p>PubChem: 3942</p> | |
| 2176 <p>3DMET: B04714</p> | |
| 2177 <p>PDB-CCD: AAB ORP</p> | |
| 2178 <p>ChEBI: 16132 55513</p> | |
| 2179 <p>NIKKAJI: J993.340I</p> | |
| 2180 <p>formula: C5H11O7P</p> | |
| 2181 <p>weight: 214.1104</p> | |
| 2182 </body> | |
| 2183 </notes> | |
| 2184 <annotation> | |
| 2185 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2186 <rdf:Description rdf:about="#_59374b64-2feb-412f-9c54-bd4498e18294"> | |
| 2187 <bqbiol:is> | |
| 2188 <rdf:Bag> | |
| 2189 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00673"/> | |
| 2190 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04714"/> | |
| 2191 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/AAB ORP"/> | |
| 2192 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16132 55513"/> | |
| 2193 </rdf:Bag> | |
| 2194 </bqbiol:is> | |
| 2195 </rdf:Description> | |
| 2196 </rdf:RDF> | |
| 2197 </annotation> | |
| 2198 </species> | |
| 2199 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C01642" metaid="_36a7ab84-94e6-4f8f-95c3-5e5cb8f9d415" name="tRNA(Gly)" sboTerm="SBO:0000240"> | |
| 2200 <notes> | |
| 2201 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2202 <p>kegg.compound: C01642</p> | |
| 2203 <p>PubChem: 4791</p> | |
| 2204 <p>ChEBI: 29176</p> | |
| 2205 </body> | |
| 2206 </notes> | |
| 2207 <annotation> | |
| 2208 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2209 <rdf:Description rdf:about="#_36a7ab84-94e6-4f8f-95c3-5e5cb8f9d415"> | |
| 2210 <bqbiol:is> | |
| 2211 <rdf:Bag> | |
| 2212 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01642"/> | |
| 2213 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29176"/> | |
| 2214 </rdf:Bag> | |
| 2215 </bqbiol:is> | |
| 2216 </rdf:Description> | |
| 2217 </rdf:RDF> | |
| 2218 </annotation> | |
| 2219 </species> | |
| 2220 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H11O7P" hasOnlySubstanceUnits="false" id="C00672" metaid="_16129a23-5166-467c-9877-540c5636bea7" name="2-Deoxy-D-ribose 1-phosphate" sboTerm="SBO:0000240"> | |
| 2221 <notes> | |
| 2222 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2223 <p>kegg.compound: C00672</p> | |
| 2224 <p>CAS: 17210-42-3</p> | |
| 2225 <p>PubChem: 3941</p> | |
| 2226 <p>3DMET: B04713</p> | |
| 2227 <p>ChEBI: 11563 28542</p> | |
| 2228 <p>NIKKAJI: J1.011.725I</p> | |
| 2229 <p>formula: C5H11O7P</p> | |
| 2230 <p>weight: 214.1104</p> | |
| 2231 </body> | |
| 2232 </notes> | |
| 2233 <annotation> | |
| 2234 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2235 <rdf:Description rdf:about="#_16129a23-5166-467c-9877-540c5636bea7"> | |
| 2236 <bqbiol:is> | |
| 2237 <rdf:Bag> | |
| 2238 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00672"/> | |
| 2239 <rdf:li rdf:resource="https://identifiers.org/CAS/17210-42-3"/> | |
| 2240 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04713"/> | |
| 2241 <rdf:li rdf:resource="https://identifiers.org/ChEBI/11563 28542"/> | |
| 2242 </rdf:Bag> | |
| 2243 </bqbiol:is> | |
| 2244 </rdf:Description> | |
| 2245 </rdf:RDF> | |
| 2246 </annotation> | |
| 2247 </species> | |
| 2248 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C01643" metaid="_82e9d600-0d01-4a7d-a1b6-3db7460bfe0f" name="tRNA(His)" sboTerm="SBO:0000240"> | |
| 2249 <notes> | |
| 2250 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2251 <p>kegg.compound: C01643</p> | |
| 2252 <p>PubChem: 4792</p> | |
| 2253 <p>ChEBI: 29178</p> | |
| 2254 </body> | |
| 2255 </notes> | |
| 2256 <annotation> | |
| 2257 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2258 <rdf:Description rdf:about="#_82e9d600-0d01-4a7d-a1b6-3db7460bfe0f"> | |
| 2259 <bqbiol:is> | |
| 2260 <rdf:Bag> | |
| 2261 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01643"/> | |
| 2262 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29178"/> | |
| 2263 </rdf:Bag> | |
| 2264 </bqbiol:is> | |
| 2265 </rdf:Description> | |
| 2266 </rdf:RDF> | |
| 2267 </annotation> | |
| 2268 </species> | |
| 2269 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H15N6O6P" hasOnlySubstanceUnits="false" id="C22441" metaid="_435f49c0-ce32-4c7d-8a71-0e63b044797a" name="dZMP" sboTerm="SBO:0000240"> | |
| 2270 <notes> | |
| 2271 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2272 <p>kegg.compound: C22441</p> | |
| 2273 <p>PDB-CCD: 1AP</p> | |
| 2274 <p>formula: C10H15N6O6P</p> | |
| 2275 <p>weight: 346.2365</p> | |
| 2276 </body> | |
| 2277 </notes> | |
| 2278 <annotation> | |
| 2279 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2280 <rdf:Description rdf:about="#_435f49c0-ce32-4c7d-8a71-0e63b044797a"> | |
| 2281 <bqbiol:is> | |
| 2282 <rdf:Bag> | |
| 2283 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C22441"/> | |
| 2284 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/1AP"/> | |
| 2285 </rdf:Bag> | |
| 2286 </bqbiol:is> | |
| 2287 </rdf:Description> | |
| 2288 </rdf:RDF> | |
| 2289 </annotation> | |
| 2290 </species> | |
| 2291 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H8O5" hasOnlySubstanceUnits="false" id="C02612" metaid="_13148750-5dc5-47be-a0db-942ef7dd15de" name="(R)-2-Methylmalate" sboTerm="SBO:0000240"> | |
| 2292 <notes> | |
| 2293 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2294 <p>kegg.compound: C02612</p> | |
| 2295 <p>PubChem: 5597</p> | |
| 2296 <p>3DMET: B00465</p> | |
| 2297 <p>ChEBI: 15586 30934</p> | |
| 2298 <p>NIKKAJI: J73.970G</p> | |
| 2299 <p>formula: C5H8O5</p> | |
| 2300 <p>weight: 148.114</p> | |
| 2301 </body> | |
| 2302 </notes> | |
| 2303 <annotation> | |
| 2304 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2305 <rdf:Description rdf:about="#_13148750-5dc5-47be-a0db-942ef7dd15de"> | |
| 2306 <bqbiol:is> | |
| 2307 <rdf:Bag> | |
| 2308 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02612"/> | |
| 2309 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00465"/> | |
| 2310 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15586 30934"/> | |
| 2311 </rdf:Bag> | |
| 2312 </bqbiol:is> | |
| 2313 </rdf:Description> | |
| 2314 </rdf:RDF> | |
| 2315 </annotation> | |
| 2316 </species> | |
| 2317 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C01644" metaid="dc13a571-b46a-4304-bdd4-13193e46c714" name="tRNA(Ile)" sboTerm="SBO:0000240"> | |
| 2318 <notes> | |
| 2319 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2320 <p>kegg.compound: C01644</p> | |
| 2321 <p>PubChem: 4793</p> | |
| 2322 <p>ChEBI: 29174</p> | |
| 2323 </body> | |
| 2324 </notes> | |
| 2325 <annotation> | |
| 2326 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2327 <rdf:Description rdf:about="#dc13a571-b46a-4304-bdd4-13193e46c714"> | |
| 2328 <bqbiol:is> | |
| 2329 <rdf:Bag> | |
| 2330 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01644"/> | |
| 2331 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29174"/> | |
| 2332 </rdf:Bag> | |
| 2333 </bqbiol:is> | |
| 2334 </rdf:Description> | |
| 2335 </rdf:RDF> | |
| 2336 </annotation> | |
| 2337 </species> | |
| 2338 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H10O3" hasOnlySubstanceUnits="false" id="C00671" metaid="cab561df-6acb-4ca6-93b5-54fff0900392" name="(S)-3-Methyl-2-oxopentanoic acid" sboTerm="SBO:0000240"> | |
| 2339 <notes> | |
| 2340 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2341 <p>kegg.compound: C00671</p> | |
| 2342 <p>PubChem: 3940</p> | |
| 2343 <p>3DMET: B01307</p> | |
| 2344 <p>PDB-CCD: 1QQ</p> | |
| 2345 <p>ChEBI: 15614 35146</p> | |
| 2346 <p>LIPIDMAPS: LMFA01020275</p> | |
| 2347 <p>NIKKAJI: J264.814H</p> | |
| 2348 <p>formula: C6H10O3</p> | |
| 2349 <p>weight: 130.1418</p> | |
| 2350 </body> | |
| 2351 </notes> | |
| 2352 <annotation> | |
| 2353 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2354 <rdf:Description rdf:about="#cab561df-6acb-4ca6-93b5-54fff0900392"> | |
| 2355 <bqbiol:is> | |
| 2356 <rdf:Bag> | |
| 2357 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00671"/> | |
| 2358 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01307"/> | |
| 2359 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/1QQ"/> | |
| 2360 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15614 35146"/> | |
| 2361 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA01020275"/> | |
| 2362 </rdf:Bag> | |
| 2363 </bqbiol:is> | |
| 2364 </rdf:Description> | |
| 2365 </rdf:RDF> | |
| 2366 </annotation> | |
| 2367 </species> | |
| 2368 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H16N6O9P2" hasOnlySubstanceUnits="false" id="C22442" metaid="_0bc1c797-7da5-473f-bb9c-417dc2b9e03a" name="dZDP" sboTerm="SBO:0000240"> | |
| 2369 <notes> | |
| 2370 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2371 <p>kegg.compound: C22442</p> | |
| 2372 <p>formula: C10H16N6O9P2</p> | |
| 2373 <p>weight: 426.2164</p> | |
| 2374 </body> | |
| 2375 </notes> | |
| 2376 <annotation> | |
| 2377 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2378 <rdf:Description rdf:about="#_0bc1c797-7da5-473f-bb9c-417dc2b9e03a"> | |
| 2379 <bqbiol:is> | |
| 2380 <rdf:Bag> | |
| 2381 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C22442"/> | |
| 2382 </rdf:Bag> | |
| 2383 </bqbiol:is> | |
| 2384 </rdf:Description> | |
| 2385 </rdf:RDF> | |
| 2386 </annotation> | |
| 2387 </species> | |
| 2388 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C01645" metaid="c184a74b-84dc-4b1c-9654-b5736a727ee1" name="tRNA(Leu)" sboTerm="SBO:0000240"> | |
| 2389 <notes> | |
| 2390 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2391 <p>kegg.compound: C01645</p> | |
| 2392 <p>PubChem: 4794</p> | |
| 2393 <p>ChEBI: 29169</p> | |
| 2394 </body> | |
| 2395 </notes> | |
| 2396 <annotation> | |
| 2397 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2398 <rdf:Description rdf:about="#c184a74b-84dc-4b1c-9654-b5736a727ee1"> | |
| 2399 <bqbiol:is> | |
| 2400 <rdf:Bag> | |
| 2401 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01645"/> | |
| 2402 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29169"/> | |
| 2403 </rdf:Bag> | |
| 2404 </bqbiol:is> | |
| 2405 </rdf:Description> | |
| 2406 </rdf:RDF> | |
| 2407 </annotation> | |
| 2408 </species> | |
| 2409 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C01646" metaid="adb56199-53d4-4faa-913e-39d4bf0ddc50" name="tRNA(Lys)" sboTerm="SBO:0000240"> | |
| 2410 <notes> | |
| 2411 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2412 <p>kegg.compound: C01646</p> | |
| 2413 <p>PubChem: 4795</p> | |
| 2414 <p>ChEBI: 29185</p> | |
| 2415 </body> | |
| 2416 </notes> | |
| 2417 <annotation> | |
| 2418 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2419 <rdf:Description rdf:about="#adb56199-53d4-4faa-913e-39d4bf0ddc50"> | |
| 2420 <bqbiol:is> | |
| 2421 <rdf:Bag> | |
| 2422 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01646"/> | |
| 2423 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29185"/> | |
| 2424 </rdf:Bag> | |
| 2425 </bqbiol:is> | |
| 2426 </rdf:Description> | |
| 2427 </rdf:RDF> | |
| 2428 </annotation> | |
| 2429 </species> | |
| 2430 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C01647" metaid="_22fadf3d-3259-402b-896b-ef455699f860" name="tRNA(Met)" sboTerm="SBO:0000240"> | |
| 2431 <notes> | |
| 2432 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2433 <p>kegg.compound: C01647</p> | |
| 2434 <p>PubChem: 4796</p> | |
| 2435 <p>ChEBI: 29173</p> | |
| 2436 </body> | |
| 2437 </notes> | |
| 2438 <annotation> | |
| 2439 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2440 <rdf:Description rdf:about="#_22fadf3d-3259-402b-896b-ef455699f860"> | |
| 2441 <bqbiol:is> | |
| 2442 <rdf:Bag> | |
| 2443 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01647"/> | |
| 2444 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29173"/> | |
| 2445 </rdf:Bag> | |
| 2446 </bqbiol:is> | |
| 2447 </rdf:Description> | |
| 2448 </rdf:RDF> | |
| 2449 </annotation> | |
| 2450 </species> | |
| 2451 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C15H25N5O15P2" hasOnlySubstanceUnits="false" id="C04916" metaid="ea3fc53b-dc44-44cc-8522-cd37206eb16b" name="N-(5'-Phospho-D-1'-ribulosylformimino)-5-amino-1-(5''-phospho-D-ribosyl)-4-imidazolecarboxamide" sboTerm="SBO:0000240"> | |
| 2452 <notes> | |
| 2453 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2454 <p>kegg.compound: C04916</p> | |
| 2455 <p>PubChem: 7464</p> | |
| 2456 <p>3DMET: B01804</p> | |
| 2457 <p>PDB-CCD: 2ER</p> | |
| 2458 <p>ChEBI: 27735</p> | |
| 2459 <p>NIKKAJI: J2.760.456K</p> | |
| 2460 <p>formula: C15H25N5O15P2</p> | |
| 2461 <p>weight: 577.331</p> | |
| 2462 </body> | |
| 2463 </notes> | |
| 2464 <annotation> | |
| 2465 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2466 <rdf:Description rdf:about="#ea3fc53b-dc44-44cc-8522-cd37206eb16b"> | |
| 2467 <bqbiol:is> | |
| 2468 <rdf:Bag> | |
| 2469 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04916"/> | |
| 2470 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01804"/> | |
| 2471 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/2ER"/> | |
| 2472 <rdf:li rdf:resource="https://identifiers.org/ChEBI/27735"/> | |
| 2473 </rdf:Bag> | |
| 2474 </bqbiol:is> | |
| 2475 </rdf:Description> | |
| 2476 </rdf:RDF> | |
| 2477 </annotation> | |
| 2478 </species> | |
| 2479 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C01648" metaid="fd39ecfa-0b71-4a95-b686-f3c2394e7f5b" name="tRNA(Phe)" sboTerm="SBO:0000240"> | |
| 2480 <notes> | |
| 2481 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2482 <p>kegg.compound: C01648</p> | |
| 2483 <p>PubChem: 4797</p> | |
| 2484 <p>ChEBI: 29184</p> | |
| 2485 </body> | |
| 2486 </notes> | |
| 2487 <annotation> | |
| 2488 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2489 <rdf:Description rdf:about="#fd39ecfa-0b71-4a95-b686-f3c2394e7f5b"> | |
| 2490 <bqbiol:is> | |
| 2491 <rdf:Bag> | |
| 2492 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01648"/> | |
| 2493 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29184"/> | |
| 2494 </rdf:Bag> | |
| 2495 </bqbiol:is> | |
| 2496 </rdf:Description> | |
| 2497 </rdf:RDF> | |
| 2498 </annotation> | |
| 2499 </species> | |
| 2500 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C01649" metaid="_01c43d1e-9ee4-4a48-a80e-c074104378ce" name="tRNA(Pro)" sboTerm="SBO:0000240"> | |
| 2501 <notes> | |
| 2502 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2503 <p>kegg.compound: C01649</p> | |
| 2504 <p>PubChem: 4798</p> | |
| 2505 <p>ChEBI: 29177</p> | |
| 2506 </body> | |
| 2507 </notes> | |
| 2508 <annotation> | |
| 2509 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2510 <rdf:Description rdf:about="#_01c43d1e-9ee4-4a48-a80e-c074104378ce"> | |
| 2511 <bqbiol:is> | |
| 2512 <rdf:Bag> | |
| 2513 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01649"/> | |
| 2514 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29177"/> | |
| 2515 </rdf:Bag> | |
| 2516 </bqbiol:is> | |
| 2517 </rdf:Description> | |
| 2518 </rdf:RDF> | |
| 2519 </annotation> | |
| 2520 </species> | |
| 2521 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="H2Se" hasOnlySubstanceUnits="false" id="C01528" metaid="e69e916c-ce44-43d0-96b4-d42cfa2d50ee" name="Hydrogen selenide" sboTerm="SBO:0000240"> | |
| 2522 <notes> | |
| 2523 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2524 <p>kegg.compound: C01528</p> | |
| 2525 <p>CAS: 7783-07-5</p> | |
| 2526 <p>PubChem: 4690</p> | |
| 2527 <p>3DMET: B01460</p> | |
| 2528 <p>PDB-CCD: SE</p> | |
| 2529 <p>ChEBI: 16503</p> | |
| 2530 <p>formula: H2Se</p> | |
| 2531 <p>weight: 80.9759</p> | |
| 2532 </body> | |
| 2533 </notes> | |
| 2534 <annotation> | |
| 2535 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2536 <rdf:Description rdf:about="#e69e916c-ce44-43d0-96b4-d42cfa2d50ee"> | |
| 2537 <bqbiol:is> | |
| 2538 <rdf:Bag> | |
| 2539 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01528"/> | |
| 2540 <rdf:li rdf:resource="https://identifiers.org/CAS/7783-07-5"/> | |
| 2541 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01460"/> | |
| 2542 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/SE"/> | |
| 2543 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16503"/> | |
| 2544 </rdf:Bag> | |
| 2545 </bqbiol:is> | |
| 2546 </rdf:Description> | |
| 2547 </rdf:RDF> | |
| 2548 </annotation> | |
| 2549 </species> | |
| 2550 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C15H25N5O20P4" hasOnlySubstanceUnits="false" id="C02739" metaid="b67528bd-8d46-43d4-b7f2-f5072f6fb308" name="1-(5-Phospho-D-ribosyl)-ATP" sboTerm="SBO:0000240"> | |
| 2551 <notes> | |
| 2552 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2553 <p>kegg.compound: C02739</p> | |
| 2554 <p>PubChem: 5699</p> | |
| 2555 <p>3DMET: B04862</p> | |
| 2556 <p>ChEBI: 73200</p> | |
| 2557 <p>NIKKAJI: J608.031F</p> | |
| 2558 <p>formula: C15H25N5O20P4</p> | |
| 2559 <p>weight: 719.2755</p> | |
| 2560 </body> | |
| 2561 </notes> | |
| 2562 <annotation> | |
| 2563 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2564 <rdf:Description rdf:about="#b67528bd-8d46-43d4-b7f2-f5072f6fb308"> | |
| 2565 <bqbiol:is> | |
| 2566 <rdf:Bag> | |
| 2567 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02739"/> | |
| 2568 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04862"/> | |
| 2569 <rdf:li rdf:resource="https://identifiers.org/ChEBI/73200"/> | |
| 2570 </rdf:Bag> | |
| 2571 </bqbiol:is> | |
| 2572 </rdf:Description> | |
| 2573 </rdf:RDF> | |
| 2574 </annotation> | |
| 2575 </species> | |
| 2576 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H8N2O5" hasOnlySubstanceUnits="false" id="C00438" metaid="c211fb8b-e795-4817-b8bf-bedda74c320e" name="N-Carbamoyl-L-aspartate" sboTerm="SBO:0000240"> | |
| 2577 <notes> | |
| 2578 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2579 <p>kegg.compound: C00438</p> | |
| 2580 <p>KNApSAcK: C00007265</p> | |
| 2581 <p>PubChem: 3727</p> | |
| 2582 <p>3DMET: B00115</p> | |
| 2583 <p>PDB-CCD: NCD</p> | |
| 2584 <p>ChEBI: 15859</p> | |
| 2585 <p>NIKKAJI: J39.568D</p> | |
| 2586 <p>formula: C5H8N2O5</p> | |
| 2587 <p>weight: 176.1274</p> | |
| 2588 </body> | |
| 2589 </notes> | |
| 2590 <annotation> | |
| 2591 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2592 <rdf:Description rdf:about="#c211fb8b-e795-4817-b8bf-bedda74c320e"> | |
| 2593 <bqbiol:is> | |
| 2594 <rdf:Bag> | |
| 2595 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00438"/> | |
| 2596 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007265"/> | |
| 2597 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00115"/> | |
| 2598 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/NCD"/> | |
| 2599 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15859"/> | |
| 2600 </rdf:Bag> | |
| 2601 </bqbiol:is> | |
| 2602 </rdf:Description> | |
| 2603 </rdf:RDF> | |
| 2604 </annotation> | |
| 2605 </species> | |
| 2606 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H13N5O3" hasOnlySubstanceUnits="false" id="C00559" metaid="_2ab3cec0-b757-4188-b73e-11fdb96ec5e1" name="Deoxyadenosine" sboTerm="SBO:0000240"> | |
| 2607 <notes> | |
| 2608 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2609 <p>kegg.compound: C00559</p> | |
| 2610 <p>KNApSAcK: C00019281</p> | |
| 2611 <p>CAS: 958-09-8</p> | |
| 2612 <p>PubChem: 3839</p> | |
| 2613 <p>3DMET: B01287</p> | |
| 2614 <p>PDB-CCD: 3D1</p> | |
| 2615 <p>ChEBI: 17256</p> | |
| 2616 <p>NIKKAJI: J80.042B</p> | |
| 2617 <p>formula: C10H13N5O3</p> | |
| 2618 <p>weight: 251.2419</p> | |
| 2619 </body> | |
| 2620 </notes> | |
| 2621 <annotation> | |
| 2622 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2623 <rdf:Description rdf:about="#_2ab3cec0-b757-4188-b73e-11fdb96ec5e1"> | |
| 2624 <bqbiol:is> | |
| 2625 <rdf:Bag> | |
| 2626 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00559"/> | |
| 2627 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019281"/> | |
| 2628 <rdf:li rdf:resource="https://identifiers.org/CAS/958-09-8"/> | |
| 2629 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01287"/> | |
| 2630 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/3D1"/> | |
| 2631 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17256"/> | |
| 2632 </rdf:Bag> | |
| 2633 </bqbiol:is> | |
| 2634 </rdf:Description> | |
| 2635 </rdf:RDF> | |
| 2636 </annotation> | |
| 2637 </species> | |
| 2638 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H14N2O3" hasOnlySubstanceUnits="false" id="C00437" metaid="_431b86a5-8075-42d5-95bf-5b96dd561886" name="N-Acetylornithine" sboTerm="SBO:0000240"> | |
| 2639 <notes> | |
| 2640 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2641 <p>kegg.compound: C00437</p> | |
| 2642 <p>CAS: 6205-08-9</p> | |
| 2643 <p>PubChem: 3726</p> | |
| 2644 <p>3DMET: B00114</p> | |
| 2645 <p>PDB-CCD: AOR</p> | |
| 2646 <p>ChEBI: 16543 181895</p> | |
| 2647 <p>NIKKAJI: J37.495D</p> | |
| 2648 <p>formula: C7H14N2O3</p> | |
| 2649 <p>weight: 174.1977</p> | |
| 2650 </body> | |
| 2651 </notes> | |
| 2652 <annotation> | |
| 2653 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2654 <rdf:Description rdf:about="#_431b86a5-8075-42d5-95bf-5b96dd561886"> | |
| 2655 <bqbiol:is> | |
| 2656 <rdf:Bag> | |
| 2657 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00437"/> | |
| 2658 <rdf:li rdf:resource="https://identifiers.org/CAS/6205-08-9"/> | |
| 2659 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00114"/> | |
| 2660 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/AOR"/> | |
| 2661 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16543 181895"/> | |
| 2662 </rdf:Bag> | |
| 2663 </bqbiol:is> | |
| 2664 </rdf:Description> | |
| 2665 </rdf:RDF> | |
| 2666 </annotation> | |
| 2667 </species> | |
| 2668 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H19N3" hasOnlySubstanceUnits="false" id="C00315" metaid="edd54859-f28e-4c7c-a0c1-1bfc2c9211f4" name="Spermidine" sboTerm="SBO:0000240"> | |
| 2669 <notes> | |
| 2670 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2671 <p>kegg.compound: C00315</p> | |
| 2672 <p>KNApSAcK: C00001431</p> | |
| 2673 <p>CAS: 124-20-9</p> | |
| 2674 <p>PubChem: 3609</p> | |
| 2675 <p>3DMET: B01214</p> | |
| 2676 <p>PDB-CCD: SPD SR0</p> | |
| 2677 <p>ChEBI: 16610</p> | |
| 2678 <p>NIKKAJI: J10.054D</p> | |
| 2679 <p>formula: C7H19N3</p> | |
| 2680 <p>weight: 145.2459</p> | |
| 2681 </body> | |
| 2682 </notes> | |
| 2683 <annotation> | |
| 2684 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2685 <rdf:Description rdf:about="#edd54859-f28e-4c7c-a0c1-1bfc2c9211f4"> | |
| 2686 <bqbiol:is> | |
| 2687 <rdf:Bag> | |
| 2688 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00315"/> | |
| 2689 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001431"/> | |
| 2690 <rdf:li rdf:resource="https://identifiers.org/CAS/124-20-9"/> | |
| 2691 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01214"/> | |
| 2692 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/SPD SR0"/> | |
| 2693 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16610"/> | |
| 2694 </rdf:Bag> | |
| 2695 </bqbiol:is> | |
| 2696 </rdf:Description> | |
| 2697 </rdf:RDF> | |
| 2698 </annotation> | |
| 2699 </species> | |
| 2700 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C01640" metaid="_616a0e40-5c28-4553-86cd-0d1cfafc2ca2" name="tRNA(Gln)" sboTerm="SBO:0000240"> | |
| 2701 <notes> | |
| 2702 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2703 <p>kegg.compound: C01640</p> | |
| 2704 <p>PubChem: 4789</p> | |
| 2705 <p>ChEBI: 29168</p> | |
| 2706 </body> | |
| 2707 </notes> | |
| 2708 <annotation> | |
| 2709 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2710 <rdf:Description rdf:about="#_616a0e40-5c28-4553-86cd-0d1cfafc2ca2"> | |
| 2711 <bqbiol:is> | |
| 2712 <rdf:Bag> | |
| 2713 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01640"/> | |
| 2714 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29168"/> | |
| 2715 </rdf:Bag> | |
| 2716 </bqbiol:is> | |
| 2717 </rdf:Description> | |
| 2718 </rdf:RDF> | |
| 2719 </annotation> | |
| 2720 </species> | |
| 2721 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C8H16NOS2R" hasOnlySubstanceUnits="false" id="C02972" metaid="_45e83d96-6670-4b40-99f8-e95798290d83" name="Dihydrolipoylprotein" sboTerm="SBO:0000240"> | |
| 2722 <notes> | |
| 2723 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2724 <p>kegg.compound: C02972</p> | |
| 2725 <p>PubChem: 5884</p> | |
| 2726 <p>ChEBI: 16194</p> | |
| 2727 <p>formula: C8H16NOS2R</p> | |
| 2728 </body> | |
| 2729 </notes> | |
| 2730 <annotation> | |
| 2731 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2732 <rdf:Description rdf:about="#_45e83d96-6670-4b40-99f8-e95798290d83"> | |
| 2733 <bqbiol:is> | |
| 2734 <rdf:Bag> | |
| 2735 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02972"/> | |
| 2736 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16194"/> | |
| 2737 </rdf:Bag> | |
| 2738 </bqbiol:is> | |
| 2739 </rdf:Description> | |
| 2740 </rdf:RDF> | |
| 2741 </annotation> | |
| 2742 </species> | |
| 2743 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C01641" metaid="_63bc1703-fa7c-4ac7-b7f9-5b8ae1a6af73" name="tRNA(Glu)" sboTerm="SBO:0000240"> | |
| 2744 <notes> | |
| 2745 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2746 <p>kegg.compound: C01641</p> | |
| 2747 <p>PubChem: 4790</p> | |
| 2748 <p>ChEBI: 29175</p> | |
| 2749 </body> | |
| 2750 </notes> | |
| 2751 <annotation> | |
| 2752 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2753 <rdf:Description rdf:about="#_63bc1703-fa7c-4ac7-b7f9-5b8ae1a6af73"> | |
| 2754 <bqbiol:is> | |
| 2755 <rdf:Bag> | |
| 2756 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01641"/> | |
| 2757 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29175"/> | |
| 2758 </rdf:Bag> | |
| 2759 </bqbiol:is> | |
| 2760 </rdf:Description> | |
| 2761 </rdf:RDF> | |
| 2762 </annotation> | |
| 2763 </species> | |
| 2764 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H12N4O6" hasOnlySubstanceUnits="false" id="C01762" metaid="_4c19b56a-d007-4283-a873-4104d958fb01" name="Xanthosine" sboTerm="SBO:0000240"> | |
| 2765 <notes> | |
| 2766 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2767 <p>kegg.compound: C01762</p> | |
| 2768 <p>KNApSAcK: C00007222</p> | |
| 2769 <p>CAS: 146-80-5</p> | |
| 2770 <p>PubChem: 4895</p> | |
| 2771 <p>3DMET: B01495</p> | |
| 2772 <p>PDB-CCD: 4UO</p> | |
| 2773 <p>ChEBI: 18107</p> | |
| 2774 <p>NIKKAJI: J9.367J</p> | |
| 2775 <p>formula: C10H12N4O6</p> | |
| 2776 <p>weight: 284.2255</p> | |
| 2777 </body> | |
| 2778 </notes> | |
| 2779 <annotation> | |
| 2780 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2781 <rdf:Description rdf:about="#_4c19b56a-d007-4283-a873-4104d958fb01"> | |
| 2782 <bqbiol:is> | |
| 2783 <rdf:Bag> | |
| 2784 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01762"/> | |
| 2785 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007222"/> | |
| 2786 <rdf:li rdf:resource="https://identifiers.org/CAS/146-80-5"/> | |
| 2787 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01495"/> | |
| 2788 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/4UO"/> | |
| 2789 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18107"/> | |
| 2790 </rdf:Bag> | |
| 2791 </bqbiol:is> | |
| 2792 </rdf:Description> | |
| 2793 </rdf:RDF> | |
| 2794 </annotation> | |
| 2795 </species> | |
| 2796 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C01653" metaid="_538826bc-18f5-4882-b6fe-2e1569cfd001" name="tRNA(Val)" sboTerm="SBO:0000240"> | |
| 2797 <notes> | |
| 2798 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2799 <p>kegg.compound: C01653</p> | |
| 2800 <p>PubChem: 4802</p> | |
| 2801 <p>ChEBI: 29183</p> | |
| 2802 </body> | |
| 2803 </notes> | |
| 2804 <annotation> | |
| 2805 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2806 <rdf:Description rdf:about="#_538826bc-18f5-4882-b6fe-2e1569cfd001"> | |
| 2807 <bqbiol:is> | |
| 2808 <rdf:Bag> | |
| 2809 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01653"/> | |
| 2810 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29183"/> | |
| 2811 </rdf:Bag> | |
| 2812 </bqbiol:is> | |
| 2813 </rdf:Description> | |
| 2814 </rdf:RDF> | |
| 2815 </annotation> | |
| 2816 </species> | |
| 2817 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C02984" metaid="_2be51140-bb57-41b1-a293-6178e8a76a75" name="L-Aspartyl-tRNA(Asp)" sboTerm="SBO:0000240"> | |
| 2818 <notes> | |
| 2819 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2820 <p>kegg.compound: C02984</p> | |
| 2821 <p>PubChem: 5893</p> | |
| 2822 <p>ChEBI: 29158</p> | |
| 2823 <p>formula: C14H22NO13PR2(C5H8O6PR)n</p> | |
| 2824 </body> | |
| 2825 </notes> | |
| 2826 <annotation> | |
| 2827 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2828 <rdf:Description rdf:about="#_2be51140-bb57-41b1-a293-6178e8a76a75"> | |
| 2829 <bqbiol:is> | |
| 2830 <rdf:Bag> | |
| 2831 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02984"/> | |
| 2832 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29158"/> | |
| 2833 </rdf:Bag> | |
| 2834 </bqbiol:is> | |
| 2835 </rdf:Description> | |
| 2836 </rdf:RDF> | |
| 2837 </annotation> | |
| 2838 </species> | |
| 2839 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H7NO3" hasOnlySubstanceUnits="false" id="C00441" metaid="_0510dd78-2708-450a-a1ea-612d3b3ab760" name="L-Aspartate 4-semialdehyde" sboTerm="SBO:0000240"> | |
| 2840 <notes> | |
| 2841 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2842 <p>kegg.compound: C00441</p> | |
| 2843 <p>KNApSAcK: C00007469</p> | |
| 2844 <p>PubChem: 3730</p> | |
| 2845 <p>3DMET: B00117</p> | |
| 2846 <p>ChEBI: 13086 18051</p> | |
| 2847 <p>NIKKAJI: J457.019G</p> | |
| 2848 <p>formula: C4H7NO3</p> | |
| 2849 <p>weight: 117.1033</p> | |
| 2850 </body> | |
| 2851 </notes> | |
| 2852 <annotation> | |
| 2853 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2854 <rdf:Description rdf:about="#_0510dd78-2708-450a-a1ea-612d3b3ab760"> | |
| 2855 <bqbiol:is> | |
| 2856 <rdf:Bag> | |
| 2857 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00441"/> | |
| 2858 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007469"/> | |
| 2859 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00117"/> | |
| 2860 <rdf:li rdf:resource="https://identifiers.org/ChEBI/13086 18051"/> | |
| 2861 </rdf:Bag> | |
| 2862 </bqbiol:is> | |
| 2863 </rdf:Description> | |
| 2864 </rdf:RDF> | |
| 2865 </annotation> | |
| 2866 </species> | |
| 2867 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C20H25N7O6" hasOnlySubstanceUnits="false" id="C00440" metaid="_6b972d8d-105c-45db-9390-480d2956cfd2" name="5-Methyltetrahydrofolate" sboTerm="SBO:0000240"> | |
| 2868 <notes> | |
| 2869 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2870 <p>kegg.compound: C00440</p> | |
| 2871 <p>KNApSAcK: C00007252</p> | |
| 2872 <p>CAS: 134-35-0</p> | |
| 2873 <p>PubChem: 3729</p> | |
| 2874 <p>3DMET: B04681</p> | |
| 2875 <p>PDB-CCD: C2F THH</p> | |
| 2876 <p>ChEBI: 15641</p> | |
| 2877 <p>NIKKAJI: J356.349I</p> | |
| 2878 <p>formula: C20H25N7O6</p> | |
| 2879 <p>weight: 459.4558</p> | |
| 2880 </body> | |
| 2881 </notes> | |
| 2882 <annotation> | |
| 2883 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2884 <rdf:Description rdf:about="#_6b972d8d-105c-45db-9390-480d2956cfd2"> | |
| 2885 <bqbiol:is> | |
| 2886 <rdf:Bag> | |
| 2887 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00440"/> | |
| 2888 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007252"/> | |
| 2889 <rdf:li rdf:resource="https://identifiers.org/CAS/134-35-0"/> | |
| 2890 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04681"/> | |
| 2891 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/C2F THH"/> | |
| 2892 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15641"/> | |
| 2893 </rdf:Bag> | |
| 2894 </bqbiol:is> | |
| 2895 </rdf:Description> | |
| 2896 </rdf:RDF> | |
| 2897 </annotation> | |
| 2898 </species> | |
| 2899 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C02987" metaid="_203fc375-67de-4b14-8f30-ae5668aba2a0" name="L-Glutamyl-tRNA(Glu)" sboTerm="SBO:0000240"> | |
| 2900 <notes> | |
| 2901 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2902 <p>kegg.compound: C02987</p> | |
| 2903 <p>PubChem: 5896</p> | |
| 2904 <p>ChEBI: 29157</p> | |
| 2905 <p>formula: C20H28N6O13PR(C5H8O6PR)n</p> | |
| 2906 </body> | |
| 2907 </notes> | |
| 2908 <annotation> | |
| 2909 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2910 <rdf:Description rdf:about="#_203fc375-67de-4b14-8f30-ae5668aba2a0"> | |
| 2911 <bqbiol:is> | |
| 2912 <rdf:Bag> | |
| 2913 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02987"/> | |
| 2914 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29157"/> | |
| 2915 </rdf:Bag> | |
| 2916 </bqbiol:is> | |
| 2917 </rdf:Description> | |
| 2918 </rdf:RDF> | |
| 2919 </annotation> | |
| 2920 </species> | |
| 2921 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C02745" metaid="_06244b59-3fe8-407b-a2dd-a9b134d65bc7" name="Reduced flavodoxin" sboTerm="SBO:0000240"> | |
| 2922 <notes> | |
| 2923 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2924 <p>kegg.compound: C02745</p> | |
| 2925 <p>PubChem: 5705</p> | |
| 2926 </body> | |
| 2927 </notes> | |
| 2928 <annotation> | |
| 2929 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2930 <rdf:Description rdf:about="#_06244b59-3fe8-407b-a2dd-a9b134d65bc7"> | |
| 2931 <bqbiol:is> | |
| 2932 <rdf:Bag> | |
| 2933 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02745"/> | |
| 2934 </rdf:Bag> | |
| 2935 </bqbiol:is> | |
| 2936 </rdf:Description> | |
| 2937 </rdf:RDF> | |
| 2938 </annotation> | |
| 2939 </species> | |
| 2940 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H14N2O4" hasOnlySubstanceUnits="false" id="C00680" metaid="_8907b5ff-90da-4fe8-b84f-fbf98a20d93a" name="meso-2,6-Diaminoheptanedioate" sboTerm="SBO:0000240"> | |
| 2941 <notes> | |
| 2942 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2943 <p>kegg.compound: C00680</p> | |
| 2944 <p>KNApSAcK: C00007595</p> | |
| 2945 <p>PubChem: 3949</p> | |
| 2946 <p>3DMET: B01309</p> | |
| 2947 <p>PDB-CCD: 6CL API</p> | |
| 2948 <p>ChEBI: 16488 30308</p> | |
| 2949 <p>NIKKAJI: J407.120D</p> | |
| 2950 <p>formula: C7H14N2O4</p> | |
| 2951 <p>weight: 190.1971</p> | |
| 2952 </body> | |
| 2953 </notes> | |
| 2954 <annotation> | |
| 2955 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2956 <rdf:Description rdf:about="#_8907b5ff-90da-4fe8-b84f-fbf98a20d93a"> | |
| 2957 <bqbiol:is> | |
| 2958 <rdf:Bag> | |
| 2959 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00680"/> | |
| 2960 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007595"/> | |
| 2961 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01309"/> | |
| 2962 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/6CL API"/> | |
| 2963 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16488 30308"/> | |
| 2964 </rdf:Bag> | |
| 2965 </bqbiol:is> | |
| 2966 </rdf:Description> | |
| 2967 </rdf:RDF> | |
| 2968 </annotation> | |
| 2969 </species> | |
| 2970 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H12O5" hasOnlySubstanceUnits="false" id="C02504" metaid="f2bda3af-0d88-4eee-8e8f-d0a5fb1c6a1b" name="alpha-Isopropylmalate" sboTerm="SBO:0000240"> | |
| 2971 <notes> | |
| 2972 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2973 <p>kegg.compound: C02504</p> | |
| 2974 <p>KNApSAcK: C00019690</p> | |
| 2975 <p>PubChem: 5516</p> | |
| 2976 <p>3DMET: B01581</p> | |
| 2977 <p>PDB-CCD: VPM</p> | |
| 2978 <p>ChEBI: 1178 35128</p> | |
| 2979 <p>LIPIDMAPS: LMFA01170083</p> | |
| 2980 <p>NIKKAJI: J319.987H</p> | |
| 2981 <p>formula: C7H12O5</p> | |
| 2982 <p>weight: 176.1672</p> | |
| 2983 </body> | |
| 2984 </notes> | |
| 2985 <annotation> | |
| 2986 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2987 <rdf:Description rdf:about="#f2bda3af-0d88-4eee-8e8f-d0a5fb1c6a1b"> | |
| 2988 <bqbiol:is> | |
| 2989 <rdf:Bag> | |
| 2990 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02504"/> | |
| 2991 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019690"/> | |
| 2992 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01581"/> | |
| 2993 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/VPM"/> | |
| 2994 <rdf:li rdf:resource="https://identifiers.org/ChEBI/1178 35128"/> | |
| 2995 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA01170083"/> | |
| 2996 </rdf:Bag> | |
| 2997 </bqbiol:is> | |
| 2998 </rdf:Description> | |
| 2999 </rdf:RDF> | |
| 3000 </annotation> | |
| 3001 </species> | |
| 3002 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C02988" metaid="_56ca4de7-6ca4-402d-b8f8-483461e3a211" name="L-Histidyl-tRNA(His)" sboTerm="SBO:0000240"> | |
| 3003 <notes> | |
| 3004 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3005 <p>kegg.compound: C02988</p> | |
| 3006 <p>PubChem: 5897</p> | |
| 3007 <p>ChEBI: 29155</p> | |
| 3008 <p>formula: C16H24N3O11PR2(C5H8O6PR)n</p> | |
| 3009 </body> | |
| 3010 </notes> | |
| 3011 <annotation> | |
| 3012 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3013 <rdf:Description rdf:about="#_56ca4de7-6ca4-402d-b8f8-483461e3a211"> | |
| 3014 <bqbiol:is> | |
| 3015 <rdf:Bag> | |
| 3016 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02988"/> | |
| 3017 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29155"/> | |
| 3018 </rdf:Bag> | |
| 3019 </bqbiol:is> | |
| 3020 </rdf:Description> | |
| 3021 </rdf:RDF> | |
| 3022 </annotation> | |
| 3023 </species> | |
| 3024 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H15N2O8P" hasOnlySubstanceUnits="false" id="C03838" metaid="_5f72be39-cd4b-435c-b7b9-6202d9bdcb55" name="5'-Phosphoribosylglycinamide" sboTerm="SBO:0000240"> | |
| 3025 <notes> | |
| 3026 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3027 <p>kegg.compound: C03838</p> | |
| 3028 <p>KNApSAcK: C00007395</p> | |
| 3029 <p>CAS: 10074-18-7</p> | |
| 3030 <p>PubChem: 6578</p> | |
| 3031 <p>3DMET: B04915</p> | |
| 3032 <p>PDB-CCD: GAR</p> | |
| 3033 <p>ChEBI: 18349</p> | |
| 3034 <p>NIKKAJI: J372.863C</p> | |
| 3035 <p>formula: C7H15N2O8P</p> | |
| 3036 <p>weight: 286.1764</p> | |
| 3037 </body> | |
| 3038 </notes> | |
| 3039 <annotation> | |
| 3040 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3041 <rdf:Description rdf:about="#_5f72be39-cd4b-435c-b7b9-6202d9bdcb55"> | |
| 3042 <bqbiol:is> | |
| 3043 <rdf:Bag> | |
| 3044 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03838"/> | |
| 3045 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007395"/> | |
| 3046 <rdf:li rdf:resource="https://identifiers.org/CAS/10074-18-7"/> | |
| 3047 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04915"/> | |
| 3048 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/GAR"/> | |
| 3049 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18349"/> | |
| 3050 </rdf:Bag> | |
| 3051 </bqbiol:is> | |
| 3052 </rdf:Description> | |
| 3053 </rdf:RDF> | |
| 3054 </annotation> | |
| 3055 </species> | |
| 3056 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C02869" metaid="_6ccb6a02-5c8b-4d2d-bb89-6f0dd5e75afb" name="Oxidized flavodoxin" sboTerm="SBO:0000240"> | |
| 3057 <notes> | |
| 3058 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3059 <p>kegg.compound: C02869</p> | |
| 3060 <p>PubChem: 5805</p> | |
| 3061 </body> | |
| 3062 </notes> | |
| 3063 <annotation> | |
| 3064 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3065 <rdf:Description rdf:about="#_6ccb6a02-5c8b-4d2d-bb89-6f0dd5e75afb"> | |
| 3066 <bqbiol:is> | |
| 3067 <rdf:Bag> | |
| 3068 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02869"/> | |
| 3069 </rdf:Bag> | |
| 3070 </bqbiol:is> | |
| 3071 </rdf:Description> | |
| 3072 </rdf:RDF> | |
| 3073 </annotation> | |
| 3074 </species> | |
| 3075 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H10N2O3S" hasOnlySubstanceUnits="false" id="C01419" metaid="_0ad96800-90da-4e39-a620-6c90d7a97f8f" name="Cys-Gly" sboTerm="SBO:0000240"> | |
| 3076 <notes> | |
| 3077 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3078 <p>kegg.compound: C01419</p> | |
| 3079 <p>CAS: 19246-18-5</p> | |
| 3080 <p>PubChem: 4606</p> | |
| 3081 <p>3DMET: B01448</p> | |
| 3082 <p>ChEBI: 4047</p> | |
| 3083 <p>NIKKAJI: J36.789C</p> | |
| 3084 <p>formula: C5H10N2O3S</p> | |
| 3085 <p>weight: 178.2095</p> | |
| 3086 </body> | |
| 3087 </notes> | |
| 3088 <annotation> | |
| 3089 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3090 <rdf:Description rdf:about="#_0ad96800-90da-4e39-a620-6c90d7a97f8f"> | |
| 3091 <bqbiol:is> | |
| 3092 <rdf:Bag> | |
| 3093 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01419"/> | |
| 3094 <rdf:li rdf:resource="https://identifiers.org/CAS/19246-18-5"/> | |
| 3095 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01448"/> | |
| 3096 <rdf:li rdf:resource="https://identifiers.org/ChEBI/4047"/> | |
| 3097 </rdf:Bag> | |
| 3098 </bqbiol:is> | |
| 3099 </rdf:Description> | |
| 3100 </rdf:RDF> | |
| 3101 </annotation> | |
| 3102 </species> | |
| 3103 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H12O9P2" hasOnlySubstanceUnits="false" id="C11453" metaid="fa23661d-3f58-4597-b6b1-16ccbb909125" name="2-C-Methyl-D-erythritol 2,4-cyclodiphosphate" sboTerm="SBO:0000240"> | |
| 3104 <notes> | |
| 3105 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3106 <p>kegg.compound: C11453</p> | |
| 3107 <p>KNApSAcK: C00007295</p> | |
| 3108 <p>CAS: 143488-44-2</p> | |
| 3109 <p>PubChem: 13625</p> | |
| 3110 <p>3DMET: B04266</p> | |
| 3111 <p>PDB-CCD: CDI</p> | |
| 3112 <p>ChEBI: 18425</p> | |
| 3113 <p>NIKKAJI: J726.915C</p> | |
| 3114 <p>formula: C5H12O9P2</p> | |
| 3115 <p>weight: 278.0909</p> | |
| 3116 </body> | |
| 3117 </notes> | |
| 3118 <annotation> | |
| 3119 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3120 <rdf:Description rdf:about="#fa23661d-3f58-4597-b6b1-16ccbb909125"> | |
| 3121 <bqbiol:is> | |
| 3122 <rdf:Bag> | |
| 3123 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C11453"/> | |
| 3124 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007295"/> | |
| 3125 <rdf:li rdf:resource="https://identifiers.org/CAS/143488-44-2"/> | |
| 3126 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04266"/> | |
| 3127 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/CDI"/> | |
| 3128 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18425"/> | |
| 3129 </rdf:Bag> | |
| 3130 </bqbiol:is> | |
| 3131 </rdf:Description> | |
| 3132 </rdf:RDF> | |
| 3133 </annotation> | |
| 3134 </species> | |
| 3135 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H22O11" hasOnlySubstanceUnits="false" id="C00208" metaid="_9e2d88a2-ed35-4c77-9959-17aa5c9f7dd9" name="Maltose" sboTerm="SBO:0000240"> | |
| 3136 <notes> | |
| 3137 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3138 <p>kegg.compound: C00208</p> | |
| 3139 <p>KNApSAcK: C00001140</p> | |
| 3140 <p>CAS: 69-79-4</p> | |
| 3141 <p>PubChem: 3508</p> | |
| 3142 <p>3DMET: B04649</p> | |
| 3143 <p>PDB-CCD: MAL N9S</p> | |
| 3144 <p>ChEBI: 17306</p> | |
| 3145 <p>NIKKAJI: J4.871B</p> | |
| 3146 <p>formula: C12H22O11</p> | |
| 3147 <p>weight: 342.2965</p> | |
| 3148 </body> | |
| 3149 </notes> | |
| 3150 <annotation> | |
| 3151 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3152 <rdf:Description rdf:about="#_9e2d88a2-ed35-4c77-9959-17aa5c9f7dd9"> | |
| 3153 <bqbiol:is> | |
| 3154 <rdf:Bag> | |
| 3155 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00208"/> | |
| 3156 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001140"/> | |
| 3157 <rdf:li rdf:resource="https://identifiers.org/CAS/69-79-4"/> | |
| 3158 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04649"/> | |
| 3159 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/MAL N9S"/> | |
| 3160 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17306"/> | |
| 3161 </rdf:Bag> | |
| 3162 </bqbiol:is> | |
| 3163 </rdf:Description> | |
| 3164 </rdf:RDF> | |
| 3165 </annotation> | |
| 3166 </species> | |
| 3167 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H15N5O9P2" hasOnlySubstanceUnits="false" id="C00206" metaid="_14fc7d68-05a1-4cb9-8e92-59294962ba69" name="dADP" sboTerm="SBO:0000240"> | |
| 3168 <notes> | |
| 3169 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3170 <p>kegg.compound: C00206</p> | |
| 3171 <p>CAS: 2793-06-8</p> | |
| 3172 <p>PubChem: 3506</p> | |
| 3173 <p>3DMET: B01188</p> | |
| 3174 <p>PDB-CCD: DAT</p> | |
| 3175 <p>ChEBI: 16174</p> | |
| 3176 <p>NIKKAJI: J247.700I</p> | |
| 3177 <p>formula: C10H15N5O9P2</p> | |
| 3178 <p>weight: 411.2017</p> | |
| 3179 </body> | |
| 3180 </notes> | |
| 3181 <annotation> | |
| 3182 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3183 <rdf:Description rdf:about="#_14fc7d68-05a1-4cb9-8e92-59294962ba69"> | |
| 3184 <bqbiol:is> | |
| 3185 <rdf:Bag> | |
| 3186 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00206"/> | |
| 3187 <rdf:li rdf:resource="https://identifiers.org/CAS/2793-06-8"/> | |
| 3188 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01188"/> | |
| 3189 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/DAT"/> | |
| 3190 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16174"/> | |
| 3191 </rdf:Bag> | |
| 3192 </bqbiol:is> | |
| 3193 </rdf:Description> | |
| 3194 </rdf:RDF> | |
| 3195 </annotation> | |
| 3196 </species> | |
| 3197 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H13N3O3" hasOnlySubstanceUnits="false" id="C00327" metaid="_29553a6d-52d9-447f-af94-341a3cba9dd6" name="L-Citrulline" sboTerm="SBO:0000240"> | |
| 3198 <notes> | |
| 3199 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3200 <p>kegg.compound: C00327</p> | |
| 3201 <p>KNApSAcK: C00001348</p> | |
| 3202 <p>CAS: 372-75-8</p> | |
| 3203 <p>PubChem: 3621</p> | |
| 3204 <p>3DMET: B01217</p> | |
| 3205 <p>PDB-CCD: CIR</p> | |
| 3206 <p>ChEBI: 16349</p> | |
| 3207 <p>NIKKAJI: J5.711H</p> | |
| 3208 <p>formula: C6H13N3O3</p> | |
| 3209 <p>weight: 175.1857</p> | |
| 3210 </body> | |
| 3211 </notes> | |
| 3212 <annotation> | |
| 3213 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3214 <rdf:Description rdf:about="#_29553a6d-52d9-447f-af94-341a3cba9dd6"> | |
| 3215 <bqbiol:is> | |
| 3216 <rdf:Bag> | |
| 3217 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00327"/> | |
| 3218 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001348"/> | |
| 3219 <rdf:li rdf:resource="https://identifiers.org/CAS/372-75-8"/> | |
| 3220 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01217"/> | |
| 3221 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/CIR"/> | |
| 3222 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16349"/> | |
| 3223 </rdf:Bag> | |
| 3224 </bqbiol:is> | |
| 3225 </rdf:Description> | |
| 3226 </rdf:RDF> | |
| 3227 </annotation> | |
| 3228 </species> | |
| 3229 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C15H28O7P2" hasOnlySubstanceUnits="false" id="C00448" metaid="_359fb76d-4e15-4f27-9703-ac1bcdae6a3c" name="trans,trans-Farnesyl diphosphate" sboTerm="SBO:0000240"> | |
| 3230 <notes> | |
| 3231 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3232 <p>kegg.compound: C00448</p> | |
| 3233 <p>KNApSAcK: C00000907 C00007268</p> | |
| 3234 <p>CAS: 372-97-4</p> | |
| 3235 <p>PubChem: 3736</p> | |
| 3236 <p>3DMET: B01245</p> | |
| 3237 <p>PDB-CCD: FPP</p> | |
| 3238 <p>ChEBI: 17407</p> | |
| 3239 <p>LIPIDMAPS: LMPR0103010002</p> | |
| 3240 <p>LipidBank: IIP0005</p> | |
| 3241 <p>NIKKAJI: J348.314B</p> | |
| 3242 <p>formula: C15H28O7P2</p> | |
| 3243 <p>weight: 382.3261</p> | |
| 3244 </body> | |
| 3245 </notes> | |
| 3246 <annotation> | |
| 3247 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3248 <rdf:Description rdf:about="#_359fb76d-4e15-4f27-9703-ac1bcdae6a3c"> | |
| 3249 <bqbiol:is> | |
| 3250 <rdf:Bag> | |
| 3251 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00448"/> | |
| 3252 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00000907 C00007268"/> | |
| 3253 <rdf:li rdf:resource="https://identifiers.org/CAS/372-97-4"/> | |
| 3254 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01245"/> | |
| 3255 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/FPP"/> | |
| 3256 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17407"/> | |
| 3257 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMPR0103010002"/> | |
| 3258 <rdf:li rdf:resource="https://identifiers.org/LipidBank/IIP0005"/> | |
| 3259 </rdf:Bag> | |
| 3260 </bqbiol:is> | |
| 3261 </rdf:Description> | |
| 3262 </rdf:RDF> | |
| 3263 </annotation> | |
| 3264 </species> | |
| 3265 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H23O14P" hasOnlySubstanceUnits="false" id="C00689" metaid="_1cac794d-69e8-4289-81d1-ce2b75901312" name="alpha,alpha'-Trehalose 6-phosphate" sboTerm="SBO:0000240"> | |
| 3266 <notes> | |
| 3267 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3268 <p>kegg.compound: C00689</p> | |
| 3269 <p>KNApSAcK: C00007451</p> | |
| 3270 <p>CAS: 4484-88-2</p> | |
| 3271 <p>PubChem: 3958</p> | |
| 3272 <p>3DMET: B01312</p> | |
| 3273 <p>PDB-CCD: T6P</p> | |
| 3274 <p>ChEBI: 18283</p> | |
| 3275 <p>NIKKAJI: J741.923F</p> | |
| 3276 <p>formula: C12H23O14P</p> | |
| 3277 <p>weight: 422.2764</p> | |
| 3278 </body> | |
| 3279 </notes> | |
| 3280 <annotation> | |
| 3281 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3282 <rdf:Description rdf:about="#_1cac794d-69e8-4289-81d1-ce2b75901312"> | |
| 3283 <bqbiol:is> | |
| 3284 <rdf:Bag> | |
| 3285 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00689"/> | |
| 3286 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007451"/> | |
| 3287 <rdf:li rdf:resource="https://identifiers.org/CAS/4484-88-2"/> | |
| 3288 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01312"/> | |
| 3289 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/T6P"/> | |
| 3290 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18283"/> | |
| 3291 </rdf:Bag> | |
| 3292 </bqbiol:is> | |
| 3293 </rdf:Description> | |
| 3294 </rdf:RDF> | |
| 3295 </annotation> | |
| 3296 </species> | |
| 3297 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H16O13P2" hasOnlySubstanceUnits="false" id="C00447" metaid="_45c4b46d-0ca5-4fcc-a332-1f8cf87fac25" name="Sedoheptulose 1,7-bisphosphate" sboTerm="SBO:0000240"> | |
| 3298 <notes> | |
| 3299 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3300 <p>kegg.compound: C00447</p> | |
| 3301 <p>CAS: 815-91-8</p> | |
| 3302 <p>PubChem: 3735</p> | |
| 3303 <p>3DMET: B04683</p> | |
| 3304 <p>ChEBI: 17969</p> | |
| 3305 <p>NIKKAJI: J604.571E</p> | |
| 3306 <p>formula: C7H16O13P2</p> | |
| 3307 <p>weight: 370.1417</p> | |
| 3308 </body> | |
| 3309 </notes> | |
| 3310 <annotation> | |
| 3311 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3312 <rdf:Description rdf:about="#_45c4b46d-0ca5-4fcc-a332-1f8cf87fac25"> | |
| 3313 <bqbiol:is> | |
| 3314 <rdf:Bag> | |
| 3315 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00447"/> | |
| 3316 <rdf:li rdf:resource="https://identifiers.org/CAS/815-91-8"/> | |
| 3317 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04683"/> | |
| 3318 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17969"/> | |
| 3319 </rdf:Bag> | |
| 3320 </bqbiol:is> | |
| 3321 </rdf:Description> | |
| 3322 </rdf:RDF> | |
| 3323 </annotation> | |
| 3324 </species> | |
| 3325 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C20H22N7O6" hasOnlySubstanceUnits="false" id="C00445" metaid="b7c5b4a1-0d9f-45b0-a8f4-51a525f1f389" name="5,10-Methenyltetrahydrofolate" sboTerm="SBO:0000240"> | |
| 3326 <notes> | |
| 3327 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3328 <p>kegg.compound: C00445</p> | |
| 3329 <p>PubChem: 3733</p> | |
| 3330 <p>3DMET: B04682</p> | |
| 3331 <p>ChEBI: 15638</p> | |
| 3332 <p>NIKKAJI: J1.213.619F</p> | |
| 3333 <p>formula: C20H22N7O6</p> | |
| 3334 <p>weight: 456.432</p> | |
| 3335 </body> | |
| 3336 </notes> | |
| 3337 <annotation> | |
| 3338 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3339 <rdf:Description rdf:about="#b7c5b4a1-0d9f-45b0-a8f4-51a525f1f389"> | |
| 3340 <bqbiol:is> | |
| 3341 <rdf:Bag> | |
| 3342 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00445"/> | |
| 3343 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04682"/> | |
| 3344 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15638"/> | |
| 3345 </rdf:Bag> | |
| 3346 </bqbiol:is> | |
| 3347 </rdf:Description> | |
| 3348 </rdf:RDF> | |
| 3349 </annotation> | |
| 3350 </species> | |
| 3351 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C01650" metaid="_0a29d6ff-e703-4c41-b7d8-9c76d42ddbcf" name="tRNA(Ser)" sboTerm="SBO:0000240"> | |
| 3352 <notes> | |
| 3353 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3354 <p>kegg.compound: C01650</p> | |
| 3355 <p>PubChem: 4799</p> | |
| 3356 <p>ChEBI: 29179</p> | |
| 3357 </body> | |
| 3358 </notes> | |
| 3359 <annotation> | |
| 3360 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3361 <rdf:Description rdf:about="#_0a29d6ff-e703-4c41-b7d8-9c76d42ddbcf"> | |
| 3362 <bqbiol:is> | |
| 3363 <rdf:Bag> | |
| 3364 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01650"/> | |
| 3365 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29179"/> | |
| 3366 </rdf:Bag> | |
| 3367 </bqbiol:is> | |
| 3368 </rdf:Description> | |
| 3369 </rdf:RDF> | |
| 3370 </annotation> | |
| 3371 </species> | |
| 3372 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C01651" metaid="_3159eed7-a0b6-44c3-bbaa-e1acd4f88d5f" name="tRNA(Thr)" sboTerm="SBO:0000240"> | |
| 3373 <notes> | |
| 3374 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3375 <p>kegg.compound: C01651</p> | |
| 3376 <p>PubChem: 4800</p> | |
| 3377 <p>ChEBI: 29180</p> | |
| 3378 </body> | |
| 3379 </notes> | |
| 3380 <annotation> | |
| 3381 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3382 <rdf:Description rdf:about="#_3159eed7-a0b6-44c3-bbaa-e1acd4f88d5f"> | |
| 3383 <bqbiol:is> | |
| 3384 <rdf:Bag> | |
| 3385 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01651"/> | |
| 3386 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29180"/> | |
| 3387 </rdf:Bag> | |
| 3388 </bqbiol:is> | |
| 3389 </rdf:Description> | |
| 3390 </rdf:RDF> | |
| 3391 </annotation> | |
| 3392 </species> | |
| 3393 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H2O2SR2" hasOnlySubstanceUnits="false" id="C00685" metaid="_5c976608-9c24-4abd-b30f-b1cae6b89548" name="3-Oxoacyl-[acyl-carrier protein]" sboTerm="SBO:0000240"> | |
| 3394 <notes> | |
| 3395 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3396 <p>kegg.compound: C00685</p> | |
| 3397 <p>PubChem: 3954</p> | |
| 3398 <p>formula: C3H2O2SR2</p> | |
| 3399 </body> | |
| 3400 </notes> | |
| 3401 <annotation> | |
| 3402 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3403 <rdf:Description rdf:about="#_5c976608-9c24-4abd-b30f-b1cae6b89548"> | |
| 3404 <bqbiol:is> | |
| 3405 <rdf:Bag> | |
| 3406 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00685"/> | |
| 3407 </rdf:Bag> | |
| 3408 </bqbiol:is> | |
| 3409 </rdf:Description> | |
| 3410 </rdf:RDF> | |
| 3411 </annotation> | |
| 3412 </species> | |
| 3413 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H12O13P3R" hasOnlySubstanceUnits="false" id="C00201" metaid="_11219b0a-90ec-438b-9c64-f874904e7447" name="Nucleoside triphosphate" sboTerm="SBO:0000240"> | |
| 3414 <notes> | |
| 3415 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3416 <p>kegg.compound: C00201</p> | |
| 3417 <p>PubChem: 3501</p> | |
| 3418 <p>ChEBI: 17326</p> | |
| 3419 <p>formula: C5H12O13P3R</p> | |
| 3420 </body> | |
| 3421 </notes> | |
| 3422 <annotation> | |
| 3423 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3424 <rdf:Description rdf:about="#_11219b0a-90ec-438b-9c64-f874904e7447"> | |
| 3425 <bqbiol:is> | |
| 3426 <rdf:Bag> | |
| 3427 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00201"/> | |
| 3428 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17326"/> | |
| 3429 </rdf:Bag> | |
| 3430 </bqbiol:is> | |
| 3431 </rdf:Description> | |
| 3432 </rdf:RDF> | |
| 3433 </annotation> | |
| 3434 </species> | |
| 3435 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C01652" metaid="_85de5e22-2581-46cb-9f08-199edd9c3d13" name="tRNA(Trp)" sboTerm="SBO:0000240"> | |
| 3436 <notes> | |
| 3437 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3438 <p>kegg.compound: C01652</p> | |
| 3439 <p>PubChem: 4801</p> | |
| 3440 <p>ChEBI: 29181</p> | |
| 3441 </body> | |
| 3442 </notes> | |
| 3443 <annotation> | |
| 3444 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3445 <rdf:Description rdf:about="#_85de5e22-2581-46cb-9f08-199edd9c3d13"> | |
| 3446 <bqbiol:is> | |
| 3447 <rdf:Bag> | |
| 3448 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01652"/> | |
| 3449 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29181"/> | |
| 3450 </rdf:Bag> | |
| 3451 </bqbiol:is> | |
| 3452 </rdf:Description> | |
| 3453 </rdf:RDF> | |
| 3454 </annotation> | |
| 3455 </species> | |
| 3456 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C15H23N5O14P2" hasOnlySubstanceUnits="false" id="C02741" metaid="af6e6e43-7366-48dc-8229-0e19f042c7c1" name="Phosphoribosyl-AMP" sboTerm="SBO:0000240"> | |
| 3457 <notes> | |
| 3458 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3459 <p>kegg.compound: C02741</p> | |
| 3460 <p>PubChem: 5701</p> | |
| 3461 <p>3DMET: B04863</p> | |
| 3462 <p>ChEBI: 18374</p> | |
| 3463 <p>formula: C15H23N5O14P2</p> | |
| 3464 <p>weight: 559.3157</p> | |
| 3465 </body> | |
| 3466 </notes> | |
| 3467 <annotation> | |
| 3468 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3469 <rdf:Description rdf:about="#af6e6e43-7366-48dc-8229-0e19f042c7c1"> | |
| 3470 <bqbiol:is> | |
| 3471 <rdf:Bag> | |
| 3472 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02741"/> | |
| 3473 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04863"/> | |
| 3474 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18374"/> | |
| 3475 </rdf:Bag> | |
| 3476 </bqbiol:is> | |
| 3477 </rdf:Description> | |
| 3478 </rdf:RDF> | |
| 3479 </annotation> | |
| 3480 </species> | |
| 3481 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H8O5" hasOnlySubstanceUnits="false" id="C00322" metaid="_5dc8e797-8e5d-414c-a137-b55988c24e5d" name="2-Oxoadipate" sboTerm="SBO:0000240"> | |
| 3482 <notes> | |
| 3483 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3484 <p>kegg.compound: C00322</p> | |
| 3485 <p>KNApSAcK: C00000770</p> | |
| 3486 <p>CAS: 3184-35-8</p> | |
| 3487 <p>PubChem: 3616</p> | |
| 3488 <p>3DMET: B00088</p> | |
| 3489 <p>PDB-CCD: OOG</p> | |
| 3490 <p>ChEBI: 15753</p> | |
| 3491 <p>LIPIDMAPS: LMFA01170121</p> | |
| 3492 <p>NIKKAJI: J39.063A</p> | |
| 3493 <p>formula: C6H8O5</p> | |
| 3494 <p>weight: 160.1247</p> | |
| 3495 </body> | |
| 3496 </notes> | |
| 3497 <annotation> | |
| 3498 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3499 <rdf:Description rdf:about="#_5dc8e797-8e5d-414c-a137-b55988c24e5d"> | |
| 3500 <bqbiol:is> | |
| 3501 <rdf:Bag> | |
| 3502 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00322"/> | |
| 3503 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00000770"/> | |
| 3504 <rdf:li rdf:resource="https://identifiers.org/CAS/3184-35-8"/> | |
| 3505 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00088"/> | |
| 3506 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/OOG"/> | |
| 3507 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15753"/> | |
| 3508 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA01170121"/> | |
| 3509 </rdf:Bag> | |
| 3510 </bqbiol:is> | |
| 3511 </rdf:Description> | |
| 3512 </rdf:RDF> | |
| 3513 </annotation> | |
| 3514 </species> | |
| 3515 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H23O14P" hasOnlySubstanceUnits="false" id="C02995" metaid="e6297365-0c3a-49e1-9fb6-e62daa302ebc" name="Maltose 6'-phosphate" sboTerm="SBO:0000240"> | |
| 3516 <notes> | |
| 3517 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3518 <p>kegg.compound: C02995</p> | |
| 3519 <p>PubChem: 5904</p> | |
| 3520 <p>3DMET: B01617</p> | |
| 3521 <p>ChEBI: 15703</p> | |
| 3522 <p>NIKKAJI: J2.740.326C</p> | |
| 3523 <p>formula: C12H23O14P</p> | |
| 3524 <p>weight: 422.2764</p> | |
| 3525 </body> | |
| 3526 </notes> | |
| 3527 <annotation> | |
| 3528 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3529 <rdf:Description rdf:about="#e6297365-0c3a-49e1-9fb6-e62daa302ebc"> | |
| 3530 <bqbiol:is> | |
| 3531 <rdf:Bag> | |
| 3532 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02995"/> | |
| 3533 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01617"/> | |
| 3534 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15703"/> | |
| 3535 </rdf:Bag> | |
| 3536 </bqbiol:is> | |
| 3537 </rdf:Description> | |
| 3538 </rdf:RDF> | |
| 3539 </annotation> | |
| 3540 </species> | |
| 3541 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H16NO9P" hasOnlySubstanceUnits="false" id="C01302" metaid="cd0b8313-30b7-473e-8c5e-28d6081ff36d" name="1-(2-Carboxyphenylamino)-1-deoxy-D-ribulose 5-phosphate" sboTerm="SBO:0000240"> | |
| 3542 <notes> | |
| 3543 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3544 <p>kegg.compound: C01302</p> | |
| 3545 <p>KNApSAcK: C00007450</p> | |
| 3546 <p>PubChem: 4520</p> | |
| 3547 <p>3DMET: B04792</p> | |
| 3548 <p>ChEBI: 29112</p> | |
| 3549 <p>NIKKAJI: J2.634.852H</p> | |
| 3550 <p>formula: C12H16NO9P</p> | |
| 3551 <p>weight: 349.2305</p> | |
| 3552 </body> | |
| 3553 </notes> | |
| 3554 <annotation> | |
| 3555 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3556 <rdf:Description rdf:about="#cd0b8313-30b7-473e-8c5e-28d6081ff36d"> | |
| 3557 <bqbiol:is> | |
| 3558 <rdf:Bag> | |
| 3559 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01302"/> | |
| 3560 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007450"/> | |
| 3561 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04792"/> | |
| 3562 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29112"/> | |
| 3563 </rdf:Bag> | |
| 3564 </bqbiol:is> | |
| 3565 </rdf:Description> | |
| 3566 </rdf:RDF> | |
| 3567 </annotation> | |
| 3568 </species> | |
| 3569 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H2OSR2" hasOnlySubstanceUnits="false" id="C00693" metaid="_9b635ac4-c830-4df2-9bf9-9f7df4e13763" name="trans-2,3-Dehydroacyl-[acyl-carrier protein]" sboTerm="SBO:0000240"> | |
| 3570 <notes> | |
| 3571 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3572 <p>kegg.compound: C00693</p> | |
| 3573 <p>PubChem: 3961</p> | |
| 3574 <p>formula: C3H2OSR2</p> | |
| 3575 </body> | |
| 3576 </notes> | |
| 3577 <annotation> | |
| 3578 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3579 <rdf:Description rdf:about="#_9b635ac4-c830-4df2-9bf9-9f7df4e13763"> | |
| 3580 <bqbiol:is> | |
| 3581 <rdf:Bag> | |
| 3582 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00693"/> | |
| 3583 </rdf:Bag> | |
| 3584 </bqbiol:is> | |
| 3585 </rdf:Description> | |
| 3586 </rdf:RDF> | |
| 3587 </annotation> | |
| 3588 </species> | |
| 3589 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H13N5O4" hasOnlySubstanceUnits="false" id="C00330" metaid="ad69aa35-7fe0-4875-8723-728caee00aca" name="Deoxyguanosine" sboTerm="SBO:0000240"> | |
| 3590 <notes> | |
| 3591 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3592 <p>kegg.compound: C00330</p> | |
| 3593 <p>CAS: 961-07-9</p> | |
| 3594 <p>PubChem: 3624</p> | |
| 3595 <p>3DMET: B01219</p> | |
| 3596 <p>PDB-CCD: GNG</p> | |
| 3597 <p>ChEBI: 17172</p> | |
| 3598 <p>NIKKAJI: J13.863K</p> | |
| 3599 <p>formula: C10H13N5O4</p> | |
| 3600 <p>weight: 267.2413</p> | |
| 3601 </body> | |
| 3602 </notes> | |
| 3603 <annotation> | |
| 3604 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3605 <rdf:Description rdf:about="#ad69aa35-7fe0-4875-8723-728caee00aca"> | |
| 3606 <bqbiol:is> | |
| 3607 <rdf:Bag> | |
| 3608 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00330"/> | |
| 3609 <rdf:li rdf:resource="https://identifiers.org/CAS/961-07-9"/> | |
| 3610 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01219"/> | |
| 3611 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/GNG"/> | |
| 3612 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17172"/> | |
| 3613 </rdf:Bag> | |
| 3614 </bqbiol:is> | |
| 3615 </rdf:Description> | |
| 3616 </rdf:RDF> | |
| 3617 </annotation> | |
| 3618 </species> | |
| 3619 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H7O5P" hasOnlySubstanceUnits="false" id="C02876" metaid="_9ec124d8-0f83-4908-a600-05b4ba620b63" name="Propanoyl phosphate" sboTerm="SBO:0000240"> | |
| 3620 <notes> | |
| 3621 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3622 <p>kegg.compound: C02876</p> | |
| 3623 <p>PubChem: 5809</p> | |
| 3624 <p>3DMET: B00510</p> | |
| 3625 <p>ChEBI: 8478</p> | |
| 3626 <p>NIKKAJI: J2.365.532B</p> | |
| 3627 <p>formula: C3H7O5P</p> | |
| 3628 <p>weight: 154.0584</p> | |
| 3629 </body> | |
| 3630 </notes> | |
| 3631 <annotation> | |
| 3632 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3633 <rdf:Description rdf:about="#_9ec124d8-0f83-4908-a600-05b4ba620b63"> | |
| 3634 <bqbiol:is> | |
| 3635 <rdf:Bag> | |
| 3636 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02876"/> | |
| 3637 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00510"/> | |
| 3638 <rdf:li rdf:resource="https://identifiers.org/ChEBI/8478"/> | |
| 3639 </rdf:Bag> | |
| 3640 </bqbiol:is> | |
| 3641 </rdf:Description> | |
| 3642 </rdf:RDF> | |
| 3643 </annotation> | |
| 3644 </species> | |
| 3645 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H16N5O8P" hasOnlySubstanceUnits="false" id="C01304" metaid="_5953f244-02df-4ca9-9844-1ee991df5a75" name="2,5-Diamino-6-(5-phospho-D-ribosylamino)pyrimidin-4(3H)-one" sboTerm="SBO:0000240"> | |
| 3646 <notes> | |
| 3647 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3648 <p>kegg.compound: C01304</p> | |
| 3649 <p>PubChem: 4522</p> | |
| 3650 <p>3DMET: B01437</p> | |
| 3651 <p>ChEBI: 29114 59546</p> | |
| 3652 <p>NIKKAJI: J1.557.013J</p> | |
| 3653 <p>formula: C9H16N5O8P</p> | |
| 3654 <p>weight: 353.2258</p> | |
| 3655 </body> | |
| 3656 </notes> | |
| 3657 <annotation> | |
| 3658 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3659 <rdf:Description rdf:about="#_5953f244-02df-4ca9-9844-1ee991df5a75"> | |
| 3660 <bqbiol:is> | |
| 3661 <rdf:Bag> | |
| 3662 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01304"/> | |
| 3663 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01437"/> | |
| 3664 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29114 59546"/> | |
| 3665 </rdf:Bag> | |
| 3666 </bqbiol:is> | |
| 3667 </rdf:Description> | |
| 3668 </rdf:RDF> | |
| 3669 </annotation> | |
| 3670 </species> | |
| 3671 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C28H43N5O23P2" hasOnlySubstanceUnits="false" id="C00692" metaid="_91783a00-daeb-485a-86af-0e6f4c4a5f5b" name="UDP-N-acetylmuramoyl-L-alanyl-D-glutamate" sboTerm="SBO:0000240"> | |
| 3672 <notes> | |
| 3673 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3674 <p>kegg.compound: C00692</p> | |
| 3675 <p>PubChem: 3960</p> | |
| 3676 <p>3DMET: B04718</p> | |
| 3677 <p>PDB-CCD: UAG</p> | |
| 3678 <p>ChEBI: 16970 46143</p> | |
| 3679 <p>NIKKAJI: J2.730.233E</p> | |
| 3680 <p>formula: C28H43N5O23P2</p> | |
| 3681 <p>weight: 879.6082</p> | |
| 3682 </body> | |
| 3683 </notes> | |
| 3684 <annotation> | |
| 3685 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3686 <rdf:Description rdf:about="#_91783a00-daeb-485a-86af-0e6f4c4a5f5b"> | |
| 3687 <bqbiol:is> | |
| 3688 <rdf:Bag> | |
| 3689 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00692"/> | |
| 3690 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04718"/> | |
| 3691 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/UAG"/> | |
| 3692 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16970 46143"/> | |
| 3693 </rdf:Bag> | |
| 3694 </bqbiol:is> | |
| 3695 </rdf:Description> | |
| 3696 </rdf:RDF> | |
| 3697 </annotation> | |
| 3698 </species> | |
| 3699 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H8O5" hasOnlySubstanceUnits="false" id="C02637" metaid="_251f89d6-78f1-4fe0-92a1-45baedbe06d2" name="3-Dehydroshikimate" sboTerm="SBO:0000240"> | |
| 3700 <notes> | |
| 3701 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3702 <p>kegg.compound: C02637</p> | |
| 3703 <p>KNApSAcK: C00019663</p> | |
| 3704 <p>PubChem: 5617</p> | |
| 3705 <p>3DMET: B01592</p> | |
| 3706 <p>PDB-CCD: 3DS</p> | |
| 3707 <p>ChEBI: 16630 30918</p> | |
| 3708 <p>NIKKAJI: J412.314J</p> | |
| 3709 <p>formula: C7H8O5</p> | |
| 3710 <p>weight: 172.1354</p> | |
| 3711 </body> | |
| 3712 </notes> | |
| 3713 <annotation> | |
| 3714 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3715 <rdf:Description rdf:about="#_251f89d6-78f1-4fe0-92a1-45baedbe06d2"> | |
| 3716 <bqbiol:is> | |
| 3717 <rdf:Bag> | |
| 3718 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02637"/> | |
| 3719 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019663"/> | |
| 3720 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01592"/> | |
| 3721 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/3DS"/> | |
| 3722 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16630 30918"/> | |
| 3723 </rdf:Bag> | |
| 3724 </bqbiol:is> | |
| 3725 </rdf:Description> | |
| 3726 </rdf:RDF> | |
| 3727 </annotation> | |
| 3728 </species> | |
| 3729 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H6N2O2SR2" hasOnlySubstanceUnits="false" id="C15811" metaid="_8e3174a1-1217-453a-923a-fa1e4e541057" name="[Enzyme]-cysteine" sboTerm="SBO:0000240"> | |
| 3730 <notes> | |
| 3731 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3732 <p>kegg.compound: C15811</p> | |
| 3733 <p>PubChem: 47205136</p> | |
| 3734 <p>formula: C4H6N2O2SR2</p> | |
| 3735 </body> | |
| 3736 </notes> | |
| 3737 <annotation> | |
| 3738 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3739 <rdf:Description rdf:about="#_8e3174a1-1217-453a-923a-fa1e4e541057"> | |
| 3740 <bqbiol:is> | |
| 3741 <rdf:Bag> | |
| 3742 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C15811"/> | |
| 3743 </rdf:Bag> | |
| 3744 </bqbiol:is> | |
| 3745 </rdf:Description> | |
| 3746 </rdf:RDF> | |
| 3747 </annotation> | |
| 3748 </species> | |
| 3749 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H6N2O2S2R2" hasOnlySubstanceUnits="false" id="C15812" metaid="_9f165fb7-b97d-4eff-8878-76f280eca686" name="[Enzyme]-S-sulfanylcysteine" sboTerm="SBO:0000240"> | |
| 3750 <notes> | |
| 3751 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3752 <p>kegg.compound: C15812</p> | |
| 3753 <p>PubChem: 47205137</p> | |
| 3754 <p>formula: C4H6N2O2S2R2</p> | |
| 3755 </body> | |
| 3756 </notes> | |
| 3757 <annotation> | |
| 3758 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3759 <rdf:Description rdf:about="#_9f165fb7-b97d-4eff-8878-76f280eca686"> | |
| 3760 <bqbiol:is> | |
| 3761 <rdf:Bag> | |
| 3762 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C15812"/> | |
| 3763 </rdf:Bag> | |
| 3764 </bqbiol:is> | |
| 3765 </rdf:Description> | |
| 3766 </rdf:RDF> | |
| 3767 </annotation> | |
| 3768 </species> | |
| 3769 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H9NO4" hasOnlySubstanceUnits="false" id="C00217" metaid="b9f9f1a5-cd38-4bb4-8688-9720774b6bed" name="D-Glutamate" sboTerm="SBO:0000240"> | |
| 3770 <notes> | |
| 3771 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3772 <p>kegg.compound: C00217</p> | |
| 3773 <p>KNApSAcK: C00019577</p> | |
| 3774 <p>CAS: 6893-26-1</p> | |
| 3775 <p>PubChem: 3517</p> | |
| 3776 <p>3DMET: B01192</p> | |
| 3777 <p>PDB-CCD: DGL FGA</p> | |
| 3778 <p>ChEBI: 15966</p> | |
| 3779 <p>NIKKAJI: J9.214B</p> | |
| 3780 <p>formula: C5H9NO4</p> | |
| 3781 <p>weight: 147.1293</p> | |
| 3782 </body> | |
| 3783 </notes> | |
| 3784 <annotation> | |
| 3785 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3786 <rdf:Description rdf:about="#b9f9f1a5-cd38-4bb4-8688-9720774b6bed"> | |
| 3787 <bqbiol:is> | |
| 3788 <rdf:Bag> | |
| 3789 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00217"/> | |
| 3790 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019577"/> | |
| 3791 <rdf:li rdf:resource="https://identifiers.org/CAS/6893-26-1"/> | |
| 3792 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01192"/> | |
| 3793 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/DGL FGA"/> | |
| 3794 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15966"/> | |
| 3795 </rdf:Bag> | |
| 3796 </bqbiol:is> | |
| 3797 </rdf:Description> | |
| 3798 </rdf:RDF> | |
| 3799 </annotation> | |
| 3800 </species> | |
| 3801 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H6N2O4" hasOnlySubstanceUnits="false" id="C00337" metaid="_18428ffd-d510-45c9-945f-6aefc0036983" name="(S)-Dihydroorotate" sboTerm="SBO:0000240"> | |
| 3802 <notes> | |
| 3803 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3804 <p>kegg.compound: C00337</p> | |
| 3805 <p>KNApSAcK: C00007302</p> | |
| 3806 <p>CAS: 5988-19-2</p> | |
| 3807 <p>PubChem: 3630</p> | |
| 3808 <p>3DMET: B01220</p> | |
| 3809 <p>PDB-CCD: DOR</p> | |
| 3810 <p>ChEBI: 17025</p> | |
| 3811 <p>NIKKAJI: J236.345C</p> | |
| 3812 <p>formula: C5H6N2O4</p> | |
| 3813 <p>weight: 158.1121</p> | |
| 3814 </body> | |
| 3815 </notes> | |
| 3816 <annotation> | |
| 3817 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3818 <rdf:Description rdf:about="#_18428ffd-d510-45c9-945f-6aefc0036983"> | |
| 3819 <bqbiol:is> | |
| 3820 <rdf:Bag> | |
| 3821 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00337"/> | |
| 3822 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007302"/> | |
| 3823 <rdf:li rdf:resource="https://identifiers.org/CAS/5988-19-2"/> | |
| 3824 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01220"/> | |
| 3825 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/DOR"/> | |
| 3826 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17025"/> | |
| 3827 </rdf:Bag> | |
| 3828 </bqbiol:is> | |
| 3829 </rdf:Description> | |
| 3830 </rdf:RDF> | |
| 3831 </annotation> | |
| 3832 </species> | |
| 3833 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H16N3O13P3" hasOnlySubstanceUnits="false" id="C00458" metaid="c636e510-7d27-4763-83ea-ed7d5812a201" name="dCTP" sboTerm="SBO:0000240"> | |
| 3834 <notes> | |
| 3835 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3836 <p>kegg.compound: C00458</p> | |
| 3837 <p>CAS: 2056-98-6</p> | |
| 3838 <p>PubChem: 3742</p> | |
| 3839 <p>3DMET: B01248</p> | |
| 3840 <p>PDB-CCD: DCP</p> | |
| 3841 <p>ChEBI: 16311</p> | |
| 3842 <p>NIKKAJI: J247.702E</p> | |
| 3843 <p>formula: C9H16N3O13P3</p> | |
| 3844 <p>weight: 467.1569</p> | |
| 3845 </body> | |
| 3846 </notes> | |
| 3847 <annotation> | |
| 3848 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3849 <rdf:Description rdf:about="#c636e510-7d27-4763-83ea-ed7d5812a201"> | |
| 3850 <bqbiol:is> | |
| 3851 <rdf:Bag> | |
| 3852 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00458"/> | |
| 3853 <rdf:li rdf:resource="https://identifiers.org/CAS/2056-98-6"/> | |
| 3854 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01248"/> | |
| 3855 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/DCP"/> | |
| 3856 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16311"/> | |
| 3857 </rdf:Bag> | |
| 3858 </bqbiol:is> | |
| 3859 </rdf:Description> | |
| 3860 </rdf:RDF> | |
| 3861 </annotation> | |
| 3862 </species> | |
| 3863 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H6O3" hasOnlySubstanceUnits="false" id="C00577" metaid="_0f21c85a-a1f2-400c-8b90-756c0dfc63ca" name="D-Glyceraldehyde" sboTerm="SBO:0000240"> | |
| 3864 <notes> | |
| 3865 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3866 <p>kegg.compound: C00577</p> | |
| 3867 <p>CAS: 453-17-8 367-47-5</p> | |
| 3868 <p>PubChem: 3856</p> | |
| 3869 <p>3DMET: B00137</p> | |
| 3870 <p>PDB-CCD: 3GR</p> | |
| 3871 <p>ChEBI: 17378</p> | |
| 3872 <p>NIKKAJI: J5.790H J9.119G</p> | |
| 3873 <p>formula: C3H6O3</p> | |
| 3874 <p>weight: 90.0779</p> | |
| 3875 </body> | |
| 3876 </notes> | |
| 3877 <annotation> | |
| 3878 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3879 <rdf:Description rdf:about="#_0f21c85a-a1f2-400c-8b90-756c0dfc63ca"> | |
| 3880 <bqbiol:is> | |
| 3881 <rdf:Bag> | |
| 3882 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00577"/> | |
| 3883 <rdf:li rdf:resource="https://identifiers.org/CAS/453-17-8 367-47-5"/> | |
| 3884 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00137"/> | |
| 3885 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/3GR"/> | |
| 3886 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17378"/> | |
| 3887 </rdf:Bag> | |
| 3888 </bqbiol:is> | |
| 3889 </rdf:Description> | |
| 3890 </rdf:RDF> | |
| 3891 </annotation> | |
| 3892 </species> | |
| 3893 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C02992" metaid="_3d222028-ec8c-49fb-a3c1-1898822f0645" name="L-Threonyl-tRNA(Thr)" sboTerm="SBO:0000240"> | |
| 3894 <notes> | |
| 3895 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3896 <p>kegg.compound: C02992</p> | |
| 3897 <p>PubChem: 5901</p> | |
| 3898 <p>ChEBI: 29163</p> | |
| 3899 <p>formula: C14H24NO12PR2(C5H8O6PR)n</p> | |
| 3900 </body> | |
| 3901 </notes> | |
| 3902 <annotation> | |
| 3903 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3904 <rdf:Description rdf:about="#_3d222028-ec8c-49fb-a3c1-1898822f0645"> | |
| 3905 <bqbiol:is> | |
| 3906 <rdf:Bag> | |
| 3907 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02992"/> | |
| 3908 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29163"/> | |
| 3909 </rdf:Bag> | |
| 3910 </bqbiol:is> | |
| 3911 </rdf:Description> | |
| 3912 </rdf:RDF> | |
| 3913 </annotation> | |
| 3914 </species> | |
| 3915 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C11H15N2O8P" hasOnlySubstanceUnits="false" id="C00455" metaid="_343aa6ec-7560-418d-923a-a9af5a518481" name="Nicotinamide D-ribonucleotide" sboTerm="SBO:0000240"> | |
| 3916 <notes> | |
| 3917 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3918 <p>kegg.compound: C00455</p> | |
| 3919 <p>KNApSAcK: C00019694</p> | |
| 3920 <p>CAS: 1094-61-7</p> | |
| 3921 <p>PubChem: 3741</p> | |
| 3922 <p>3DMET: B01247</p> | |
| 3923 <p>PDB-CCD: NMN</p> | |
| 3924 <p>ChEBI: 16171</p> | |
| 3925 <p>NIKKAJI: J9.877I</p> | |
| 3926 <p>formula: C11H15N2O8P</p> | |
| 3927 <p>weight: 334.2192</p> | |
| 3928 </body> | |
| 3929 </notes> | |
| 3930 <annotation> | |
| 3931 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3932 <rdf:Description rdf:about="#_343aa6ec-7560-418d-923a-a9af5a518481"> | |
| 3933 <bqbiol:is> | |
| 3934 <rdf:Bag> | |
| 3935 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00455"/> | |
| 3936 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019694"/> | |
| 3937 <rdf:li rdf:resource="https://identifiers.org/CAS/1094-61-7"/> | |
| 3938 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01247"/> | |
| 3939 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/NMN"/> | |
| 3940 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16171"/> | |
| 3941 </rdf:Bag> | |
| 3942 </bqbiol:is> | |
| 3943 </rdf:Description> | |
| 3944 </rdf:RDF> | |
| 3945 </annotation> | |
| 3946 </species> | |
| 3947 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H16N2O5" hasOnlySubstanceUnits="false" id="C21015" metaid="c8fa9096-4ae8-4811-9837-e9d3e8132d15" name="gamma-L-Glutamyl-L-2-aminobutyrate" sboTerm="SBO:0000240"> | |
| 3948 <notes> | |
| 3949 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3950 <p>kegg.compound: C21015</p> | |
| 3951 <p>PubChem: 254741469</p> | |
| 3952 <p>ChEBI: 176875</p> | |
| 3953 <p>formula: C9H16N2O5</p> | |
| 3954 <p>weight: 232.2337</p> | |
| 3955 </body> | |
| 3956 </notes> | |
| 3957 <annotation> | |
| 3958 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3959 <rdf:Description rdf:about="#c8fa9096-4ae8-4811-9837-e9d3e8132d15"> | |
| 3960 <bqbiol:is> | |
| 3961 <rdf:Bag> | |
| 3962 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C21015"/> | |
| 3963 <rdf:li rdf:resource="https://identifiers.org/ChEBI/176875"/> | |
| 3964 </rdf:Bag> | |
| 3965 </bqbiol:is> | |
| 3966 </rdf:Description> | |
| 3967 </rdf:RDF> | |
| 3968 </annotation> | |
| 3969 </species> | |
| 3970 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H13N5O4" hasOnlySubstanceUnits="false" id="C00212" metaid="_229f5de7-d4c5-4c2a-96e3-613efab79ca5" name="Adenosine" sboTerm="SBO:0000240"> | |
| 3971 <notes> | |
| 3972 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3973 <p>kegg.compound: C00212</p> | |
| 3974 <p>KNApSAcK: C00007444</p> | |
| 3975 <p>CAS: 58-61-7</p> | |
| 3976 <p>PubChem: 3512</p> | |
| 3977 <p>3DMET: B01189</p> | |
| 3978 <p>PDB-CCD: ADN</p> | |
| 3979 <p>ChEBI: 16335</p> | |
| 3980 <p>NIKKAJI: J4.501B</p> | |
| 3981 <p>formula: C10H13N5O4</p> | |
| 3982 <p>weight: 267.2413</p> | |
| 3983 </body> | |
| 3984 </notes> | |
| 3985 <annotation> | |
| 3986 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3987 <rdf:Description rdf:about="#_229f5de7-d4c5-4c2a-96e3-613efab79ca5"> | |
| 3988 <bqbiol:is> | |
| 3989 <rdf:Bag> | |
| 3990 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00212"/> | |
| 3991 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007444"/> | |
| 3992 <rdf:li rdf:resource="https://identifiers.org/CAS/58-61-7"/> | |
| 3993 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01189"/> | |
| 3994 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/ADN"/> | |
| 3995 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16335"/> | |
| 3996 </rdf:Bag> | |
| 3997 </bqbiol:is> | |
| 3998 </rdf:Description> | |
| 3999 </rdf:RDF> | |
| 4000 </annotation> | |
| 4001 </species> | |
| 4002 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H11O10P2R" hasOnlySubstanceUnits="false" id="C00454" metaid="_0adfd6a8-e338-4aa8-80c2-b6da98cd3621" name="NDP" sboTerm="SBO:0000240"> | |
| 4003 <notes> | |
| 4004 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4005 <p>kegg.compound: C00454</p> | |
| 4006 <p>PubChem: 3740</p> | |
| 4007 <p>ChEBI: 16862</p> | |
| 4008 <p>formula: C5H11O10P2R</p> | |
| 4009 </body> | |
| 4010 </notes> | |
| 4011 <annotation> | |
| 4012 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4013 <rdf:Description rdf:about="#_0adfd6a8-e338-4aa8-80c2-b6da98cd3621"> | |
| 4014 <bqbiol:is> | |
| 4015 <rdf:Bag> | |
| 4016 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00454"/> | |
| 4017 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16862"/> | |
| 4018 </rdf:Bag> | |
| 4019 </bqbiol:is> | |
| 4020 </rdf:Description> | |
| 4021 </rdf:RDF> | |
| 4022 </annotation> | |
| 4023 </species> | |
| 4024 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H10O4" hasOnlySubstanceUnits="false" id="C02631" metaid="_89b43eb6-33ae-40ec-9a03-1f0567859552" name="2-Isopropylmaleate" sboTerm="SBO:0000240"> | |
| 4025 <notes> | |
| 4026 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4027 <p>kegg.compound: C02631</p> | |
| 4028 <p>PubChem: 5611</p> | |
| 4029 <p>3DMET: B00468</p> | |
| 4030 <p>ChEBI: 17275</p> | |
| 4031 <p>NIKKAJI: J867.346B</p> | |
| 4032 <p>formula: C7H10O4</p> | |
| 4033 <p>weight: 158.1519</p> | |
| 4034 </body> | |
| 4035 </notes> | |
| 4036 <annotation> | |
| 4037 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4038 <rdf:Description rdf:about="#_89b43eb6-33ae-40ec-9a03-1f0567859552"> | |
| 4039 <bqbiol:is> | |
| 4040 <rdf:Bag> | |
| 4041 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02631"/> | |
| 4042 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00468"/> | |
| 4043 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17275"/> | |
| 4044 </rdf:Bag> | |
| 4045 </bqbiol:is> | |
| 4046 </rdf:Description> | |
| 4047 </rdf:RDF> | |
| 4048 </annotation> | |
| 4049 </species> | |
| 4050 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C11H19N3O6" hasOnlySubstanceUnits="false" id="C21016" metaid="_0be50c0d-2a5f-4bb0-b524-6901105b4f2b" name="Ophthalmate" sboTerm="SBO:0000240"> | |
| 4051 <notes> | |
| 4052 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4053 <p>kegg.compound: C21016</p> | |
| 4054 <p>PubChem: 254741470</p> | |
| 4055 <p>formula: C11H19N3O6</p> | |
| 4056 <p>weight: 289.2851</p> | |
| 4057 </body> | |
| 4058 </notes> | |
| 4059 <annotation> | |
| 4060 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4061 <rdf:Description rdf:about="#_0be50c0d-2a5f-4bb0-b524-6901105b4f2b"> | |
| 4062 <bqbiol:is> | |
| 4063 <rdf:Bag> | |
| 4064 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C21016"/> | |
| 4065 </rdf:Bag> | |
| 4066 </bqbiol:is> | |
| 4067 </rdf:Description> | |
| 4068 </rdf:RDF> | |
| 4069 </annotation> | |
| 4070 </species> | |
| 4071 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C19H23N7O6" hasOnlySubstanceUnits="false" id="C00101" metaid="abec11eb-0971-40f7-8cf1-4e1b89d4253f" name="Tetrahydrofolate" sboTerm="SBO:0000240"> | |
| 4072 <notes> | |
| 4073 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4074 <p>kegg.compound: C00101</p> | |
| 4075 <p>KNApSAcK: C00007249</p> | |
| 4076 <p>CAS: 135-16-0</p> | |
| 4077 <p>PubChem: 3401</p> | |
| 4078 <p>3DMET: B04633</p> | |
| 4079 <p>PDB-CCD: THG</p> | |
| 4080 <p>ChEBI: 15635 20506</p> | |
| 4081 <p>NIKKAJI: J184.393A</p> | |
| 4082 <p>formula: C19H23N7O6</p> | |
| 4083 <p>weight: 445.4292</p> | |
| 4084 </body> | |
| 4085 </notes> | |
| 4086 <annotation> | |
| 4087 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4088 <rdf:Description rdf:about="#abec11eb-0971-40f7-8cf1-4e1b89d4253f"> | |
| 4089 <bqbiol:is> | |
| 4090 <rdf:Bag> | |
| 4091 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00101"/> | |
| 4092 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007249"/> | |
| 4093 <rdf:li rdf:resource="https://identifiers.org/CAS/135-16-0"/> | |
| 4094 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04633"/> | |
| 4095 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/THG"/> | |
| 4096 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15635 20506"/> | |
| 4097 </rdf:Bag> | |
| 4098 </bqbiol:is> | |
| 4099 </rdf:Description> | |
| 4100 </rdf:RDF> | |
| 4101 </annotation> | |
| 4102 </species> | |
| 4103 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H12N4O4S2R4" hasOnlySubstanceUnits="false" id="C00343" metaid="_602c8b09-77f0-4ad6-9056-514f4c257a30" name="Thioredoxin disulfide" sboTerm="SBO:0000240"> | |
| 4104 <notes> | |
| 4105 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4106 <p>kegg.compound: C00343</p> | |
| 4107 <p>PubChem: 3636</p> | |
| 4108 <p>ChEBI: 18191</p> | |
| 4109 <p>formula: C10H12N4O4S2R4</p> | |
| 4110 </body> | |
| 4111 </notes> | |
| 4112 <annotation> | |
| 4113 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4114 <rdf:Description rdf:about="#_602c8b09-77f0-4ad6-9056-514f4c257a30"> | |
| 4115 <bqbiol:is> | |
| 4116 <rdf:Bag> | |
| 4117 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00343"/> | |
| 4118 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18191"/> | |
| 4119 </rdf:Bag> | |
| 4120 </bqbiol:is> | |
| 4121 </rdf:Description> | |
| 4122 </rdf:RDF> | |
| 4123 </annotation> | |
| 4124 </species> | |
| 4125 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C8H7N" hasOnlySubstanceUnits="false" id="C00463" metaid="_7f8e45ef-7d6b-4aaf-b869-cf5abfe079ca" name="Indole" sboTerm="SBO:0000240"> | |
| 4126 <notes> | |
| 4127 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4128 <p>kegg.compound: C00463</p> | |
| 4129 <p>KNApSAcK: C00001418</p> | |
| 4130 <p>CAS: 120-72-9</p> | |
| 4131 <p>PubChem: 3747</p> | |
| 4132 <p>3DMET: B01251</p> | |
| 4133 <p>PDB-CCD: IND</p> | |
| 4134 <p>ChEBI: 16881</p> | |
| 4135 <p>NIKKAJI: J2.920C</p> | |
| 4136 <p>formula: C8H7N</p> | |
| 4137 <p>weight: 117.1479</p> | |
| 4138 </body> | |
| 4139 </notes> | |
| 4140 <annotation> | |
| 4141 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4142 <rdf:Description rdf:about="#_7f8e45ef-7d6b-4aaf-b869-cf5abfe079ca"> | |
| 4143 <bqbiol:is> | |
| 4144 <rdf:Bag> | |
| 4145 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00463"/> | |
| 4146 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001418"/> | |
| 4147 <rdf:li rdf:resource="https://identifiers.org/CAS/120-72-9"/> | |
| 4148 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01251"/> | |
| 4149 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/IND"/> | |
| 4150 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16881"/> | |
| 4151 </rdf:Bag> | |
| 4152 </bqbiol:is> | |
| 4153 </rdf:Description> | |
| 4154 </rdf:RDF> | |
| 4155 </annotation> | |
| 4156 </species> | |
| 4157 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H14N4O4S2R4" hasOnlySubstanceUnits="false" id="C00342" metaid="_41d65f98-fdbd-4505-8eb2-d6c662ad5676" name="Thioredoxin" sboTerm="SBO:0000240"> | |
| 4158 <notes> | |
| 4159 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4160 <p>kegg.compound: C00342</p> | |
| 4161 <p>CAS: 52500-60-4</p> | |
| 4162 <p>PubChem: 3635</p> | |
| 4163 <p>ChEBI: 15033 15967</p> | |
| 4164 <p>formula: C10H14N4O4S2R4</p> | |
| 4165 </body> | |
| 4166 </notes> | |
| 4167 <annotation> | |
| 4168 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4169 <rdf:Description rdf:about="#_41d65f98-fdbd-4505-8eb2-d6c662ad5676"> | |
| 4170 <bqbiol:is> | |
| 4171 <rdf:Bag> | |
| 4172 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00342"/> | |
| 4173 <rdf:li rdf:resource="https://identifiers.org/CAS/52500-60-4"/> | |
| 4174 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15033 15967"/> | |
| 4175 </rdf:Bag> | |
| 4176 </bqbiol:is> | |
| 4177 </rdf:Description> | |
| 4178 </rdf:RDF> | |
| 4179 </annotation> | |
| 4180 </species> | |
| 4181 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C24H40N7O17P3S" hasOnlySubstanceUnits="false" id="C00100" metaid="_80b9eb8c-7c68-4144-b860-3519030c355f" name="Propanoyl-CoA" sboTerm="SBO:0000240"> | |
| 4182 <notes> | |
| 4183 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4184 <p>kegg.compound: C00100</p> | |
| 4185 <p>CAS: 317-66-8</p> | |
| 4186 <p>PubChem: 3400</p> | |
| 4187 <p>3DMET: B04632</p> | |
| 4188 <p>PDB-CCD: 1VU</p> | |
| 4189 <p>ChEBI: 15539</p> | |
| 4190 <p>LIPIDMAPS: LMFA07050364</p> | |
| 4191 <p>NIKKAJI: J1.695.704F</p> | |
| 4192 <p>formula: C24H40N7O17P3S</p> | |
| 4193 <p>weight: 823.5974</p> | |
| 4194 </body> | |
| 4195 </notes> | |
| 4196 <annotation> | |
| 4197 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4198 <rdf:Description rdf:about="#_80b9eb8c-7c68-4144-b860-3519030c355f"> | |
| 4199 <bqbiol:is> | |
| 4200 <rdf:Bag> | |
| 4201 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00100"/> | |
| 4202 <rdf:li rdf:resource="https://identifiers.org/CAS/317-66-8"/> | |
| 4203 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04632"/> | |
| 4204 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/1VU"/> | |
| 4205 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15539"/> | |
| 4206 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA07050364"/> | |
| 4207 </rdf:Bag> | |
| 4208 </bqbiol:is> | |
| 4209 </rdf:Description> | |
| 4210 </rdf:RDF> | |
| 4211 </annotation> | |
| 4212 </species> | |
| 4213 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H20O7P2" hasOnlySubstanceUnits="false" id="C00341" metaid="_44460187-a854-413b-a267-54c2b0af0126" name="Geranyl diphosphate" sboTerm="SBO:0000240"> | |
| 4214 <notes> | |
| 4215 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4216 <p>kegg.compound: C00341</p> | |
| 4217 <p>KNApSAcK: C00000846</p> | |
| 4218 <p>PubChem: 3634</p> | |
| 4219 <p>3DMET: B00091</p> | |
| 4220 <p>PDB-CCD: GPP</p> | |
| 4221 <p>ChEBI: 17211</p> | |
| 4222 <p>LIPIDMAPS: LMPR0102010001</p> | |
| 4223 <p>LipidBank: IIP0003</p> | |
| 4224 <p>NIKKAJI: J1.452.575K J39.583H</p> | |
| 4225 <p>formula: C10H20O7P2</p> | |
| 4226 <p>weight: 314.2091</p> | |
| 4227 </body> | |
| 4228 </notes> | |
| 4229 <annotation> | |
| 4230 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4231 <rdf:Description rdf:about="#_44460187-a854-413b-a267-54c2b0af0126"> | |
| 4232 <bqbiol:is> | |
| 4233 <rdf:Bag> | |
| 4234 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00341"/> | |
| 4235 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00000846"/> | |
| 4236 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00091"/> | |
| 4237 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/GPP"/> | |
| 4238 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17211"/> | |
| 4239 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMPR0102010001"/> | |
| 4240 <rdf:li rdf:resource="https://identifiers.org/LipidBank/IIP0003"/> | |
| 4241 </rdf:Bag> | |
| 4242 </bqbiol:is> | |
| 4243 </rdf:Description> | |
| 4244 </rdf:RDF> | |
| 4245 </annotation> | |
| 4246 </species> | |
| 4247 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C40H65N9O26P2" hasOnlySubstanceUnits="false" id="C04702" metaid="_089305b8-7fa6-4b44-9767-c68940c1cf90" name="UDPMurNAc(oyl-L-Ala-D-gamma-Glu-L-Lys-D-Ala-D-Ala)" sboTerm="SBO:0000240"> | |
| 4248 <notes> | |
| 4249 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4250 <p>kegg.compound: C04702</p> | |
| 4251 <p>PubChem: 7277</p> | |
| 4252 <p>3DMET: B04954</p> | |
| 4253 <p>ChEBI: 70768</p> | |
| 4254 <p>NIKKAJI: J2.755.974C J956.512D</p> | |
| 4255 <p>formula: C40H65N9O26P2</p> | |
| 4256 <p>weight: 1149.9363</p> | |
| 4257 </body> | |
| 4258 </notes> | |
| 4259 <annotation> | |
| 4260 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4261 <rdf:Description rdf:about="#_089305b8-7fa6-4b44-9767-c68940c1cf90"> | |
| 4262 <bqbiol:is> | |
| 4263 <rdf:Bag> | |
| 4264 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04702"/> | |
| 4265 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04954"/> | |
| 4266 <rdf:li rdf:resource="https://identifiers.org/ChEBI/70768"/> | |
| 4267 </rdf:Bag> | |
| 4268 </bqbiol:is> | |
| 4269 </rdf:Description> | |
| 4270 </rdf:RDF> | |
| 4271 </annotation> | |
| 4272 </species> | |
| 4273 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C13H19N4O12P" hasOnlySubstanceUnits="false" id="C04823" metaid="_206b44a0-70aa-43d4-98bf-2fa70adb4883" name="1-(5'-Phosphoribosyl)-5-amino-4-(N-succinocarboxamide)-imidazole" sboTerm="SBO:0000240"> | |
| 4274 <notes> | |
| 4275 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4276 <p>kegg.compound: C04823</p> | |
| 4277 <p>CAS: 3031-95-6</p> | |
| 4278 <p>PubChem: 7384</p> | |
| 4279 <p>3DMET: B04963</p> | |
| 4280 <p>PDB-CCD: OK8</p> | |
| 4281 <p>ChEBI: 18319</p> | |
| 4282 <p>NIKKAJI: J7.666J</p> | |
| 4283 <p>formula: C13H19N4O12P</p> | |
| 4284 <p>weight: 454.2833</p> | |
| 4285 </body> | |
| 4286 </notes> | |
| 4287 <annotation> | |
| 4288 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4289 <rdf:Description rdf:about="#_206b44a0-70aa-43d4-98bf-2fa70adb4883"> | |
| 4290 <bqbiol:is> | |
| 4291 <rdf:Bag> | |
| 4292 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04823"/> | |
| 4293 <rdf:li rdf:resource="https://identifiers.org/CAS/3031-95-6"/> | |
| 4294 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04963"/> | |
| 4295 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/OK8"/> | |
| 4296 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18319"/> | |
| 4297 </rdf:Bag> | |
| 4298 </bqbiol:is> | |
| 4299 </rdf:Description> | |
| 4300 </rdf:RDF> | |
| 4301 </annotation> | |
| 4302 </species> | |
| 4303 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H15N2O14P3" hasOnlySubstanceUnits="false" id="C00460" metaid="_834f5d7a-c002-47c5-ab84-ffd83d468dab" name="dUTP" sboTerm="SBO:0000240"> | |
| 4304 <notes> | |
| 4305 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4306 <p>kegg.compound: C00460</p> | |
| 4307 <p>KNApSAcK: C00019636</p> | |
| 4308 <p>PubChem: 3744</p> | |
| 4309 <p>3DMET: B01250</p> | |
| 4310 <p>PDB-CCD: DUT</p> | |
| 4311 <p>ChEBI: 17625</p> | |
| 4312 <p>NIKKAJI: J315.490D</p> | |
| 4313 <p>formula: C9H15N2O14P3</p> | |
| 4314 <p>weight: 468.1417</p> | |
| 4315 </body> | |
| 4316 </notes> | |
| 4317 <annotation> | |
| 4318 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4319 <rdf:Description rdf:about="#_834f5d7a-c002-47c5-ab84-ffd83d468dab"> | |
| 4320 <bqbiol:is> | |
| 4321 <rdf:Bag> | |
| 4322 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00460"/> | |
| 4323 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019636"/> | |
| 4324 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01250"/> | |
| 4325 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/DUT"/> | |
| 4326 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17625"/> | |
| 4327 </rdf:Bag> | |
| 4328 </bqbiol:is> | |
| 4329 </rdf:Description> | |
| 4330 </rdf:RDF> | |
| 4331 </annotation> | |
| 4332 </species> | |
| 4333 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C15602" metaid="_6927a3e2-f612-4fbb-a54a-979455a09850" name="Quinone" sboTerm="SBO:0000240"> | |
| 4334 <notes> | |
| 4335 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4336 <p>kegg.compound: C15602</p> | |
| 4337 <p>PubChem: 17396594</p> | |
| 4338 <p>ChEBI: 16509</p> | |
| 4339 </body> | |
| 4340 </notes> | |
| 4341 <annotation> | |
| 4342 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4343 <rdf:Description rdf:about="#_6927a3e2-f612-4fbb-a54a-979455a09850"> | |
| 4344 <bqbiol:is> | |
| 4345 <rdf:Bag> | |
| 4346 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C15602"/> | |
| 4347 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16509"/> | |
| 4348 </rdf:Bag> | |
| 4349 </bqbiol:is> | |
| 4350 </rdf:Description> | |
| 4351 </rdf:RDF> | |
| 4352 </annotation> | |
| 4353 </species> | |
| 4354 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C15603" metaid="_2854e538-866b-4c4e-9847-cec7e7d541f9" name="Hydroquinone" sboTerm="SBO:0000240"> | |
| 4355 <notes> | |
| 4356 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4357 <p>kegg.compound: C15603</p> | |
| 4358 <p>PubChem: 17396595</p> | |
| 4359 <p>ChEBI: 17594</p> | |
| 4360 </body> | |
| 4361 </notes> | |
| 4362 <annotation> | |
| 4363 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4364 <rdf:Description rdf:about="#_2854e538-866b-4c4e-9847-cec7e7d541f9"> | |
| 4365 <bqbiol:is> | |
| 4366 <rdf:Bag> | |
| 4367 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C15603"/> | |
| 4368 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17594"/> | |
| 4369 </rdf:Bag> | |
| 4370 </bqbiol:is> | |
| 4371 </rdf:Description> | |
| 4372 </rdf:RDF> | |
| 4373 </annotation> | |
| 4374 </species> | |
| 4375 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H6O3" hasOnlySubstanceUnits="false" id="C00109" metaid="_3b63fa9f-ee1a-4443-88a2-b01542bb3489" name="2-Oxobutanoate" sboTerm="SBO:0000240"> | |
| 4376 <notes> | |
| 4377 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4378 <p>kegg.compound: C00109</p> | |
| 4379 <p>KNApSAcK: C00019675</p> | |
| 4380 <p>CAS: 600-18-0</p> | |
| 4381 <p>PubChem: 3409</p> | |
| 4382 <p>3DMET: B00028</p> | |
| 4383 <p>PDB-CCD: 2KT</p> | |
| 4384 <p>ChEBI: 16763 30831</p> | |
| 4385 <p>LIPIDMAPS: LMFA01060002</p> | |
| 4386 <p>LipidBank: DFA0386</p> | |
| 4387 <p>NIKKAJI: J2.726J</p> | |
| 4388 <p>formula: C4H6O3</p> | |
| 4389 <p>weight: 102.0886</p> | |
| 4390 </body> | |
| 4391 </notes> | |
| 4392 <annotation> | |
| 4393 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4394 <rdf:Description rdf:about="#_3b63fa9f-ee1a-4443-88a2-b01542bb3489"> | |
| 4395 <bqbiol:is> | |
| 4396 <rdf:Bag> | |
| 4397 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00109"/> | |
| 4398 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019675"/> | |
| 4399 <rdf:li rdf:resource="https://identifiers.org/CAS/600-18-0"/> | |
| 4400 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00028"/> | |
| 4401 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/2KT"/> | |
| 4402 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16763 30831"/> | |
| 4403 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA01060002"/> | |
| 4404 <rdf:li rdf:resource="https://identifiers.org/LipidBank/DFA0386"/> | |
| 4405 </rdf:Bag> | |
| 4406 </bqbiol:is> | |
| 4407 </rdf:Description> | |
| 4408 </rdf:RDF> | |
| 4409 </annotation> | |
| 4410 </species> | |
| 4411 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="HSR" hasOnlySubstanceUnits="false" id="C00229" metaid="_166b2b4b-ce15-48e5-a01e-b49cecf576e2" name="Acyl-carrier protein" sboTerm="SBO:0000240"> | |
| 4412 <notes> | |
| 4413 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4414 <p>kegg.compound: C00229</p> | |
| 4415 <p>PubChem: 3528</p> | |
| 4416 <p>ChEBI: 18359</p> | |
| 4417 <p>formula: HSR</p> | |
| 4418 </body> | |
| 4419 </notes> | |
| 4420 <annotation> | |
| 4421 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4422 <rdf:Description rdf:about="#_166b2b4b-ce15-48e5-a01e-b49cecf576e2"> | |
| 4423 <bqbiol:is> | |
| 4424 <rdf:Bag> | |
| 4425 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00229"/> | |
| 4426 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18359"/> | |
| 4427 </rdf:Bag> | |
| 4428 </bqbiol:is> | |
| 4429 </rdf:Description> | |
| 4430 </rdf:RDF> | |
| 4431 </annotation> | |
| 4432 </species> | |
| 4433 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H7NO2" hasOnlySubstanceUnits="false" id="C00108" metaid="b3dcc1b2-79b9-4cb5-9ed1-590465731736" name="Anthranilate" sboTerm="SBO:0000240"> | |
| 4434 <notes> | |
| 4435 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4436 <p>kegg.compound: C00108</p> | |
| 4437 <p>KNApSAcK: C00007382</p> | |
| 4438 <p>CAS: 118-92-3</p> | |
| 4439 <p>PubChem: 3408</p> | |
| 4440 <p>3DMET: B00027</p> | |
| 4441 <p>PDB-CCD: BE2</p> | |
| 4442 <p>ChEBI: 16567 30754</p> | |
| 4443 <p>NIKKAJI: J2.912B</p> | |
| 4444 <p>formula: C7H7NO2</p> | |
| 4445 <p>weight: 137.136</p> | |
| 4446 </body> | |
| 4447 </notes> | |
| 4448 <annotation> | |
| 4449 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4450 <rdf:Description rdf:about="#b3dcc1b2-79b9-4cb5-9ed1-590465731736"> | |
| 4451 <bqbiol:is> | |
| 4452 <rdf:Bag> | |
| 4453 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00108"/> | |
| 4454 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007382"/> | |
| 4455 <rdf:li rdf:resource="https://identifiers.org/CAS/118-92-3"/> | |
| 4456 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00027"/> | |
| 4457 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/BE2"/> | |
| 4458 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16567 30754"/> | |
| 4459 </rdf:Bag> | |
| 4460 </bqbiol:is> | |
| 4461 </rdf:Description> | |
| 4462 </rdf:RDF> | |
| 4463 </annotation> | |
| 4464 </species> | |
| 4465 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C2H5O5P" hasOnlySubstanceUnits="false" id="C00227" metaid="_9d7c8626-0af9-4b66-bc38-5dfff72e18de" name="Acetyl phosphate" sboTerm="SBO:0000240"> | |
| 4466 <notes> | |
| 4467 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4468 <p>kegg.compound: C00227</p> | |
| 4469 <p>KNApSAcK: C00019559</p> | |
| 4470 <p>PubChem: 3527</p> | |
| 4471 <p>3DMET: B00063</p> | |
| 4472 <p>PDB-CCD: UVW</p> | |
| 4473 <p>ChEBI: 15350</p> | |
| 4474 <p>NIKKAJI: J37.490C</p> | |
| 4475 <p>formula: C2H5O5P</p> | |
| 4476 <p>weight: 140.0319</p> | |
| 4477 </body> | |
| 4478 </notes> | |
| 4479 <annotation> | |
| 4480 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4481 <rdf:Description rdf:about="#_9d7c8626-0af9-4b66-bc38-5dfff72e18de"> | |
| 4482 <bqbiol:is> | |
| 4483 <rdf:Bag> | |
| 4484 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00227"/> | |
| 4485 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019559"/> | |
| 4486 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00063"/> | |
| 4487 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/UVW"/> | |
| 4488 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15350"/> | |
| 4489 </rdf:Bag> | |
| 4490 </bqbiol:is> | |
| 4491 </rdf:Description> | |
| 4492 </rdf:RDF> | |
| 4493 </annotation> | |
| 4494 </species> | |
| 4495 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H13N2O9P" hasOnlySubstanceUnits="false" id="C00105" metaid="d7c3b4ed-9075-4bc0-9de3-8005f147f2f1" name="UMP" sboTerm="SBO:0000240"> | |
| 4496 <notes> | |
| 4497 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4498 <p>kegg.compound: C00105</p> | |
| 4499 <p>KNApSAcK: C00007311</p> | |
| 4500 <p>CAS: 58-97-9</p> | |
| 4501 <p>PubChem: 3405</p> | |
| 4502 <p>3DMET: B01161</p> | |
| 4503 <p>PDB-CCD: U U5P</p> | |
| 4504 <p>ChEBI: 16695</p> | |
| 4505 <p>NIKKAJI: J4.594B</p> | |
| 4506 <p>formula: C9H13N2O9P</p> | |
| 4507 <p>weight: 324.1813</p> | |
| 4508 </body> | |
| 4509 </notes> | |
| 4510 <annotation> | |
| 4511 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4512 <rdf:Description rdf:about="#d7c3b4ed-9075-4bc0-9de3-8005f147f2f1"> | |
| 4513 <bqbiol:is> | |
| 4514 <rdf:Bag> | |
| 4515 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00105"/> | |
| 4516 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007311"/> | |
| 4517 <rdf:li rdf:resource="https://identifiers.org/CAS/58-97-9"/> | |
| 4518 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01161"/> | |
| 4519 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/U U5P"/> | |
| 4520 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16695"/> | |
| 4521 </rdf:Bag> | |
| 4522 </bqbiol:is> | |
| 4523 </rdf:Description> | |
| 4524 </rdf:RDF> | |
| 4525 </annotation> | |
| 4526 </species> | |
| 4527 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H14N4O11P2" hasOnlySubstanceUnits="false" id="C00104" metaid="dbd3046b-0bf0-49c3-b9d8-2d17c357255b" name="IDP" sboTerm="SBO:0000240"> | |
| 4528 <notes> | |
| 4529 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4530 <p>kegg.compound: C00104</p> | |
| 4531 <p>CAS: 86-04-4</p> | |
| 4532 <p>PubChem: 3404</p> | |
| 4533 <p>3DMET: B01160</p> | |
| 4534 <p>PDB-CCD: IDP</p> | |
| 4535 <p>ChEBI: 17808</p> | |
| 4536 <p>NIKKAJI: J38.561A</p> | |
| 4537 <p>formula: C10H14N4O11P2</p> | |
| 4538 <p>weight: 428.1859</p> | |
| 4539 </body> | |
| 4540 </notes> | |
| 4541 <annotation> | |
| 4542 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4543 <rdf:Description rdf:about="#dbd3046b-0bf0-49c3-b9d8-2d17c357255b"> | |
| 4544 <bqbiol:is> | |
| 4545 <rdf:Bag> | |
| 4546 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00104"/> | |
| 4547 <rdf:li rdf:resource="https://identifiers.org/CAS/86-04-4"/> | |
| 4548 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01160"/> | |
| 4549 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/IDP"/> | |
| 4550 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17808"/> | |
| 4551 </rdf:Bag> | |
| 4552 </bqbiol:is> | |
| 4553 </rdf:Description> | |
| 4554 </rdf:RDF> | |
| 4555 </annotation> | |
| 4556 </species> | |
| 4557 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H14N2" hasOnlySubstanceUnits="false" id="C01672" metaid="de7eac8b-e8f1-4182-bdcd-edf968dded0a" name="Cadaverine" sboTerm="SBO:0000240"> | |
| 4558 <notes> | |
| 4559 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4560 <p>kegg.compound: C01672</p> | |
| 4561 <p>KNApSAcK: C00001403</p> | |
| 4562 <p>CAS: 462-94-2</p> | |
| 4563 <p>PubChem: 4816</p> | |
| 4564 <p>3DMET: B00334</p> | |
| 4565 <p>PDB-CCD: N2P</p> | |
| 4566 <p>ChEBI: 18127</p> | |
| 4567 <p>NIKKAJI: J5.771A</p> | |
| 4568 <p>formula: C5H14N2</p> | |
| 4569 <p>weight: 102.1781</p> | |
| 4570 </body> | |
| 4571 </notes> | |
| 4572 <annotation> | |
| 4573 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4574 <rdf:Description rdf:about="#de7eac8b-e8f1-4182-bdcd-edf968dded0a"> | |
| 4575 <bqbiol:is> | |
| 4576 <rdf:Bag> | |
| 4577 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01672"/> | |
| 4578 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001403"/> | |
| 4579 <rdf:li rdf:resource="https://identifiers.org/CAS/462-94-2"/> | |
| 4580 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00334"/> | |
| 4581 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/N2P"/> | |
| 4582 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18127"/> | |
| 4583 </rdf:Bag> | |
| 4584 </bqbiol:is> | |
| 4585 </rdf:Description> | |
| 4586 </rdf:RDF> | |
| 4587 </annotation> | |
| 4588 </species> | |
| 4589 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H13O10P" hasOnlySubstanceUnits="false" id="C00345" metaid="bc6d7de1-0fd0-466d-8040-127209803033" name="6-Phospho-D-gluconate" sboTerm="SBO:0000240"> | |
| 4590 <notes> | |
| 4591 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4592 <p>kegg.compound: C00345</p> | |
| 4593 <p>KNApSAcK: C00007481</p> | |
| 4594 <p>PubChem: 3638</p> | |
| 4595 <p>3DMET: B01221</p> | |
| 4596 <p>PDB-CCD: 6PG</p> | |
| 4597 <p>ChEBI: 48928</p> | |
| 4598 <p>NIKKAJI: J1.343.743B</p> | |
| 4599 <p>formula: C6H13O10P</p> | |
| 4600 <p>weight: 276.1352</p> | |
| 4601 </body> | |
| 4602 </notes> | |
| 4603 <annotation> | |
| 4604 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4605 <rdf:Description rdf:about="#bc6d7de1-0fd0-466d-8040-127209803033"> | |
| 4606 <bqbiol:is> | |
| 4607 <rdf:Bag> | |
| 4608 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00345"/> | |
| 4609 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007481"/> | |
| 4610 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01221"/> | |
| 4611 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/6PG"/> | |
| 4612 <rdf:li rdf:resource="https://identifiers.org/ChEBI/48928"/> | |
| 4613 </rdf:Bag> | |
| 4614 </bqbiol:is> | |
| 4615 </rdf:Description> | |
| 4616 </rdf:RDF> | |
| 4617 </annotation> | |
| 4618 </species> | |
| 4619 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H14N5O10PS" hasOnlySubstanceUnits="false" id="C00224" metaid="ded6589f-d995-4778-82fb-e2b4c7073a26" name="Adenylyl sulfate" sboTerm="SBO:0000240"> | |
| 4620 <notes> | |
| 4621 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4622 <p>kegg.compound: C00224</p> | |
| 4623 <p>KNApSAcK: C00007445</p> | |
| 4624 <p>CAS: 485-84-7</p> | |
| 4625 <p>PubChem: 3524</p> | |
| 4626 <p>3DMET: B01194</p> | |
| 4627 <p>PDB-CCD: ADX</p> | |
| 4628 <p>ChEBI: 17709</p> | |
| 4629 <p>NIKKAJI: J37.502K</p> | |
| 4630 <p>formula: C10H14N5O10PS</p> | |
| 4631 <p>weight: 427.2844</p> | |
| 4632 </body> | |
| 4633 </notes> | |
| 4634 <annotation> | |
| 4635 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4636 <rdf:Description rdf:about="#ded6589f-d995-4778-82fb-e2b4c7073a26"> | |
| 4637 <bqbiol:is> | |
| 4638 <rdf:Bag> | |
| 4639 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00224"/> | |
| 4640 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007445"/> | |
| 4641 <rdf:li rdf:resource="https://identifiers.org/CAS/485-84-7"/> | |
| 4642 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01194"/> | |
| 4643 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/ADX"/> | |
| 4644 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17709"/> | |
| 4645 </rdf:Bag> | |
| 4646 </bqbiol:is> | |
| 4647 </rdf:Description> | |
| 4648 </rdf:RDF> | |
| 4649 </annotation> | |
| 4650 </species> | |
| 4651 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H13O9P" hasOnlySubstanceUnits="false" id="C00103" metaid="_55b7b39b-aba6-43d7-a6ca-e0326bd39bc3" name="D-Glucose 1-phosphate" sboTerm="SBO:0000240"> | |
| 4652 <notes> | |
| 4653 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4654 <p>kegg.compound: C00103</p> | |
| 4655 <p>KNApSAcK: C00007482</p> | |
| 4656 <p>CAS: 59-56-3</p> | |
| 4657 <p>PubChem: 3403</p> | |
| 4658 <p>3DMET: B04634</p> | |
| 4659 <p>PDB-CCD: G1P</p> | |
| 4660 <p>ChEBI: 29042</p> | |
| 4661 <p>NIKKAJI: J40.065C</p> | |
| 4662 <p>formula: C6H13O9P</p> | |
| 4663 <p>weight: 260.1358</p> | |
| 4664 </body> | |
| 4665 </notes> | |
| 4666 <annotation> | |
| 4667 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4668 <rdf:Description rdf:about="#_55b7b39b-aba6-43d7-a6ca-e0326bd39bc3"> | |
| 4669 <bqbiol:is> | |
| 4670 <rdf:Bag> | |
| 4671 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00103"/> | |
| 4672 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007482"/> | |
| 4673 <rdf:li rdf:resource="https://identifiers.org/CAS/59-56-3"/> | |
| 4674 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04634"/> | |
| 4675 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/G1P"/> | |
| 4676 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29042"/> | |
| 4677 </rdf:Bag> | |
| 4678 </bqbiol:is> | |
| 4679 </rdf:Description> | |
| 4680 </rdf:RDF> | |
| 4681 </annotation> | |
| 4682 </species> | |
| 4683 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C8H13O10PR2" hasOnlySubstanceUnits="false" id="C00344" metaid="_65fb358f-0e97-471b-b793-95c111169511" name="Phosphatidylglycerol" sboTerm="SBO:0000240"> | |
| 4684 <notes> | |
| 4685 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4686 <p>kegg.compound: C00344</p> | |
| 4687 <p>PubChem: 3637</p> | |
| 4688 <p>ChEBI: 17517</p> | |
| 4689 <p>NIKKAJI: J453.835H</p> | |
| 4690 <p>formula: C8H13O10PR2</p> | |
| 4691 </body> | |
| 4692 </notes> | |
| 4693 <annotation> | |
| 4694 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4695 <rdf:Description rdf:about="#_65fb358f-0e97-471b-b793-95c111169511"> | |
| 4696 <bqbiol:is> | |
| 4697 <rdf:Bag> | |
| 4698 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00344"/> | |
| 4699 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17517"/> | |
| 4700 </rdf:Bag> | |
| 4701 </bqbiol:is> | |
| 4702 </rdf:Description> | |
| 4703 </rdf:RDF> | |
| 4704 </annotation> | |
| 4705 </species> | |
| 4706 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H9NO4" hasOnlySubstanceUnits="false" id="C03972" metaid="_14558367-a496-42f3-a4e1-8eb5e49782c8" name="2,3,4,5-Tetrahydrodipicolinate" sboTerm="SBO:0000240"> | |
| 4707 <notes> | |
| 4708 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4709 <p>kegg.compound: C03972</p> | |
| 4710 <p>KNApSAcK: C00007502</p> | |
| 4711 <p>PubChem: 6692</p> | |
| 4712 <p>3DMET: B01707</p> | |
| 4713 <p>ChEBI: 16845 864</p> | |
| 4714 <p>NIKKAJI: J603.133A</p> | |
| 4715 <p>formula: C7H9NO4</p> | |
| 4716 <p>weight: 171.1507</p> | |
| 4717 </body> | |
| 4718 </notes> | |
| 4719 <annotation> | |
| 4720 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4721 <rdf:Description rdf:about="#_14558367-a496-42f3-a4e1-8eb5e49782c8"> | |
| 4722 <bqbiol:is> | |
| 4723 <rdf:Bag> | |
| 4724 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03972"/> | |
| 4725 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007502"/> | |
| 4726 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01707"/> | |
| 4727 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16845 864"/> | |
| 4728 </rdf:Bag> | |
| 4729 </bqbiol:is> | |
| 4730 </rdf:Description> | |
| 4731 </rdf:RDF> | |
| 4732 </annotation> | |
| 4733 </species> | |
| 4734 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H10O3" hasOnlySubstanceUnits="false" id="C00233" metaid="aa1fe3e0-7114-46f7-b046-ada8edf5902c" name="4-Methyl-2-oxopentanoate" sboTerm="SBO:0000240"> | |
| 4735 <notes> | |
| 4736 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4737 <p>kegg.compound: C00233</p> | |
| 4738 <p>KNApSAcK: C00019677</p> | |
| 4739 <p>CAS: 816-66-0</p> | |
| 4740 <p>PubChem: 3532</p> | |
| 4741 <p>3DMET: B00066</p> | |
| 4742 <p>PDB-CCD: COI</p> | |
| 4743 <p>ChEBI: 17865 48430</p> | |
| 4744 <p>NIKKAJI: J39.557I</p> | |
| 4745 <p>formula: C6H10O3</p> | |
| 4746 <p>weight: 130.1418</p> | |
| 4747 </body> | |
| 4748 </notes> | |
| 4749 <annotation> | |
| 4750 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4751 <rdf:Description rdf:about="#aa1fe3e0-7114-46f7-b046-ada8edf5902c"> | |
| 4752 <bqbiol:is> | |
| 4753 <rdf:Bag> | |
| 4754 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00233"/> | |
| 4755 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019677"/> | |
| 4756 <rdf:li rdf:resource="https://identifiers.org/CAS/816-66-0"/> | |
| 4757 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00066"/> | |
| 4758 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/COI"/> | |
| 4759 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17865 48430"/> | |
| 4760 </rdf:Bag> | |
| 4761 </bqbiol:is> | |
| 4762 </rdf:Description> | |
| 4763 </rdf:RDF> | |
| 4764 </annotation> | |
| 4765 </species> | |
| 4766 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H14O12P2" hasOnlySubstanceUnits="false" id="C00354" metaid="_3853d8aa-de9f-43a6-aa23-6f99836acf44" name="D-Fructose 1,6-bisphosphate" sboTerm="SBO:0000240"> | |
| 4767 <notes> | |
| 4768 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4769 <p>kegg.compound: C00354</p> | |
| 4770 <p>KNApSAcK: C00007386</p> | |
| 4771 <p>CAS: 488-69-7</p> | |
| 4772 <p>PubChem: 3647</p> | |
| 4773 <p>3DMET: B04673</p> | |
| 4774 <p>PDB-CCD: AFP FBP</p> | |
| 4775 <p>ChEBI: 16905 37736</p> | |
| 4776 <p>NIKKAJI: J15.941G</p> | |
| 4777 <p>formula: C6H14O12P2</p> | |
| 4778 <p>weight: 340.1157</p> | |
| 4779 </body> | |
| 4780 </notes> | |
| 4781 <annotation> | |
| 4782 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4783 <rdf:Description rdf:about="#_3853d8aa-de9f-43a6-aa23-6f99836acf44"> | |
| 4784 <bqbiol:is> | |
| 4785 <rdf:Bag> | |
| 4786 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00354"/> | |
| 4787 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007386"/> | |
| 4788 <rdf:li rdf:resource="https://identifiers.org/CAS/488-69-7"/> | |
| 4789 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04673"/> | |
| 4790 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/AFP FBP"/> | |
| 4791 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16905 37736"/> | |
| 4792 </rdf:Bag> | |
| 4793 </bqbiol:is> | |
| 4794 </rdf:Description> | |
| 4795 </rdf:RDF> | |
| 4796 </annotation> | |
| 4797 </species> | |
| 4798 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C02412" metaid="_1676c980-c17b-411d-96a3-112086f2b710" name="Glycyl-tRNA(Gly)" sboTerm="SBO:0000240"> | |
| 4799 <notes> | |
| 4800 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4801 <p>kegg.compound: C02412</p> | |
| 4802 <p>PubChem: 5445</p> | |
| 4803 <p>ChEBI: 29156</p> | |
| 4804 <p>formula: C12H20NO11PR2(C5H8O6PR)n</p> | |
| 4805 </body> | |
| 4806 </notes> | |
| 4807 <annotation> | |
| 4808 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4809 <rdf:Description rdf:about="#_1676c980-c17b-411d-96a3-112086f2b710"> | |
| 4810 <bqbiol:is> | |
| 4811 <rdf:Bag> | |
| 4812 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02412"/> | |
| 4813 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29156"/> | |
| 4814 </rdf:Bag> | |
| 4815 </bqbiol:is> | |
| 4816 </rdf:Description> | |
| 4817 </rdf:RDF> | |
| 4818 </annotation> | |
| 4819 </species> | |
| 4820 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H15N3O11P2" hasOnlySubstanceUnits="false" id="C00112" metaid="fbf1d389-382b-4d16-b37e-34b2bd8d8898" name="CDP" sboTerm="SBO:0000240"> | |
| 4821 <notes> | |
| 4822 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4823 <p>kegg.compound: C00112</p> | |
| 4824 <p>CAS: 63-38-7</p> | |
| 4825 <p>PubChem: 3412</p> | |
| 4826 <p>3DMET: B01162</p> | |
| 4827 <p>PDB-CCD: CDP</p> | |
| 4828 <p>ChEBI: 17239</p> | |
| 4829 <p>NIKKAJI: J150.290E</p> | |
| 4830 <p>formula: C9H15N3O11P2</p> | |
| 4831 <p>weight: 403.1764</p> | |
| 4832 </body> | |
| 4833 </notes> | |
| 4834 <annotation> | |
| 4835 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4836 <rdf:Description rdf:about="#fbf1d389-382b-4d16-b37e-34b2bd8d8898"> | |
| 4837 <bqbiol:is> | |
| 4838 <rdf:Bag> | |
| 4839 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00112"/> | |
| 4840 <rdf:li rdf:resource="https://identifiers.org/CAS/63-38-7"/> | |
| 4841 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01162"/> | |
| 4842 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/CDP"/> | |
| 4843 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17239"/> | |
| 4844 </rdf:Bag> | |
| 4845 </bqbiol:is> | |
| 4846 </rdf:Description> | |
| 4847 </rdf:RDF> | |
| 4848 </annotation> | |
| 4849 </species> | |
| 4850 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H7O6P" hasOnlySubstanceUnits="false" id="C00111" metaid="bbf77b7d-bd2d-4afb-af97-5581f5cfe7ee" name="Glycerone phosphate" sboTerm="SBO:0000240"> | |
| 4851 <notes> | |
| 4852 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4853 <p>kegg.compound: C00111</p> | |
| 4854 <p>KNApSAcK: C00007560</p> | |
| 4855 <p>CAS: 57-04-5</p> | |
| 4856 <p>PubChem: 3411</p> | |
| 4857 <p>3DMET: B00029</p> | |
| 4858 <p>PDB-CCD: 13P</p> | |
| 4859 <p>ChEBI: 16108</p> | |
| 4860 <p>NIKKAJI: J213.543D</p> | |
| 4861 <p>formula: C3H7O6P</p> | |
| 4862 <p>weight: 170.0578</p> | |
| 4863 </body> | |
| 4864 </notes> | |
| 4865 <annotation> | |
| 4866 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4867 <rdf:Description rdf:about="#bbf77b7d-bd2d-4afb-af97-5581f5cfe7ee"> | |
| 4868 <bqbiol:is> | |
| 4869 <rdf:Bag> | |
| 4870 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00111"/> | |
| 4871 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007560"/> | |
| 4872 <rdf:li rdf:resource="https://identifiers.org/CAS/57-04-5"/> | |
| 4873 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00029"/> | |
| 4874 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/13P"/> | |
| 4875 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16108"/> | |
| 4876 </rdf:Bag> | |
| 4877 </bqbiol:is> | |
| 4878 </rdf:Description> | |
| 4879 </rdf:RDF> | |
| 4880 </annotation> | |
| 4881 </species> | |
| 4882 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H11O8P" hasOnlySubstanceUnits="false" id="C00231" metaid="e0803b2f-6346-4a63-985b-f6885ad38ca8" name="D-Xylulose 5-phosphate" sboTerm="SBO:0000240"> | |
| 4883 <notes> | |
| 4884 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4885 <p>kegg.compound: C00231</p> | |
| 4886 <p>KNApSAcK: C00019693</p> | |
| 4887 <p>PubChem: 3530</p> | |
| 4888 <p>3DMET: B01195</p> | |
| 4889 <p>PDB-CCD: 5SP</p> | |
| 4890 <p>ChEBI: 16332</p> | |
| 4891 <p>NIKKAJI: J652.282C</p> | |
| 4892 <p>formula: C5H11O8P</p> | |
| 4893 <p>weight: 230.1098</p> | |
| 4894 </body> | |
| 4895 </notes> | |
| 4896 <annotation> | |
| 4897 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4898 <rdf:Description rdf:about="#e0803b2f-6346-4a63-985b-f6885ad38ca8"> | |
| 4899 <bqbiol:is> | |
| 4900 <rdf:Bag> | |
| 4901 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00231"/> | |
| 4902 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019693"/> | |
| 4903 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01195"/> | |
| 4904 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/5SP"/> | |
| 4905 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16332"/> | |
| 4906 </rdf:Bag> | |
| 4907 </bqbiol:is> | |
| 4908 </rdf:Description> | |
| 4909 </rdf:RDF> | |
| 4910 </annotation> | |
| 4911 </species> | |
| 4912 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H14NO8P" hasOnlySubstanceUnits="false" id="C00352" metaid="de5d2154-bfcd-48fe-8279-e65d38f8f85b" name="D-Glucosamine 6-phosphate" sboTerm="SBO:0000240"> | |
| 4913 <notes> | |
| 4914 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4915 <p>kegg.compound: C00352</p> | |
| 4916 <p>KNApSAcK: C00019580</p> | |
| 4917 <p>CAS: 3616-42-0</p> | |
| 4918 <p>PubChem: 3645</p> | |
| 4919 <p>3DMET: B01222</p> | |
| 4920 <p>PDB-CCD: 4R1 GLP</p> | |
| 4921 <p>ChEBI: 15873 47987</p> | |
| 4922 <p>NIKKAJI: J79.822C</p> | |
| 4923 <p>formula: C6H14NO8P</p> | |
| 4924 <p>weight: 259.151</p> | |
| 4925 </body> | |
| 4926 </notes> | |
| 4927 <annotation> | |
| 4928 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4929 <rdf:Description rdf:about="#de5d2154-bfcd-48fe-8279-e65d38f8f85b"> | |
| 4930 <bqbiol:is> | |
| 4931 <rdf:Bag> | |
| 4932 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00352"/> | |
| 4933 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019580"/> | |
| 4934 <rdf:li rdf:resource="https://identifiers.org/CAS/3616-42-0"/> | |
| 4935 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01222"/> | |
| 4936 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/4R1 GLP"/> | |
| 4937 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15873 47987"/> | |
| 4938 </rdf:Bag> | |
| 4939 </bqbiol:is> | |
| 4940 </rdf:Description> | |
| 4941 </rdf:RDF> | |
| 4942 </annotation> | |
| 4943 </species> | |
| 4944 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C11H14NO6P" hasOnlySubstanceUnits="false" id="C03506" metaid="e1b73845-7453-4ee2-ac0b-acceb836b269" name="Indoleglycerol phosphate" sboTerm="SBO:0000240"> | |
| 4945 <notes> | |
| 4946 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4947 <p>kegg.compound: C03506</p> | |
| 4948 <p>PubChem: 6317</p> | |
| 4949 <p>3DMET: B04900</p> | |
| 4950 <p>PDB-CCD: IGP</p> | |
| 4951 <p>ChEBI: 18299 51793</p> | |
| 4952 <p>NIKKAJI: J39.032A</p> | |
| 4953 <p>formula: C11H14NO6P</p> | |
| 4954 <p>weight: 287.2057</p> | |
| 4955 </body> | |
| 4956 </notes> | |
| 4957 <annotation> | |
| 4958 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4959 <rdf:Description rdf:about="#e1b73845-7453-4ee2-ac0b-acceb836b269"> | |
| 4960 <bqbiol:is> | |
| 4961 <rdf:Bag> | |
| 4962 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03506"/> | |
| 4963 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04900"/> | |
| 4964 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/IGP"/> | |
| 4965 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18299 51793"/> | |
| 4966 </rdf:Bag> | |
| 4967 </bqbiol:is> | |
| 4968 </rdf:Description> | |
| 4969 </rdf:RDF> | |
| 4970 </annotation> | |
| 4971 </species> | |
| 4972 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H12NO8PR2" hasOnlySubstanceUnits="false" id="C00350" metaid="_4fd49a46-0826-4843-9e49-06b798786c11" name="Phosphatidylethanolamine" sboTerm="SBO:0000240"> | |
| 4973 <notes> | |
| 4974 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4975 <p>kegg.compound: C00350</p> | |
| 4976 <p>CAS: 39382-08-6</p> | |
| 4977 <p>PubChem: 3643</p> | |
| 4978 <p>ChEBI: 16038</p> | |
| 4979 <p>formula: C7H12NO8PR2</p> | |
| 4980 </body> | |
| 4981 </notes> | |
| 4982 <annotation> | |
| 4983 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4984 <rdf:Description rdf:about="#_4fd49a46-0826-4843-9e49-06b798786c11"> | |
| 4985 <bqbiol:is> | |
| 4986 <rdf:Bag> | |
| 4987 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00350"/> | |
| 4988 <rdf:li rdf:resource="https://identifiers.org/CAS/39382-08-6"/> | |
| 4989 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16038"/> | |
| 4990 </rdf:Bag> | |
| 4991 </bqbiol:is> | |
| 4992 </rdf:Description> | |
| 4993 </rdf:RDF> | |
| 4994 </annotation> | |
| 4995 </species> | |
| 4996 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H3O3SR" hasOnlySubstanceUnits="false" id="C01209" metaid="cbb2b025-b3da-439b-8ea1-4e68ff17cd4e" name="Malonyl-[acyl-carrier protein]" sboTerm="SBO:0000240"> | |
| 4997 <notes> | |
| 4998 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4999 <p>kegg.compound: C01209</p> | |
| 5000 <p>PubChem: 4431</p> | |
| 5001 <p>ChEBI: 17330</p> | |
| 5002 <p>formula: C3H3O3SR</p> | |
| 5003 </body> | |
| 5004 </notes> | |
| 5005 <annotation> | |
| 5006 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5007 <rdf:Description rdf:about="#cbb2b025-b3da-439b-8ea1-4e68ff17cd4e"> | |
| 5008 <bqbiol:is> | |
| 5009 <rdf:Bag> | |
| 5010 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01209"/> | |
| 5011 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17330"/> | |
| 5012 </rdf:Bag> | |
| 5013 </bqbiol:is> | |
| 5014 </rdf:Description> | |
| 5015 </rdf:RDF> | |
| 5016 </annotation> | |
| 5017 </species> | |
| 5018 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H10NO6P" hasOnlySubstanceUnits="false" id="C12215" metaid="c99d9b5a-23e0-4af9-91ba-b5dc7e352837" name="Iminoerythrose 4-phosphate" sboTerm="SBO:0000240"> | |
| 5019 <notes> | |
| 5020 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5021 <p>kegg.compound: C12215</p> | |
| 5022 <p>PubChem: 14360</p> | |
| 5023 <p>3DMET: B05619</p> | |
| 5024 <p>ChEBI: 31692</p> | |
| 5025 <p>NIKKAJI: J1.682.370H</p> | |
| 5026 <p>formula: C4H10NO6P</p> | |
| 5027 <p>weight: 199.0991</p> | |
| 5028 </body> | |
| 5029 </notes> | |
| 5030 <annotation> | |
| 5031 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5032 <rdf:Description rdf:about="#c99d9b5a-23e0-4af9-91ba-b5dc7e352837"> | |
| 5033 <bqbiol:is> | |
| 5034 <rdf:Bag> | |
| 5035 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C12215"/> | |
| 5036 <rdf:li rdf:resource="https://identifiers.org/3DMET/B05619"/> | |
| 5037 <rdf:li rdf:resource="https://identifiers.org/ChEBI/31692"/> | |
| 5038 </rdf:Bag> | |
| 5039 </bqbiol:is> | |
| 5040 </rdf:Description> | |
| 5041 </rdf:RDF> | |
| 5042 </annotation> | |
| 5043 </species> | |
| 5044 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H14NO8P" hasOnlySubstanceUnits="false" id="C12214" metaid="_8daacd9d-820a-4e8e-8bf8-258e212d36bc" name="Aminofructose 6-phosphate" sboTerm="SBO:0000240"> | |
| 5045 <notes> | |
| 5046 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5047 <p>kegg.compound: C12214</p> | |
| 5048 <p>PubChem: 14359</p> | |
| 5049 <p>3DMET: B05618</p> | |
| 5050 <p>ChEBI: 31203</p> | |
| 5051 <p>NIKKAJI: J2.781.581B</p> | |
| 5052 <p>formula: C6H14NO8P</p> | |
| 5053 <p>weight: 259.151</p> | |
| 5054 </body> | |
| 5055 </notes> | |
| 5056 <annotation> | |
| 5057 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5058 <rdf:Description rdf:about="#_8daacd9d-820a-4e8e-8bf8-258e212d36bc"> | |
| 5059 <bqbiol:is> | |
| 5060 <rdf:Bag> | |
| 5061 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C12214"/> | |
| 5062 <rdf:li rdf:resource="https://identifiers.org/3DMET/B05618"/> | |
| 5063 <rdf:li rdf:resource="https://identifiers.org/ChEBI/31203"/> | |
| 5064 </rdf:Bag> | |
| 5065 </bqbiol:is> | |
| 5066 </rdf:Description> | |
| 5067 </rdf:RDF> | |
| 5068 </annotation> | |
| 5069 </species> | |
| 5070 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H13O14P3" hasOnlySubstanceUnits="false" id="C00119" metaid="_0b4cb2b7-775a-488f-bb4c-45f71a87779f" name="5-Phospho-alpha-D-ribose 1-diphosphate" sboTerm="SBO:0000240"> | |
| 5071 <notes> | |
| 5072 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5073 <p>kegg.compound: C00119</p> | |
| 5074 <p>KNApSAcK: C00007296</p> | |
| 5075 <p>PubChem: 3419</p> | |
| 5076 <p>3DMET: B01164</p> | |
| 5077 <p>PDB-CCD: PRP</p> | |
| 5078 <p>ChEBI: 17111</p> | |
| 5079 <p>NIKKAJI: J40.073D</p> | |
| 5080 <p>formula: C5H13O14P3</p> | |
| 5081 <p>weight: 390.0696</p> | |
| 5082 </body> | |
| 5083 </notes> | |
| 5084 <annotation> | |
| 5085 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5086 <rdf:Description rdf:about="#_0b4cb2b7-775a-488f-bb4c-45f71a87779f"> | |
| 5087 <bqbiol:is> | |
| 5088 <rdf:Bag> | |
| 5089 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00119"/> | |
| 5090 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007296"/> | |
| 5091 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01164"/> | |
| 5092 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/PRP"/> | |
| 5093 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17111"/> | |
| 5094 </rdf:Bag> | |
| 5095 </bqbiol:is> | |
| 5096 </rdf:Description> | |
| 5097 </rdf:RDF> | |
| 5098 </annotation> | |
| 5099 </species> | |
| 5100 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H7O6P" hasOnlySubstanceUnits="false" id="C00118" metaid="b02301f9-586f-4026-b91b-493b175e3798" name="D-Glyceraldehyde 3-phosphate" sboTerm="SBO:0000240"> | |
| 5101 <notes> | |
| 5102 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5103 <p>kegg.compound: C00118</p> | |
| 5104 <p>KNApSAcK: C00007564</p> | |
| 5105 <p>CAS: 591-57-1</p> | |
| 5106 <p>PubChem: 3418</p> | |
| 5107 <p>3DMET: B01163</p> | |
| 5108 <p>PDB-CCD: G3H</p> | |
| 5109 <p>ChEBI: 29052</p> | |
| 5110 <p>NIKKAJI: J228.059K</p> | |
| 5111 <p>formula: C3H7O6P</p> | |
| 5112 <p>weight: 170.0578</p> | |
| 5113 </body> | |
| 5114 </notes> | |
| 5115 <annotation> | |
| 5116 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5117 <rdf:Description rdf:about="#b02301f9-586f-4026-b91b-493b175e3798"> | |
| 5118 <bqbiol:is> | |
| 5119 <rdf:Bag> | |
| 5120 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00118"/> | |
| 5121 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007564"/> | |
| 5122 <rdf:li rdf:resource="https://identifiers.org/CAS/591-57-1"/> | |
| 5123 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01163"/> | |
| 5124 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/G3H"/> | |
| 5125 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29052"/> | |
| 5126 </rdf:Bag> | |
| 5127 </bqbiol:is> | |
| 5128 </rdf:Description> | |
| 5129 </rdf:RDF> | |
| 5130 </annotation> | |
| 5131 </species> | |
| 5132 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H14N3O7P" hasOnlySubstanceUnits="false" id="C00239" metaid="e1ac8ed6-aaf3-4ad0-ad58-c22bbbcfd443" name="dCMP" sboTerm="SBO:0000240"> | |
| 5133 <notes> | |
| 5134 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5135 <p>kegg.compound: C00239</p> | |
| 5136 <p>CAS: 1032-65-1</p> | |
| 5137 <p>PubChem: 3538</p> | |
| 5138 <p>3DMET: B01198</p> | |
| 5139 <p>PDB-CCD: DC DCM DNR</p> | |
| 5140 <p>ChEBI: 15918</p> | |
| 5141 <p>NIKKAJI: J14.407J</p> | |
| 5142 <p>formula: C9H14N3O7P</p> | |
| 5143 <p>weight: 307.1971</p> | |
| 5144 </body> | |
| 5145 </notes> | |
| 5146 <annotation> | |
| 5147 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5148 <rdf:Description rdf:about="#e1ac8ed6-aaf3-4ad0-ad58-c22bbbcfd443"> | |
| 5149 <bqbiol:is> | |
| 5150 <rdf:Bag> | |
| 5151 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00239"/> | |
| 5152 <rdf:li rdf:resource="https://identifiers.org/CAS/1032-65-1"/> | |
| 5153 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01198"/> | |
| 5154 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/DC DCM DNR"/> | |
| 5155 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15918"/> | |
| 5156 </rdf:Bag> | |
| 5157 </bqbiol:is> | |
| 5158 </rdf:Description> | |
| 5159 </rdf:RDF> | |
| 5160 </annotation> | |
| 5161 </species> | |
| 5162 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H11O8P" hasOnlySubstanceUnits="false" id="C00117" metaid="a0a5cc19-8dc0-4df4-87d9-0d2fde44c12c" name="D-Ribose 5-phosphate" sboTerm="SBO:0000240"> | |
| 5163 <notes> | |
| 5164 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5165 <p>kegg.compound: C00117</p> | |
| 5166 <p>KNApSAcK: C00007473</p> | |
| 5167 <p>CAS: 4300-28-1</p> | |
| 5168 <p>PubChem: 3417</p> | |
| 5169 <p>3DMET: B04635</p> | |
| 5170 <p>PDB-CCD: HSX RP5</p> | |
| 5171 <p>ChEBI: 17797 52742</p> | |
| 5172 <p>NIKKAJI: J205.693C</p> | |
| 5173 <p>formula: C5H11O8P</p> | |
| 5174 <p>weight: 230.1098</p> | |
| 5175 </body> | |
| 5176 </notes> | |
| 5177 <annotation> | |
| 5178 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5179 <rdf:Description rdf:about="#a0a5cc19-8dc0-4df4-87d9-0d2fde44c12c"> | |
| 5180 <bqbiol:is> | |
| 5181 <rdf:Bag> | |
| 5182 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00117"/> | |
| 5183 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007473"/> | |
| 5184 <rdf:li rdf:resource="https://identifiers.org/CAS/4300-28-1"/> | |
| 5185 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04635"/> | |
| 5186 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/HSX RP5"/> | |
| 5187 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17797 52742"/> | |
| 5188 </rdf:Bag> | |
| 5189 </bqbiol:is> | |
| 5190 </rdf:Description> | |
| 5191 </rdf:RDF> | |
| 5192 </annotation> | |
| 5193 </species> | |
| 5194 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H8O3" hasOnlySubstanceUnits="false" id="C00116" metaid="e11087ba-1b55-45e7-86f3-22429f05379e" name="Glycerol" sboTerm="SBO:0000240"> | |
| 5195 <notes> | |
| 5196 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5197 <p>kegg.compound: C00116</p> | |
| 5198 <p>KNApSAcK: C00001163</p> | |
| 5199 <p>CAS: 56-81-5</p> | |
| 5200 <p>PubChem: 3416</p> | |
| 5201 <p>3DMET: B00032</p> | |
| 5202 <p>PDB-CCD: GOL</p> | |
| 5203 <p>ChEBI: 17754</p> | |
| 5204 <p>NIKKAJI: J1.916J</p> | |
| 5205 <p>formula: C3H8O3</p> | |
| 5206 <p>weight: 92.0938</p> | |
| 5207 </body> | |
| 5208 </notes> | |
| 5209 <annotation> | |
| 5210 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5211 <rdf:Description rdf:about="#e11087ba-1b55-45e7-86f3-22429f05379e"> | |
| 5212 <bqbiol:is> | |
| 5213 <rdf:Bag> | |
| 5214 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00116"/> | |
| 5215 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001163"/> | |
| 5216 <rdf:li rdf:resource="https://identifiers.org/CAS/56-81-5"/> | |
| 5217 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00032"/> | |
| 5218 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/GOL"/> | |
| 5219 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17754"/> | |
| 5220 </rdf:Bag> | |
| 5221 </bqbiol:is> | |
| 5222 </rdf:Description> | |
| 5223 </rdf:RDF> | |
| 5224 </annotation> | |
| 5225 </species> | |
| 5226 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H8O10P2" hasOnlySubstanceUnits="false" id="C00236" metaid="_62234e29-580d-4a5a-98ad-a36344dcff24" name="3-Phospho-D-glyceroyl phosphate" sboTerm="SBO:0000240"> | |
| 5227 <notes> | |
| 5228 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5229 <p>kegg.compound: C00236</p> | |
| 5230 <p>KNApSAcK: C00019552</p> | |
| 5231 <p>CAS: 38168-82-0</p> | |
| 5232 <p>PubChem: 3535</p> | |
| 5233 <p>3DMET: B01197</p> | |
| 5234 <p>PDB-CCD: X15</p> | |
| 5235 <p>ChEBI: 16001</p> | |
| 5236 <p>NIKKAJI: J40.060B</p> | |
| 5237 <p>formula: C3H8O10P2</p> | |
| 5238 <p>weight: 266.0371</p> | |
| 5239 </body> | |
| 5240 </notes> | |
| 5241 <annotation> | |
| 5242 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5243 <rdf:Description rdf:about="#_62234e29-580d-4a5a-98ad-a36344dcff24"> | |
| 5244 <bqbiol:is> | |
| 5245 <rdf:Bag> | |
| 5246 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00236"/> | |
| 5247 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019552"/> | |
| 5248 <rdf:li rdf:resource="https://identifiers.org/CAS/38168-82-0"/> | |
| 5249 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01197"/> | |
| 5250 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/X15"/> | |
| 5251 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16001"/> | |
| 5252 </rdf:Bag> | |
| 5253 </bqbiol:is> | |
| 5254 </rdf:Description> | |
| 5255 </rdf:RDF> | |
| 5256 </annotation> | |
| 5257 </species> | |
| 5258 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C8H16NO9P" hasOnlySubstanceUnits="false" id="C00357" metaid="_881da8a1-5f01-4f53-8387-38e331a11a7d" name="N-Acetyl-D-glucosamine 6-phosphate" sboTerm="SBO:0000240"> | |
| 5259 <notes> | |
| 5260 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5261 <p>kegg.compound: C00357</p> | |
| 5262 <p>PubChem: 3650</p> | |
| 5263 <p>3DMET: B01225</p> | |
| 5264 <p>PDB-CCD: 16G 4QY</p> | |
| 5265 <p>ChEBI: 15784</p> | |
| 5266 <p>NIKKAJI: J1.734.828K</p> | |
| 5267 <p>formula: C8H16NO9P</p> | |
| 5268 <p>weight: 301.1877</p> | |
| 5269 </body> | |
| 5270 </notes> | |
| 5271 <annotation> | |
| 5272 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5273 <rdf:Description rdf:about="#_881da8a1-5f01-4f53-8387-38e331a11a7d"> | |
| 5274 <bqbiol:is> | |
| 5275 <rdf:Bag> | |
| 5276 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00357"/> | |
| 5277 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01225"/> | |
| 5278 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/16G 4QY"/> | |
| 5279 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15784"/> | |
| 5280 </rdf:Bag> | |
| 5281 </bqbiol:is> | |
| 5282 </rdf:Description> | |
| 5283 </rdf:RDF> | |
| 5284 </annotation> | |
| 5285 </species> | |
| 5286 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H12O7P2" hasOnlySubstanceUnits="false" id="C00235" metaid="a4486e53-c297-40b2-9935-e0e8b9b78479" name="Dimethylallyl diphosphate" sboTerm="SBO:0000240"> | |
| 5287 <notes> | |
| 5288 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5289 <p>kegg.compound: C00235</p> | |
| 5290 <p>KNApSAcK: C00007294</p> | |
| 5291 <p>CAS: 358-72-5</p> | |
| 5292 <p>PubChem: 3534</p> | |
| 5293 <p>3DMET: B01196</p> | |
| 5294 <p>PDB-CCD: DMA</p> | |
| 5295 <p>ChEBI: 16057</p> | |
| 5296 <p>LIPIDMAPS: LMPR01010001</p> | |
| 5297 <p>LipidBank: IIP0002</p> | |
| 5298 <p>NIKKAJI: J39.581A</p> | |
| 5299 <p>formula: C5H12O7P2</p> | |
| 5300 <p>weight: 246.0921</p> | |
| 5301 </body> | |
| 5302 </notes> | |
| 5303 <annotation> | |
| 5304 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5305 <rdf:Description rdf:about="#a4486e53-c297-40b2-9935-e0e8b9b78479"> | |
| 5306 <bqbiol:is> | |
| 5307 <rdf:Bag> | |
| 5308 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00235"/> | |
| 5309 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007294"/> | |
| 5310 <rdf:li rdf:resource="https://identifiers.org/CAS/358-72-5"/> | |
| 5311 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01196"/> | |
| 5312 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/DMA"/> | |
| 5313 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16057"/> | |
| 5314 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMPR01010001"/> | |
| 5315 <rdf:li rdf:resource="https://identifiers.org/LipidBank/IIP0002"/> | |
| 5316 </rdf:Bag> | |
| 5317 </bqbiol:is> | |
| 5318 </rdf:Description> | |
| 5319 </rdf:RDF> | |
| 5320 </annotation> | |
| 5321 </species> | |
| 5322 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C20H23N7O7" hasOnlySubstanceUnits="false" id="C00234" metaid="_5ac3b742-4786-4d22-9db2-92093d3a5521" name="10-Formyltetrahydrofolate" sboTerm="SBO:0000240"> | |
| 5323 <notes> | |
| 5324 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5325 <p>kegg.compound: C00234</p> | |
| 5326 <p>CAS: 2800-34-2</p> | |
| 5327 <p>PubChem: 3533</p> | |
| 5328 <p>3DMET: B04652</p> | |
| 5329 <p>ChEBI: 15637</p> | |
| 5330 <p>NIKKAJI: J356.348K</p> | |
| 5331 <p>formula: C20H23N7O7</p> | |
| 5332 <p>weight: 473.4393</p> | |
| 5333 </body> | |
| 5334 </notes> | |
| 5335 <annotation> | |
| 5336 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5337 <rdf:Description rdf:about="#_5ac3b742-4786-4d22-9db2-92093d3a5521"> | |
| 5338 <bqbiol:is> | |
| 5339 <rdf:Bag> | |
| 5340 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00234"/> | |
| 5341 <rdf:li rdf:resource="https://identifiers.org/CAS/2800-34-2"/> | |
| 5342 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04652"/> | |
| 5343 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15637"/> | |
| 5344 </rdf:Bag> | |
| 5345 </bqbiol:is> | |
| 5346 </rdf:Description> | |
| 5347 </rdf:RDF> | |
| 5348 </annotation> | |
| 5349 </species> | |
| 5350 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C14H6N2O8" hasOnlySubstanceUnits="false" id="C00113" metaid="_07196178-6426-4dca-af6e-9275afa4091b" name="PQQ" sboTerm="SBO:0000240"> | |
| 5351 <notes> | |
| 5352 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5353 <p>kegg.compound: C00113</p> | |
| 5354 <p>CAS: 72909-34-3</p> | |
| 5355 <p>PubChem: 3413</p> | |
| 5356 <p>3DMET: B00030</p> | |
| 5357 <p>PDB-CCD: PQQ</p> | |
| 5358 <p>ChEBI: 18315</p> | |
| 5359 <p>NIKKAJI: J126.218A</p> | |
| 5360 <p>formula: C14H6N2O8</p> | |
| 5361 <p>weight: 330.206</p> | |
| 5362 </body> | |
| 5363 </notes> | |
| 5364 <annotation> | |
| 5365 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5366 <rdf:Description rdf:about="#_07196178-6426-4dca-af6e-9275afa4091b"> | |
| 5367 <bqbiol:is> | |
| 5368 <rdf:Bag> | |
| 5369 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00113"/> | |
| 5370 <rdf:li rdf:resource="https://identifiers.org/CAS/72909-34-3"/> | |
| 5371 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00030"/> | |
| 5372 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/PQQ"/> | |
| 5373 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18315"/> | |
| 5374 </rdf:Bag> | |
| 5375 </bqbiol:is> | |
| 5376 </rdf:Description> | |
| 5377 </rdf:RDF> | |
| 5378 </annotation> | |
| 5379 </species> | |
| 5380 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H16N5O13P3" hasOnlySubstanceUnits="false" id="C00002" metaid="c3982148-50db-429d-bbda-1b991c59bb2a" name="ATP" sboTerm="SBO:0000240"> | |
| 5381 <notes> | |
| 5382 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5383 <p>kegg.compound: C00002</p> | |
| 5384 <p>KNApSAcK: C00001491</p> | |
| 5385 <p>CAS: 56-65-5</p> | |
| 5386 <p>PubChem: 3304</p> | |
| 5387 <p>3DMET: B01125</p> | |
| 5388 <p>PDB-CCD: ATP</p> | |
| 5389 <p>ChEBI: 15422</p> | |
| 5390 <p>NIKKAJI: J10.680A</p> | |
| 5391 <p>formula: C10H16N5O13P3</p> | |
| 5392 <p>weight: 507.181</p> | |
| 5393 </body> | |
| 5394 </notes> | |
| 5395 <annotation> | |
| 5396 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5397 <rdf:Description rdf:about="#c3982148-50db-429d-bbda-1b991c59bb2a"> | |
| 5398 <bqbiol:is> | |
| 5399 <rdf:Bag> | |
| 5400 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00002"/> | |
| 5401 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001491"/> | |
| 5402 <rdf:li rdf:resource="https://identifiers.org/CAS/56-65-5"/> | |
| 5403 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01125"/> | |
| 5404 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/ATP"/> | |
| 5405 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15422"/> | |
| 5406 </rdf:Bag> | |
| 5407 </bqbiol:is> | |
| 5408 </rdf:Description> | |
| 5409 </rdf:RDF> | |
| 5410 </annotation> | |
| 5411 </species> | |
| 5412 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H16N3O8P" hasOnlySubstanceUnits="false" id="C03997" metaid="_04ec6b7c-af39-408d-ba02-3cfbae55fdcc" name="5-Hydroxymethyldeoxycytidylate" sboTerm="SBO:0000240"> | |
| 5413 <notes> | |
| 5414 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5415 <p>kegg.compound: C03997</p> | |
| 5416 <p>CAS: 13009-95-5</p> | |
| 5417 <p>PubChem: 6710</p> | |
| 5418 <p>3DMET: B01709</p> | |
| 5419 <p>PDB-CCD: 5HC</p> | |
| 5420 <p>ChEBI: 16952</p> | |
| 5421 <p>NIKKAJI: J2.745.326K</p> | |
| 5422 <p>formula: C10H16N3O8P</p> | |
| 5423 <p>weight: 337.2231</p> | |
| 5424 </body> | |
| 5425 </notes> | |
| 5426 <annotation> | |
| 5427 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5428 <rdf:Description rdf:about="#_04ec6b7c-af39-408d-ba02-3cfbae55fdcc"> | |
| 5429 <bqbiol:is> | |
| 5430 <rdf:Bag> | |
| 5431 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03997"/> | |
| 5432 <rdf:li rdf:resource="https://identifiers.org/CAS/13009-95-5"/> | |
| 5433 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01709"/> | |
| 5434 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/5HC"/> | |
| 5435 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16952"/> | |
| 5436 </rdf:Bag> | |
| 5437 </bqbiol:is> | |
| 5438 </rdf:Description> | |
| 5439 </rdf:RDF> | |
| 5440 </annotation> | |
| 5441 </species> | |
| 5442 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C14H19N6O10P" hasOnlySubstanceUnits="false" id="C22395" metaid="d8712030-d79d-4fe2-b27d-e030142389a5" name="N6-Succino-2-amino-2'-deoxyadenylate" sboTerm="SBO:0000240"> | |
| 5443 <notes> | |
| 5444 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5445 <p>kegg.compound: C22395</p> | |
| 5446 <p>formula: C14H19N6O10P</p> | |
| 5447 <p>weight: 462.3086</p> | |
| 5448 </body> | |
| 5449 </notes> | |
| 5450 <annotation> | |
| 5451 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5452 <rdf:Description rdf:about="#d8712030-d79d-4fe2-b27d-e030142389a5"> | |
| 5453 <bqbiol:is> | |
| 5454 <rdf:Bag> | |
| 5455 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C22395"/> | |
| 5456 </rdf:Bag> | |
| 5457 </bqbiol:is> | |
| 5458 </rdf:Description> | |
| 5459 </rdf:RDF> | |
| 5460 </annotation> | |
| 5461 </species> | |
| 5462 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H13N2O8P" hasOnlySubstanceUnits="false" id="C00365" metaid="_8bdd94b7-7cb2-4fac-9be5-be454dce497f" name="dUMP" sboTerm="SBO:0000240"> | |
| 5463 <notes> | |
| 5464 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5465 <p>kegg.compound: C00365</p> | |
| 5466 <p>KNApSAcK: C00019282</p> | |
| 5467 <p>CAS: 964-26-1</p> | |
| 5468 <p>PubChem: 3656</p> | |
| 5469 <p>3DMET: B01231</p> | |
| 5470 <p>PDB-CCD: DU UMP</p> | |
| 5471 <p>ChEBI: 17622</p> | |
| 5472 <p>NIKKAJI: J298.569A</p> | |
| 5473 <p>formula: C9H13N2O8P</p> | |
| 5474 <p>weight: 308.1819</p> | |
| 5475 </body> | |
| 5476 </notes> | |
| 5477 <annotation> | |
| 5478 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5479 <rdf:Description rdf:about="#_8bdd94b7-7cb2-4fac-9be5-be454dce497f"> | |
| 5480 <bqbiol:is> | |
| 5481 <rdf:Bag> | |
| 5482 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00365"/> | |
| 5483 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019282"/> | |
| 5484 <rdf:li rdf:resource="https://identifiers.org/CAS/964-26-1"/> | |
| 5485 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01231"/> | |
| 5486 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/DU UMP"/> | |
| 5487 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17622"/> | |
| 5488 </rdf:Bag> | |
| 5489 </bqbiol:is> | |
| 5490 </rdf:Description> | |
| 5491 </rdf:RDF> | |
| 5492 </annotation> | |
| 5493 </species> | |
| 5494 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H13NO2" hasOnlySubstanceUnits="false" id="C00123" metaid="d1d2b389-11c9-471e-bf9e-030b6d72c959" name="L-Leucine" sboTerm="SBO:0000240"> | |
| 5495 <notes> | |
| 5496 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5497 <p>kegg.compound: C00123</p> | |
| 5498 <p>KNApSAcK: C00001377</p> | |
| 5499 <p>CAS: 61-90-5</p> | |
| 5500 <p>PubChem: 3423</p> | |
| 5501 <p>3DMET: B00034</p> | |
| 5502 <p>PDB-CCD: LEU</p> | |
| 5503 <p>ChEBI: 15603</p> | |
| 5504 <p>NIKKAJI: J1.167C</p> | |
| 5505 <p>formula: C6H13NO2</p> | |
| 5506 <p>weight: 131.1729</p> | |
| 5507 </body> | |
| 5508 </notes> | |
| 5509 <annotation> | |
| 5510 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5511 <rdf:Description rdf:about="#d1d2b389-11c9-471e-bf9e-030b6d72c959"> | |
| 5512 <bqbiol:is> | |
| 5513 <rdf:Bag> | |
| 5514 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00123"/> | |
| 5515 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001377"/> | |
| 5516 <rdf:li rdf:resource="https://identifiers.org/CAS/61-90-5"/> | |
| 5517 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00034"/> | |
| 5518 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/LEU"/> | |
| 5519 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15603"/> | |
| 5520 </rdf:Bag> | |
| 5521 </bqbiol:is> | |
| 5522 </rdf:Description> | |
| 5523 </rdf:RDF> | |
| 5524 </annotation> | |
| 5525 </species> | |
| 5526 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="H2O" hasOnlySubstanceUnits="false" id="C00001" metaid="de54fdd9-c9c7-4a6f-8c0a-d4253626c56a" name="H2O" sboTerm="SBO:0000240"> | |
| 5527 <notes> | |
| 5528 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5529 <p>kegg.compound: C00001</p> | |
| 5530 <p>CAS: 7732-18-5</p> | |
| 5531 <p>PubChem: 3303</p> | |
| 5532 <p>3DMET: B01124</p> | |
| 5533 <p>PDB-CCD: HOH O</p> | |
| 5534 <p>ChEBI: 15377</p> | |
| 5535 <p>NIKKAJI: J43.587B</p> | |
| 5536 <p>formula: H2O</p> | |
| 5537 <p>weight: 18.0153</p> | |
| 5538 </body> | |
| 5539 </notes> | |
| 5540 <annotation> | |
| 5541 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5542 <rdf:Description rdf:about="#de54fdd9-c9c7-4a6f-8c0a-d4253626c56a"> | |
| 5543 <bqbiol:is> | |
| 5544 <rdf:Bag> | |
| 5545 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00001"/> | |
| 5546 <rdf:li rdf:resource="https://identifiers.org/CAS/7732-18-5"/> | |
| 5547 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01124"/> | |
| 5548 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/HOH O"/> | |
| 5549 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15377"/> | |
| 5550 </rdf:Bag> | |
| 5551 </bqbiol:is> | |
| 5552 </rdf:Description> | |
| 5553 </rdf:RDF> | |
| 5554 </annotation> | |
| 5555 </species> | |
| 5556 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C22154" metaid="d2f682b6-5ab4-4839-b009-ce2ea0e589d6" name="[Fe-S] cluster scaffold protein carrying a [4Fe-4S]2+ cluster" sboTerm="SBO:0000240"> | |
| 5557 <notes> | |
| 5558 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5559 <p>kegg.compound: C22154</p> | |
| 5560 <p>PubChem: 405226345</p> | |
| 5561 </body> | |
| 5562 </notes> | |
| 5563 <annotation> | |
| 5564 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5565 <rdf:Description rdf:about="#d2f682b6-5ab4-4839-b009-ce2ea0e589d6"> | |
| 5566 <bqbiol:is> | |
| 5567 <rdf:Bag> | |
| 5568 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C22154"/> | |
| 5569 </rdf:Bag> | |
| 5570 </bqbiol:is> | |
| 5571 </rdf:Description> | |
| 5572 </rdf:RDF> | |
| 5573 </annotation> | |
| 5574 </species> | |
| 5575 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H4O4" hasOnlySubstanceUnits="false" id="C00122" metaid="_20ea9e4c-1ba4-4970-a45b-44af6f40ceaf" name="Fumarate" sboTerm="SBO:0000240"> | |
| 5576 <notes> | |
| 5577 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5578 <p>kegg.compound: C00122</p> | |
| 5579 <p>KNApSAcK: C00001183 C00033849</p> | |
| 5580 <p>CAS: 110-17-8</p> | |
| 5581 <p>PubChem: 3422</p> | |
| 5582 <p>3DMET: B00033</p> | |
| 5583 <p>PDB-CCD: FUM</p> | |
| 5584 <p>ChEBI: 18012 29806</p> | |
| 5585 <p>NIKKAJI: J2.880K</p> | |
| 5586 <p>formula: C4H4O4</p> | |
| 5587 <p>weight: 116.0722</p> | |
| 5588 </body> | |
| 5589 </notes> | |
| 5590 <annotation> | |
| 5591 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5592 <rdf:Description rdf:about="#_20ea9e4c-1ba4-4970-a45b-44af6f40ceaf"> | |
| 5593 <bqbiol:is> | |
| 5594 <rdf:Bag> | |
| 5595 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00122"/> | |
| 5596 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001183 C00033849"/> | |
| 5597 <rdf:li rdf:resource="https://identifiers.org/CAS/110-17-8"/> | |
| 5598 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00033"/> | |
| 5599 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/FUM"/> | |
| 5600 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18012 29806"/> | |
| 5601 </rdf:Bag> | |
| 5602 </bqbiol:is> | |
| 5603 </rdf:Description> | |
| 5604 </rdf:RDF> | |
| 5605 </annotation> | |
| 5606 </species> | |
| 5607 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H15N2O8P" hasOnlySubstanceUnits="false" id="C00364" metaid="_30883ec8-4196-48c9-b624-7b36aab3edee" name="dTMP" sboTerm="SBO:0000240"> | |
| 5608 <notes> | |
| 5609 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5610 <p>kegg.compound: C00364</p> | |
| 5611 <p>KNApSAcK: C00019637</p> | |
| 5612 <p>CAS: 365-07-1</p> | |
| 5613 <p>PubChem: 3655</p> | |
| 5614 <p>3DMET: B01230</p> | |
| 5615 <p>PDB-CCD: DT TMP</p> | |
| 5616 <p>ChEBI: 17013</p> | |
| 5617 <p>NIKKAJI: J150.344H</p> | |
| 5618 <p>formula: C10H15N2O8P</p> | |
| 5619 <p>weight: 322.2085</p> | |
| 5620 </body> | |
| 5621 </notes> | |
| 5622 <annotation> | |
| 5623 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5624 <rdf:Description rdf:about="#_30883ec8-4196-48c9-b624-7b36aab3edee"> | |
| 5625 <bqbiol:is> | |
| 5626 <rdf:Bag> | |
| 5627 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00364"/> | |
| 5628 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019637"/> | |
| 5629 <rdf:li rdf:resource="https://identifiers.org/CAS/365-07-1"/> | |
| 5630 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01230"/> | |
| 5631 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/DT TMP"/> | |
| 5632 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17013"/> | |
| 5633 </rdf:Bag> | |
| 5634 </bqbiol:is> | |
| 5635 </rdf:Description> | |
| 5636 </rdf:RDF> | |
| 5637 </annotation> | |
| 5638 </species> | |
| 5639 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C03512" metaid="_800ea8de-8aec-4625-a0a5-b2a8935223cc" name="L-Tryptophanyl-tRNA(Trp)" sboTerm="SBO:0000240"> | |
| 5640 <notes> | |
| 5641 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5642 <p>kegg.compound: C03512</p> | |
| 5643 <p>PubChem: 6322</p> | |
| 5644 <p>ChEBI: 29159</p> | |
| 5645 <p>formula: C26H31N7O11PR(C5H8O6PR)n</p> | |
| 5646 </body> | |
| 5647 </notes> | |
| 5648 <annotation> | |
| 5649 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5650 <rdf:Description rdf:about="#_800ea8de-8aec-4625-a0a5-b2a8935223cc"> | |
| 5651 <bqbiol:is> | |
| 5652 <rdf:Bag> | |
| 5653 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03512"/> | |
| 5654 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29159"/> | |
| 5655 </rdf:Bag> | |
| 5656 </bqbiol:is> | |
| 5657 </rdf:Description> | |
| 5658 </rdf:RDF> | |
| 5659 </annotation> | |
| 5660 </species> | |
| 5661 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C22155" metaid="fc14d09a-8f47-4ef9-8b87-78544172233b" name="[Fe-S] cluster scaffold protein" sboTerm="SBO:0000240"> | |
| 5662 <notes> | |
| 5663 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5664 <p>kegg.compound: C22155</p> | |
| 5665 <p>PubChem: 405226346</p> | |
| 5666 </body> | |
| 5667 </notes> | |
| 5668 <annotation> | |
| 5669 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5670 <rdf:Description rdf:about="#fc14d09a-8f47-4ef9-8b87-78544172233b"> | |
| 5671 <bqbiol:is> | |
| 5672 <rdf:Bag> | |
| 5673 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C22155"/> | |
| 5674 </rdf:Bag> | |
| 5675 </bqbiol:is> | |
| 5676 </rdf:Description> | |
| 5677 </rdf:RDF> | |
| 5678 </annotation> | |
| 5679 </species> | |
| 5680 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H10O5" hasOnlySubstanceUnits="false" id="C00121" metaid="_19bae950-2708-4ed9-ba83-53e1a9b7baaf" name="D-Ribose" sboTerm="SBO:0000240"> | |
| 5681 <notes> | |
| 5682 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5683 <p>kegg.compound: C00121</p> | |
| 5684 <p>KNApSAcK: C00034198</p> | |
| 5685 <p>CAS: 50-69-1</p> | |
| 5686 <p>PubChem: 3421</p> | |
| 5687 <p>3DMET: B04636</p> | |
| 5688 <p>PDB-CCD: BDR RIB</p> | |
| 5689 <p>ChEBI: 47013</p> | |
| 5690 <p>NIKKAJI: J60.867J</p> | |
| 5691 <p>formula: C5H10O5</p> | |
| 5692 <p>weight: 150.1299</p> | |
| 5693 </body> | |
| 5694 </notes> | |
| 5695 <annotation> | |
| 5696 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5697 <rdf:Description rdf:about="#_19bae950-2708-4ed9-ba83-53e1a9b7baaf"> | |
| 5698 <bqbiol:is> | |
| 5699 <rdf:Bag> | |
| 5700 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00121"/> | |
| 5701 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00034198"/> | |
| 5702 <rdf:li rdf:resource="https://identifiers.org/CAS/50-69-1"/> | |
| 5703 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04636"/> | |
| 5704 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/BDR RIB"/> | |
| 5705 <rdf:li rdf:resource="https://identifiers.org/ChEBI/47013"/> | |
| 5706 </rdf:Bag> | |
| 5707 </bqbiol:is> | |
| 5708 </rdf:Description> | |
| 5709 </rdf:RDF> | |
| 5710 </annotation> | |
| 5711 </species> | |
| 5712 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H5N5O" hasOnlySubstanceUnits="false" id="C00242" metaid="d203e35f-122f-448a-af40-f0a83619f870" name="Guanine" sboTerm="SBO:0000240"> | |
| 5713 <notes> | |
| 5714 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5715 <p>kegg.compound: C00242</p> | |
| 5716 <p>KNApSAcK: C00001501</p> | |
| 5717 <p>CAS: 73-40-5</p> | |
| 5718 <p>PubChem: 3541</p> | |
| 5719 <p>3DMET: B00067</p> | |
| 5720 <p>PDB-CCD: GUN</p> | |
| 5721 <p>ChEBI: 16235</p> | |
| 5722 <p>NIKKAJI: J9.344K</p> | |
| 5723 <p>formula: C5H5N5O</p> | |
| 5724 <p>weight: 151.1261</p> | |
| 5725 </body> | |
| 5726 </notes> | |
| 5727 <annotation> | |
| 5728 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5729 <rdf:Description rdf:about="#d203e35f-122f-448a-af40-f0a83619f870"> | |
| 5730 <bqbiol:is> | |
| 5731 <rdf:Bag> | |
| 5732 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00242"/> | |
| 5733 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001501"/> | |
| 5734 <rdf:li rdf:resource="https://identifiers.org/CAS/73-40-5"/> | |
| 5735 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00067"/> | |
| 5736 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/GUN"/> | |
| 5737 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16235"/> | |
| 5738 </rdf:Bag> | |
| 5739 </bqbiol:is> | |
| 5740 </rdf:Description> | |
| 5741 </rdf:RDF> | |
| 5742 </annotation> | |
| 5743 </species> | |
| 5744 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H16N2O11P2" hasOnlySubstanceUnits="false" id="C00363" metaid="_642f9864-21ea-4de8-9b49-c976535708e2" name="dTDP" sboTerm="SBO:0000240"> | |
| 5745 <notes> | |
| 5746 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5747 <p>kegg.compound: C00363</p> | |
| 5748 <p>KNApSAcK: C00019696</p> | |
| 5749 <p>CAS: 491-97-4</p> | |
| 5750 <p>PubChem: 3654</p> | |
| 5751 <p>3DMET: B01229</p> | |
| 5752 <p>PDB-CCD: TYD</p> | |
| 5753 <p>ChEBI: 18075</p> | |
| 5754 <p>NIKKAJI: J247.693B</p> | |
| 5755 <p>formula: C10H16N2O11P2</p> | |
| 5756 <p>weight: 402.1884</p> | |
| 5757 </body> | |
| 5758 </notes> | |
| 5759 <annotation> | |
| 5760 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5761 <rdf:Description rdf:about="#_642f9864-21ea-4de8-9b49-c976535708e2"> | |
| 5762 <bqbiol:is> | |
| 5763 <rdf:Bag> | |
| 5764 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00363"/> | |
| 5765 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019696"/> | |
| 5766 <rdf:li rdf:resource="https://identifiers.org/CAS/491-97-4"/> | |
| 5767 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01229"/> | |
| 5768 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/TYD"/> | |
| 5769 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18075"/> | |
| 5770 </rdf:Bag> | |
| 5771 </bqbiol:is> | |
| 5772 </rdf:Description> | |
| 5773 </rdf:RDF> | |
| 5774 </annotation> | |
| 5775 </species> | |
| 5776 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H14N5O7P" hasOnlySubstanceUnits="false" id="C00362" metaid="aa1ef6e4-9c58-42d1-9357-67376d518a82" name="dGMP" sboTerm="SBO:0000240"> | |
| 5777 <notes> | |
| 5778 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5779 <p>kegg.compound: C00362</p> | |
| 5780 <p>KNApSAcK: C00019356</p> | |
| 5781 <p>CAS: 902-04-5</p> | |
| 5782 <p>PubChem: 3653</p> | |
| 5783 <p>3DMET: B01228</p> | |
| 5784 <p>PDB-CCD: DG DGP</p> | |
| 5785 <p>ChEBI: 16192</p> | |
| 5786 <p>NIKKAJI: J195.198J</p> | |
| 5787 <p>formula: C10H14N5O7P</p> | |
| 5788 <p>weight: 347.2212</p> | |
| 5789 </body> | |
| 5790 </notes> | |
| 5791 <annotation> | |
| 5792 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5793 <rdf:Description rdf:about="#aa1ef6e4-9c58-42d1-9357-67376d518a82"> | |
| 5794 <bqbiol:is> | |
| 5795 <rdf:Bag> | |
| 5796 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00362"/> | |
| 5797 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019356"/> | |
| 5798 <rdf:li rdf:resource="https://identifiers.org/CAS/902-04-5"/> | |
| 5799 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01228"/> | |
| 5800 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/DG DGP"/> | |
| 5801 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16192"/> | |
| 5802 </rdf:Bag> | |
| 5803 </bqbiol:is> | |
| 5804 </rdf:Description> | |
| 5805 </rdf:RDF> | |
| 5806 </annotation> | |
| 5807 </species> | |
| 5808 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H16N2O3S" hasOnlySubstanceUnits="false" id="C00120" metaid="_2be6ab2c-d68d-4e77-a254-3b9b224f00e1" name="Biotin" sboTerm="SBO:0000240"> | |
| 5809 <notes> | |
| 5810 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5811 <p>kegg.compound: C00120</p> | |
| 5812 <p>KNApSAcK: C00000756</p> | |
| 5813 <p>CAS: 58-85-5</p> | |
| 5814 <p>PubChem: 3420</p> | |
| 5815 <p>3DMET: B01165</p> | |
| 5816 <p>PDB-CCD: BTN</p> | |
| 5817 <p>ChEBI: 15956</p> | |
| 5818 <p>NIKKAJI: J94.599D</p> | |
| 5819 <p>formula: C10H16N2O3S</p> | |
| 5820 <p>weight: 244.3106</p> | |
| 5821 </body> | |
| 5822 </notes> | |
| 5823 <annotation> | |
| 5824 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5825 <rdf:Description rdf:about="#_2be6ab2c-d68d-4e77-a254-3b9b224f00e1"> | |
| 5826 <bqbiol:is> | |
| 5827 <rdf:Bag> | |
| 5828 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00120"/> | |
| 5829 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00000756"/> | |
| 5830 <rdf:li rdf:resource="https://identifiers.org/CAS/58-85-5"/> | |
| 5831 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01165"/> | |
| 5832 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/BTN"/> | |
| 5833 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15956"/> | |
| 5834 </rdf:Bag> | |
| 5835 </bqbiol:is> | |
| 5836 </rdf:Description> | |
| 5837 </rdf:RDF> | |
| 5838 </annotation> | |
| 5839 </species> | |
| 5840 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H15N5O10P2" hasOnlySubstanceUnits="false" id="C00361" metaid="_72fc56f8-b6b3-4588-8f10-3f534cd5ec29" name="dGDP" sboTerm="SBO:0000240"> | |
| 5841 <notes> | |
| 5842 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5843 <p>kegg.compound: C00361</p> | |
| 5844 <p>PubChem: 3652</p> | |
| 5845 <p>3DMET: B01227</p> | |
| 5846 <p>PDB-CCD: DGI</p> | |
| 5847 <p>ChEBI: 28862</p> | |
| 5848 <p>NIKKAJI: J366.498H</p> | |
| 5849 <p>formula: C10H15N5O10P2</p> | |
| 5850 <p>weight: 427.2011</p> | |
| 5851 </body> | |
| 5852 </notes> | |
| 5853 <annotation> | |
| 5854 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5855 <rdf:Description rdf:about="#_72fc56f8-b6b3-4588-8f10-3f534cd5ec29"> | |
| 5856 <bqbiol:is> | |
| 5857 <rdf:Bag> | |
| 5858 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00361"/> | |
| 5859 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01227"/> | |
| 5860 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/DGI"/> | |
| 5861 <rdf:li rdf:resource="https://identifiers.org/ChEBI/28862"/> | |
| 5862 </rdf:Bag> | |
| 5863 </bqbiol:is> | |
| 5864 </rdf:Description> | |
| 5865 </rdf:RDF> | |
| 5866 </annotation> | |
| 5867 </species> | |
| 5868 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C30H45N6O16P" hasOnlySubstanceUnits="false" id="C01217" metaid="fe0c44d8-b829-46aa-8da3-7d8067e94efa" name="5,6,7,8-Tetrahydromethanopterin" sboTerm="SBO:0000240"> | |
| 5869 <notes> | |
| 5870 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5871 <p>kegg.compound: C01217</p> | |
| 5872 <p>CAS: 92481-94-2</p> | |
| 5873 <p>PubChem: 4439</p> | |
| 5874 <p>3DMET: B01409</p> | |
| 5875 <p>ChEBI: 17321</p> | |
| 5876 <p>NIKKAJI: J1.153.548H</p> | |
| 5877 <p>formula: C30H45N6O16P</p> | |
| 5878 <p>weight: 776.6827</p> | |
| 5879 </body> | |
| 5880 </notes> | |
| 5881 <annotation> | |
| 5882 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5883 <rdf:Description rdf:about="#fe0c44d8-b829-46aa-8da3-7d8067e94efa"> | |
| 5884 <bqbiol:is> | |
| 5885 <rdf:Bag> | |
| 5886 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01217"/> | |
| 5887 <rdf:li rdf:resource="https://identifiers.org/CAS/92481-94-2"/> | |
| 5888 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01409"/> | |
| 5889 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17321"/> | |
| 5890 </rdf:Bag> | |
| 5891 </bqbiol:is> | |
| 5892 </rdf:Description> | |
| 5893 </rdf:RDF> | |
| 5894 </annotation> | |
| 5895 </species> | |
| 5896 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C22150" metaid="_790fd5e2-5cc3-496e-8db6-bbbf68a44ac0" name="Reduced [2Fe-2S] ferredoxin" sboTerm="SBO:0000240"> | |
| 5897 <notes> | |
| 5898 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5899 <p>kegg.compound: C22150</p> | |
| 5900 <p>PubChem: 405226341</p> | |
| 5901 </body> | |
| 5902 </notes> | |
| 5903 <annotation> | |
| 5904 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5905 <rdf:Description rdf:about="#_790fd5e2-5cc3-496e-8db6-bbbf68a44ac0"> | |
| 5906 <bqbiol:is> | |
| 5907 <rdf:Bag> | |
| 5908 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C22150"/> | |
| 5909 </rdf:Bag> | |
| 5910 </bqbiol:is> | |
| 5911 </rdf:Description> | |
| 5912 </rdf:RDF> | |
| 5913 </annotation> | |
| 5914 </species> | |
| 5915 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H14N5O6P" hasOnlySubstanceUnits="false" id="C00360" metaid="b756f7ba-738d-440b-9211-3d4ec4b309fb" name="dAMP" sboTerm="SBO:0000240"> | |
| 5916 <notes> | |
| 5917 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5918 <p>kegg.compound: C00360</p> | |
| 5919 <p>CAS: 653-63-4</p> | |
| 5920 <p>PubChem: 3651</p> | |
| 5921 <p>3DMET: B01226</p> | |
| 5922 <p>PDB-CCD: D5M DA</p> | |
| 5923 <p>ChEBI: 17713</p> | |
| 5924 <p>NIKKAJI: J205.943F</p> | |
| 5925 <p>formula: C10H14N5O6P</p> | |
| 5926 <p>weight: 331.2218</p> | |
| 5927 </body> | |
| 5928 </notes> | |
| 5929 <annotation> | |
| 5930 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5931 <rdf:Description rdf:about="#b756f7ba-738d-440b-9211-3d4ec4b309fb"> | |
| 5932 <bqbiol:is> | |
| 5933 <rdf:Bag> | |
| 5934 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00360"/> | |
| 5935 <rdf:li rdf:resource="https://identifiers.org/CAS/653-63-4"/> | |
| 5936 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01226"/> | |
| 5937 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/D5M DA"/> | |
| 5938 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17713"/> | |
| 5939 </rdf:Bag> | |
| 5940 </bqbiol:is> | |
| 5941 </rdf:Description> | |
| 5942 </rdf:RDF> | |
| 5943 </annotation> | |
| 5944 </species> | |
| 5945 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C22151" metaid="d891330a-3259-4781-aa3b-bac7305e6203" name="Oxidized [2Fe-2S] ferredoxin" sboTerm="SBO:0000240"> | |
| 5946 <notes> | |
| 5947 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5948 <p>kegg.compound: C22151</p> | |
| 5949 <p>PubChem: 405226342</p> | |
| 5950 </body> | |
| 5951 </notes> | |
| 5952 <annotation> | |
| 5953 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5954 <rdf:Description rdf:about="#d891330a-3259-4781-aa3b-bac7305e6203"> | |
| 5955 <bqbiol:is> | |
| 5956 <rdf:Bag> | |
| 5957 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C22151"/> | |
| 5958 </rdf:Bag> | |
| 5959 </bqbiol:is> | |
| 5960 </rdf:Description> | |
| 5961 </rdf:RDF> | |
| 5962 </annotation> | |
| 5963 </species> | |
| 5964 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="H3PO4" hasOnlySubstanceUnits="false" id="C00009" metaid="a315ccaf-6399-4970-aab9-1deb79b2e099" name="Orthophosphate" sboTerm="SBO:0000240"> | |
| 5965 <notes> | |
| 5966 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5967 <p>kegg.compound: C00009</p> | |
| 5968 <p>KNApSAcK: C00007408</p> | |
| 5969 <p>CAS: 7664-38-2</p> | |
| 5970 <p>PubChem: 3311</p> | |
| 5971 <p>3DMET: B00002</p> | |
| 5972 <p>PDB-CCD: 2HP PI PO4</p> | |
| 5973 <p>ChEBI: 18367 26078</p> | |
| 5974 <p>NIKKAJI: J3.746J</p> | |
| 5975 <p>formula: H3PO4</p> | |
| 5976 <p>weight: 97.9952</p> | |
| 5977 </body> | |
| 5978 </notes> | |
| 5979 <annotation> | |
| 5980 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5981 <rdf:Description rdf:about="#a315ccaf-6399-4970-aab9-1deb79b2e099"> | |
| 5982 <bqbiol:is> | |
| 5983 <rdf:Bag> | |
| 5984 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00009"/> | |
| 5985 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007408"/> | |
| 5986 <rdf:li rdf:resource="https://identifiers.org/CAS/7664-38-2"/> | |
| 5987 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00002"/> | |
| 5988 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/2HP PI PO4"/> | |
| 5989 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18367 26078"/> | |
| 5990 </rdf:Bag> | |
| 5991 </bqbiol:is> | |
| 5992 </rdf:Description> | |
| 5993 </rdf:RDF> | |
| 5994 </annotation> | |
| 5995 </species> | |
| 5996 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H15N5O10P2" hasOnlySubstanceUnits="false" id="C00008" metaid="_0d615d55-a092-4975-bc57-fece3f9d5029" name="ADP" sboTerm="SBO:0000240"> | |
| 5997 <notes> | |
| 5998 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5999 <p>kegg.compound: C00008</p> | |
| 6000 <p>KNApSAcK: C00019353</p> | |
| 6001 <p>CAS: 58-64-0</p> | |
| 6002 <p>PubChem: 3310</p> | |
| 6003 <p>3DMET: B01130</p> | |
| 6004 <p>PDB-CCD: ADP</p> | |
| 6005 <p>ChEBI: 16761</p> | |
| 6006 <p>NIKKAJI: J10.683F</p> | |
| 6007 <p>formula: C10H15N5O10P2</p> | |
| 6008 <p>weight: 427.2011</p> | |
| 6009 </body> | |
| 6010 </notes> | |
| 6011 <annotation> | |
| 6012 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6013 <rdf:Description rdf:about="#_0d615d55-a092-4975-bc57-fece3f9d5029"> | |
| 6014 <bqbiol:is> | |
| 6015 <rdf:Bag> | |
| 6016 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00008"/> | |
| 6017 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019353"/> | |
| 6018 <rdf:li rdf:resource="https://identifiers.org/CAS/58-64-0"/> | |
| 6019 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01130"/> | |
| 6020 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/ADP"/> | |
| 6021 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16761"/> | |
| 6022 </rdf:Bag> | |
| 6023 </bqbiol:is> | |
| 6024 </rdf:Description> | |
| 6025 </rdf:RDF> | |
| 6026 </annotation> | |
| 6027 </species> | |
| 6028 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H12O7P2" hasOnlySubstanceUnits="false" id="C00129" metaid="_8ef6a348-a296-4624-a855-1eb7e3e5e175" name="Isopentenyl diphosphate" sboTerm="SBO:0000240"> | |
| 6029 <notes> | |
| 6030 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6031 <p>kegg.compound: C00129</p> | |
| 6032 <p>KNApSAcK: C00000848</p> | |
| 6033 <p>CAS: 358-71-4</p> | |
| 6034 <p>PubChem: 3429</p> | |
| 6035 <p>3DMET: B00035</p> | |
| 6036 <p>PDB-CCD: IPE</p> | |
| 6037 <p>ChEBI: 16584</p> | |
| 6038 <p>LIPIDMAPS: LMPR01010008</p> | |
| 6039 <p>LipidBank: IIP0001</p> | |
| 6040 <p>NIKKAJI: J38.556E</p> | |
| 6041 <p>formula: C5H12O7P2</p> | |
| 6042 <p>weight: 246.0921</p> | |
| 6043 </body> | |
| 6044 </notes> | |
| 6045 <annotation> | |
| 6046 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6047 <rdf:Description rdf:about="#_8ef6a348-a296-4624-a855-1eb7e3e5e175"> | |
| 6048 <bqbiol:is> | |
| 6049 <rdf:Bag> | |
| 6050 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00129"/> | |
| 6051 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00000848"/> | |
| 6052 <rdf:li rdf:resource="https://identifiers.org/CAS/358-71-4"/> | |
| 6053 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00035"/> | |
| 6054 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/IPE"/> | |
| 6055 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16584"/> | |
| 6056 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMPR01010008"/> | |
| 6057 <rdf:li rdf:resource="https://identifiers.org/LipidBank/IIP0001"/> | |
| 6058 </rdf:Bag> | |
| 6059 </bqbiol:is> | |
| 6060 </rdf:Description> | |
| 6061 </rdf:RDF> | |
| 6062 </annotation> | |
| 6063 </species> | |
| 6064 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="O2" hasOnlySubstanceUnits="false" id="C00007" metaid="bd33c11c-755d-4690-a46e-e569e871b028" name="Oxygen" sboTerm="SBO:0000240"> | |
| 6065 <notes> | |
| 6066 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6067 <p>kegg.compound: C00007</p> | |
| 6068 <p>CAS: 7782-44-7</p> | |
| 6069 <p>PubChem: 3309</p> | |
| 6070 <p>3DMET: B00001</p> | |
| 6071 <p>PDB-CCD: OXY</p> | |
| 6072 <p>ChEBI: 15379 25805</p> | |
| 6073 <p>NIKKAJI: J44.420K</p> | |
| 6074 <p>formula: O2</p> | |
| 6075 <p>weight: 31.9988</p> | |
| 6076 </body> | |
| 6077 </notes> | |
| 6078 <annotation> | |
| 6079 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6080 <rdf:Description rdf:about="#bd33c11c-755d-4690-a46e-e569e871b028"> | |
| 6081 <bqbiol:is> | |
| 6082 <rdf:Bag> | |
| 6083 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00007"/> | |
| 6084 <rdf:li rdf:resource="https://identifiers.org/CAS/7782-44-7"/> | |
| 6085 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00001"/> | |
| 6086 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/OXY"/> | |
| 6087 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15379 25805"/> | |
| 6088 </rdf:Bag> | |
| 6089 </bqbiol:is> | |
| 6090 </rdf:Description> | |
| 6091 </rdf:RDF> | |
| 6092 </annotation> | |
| 6093 </species> | |
| 6094 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C21H29N7O17P3" hasOnlySubstanceUnits="false" id="C00006" metaid="d1b337a6-ef70-4dcf-b266-be402efa1f72" name="NADP+" sboTerm="SBO:0000240"> | |
| 6095 <notes> | |
| 6096 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6097 <p>kegg.compound: C00006</p> | |
| 6098 <p>CAS: 53-59-8</p> | |
| 6099 <p>PubChem: 3308</p> | |
| 6100 <p>3DMET: B01129</p> | |
| 6101 <p>PDB-CCD: NAP</p> | |
| 6102 <p>ChEBI: 18009</p> | |
| 6103 <p>NIKKAJI: J247.824B</p> | |
| 6104 <p>formula: C21H29N7O17P3</p> | |
| 6105 <p>weight: 744.4129</p> | |
| 6106 </body> | |
| 6107 </notes> | |
| 6108 <annotation> | |
| 6109 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6110 <rdf:Description rdf:about="#d1b337a6-ef70-4dcf-b266-be402efa1f72"> | |
| 6111 <bqbiol:is> | |
| 6112 <rdf:Bag> | |
| 6113 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00006"/> | |
| 6114 <rdf:li rdf:resource="https://identifiers.org/CAS/53-59-8"/> | |
| 6115 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01129"/> | |
| 6116 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/NAP"/> | |
| 6117 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18009"/> | |
| 6118 </rdf:Bag> | |
| 6119 </bqbiol:is> | |
| 6120 </rdf:Description> | |
| 6121 </rdf:RDF> | |
| 6122 </annotation> | |
| 6123 </species> | |
| 6124 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="NH2R" hasOnlySubstanceUnits="false" id="C22157" metaid="b96773c8-9072-413c-9744-d06c92f7c1a1" name="Glycine cleavage system H" sboTerm="SBO:0000240"> | |
| 6125 <notes> | |
| 6126 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6127 <p>kegg.compound: C22157</p> | |
| 6128 <p>PubChem: 405226348</p> | |
| 6129 <p>formula: NH2R</p> | |
| 6130 </body> | |
| 6131 </notes> | |
| 6132 <annotation> | |
| 6133 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6134 <rdf:Description rdf:about="#b96773c8-9072-413c-9744-d06c92f7c1a1"> | |
| 6135 <bqbiol:is> | |
| 6136 <rdf:Bag> | |
| 6137 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C22157"/> | |
| 6138 </rdf:Bag> | |
| 6139 </bqbiol:is> | |
| 6140 </rdf:Description> | |
| 6141 </rdf:RDF> | |
| 6142 </annotation> | |
| 6143 </species> | |
| 6144 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C13H18O7" hasOnlySubstanceUnits="false" id="C01451" metaid="_3057fb5a-0d22-4799-8d80-8da3029d7254" name="Salicin" sboTerm="SBO:0000240"> | |
| 6145 <notes> | |
| 6146 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6147 <p>kegg.compound: C01451</p> | |
| 6148 <p>KNApSAcK: C00002672</p> | |
| 6149 <p>CAS: 138-52-3</p> | |
| 6150 <p>PubChem: 4628</p> | |
| 6151 <p>3DMET: B01452</p> | |
| 6152 <p>PDB-CCD: SA0</p> | |
| 6153 <p>ChEBI: 17814</p> | |
| 6154 <p>NIKKAJI: J5.634K</p> | |
| 6155 <p>formula: C13H18O7</p> | |
| 6156 <p>weight: 286.2778</p> | |
| 6157 </body> | |
| 6158 </notes> | |
| 6159 <annotation> | |
| 6160 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6161 <rdf:Description rdf:about="#_3057fb5a-0d22-4799-8d80-8da3029d7254"> | |
| 6162 <bqbiol:is> | |
| 6163 <rdf:Bag> | |
| 6164 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01451"/> | |
| 6165 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00002672"/> | |
| 6166 <rdf:li rdf:resource="https://identifiers.org/CAS/138-52-3"/> | |
| 6167 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01452"/> | |
| 6168 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/SA0"/> | |
| 6169 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17814"/> | |
| 6170 </rdf:Bag> | |
| 6171 </bqbiol:is> | |
| 6172 </rdf:Description> | |
| 6173 </rdf:RDF> | |
| 6174 </annotation> | |
| 6175 </species> | |
| 6176 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C21H30N7O17P3" hasOnlySubstanceUnits="false" id="C00005" metaid="dca9c1fe-4a31-4487-98ec-efd67c980458" name="NADPH" sboTerm="SBO:0000240"> | |
| 6177 <notes> | |
| 6178 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6179 <p>kegg.compound: C00005</p> | |
| 6180 <p>CAS: 2646-71-1</p> | |
| 6181 <p>PubChem: 3307</p> | |
| 6182 <p>3DMET: B01128</p> | |
| 6183 <p>PDB-CCD: NDP</p> | |
| 6184 <p>ChEBI: 16474</p> | |
| 6185 <p>NIKKAJI: J208.978E</p> | |
| 6186 <p>formula: C21H30N7O17P3</p> | |
| 6187 <p>weight: 745.4209</p> | |
| 6188 </body> | |
| 6189 </notes> | |
| 6190 <annotation> | |
| 6191 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6192 <rdf:Description rdf:about="#dca9c1fe-4a31-4487-98ec-efd67c980458"> | |
| 6193 <bqbiol:is> | |
| 6194 <rdf:Bag> | |
| 6195 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00005"/> | |
| 6196 <rdf:li rdf:resource="https://identifiers.org/CAS/2646-71-1"/> | |
| 6197 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01128"/> | |
| 6198 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/NDP"/> | |
| 6199 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16474"/> | |
| 6200 </rdf:Bag> | |
| 6201 </bqbiol:is> | |
| 6202 </rdf:Description> | |
| 6203 </rdf:RDF> | |
| 6204 </annotation> | |
| 6205 </species> | |
| 6206 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="NH2R" hasOnlySubstanceUnits="false" id="C22158" metaid="a0944664-3fbc-4eab-b6db-a27d344252b4" name="Lipoyl-carrier protein E2" sboTerm="SBO:0000240"> | |
| 6207 <notes> | |
| 6208 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6209 <p>kegg.compound: C22158</p> | |
| 6210 <p>PubChem: 405226349</p> | |
| 6211 <p>formula: NH2R</p> | |
| 6212 </body> | |
| 6213 </notes> | |
| 6214 <annotation> | |
| 6215 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6216 <rdf:Description rdf:about="#a0944664-3fbc-4eab-b6db-a27d344252b4"> | |
| 6217 <bqbiol:is> | |
| 6218 <rdf:Bag> | |
| 6219 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C22158"/> | |
| 6220 </rdf:Bag> | |
| 6221 </bqbiol:is> | |
| 6222 </rdf:Description> | |
| 6223 </rdf:RDF> | |
| 6224 </annotation> | |
| 6225 </species> | |
| 6226 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C21H29N7O14P2" hasOnlySubstanceUnits="false" id="C00004" metaid="b9e21260-c384-4998-93a1-17bda56a8eda" name="NADH" sboTerm="SBO:0000240"> | |
| 6227 <notes> | |
| 6228 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6229 <p>kegg.compound: C00004</p> | |
| 6230 <p>KNApSAcK: C00019343</p> | |
| 6231 <p>CAS: 58-68-4</p> | |
| 6232 <p>PubChem: 3306</p> | |
| 6233 <p>3DMET: B01127</p> | |
| 6234 <p>PDB-CCD: NAI</p> | |
| 6235 <p>ChEBI: 16908</p> | |
| 6236 <p>NIKKAJI: J213.546I</p> | |
| 6237 <p>formula: C21H29N7O14P2</p> | |
| 6238 <p>weight: 665.441</p> | |
| 6239 </body> | |
| 6240 </notes> | |
| 6241 <annotation> | |
| 6242 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6243 <rdf:Description rdf:about="#b9e21260-c384-4998-93a1-17bda56a8eda"> | |
| 6244 <bqbiol:is> | |
| 6245 <rdf:Bag> | |
| 6246 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00004"/> | |
| 6247 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019343"/> | |
| 6248 <rdf:li rdf:resource="https://identifiers.org/CAS/58-68-4"/> | |
| 6249 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01127"/> | |
| 6250 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/NAI"/> | |
| 6251 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16908"/> | |
| 6252 </rdf:Bag> | |
| 6253 </bqbiol:is> | |
| 6254 </rdf:Description> | |
| 6255 </rdf:RDF> | |
| 6256 </annotation> | |
| 6257 </species> | |
| 6258 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C8H16NOR" hasOnlySubstanceUnits="false" id="C22159" metaid="_25409c29-6e9f-4a1c-af28-46256fd2f2ba" name="[Glycine cleavage system H]-N6-octanoyl-L-lysine" sboTerm="SBO:0000240"> | |
| 6259 <notes> | |
| 6260 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6261 <p>kegg.compound: C22159</p> | |
| 6262 <p>PubChem: 405226350</p> | |
| 6263 <p>formula: C8H16NOR</p> | |
| 6264 </body> | |
| 6265 </notes> | |
| 6266 <annotation> | |
| 6267 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6268 <rdf:Description rdf:about="#_25409c29-6e9f-4a1c-af28-46256fd2f2ba"> | |
| 6269 <bqbiol:is> | |
| 6270 <rdf:Bag> | |
| 6271 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C22159"/> | |
| 6272 </rdf:Bag> | |
| 6273 </bqbiol:is> | |
| 6274 </rdf:Description> | |
| 6275 </rdf:RDF> | |
| 6276 </annotation> | |
| 6277 </species> | |
| 6278 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C03511" metaid="e05de222-fb8c-4ca5-ab1a-70a93a77456d" name="L-Phenylalanyl-tRNA(Phe)" sboTerm="SBO:0000240"> | |
| 6279 <notes> | |
| 6280 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6281 <p>kegg.compound: C03511</p> | |
| 6282 <p>PubChem: 6321</p> | |
| 6283 <p>ChEBI: 29153</p> | |
| 6284 <p>formula: C19H26NO11PR2(C5H8O6PR)n</p> | |
| 6285 </body> | |
| 6286 </notes> | |
| 6287 <annotation> | |
| 6288 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6289 <rdf:Description rdf:about="#e05de222-fb8c-4ca5-ab1a-70a93a77456d"> | |
| 6290 <bqbiol:is> | |
| 6291 <rdf:Bag> | |
| 6292 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03511"/> | |
| 6293 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29153"/> | |
| 6294 </rdf:Bag> | |
| 6295 </bqbiol:is> | |
| 6296 </rdf:Description> | |
| 6297 </rdf:RDF> | |
| 6298 </annotation> | |
| 6299 </species> | |
| 6300 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C21H28N7O14P2" hasOnlySubstanceUnits="false" id="C00003" metaid="_70f2dbed-8ec1-42dc-ad80-1a6089e4048b" name="NAD+" sboTerm="SBO:0000240"> | |
| 6301 <notes> | |
| 6302 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6303 <p>kegg.compound: C00003</p> | |
| 6304 <p>KNApSAcK: C00007256</p> | |
| 6305 <p>CAS: 53-84-9</p> | |
| 6306 <p>PubChem: 3305</p> | |
| 6307 <p>3DMET: B01126</p> | |
| 6308 <p>PDB-CCD: NAD NAJ</p> | |
| 6309 <p>ChEBI: 15846</p> | |
| 6310 <p>NIKKAJI: J136.554A</p> | |
| 6311 <p>formula: C21H28N7O14P2</p> | |
| 6312 <p>weight: 664.433</p> | |
| 6313 </body> | |
| 6314 </notes> | |
| 6315 <annotation> | |
| 6316 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6317 <rdf:Description rdf:about="#_70f2dbed-8ec1-42dc-ad80-1a6089e4048b"> | |
| 6318 <bqbiol:is> | |
| 6319 <rdf:Bag> | |
| 6320 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00003"/> | |
| 6321 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007256"/> | |
| 6322 <rdf:li rdf:resource="https://identifiers.org/CAS/53-84-9"/> | |
| 6323 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01126"/> | |
| 6324 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/NAD NAJ"/> | |
| 6325 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15846"/> | |
| 6326 </rdf:Bag> | |
| 6327 </bqbiol:is> | |
| 6328 </rdf:Description> | |
| 6329 </rdf:RDF> | |
| 6330 </annotation> | |
| 6331 </species> | |
| 6332 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C23H36N4O20P2" hasOnlySubstanceUnits="false" id="C01212" metaid="_694d32a3-b413-47f4-a524-0c9497095caa" name="UDP-N-acetylmuramoyl-L-alanine" sboTerm="SBO:0000240"> | |
| 6333 <notes> | |
| 6334 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6335 <p>kegg.compound: C01212</p> | |
| 6336 <p>PubChem: 4434</p> | |
| 6337 <p>3DMET: B04782</p> | |
| 6338 <p>PDB-CCD: UMA</p> | |
| 6339 <p>ChEBI: 84726</p> | |
| 6340 <p>NIKKAJI: J890.604A</p> | |
| 6341 <p>formula: C23H36N4O20P2</p> | |
| 6342 <p>weight: 750.4943</p> | |
| 6343 </body> | |
| 6344 </notes> | |
| 6345 <annotation> | |
| 6346 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6347 <rdf:Description rdf:about="#_694d32a3-b413-47f4-a524-0c9497095caa"> | |
| 6348 <bqbiol:is> | |
| 6349 <rdf:Bag> | |
| 6350 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01212"/> | |
| 6351 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04782"/> | |
| 6352 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/UMA"/> | |
| 6353 <rdf:li rdf:resource="https://identifiers.org/ChEBI/84726"/> | |
| 6354 </rdf:Bag> | |
| 6355 </bqbiol:is> | |
| 6356 </rdf:Description> | |
| 6357 </rdf:RDF> | |
| 6358 </annotation> | |
| 6359 </species> | |
| 6360 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="H4P2O7" hasOnlySubstanceUnits="false" id="C00013" metaid="_54593763-e023-4f11-aaa5-9bc8cd9bf39e" name="Diphosphate" sboTerm="SBO:0000240"> | |
| 6361 <notes> | |
| 6362 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6363 <p>kegg.compound: C00013</p> | |
| 6364 <p>KNApSAcK: C00019561</p> | |
| 6365 <p>CAS: 2466-09-3</p> | |
| 6366 <p>PubChem: 3315</p> | |
| 6367 <p>3DMET: B00003</p> | |
| 6368 <p>PDB-CCD: DPO POP PPV</p> | |
| 6369 <p>ChEBI: 18361 29888</p> | |
| 6370 <p>NIKKAJI: J43.595C</p> | |
| 6371 <p>formula: H4P2O7</p> | |
| 6372 <p>weight: 177.9751</p> | |
| 6373 </body> | |
| 6374 </notes> | |
| 6375 <annotation> | |
| 6376 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6377 <rdf:Description rdf:about="#_54593763-e023-4f11-aaa5-9bc8cd9bf39e"> | |
| 6378 <bqbiol:is> | |
| 6379 <rdf:Bag> | |
| 6380 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00013"/> | |
| 6381 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019561"/> | |
| 6382 <rdf:li rdf:resource="https://identifiers.org/CAS/2466-09-3"/> | |
| 6383 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00003"/> | |
| 6384 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/DPO POP PPV"/> | |
| 6385 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18361 29888"/> | |
| 6386 </rdf:Bag> | |
| 6387 </bqbiol:is> | |
| 6388 </rdf:Description> | |
| 6389 </rdf:RDF> | |
| 6390 </annotation> | |
| 6391 </species> | |
| 6392 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="CH4Se" hasOnlySubstanceUnits="false" id="C05703" metaid="_4821c073-db31-4704-aaeb-96a2f7d43970" name="Methaneselenol" sboTerm="SBO:0000240"> | |
| 6393 <notes> | |
| 6394 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6395 <p>kegg.compound: C05703</p> | |
| 6396 <p>CAS: 6486-05-1</p> | |
| 6397 <p>PubChem: 8010</p> | |
| 6398 <p>3DMET: B01888</p> | |
| 6399 <p>ChEBI: 64685</p> | |
| 6400 <p>NIKKAJI: J151.317F</p> | |
| 6401 <p>formula: CH4Se</p> | |
| 6402 <p>weight: 95.0025</p> | |
| 6403 </body> | |
| 6404 </notes> | |
| 6405 <annotation> | |
| 6406 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6407 <rdf:Description rdf:about="#_4821c073-db31-4704-aaeb-96a2f7d43970"> | |
| 6408 <bqbiol:is> | |
| 6409 <rdf:Bag> | |
| 6410 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05703"/> | |
| 6411 <rdf:li rdf:resource="https://identifiers.org/CAS/6486-05-1"/> | |
| 6412 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01888"/> | |
| 6413 <rdf:li rdf:resource="https://identifiers.org/ChEBI/64685"/> | |
| 6414 </rdf:Bag> | |
| 6415 </bqbiol:is> | |
| 6416 </rdf:Description> | |
| 6417 </rdf:RDF> | |
| 6418 </annotation> | |
| 6419 </species> | |
| 6420 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C17H20N4O6" hasOnlySubstanceUnits="false" id="C00255" metaid="b3f51e53-59e2-4743-a82d-e27d4955d08e" name="Riboflavin" sboTerm="SBO:0000240"> | |
| 6421 <notes> | |
| 6422 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6423 <p>kegg.compound: C00255</p> | |
| 6424 <p>KNApSAcK: C00001552</p> | |
| 6425 <p>CAS: 83-88-5</p> | |
| 6426 <p>PubChem: 3554</p> | |
| 6427 <p>3DMET: B01201</p> | |
| 6428 <p>PDB-CCD: RBF</p> | |
| 6429 <p>ChEBI: 17015</p> | |
| 6430 <p>NIKKAJI: J3.876H</p> | |
| 6431 <p>formula: C17H20N4O6</p> | |
| 6432 <p>weight: 376.3639</p> | |
| 6433 </body> | |
| 6434 </notes> | |
| 6435 <annotation> | |
| 6436 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6437 <rdf:Description rdf:about="#b3f51e53-59e2-4743-a82d-e27d4955d08e"> | |
| 6438 <bqbiol:is> | |
| 6439 <rdf:Bag> | |
| 6440 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00255"/> | |
| 6441 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001552"/> | |
| 6442 <rdf:li rdf:resource="https://identifiers.org/CAS/83-88-5"/> | |
| 6443 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01201"/> | |
| 6444 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/RBF"/> | |
| 6445 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17015"/> | |
| 6446 </rdf:Bag> | |
| 6447 </bqbiol:is> | |
| 6448 </rdf:Description> | |
| 6449 </rdf:RDF> | |
| 6450 </annotation> | |
| 6451 </species> | |
| 6452 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H13N2O11P" hasOnlySubstanceUnits="false" id="C01103" metaid="_231d05ed-56e6-4af2-a846-f5c1aa1d7dd3" name="Orotidine 5'-phosphate" sboTerm="SBO:0000240"> | |
| 6453 <notes> | |
| 6454 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6455 <p>kegg.compound: C01103</p> | |
| 6456 <p>CAS: 2149-82-8</p> | |
| 6457 <p>PubChem: 4337</p> | |
| 6458 <p>3DMET: B01381</p> | |
| 6459 <p>PDB-CCD: OMP</p> | |
| 6460 <p>ChEBI: 15842</p> | |
| 6461 <p>NIKKAJI: J13.801K</p> | |
| 6462 <p>formula: C10H13N2O11P</p> | |
| 6463 <p>weight: 368.1908</p> | |
| 6464 </body> | |
| 6465 </notes> | |
| 6466 <annotation> | |
| 6467 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6468 <rdf:Description rdf:about="#_231d05ed-56e6-4af2-a846-f5c1aa1d7dd3"> | |
| 6469 <bqbiol:is> | |
| 6470 <rdf:Bag> | |
| 6471 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01103"/> | |
| 6472 <rdf:li rdf:resource="https://identifiers.org/CAS/2149-82-8"/> | |
| 6473 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01381"/> | |
| 6474 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/OMP"/> | |
| 6475 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15842"/> | |
| 6476 </rdf:Bag> | |
| 6477 </bqbiol:is> | |
| 6478 </rdf:Description> | |
| 6479 </rdf:RDF> | |
| 6480 </annotation> | |
| 6481 </species> | |
| 6482 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H15N4O9P" hasOnlySubstanceUnits="false" id="C04734" metaid="_44a31d91-8b26-4033-aadb-e2a46df48d3f" name="1-(5'-Phosphoribosyl)-5-formamido-4-imidazolecarboxamide" sboTerm="SBO:0000240"> | |
| 6483 <notes> | |
| 6484 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6485 <p>kegg.compound: C04734</p> | |
| 6486 <p>PubChem: 7305</p> | |
| 6487 <p>3DMET: B01781</p> | |
| 6488 <p>PDB-CCD: FAI</p> | |
| 6489 <p>ChEBI: 18381</p> | |
| 6490 <p>NIKKAJI: J602.393B</p> | |
| 6491 <p>formula: C10H15N4O9P</p> | |
| 6492 <p>weight: 366.2213</p> | |
| 6493 </body> | |
| 6494 </notes> | |
| 6495 <annotation> | |
| 6496 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6497 <rdf:Description rdf:about="#_44a31d91-8b26-4033-aadb-e2a46df48d3f"> | |
| 6498 <bqbiol:is> | |
| 6499 <rdf:Bag> | |
| 6500 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04734"/> | |
| 6501 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01781"/> | |
| 6502 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/FAI"/> | |
| 6503 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18381"/> | |
| 6504 </rdf:Bag> | |
| 6505 </bqbiol:is> | |
| 6506 </rdf:Description> | |
| 6507 </rdf:RDF> | |
| 6508 </annotation> | |
| 6509 </species> | |
| 6510 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H12N2" hasOnlySubstanceUnits="false" id="C00134" metaid="_66903a14-b74d-4362-b04b-ab1112c1178d" name="Putrescine" sboTerm="SBO:0000240"> | |
| 6511 <notes> | |
| 6512 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6513 <p>kegg.compound: C00134</p> | |
| 6514 <p>KNApSAcK: C00001428</p> | |
| 6515 <p>CAS: 110-60-1</p> | |
| 6516 <p>PubChem: 3434</p> | |
| 6517 <p>3DMET: B00037</p> | |
| 6518 <p>PDB-CCD: 58I PUT</p> | |
| 6519 <p>ChEBI: 17148</p> | |
| 6520 <p>NIKKAJI: J1.979H</p> | |
| 6521 <p>formula: C4H12N2</p> | |
| 6522 <p>weight: 88.1515</p> | |
| 6523 </body> | |
| 6524 </notes> | |
| 6525 <annotation> | |
| 6526 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6527 <rdf:Description rdf:about="#_66903a14-b74d-4362-b04b-ab1112c1178d"> | |
| 6528 <bqbiol:is> | |
| 6529 <rdf:Bag> | |
| 6530 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00134"/> | |
| 6531 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001428"/> | |
| 6532 <rdf:li rdf:resource="https://identifiers.org/CAS/110-60-1"/> | |
| 6533 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00037"/> | |
| 6534 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/58I PUT"/> | |
| 6535 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17148"/> | |
| 6536 </rdf:Bag> | |
| 6537 </bqbiol:is> | |
| 6538 </rdf:Description> | |
| 6539 </rdf:RDF> | |
| 6540 </annotation> | |
| 6541 </species> | |
| 6542 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H10O6" hasOnlySubstanceUnits="false" id="C00254" metaid="be1cd7f3-c162-4e28-bdaa-64d3459622dd" name="Prephenate" sboTerm="SBO:0000240"> | |
| 6543 <notes> | |
| 6544 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6545 <p>kegg.compound: C00254</p> | |
| 6546 <p>KNApSAcK: C00019632</p> | |
| 6547 <p>CAS: 126-49-8</p> | |
| 6548 <p>PubChem: 3553</p> | |
| 6549 <p>3DMET: B00074</p> | |
| 6550 <p>PDB-CCD: PRE</p> | |
| 6551 <p>ChEBI: 29934 84387</p> | |
| 6552 <p>NIKKAJI: J38.009A</p> | |
| 6553 <p>formula: C10H10O6</p> | |
| 6554 <p>weight: 226.1828</p> | |
| 6555 </body> | |
| 6556 </notes> | |
| 6557 <annotation> | |
| 6558 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6559 <rdf:Description rdf:about="#be1cd7f3-c162-4e28-bdaa-64d3459622dd"> | |
| 6560 <bqbiol:is> | |
| 6561 <rdf:Bag> | |
| 6562 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00254"/> | |
| 6563 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019632"/> | |
| 6564 <rdf:li rdf:resource="https://identifiers.org/CAS/126-49-8"/> | |
| 6565 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00074"/> | |
| 6566 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/PRE"/> | |
| 6567 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29934 84387"/> | |
| 6568 </rdf:Bag> | |
| 6569 </bqbiol:is> | |
| 6570 </rdf:Description> | |
| 6571 </rdf:RDF> | |
| 6572 </annotation> | |
| 6573 </species> | |
| 6574 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H7NO2" hasOnlySubstanceUnits="false" id="C00133" metaid="_4adfd87a-1d87-417e-8d72-1a69e28f0e62" name="D-Alanine" sboTerm="SBO:0000240"> | |
| 6575 <notes> | |
| 6576 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6577 <p>kegg.compound: C00133</p> | |
| 6578 <p>KNApSAcK: C00019654</p> | |
| 6579 <p>CAS: 338-69-2</p> | |
| 6580 <p>PubChem: 3433</p> | |
| 6581 <p>3DMET: B00036</p> | |
| 6582 <p>PDB-CCD: DAL</p> | |
| 6583 <p>ChEBI: 15570</p> | |
| 6584 <p>NIKKAJI: J9.190A</p> | |
| 6585 <p>formula: C3H7NO2</p> | |
| 6586 <p>weight: 89.0932</p> | |
| 6587 </body> | |
| 6588 </notes> | |
| 6589 <annotation> | |
| 6590 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6591 <rdf:Description rdf:about="#_4adfd87a-1d87-417e-8d72-1a69e28f0e62"> | |
| 6592 <bqbiol:is> | |
| 6593 <rdf:Bag> | |
| 6594 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00133"/> | |
| 6595 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019654"/> | |
| 6596 <rdf:li rdf:resource="https://identifiers.org/CAS/338-69-2"/> | |
| 6597 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00036"/> | |
| 6598 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/DAL"/> | |
| 6599 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15570"/> | |
| 6600 </rdf:Bag> | |
| 6601 </bqbiol:is> | |
| 6602 </rdf:Description> | |
| 6603 </rdf:RDF> | |
| 6604 </annotation> | |
| 6605 </species> | |
| 6606 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C03402" metaid="f0409ddb-2805-4031-b401-bc2537988509" name="L-Asparaginyl-tRNA(Asn)" sboTerm="SBO:0000240"> | |
| 6607 <notes> | |
| 6608 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6609 <p>kegg.compound: C03402</p> | |
| 6610 <p>PubChem: 6232</p> | |
| 6611 <p>ChEBI: 29265</p> | |
| 6612 <p>formula: C14H23N2O12PR2(C5H8O6PR)n</p> | |
| 6613 </body> | |
| 6614 </notes> | |
| 6615 <annotation> | |
| 6616 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6617 <rdf:Description rdf:about="#f0409ddb-2805-4031-b401-bc2537988509"> | |
| 6618 <bqbiol:is> | |
| 6619 <rdf:Bag> | |
| 6620 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03402"/> | |
| 6621 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29265"/> | |
| 6622 </rdf:Bag> | |
| 6623 </bqbiol:is> | |
| 6624 </rdf:Description> | |
| 6625 </rdf:RDF> | |
| 6626 </annotation> | |
| 6627 </species> | |
| 6628 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H14N2O11P2" hasOnlySubstanceUnits="false" id="C01346" metaid="b48cf424-e976-439c-a8e4-bcabf33e5f7d" name="dUDP" sboTerm="SBO:0000240"> | |
| 6629 <notes> | |
| 6630 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6631 <p>kegg.compound: C01346</p> | |
| 6632 <p>CAS: 4208-67-7</p> | |
| 6633 <p>PubChem: 4551</p> | |
| 6634 <p>3DMET: B01441</p> | |
| 6635 <p>PDB-CCD: DUD</p> | |
| 6636 <p>ChEBI: 28850</p> | |
| 6637 <p>NIKKAJI: J699.272B</p> | |
| 6638 <p>formula: C9H14N2O11P2</p> | |
| 6639 <p>weight: 388.1618</p> | |
| 6640 </body> | |
| 6641 </notes> | |
| 6642 <annotation> | |
| 6643 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6644 <rdf:Description rdf:about="#b48cf424-e976-439c-a8e4-bcabf33e5f7d"> | |
| 6645 <bqbiol:is> | |
| 6646 <rdf:Bag> | |
| 6647 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01346"/> | |
| 6648 <rdf:li rdf:resource="https://identifiers.org/CAS/4208-67-7"/> | |
| 6649 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01441"/> | |
| 6650 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/DUD"/> | |
| 6651 <rdf:li rdf:resource="https://identifiers.org/ChEBI/28850"/> | |
| 6652 </rdf:Bag> | |
| 6653 </bqbiol:is> | |
| 6654 </rdf:Description> | |
| 6655 </rdf:RDF> | |
| 6656 </annotation> | |
| 6657 </species> | |
| 6658 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="CO2" hasOnlySubstanceUnits="false" id="C00011" metaid="_0bd1c24e-202e-4246-96f8-25dcd6c3996b" name="CO2" sboTerm="SBO:0000240"> | |
| 6659 <notes> | |
| 6660 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6661 <p>kegg.compound: C00011</p> | |
| 6662 <p>CAS: 124-38-9</p> | |
| 6663 <p>PubChem: 3313</p> | |
| 6664 <p>3DMET: B01131</p> | |
| 6665 <p>PDB-CCD: CO2</p> | |
| 6666 <p>ChEBI: 16526</p> | |
| 6667 <p>NIKKAJI: J43.600C</p> | |
| 6668 <p>formula: CO2</p> | |
| 6669 <p>weight: 44.0095</p> | |
| 6670 </body> | |
| 6671 </notes> | |
| 6672 <annotation> | |
| 6673 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6674 <rdf:Description rdf:about="#_0bd1c24e-202e-4246-96f8-25dcd6c3996b"> | |
| 6675 <bqbiol:is> | |
| 6676 <rdf:Bag> | |
| 6677 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00011"/> | |
| 6678 <rdf:li rdf:resource="https://identifiers.org/CAS/124-38-9"/> | |
| 6679 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01131"/> | |
| 6680 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/CO2"/> | |
| 6681 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16526"/> | |
| 6682 </rdf:Bag> | |
| 6683 </bqbiol:is> | |
| 6684 </rdf:Description> | |
| 6685 </rdf:RDF> | |
| 6686 </annotation> | |
| 6687 </species> | |
| 6688 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H5NO2" hasOnlySubstanceUnits="false" id="C00253" metaid="_98b6748b-fe83-4f90-96f0-04cf6605221f" name="Nicotinate" sboTerm="SBO:0000240"> | |
| 6689 <notes> | |
| 6690 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6691 <p>kegg.compound: C00253</p> | |
| 6692 <p>KNApSAcK: C00000208</p> | |
| 6693 <p>CAS: 59-67-6</p> | |
| 6694 <p>PubChem: 3552</p> | |
| 6695 <p>3DMET: B00073</p> | |
| 6696 <p>PDB-CCD: NIO</p> | |
| 6697 <p>ChEBI: 15940</p> | |
| 6698 <p>NIKKAJI: J2.809F</p> | |
| 6699 <p>formula: C6H5NO2</p> | |
| 6700 <p>weight: 123.1094</p> | |
| 6701 </body> | |
| 6702 </notes> | |
| 6703 <annotation> | |
| 6704 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6705 <rdf:Description rdf:about="#_98b6748b-fe83-4f90-96f0-04cf6605221f"> | |
| 6706 <bqbiol:is> | |
| 6707 <rdf:Bag> | |
| 6708 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00253"/> | |
| 6709 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00000208"/> | |
| 6710 <rdf:li rdf:resource="https://identifiers.org/CAS/59-67-6"/> | |
| 6711 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00073"/> | |
| 6712 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/NIO"/> | |
| 6713 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15940"/> | |
| 6714 </rdf:Bag> | |
| 6715 </bqbiol:is> | |
| 6716 </rdf:Description> | |
| 6717 </rdf:RDF> | |
| 6718 </annotation> | |
| 6719 </species> | |
| 6720 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H11N3O3S2R2" hasOnlySubstanceUnits="false" id="C02315" metaid="_95d34988-1a9a-46d1-bab0-1111c64348a7" name="Protein dithiol" sboTerm="SBO:0000240"> | |
| 6721 <notes> | |
| 6722 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6723 <p>kegg.compound: C02315</p> | |
| 6724 <p>PubChem: 5369</p> | |
| 6725 <p>ChEBI: 17999</p> | |
| 6726 <p>formula: C7H11N3O3S2R2</p> | |
| 6727 </body> | |
| 6728 </notes> | |
| 6729 <annotation> | |
| 6730 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6731 <rdf:Description rdf:about="#_95d34988-1a9a-46d1-bab0-1111c64348a7"> | |
| 6732 <bqbiol:is> | |
| 6733 <rdf:Bag> | |
| 6734 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02315"/> | |
| 6735 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17999"/> | |
| 6736 </rdf:Bag> | |
| 6737 </bqbiol:is> | |
| 6738 </rdf:Description> | |
| 6739 </rdf:RDF> | |
| 6740 </annotation> | |
| 6741 </species> | |
| 6742 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C21H36N7O16P3S" hasOnlySubstanceUnits="false" id="C00010" metaid="b7ddc835-4251-4c2e-be87-8bc112ebb0ec" name="CoA" sboTerm="SBO:0000240"> | |
| 6743 <notes> | |
| 6744 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6745 <p>kegg.compound: C00010</p> | |
| 6746 <p>KNApSAcK: C00007258</p> | |
| 6747 <p>CAS: 85-61-0</p> | |
| 6748 <p>PubChem: 3312</p> | |
| 6749 <p>3DMET: B04618</p> | |
| 6750 <p>PDB-CCD: COA</p> | |
| 6751 <p>ChEBI: 15346</p> | |
| 6752 <p>NIKKAJI: J192.630F</p> | |
| 6753 <p>formula: C21H36N7O16P3S</p> | |
| 6754 <p>weight: 767.5341</p> | |
| 6755 </body> | |
| 6756 </notes> | |
| 6757 <annotation> | |
| 6758 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6759 <rdf:Description rdf:about="#b7ddc835-4251-4c2e-be87-8bc112ebb0ec"> | |
| 6760 <bqbiol:is> | |
| 6761 <rdf:Bag> | |
| 6762 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00010"/> | |
| 6763 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007258"/> | |
| 6764 <rdf:li rdf:resource="https://identifiers.org/CAS/85-61-0"/> | |
| 6765 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04618"/> | |
| 6766 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/COA"/> | |
| 6767 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15346"/> | |
| 6768 </rdf:Bag> | |
| 6769 </bqbiol:is> | |
| 6770 </rdf:Description> | |
| 6771 </rdf:RDF> | |
| 6772 </annotation> | |
| 6773 </species> | |
| 6774 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H16N5O12P3" hasOnlySubstanceUnits="false" id="C00131" metaid="dcac8289-86db-445a-8d40-fd2e00e0b348" name="dATP" sboTerm="SBO:0000240"> | |
| 6775 <notes> | |
| 6776 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6777 <p>kegg.compound: C00131</p> | |
| 6778 <p>CAS: 1927-31-7</p> | |
| 6779 <p>PubChem: 3431</p> | |
| 6780 <p>3DMET: B01169</p> | |
| 6781 <p>PDB-CCD: DTP</p> | |
| 6782 <p>ChEBI: 16284</p> | |
| 6783 <p>NIKKAJI: J90.479A</p> | |
| 6784 <p>formula: C10H16N5O12P3</p> | |
| 6785 <p>weight: 491.1816</p> | |
| 6786 </body> | |
| 6787 </notes> | |
| 6788 <annotation> | |
| 6789 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6790 <rdf:Description rdf:about="#dcac8289-86db-445a-8d40-fd2e00e0b348"> | |
| 6791 <bqbiol:is> | |
| 6792 <rdf:Bag> | |
| 6793 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00131"/> | |
| 6794 <rdf:li rdf:resource="https://identifiers.org/CAS/1927-31-7"/> | |
| 6795 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01169"/> | |
| 6796 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/DTP"/> | |
| 6797 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16284"/> | |
| 6798 </rdf:Bag> | |
| 6799 </bqbiol:is> | |
| 6800 </rdf:Description> | |
| 6801 </rdf:RDF> | |
| 6802 </annotation> | |
| 6803 </species> | |
| 6804 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H13N4O8P" hasOnlySubstanceUnits="false" id="C00130" metaid="_8768d450-e3e5-4388-8f52-86c6db4f0d36" name="IMP" sboTerm="SBO:0000240"> | |
| 6805 <notes> | |
| 6806 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6807 <p>kegg.compound: C00130</p> | |
| 6808 <p>KNApSAcK: C00007224</p> | |
| 6809 <p>CAS: 131-99-7</p> | |
| 6810 <p>PubChem: 3430</p> | |
| 6811 <p>3DMET: B01168</p> | |
| 6812 <p>PDB-CCD: IMP</p> | |
| 6813 <p>ChEBI: 17202</p> | |
| 6814 <p>NIKKAJI: J9.493E</p> | |
| 6815 <p>formula: C10H13N4O8P</p> | |
| 6816 <p>weight: 348.206</p> | |
| 6817 </body> | |
| 6818 </notes> | |
| 6819 <annotation> | |
| 6820 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6821 <rdf:Description rdf:about="#_8768d450-e3e5-4388-8f52-86c6db4f0d36"> | |
| 6822 <bqbiol:is> | |
| 6823 <rdf:Bag> | |
| 6824 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00130"/> | |
| 6825 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007224"/> | |
| 6826 <rdf:li rdf:resource="https://identifiers.org/CAS/131-99-7"/> | |
| 6827 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01168"/> | |
| 6828 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/IMP"/> | |
| 6829 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17202"/> | |
| 6830 </rdf:Bag> | |
| 6831 </bqbiol:is> | |
| 6832 </rdf:Description> | |
| 6833 </rdf:RDF> | |
| 6834 </annotation> | |
| 6835 </species> | |
| 6836 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H10O5" hasOnlySubstanceUnits="false" id="C00493" metaid="ace5e259-870e-4016-8893-9bf6f0ba53bc" name="Shikimate" sboTerm="SBO:0000240"> | |
| 6837 <notes> | |
| 6838 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6839 <p>kegg.compound: C00493</p> | |
| 6840 <p>KNApSAcK: C00001203</p> | |
| 6841 <p>CAS: 138-59-0</p> | |
| 6842 <p>PubChem: 3776</p> | |
| 6843 <p>3DMET: B01267</p> | |
| 6844 <p>PDB-CCD: SKM</p> | |
| 6845 <p>ChEBI: 16119</p> | |
| 6846 <p>NIKKAJI: J3.267K</p> | |
| 6847 <p>formula: C7H10O5</p> | |
| 6848 <p>weight: 174.1513</p> | |
| 6849 </body> | |
| 6850 </notes> | |
| 6851 <annotation> | |
| 6852 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6853 <rdf:Description rdf:about="#ace5e259-870e-4016-8893-9bf6f0ba53bc"> | |
| 6854 <bqbiol:is> | |
| 6855 <rdf:Bag> | |
| 6856 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00493"/> | |
| 6857 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001203"/> | |
| 6858 <rdf:li rdf:resource="https://identifiers.org/CAS/138-59-0"/> | |
| 6859 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01267"/> | |
| 6860 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/SKM"/> | |
| 6861 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16119"/> | |
| 6862 </rdf:Bag> | |
| 6863 </bqbiol:is> | |
| 6864 </rdf:Description> | |
| 6865 </rdf:RDF> | |
| 6866 </annotation> | |
| 6867 </species> | |
| 6868 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H10O6" hasOnlySubstanceUnits="false" id="C00251" metaid="b578472f-4470-467c-967e-1d19a1dd5627" name="Chorismate" sboTerm="SBO:0000240"> | |
| 6869 <notes> | |
| 6870 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6871 <p>kegg.compound: C00251</p> | |
| 6872 <p>KNApSAcK: C00000733</p> | |
| 6873 <p>CAS: 617-12-9</p> | |
| 6874 <p>PubChem: 3550</p> | |
| 6875 <p>3DMET: B01200</p> | |
| 6876 <p>PDB-CCD: ISJ</p> | |
| 6877 <p>ChEBI: 17333</p> | |
| 6878 <p>NIKKAJI: J7.035A</p> | |
| 6879 <p>formula: C10H10O6</p> | |
| 6880 <p>weight: 226.1828</p> | |
| 6881 </body> | |
| 6882 </notes> | |
| 6883 <annotation> | |
| 6884 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6885 <rdf:Description rdf:about="#b578472f-4470-467c-967e-1d19a1dd5627"> | |
| 6886 <bqbiol:is> | |
| 6887 <rdf:Bag> | |
| 6888 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00251"/> | |
| 6889 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00000733"/> | |
| 6890 <rdf:li rdf:resource="https://identifiers.org/CAS/617-12-9"/> | |
| 6891 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01200"/> | |
| 6892 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/ISJ"/> | |
| 6893 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17333"/> | |
| 6894 </rdf:Bag> | |
| 6895 </bqbiol:is> | |
| 6896 </rdf:Description> | |
| 6897 </rdf:RDF> | |
| 6898 </annotation> | |
| 6899 </species> | |
| 6900 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H18N4O6" hasOnlySubstanceUnits="false" id="C03406" metaid="_6524280c-8259-446c-b1a0-3a773ea37ce7" name="N-(L-Arginino)succinate" sboTerm="SBO:0000240"> | |
| 6901 <notes> | |
| 6902 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6903 <p>kegg.compound: C03406</p> | |
| 6904 <p>KNApSAcK: C00019688</p> | |
| 6905 <p>CAS: 2387-71-5</p> | |
| 6906 <p>PubChem: 6235</p> | |
| 6907 <p>3DMET: B04894</p> | |
| 6908 <p>ChEBI: 15682 184023</p> | |
| 6909 <p>NIKKAJI: J37.380J</p> | |
| 6910 <p>formula: C10H18N4O6</p> | |
| 6911 <p>weight: 290.2731</p> | |
| 6912 </body> | |
| 6913 </notes> | |
| 6914 <annotation> | |
| 6915 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6916 <rdf:Description rdf:about="#_6524280c-8259-446c-b1a0-3a773ea37ce7"> | |
| 6917 <bqbiol:is> | |
| 6918 <rdf:Bag> | |
| 6919 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03406"/> | |
| 6920 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019688"/> | |
| 6921 <rdf:li rdf:resource="https://identifiers.org/CAS/2387-71-5"/> | |
| 6922 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04894"/> | |
| 6923 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15682 184023"/> | |
| 6924 </rdf:Bag> | |
| 6925 </bqbiol:is> | |
| 6926 </rdf:Description> | |
| 6927 </rdf:RDF> | |
| 6928 </annotation> | |
| 6929 </species> | |
| 6930 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H19O2SR" hasOnlySubstanceUnits="false" id="C04619" metaid="_671e6e5b-bd1d-491d-92bf-c2c5e7f9a2ca" name="(3R)-3-Hydroxydecanoyl-[acyl-carrier protein]" sboTerm="SBO:0000240"> | |
| 6931 <notes> | |
| 6932 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6933 <p>kegg.compound: C04619</p> | |
| 6934 <p>PubChem: 7209</p> | |
| 6935 <p>formula: C10H19O2SR</p> | |
| 6936 </body> | |
| 6937 </notes> | |
| 6938 <annotation> | |
| 6939 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6940 <rdf:Description rdf:about="#_671e6e5b-bd1d-491d-92bf-c2c5e7f9a2ca"> | |
| 6941 <bqbiol:is> | |
| 6942 <rdf:Bag> | |
| 6943 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04619"/> | |
| 6944 </rdf:Bag> | |
| 6945 </bqbiol:is> | |
| 6946 </rdf:Description> | |
| 6947 </rdf:RDF> | |
| 6948 </annotation> | |
| 6949 </species> | |
| 6950 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H7O2SR" hasOnlySubstanceUnits="false" id="C04618" metaid="_8cce2625-7a52-42ef-96d5-db0e4c7da8f8" name="(3R)-3-Hydroxybutanoyl-[acyl-carrier protein]" sboTerm="SBO:0000240"> | |
| 6951 <notes> | |
| 6952 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6953 <p>kegg.compound: C04618</p> | |
| 6954 <p>PubChem: 7208</p> | |
| 6955 <p>formula: C4H7O2SR</p> | |
| 6956 </body> | |
| 6957 </notes> | |
| 6958 <annotation> | |
| 6959 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6960 <rdf:Description rdf:about="#_8cce2625-7a52-42ef-96d5-db0e4c7da8f8"> | |
| 6961 <bqbiol:is> | |
| 6962 <rdf:Bag> | |
| 6963 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04618"/> | |
| 6964 </rdf:Bag> | |
| 6965 </bqbiol:is> | |
| 6966 </rdf:Description> | |
| 6967 </rdf:RDF> | |
| 6968 </annotation> | |
| 6969 </species> | |
| 6970 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C8H14NOS2R" hasOnlySubstanceUnits="false" id="C15972" metaid="_3fd82b2c-c386-4829-ada7-219cc46b41ee" name="Enzyme N6-(lipoyl)lysine" sboTerm="SBO:0000240"> | |
| 6971 <notes> | |
| 6972 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6973 <p>kegg.compound: C15972</p> | |
| 6974 <p>PubChem: 47205285</p> | |
| 6975 <p>ChEBI: 80218</p> | |
| 6976 <p>formula: C8H14NOS2R</p> | |
| 6977 </body> | |
| 6978 </notes> | |
| 6979 <annotation> | |
| 6980 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6981 <rdf:Description rdf:about="#_3fd82b2c-c386-4829-ada7-219cc46b41ee"> | |
| 6982 <bqbiol:is> | |
| 6983 <rdf:Bag> | |
| 6984 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C15972"/> | |
| 6985 <rdf:li rdf:resource="https://identifiers.org/ChEBI/80218"/> | |
| 6986 </rdf:Bag> | |
| 6987 </bqbiol:is> | |
| 6988 </rdf:Description> | |
| 6989 </rdf:RDF> | |
| 6990 </annotation> | |
| 6991 </species> | |
| 6992 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C8H16NOS2R" hasOnlySubstanceUnits="false" id="C15973" metaid="_5f63fe47-f67c-4de5-a0a6-30516e3598e8" name="Enzyme N6-(dihydrolipoyl)lysine" sboTerm="SBO:0000240"> | |
| 6993 <notes> | |
| 6994 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6995 <p>kegg.compound: C15973</p> | |
| 6996 <p>PubChem: 47205286</p> | |
| 6997 <p>ChEBI: 80219</p> | |
| 6998 <p>formula: C8H16NOS2R</p> | |
| 6999 </body> | |
| 7000 </notes> | |
| 7001 <annotation> | |
| 7002 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7003 <rdf:Description rdf:about="#_5f63fe47-f67c-4de5-a0a6-30516e3598e8"> | |
| 7004 <bqbiol:is> | |
| 7005 <rdf:Bag> | |
| 7006 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C15973"/> | |
| 7007 <rdf:li rdf:resource="https://identifiers.org/ChEBI/80219"/> | |
| 7008 </rdf:Bag> | |
| 7009 </bqbiol:is> | |
| 7010 </rdf:Description> | |
| 7011 </rdf:RDF> | |
| 7012 </annotation> | |
| 7013 </species> | |
| 7014 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C15H22N6O5S" hasOnlySubstanceUnits="false" id="C00019" metaid="_1ac67426-155a-4267-89d8-e319618c7490" name="S-Adenosyl-L-methionine" sboTerm="SBO:0000240"> | |
| 7015 <notes> | |
| 7016 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7017 <p>kegg.compound: C00019</p> | |
| 7018 <p>KNApSAcK: C00007347</p> | |
| 7019 <p>CAS: 29908-03-0</p> | |
| 7020 <p>PubChem: 3321</p> | |
| 7021 <p>3DMET: B04620</p> | |
| 7022 <p>PDB-CCD: SAM</p> | |
| 7023 <p>ChEBI: 15414 67040</p> | |
| 7024 <p>NIKKAJI: J23.293I</p> | |
| 7025 <p>formula: C15H22N6O5S</p> | |
| 7026 <p>weight: 398.4374</p> | |
| 7027 </body> | |
| 7028 </notes> | |
| 7029 <annotation> | |
| 7030 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7031 <rdf:Description rdf:about="#_1ac67426-155a-4267-89d8-e319618c7490"> | |
| 7032 <bqbiol:is> | |
| 7033 <rdf:Bag> | |
| 7034 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00019"/> | |
| 7035 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007347"/> | |
| 7036 <rdf:li rdf:resource="https://identifiers.org/CAS/29908-03-0"/> | |
| 7037 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04620"/> | |
| 7038 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/SAM"/> | |
| 7039 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15414 67040"/> | |
| 7040 </rdf:Bag> | |
| 7041 </bqbiol:is> | |
| 7042 </rdf:Description> | |
| 7043 </rdf:RDF> | |
| 7044 </annotation> | |
| 7045 </species> | |
| 7046 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C00139" metaid="_47ecc99d-1f96-4bc8-a5c0-38a1644ae438" name="Oxidized ferredoxin" sboTerm="SBO:0000240"> | |
| 7047 <notes> | |
| 7048 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7049 <p>kegg.compound: C00139</p> | |
| 7050 <p>PubChem: 3439</p> | |
| 7051 <p>ChEBI: 17908</p> | |
| 7052 </body> | |
| 7053 </notes> | |
| 7054 <annotation> | |
| 7055 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7056 <rdf:Description rdf:about="#_47ecc99d-1f96-4bc8-a5c0-38a1644ae438"> | |
| 7057 <bqbiol:is> | |
| 7058 <rdf:Bag> | |
| 7059 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00139"/> | |
| 7060 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17908"/> | |
| 7061 </rdf:Bag> | |
| 7062 </bqbiol:is> | |
| 7063 </rdf:Description> | |
| 7064 </rdf:RDF> | |
| 7065 </annotation> | |
| 7066 </species> | |
| 7067 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C02430" metaid="_39d1e0d1-323f-407a-b415-6ed0815c23da" name="L-Methionyl-tRNA" sboTerm="SBO:0000240"> | |
| 7068 <notes> | |
| 7069 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7070 <p>kegg.compound: C02430</p> | |
| 7071 <p>PubChem: 5457</p> | |
| 7072 <p>ChEBI: 16635</p> | |
| 7073 <p>formula: C20H30N6O11PSR(C5H8O6PR)n</p> | |
| 7074 </body> | |
| 7075 </notes> | |
| 7076 <annotation> | |
| 7077 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7078 <rdf:Description rdf:about="#_39d1e0d1-323f-407a-b415-6ed0815c23da"> | |
| 7079 <bqbiol:is> | |
| 7080 <rdf:Bag> | |
| 7081 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02430"/> | |
| 7082 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16635"/> | |
| 7083 </rdf:Bag> | |
| 7084 </bqbiol:is> | |
| 7085 </rdf:Description> | |
| 7086 </rdf:RDF> | |
| 7087 </annotation> | |
| 7088 </species> | |
| 7089 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C00138" metaid="f8ecbd62-7829-4555-b00c-90db740011d6" name="Reduced ferredoxin" sboTerm="SBO:0000240"> | |
| 7090 <notes> | |
| 7091 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7092 <p>kegg.compound: C00138</p> | |
| 7093 <p>PubChem: 3438</p> | |
| 7094 <p>ChEBI: 17513</p> | |
| 7095 </body> | |
| 7096 </notes> | |
| 7097 <annotation> | |
| 7098 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7099 <rdf:Description rdf:about="#f8ecbd62-7829-4555-b00c-90db740011d6"> | |
| 7100 <bqbiol:is> | |
| 7101 <rdf:Bag> | |
| 7102 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00138"/> | |
| 7103 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17513"/> | |
| 7104 </rdf:Bag> | |
| 7105 </bqbiol:is> | |
| 7106 </rdf:Description> | |
| 7107 </rdf:RDF> | |
| 7108 </annotation> | |
| 7109 </species> | |
| 7110 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C86H143N7O21P2" hasOnlySubstanceUnits="false" id="C04851" metaid="_8fa06f1d-bfc3-48d8-a3b3-fec88cb8fc5a" name="MurAc(oyl-L-Ala-D-gamma-Glu-L-Lys-D-Ala-D-Ala)-diphospho-undecaprenol" sboTerm="SBO:0000240"> | |
| 7111 <notes> | |
| 7112 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7113 <p>kegg.compound: C04851</p> | |
| 7114 <p>PubChem: 7408</p> | |
| 7115 <p>3DMET: B04969</p> | |
| 7116 <p>ChEBI: 37738</p> | |
| 7117 <p>NIKKAJI: J2.756.131D</p> | |
| 7118 <p>formula: C86H143N7O21P2</p> | |
| 7119 <p>weight: 1673.0374</p> | |
| 7120 </body> | |
| 7121 </notes> | |
| 7122 <annotation> | |
| 7123 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7124 <rdf:Description rdf:about="#_8fa06f1d-bfc3-48d8-a3b3-fec88cb8fc5a"> | |
| 7125 <bqbiol:is> | |
| 7126 <rdf:Bag> | |
| 7127 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04851"/> | |
| 7128 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04969"/> | |
| 7129 <rdf:li rdf:resource="https://identifiers.org/ChEBI/37738"/> | |
| 7130 </rdf:Bag> | |
| 7131 </bqbiol:is> | |
| 7132 </rdf:Description> | |
| 7133 </rdf:RDF> | |
| 7134 </annotation> | |
| 7135 </species> | |
| 7136 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O6" hasOnlySubstanceUnits="false" id="C00137" metaid="_90e7a9f3-bb51-4949-8dfb-14ebbf608e7e" name="myo-Inositol" sboTerm="SBO:0000240"> | |
| 7137 <notes> | |
| 7138 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7139 <p>kegg.compound: C00137</p> | |
| 7140 <p>KNApSAcK: C00001164</p> | |
| 7141 <p>CAS: 87-89-8</p> | |
| 7142 <p>PubChem: 3437</p> | |
| 7143 <p>3DMET: B00038</p> | |
| 7144 <p>PDB-CCD: INS</p> | |
| 7145 <p>ChEBI: 17268</p> | |
| 7146 <p>NIKKAJI: J4.282J</p> | |
| 7147 <p>formula: C6H12O6</p> | |
| 7148 <p>weight: 180.1559</p> | |
| 7149 </body> | |
| 7150 </notes> | |
| 7151 <annotation> | |
| 7152 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7153 <rdf:Description rdf:about="#_90e7a9f3-bb51-4949-8dfb-14ebbf608e7e"> | |
| 7154 <bqbiol:is> | |
| 7155 <rdf:Bag> | |
| 7156 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00137"/> | |
| 7157 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001164"/> | |
| 7158 <rdf:li rdf:resource="https://identifiers.org/CAS/87-89-8"/> | |
| 7159 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00038"/> | |
| 7160 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/INS"/> | |
| 7161 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17268"/> | |
| 7162 </rdf:Bag> | |
| 7163 </bqbiol:is> | |
| 7164 </rdf:Description> | |
| 7165 </rdf:RDF> | |
| 7166 </annotation> | |
| 7167 </species> | |
| 7168 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C27H33N9O15P2" hasOnlySubstanceUnits="false" id="C00016" metaid="ba647161-0e95-4dc5-a8b6-7deec66be858" name="FAD" sboTerm="SBO:0000240"> | |
| 7169 <notes> | |
| 7170 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7171 <p>kegg.compound: C00016</p> | |
| 7172 <p>KNApSAcK: C00001500</p> | |
| 7173 <p>CAS: 146-14-5</p> | |
| 7174 <p>PubChem: 3318</p> | |
| 7175 <p>3DMET: B04619</p> | |
| 7176 <p>PDB-CCD: FAD FAE</p> | |
| 7177 <p>ChEBI: 16238</p> | |
| 7178 <p>NIKKAJI: J39.053D</p> | |
| 7179 <p>formula: C27H33N9O15P2</p> | |
| 7180 <p>weight: 785.5497</p> | |
| 7181 </body> | |
| 7182 </notes> | |
| 7183 <annotation> | |
| 7184 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7185 <rdf:Description rdf:about="#ba647161-0e95-4dc5-a8b6-7deec66be858"> | |
| 7186 <bqbiol:is> | |
| 7187 <rdf:Bag> | |
| 7188 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00016"/> | |
| 7189 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001500"/> | |
| 7190 <rdf:li rdf:resource="https://identifiers.org/CAS/146-14-5"/> | |
| 7191 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04619"/> | |
| 7192 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/FAD FAE"/> | |
| 7193 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16238"/> | |
| 7194 </rdf:Bag> | |
| 7195 </bqbiol:is> | |
| 7196 </rdf:Description> | |
| 7197 </rdf:RDF> | |
| 7198 </annotation> | |
| 7199 </species> | |
| 7200 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12N3O4P" hasOnlySubstanceUnits="false" id="C01100" metaid="c9f731d3-93dc-46d9-a669-3b2af8154e5d" name="L-Histidinol phosphate" sboTerm="SBO:0000240"> | |
| 7201 <notes> | |
| 7202 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7203 <p>kegg.compound: C01100</p> | |
| 7204 <p>KNApSAcK: C00007480</p> | |
| 7205 <p>CAS: 25679-93-0</p> | |
| 7206 <p>PubChem: 4334</p> | |
| 7207 <p>3DMET: B01378</p> | |
| 7208 <p>PDB-CCD: HSA</p> | |
| 7209 <p>ChEBI: 16996</p> | |
| 7210 <p>NIKKAJI: J540.521A</p> | |
| 7211 <p>formula: C6H12N3O4P</p> | |
| 7212 <p>weight: 221.1509</p> | |
| 7213 </body> | |
| 7214 </notes> | |
| 7215 <annotation> | |
| 7216 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7217 <rdf:Description rdf:about="#c9f731d3-93dc-46d9-a669-3b2af8154e5d"> | |
| 7218 <bqbiol:is> | |
| 7219 <rdf:Bag> | |
| 7220 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01100"/> | |
| 7221 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007480"/> | |
| 7222 <rdf:li rdf:resource="https://identifiers.org/CAS/25679-93-0"/> | |
| 7223 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01378"/> | |
| 7224 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/HSA"/> | |
| 7225 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16996"/> | |
| 7226 </rdf:Bag> | |
| 7227 </bqbiol:is> | |
| 7228 </rdf:Description> | |
| 7229 </rdf:RDF> | |
| 7230 </annotation> | |
| 7231 </species> | |
| 7232 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H14N2O12P2" hasOnlySubstanceUnits="false" id="C00015" metaid="d0b79c21-c4dd-4985-b872-74ca37456e8a" name="UDP" sboTerm="SBO:0000240"> | |
| 7233 <notes> | |
| 7234 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7235 <p>kegg.compound: C00015</p> | |
| 7236 <p>KNApSAcK: C00007313</p> | |
| 7237 <p>CAS: 58-98-0</p> | |
| 7238 <p>PubChem: 3317</p> | |
| 7239 <p>3DMET: B01132</p> | |
| 7240 <p>PDB-CCD: UDP</p> | |
| 7241 <p>ChEBI: 17659</p> | |
| 7242 <p>NIKKAJI: J4.595K</p> | |
| 7243 <p>formula: C9H14N2O12P2</p> | |
| 7244 <p>weight: 404.1612</p> | |
| 7245 </body> | |
| 7246 </notes> | |
| 7247 <annotation> | |
| 7248 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7249 <rdf:Description rdf:about="#d0b79c21-c4dd-4985-b872-74ca37456e8a"> | |
| 7250 <bqbiol:is> | |
| 7251 <rdf:Bag> | |
| 7252 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00015"/> | |
| 7253 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007313"/> | |
| 7254 <rdf:li rdf:resource="https://identifiers.org/CAS/58-98-0"/> | |
| 7255 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01132"/> | |
| 7256 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/UDP"/> | |
| 7257 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17659"/> | |
| 7258 </rdf:Bag> | |
| 7259 </bqbiol:is> | |
| 7260 </rdf:Description> | |
| 7261 </rdf:RDF> | |
| 7262 </annotation> | |
| 7263 </species> | |
| 7264 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H16N4O6" hasOnlySubstanceUnits="false" id="C04732" metaid="_35f692ea-3bfd-44e8-892b-16887195abb7" name="5-Amino-6-(1-D-ribitylamino)uracil" sboTerm="SBO:0000240"> | |
| 7265 <notes> | |
| 7266 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7267 <p>kegg.compound: C04732</p> | |
| 7268 <p>PubChem: 7303</p> | |
| 7269 <p>3DMET: B04958</p> | |
| 7270 <p>ChEBI: 15934</p> | |
| 7271 <p>NIKKAJI: J642.641G</p> | |
| 7272 <p>formula: C9H16N4O6</p> | |
| 7273 <p>weight: 276.2465</p> | |
| 7274 </body> | |
| 7275 </notes> | |
| 7276 <annotation> | |
| 7277 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7278 <rdf:Description rdf:about="#_35f692ea-3bfd-44e8-892b-16887195abb7"> | |
| 7279 <bqbiol:is> | |
| 7280 <rdf:Bag> | |
| 7281 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04732"/> | |
| 7282 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04958"/> | |
| 7283 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15934"/> | |
| 7284 </rdf:Bag> | |
| 7285 </bqbiol:is> | |
| 7286 </rdf:Description> | |
| 7287 </rdf:RDF> | |
| 7288 </annotation> | |
| 7289 </species> | |
| 7290 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C02553" metaid="_122dc520-a527-4683-b24d-889e04b302e2" name="L-Seryl-tRNA(Ser)" sboTerm="SBO:0000240"> | |
| 7291 <notes> | |
| 7292 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7293 <p>kegg.compound: C02553</p> | |
| 7294 <p>PubChem: 5554</p> | |
| 7295 <p>ChEBI: 29162</p> | |
| 7296 <p>formula: C13H22NO12PR2(C5H8O6PR)n</p> | |
| 7297 </body> | |
| 7298 </notes> | |
| 7299 <annotation> | |
| 7300 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7301 <rdf:Description rdf:about="#_122dc520-a527-4683-b24d-889e04b302e2"> | |
| 7302 <bqbiol:is> | |
| 7303 <rdf:Bag> | |
| 7304 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02553"/> | |
| 7305 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29162"/> | |
| 7306 </rdf:Bag> | |
| 7307 </bqbiol:is> | |
| 7308 </rdf:Description> | |
| 7309 </rdf:RDF> | |
| 7310 </annotation> | |
| 7311 </species> | |
| 7312 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="NH3" hasOnlySubstanceUnits="false" id="C00014" metaid="_8e936475-f305-4c67-b863-0bc385baf206" name="Ammonia" sboTerm="SBO:0000240"> | |
| 7313 <notes> | |
| 7314 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7315 <p>kegg.compound: C00014</p> | |
| 7316 <p>KNApSAcK: C00007267</p> | |
| 7317 <p>CAS: 7664-41-7</p> | |
| 7318 <p>PubChem: 3316</p> | |
| 7319 <p>3DMET: B00004</p> | |
| 7320 <p>PDB-CCD: NH3</p> | |
| 7321 <p>ChEBI: 16134</p> | |
| 7322 <p>NIKKAJI: J3.748F</p> | |
| 7323 <p>formula: NH3</p> | |
| 7324 <p>weight: 17.0305</p> | |
| 7325 </body> | |
| 7326 </notes> | |
| 7327 <annotation> | |
| 7328 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7329 <rdf:Description rdf:about="#_8e936475-f305-4c67-b863-0bc385baf206"> | |
| 7330 <bqbiol:is> | |
| 7331 <rdf:Bag> | |
| 7332 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00014"/> | |
| 7333 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007267"/> | |
| 7334 <rdf:li rdf:resource="https://identifiers.org/CAS/7664-41-7"/> | |
| 7335 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00004"/> | |
| 7336 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/NH3"/> | |
| 7337 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16134"/> | |
| 7338 </rdf:Bag> | |
| 7339 </bqbiol:is> | |
| 7340 </rdf:Description> | |
| 7341 </rdf:RDF> | |
| 7342 </annotation> | |
| 7343 </species> | |
| 7344 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H10NO6P" hasOnlySubstanceUnits="false" id="C01102" metaid="e2b887f2-325c-4bff-993b-71d0d4bf3fb7" name="O-Phospho-L-homoserine" sboTerm="SBO:0000240"> | |
| 7345 <notes> | |
| 7346 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7347 <p>kegg.compound: C01102</p> | |
| 7348 <p>KNApSAcK: C00007385</p> | |
| 7349 <p>PubChem: 4336</p> | |
| 7350 <p>3DMET: B01380</p> | |
| 7351 <p>ChEBI: 15961</p> | |
| 7352 <p>NIKKAJI: J2.731.281K</p> | |
| 7353 <p>formula: C4H10NO6P</p> | |
| 7354 <p>weight: 199.0991</p> | |
| 7355 </body> | |
| 7356 </notes> | |
| 7357 <annotation> | |
| 7358 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7359 <rdf:Description rdf:about="#e2b887f2-325c-4bff-993b-71d0d4bf3fb7"> | |
| 7360 <bqbiol:is> | |
| 7361 <rdf:Bag> | |
| 7362 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01102"/> | |
| 7363 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007385"/> | |
| 7364 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01380"/> | |
| 7365 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15961"/> | |
| 7366 </rdf:Bag> | |
| 7367 </bqbiol:is> | |
| 7368 </rdf:Description> | |
| 7369 </rdf:RDF> | |
| 7370 </annotation> | |
| 7371 </species> | |
| 7372 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H6O3" hasOnlySubstanceUnits="false" id="C00256" metaid="_3baf501e-8110-4f19-8cc4-c337e1e2d58e" name="(R)-Lactate" sboTerm="SBO:0000240"> | |
| 7373 <notes> | |
| 7374 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7375 <p>kegg.compound: C00256</p> | |
| 7376 <p>KNApSAcK: C00019549</p> | |
| 7377 <p>CAS: 10326-41-7</p> | |
| 7378 <p>PubChem: 3555</p> | |
| 7379 <p>3DMET: B00075</p> | |
| 7380 <p>PDB-CCD: LAC</p> | |
| 7381 <p>ChEBI: 16004 42111</p> | |
| 7382 <p>NIKKAJI: J9.141C</p> | |
| 7383 <p>formula: C3H6O3</p> | |
| 7384 <p>weight: 90.0779</p> | |
| 7385 </body> | |
| 7386 </notes> | |
| 7387 <annotation> | |
| 7388 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7389 <rdf:Description rdf:about="#_3baf501e-8110-4f19-8cc4-c337e1e2d58e"> | |
| 7390 <bqbiol:is> | |
| 7391 <rdf:Bag> | |
| 7392 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00256"/> | |
| 7393 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019549"/> | |
| 7394 <rdf:li rdf:resource="https://identifiers.org/CAS/10326-41-7"/> | |
| 7395 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00075"/> | |
| 7396 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/LAC"/> | |
| 7397 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16004 42111"/> | |
| 7398 </rdf:Bag> | |
| 7399 </bqbiol:is> | |
| 7400 </rdf:Description> | |
| 7401 </rdf:RDF> | |
| 7402 </annotation> | |
| 7403 </species> | |
| 7404 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C02554" metaid="_7470fba8-9217-4174-84bf-75a81329a299" name="L-Valyl-tRNA(Val)" sboTerm="SBO:0000240"> | |
| 7405 <notes> | |
| 7406 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7407 <p>kegg.compound: C02554</p> | |
| 7408 <p>PubChem: 5555</p> | |
| 7409 <p>ChEBI: 29164</p> | |
| 7410 <p>formula: C20H30N6O11PR(C5H8O6PR)n</p> | |
| 7411 </body> | |
| 7412 </notes> | |
| 7413 <annotation> | |
| 7414 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7415 <rdf:Description rdf:about="#_7470fba8-9217-4174-84bf-75a81329a299"> | |
| 7416 <bqbiol:is> | |
| 7417 <rdf:Bag> | |
| 7418 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02554"/> | |
| 7419 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29164"/> | |
| 7420 </rdf:Bag> | |
| 7421 </bqbiol:is> | |
| 7422 </rdf:Description> | |
| 7423 </rdf:RDF> | |
| 7424 </annotation> | |
| 7425 </species> | |
| 7426 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H9N3O2" hasOnlySubstanceUnits="false" id="C00135" metaid="bcf98d98-cafb-4de9-a07e-2554ec220826" name="L-Histidine" sboTerm="SBO:0000240"> | |
| 7427 <notes> | |
| 7428 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7429 <p>kegg.compound: C00135</p> | |
| 7430 <p>KNApSAcK: C00001363</p> | |
| 7431 <p>CAS: 71-00-1</p> | |
| 7432 <p>PubChem: 3435</p> | |
| 7433 <p>3DMET: B01171</p> | |
| 7434 <p>PDB-CCD: HIS</p> | |
| 7435 <p>ChEBI: 15971</p> | |
| 7436 <p>NIKKAJI: J4.881J</p> | |
| 7437 <p>formula: C6H9N3O2</p> | |
| 7438 <p>weight: 155.1546</p> | |
| 7439 </body> | |
| 7440 </notes> | |
| 7441 <annotation> | |
| 7442 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7443 <rdf:Description rdf:about="#bcf98d98-cafb-4de9-a07e-2554ec220826"> | |
| 7444 <bqbiol:is> | |
| 7445 <rdf:Bag> | |
| 7446 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00135"/> | |
| 7447 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001363"/> | |
| 7448 <rdf:li rdf:resource="https://identifiers.org/CAS/71-00-1"/> | |
| 7449 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01171"/> | |
| 7450 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/HIS"/> | |
| 7451 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15971"/> | |
| 7452 </rdf:Bag> | |
| 7453 </bqbiol:is> | |
| 7454 </rdf:Description> | |
| 7455 </rdf:RDF> | |
| 7456 </annotation> | |
| 7457 </species> | |
| 7458 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C17023" metaid="_2c0dfef6-27ac-4127-9f33-9faec695270d" name="Sulfur donor" sboTerm="SBO:0000240"> | |
| 7459 <notes> | |
| 7460 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7461 <p>kegg.compound: C17023</p> | |
| 7462 <p>PubChem: 96023504</p> | |
| 7463 <p>ChEBI: 80867</p> | |
| 7464 </body> | |
| 7465 </notes> | |
| 7466 <annotation> | |
| 7467 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7468 <rdf:Description rdf:about="#_2c0dfef6-27ac-4127-9f33-9faec695270d"> | |
| 7469 <bqbiol:is> | |
| 7470 <rdf:Bag> | |
| 7471 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C17023"/> | |
| 7472 <rdf:li rdf:resource="https://identifiers.org/ChEBI/80867"/> | |
| 7473 </rdf:Bag> | |
| 7474 </bqbiol:is> | |
| 7475 </rdf:Description> | |
| 7476 </rdf:RDF> | |
| 7477 </annotation> | |
| 7478 </species> | |
| 7479 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H8O4" hasOnlySubstanceUnits="false" id="C04181" metaid="_62f61ac6-f4ec-4aef-a497-30586b0d0fe8" name="3-Hydroxy-3-methyl-2-oxobutanoic acid" sboTerm="SBO:0000240"> | |
| 7480 <notes> | |
| 7481 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7482 <p>kegg.compound: C04181</p> | |
| 7483 <p>PubChem: 6858</p> | |
| 7484 <p>3DMET: B00686</p> | |
| 7485 <p>ChEBI: 11812 17667</p> | |
| 7486 <p>LIPIDMAPS: LMFA01020277</p> | |
| 7487 <p>NIKKAJI: J2.362.068E</p> | |
| 7488 <p>formula: C5H8O4</p> | |
| 7489 <p>weight: 132.1146</p> | |
| 7490 </body> | |
| 7491 </notes> | |
| 7492 <annotation> | |
| 7493 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7494 <rdf:Description rdf:about="#_62f61ac6-f4ec-4aef-a497-30586b0d0fe8"> | |
| 7495 <bqbiol:is> | |
| 7496 <rdf:Bag> | |
| 7497 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04181"/> | |
| 7498 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00686"/> | |
| 7499 <rdf:li rdf:resource="https://identifiers.org/ChEBI/11812 17667"/> | |
| 7500 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA01020277"/> | |
| 7501 </rdf:Bag> | |
| 7502 </bqbiol:is> | |
| 7503 </rdf:Description> | |
| 7504 </rdf:RDF> | |
| 7505 </annotation> | |
| 7506 </species> | |
| 7507 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H13NO5" hasOnlySubstanceUnits="false" id="C00826" metaid="_8fcd7114-c046-492e-89c8-fba00ade7a88" name="L-Arogenate" sboTerm="SBO:0000240"> | |
| 7508 <notes> | |
| 7509 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7510 <p>kegg.compound: C00826</p> | |
| 7511 <p>KNApSAcK: C00007338</p> | |
| 7512 <p>CAS: 53078-86-7</p> | |
| 7513 <p>PubChem: 4084</p> | |
| 7514 <p>3DMET: B04732</p> | |
| 7515 <p>ChEBI: 17530</p> | |
| 7516 <p>NIKKAJI: J157.886C</p> | |
| 7517 <p>formula: C10H13NO5</p> | |
| 7518 <p>weight: 227.2139</p> | |
| 7519 </body> | |
| 7520 </notes> | |
| 7521 <annotation> | |
| 7522 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7523 <rdf:Description rdf:about="#_8fcd7114-c046-492e-89c8-fba00ade7a88"> | |
| 7524 <bqbiol:is> | |
| 7525 <rdf:Bag> | |
| 7526 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00826"/> | |
| 7527 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007338"/> | |
| 7528 <rdf:li rdf:resource="https://identifiers.org/CAS/53078-86-7"/> | |
| 7529 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04732"/> | |
| 7530 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17530"/> | |
| 7531 </rdf:Bag> | |
| 7532 </bqbiol:is> | |
| 7533 </rdf:Description> | |
| 7534 </rdf:RDF> | |
| 7535 </annotation> | |
| 7536 </species> | |
| 7537 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H15N3O10P2" hasOnlySubstanceUnits="false" id="C00705" metaid="a31b3a05-91ce-41e9-b0c1-89df04d504ae" name="dCDP" sboTerm="SBO:0000240"> | |
| 7538 <notes> | |
| 7539 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7540 <p>kegg.compound: C00705</p> | |
| 7541 <p>CAS: 800-73-7</p> | |
| 7542 <p>PubChem: 3972</p> | |
| 7543 <p>3DMET: B01317</p> | |
| 7544 <p>PDB-CCD: YYY</p> | |
| 7545 <p>ChEBI: 28846</p> | |
| 7546 <p>NIKKAJI: J247.701G</p> | |
| 7547 <p>formula: C9H15N3O10P2</p> | |
| 7548 <p>weight: 387.177</p> | |
| 7549 </body> | |
| 7550 </notes> | |
| 7551 <annotation> | |
| 7552 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7553 <rdf:Description rdf:about="#a31b3a05-91ce-41e9-b0c1-89df04d504ae"> | |
| 7554 <bqbiol:is> | |
| 7555 <rdf:Bag> | |
| 7556 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00705"/> | |
| 7557 <rdf:li rdf:resource="https://identifiers.org/CAS/800-73-7"/> | |
| 7558 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01317"/> | |
| 7559 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/YYY"/> | |
| 7560 <rdf:li rdf:resource="https://identifiers.org/ChEBI/28846"/> | |
| 7561 </rdf:Bag> | |
| 7562 </bqbiol:is> | |
| 7563 </rdf:Description> | |
| 7564 </rdf:RDF> | |
| 7565 </annotation> | |
| 7566 </species> | |
| 7567 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C06481" metaid="a8428130-97c9-44eb-8091-1ae76ca98f1e" name="L-Seryl-tRNA(Sec)" sboTerm="SBO:0000240"> | |
| 7568 <notes> | |
| 7569 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7570 <p>kegg.compound: C06481</p> | |
| 7571 <p>PubChem: 8712</p> | |
| 7572 <p>ChEBI: 13170 74589</p> | |
| 7573 <p>formula: C13H22NO12PR2(C5H8O6PR)n</p> | |
| 7574 </body> | |
| 7575 </notes> | |
| 7576 <annotation> | |
| 7577 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7578 <rdf:Description rdf:about="#a8428130-97c9-44eb-8091-1ae76ca98f1e"> | |
| 7579 <bqbiol:is> | |
| 7580 <rdf:Bag> | |
| 7581 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C06481"/> | |
| 7582 <rdf:li rdf:resource="https://identifiers.org/ChEBI/13170 74589"/> | |
| 7583 </rdf:Bag> | |
| 7584 </bqbiol:is> | |
| 7585 </rdf:Description> | |
| 7586 </rdf:RDF> | |
| 7587 </annotation> | |
| 7588 </species> | |
| 7589 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H10O6" hasOnlySubstanceUnits="false" id="C00944" metaid="ce0229ea-99b6-40d7-adf1-aca135f490d0" name="3-Dehydroquinate" sboTerm="SBO:0000240"> | |
| 7590 <notes> | |
| 7591 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7592 <p>kegg.compound: C00944</p> | |
| 7593 <p>KNApSAcK: C00019664</p> | |
| 7594 <p>PubChem: 4196</p> | |
| 7595 <p>3DMET: B01356</p> | |
| 7596 <p>PDB-CCD: DQA</p> | |
| 7597 <p>ChEBI: 17947 32364</p> | |
| 7598 <p>NIKKAJI: J93.942K</p> | |
| 7599 <p>formula: C7H10O6</p> | |
| 7600 <p>weight: 190.1507</p> | |
| 7601 </body> | |
| 7602 </notes> | |
| 7603 <annotation> | |
| 7604 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7605 <rdf:Description rdf:about="#ce0229ea-99b6-40d7-adf1-aca135f490d0"> | |
| 7606 <bqbiol:is> | |
| 7607 <rdf:Bag> | |
| 7608 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00944"/> | |
| 7609 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019664"/> | |
| 7610 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01356"/> | |
| 7611 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/DQA"/> | |
| 7612 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17947 32364"/> | |
| 7613 </rdf:Bag> | |
| 7614 </bqbiol:is> | |
| 7615 </rdf:Description> | |
| 7616 </rdf:RDF> | |
| 7617 </annotation> | |
| 7618 </species> | |
| 7619 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O4" hasOnlySubstanceUnits="false" id="C06007" metaid="_88db8422-8831-4575-a83d-1c758d106ad6" name="(R)-2,3-Dihydroxy-3-methylpentanoate" sboTerm="SBO:0000240"> | |
| 7620 <notes> | |
| 7621 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7622 <p>kegg.compound: C06007</p> | |
| 7623 <p>PubChem: 8280</p> | |
| 7624 <p>3DMET: B05146</p> | |
| 7625 <p>PDB-CCD: DMV</p> | |
| 7626 <p>ChEBI: 27512 49258</p> | |
| 7627 <p>LIPIDMAPS: LMFA01050452</p> | |
| 7628 <p>NIKKAJI: J2.760.883C</p> | |
| 7629 <p>formula: C6H12O4</p> | |
| 7630 <p>weight: 148.1571</p> | |
| 7631 </body> | |
| 7632 </notes> | |
| 7633 <annotation> | |
| 7634 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7635 <rdf:Description rdf:about="#_88db8422-8831-4575-a83d-1c758d106ad6"> | |
| 7636 <bqbiol:is> | |
| 7637 <rdf:Bag> | |
| 7638 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C06007"/> | |
| 7639 <rdf:li rdf:resource="https://identifiers.org/3DMET/B05146"/> | |
| 7640 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/DMV"/> | |
| 7641 <rdf:li rdf:resource="https://identifiers.org/ChEBI/27512 49258"/> | |
| 7642 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA01050452"/> | |
| 7643 </rdf:Bag> | |
| 7644 </bqbiol:is> | |
| 7645 </rdf:Description> | |
| 7646 </rdf:RDF> | |
| 7647 </annotation> | |
| 7648 </species> | |
| 7649 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H10O4" hasOnlySubstanceUnits="false" id="C06006" metaid="f215f9eb-1eb6-4474-af05-0b4400130849" name="(S)-2-Aceto-2-hydroxybutanoate" sboTerm="SBO:0000240"> | |
| 7650 <notes> | |
| 7651 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7652 <p>kegg.compound: C06006</p> | |
| 7653 <p>PubChem: 8279</p> | |
| 7654 <p>3DMET: B01948</p> | |
| 7655 <p>ChEBI: 27681 49256</p> | |
| 7656 <p>LIPIDMAPS: LMFA01050383</p> | |
| 7657 <p>NIKKAJI: J372.593F</p> | |
| 7658 <p>formula: C6H10O4</p> | |
| 7659 <p>weight: 146.1412</p> | |
| 7660 </body> | |
| 7661 </notes> | |
| 7662 <annotation> | |
| 7663 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7664 <rdf:Description rdf:about="#f215f9eb-1eb6-4474-af05-0b4400130849"> | |
| 7665 <bqbiol:is> | |
| 7666 <rdf:Bag> | |
| 7667 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C06006"/> | |
| 7668 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01948"/> | |
| 7669 <rdf:li rdf:resource="https://identifiers.org/ChEBI/27681 49256"/> | |
| 7670 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA01050383"/> | |
| 7671 </rdf:Bag> | |
| 7672 </bqbiol:is> | |
| 7673 </rdf:Description> | |
| 7674 </rdf:RDF> | |
| 7675 </annotation> | |
| 7676 </species> | |
| 7677 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H5O3SR" hasOnlySubstanceUnits="false" id="C19673" metaid="_0925f08d-9b75-4fd8-9952-c1f09dd38220" name="Malonyl-[acp] methyl ester" sboTerm="SBO:0000240"> | |
| 7678 <notes> | |
| 7679 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7680 <p>kegg.compound: C19673</p> | |
| 7681 <p>PubChem: 135626141</p> | |
| 7682 <p>formula: C4H5O3SR</p> | |
| 7683 </body> | |
| 7684 </notes> | |
| 7685 <annotation> | |
| 7686 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7687 <rdf:Description rdf:about="#_0925f08d-9b75-4fd8-9952-c1f09dd38220"> | |
| 7688 <bqbiol:is> | |
| 7689 <rdf:Bag> | |
| 7690 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C19673"/> | |
| 7691 </rdf:Bag> | |
| 7692 </bqbiol:is> | |
| 7693 </rdf:Description> | |
| 7694 </rdf:RDF> | |
| 7695 </annotation> | |
| 7696 </species> | |
| 7697 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H9N3O" hasOnlySubstanceUnits="false" id="C01929" metaid="a449d646-9a10-481c-8efa-6b64f0cba675" name="L-Histidinal" sboTerm="SBO:0000240"> | |
| 7698 <notes> | |
| 7699 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7700 <p>kegg.compound: C01929</p> | |
| 7701 <p>KNApSAcK: C00007495</p> | |
| 7702 <p>PubChem: 5035</p> | |
| 7703 <p>3DMET: B01518</p> | |
| 7704 <p>PDB-CCD: HSV</p> | |
| 7705 <p>ChEBI: 27676</p> | |
| 7706 <p>NIKKAJI: J36.234D</p> | |
| 7707 <p>formula: C6H9N3O</p> | |
| 7708 <p>weight: 139.1552</p> | |
| 7709 </body> | |
| 7710 </notes> | |
| 7711 <annotation> | |
| 7712 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7713 <rdf:Description rdf:about="#a449d646-9a10-481c-8efa-6b64f0cba675"> | |
| 7714 <bqbiol:is> | |
| 7715 <rdf:Bag> | |
| 7716 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01929"/> | |
| 7717 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007495"/> | |
| 7718 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01518"/> | |
| 7719 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/HSV"/> | |
| 7720 <rdf:li rdf:resource="https://identifiers.org/ChEBI/27676"/> | |
| 7721 </rdf:Bag> | |
| 7722 </bqbiol:is> | |
| 7723 </rdf:Description> | |
| 7724 </rdf:RDF> | |
| 7725 </annotation> | |
| 7726 </species> | |
| 7727 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H11NO2" hasOnlySubstanceUnits="false" id="C00719" metaid="_453fd564-4404-473f-83f4-4e3e40bafead" name="Betaine" sboTerm="SBO:0000240"> | |
| 7728 <notes> | |
| 7729 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7730 <p>kegg.compound: C00719</p> | |
| 7731 <p>KNApSAcK: C00007291</p> | |
| 7732 <p>CAS: 107-43-7</p> | |
| 7733 <p>PubChem: 3985</p> | |
| 7734 <p>3DMET: B01318</p> | |
| 7735 <p>PDB-CCD: BET</p> | |
| 7736 <p>ChEBI: 17750</p> | |
| 7737 <p>NIKKAJI: J5.058J</p> | |
| 7738 <p>formula: C5H11NO2</p> | |
| 7739 <p>weight: 117.1463</p> | |
| 7740 </body> | |
| 7741 </notes> | |
| 7742 <annotation> | |
| 7743 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7744 <rdf:Description rdf:about="#_453fd564-4404-473f-83f4-4e3e40bafead"> | |
| 7745 <bqbiol:is> | |
| 7746 <rdf:Bag> | |
| 7747 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00719"/> | |
| 7748 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007291"/> | |
| 7749 <rdf:li rdf:resource="https://identifiers.org/CAS/107-43-7"/> | |
| 7750 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01318"/> | |
| 7751 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/BET"/> | |
| 7752 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17750"/> | |
| 7753 </rdf:Bag> | |
| 7754 </bqbiol:is> | |
| 7755 </rdf:Description> | |
| 7756 </rdf:RDF> | |
| 7757 </annotation> | |
| 7758 </species> | |
| 7759 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H8O4" hasOnlySubstanceUnits="false" id="C06010" metaid="_421cc162-bb48-4e03-9b85-d519c4e5e180" name="(S)-2-Acetolactate" sboTerm="SBO:0000240"> | |
| 7760 <notes> | |
| 7761 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7762 <p>kegg.compound: C06010</p> | |
| 7763 <p>PubChem: 8282</p> | |
| 7764 <p>3DMET: B01949</p> | |
| 7765 <p>PDB-CCD: X2X</p> | |
| 7766 <p>ChEBI: 18409</p> | |
| 7767 <p>LIPIDMAPS: LMFA01050460</p> | |
| 7768 <p>NIKKAJI: J2.362.063D</p> | |
| 7769 <p>formula: C5H8O4</p> | |
| 7770 <p>weight: 132.1146</p> | |
| 7771 </body> | |
| 7772 </notes> | |
| 7773 <annotation> | |
| 7774 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7775 <rdf:Description rdf:about="#_421cc162-bb48-4e03-9b85-d519c4e5e180"> | |
| 7776 <bqbiol:is> | |
| 7777 <rdf:Bag> | |
| 7778 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C06010"/> | |
| 7779 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01949"/> | |
| 7780 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/X2X"/> | |
| 7781 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18409"/> | |
| 7782 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA01050460"/> | |
| 7783 </rdf:Bag> | |
| 7784 </bqbiol:is> | |
| 7785 </rdf:Description> | |
| 7786 </rdf:RDF> | |
| 7787 </annotation> | |
| 7788 </species> | |
| 7789 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H11NO3" hasOnlySubstanceUnits="false" id="C04076" metaid="_185fe4be-ce27-4446-8d59-c29300199e47" name="L-2-Aminoadipate 6-semialdehyde" sboTerm="SBO:0000240"> | |
| 7790 <notes> | |
| 7791 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7792 <p>kegg.compound: C04076</p> | |
| 7793 <p>PubChem: 6771</p> | |
| 7794 <p>3DMET: B00675</p> | |
| 7795 <p>ChEBI: 17917</p> | |
| 7796 <p>NIKKAJI: J1.136.598A</p> | |
| 7797 <p>formula: C6H11NO3</p> | |
| 7798 <p>weight: 145.1564</p> | |
| 7799 </body> | |
| 7800 </notes> | |
| 7801 <annotation> | |
| 7802 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7803 <rdf:Description rdf:about="#_185fe4be-ce27-4446-8d59-c29300199e47"> | |
| 7804 <bqbiol:is> | |
| 7805 <rdf:Bag> | |
| 7806 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04076"/> | |
| 7807 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00675"/> | |
| 7808 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17917"/> | |
| 7809 </rdf:Bag> | |
| 7810 </bqbiol:is> | |
| 7811 </rdf:Description> | |
| 7812 </rdf:RDF> | |
| 7813 </annotation> | |
| 7814 </species> | |
| 7815 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H9NO" hasOnlySubstanceUnits="false" id="C21873" metaid="_5b4cd4c6-e0ca-4c35-993c-d8f3591e5c42" name="2-Methylquinolin-4-ol" sboTerm="SBO:0000240"> | |
| 7816 <notes> | |
| 7817 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7818 <p>kegg.compound: C21873</p> | |
| 7819 <p>CAS: 607-67-0</p> | |
| 7820 <p>formula: C10H9NO</p> | |
| 7821 <p>weight: 159.1846</p> | |
| 7822 </body> | |
| 7823 </notes> | |
| 7824 <annotation> | |
| 7825 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7826 <rdf:Description rdf:about="#_5b4cd4c6-e0ca-4c35-993c-d8f3591e5c42"> | |
| 7827 <bqbiol:is> | |
| 7828 <rdf:Bag> | |
| 7829 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C21873"/> | |
| 7830 <rdf:li rdf:resource="https://identifiers.org/CAS/607-67-0"/> | |
| 7831 </rdf:Bag> | |
| 7832 </bqbiol:is> | |
| 7833 </rdf:Description> | |
| 7834 </rdf:RDF> | |
| 7835 </annotation> | |
| 7836 </species> | |
| 7837 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C01931" metaid="_374a77a2-557c-45d8-88d7-f617a100e80d" name="L-Lysyl-tRNA" sboTerm="SBO:0000240"> | |
| 7838 <notes> | |
| 7839 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7840 <p>kegg.compound: C01931</p> | |
| 7841 <p>PubChem: 5037</p> | |
| 7842 <p>ChEBI: 16047</p> | |
| 7843 <p>formula: C16H29N2O11PR2(C5H8O6PR)n</p> | |
| 7844 </body> | |
| 7845 </notes> | |
| 7846 <annotation> | |
| 7847 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7848 <rdf:Description rdf:about="#_374a77a2-557c-45d8-88d7-f617a100e80d"> | |
| 7849 <bqbiol:is> | |
| 7850 <rdf:Bag> | |
| 7851 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01931"/> | |
| 7852 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16047"/> | |
| 7853 </rdf:Bag> | |
| 7854 </bqbiol:is> | |
| 7855 </rdf:Description> | |
| 7856 </rdf:RDF> | |
| 7857 </annotation> | |
| 7858 </species> | |
| 7859 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C18H35OSR" hasOnlySubstanceUnits="false" id="C04088" metaid="_89395592-0138-4e0f-9c99-ce4883646acb" name="Octadecanoyl-[acyl-carrier protein]" sboTerm="SBO:0000240"> | |
| 7860 <notes> | |
| 7861 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7862 <p>kegg.compound: C04088</p> | |
| 7863 <p>PubChem: 6780</p> | |
| 7864 <p>formula: C18H35OSR</p> | |
| 7865 </body> | |
| 7866 </notes> | |
| 7867 <annotation> | |
| 7868 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7869 <rdf:Description rdf:about="#_89395592-0138-4e0f-9c99-ce4883646acb"> | |
| 7870 <bqbiol:is> | |
| 7871 <rdf:Bag> | |
| 7872 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04088"/> | |
| 7873 </rdf:Bag> | |
| 7874 </bqbiol:is> | |
| 7875 </rdf:Description> | |
| 7876 </rdf:RDF> | |
| 7877 </annotation> | |
| 7878 </species> | |
| 7879 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H10O4" hasOnlySubstanceUnits="false" id="C00966" metaid="_3c3d2612-1bb1-40d0-9b94-4626dafc8277" name="2-Dehydropantoate" sboTerm="SBO:0000240"> | |
| 7880 <notes> | |
| 7881 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7882 <p>kegg.compound: C00966</p> | |
| 7883 <p>KNApSAcK: C00007477</p> | |
| 7884 <p>PubChem: 4217</p> | |
| 7885 <p>3DMET: B01362</p> | |
| 7886 <p>PDB-CCD: KPL</p> | |
| 7887 <p>ChEBI: 11561 17094</p> | |
| 7888 <p>NIKKAJI: J934.784D</p> | |
| 7889 <p>formula: C6H10O4</p> | |
| 7890 <p>weight: 146.1412</p> | |
| 7891 </body> | |
| 7892 </notes> | |
| 7893 <annotation> | |
| 7894 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7895 <rdf:Description rdf:about="#_3c3d2612-1bb1-40d0-9b94-4626dafc8277"> | |
| 7896 <bqbiol:is> | |
| 7897 <rdf:Bag> | |
| 7898 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00966"/> | |
| 7899 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007477"/> | |
| 7900 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01362"/> | |
| 7901 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/KPL"/> | |
| 7902 <rdf:li rdf:resource="https://identifiers.org/ChEBI/11561 17094"/> | |
| 7903 </rdf:Bag> | |
| 7904 </bqbiol:is> | |
| 7905 </rdf:Description> | |
| 7906 </rdf:RDF> | |
| 7907 </annotation> | |
| 7908 </species> | |
| 7909 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H8O5" hasOnlySubstanceUnits="false" id="C06032" metaid="f566a043-1fe7-493b-af20-41881294a1c0" name="D-erythro-3-Methylmalate" sboTerm="SBO:0000240"> | |
| 7910 <notes> | |
| 7911 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7912 <p>kegg.compound: C06032</p> | |
| 7913 <p>PubChem: 8304</p> | |
| 7914 <p>3DMET: B01955</p> | |
| 7915 <p>ChEBI: 27394</p> | |
| 7916 <p>NIKKAJI: J883.007J</p> | |
| 7917 <p>formula: C5H8O5</p> | |
| 7918 <p>weight: 148.114</p> | |
| 7919 </body> | |
| 7920 </notes> | |
| 7921 <annotation> | |
| 7922 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7923 <rdf:Description rdf:about="#f566a043-1fe7-493b-af20-41881294a1c0"> | |
| 7924 <bqbiol:is> | |
| 7925 <rdf:Bag> | |
| 7926 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C06032"/> | |
| 7927 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01955"/> | |
| 7928 <rdf:li rdf:resource="https://identifiers.org/ChEBI/27394"/> | |
| 7929 </rdf:Bag> | |
| 7930 </bqbiol:is> | |
| 7931 </rdf:Description> | |
| 7932 </rdf:RDF> | |
| 7933 </annotation> | |
| 7934 </species> | |
| 7935 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H9NO4" hasOnlySubstanceUnits="false" id="C00979" metaid="_9dc4f0b6-9bd6-422d-8a20-926302c02d18" name="O-Acetyl-L-serine" sboTerm="SBO:0000240"> | |
| 7936 <notes> | |
| 7937 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7938 <p>kegg.compound: C00979</p> | |
| 7939 <p>KNApSAcK: C00007459</p> | |
| 7940 <p>CAS: 5147-00-2</p> | |
| 7941 <p>PubChem: 4228</p> | |
| 7942 <p>3DMET: B00213</p> | |
| 7943 <p>PDB-CCD: OAS</p> | |
| 7944 <p>ChEBI: 17981</p> | |
| 7945 <p>NIKKAJI: J37.500D</p> | |
| 7946 <p>formula: C5H9NO4</p> | |
| 7947 <p>weight: 147.1293</p> | |
| 7948 </body> | |
| 7949 </notes> | |
| 7950 <annotation> | |
| 7951 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7952 <rdf:Description rdf:about="#_9dc4f0b6-9bd6-422d-8a20-926302c02d18"> | |
| 7953 <bqbiol:is> | |
| 7954 <rdf:Bag> | |
| 7955 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00979"/> | |
| 7956 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007459"/> | |
| 7957 <rdf:li rdf:resource="https://identifiers.org/CAS/5147-00-2"/> | |
| 7958 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00213"/> | |
| 7959 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/OAS"/> | |
| 7960 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17981"/> | |
| 7961 </rdf:Bag> | |
| 7962 </bqbiol:is> | |
| 7963 </rdf:Description> | |
| 7964 </rdf:RDF> | |
| 7965 </annotation> | |
| 7966 </species> | |
| 7967 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H8N4O2R2" hasOnlySubstanceUnits="false" id="C00615" metaid="cbfee2ad-5be5-482c-9365-1f648a49002a" name="Protein histidine" sboTerm="SBO:0000240"> | |
| 7968 <notes> | |
| 7969 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7970 <p>kegg.compound: C00615</p> | |
| 7971 <p>PubChem: 3889</p> | |
| 7972 <p>formula: C7H8N4O2R2</p> | |
| 7973 </body> | |
| 7974 </notes> | |
| 7975 <annotation> | |
| 7976 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7977 <rdf:Description rdf:about="#cbfee2ad-5be5-482c-9365-1f648a49002a"> | |
| 7978 <bqbiol:is> | |
| 7979 <rdf:Bag> | |
| 7980 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00615"/> | |
| 7981 </rdf:Bag> | |
| 7982 </bqbiol:is> | |
| 7983 </rdf:Description> | |
| 7984 </rdf:RDF> | |
| 7985 </annotation> | |
| 7986 </species> | |
| 7987 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C21H27N6O15P2" hasOnlySubstanceUnits="false" id="C00857" metaid="_94cff0ca-1efd-4f44-8688-802a64c80da2" name="Deamino-NAD+" sboTerm="SBO:0000240"> | |
| 7988 <notes> | |
| 7989 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7990 <p>kegg.compound: C00857</p> | |
| 7991 <p>PubChem: 4114</p> | |
| 7992 <p>3DMET: B01343</p> | |
| 7993 <p>PDB-CCD: DND NXX</p> | |
| 7994 <p>ChEBI: 18304</p> | |
| 7995 <p>formula: C21H27N6O15P2</p> | |
| 7996 <p>weight: 665.4178</p> | |
| 7997 </body> | |
| 7998 </notes> | |
| 7999 <annotation> | |
| 8000 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8001 <rdf:Description rdf:about="#_94cff0ca-1efd-4f44-8688-802a64c80da2"> | |
| 8002 <bqbiol:is> | |
| 8003 <rdf:Bag> | |
| 8004 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00857"/> | |
| 8005 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01343"/> | |
| 8006 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/DND NXX"/> | |
| 8007 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18304"/> | |
| 8008 </rdf:Bag> | |
| 8009 </bqbiol:is> | |
| 8010 </rdf:Description> | |
| 8011 </rdf:RDF> | |
| 8012 </annotation> | |
| 8013 </species> | |
| 8014 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H14NO8P" hasOnlySubstanceUnits="false" id="C06156" metaid="_92d31e70-e7f7-4b3f-b670-489f69c25e47" name="alpha-D-Glucosamine 1-phosphate" sboTerm="SBO:0000240"> | |
| 8015 <notes> | |
| 8016 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8017 <p>kegg.compound: C06156</p> | |
| 8018 <p>KNApSAcK: C00019579</p> | |
| 8019 <p>CAS: 2152-75-2</p> | |
| 8020 <p>PubChem: 8412</p> | |
| 8021 <p>3DMET: B01976</p> | |
| 8022 <p>PDB-CCD: GP1 L1L</p> | |
| 8023 <p>ChEBI: 27625</p> | |
| 8024 <p>NIKKAJI: J1.531.908I</p> | |
| 8025 <p>formula: C6H14NO8P</p> | |
| 8026 <p>weight: 259.151</p> | |
| 8027 </body> | |
| 8028 </notes> | |
| 8029 <annotation> | |
| 8030 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8031 <rdf:Description rdf:about="#_92d31e70-e7f7-4b3f-b670-489f69c25e47"> | |
| 8032 <bqbiol:is> | |
| 8033 <rdf:Bag> | |
| 8034 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C06156"/> | |
| 8035 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019579"/> | |
| 8036 <rdf:li rdf:resource="https://identifiers.org/CAS/2152-75-2"/> | |
| 8037 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01976"/> | |
| 8038 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/GP1 L1L"/> | |
| 8039 <rdf:li rdf:resource="https://identifiers.org/ChEBI/27625"/> | |
| 8040 </rdf:Bag> | |
| 8041 </bqbiol:is> | |
| 8042 </rdf:Description> | |
| 8043 </rdf:RDF> | |
| 8044 </annotation> | |
| 8045 </species> | |
| 8046 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H11N3O" hasOnlySubstanceUnits="false" id="C00860" metaid="_6058937e-9862-46e2-aa88-503923189863" name="L-Histidinol" sboTerm="SBO:0000240"> | |
| 8047 <notes> | |
| 8048 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8049 <p>kegg.compound: C00860</p> | |
| 8050 <p>KNApSAcK: C00007479</p> | |
| 8051 <p>CAS: 4836-52-6</p> | |
| 8052 <p>PubChem: 4117</p> | |
| 8053 <p>3DMET: B01345</p> | |
| 8054 <p>PDB-CCD: HSO</p> | |
| 8055 <p>ChEBI: 16255</p> | |
| 8056 <p>NIKKAJI: J80.912H</p> | |
| 8057 <p>formula: C6H11N3O</p> | |
| 8058 <p>weight: 141.171</p> | |
| 8059 </body> | |
| 8060 </notes> | |
| 8061 <annotation> | |
| 8062 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8063 <rdf:Description rdf:about="#_6058937e-9862-46e2-aa88-503923189863"> | |
| 8064 <bqbiol:is> | |
| 8065 <rdf:Bag> | |
| 8066 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00860"/> | |
| 8067 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007479"/> | |
| 8068 <rdf:li rdf:resource="https://identifiers.org/CAS/4836-52-6"/> | |
| 8069 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01345"/> | |
| 8070 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/HSO"/> | |
| 8071 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16255"/> | |
| 8072 </rdf:Bag> | |
| 8073 </bqbiol:is> | |
| 8074 </rdf:Description> | |
| 8075 </rdf:RDF> | |
| 8076 </annotation> | |
| 8077 </species> | |
| 8078 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C42H44FeN4O16" hasOnlySubstanceUnits="false" id="C00748" metaid="d2562483-5815-49a4-b431-7fdc6e83ba6f" name="Siroheme" sboTerm="SBO:0000240"> | |
| 8079 <notes> | |
| 8080 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8081 <p>kegg.compound: C00748</p> | |
| 8082 <p>PubChem: 4010</p> | |
| 8083 <p>3DMET: B01324</p> | |
| 8084 <p>ChEBI: 28599</p> | |
| 8085 <p>formula: C42H44FeN4O16</p> | |
| 8086 <p>weight: 916.661</p> | |
| 8087 </body> | |
| 8088 </notes> | |
| 8089 <annotation> | |
| 8090 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8091 <rdf:Description rdf:about="#d2562483-5815-49a4-b431-7fdc6e83ba6f"> | |
| 8092 <bqbiol:is> | |
| 8093 <rdf:Bag> | |
| 8094 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00748"/> | |
| 8095 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01324"/> | |
| 8096 <rdf:li rdf:resource="https://identifiers.org/ChEBI/28599"/> | |
| 8097 </rdf:Bag> | |
| 8098 </bqbiol:is> | |
| 8099 </rdf:Description> | |
| 8100 </rdf:RDF> | |
| 8101 </annotation> | |
| 8102 </species> | |
| 8103 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H13N5O3" hasOnlySubstanceUnits="false" id="C05198" metaid="bcbd9c3c-680f-40d3-9203-934243ed8b89" name="5'-Deoxyadenosine" sboTerm="SBO:0000240"> | |
| 8104 <notes> | |
| 8105 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8106 <p>kegg.compound: C05198</p> | |
| 8107 <p>CAS: 4754-39-6</p> | |
| 8108 <p>PubChem: 7603</p> | |
| 8109 <p>PDB-CCD: 5AD</p> | |
| 8110 <p>ChEBI: 17319</p> | |
| 8111 <p>NIKKAJI: J103.510J</p> | |
| 8112 <p>formula: C10H13N5O3</p> | |
| 8113 <p>weight: 251.2419</p> | |
| 8114 </body> | |
| 8115 </notes> | |
| 8116 <annotation> | |
| 8117 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8118 <rdf:Description rdf:about="#bcbd9c3c-680f-40d3-9203-934243ed8b89"> | |
| 8119 <bqbiol:is> | |
| 8120 <rdf:Bag> | |
| 8121 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05198"/> | |
| 8122 <rdf:li rdf:resource="https://identifiers.org/CAS/4754-39-6"/> | |
| 8123 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/5AD"/> | |
| 8124 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17319"/> | |
| 8125 </rdf:Bag> | |
| 8126 </bqbiol:is> | |
| 8127 </rdf:Description> | |
| 8128 </rdf:RDF> | |
| 8129 </annotation> | |
| 8130 </species> | |
| 8131 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C19H19N7O6" hasOnlySubstanceUnits="false" id="C00504" metaid="ee9bfb2d-82fe-4626-89ff-f7fcd2be5a7c" name="Folate" sboTerm="SBO:0000240"> | |
| 8132 <notes> | |
| 8133 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8134 <p>kegg.compound: C00504</p> | |
| 8135 <p>KNApSAcK: C00001539</p> | |
| 8136 <p>CAS: 59-30-3</p> | |
| 8137 <p>PubChem: 3787</p> | |
| 8138 <p>3DMET: B01273</p> | |
| 8139 <p>PDB-CCD: FOL</p> | |
| 8140 <p>ChEBI: 27470</p> | |
| 8141 <p>NIKKAJI: J1.392G</p> | |
| 8142 <p>formula: C19H19N7O6</p> | |
| 8143 <p>weight: 441.3975</p> | |
| 8144 </body> | |
| 8145 </notes> | |
| 8146 <annotation> | |
| 8147 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8148 <rdf:Description rdf:about="#ee9bfb2d-82fe-4626-89ff-f7fcd2be5a7c"> | |
| 8149 <bqbiol:is> | |
| 8150 <rdf:Bag> | |
| 8151 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00504"/> | |
| 8152 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001539"/> | |
| 8153 <rdf:li rdf:resource="https://identifiers.org/CAS/59-30-3"/> | |
| 8154 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01273"/> | |
| 8155 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/FOL"/> | |
| 8156 <rdf:li rdf:resource="https://identifiers.org/ChEBI/27470"/> | |
| 8157 </rdf:Bag> | |
| 8158 </bqbiol:is> | |
| 8159 </rdf:Description> | |
| 8160 </rdf:RDF> | |
| 8161 </annotation> | |
| 8162 </species> | |
| 8163 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H11NO5" hasOnlySubstanceUnits="false" id="C00624" metaid="_632bd07e-40b7-463b-98eb-4cb846083f51" name="N-Acetyl-L-glutamate" sboTerm="SBO:0000240"> | |
| 8164 <notes> | |
| 8165 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8166 <p>kegg.compound: C00624</p> | |
| 8167 <p>CAS: 1188-37-0</p> | |
| 8168 <p>PubChem: 3897</p> | |
| 8169 <p>3DMET: B00147</p> | |
| 8170 <p>PDB-CCD: NLG</p> | |
| 8171 <p>ChEBI: 172431 17533 44337</p> | |
| 8172 <p>NIKKAJI: J37.497K</p> | |
| 8173 <p>formula: C7H11NO5</p> | |
| 8174 <p>weight: 189.1659</p> | |
| 8175 </body> | |
| 8176 </notes> | |
| 8177 <annotation> | |
| 8178 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8179 <rdf:Description rdf:about="#_632bd07e-40b7-463b-98eb-4cb846083f51"> | |
| 8180 <bqbiol:is> | |
| 8181 <rdf:Bag> | |
| 8182 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00624"/> | |
| 8183 <rdf:li rdf:resource="https://identifiers.org/CAS/1188-37-0"/> | |
| 8184 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00147"/> | |
| 8185 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/NLG"/> | |
| 8186 <rdf:li rdf:resource="https://identifiers.org/ChEBI/172431 17533 44337"/> | |
| 8187 </rdf:Bag> | |
| 8188 </bqbiol:is> | |
| 8189 </rdf:Description> | |
| 8190 </rdf:RDF> | |
| 8191 </annotation> | |
| 8192 </species> | |
| 8193 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H17NO5" hasOnlySubstanceUnits="false" id="C00864" metaid="a494698d-8e68-404e-9a50-2ee428357462" name="Pantothenate" sboTerm="SBO:0000240"> | |
| 8194 <notes> | |
| 8195 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8196 <p>kegg.compound: C00864</p> | |
| 8197 <p>KNApSAcK: C00001550</p> | |
| 8198 <p>CAS: 79-83-4</p> | |
| 8199 <p>PubChem: 4121</p> | |
| 8200 <p>3DMET: B00193</p> | |
| 8201 <p>PDB-CCD: PAU</p> | |
| 8202 <p>ChEBI: 46905 7916</p> | |
| 8203 <p>NIKKAJI: J4.242K</p> | |
| 8204 <p>formula: C9H17NO5</p> | |
| 8205 <p>weight: 219.235</p> | |
| 8206 </body> | |
| 8207 </notes> | |
| 8208 <annotation> | |
| 8209 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8210 <rdf:Description rdf:about="#a494698d-8e68-404e-9a50-2ee428357462"> | |
| 8211 <bqbiol:is> | |
| 8212 <rdf:Bag> | |
| 8213 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00864"/> | |
| 8214 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001550"/> | |
| 8215 <rdf:li rdf:resource="https://identifiers.org/CAS/79-83-4"/> | |
| 8216 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00193"/> | |
| 8217 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/PAU"/> | |
| 8218 <rdf:li rdf:resource="https://identifiers.org/ChEBI/46905 7916"/> | |
| 8219 </rdf:Bag> | |
| 8220 </bqbiol:is> | |
| 8221 </rdf:Description> | |
| 8222 </rdf:RDF> | |
| 8223 </annotation> | |
| 8224 </species> | |
| 8225 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H11O8P" hasOnlySubstanceUnits="false" id="C00620" metaid="cb698cef-68af-4917-b8db-4e4354a6a211" name="alpha-D-Ribose 1-phosphate" sboTerm="SBO:0000240"> | |
| 8226 <notes> | |
| 8227 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8228 <p>kegg.compound: C00620</p> | |
| 8229 <p>PubChem: 3894</p> | |
| 8230 <p>3DMET: B04706</p> | |
| 8231 <p>PDB-CCD: R1P</p> | |
| 8232 <p>ChEBI: 16300</p> | |
| 8233 <p>NIKKAJI: J292.493E</p> | |
| 8234 <p>formula: C5H11O8P</p> | |
| 8235 <p>weight: 230.1098</p> | |
| 8236 </body> | |
| 8237 </notes> | |
| 8238 <annotation> | |
| 8239 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8240 <rdf:Description rdf:about="#cb698cef-68af-4917-b8db-4e4354a6a211"> | |
| 8241 <bqbiol:is> | |
| 8242 <rdf:Bag> | |
| 8243 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00620"/> | |
| 8244 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04706"/> | |
| 8245 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/R1P"/> | |
| 8246 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16300"/> | |
| 8247 </rdf:Bag> | |
| 8248 </bqbiol:is> | |
| 8249 </rdf:Description> | |
| 8250 </rdf:RDF> | |
| 8251 </annotation> | |
| 8252 </species> | |
| 8253 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H7O8P" hasOnlySubstanceUnits="false" id="C06054" metaid="_77f3aa5f-53af-4b8a-8e5a-bd20e0a4340b" name="2-Oxo-3-hydroxy-4-phosphobutanoate" sboTerm="SBO:0000240"> | |
| 8254 <notes> | |
| 8255 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8256 <p>kegg.compound: C06054</p> | |
| 8257 <p>PubChem: 8324</p> | |
| 8258 <p>3DMET: B01959</p> | |
| 8259 <p>ChEBI: 27951</p> | |
| 8260 <p>NIKKAJI: J2.761.015C</p> | |
| 8261 <p>formula: C4H7O8P</p> | |
| 8262 <p>weight: 214.0673</p> | |
| 8263 </body> | |
| 8264 </notes> | |
| 8265 <annotation> | |
| 8266 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8267 <rdf:Description rdf:about="#_77f3aa5f-53af-4b8a-8e5a-bd20e0a4340b"> | |
| 8268 <bqbiol:is> | |
| 8269 <rdf:Bag> | |
| 8270 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C06054"/> | |
| 8271 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01959"/> | |
| 8272 <rdf:li rdf:resource="https://identifiers.org/ChEBI/27951"/> | |
| 8273 </rdf:Bag> | |
| 8274 </bqbiol:is> | |
| 8275 </rdf:Description> | |
| 8276 </rdf:RDF> | |
| 8277 </annotation> | |
| 8278 </species> | |
| 8279 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H10NO7P" hasOnlySubstanceUnits="false" id="C06055" metaid="_0ff3d2b7-67fc-46cd-bf85-cbb13c5be48c" name="O-Phospho-4-hydroxy-L-threonine" sboTerm="SBO:0000240"> | |
| 8280 <notes> | |
| 8281 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8282 <p>kegg.compound: C06055</p> | |
| 8283 <p>PubChem: 8325</p> | |
| 8284 <p>3DMET: B01960</p> | |
| 8285 <p>PDB-CCD: 4TP</p> | |
| 8286 <p>ChEBI: 18336</p> | |
| 8287 <p>NIKKAJI: J695.803F</p> | |
| 8288 <p>formula: C4H10NO7P</p> | |
| 8289 <p>weight: 215.0985</p> | |
| 8290 </body> | |
| 8291 </notes> | |
| 8292 <annotation> | |
| 8293 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8294 <rdf:Description rdf:about="#_0ff3d2b7-67fc-46cd-bf85-cbb13c5be48c"> | |
| 8295 <bqbiol:is> | |
| 8296 <rdf:Bag> | |
| 8297 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C06055"/> | |
| 8298 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01960"/> | |
| 8299 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/4TP"/> | |
| 8300 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18336"/> | |
| 8301 </rdf:Bag> | |
| 8302 </bqbiol:is> | |
| 8303 </rdf:Description> | |
| 8304 </rdf:RDF> | |
| 8305 </annotation> | |
| 8306 </species> | |
| 8307 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H9NO4" hasOnlySubstanceUnits="false" id="C06056" metaid="_2748d0b9-3a9f-498b-8437-e31ffa671dd3" name="4-Hydroxy-L-threonine" sboTerm="SBO:0000240"> | |
| 8308 <notes> | |
| 8309 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8310 <p>kegg.compound: C06056</p> | |
| 8311 <p>CAS: 21768-45-6</p> | |
| 8312 <p>PubChem: 8326</p> | |
| 8313 <p>3DMET: B01961</p> | |
| 8314 <p>PDB-CCD: TH6</p> | |
| 8315 <p>ChEBI: 28330</p> | |
| 8316 <p>NIKKAJI: J694.566J</p> | |
| 8317 <p>formula: C4H9NO4</p> | |
| 8318 <p>weight: 135.1186</p> | |
| 8319 </body> | |
| 8320 </notes> | |
| 8321 <annotation> | |
| 8322 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8323 <rdf:Description rdf:about="#_2748d0b9-3a9f-498b-8437-e31ffa671dd3"> | |
| 8324 <bqbiol:is> | |
| 8325 <rdf:Bag> | |
| 8326 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C06056"/> | |
| 8327 <rdf:li rdf:resource="https://identifiers.org/CAS/21768-45-6"/> | |
| 8328 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01961"/> | |
| 8329 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/TH6"/> | |
| 8330 <rdf:li rdf:resource="https://identifiers.org/ChEBI/28330"/> | |
| 8331 </rdf:Bag> | |
| 8332 </bqbiol:is> | |
| 8333 </rdf:Description> | |
| 8334 </rdf:RDF> | |
| 8335 </annotation> | |
| 8336 </species> | |
| 8337 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H7O7P" hasOnlySubstanceUnits="false" id="C00631" metaid="_0d1a0c5f-4301-4001-a039-82b41ed49fcf" name="2-Phospho-D-glycerate" sboTerm="SBO:0000240"> | |
| 8338 <notes> | |
| 8339 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8340 <p>kegg.compound: C00631</p> | |
| 8341 <p>KNApSAcK: C00000123</p> | |
| 8342 <p>PubChem: 3904</p> | |
| 8343 <p>3DMET: B01295</p> | |
| 8344 <p>PDB-CCD: 2PG</p> | |
| 8345 <p>ChEBI: 17835</p> | |
| 8346 <p>NIKKAJI: J71.811D</p> | |
| 8347 <p>formula: C3H7O7P</p> | |
| 8348 <p>weight: 186.0572</p> | |
| 8349 </body> | |
| 8350 </notes> | |
| 8351 <annotation> | |
| 8352 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8353 <rdf:Description rdf:about="#_0d1a0c5f-4301-4001-a039-82b41ed49fcf"> | |
| 8354 <bqbiol:is> | |
| 8355 <rdf:Bag> | |
| 8356 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00631"/> | |
| 8357 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00000123"/> | |
| 8358 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01295"/> | |
| 8359 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/2PG"/> | |
| 8360 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17835"/> | |
| 8361 </rdf:Bag> | |
| 8362 </bqbiol:is> | |
| 8363 </rdf:Description> | |
| 8364 </rdf:RDF> | |
| 8365 </annotation> | |
| 8366 </species> | |
| 8367 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12N2O3" hasOnlySubstanceUnits="false" id="C00993" metaid="acfa7c4c-f055-4a40-ac60-8ba6a99620c8" name="D-Alanyl-D-alanine" sboTerm="SBO:0000240"> | |
| 8368 <notes> | |
| 8369 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8370 <p>kegg.compound: C00993</p> | |
| 8371 <p>KNApSAcK: C00019576</p> | |
| 8372 <p>CAS: 923-16-0</p> | |
| 8373 <p>PubChem: 4239</p> | |
| 8374 <p>3DMET: B01365</p> | |
| 8375 <p>ChEBI: 16576</p> | |
| 8376 <p>NIKKAJI: J80.011B</p> | |
| 8377 <p>formula: C6H12N2O3</p> | |
| 8378 <p>weight: 160.1711</p> | |
| 8379 </body> | |
| 8380 </notes> | |
| 8381 <annotation> | |
| 8382 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8383 <rdf:Description rdf:about="#acfa7c4c-f055-4a40-ac60-8ba6a99620c8"> | |
| 8384 <bqbiol:is> | |
| 8385 <rdf:Bag> | |
| 8386 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00993"/> | |
| 8387 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019576"/> | |
| 8388 <rdf:li rdf:resource="https://identifiers.org/CAS/923-16-0"/> | |
| 8389 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01365"/> | |
| 8390 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16576"/> | |
| 8391 </rdf:Bag> | |
| 8392 </bqbiol:is> | |
| 8393 </rdf:Description> | |
| 8394 </rdf:RDF> | |
| 8395 </annotation> | |
| 8396 </species> | |
| 8397 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C21H35N7O13P2S" hasOnlySubstanceUnits="false" id="C00882" metaid="_1e253f5b-448c-4352-bc3e-71a453072e34" name="Dephospho-CoA" sboTerm="SBO:0000240"> | |
| 8398 <notes> | |
| 8399 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8400 <p>kegg.compound: C00882</p> | |
| 8401 <p>KNApSAcK: C00007257</p> | |
| 8402 <p>CAS: 3633-59-8</p> | |
| 8403 <p>PubChem: 4138</p> | |
| 8404 <p>3DMET: B04743</p> | |
| 8405 <p>PDB-CCD: COD</p> | |
| 8406 <p>ChEBI: 15468</p> | |
| 8407 <p>LIPIDMAPS: LMFA07050315</p> | |
| 8408 <p>formula: C21H35N7O13P2S</p> | |
| 8409 <p>weight: 687.5542</p> | |
| 8410 </body> | |
| 8411 </notes> | |
| 8412 <annotation> | |
| 8413 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8414 <rdf:Description rdf:about="#_1e253f5b-448c-4352-bc3e-71a453072e34"> | |
| 8415 <bqbiol:is> | |
| 8416 <rdf:Bag> | |
| 8417 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00882"/> | |
| 8418 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007257"/> | |
| 8419 <rdf:li rdf:resource="https://identifiers.org/CAS/3633-59-8"/> | |
| 8420 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04743"/> | |
| 8421 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/COD"/> | |
| 8422 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15468"/> | |
| 8423 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA07050315"/> | |
| 8424 </rdf:Bag> | |
| 8425 </bqbiol:is> | |
| 8426 </rdf:Description> | |
| 8427 </rdf:RDF> | |
| 8428 </annotation> | |
| 8429 </species> | |
| 8430 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H7O3SR" hasOnlySubstanceUnits="false" id="C20374" metaid="eeba4141-a7c6-40ad-89bd-e384dbe74831" name="Enoylglutaryl-[acp] methyl ester" sboTerm="SBO:0000240"> | |
| 8431 <notes> | |
| 8432 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8433 <p>kegg.compound: C20374</p> | |
| 8434 <p>PubChem: 163312112</p> | |
| 8435 <p>formula: C6H7O3SR</p> | |
| 8436 </body> | |
| 8437 </notes> | |
| 8438 <annotation> | |
| 8439 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8440 <rdf:Description rdf:about="#eeba4141-a7c6-40ad-89bd-e384dbe74831"> | |
| 8441 <bqbiol:is> | |
| 8442 <rdf:Bag> | |
| 8443 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C20374"/> | |
| 8444 </rdf:Bag> | |
| 8445 </bqbiol:is> | |
| 8446 </rdf:Description> | |
| 8447 </rdf:RDF> | |
| 8448 </annotation> | |
| 8449 </species> | |
| 8450 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C02702" metaid="_224bd24b-9cfe-4698-8662-2a70867b72d9" name="L-Prolyl-tRNA(Pro)" sboTerm="SBO:0000240"> | |
| 8451 <notes> | |
| 8452 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8453 <p>kegg.compound: C02702</p> | |
| 8454 <p>PubChem: 5665</p> | |
| 8455 <p>ChEBI: 29154</p> | |
| 8456 <p>formula: C15H24NO11PR2(C5H8O6PR)n</p> | |
| 8457 </body> | |
| 8458 </notes> | |
| 8459 <annotation> | |
| 8460 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8461 <rdf:Description rdf:about="#_224bd24b-9cfe-4698-8662-2a70867b72d9"> | |
| 8462 <bqbiol:is> | |
| 8463 <rdf:Bag> | |
| 8464 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02702"/> | |
| 8465 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29154"/> | |
| 8466 </rdf:Bag> | |
| 8467 </bqbiol:is> | |
| 8468 </rdf:Description> | |
| 8469 </rdf:RDF> | |
| 8470 </annotation> | |
| 8471 </species> | |
| 8472 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H9O4SR" hasOnlySubstanceUnits="false" id="C20373" metaid="_2431f621-4822-49d1-9008-9da36bbc6aeb" name="3-Hydroxyglutaryl-[acp] methyl ester" sboTerm="SBO:0000240"> | |
| 8473 <notes> | |
| 8474 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8475 <p>kegg.compound: C20373</p> | |
| 8476 <p>PubChem: 163312111</p> | |
| 8477 <p>formula: C6H9O4SR</p> | |
| 8478 </body> | |
| 8479 </notes> | |
| 8480 <annotation> | |
| 8481 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8482 <rdf:Description rdf:about="#_2431f621-4822-49d1-9008-9da36bbc6aeb"> | |
| 8483 <bqbiol:is> | |
| 8484 <rdf:Bag> | |
| 8485 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C20373"/> | |
| 8486 </rdf:Bag> | |
| 8487 </bqbiol:is> | |
| 8488 </rdf:Description> | |
| 8489 </rdf:RDF> | |
| 8490 </annotation> | |
| 8491 </species> | |
| 8492 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H7O4SR" hasOnlySubstanceUnits="false" id="C20372" metaid="_1333a341-a403-4c3d-8935-0aa0feba192d" name="3-Ketoglutaryl-[acp] methyl ester" sboTerm="SBO:0000240"> | |
| 8493 <notes> | |
| 8494 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8495 <p>kegg.compound: C20372</p> | |
| 8496 <p>PubChem: 163312110</p> | |
| 8497 <p>formula: C6H7O4SR</p> | |
| 8498 </body> | |
| 8499 </notes> | |
| 8500 <annotation> | |
| 8501 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8502 <rdf:Description rdf:about="#_1333a341-a403-4c3d-8935-0aa0feba192d"> | |
| 8503 <bqbiol:is> | |
| 8504 <rdf:Bag> | |
| 8505 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C20372"/> | |
| 8506 </rdf:Bag> | |
| 8507 </bqbiol:is> | |
| 8508 </rdf:Description> | |
| 8509 </rdf:RDF> | |
| 8510 </annotation> | |
| 8511 </species> | |
| 8512 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H16O7" hasOnlySubstanceUnits="false" id="C06186" metaid="d72f8e0d-b614-41d4-a696-269ea95dc7db" name="Arbutin" sboTerm="SBO:0000240"> | |
| 8513 <notes> | |
| 8514 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8515 <p>kegg.compound: C06186</p> | |
| 8516 <p>KNApSAcK: C00002638</p> | |
| 8517 <p>CAS: 497-76-7</p> | |
| 8518 <p>PubChem: 8437</p> | |
| 8519 <p>3DMET: B01987</p> | |
| 8520 <p>PDB-CCD: 7OQ</p> | |
| 8521 <p>ChEBI: 18305</p> | |
| 8522 <p>NIKKAJI: J6.104B</p> | |
| 8523 <p>formula: C12H16O7</p> | |
| 8524 <p>weight: 272.2512</p> | |
| 8525 </body> | |
| 8526 </notes> | |
| 8527 <annotation> | |
| 8528 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8529 <rdf:Description rdf:about="#d72f8e0d-b614-41d4-a696-269ea95dc7db"> | |
| 8530 <bqbiol:is> | |
| 8531 <rdf:Bag> | |
| 8532 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C06186"/> | |
| 8533 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00002638"/> | |
| 8534 <rdf:li rdf:resource="https://identifiers.org/CAS/497-76-7"/> | |
| 8535 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01987"/> | |
| 8536 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/7OQ"/> | |
| 8537 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18305"/> | |
| 8538 </rdf:Bag> | |
| 8539 </bqbiol:is> | |
| 8540 </rdf:Description> | |
| 8541 </rdf:RDF> | |
| 8542 </annotation> | |
| 8543 </species> | |
| 8544 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H17O10P" hasOnlySubstanceUnits="false" id="C06187" metaid="fa7415c8-d995-4fc7-95f6-d46236a2b76e" name="Arbutin 6-phosphate" sboTerm="SBO:0000240"> | |
| 8545 <notes> | |
| 8546 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8547 <p>kegg.compound: C06187</p> | |
| 8548 <p>PubChem: 8438</p> | |
| 8549 <p>3DMET: B01988</p> | |
| 8550 <p>ChEBI: 2807</p> | |
| 8551 <p>NIKKAJI: J2.761.841C</p> | |
| 8552 <p>formula: C12H17O10P</p> | |
| 8553 <p>weight: 352.2311</p> | |
| 8554 </body> | |
| 8555 </notes> | |
| 8556 <annotation> | |
| 8557 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8558 <rdf:Description rdf:about="#fa7415c8-d995-4fc7-95f6-d46236a2b76e"> | |
| 8559 <bqbiol:is> | |
| 8560 <rdf:Bag> | |
| 8561 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C06187"/> | |
| 8562 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01988"/> | |
| 8563 <rdf:li rdf:resource="https://identifiers.org/ChEBI/2807"/> | |
| 8564 </rdf:Bag> | |
| 8565 </bqbiol:is> | |
| 8566 </rdf:Description> | |
| 8567 </rdf:RDF> | |
| 8568 </annotation> | |
| 8569 </species> | |
| 8570 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C24H30N8O9" hasOnlySubstanceUnits="false" id="C09332" metaid="_5d08dc33-7cc2-4537-b4ec-ccdc139532aa" name="THF-L-glutamate" sboTerm="SBO:0000240"> | |
| 8571 <notes> | |
| 8572 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8573 <p>kegg.compound: C09332</p> | |
| 8574 <p>PubChem: 11523</p> | |
| 8575 <p>3DMET: B05350</p> | |
| 8576 <p>ChEBI: 27650</p> | |
| 8577 <p>NIKKAJI: J2.769.210I</p> | |
| 8578 <p>formula: C24H30N8O9</p> | |
| 8579 <p>weight: 574.5432</p> | |
| 8580 </body> | |
| 8581 </notes> | |
| 8582 <annotation> | |
| 8583 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8584 <rdf:Description rdf:about="#_5d08dc33-7cc2-4537-b4ec-ccdc139532aa"> | |
| 8585 <bqbiol:is> | |
| 8586 <rdf:Bag> | |
| 8587 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C09332"/> | |
| 8588 <rdf:li rdf:resource="https://identifiers.org/3DMET/B05350"/> | |
| 8589 <rdf:li rdf:resource="https://identifiers.org/ChEBI/27650"/> | |
| 8590 </rdf:Bag> | |
| 8591 </bqbiol:is> | |
| 8592 </rdf:Description> | |
| 8593 </rdf:RDF> | |
| 8594 </annotation> | |
| 8595 </species> | |
| 8596 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H13NO2" hasOnlySubstanceUnits="false" id="C00407" metaid="e5cff1a9-ff23-45e4-88d4-24f3481d83eb" name="L-Isoleucine" sboTerm="SBO:0000240"> | |
| 8597 <notes> | |
| 8598 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8599 <p>kegg.compound: C00407</p> | |
| 8600 <p>KNApSAcK: C00001374</p> | |
| 8601 <p>CAS: 73-32-5</p> | |
| 8602 <p>PubChem: 3697</p> | |
| 8603 <p>3DMET: B01236</p> | |
| 8604 <p>PDB-CCD: ILE</p> | |
| 8605 <p>ChEBI: 17191</p> | |
| 8606 <p>LIPIDMAPS: LMFA01100047</p> | |
| 8607 <p>NIKKAJI: J2.818E</p> | |
| 8608 <p>formula: C6H13NO2</p> | |
| 8609 <p>weight: 131.1729</p> | |
| 8610 </body> | |
| 8611 </notes> | |
| 8612 <annotation> | |
| 8613 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8614 <rdf:Description rdf:about="#e5cff1a9-ff23-45e4-88d4-24f3481d83eb"> | |
| 8615 <bqbiol:is> | |
| 8616 <rdf:Bag> | |
| 8617 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00407"/> | |
| 8618 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001374"/> | |
| 8619 <rdf:li rdf:resource="https://identifiers.org/CAS/73-32-5"/> | |
| 8620 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01236"/> | |
| 8621 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/ILE"/> | |
| 8622 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17191"/> | |
| 8623 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA01100047"/> | |
| 8624 </rdf:Bag> | |
| 8625 </bqbiol:is> | |
| 8626 </rdf:Description> | |
| 8627 </rdf:RDF> | |
| 8628 </annotation> | |
| 8629 </species> | |
| 8630 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C8H11O3SR" hasOnlySubstanceUnits="false" id="C20378" metaid="af49e2e2-1360-4056-a8d3-80e742838296" name="Enoylpimeloyl-[acp] methyl ester" sboTerm="SBO:0000240"> | |
| 8631 <notes> | |
| 8632 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8633 <p>kegg.compound: C20378</p> | |
| 8634 <p>PubChem: 163312116</p> | |
| 8635 <p>formula: C8H11O3SR</p> | |
| 8636 </body> | |
| 8637 </notes> | |
| 8638 <annotation> | |
| 8639 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8640 <rdf:Description rdf:about="#af49e2e2-1360-4056-a8d3-80e742838296"> | |
| 8641 <bqbiol:is> | |
| 8642 <rdf:Bag> | |
| 8643 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C20378"/> | |
| 8644 </rdf:Bag> | |
| 8645 </bqbiol:is> | |
| 8646 </rdf:Description> | |
| 8647 </rdf:RDF> | |
| 8648 </annotation> | |
| 8649 </species> | |
| 8650 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C26H42N7O19P3S" hasOnlySubstanceUnits="false" id="C00527" metaid="_921cb8f5-aa14-46f7-bb35-07a8df9bb23e" name="Glutaryl-CoA" sboTerm="SBO:0000240"> | |
| 8651 <notes> | |
| 8652 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8653 <p>kegg.compound: C00527</p> | |
| 8654 <p>CAS: 3131-84-8</p> | |
| 8655 <p>PubChem: 3810</p> | |
| 8656 <p>3DMET: B04695</p> | |
| 8657 <p>PDB-CCD: GRA</p> | |
| 8658 <p>ChEBI: 15524</p> | |
| 8659 <p>LIPIDMAPS: LMFA07050324</p> | |
| 8660 <p>NIKKAJI: J1.748.735C</p> | |
| 8661 <p>formula: C26H42N7O19P3S</p> | |
| 8662 <p>weight: 881.6335</p> | |
| 8663 </body> | |
| 8664 </notes> | |
| 8665 <annotation> | |
| 8666 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8667 <rdf:Description rdf:about="#_921cb8f5-aa14-46f7-bb35-07a8df9bb23e"> | |
| 8668 <bqbiol:is> | |
| 8669 <rdf:Bag> | |
| 8670 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00527"/> | |
| 8671 <rdf:li rdf:resource="https://identifiers.org/CAS/3131-84-8"/> | |
| 8672 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04695"/> | |
| 8673 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/GRA"/> | |
| 8674 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15524"/> | |
| 8675 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA07050324"/> | |
| 8676 </rdf:Bag> | |
| 8677 </bqbiol:is> | |
| 8678 </rdf:Description> | |
| 8679 </rdf:RDF> | |
| 8680 </annotation> | |
| 8681 </species> | |
| 8682 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C8H13O4SR" hasOnlySubstanceUnits="false" id="C20377" metaid="f75d3ec4-b1f5-4bc2-8481-dfb322318626" name="3-Hydroxypimeloyl-[acp] methyl ester" sboTerm="SBO:0000240"> | |
| 8683 <notes> | |
| 8684 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8685 <p>kegg.compound: C20377</p> | |
| 8686 <p>PubChem: 163312115</p> | |
| 8687 <p>formula: C8H13O4SR</p> | |
| 8688 </body> | |
| 8689 </notes> | |
| 8690 <annotation> | |
| 8691 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8692 <rdf:Description rdf:about="#f75d3ec4-b1f5-4bc2-8481-dfb322318626"> | |
| 8693 <bqbiol:is> | |
| 8694 <rdf:Bag> | |
| 8695 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C20377"/> | |
| 8696 </rdf:Bag> | |
| 8697 </bqbiol:is> | |
| 8698 </rdf:Description> | |
| 8699 </rdf:RDF> | |
| 8700 </annotation> | |
| 8701 </species> | |
| 8702 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C8H11O4SR" hasOnlySubstanceUnits="false" id="C20376" metaid="a7c2b321-9233-4ce3-844c-34fec19ab7b3" name="3-Ketopimeloyl-[acp] methyl ester" sboTerm="SBO:0000240"> | |
| 8703 <notes> | |
| 8704 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8705 <p>kegg.compound: C20376</p> | |
| 8706 <p>PubChem: 163312114</p> | |
| 8707 <p>formula: C8H11O4SR</p> | |
| 8708 </body> | |
| 8709 </notes> | |
| 8710 <annotation> | |
| 8711 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8712 <rdf:Description rdf:about="#a7c2b321-9233-4ce3-844c-34fec19ab7b3"> | |
| 8713 <bqbiol:is> | |
| 8714 <rdf:Bag> | |
| 8715 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C20376"/> | |
| 8716 </rdf:Bag> | |
| 8717 </bqbiol:is> | |
| 8718 </rdf:Description> | |
| 8719 </rdf:RDF> | |
| 8720 </annotation> | |
| 8721 </species> | |
| 8722 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H6O5" hasOnlySubstanceUnits="false" id="C22438" metaid="d3028683-bb08-49e6-a9f4-440badd169fb" name="3,5-Dehydroshikimate" sboTerm="SBO:0000240"> | |
| 8723 <notes> | |
| 8724 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8725 <p>kegg.compound: C22438</p> | |
| 8726 <p>formula: C7H6O5</p> | |
| 8727 <p>weight: 170.1195</p> | |
| 8728 </body> | |
| 8729 </notes> | |
| 8730 <annotation> | |
| 8731 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8732 <rdf:Description rdf:about="#d3028683-bb08-49e6-a9f4-440badd169fb"> | |
| 8733 <bqbiol:is> | |
| 8734 <rdf:Bag> | |
| 8735 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C22438"/> | |
| 8736 </rdf:Bag> | |
| 8737 </bqbiol:is> | |
| 8738 </rdf:Description> | |
| 8739 </rdf:RDF> | |
| 8740 </annotation> | |
| 8741 </species> | |
| 8742 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C13H19O10P" hasOnlySubstanceUnits="false" id="C06188" metaid="_6d3d7a41-6b86-4bef-811b-d93542562791" name="Salicin 6-phosphate" sboTerm="SBO:0000240"> | |
| 8743 <notes> | |
| 8744 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8745 <p>kegg.compound: C06188</p> | |
| 8746 <p>PubChem: 8439</p> | |
| 8747 <p>3DMET: B01989</p> | |
| 8748 <p>PDB-CCD: P53</p> | |
| 8749 <p>ChEBI: 9003</p> | |
| 8750 <p>NIKKAJI: J2.761.856A</p> | |
| 8751 <p>formula: C13H19O10P</p> | |
| 8752 <p>weight: 366.2577</p> | |
| 8753 </body> | |
| 8754 </notes> | |
| 8755 <annotation> | |
| 8756 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8757 <rdf:Description rdf:about="#_6d3d7a41-6b86-4bef-811b-d93542562791"> | |
| 8758 <bqbiol:is> | |
| 8759 <rdf:Bag> | |
| 8760 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C06188"/> | |
| 8761 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01989"/> | |
| 8762 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/P53"/> | |
| 8763 <rdf:li rdf:resource="https://identifiers.org/ChEBI/9003"/> | |
| 8764 </rdf:Bag> | |
| 8765 </bqbiol:is> | |
| 8766 </rdf:Description> | |
| 8767 </rdf:RDF> | |
| 8768 </annotation> | |
| 8769 </species> | |
| 8770 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H9O3SR" hasOnlySubstanceUnits="false" id="C20375" metaid="_31c0d32c-9f53-401e-aa3d-27acbca592f0" name="Glutaryl-[acp] methyl ester" sboTerm="SBO:0000240"> | |
| 8771 <notes> | |
| 8772 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8773 <p>kegg.compound: C20375</p> | |
| 8774 <p>PubChem: 163312113</p> | |
| 8775 <p>formula: C6H9O3SR</p> | |
| 8776 </body> | |
| 8777 </notes> | |
| 8778 <annotation> | |
| 8779 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8780 <rdf:Description rdf:about="#_31c0d32c-9f53-401e-aa3d-27acbca592f0"> | |
| 8781 <bqbiol:is> | |
| 8782 <rdf:Bag> | |
| 8783 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C20375"/> | |
| 8784 </rdf:Bag> | |
| 8785 </bqbiol:is> | |
| 8786 </rdf:Description> | |
| 8787 </rdf:RDF> | |
| 8788 </annotation> | |
| 8789 </species> | |
| 8790 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H15O9P" hasOnlySubstanceUnits="false" id="C00644" metaid="_7cfbae22-a308-4081-8754-5c7cc6b8b06a" name="D-Mannitol 1-phosphate" sboTerm="SBO:0000240"> | |
| 8791 <notes> | |
| 8792 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8793 <p>kegg.compound: C00644</p> | |
| 8794 <p>KNApSAcK: C00019638</p> | |
| 8795 <p>CAS: 15806-48-1</p> | |
| 8796 <p>PubChem: 3917</p> | |
| 8797 <p>3DMET: B04709</p> | |
| 8798 <p>PDB-CCD: 44H</p> | |
| 8799 <p>ChEBI: 16298</p> | |
| 8800 <p>NIKKAJI: J923.291E</p> | |
| 8801 <p>formula: C6H15O9P</p> | |
| 8802 <p>weight: 262.1517</p> | |
| 8803 </body> | |
| 8804 </notes> | |
| 8805 <annotation> | |
| 8806 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8807 <rdf:Description rdf:about="#_7cfbae22-a308-4081-8754-5c7cc6b8b06a"> | |
| 8808 <bqbiol:is> | |
| 8809 <rdf:Bag> | |
| 8810 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00644"/> | |
| 8811 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019638"/> | |
| 8812 <rdf:li rdf:resource="https://identifiers.org/CAS/15806-48-1"/> | |
| 8813 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04709"/> | |
| 8814 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/44H"/> | |
| 8815 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16298"/> | |
| 8816 </rdf:Bag> | |
| 8817 </bqbiol:is> | |
| 8818 </rdf:Description> | |
| 8819 </rdf:RDF> | |
| 8820 </annotation> | |
| 8821 </species> | |
| 8822 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C00886" metaid="_895563c7-58b2-4453-a1ff-4c5c4846096d" name="L-Alanyl-tRNA" sboTerm="SBO:0000240"> | |
| 8823 <notes> | |
| 8824 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8825 <p>kegg.compound: C00886</p> | |
| 8826 <p>PubChem: 4142</p> | |
| 8827 <p>ChEBI: 17732</p> | |
| 8828 <p>formula: C13H22NO11PR2(C5H8O6PR)n</p> | |
| 8829 </body> | |
| 8830 </notes> | |
| 8831 <annotation> | |
| 8832 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8833 <rdf:Description rdf:about="#_895563c7-58b2-4453-a1ff-4c5c4846096d"> | |
| 8834 <bqbiol:is> | |
| 8835 <rdf:Bag> | |
| 8836 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00886"/> | |
| 8837 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17732"/> | |
| 8838 </rdf:Bag> | |
| 8839 </bqbiol:is> | |
| 8840 </rdf:Description> | |
| 8841 </rdf:RDF> | |
| 8842 </annotation> | |
| 8843 </species> | |
| 8844 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O4" hasOnlySubstanceUnits="false" id="C00522" metaid="_616fac98-ce53-4957-8655-b92dbe50db5c" name="(R)-Pantoate" sboTerm="SBO:0000240"> | |
| 8845 <notes> | |
| 8846 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8847 <p>kegg.compound: C00522</p> | |
| 8848 <p>KNApSAcK: C00007622</p> | |
| 8849 <p>CAS: 470-29-1</p> | |
| 8850 <p>PubChem: 3805</p> | |
| 8851 <p>3DMET: B00120</p> | |
| 8852 <p>PDB-CCD: PAF</p> | |
| 8853 <p>ChEBI: 14737 15980 18697</p> | |
| 8854 <p>NIKKAJI: J23.325K</p> | |
| 8855 <p>formula: C6H12O4</p> | |
| 8856 <p>weight: 148.1571</p> | |
| 8857 </body> | |
| 8858 </notes> | |
| 8859 <annotation> | |
| 8860 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8861 <rdf:Description rdf:about="#_616fac98-ce53-4957-8655-b92dbe50db5c"> | |
| 8862 <bqbiol:is> | |
| 8863 <rdf:Bag> | |
| 8864 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00522"/> | |
| 8865 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007622"/> | |
| 8866 <rdf:li rdf:resource="https://identifiers.org/CAS/470-29-1"/> | |
| 8867 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00120"/> | |
| 8868 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/PAF"/> | |
| 8869 <rdf:li rdf:resource="https://identifiers.org/ChEBI/14737 15980 18697"/> | |
| 8870 </rdf:Bag> | |
| 8871 </bqbiol:is> | |
| 8872 </rdf:Description> | |
| 8873 </rdf:RDF> | |
| 8874 </annotation> | |
| 8875 </species> | |
| 8876 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H9NO5" hasOnlySubstanceUnits="false" id="C20258" metaid="_56efb439-70bf-43f0-9f42-c0cf70cbef0b" name="(2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate" sboTerm="SBO:0000240"> | |
| 8877 <notes> | |
| 8878 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8879 <p>kegg.compound: C20258</p> | |
| 8880 <p>PubChem: 163311998</p> | |
| 8881 <p>formula: C7H9NO5</p> | |
| 8882 <p>weight: 187.1501</p> | |
| 8883 </body> | |
| 8884 </notes> | |
| 8885 <annotation> | |
| 8886 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8887 <rdf:Description rdf:about="#_56efb439-70bf-43f0-9f42-c0cf70cbef0b"> | |
| 8888 <bqbiol:is> | |
| 8889 <rdf:Bag> | |
| 8890 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C20258"/> | |
| 8891 </rdf:Bag> | |
| 8892 </bqbiol:is> | |
| 8893 </rdf:Description> | |
| 8894 </rdf:RDF> | |
| 8895 </annotation> | |
| 8896 </species> | |
| 8897 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H13N5O3" hasOnlySubstanceUnits="false" id="C02953" metaid="_76792071-7df1-4ac8-b0af-16db103776f8" name="7,8-Dihydrobiopterin" sboTerm="SBO:0000240"> | |
| 8898 <notes> | |
| 8899 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8900 <p>kegg.compound: C02953</p> | |
| 8901 <p>CAS: 6779-87-9</p> | |
| 8902 <p>PubChem: 5871</p> | |
| 8903 <p>PDB-CCD: HBI</p> | |
| 8904 <p>ChEBI: 64277</p> | |
| 8905 <p>NIKKAJI: J959.455H</p> | |
| 8906 <p>formula: C9H13N5O3</p> | |
| 8907 <p>weight: 239.2312</p> | |
| 8908 </body> | |
| 8909 </notes> | |
| 8910 <annotation> | |
| 8911 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8912 <rdf:Description rdf:about="#_76792071-7df1-4ac8-b0af-16db103776f8"> | |
| 8913 <bqbiol:is> | |
| 8914 <rdf:Bag> | |
| 8915 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02953"/> | |
| 8916 <rdf:li rdf:resource="https://identifiers.org/CAS/6779-87-9"/> | |
| 8917 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/HBI"/> | |
| 8918 <rdf:li rdf:resource="https://identifiers.org/ChEBI/64277"/> | |
| 8919 </rdf:Bag> | |
| 8920 </bqbiol:is> | |
| 8921 </rdf:Description> | |
| 8922 </rdf:RDF> | |
| 8923 </annotation> | |
| 8924 </species> | |
| 8925 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C11H19NO8" hasOnlySubstanceUnits="false" id="C02713" metaid="_0fb5c0d6-094a-4e27-bb97-824cfd395a8a" name="N-Acetylmuramate" sboTerm="SBO:0000240"> | |
| 8926 <notes> | |
| 8927 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8928 <p>kegg.compound: C02713</p> | |
| 8929 <p>CAS: 61633-75-8</p> | |
| 8930 <p>PubChem: 5676</p> | |
| 8931 <p>3DMET: B04861</p> | |
| 8932 <p>PDB-CCD: AMU MUB</p> | |
| 8933 <p>ChEBI: 181907 21615 28881</p> | |
| 8934 <p>NIKKAJI: J227.021H</p> | |
| 8935 <p>formula: C11H19NO8</p> | |
| 8936 <p>weight: 293.2705</p> | |
| 8937 </body> | |
| 8938 </notes> | |
| 8939 <annotation> | |
| 8940 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8941 <rdf:Description rdf:about="#_0fb5c0d6-094a-4e27-bb97-824cfd395a8a"> | |
| 8942 <bqbiol:is> | |
| 8943 <rdf:Bag> | |
| 8944 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02713"/> | |
| 8945 <rdf:li rdf:resource="https://identifiers.org/CAS/61633-75-8"/> | |
| 8946 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04861"/> | |
| 8947 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/AMU MUB"/> | |
| 8948 <rdf:li rdf:resource="https://identifiers.org/ChEBI/181907 21615 28881"/> | |
| 8949 </rdf:Bag> | |
| 8950 </bqbiol:is> | |
| 8951 </rdf:Description> | |
| 8952 </rdf:RDF> | |
| 8953 </annotation> | |
| 8954 </species> | |
| 8955 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="Fe" hasOnlySubstanceUnits="false" id="C14818" metaid="_6df88846-5982-4f8d-8e6a-a0235c49890d" name="Fe2+" sboTerm="SBO:0000240"> | |
| 8956 <notes> | |
| 8957 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8958 <p>kegg.compound: C14818</p> | |
| 8959 <p>PubChem: 17395816</p> | |
| 8960 <p>PDB-CCD: FE2</p> | |
| 8961 <p>ChEBI: 29033</p> | |
| 8962 <p>NIKKAJI: J300.941F</p> | |
| 8963 <p>formula: Fe</p> | |
| 8964 <p>weight: 55.845</p> | |
| 8965 </body> | |
| 8966 </notes> | |
| 8967 <annotation> | |
| 8968 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8969 <rdf:Description rdf:about="#_6df88846-5982-4f8d-8e6a-a0235c49890d"> | |
| 8970 <bqbiol:is> | |
| 8971 <rdf:Bag> | |
| 8972 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C14818"/> | |
| 8973 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/FE2"/> | |
| 8974 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29033"/> | |
| 8975 </rdf:Bag> | |
| 8976 </bqbiol:is> | |
| 8977 </rdf:Description> | |
| 8978 </rdf:RDF> | |
| 8979 </annotation> | |
| 8980 </species> | |
| 8981 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C02839" metaid="_96ddc057-9436-4af3-af8c-8834c3e9bc27" name="L-Tyrosyl-tRNA(Tyr)" sboTerm="SBO:0000240"> | |
| 8982 <notes> | |
| 8983 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 8984 <p>kegg.compound: C02839</p> | |
| 8985 <p>PubChem: 5781</p> | |
| 8986 <p>ChEBI: 29161</p> | |
| 8987 <p>formula: C24H30N6O12PR(C5H8O6PR)n</p> | |
| 8988 </body> | |
| 8989 </notes> | |
| 8990 <annotation> | |
| 8991 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 8992 <rdf:Description rdf:about="#_96ddc057-9436-4af3-af8c-8834c3e9bc27"> | |
| 8993 <bqbiol:is> | |
| 8994 <rdf:Bag> | |
| 8995 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02839"/> | |
| 8996 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29161"/> | |
| 8997 </rdf:Bag> | |
| 8998 </bqbiol:is> | |
| 8999 </rdf:Description> | |
| 9000 </rdf:RDF> | |
| 9001 </annotation> | |
| 9002 </species> | |
| 9003 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C19H21N7O6" hasOnlySubstanceUnits="false" id="C00415" metaid="b874c263-b87e-4396-a1b9-92002b82286e" name="Dihydrofolate" sboTerm="SBO:0000240"> | |
| 9004 <notes> | |
| 9005 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9006 <p>kegg.compound: C00415</p> | |
| 9007 <p>KNApSAcK: C00007248</p> | |
| 9008 <p>CAS: 4033-27-6</p> | |
| 9009 <p>PubChem: 3705</p> | |
| 9010 <p>3DMET: B01240</p> | |
| 9011 <p>PDB-CCD: DHF</p> | |
| 9012 <p>ChEBI: 15633</p> | |
| 9013 <p>NIKKAJI: J373.767E</p> | |
| 9014 <p>formula: C19H21N7O6</p> | |
| 9015 <p>weight: 443.4133</p> | |
| 9016 </body> | |
| 9017 </notes> | |
| 9018 <annotation> | |
| 9019 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9020 <rdf:Description rdf:about="#b874c263-b87e-4396-a1b9-92002b82286e"> | |
| 9021 <bqbiol:is> | |
| 9022 <rdf:Bag> | |
| 9023 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00415"/> | |
| 9024 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007248"/> | |
| 9025 <rdf:li rdf:resource="https://identifiers.org/CAS/4033-27-6"/> | |
| 9026 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01240"/> | |
| 9027 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/DHF"/> | |
| 9028 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15633"/> | |
| 9029 </rdf:Bag> | |
| 9030 </bqbiol:is> | |
| 9031 </rdf:Description> | |
| 9032 </rdf:RDF> | |
| 9033 </annotation> | |
| 9034 </species> | |
| 9035 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H13N4O9P" hasOnlySubstanceUnits="false" id="C00655" metaid="_923dfec7-9f3e-46fc-a611-127ab313ed2b" name="Xanthosine 5'-phosphate" sboTerm="SBO:0000240"> | |
| 9036 <notes> | |
| 9037 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9038 <p>kegg.compound: C00655</p> | |
| 9039 <p>KNApSAcK: C00007396</p> | |
| 9040 <p>CAS: 523-98-8</p> | |
| 9041 <p>PubChem: 3925</p> | |
| 9042 <p>3DMET: B01300</p> | |
| 9043 <p>PDB-CCD: XMP</p> | |
| 9044 <p>ChEBI: 15652</p> | |
| 9045 <p>NIKKAJI: J29.066A</p> | |
| 9046 <p>formula: C10H13N4O9P</p> | |
| 9047 <p>weight: 364.2054</p> | |
| 9048 </body> | |
| 9049 </notes> | |
| 9050 <annotation> | |
| 9051 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9052 <rdf:Description rdf:about="#_923dfec7-9f3e-46fc-a611-127ab313ed2b"> | |
| 9053 <bqbiol:is> | |
| 9054 <rdf:Bag> | |
| 9055 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00655"/> | |
| 9056 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007396"/> | |
| 9057 <rdf:li rdf:resource="https://identifiers.org/CAS/523-98-8"/> | |
| 9058 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01300"/> | |
| 9059 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/XMP"/> | |
| 9060 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15652"/> | |
| 9061 </rdf:Bag> | |
| 9062 </bqbiol:is> | |
| 9063 </rdf:Description> | |
| 9064 </rdf:RDF> | |
| 9065 </annotation> | |
| 9066 </species> | |
| 9067 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C11H20NO11P" hasOnlySubstanceUnits="false" id="C16698" metaid="_1be8aecf-3bcb-4d19-b4f8-0c0d83e8561d" name="N-Acetylmuramic acid 6-phosphate" sboTerm="SBO:0000240"> | |
| 9068 <notes> | |
| 9069 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9070 <p>kegg.compound: C16698</p> | |
| 9071 <p>PubChem: 51091020</p> | |
| 9072 <p>PDB-CCD: J79</p> | |
| 9073 <p>ChEBI: 47968</p> | |
| 9074 <p>NIKKAJI: J2.224.719K</p> | |
| 9075 <p>formula: C11H20NO11P</p> | |
| 9076 <p>weight: 373.2504</p> | |
| 9077 </body> | |
| 9078 </notes> | |
| 9079 <annotation> | |
| 9080 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9081 <rdf:Description rdf:about="#_1be8aecf-3bcb-4d19-b4f8-0c0d83e8561d"> | |
| 9082 <bqbiol:is> | |
| 9083 <rdf:Bag> | |
| 9084 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C16698"/> | |
| 9085 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/J79"/> | |
| 9086 <rdf:li rdf:resource="https://identifiers.org/ChEBI/47968"/> | |
| 9087 </rdf:Bag> | |
| 9088 </bqbiol:is> | |
| 9089 </rdf:Description> | |
| 9090 </rdf:RDF> | |
| 9091 </annotation> | |
| 9092 </species> | |
| 9093 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C8H13O3SR" hasOnlySubstanceUnits="false" id="C19846" metaid="_10fe10b3-da8f-4992-bbe8-2e39ca6eac6f" name="Pimeloyl-[acyl-carrier protein] methyl ester" sboTerm="SBO:0000240"> | |
| 9094 <notes> | |
| 9095 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9096 <p>kegg.compound: C19846</p> | |
| 9097 <p>PubChem: 135626313</p> | |
| 9098 <p>formula: C8H13O3SR</p> | |
| 9099 </body> | |
| 9100 </notes> | |
| 9101 <annotation> | |
| 9102 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9103 <rdf:Description rdf:about="#_10fe10b3-da8f-4992-bbe8-2e39ca6eac6f"> | |
| 9104 <bqbiol:is> | |
| 9105 <rdf:Bag> | |
| 9106 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C19846"/> | |
| 9107 </rdf:Bag> | |
| 9108 </bqbiol:is> | |
| 9109 </rdf:Description> | |
| 9110 </rdf:RDF> | |
| 9111 </annotation> | |
| 9112 </species> | |
| 9113 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C18H33O2SR" hasOnlySubstanceUnits="false" id="C16219" metaid="_52b965dd-4d11-486e-8e3b-da44329e5f02" name="3-Oxostearoyl-[acp]" sboTerm="SBO:0000240"> | |
| 9114 <notes> | |
| 9115 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9116 <p>kegg.compound: C16219</p> | |
| 9117 <p>PubChem: 47205527</p> | |
| 9118 <p>ChEBI: 80386</p> | |
| 9119 <p>formula: C18H33O2SR</p> | |
| 9120 </body> | |
| 9121 </notes> | |
| 9122 <annotation> | |
| 9123 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9124 <rdf:Description rdf:about="#_52b965dd-4d11-486e-8e3b-da44329e5f02"> | |
| 9125 <bqbiol:is> | |
| 9126 <rdf:Bag> | |
| 9127 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C16219"/> | |
| 9128 <rdf:li rdf:resource="https://identifiers.org/ChEBI/80386"/> | |
| 9129 </rdf:Bag> | |
| 9130 </bqbiol:is> | |
| 9131 </rdf:Description> | |
| 9132 </rdf:RDF> | |
| 9133 </annotation> | |
| 9134 </species> | |
| 9135 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C02282" metaid="_16fb9247-cf9d-4e28-8127-770526d62b65" name="Glutaminyl-tRNA" sboTerm="SBO:0000240"> | |
| 9136 <notes> | |
| 9137 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9138 <p>kegg.compound: C02282</p> | |
| 9139 <p>PubChem: 5339</p> | |
| 9140 <p>ChEBI: 29166</p> | |
| 9141 <p>formula: C20H29N7O12PR(C5H8O6PR)n</p> | |
| 9142 </body> | |
| 9143 </notes> | |
| 9144 <annotation> | |
| 9145 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9146 <rdf:Description rdf:about="#_16fb9247-cf9d-4e28-8127-770526d62b65"> | |
| 9147 <bqbiol:is> | |
| 9148 <rdf:Bag> | |
| 9149 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02282"/> | |
| 9150 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29166"/> | |
| 9151 </rdf:Bag> | |
| 9152 </bqbiol:is> | |
| 9153 </rdf:Description> | |
| 9154 </rdf:RDF> | |
| 9155 </annotation> | |
| 9156 </species> | |
| 9157 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C11H15NO8" hasOnlySubstanceUnits="false" id="C04462" metaid="edddf95d-94e2-409d-a3aa-a464220b5026" name="N-Succinyl-2-L-amino-6-oxoheptanedioate" sboTerm="SBO:0000240"> | |
| 9158 <notes> | |
| 9159 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9160 <p>kegg.compound: C04462</p> | |
| 9161 <p>KNApSAcK: C00007598</p> | |
| 9162 <p>PubChem: 7087</p> | |
| 9163 <p>3DMET: B00719</p> | |
| 9164 <p>ChEBI: 15685 35266</p> | |
| 9165 <p>NIKKAJI: J788.069C</p> | |
| 9166 <p>formula: C11H15NO8</p> | |
| 9167 <p>weight: 289.2387</p> | |
| 9168 </body> | |
| 9169 </notes> | |
| 9170 <annotation> | |
| 9171 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9172 <rdf:Description rdf:about="#edddf95d-94e2-409d-a3aa-a464220b5026"> | |
| 9173 <bqbiol:is> | |
| 9174 <rdf:Bag> | |
| 9175 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04462"/> | |
| 9176 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007598"/> | |
| 9177 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00719"/> | |
| 9178 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15685 35266"/> | |
| 9179 </rdf:Bag> | |
| 9180 </bqbiol:is> | |
| 9181 </rdf:Description> | |
| 9182 </rdf:RDF> | |
| 9183 </annotation> | |
| 9184 </species> | |
| 9185 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C02163" metaid="_17286e71-f59e-4b06-96d3-2f99fccc6218" name="L-Arginyl-tRNA(Arg)" sboTerm="SBO:0000240"> | |
| 9186 <notes> | |
| 9187 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9188 <p>kegg.compound: C02163</p> | |
| 9189 <p>PubChem: 5239</p> | |
| 9190 <p>ChEBI: 18366</p> | |
| 9191 <p>formula: C21H33N9O11PR(C5H8O6PR)n</p> | |
| 9192 </body> | |
| 9193 </notes> | |
| 9194 <annotation> | |
| 9195 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9196 <rdf:Description rdf:about="#_17286e71-f59e-4b06-96d3-2f99fccc6218"> | |
| 9197 <bqbiol:is> | |
| 9198 <rdf:Bag> | |
| 9199 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02163"/> | |
| 9200 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18366"/> | |
| 9201 </rdf:Bag> | |
| 9202 </bqbiol:is> | |
| 9203 </rdf:Description> | |
| 9204 </rdf:RDF> | |
| 9205 </annotation> | |
| 9206 </species> | |
| 9207 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C02047" metaid="f0b25514-a365-4324-9f56-8624bd224306" name="L-Leucyl-tRNA" sboTerm="SBO:0000240"> | |
| 9208 <notes> | |
| 9209 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9210 <p>kegg.compound: C02047</p> | |
| 9211 <p>PubChem: 5136</p> | |
| 9212 <p>ChEBI: 16624</p> | |
| 9213 <p>formula: C21H32N6O11PR(C5H8O6PR)n</p> | |
| 9214 </body> | |
| 9215 </notes> | |
| 9216 <annotation> | |
| 9217 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9218 <rdf:Description rdf:about="#f0b25514-a365-4324-9f56-8624bd224306"> | |
| 9219 <bqbiol:is> | |
| 9220 <rdf:Bag> | |
| 9221 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02047"/> | |
| 9222 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16624"/> | |
| 9223 </rdf:Bag> | |
| 9224 </bqbiol:is> | |
| 9225 </rdf:Description> | |
| 9226 </rdf:RDF> | |
| 9227 </annotation> | |
| 9228 </species> | |
| 9229 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H20N4O10P3S" hasOnlySubstanceUnits="false" id="C03028" metaid="_2b310876-6c1e-40a7-95f8-577e2281863a" name="Thiamin triphosphate" sboTerm="SBO:0000240"> | |
| 9230 <notes> | |
| 9231 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9232 <p>kegg.compound: C03028</p> | |
| 9233 <p>CAS: 15666-52-1 3475-65-8</p> | |
| 9234 <p>PubChem: 5933</p> | |
| 9235 <p>3DMET: B01622</p> | |
| 9236 <p>PDB-CCD: V4E</p> | |
| 9237 <p>ChEBI: 9534</p> | |
| 9238 <p>NIKKAJI: J791.117C</p> | |
| 9239 <p>formula: C12H20N4O10P3S</p> | |
| 9240 <p>weight: 505.2943</p> | |
| 9241 </body> | |
| 9242 </notes> | |
| 9243 <annotation> | |
| 9244 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9245 <rdf:Description rdf:about="#_2b310876-6c1e-40a7-95f8-577e2281863a"> | |
| 9246 <bqbiol:is> | |
| 9247 <rdf:Bag> | |
| 9248 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03028"/> | |
| 9249 <rdf:li rdf:resource="https://identifiers.org/CAS/15666-52-1 3475-65-8"/> | |
| 9250 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01622"/> | |
| 9251 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/V4E"/> | |
| 9252 <rdf:li rdf:resource="https://identifiers.org/ChEBI/9534"/> | |
| 9253 </rdf:Bag> | |
| 9254 </bqbiol:is> | |
| 9255 </rdf:Description> | |
| 9256 </rdf:RDF> | |
| 9257 </annotation> | |
| 9258 </species> | |
| 9259 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C8H21N3" hasOnlySubstanceUnits="false" id="C16565" metaid="dd5b897d-201e-466e-b262-0f1aa550d61f" name="Aminopropylcadaverine" sboTerm="SBO:0000240"> | |
| 9260 <notes> | |
| 9261 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9262 <p>kegg.compound: C16565</p> | |
| 9263 <p>CAS: 56-19-9</p> | |
| 9264 <p>PubChem: 51090894</p> | |
| 9265 <p>ChEBI: 64860</p> | |
| 9266 <p>NIKKAJI: J575.711H</p> | |
| 9267 <p>formula: C8H21N3</p> | |
| 9268 <p>weight: 159.2724</p> | |
| 9269 </body> | |
| 9270 </notes> | |
| 9271 <annotation> | |
| 9272 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9273 <rdf:Description rdf:about="#dd5b897d-201e-466e-b262-0f1aa550d61f"> | |
| 9274 <bqbiol:is> | |
| 9275 <rdf:Bag> | |
| 9276 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C16565"/> | |
| 9277 <rdf:li rdf:resource="https://identifiers.org/CAS/56-19-9"/> | |
| 9278 <rdf:li rdf:resource="https://identifiers.org/ChEBI/64860"/> | |
| 9279 </rdf:Bag> | |
| 9280 </bqbiol:is> | |
| 9281 </rdf:Description> | |
| 9282 </rdf:RDF> | |
| 9283 </annotation> | |
| 9284 </species> | |
| 9285 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H18N4O4PS" hasOnlySubstanceUnits="false" id="C01081" metaid="eae670ac-4992-429b-9d52-380d03572c48" name="Thiamin monophosphate" sboTerm="SBO:0000240"> | |
| 9286 <notes> | |
| 9287 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9288 <p>kegg.compound: C01081</p> | |
| 9289 <p>KNApSAcK: C00019628</p> | |
| 9290 <p>PubChem: 4319</p> | |
| 9291 <p>3DMET: B00237</p> | |
| 9292 <p>PDB-CCD: TPS</p> | |
| 9293 <p>ChEBI: 9533</p> | |
| 9294 <p>NIKKAJI: J221.489J</p> | |
| 9295 <p>formula: C12H18N4O4PS</p> | |
| 9296 <p>weight: 345.3345</p> | |
| 9297 </body> | |
| 9298 </notes> | |
| 9299 <annotation> | |
| 9300 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9301 <rdf:Description rdf:about="#eae670ac-4992-429b-9d52-380d03572c48"> | |
| 9302 <bqbiol:is> | |
| 9303 <rdf:Bag> | |
| 9304 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01081"/> | |
| 9305 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019628"/> | |
| 9306 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00237"/> | |
| 9307 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/TPS"/> | |
| 9308 <rdf:li rdf:resource="https://identifiers.org/ChEBI/9533"/> | |
| 9309 </rdf:Bag> | |
| 9310 </bqbiol:is> | |
| 9311 </rdf:Description> | |
| 9312 </rdf:RDF> | |
| 9313 </annotation> | |
| 9314 </species> | |
| 9315 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C8H14NOS2R" hasOnlySubstanceUnits="false" id="C02051" metaid="de4d5719-ab33-41bf-a094-3298b614809f" name="Lipoylprotein" sboTerm="SBO:0000240"> | |
| 9316 <notes> | |
| 9317 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9318 <p>kegg.compound: C02051</p> | |
| 9319 <p>PubChem: 5140</p> | |
| 9320 <p>ChEBI: 15804</p> | |
| 9321 <p>formula: C8H14NOS2R</p> | |
| 9322 </body> | |
| 9323 </notes> | |
| 9324 <annotation> | |
| 9325 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9326 <rdf:Description rdf:about="#de4d5719-ab33-41bf-a094-3298b614809f"> | |
| 9327 <bqbiol:is> | |
| 9328 <rdf:Bag> | |
| 9329 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02051"/> | |
| 9330 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15804"/> | |
| 9331 </rdf:Bag> | |
| 9332 </bqbiol:is> | |
| 9333 </rdf:Description> | |
| 9334 </rdf:RDF> | |
| 9335 </annotation> | |
| 9336 </species> | |
| 9337 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H22O11" hasOnlySubstanceUnits="false" id="C01083" metaid="_5b5def2a-7ef3-45e6-b2c7-2094d8ac4d6a" name="alpha,alpha-Trehalose" sboTerm="SBO:0000240"> | |
| 9338 <notes> | |
| 9339 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9340 <p>kegg.compound: C01083</p> | |
| 9341 <p>KNApSAcK: C00001152</p> | |
| 9342 <p>CAS: 99-20-7</p> | |
| 9343 <p>PubChem: 4320</p> | |
| 9344 <p>3DMET: B01375</p> | |
| 9345 <p>PDB-CCD: TRE</p> | |
| 9346 <p>ChEBI: 16551</p> | |
| 9347 <p>NIKKAJI: J4.965D</p> | |
| 9348 <p>formula: C12H22O11</p> | |
| 9349 <p>weight: 342.2965</p> | |
| 9350 </body> | |
| 9351 </notes> | |
| 9352 <annotation> | |
| 9353 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9354 <rdf:Description rdf:about="#_5b5def2a-7ef3-45e6-b2c7-2094d8ac4d6a"> | |
| 9355 <bqbiol:is> | |
| 9356 <rdf:Bag> | |
| 9357 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01083"/> | |
| 9358 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001152"/> | |
| 9359 <rdf:li rdf:resource="https://identifiers.org/CAS/99-20-7"/> | |
| 9360 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01375"/> | |
| 9361 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/TRE"/> | |
| 9362 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16551"/> | |
| 9363 </rdf:Bag> | |
| 9364 </bqbiol:is> | |
| 9365 </rdf:Description> | |
| 9366 </rdf:RDF> | |
| 9367 </annotation> | |
| 9368 </species> | |
| 9369 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="SeO3" hasOnlySubstanceUnits="false" id="C05684" metaid="_22007674-93bc-4a35-addb-c84b38ee179b" name="Selenite" sboTerm="SBO:0000240"> | |
| 9370 <notes> | |
| 9371 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9372 <p>kegg.compound: C05684</p> | |
| 9373 <p>PubChem: 7991</p> | |
| 9374 <p>3DMET: B01885</p> | |
| 9375 <p>ChEBI: 18212</p> | |
| 9376 <p>NIKKAJI: J2.758.808E</p> | |
| 9377 <p>formula: SeO3</p> | |
| 9378 <p>weight: 126.9582</p> | |
| 9379 </body> | |
| 9380 </notes> | |
| 9381 <annotation> | |
| 9382 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9383 <rdf:Description rdf:about="#_22007674-93bc-4a35-addb-c84b38ee179b"> | |
| 9384 <bqbiol:is> | |
| 9385 <rdf:Bag> | |
| 9386 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05684"/> | |
| 9387 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01885"/> | |
| 9388 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18212"/> | |
| 9389 </rdf:Bag> | |
| 9390 </bqbiol:is> | |
| 9391 </rdf:Description> | |
| 9392 </rdf:RDF> | |
| 9393 </annotation> | |
| 9394 </species> | |
| 9395 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H14N5O10PSe" hasOnlySubstanceUnits="false" id="C05686" metaid="_079efce6-9c41-4e60-bc89-4687680705cb" name="Adenylylselenate" sboTerm="SBO:0000240"> | |
| 9396 <notes> | |
| 9397 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9398 <p>kegg.compound: C05686</p> | |
| 9399 <p>PubChem: 7993</p> | |
| 9400 <p>3DMET: B01886</p> | |
| 9401 <p>NIKKAJI: J2.758.815H</p> | |
| 9402 <p>formula: C10H14N5O10PSe</p> | |
| 9403 <p>weight: 474.1794</p> | |
| 9404 </body> | |
| 9405 </notes> | |
| 9406 <annotation> | |
| 9407 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9408 <rdf:Description rdf:about="#_079efce6-9c41-4e60-bc89-4687680705cb"> | |
| 9409 <bqbiol:is> | |
| 9410 <rdf:Bag> | |
| 9411 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05686"/> | |
| 9412 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01886"/> | |
| 9413 </rdf:Bag> | |
| 9414 </bqbiol:is> | |
| 9415 </rdf:Description> | |
| 9416 </rdf:RDF> | |
| 9417 </annotation> | |
| 9418 </species> | |
| 9419 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H10O5" hasOnlySubstanceUnits="false" id="C04236" metaid="_216ddd0f-1fab-48db-8478-fde5260ef790" name="(2S)-2-Isopropyl-3-oxosuccinate" sboTerm="SBO:0000240"> | |
| 9420 <notes> | |
| 9421 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9422 <p>kegg.compound: C04236</p> | |
| 9423 <p>PubChem: 6905</p> | |
| 9424 <p>3DMET: B01725</p> | |
| 9425 <p>ChEBI: 1467</p> | |
| 9426 <p>NIKKAJI: J2.747.832H</p> | |
| 9427 <p>formula: C7H10O5</p> | |
| 9428 <p>weight: 174.1513</p> | |
| 9429 </body> | |
| 9430 </notes> | |
| 9431 <annotation> | |
| 9432 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9433 <rdf:Description rdf:about="#_216ddd0f-1fab-48db-8478-fde5260ef790"> | |
| 9434 <bqbiol:is> | |
| 9435 <rdf:Bag> | |
| 9436 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04236"/> | |
| 9437 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01725"/> | |
| 9438 <rdf:li rdf:resource="https://identifiers.org/ChEBI/1467"/> | |
| 9439 </rdf:Bag> | |
| 9440 </bqbiol:is> | |
| 9441 </rdf:Description> | |
| 9442 </rdf:RDF> | |
| 9443 </annotation> | |
| 9444 </species> | |
| 9445 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C17324" metaid="_5e22e6d2-a0ab-44f8-94a4-94c624f84c3b" name="tRNA adenine" sboTerm="SBO:0000240"> | |
| 9446 <notes> | |
| 9447 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9448 <p>kegg.compound: C17324</p> | |
| 9449 <p>PubChem: 96023688</p> | |
| 9450 <p>ChEBI: 81008</p> | |
| 9451 <p>formula: C10H14N5O7P(C5H8O6PR)n(C5H8O6PR)n</p> | |
| 9452 </body> | |
| 9453 </notes> | |
| 9454 <annotation> | |
| 9455 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9456 <rdf:Description rdf:about="#_5e22e6d2-a0ab-44f8-94a4-94c624f84c3b"> | |
| 9457 <bqbiol:is> | |
| 9458 <rdf:Bag> | |
| 9459 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C17324"/> | |
| 9460 <rdf:li rdf:resource="https://identifiers.org/ChEBI/81008"/> | |
| 9461 </rdf:Bag> | |
| 9462 </bqbiol:is> | |
| 9463 </rdf:Description> | |
| 9464 </rdf:RDF> | |
| 9465 </annotation> | |
| 9466 </species> | |
| 9467 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H17NO3" hasOnlySubstanceUnits="false" id="C01092" metaid="_35ab63a5-4752-4c06-9230-52496349e3a1" name="8-Amino-7-oxononanoate" sboTerm="SBO:0000240"> | |
| 9468 <notes> | |
| 9469 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9470 <p>kegg.compound: C01092</p> | |
| 9471 <p>PubChem: 4327</p> | |
| 9472 <p>3DMET: B04764</p> | |
| 9473 <p>ChEBI: 12266 15830</p> | |
| 9474 <p>LIPIDMAPS: LMFA01060168 LMFA01100065</p> | |
| 9475 <p>NIKKAJI: J511.019J</p> | |
| 9476 <p>formula: C9H17NO3</p> | |
| 9477 <p>weight: 187.2362</p> | |
| 9478 </body> | |
| 9479 </notes> | |
| 9480 <annotation> | |
| 9481 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9482 <rdf:Description rdf:about="#_35ab63a5-4752-4c06-9230-52496349e3a1"> | |
| 9483 <bqbiol:is> | |
| 9484 <rdf:Bag> | |
| 9485 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01092"/> | |
| 9486 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04764"/> | |
| 9487 <rdf:li rdf:resource="https://identifiers.org/ChEBI/12266 15830"/> | |
| 9488 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA01060168 LMFA01100065"/> | |
| 9489 </rdf:Bag> | |
| 9490 </bqbiol:is> | |
| 9491 </rdf:Description> | |
| 9492 </rdf:RDF> | |
| 9493 </annotation> | |
| 9494 </species> | |
| 9495 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C11H15N2O5" hasOnlySubstanceUnits="false" id="C03150" metaid="a4a42120-729e-49a9-90c2-119a0fe7bedb" name="Nicotinamide-beta-riboside" sboTerm="SBO:0000240"> | |
| 9496 <notes> | |
| 9497 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9498 <p>kegg.compound: C03150</p> | |
| 9499 <p>CAS: 1341-23-7</p> | |
| 9500 <p>PubChem: 6038</p> | |
| 9501 <p>3DMET: B01635</p> | |
| 9502 <p>PDB-CCD: NNR</p> | |
| 9503 <p>ChEBI: 15927</p> | |
| 9504 <p>NIKKAJI: J490.568G</p> | |
| 9505 <p>formula: C11H15N2O5</p> | |
| 9506 <p>weight: 255.2472</p> | |
| 9507 </body> | |
| 9508 </notes> | |
| 9509 <annotation> | |
| 9510 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9511 <rdf:Description rdf:about="#a4a42120-729e-49a9-90c2-119a0fe7bedb"> | |
| 9512 <bqbiol:is> | |
| 9513 <rdf:Bag> | |
| 9514 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03150"/> | |
| 9515 <rdf:li rdf:resource="https://identifiers.org/CAS/1341-23-7"/> | |
| 9516 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01635"/> | |
| 9517 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/NNR"/> | |
| 9518 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15927"/> | |
| 9519 </rdf:Bag> | |
| 9520 </bqbiol:is> | |
| 9521 </rdf:Description> | |
| 9522 </rdf:RDF> | |
| 9523 </annotation> | |
| 9524 </species> | |
| 9525 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H13O9P" hasOnlySubstanceUnits="false" id="C01094" metaid="_25f4e550-c1c1-4605-9bbd-2d98c2d58343" name="D-Fructose 1-phosphate" sboTerm="SBO:0000240"> | |
| 9526 <notes> | |
| 9527 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9528 <p>kegg.compound: C01094</p> | |
| 9529 <p>KNApSAcK: C00019676</p> | |
| 9530 <p>CAS: 15978-08-2</p> | |
| 9531 <p>PubChem: 4329</p> | |
| 9532 <p>3DMET: B04765</p> | |
| 9533 <p>PDB-CCD: F1X</p> | |
| 9534 <p>ChEBI: 18105 37515</p> | |
| 9535 <p>NIKKAJI: J219.923H</p> | |
| 9536 <p>formula: C6H13O9P</p> | |
| 9537 <p>weight: 260.1358</p> | |
| 9538 </body> | |
| 9539 </notes> | |
| 9540 <annotation> | |
| 9541 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9542 <rdf:Description rdf:about="#_25f4e550-c1c1-4605-9bbd-2d98c2d58343"> | |
| 9543 <bqbiol:is> | |
| 9544 <rdf:Bag> | |
| 9545 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01094"/> | |
| 9546 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019676"/> | |
| 9547 <rdf:li rdf:resource="https://identifiers.org/CAS/15978-08-2"/> | |
| 9548 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04765"/> | |
| 9549 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/F1X"/> | |
| 9550 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18105 37515"/> | |
| 9551 </rdf:Bag> | |
| 9552 </bqbiol:is> | |
| 9553 </rdf:Description> | |
| 9554 </rdf:RDF> | |
| 9555 </annotation> | |
| 9556 </species> | |
| 9557 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H13O9P" hasOnlySubstanceUnits="false" id="C01097" metaid="bebd009b-c278-47f0-9fc5-eae4d8ac9bbf" name="D-Tagatose 6-phosphate" sboTerm="SBO:0000240"> | |
| 9558 <notes> | |
| 9559 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9560 <p>kegg.compound: C01097</p> | |
| 9561 <p>PubChem: 4332</p> | |
| 9562 <p>3DMET: B04767</p> | |
| 9563 <p>PDB-CCD: TA6</p> | |
| 9564 <p>ChEBI: 4251</p> | |
| 9565 <p>NIKKAJI: J2.731.241A</p> | |
| 9566 <p>formula: C6H13O9P</p> | |
| 9567 <p>weight: 260.1358</p> | |
| 9568 </body> | |
| 9569 </notes> | |
| 9570 <annotation> | |
| 9571 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9572 <rdf:Description rdf:about="#bebd009b-c278-47f0-9fc5-eae4d8ac9bbf"> | |
| 9573 <bqbiol:is> | |
| 9574 <rdf:Bag> | |
| 9575 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01097"/> | |
| 9576 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04767"/> | |
| 9577 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/TA6"/> | |
| 9578 <rdf:li rdf:resource="https://identifiers.org/ChEBI/4251"/> | |
| 9579 </rdf:Bag> | |
| 9580 </bqbiol:is> | |
| 9581 </rdf:Description> | |
| 9582 </rdf:RDF> | |
| 9583 </annotation> | |
| 9584 </species> | |
| 9585 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H11NO2Se" hasOnlySubstanceUnits="false" id="C05335" metaid="_98729f17-5348-4429-b000-7448f3648b85" name="L-Selenomethionine" sboTerm="SBO:0000240"> | |
| 9586 <notes> | |
| 9587 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9588 <p>kegg.compound: C05335</p> | |
| 9589 <p>CAS: 3211-76-5</p> | |
| 9590 <p>PubChem: 7713</p> | |
| 9591 <p>3DMET: B05009</p> | |
| 9592 <p>PDB-CCD: MSE</p> | |
| 9593 <p>ChEBI: 30021</p> | |
| 9594 <p>NIKKAJI: J13.127J</p> | |
| 9595 <p>formula: C5H11NO2Se</p> | |
| 9596 <p>weight: 196.1063</p> | |
| 9597 </body> | |
| 9598 </notes> | |
| 9599 <annotation> | |
| 9600 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9601 <rdf:Description rdf:about="#_98729f17-5348-4429-b000-7448f3648b85"> | |
| 9602 <bqbiol:is> | |
| 9603 <rdf:Bag> | |
| 9604 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05335"/> | |
| 9605 <rdf:li rdf:resource="https://identifiers.org/CAS/3211-76-5"/> | |
| 9606 <rdf:li rdf:resource="https://identifiers.org/3DMET/B05009"/> | |
| 9607 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/MSE"/> | |
| 9608 <rdf:li rdf:resource="https://identifiers.org/ChEBI/30021"/> | |
| 9609 </rdf:Bag> | |
| 9610 </bqbiol:is> | |
| 9611 </rdf:Description> | |
| 9612 </rdf:RDF> | |
| 9613 </annotation> | |
| 9614 </species> | |
| 9615 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H5OSR" hasOnlySubstanceUnits="false" id="C04246" metaid="_1c138bb9-0a63-43ba-87ef-368740d9ef46" name="But-2-enoyl-[acyl-carrier protein]" sboTerm="SBO:0000240"> | |
| 9616 <notes> | |
| 9617 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9618 <p>kegg.compound: C04246</p> | |
| 9619 <p>PubChem: 6911</p> | |
| 9620 <p>formula: C4H5OSR</p> | |
| 9621 </body> | |
| 9622 </notes> | |
| 9623 <annotation> | |
| 9624 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9625 <rdf:Description rdf:about="#_1c138bb9-0a63-43ba-87ef-368740d9ef46"> | |
| 9626 <bqbiol:is> | |
| 9627 <rdf:Bag> | |
| 9628 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04246"/> | |
| 9629 </rdf:Bag> | |
| 9630 </bqbiol:is> | |
| 9631 </rdf:Description> | |
| 9632 </rdf:RDF> | |
| 9633 </annotation> | |
| 9634 </species> | |
| 9635 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="H2SeO4" hasOnlySubstanceUnits="false" id="C05697" metaid="_18641f5e-15e2-4248-9e7b-4bf1c6eafecf" name="Selenate" sboTerm="SBO:0000240"> | |
| 9636 <notes> | |
| 9637 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9638 <p>kegg.compound: C05697</p> | |
| 9639 <p>CAS: 7783-08-6</p> | |
| 9640 <p>PubChem: 8004</p> | |
| 9641 <p>3DMET: B01887</p> | |
| 9642 <p>PDB-CCD: SE4</p> | |
| 9643 <p>ChEBI: 18170</p> | |
| 9644 <p>NIKKAJI: J43.592I</p> | |
| 9645 <p>formula: H2SeO4</p> | |
| 9646 <p>weight: 144.9735</p> | |
| 9647 </body> | |
| 9648 </notes> | |
| 9649 <annotation> | |
| 9650 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9651 <rdf:Description rdf:about="#_18641f5e-15e2-4248-9e7b-4bf1c6eafecf"> | |
| 9652 <bqbiol:is> | |
| 9653 <rdf:Bag> | |
| 9654 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05697"/> | |
| 9655 <rdf:li rdf:resource="https://identifiers.org/CAS/7783-08-6"/> | |
| 9656 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01887"/> | |
| 9657 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/SE4"/> | |
| 9658 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18170"/> | |
| 9659 </rdf:Bag> | |
| 9660 </bqbiol:is> | |
| 9661 </rdf:Description> | |
| 9662 </rdf:RDF> | |
| 9663 </annotation> | |
| 9664 </species> | |
| 9665 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H13O9P" hasOnlySubstanceUnits="false" id="C04006" metaid="d5d48f3d-4b4a-40c4-b92f-606afe0570e0" name="1D-myo-Inositol 3-phosphate" sboTerm="SBO:0000240"> | |
| 9666 <notes> | |
| 9667 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9668 <p>kegg.compound: C04006</p> | |
| 9669 <p>PubChem: 6716</p> | |
| 9670 <p>3DMET: B01710</p> | |
| 9671 <p>PDB-CCD: LIP</p> | |
| 9672 <p>ChEBI: 18169</p> | |
| 9673 <p>NIKKAJI: J373.685G</p> | |
| 9674 <p>formula: C6H13O9P</p> | |
| 9675 <p>weight: 260.1358</p> | |
| 9676 </body> | |
| 9677 </notes> | |
| 9678 <annotation> | |
| 9679 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9680 <rdf:Description rdf:about="#d5d48f3d-4b4a-40c4-b92f-606afe0570e0"> | |
| 9681 <bqbiol:is> | |
| 9682 <rdf:Bag> | |
| 9683 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04006"/> | |
| 9684 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01710"/> | |
| 9685 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/LIP"/> | |
| 9686 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18169"/> | |
| 9687 </rdf:Bag> | |
| 9688 </bqbiol:is> | |
| 9689 </rdf:Description> | |
| 9690 </rdf:RDF> | |
| 9691 </annotation> | |
| 9692 </species> | |
| 9693 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H9NO2Se" hasOnlySubstanceUnits="false" id="C05698" metaid="a87560e8-32f9-4902-ab6e-b84748e422ad" name="Selenohomocysteine" sboTerm="SBO:0000240"> | |
| 9694 <notes> | |
| 9695 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9696 <p>kegg.compound: C05698</p> | |
| 9697 <p>PubChem: 8005</p> | |
| 9698 <p>3DMET: B05100</p> | |
| 9699 <p>ChEBI: 9096</p> | |
| 9700 <p>NIKKAJI: J1.427.504E</p> | |
| 9701 <p>formula: C4H9NO2Se</p> | |
| 9702 <p>weight: 182.0798</p> | |
| 9703 </body> | |
| 9704 </notes> | |
| 9705 <annotation> | |
| 9706 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9707 <rdf:Description rdf:about="#a87560e8-32f9-4902-ab6e-b84748e422ad"> | |
| 9708 <bqbiol:is> | |
| 9709 <rdf:Bag> | |
| 9710 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05698"/> | |
| 9711 <rdf:li rdf:resource="https://identifiers.org/3DMET/B05100"/> | |
| 9712 <rdf:li rdf:resource="https://identifiers.org/ChEBI/9096"/> | |
| 9713 </rdf:Bag> | |
| 9714 </bqbiol:is> | |
| 9715 </rdf:Description> | |
| 9716 </rdf:RDF> | |
| 9717 </annotation> | |
| 9718 </species> | |
| 9719 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C30H39N9O12" hasOnlySubstanceUnits="false" id="C04489" metaid="_6c2615f3-4a23-4984-89ab-838ac0b0288e" name="5-Methyltetrahydropteroyltri-L-glutamate" sboTerm="SBO:0000240"> | |
| 9720 <notes> | |
| 9721 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9722 <p>kegg.compound: C04489</p> | |
| 9723 <p>PubChem: 7108</p> | |
| 9724 <p>ChEBI: 17614</p> | |
| 9725 <p>NIKKAJI: J2.751.522C</p> | |
| 9726 <p>formula: C30H39N9O12</p> | |
| 9727 <p>weight: 717.6838</p> | |
| 9728 </body> | |
| 9729 </notes> | |
| 9730 <annotation> | |
| 9731 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9732 <rdf:Description rdf:about="#_6c2615f3-4a23-4984-89ab-838ac0b0288e"> | |
| 9733 <bqbiol:is> | |
| 9734 <rdf:Bag> | |
| 9735 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04489"/> | |
| 9736 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17614"/> | |
| 9737 </rdf:Bag> | |
| 9738 </bqbiol:is> | |
| 9739 </rdf:Description> | |
| 9740 </rdf:RDF> | |
| 9741 </annotation> | |
| 9742 </species> | |
| 9743 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C05336" metaid="_271ca5fc-5228-4e90-801e-8ae1814b2bc3" name="Selenomethionyl-tRNA(Met)" sboTerm="SBO:0000240"> | |
| 9744 <notes> | |
| 9745 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9746 <p>kegg.compound: C05336</p> | |
| 9747 <p>PubChem: 7714</p> | |
| 9748 <p>ChEBI: 9100</p> | |
| 9749 <p>formula: C20H30N6O11PSeR(C5H8O6PR)n</p> | |
| 9750 </body> | |
| 9751 </notes> | |
| 9752 <annotation> | |
| 9753 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9754 <rdf:Description rdf:about="#_271ca5fc-5228-4e90-801e-8ae1814b2bc3"> | |
| 9755 <bqbiol:is> | |
| 9756 <rdf:Bag> | |
| 9757 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05336"/> | |
| 9758 <rdf:li rdf:resource="https://identifiers.org/ChEBI/9100"/> | |
| 9759 </rdf:Bag> | |
| 9760 </bqbiol:is> | |
| 9761 </rdf:Description> | |
| 9762 </rdf:RDF> | |
| 9763 </annotation> | |
| 9764 </species> | |
| 9765 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C18H35O2SR" hasOnlySubstanceUnits="false" id="C16220" metaid="edc34e3d-5a09-4f81-ac4b-6786a68c6105" name="(R)-3-Hydroxyoctadecanoyl-[acp]" sboTerm="SBO:0000240"> | |
| 9766 <notes> | |
| 9767 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9768 <p>kegg.compound: C16220</p> | |
| 9769 <p>PubChem: 47205528</p> | |
| 9770 <p>ChEBI: 80387</p> | |
| 9771 <p>formula: C18H35O2SR</p> | |
| 9772 </body> | |
| 9773 </notes> | |
| 9774 <annotation> | |
| 9775 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9776 <rdf:Description rdf:about="#edc34e3d-5a09-4f81-ac4b-6786a68c6105"> | |
| 9777 <bqbiol:is> | |
| 9778 <rdf:Bag> | |
| 9779 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C16220"/> | |
| 9780 <rdf:li rdf:resource="https://identifiers.org/ChEBI/80387"/> | |
| 9781 </rdf:Bag> | |
| 9782 </bqbiol:is> | |
| 9783 </rdf:Description> | |
| 9784 </rdf:RDF> | |
| 9785 </annotation> | |
| 9786 </species> | |
| 9787 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C18H33OSR" hasOnlySubstanceUnits="false" id="C16221" metaid="d755fbcc-953f-418b-9394-92f5045344f4" name="(2E)-Octadecenoyl-[acp]" sboTerm="SBO:0000240"> | |
| 9788 <notes> | |
| 9789 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9790 <p>kegg.compound: C16221</p> | |
| 9791 <p>PubChem: 47205529</p> | |
| 9792 <p>ChEBI: 80388</p> | |
| 9793 <p>formula: C18H33OSR</p> | |
| 9794 </body> | |
| 9795 </notes> | |
| 9796 <annotation> | |
| 9797 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9798 <rdf:Description rdf:about="#d755fbcc-953f-418b-9394-92f5045344f4"> | |
| 9799 <bqbiol:is> | |
| 9800 <rdf:Bag> | |
| 9801 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C16221"/> | |
| 9802 <rdf:li rdf:resource="https://identifiers.org/ChEBI/80388"/> | |
| 9803 </rdf:Bag> | |
| 9804 </bqbiol:is> | |
| 9805 </rdf:Description> | |
| 9806 </rdf:RDF> | |
| 9807 </annotation> | |
| 9808 </species> | |
| 9809 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C55H91O4P" hasOnlySubstanceUnits="false" id="C17556" metaid="b39845b4-75cf-4a57-913e-33d6a203c62e" name="di-trans,poly-cis-Undecaprenyl phosphate" sboTerm="SBO:0000240"> | |
| 9810 <notes> | |
| 9811 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9812 <p>kegg.compound: C17556</p> | |
| 9813 <p>PubChem: 96023901</p> | |
| 9814 <p>ChEBI: 60468</p> | |
| 9815 <p>LIPIDMAPS: LMPR03020001</p> | |
| 9816 <p>NIKKAJI: J2.167.536I</p> | |
| 9817 <p>formula: C55H91O4P</p> | |
| 9818 <p>weight: 847.2824</p> | |
| 9819 </body> | |
| 9820 </notes> | |
| 9821 <annotation> | |
| 9822 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9823 <rdf:Description rdf:about="#b39845b4-75cf-4a57-913e-33d6a203c62e"> | |
| 9824 <bqbiol:is> | |
| 9825 <rdf:Bag> | |
| 9826 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C17556"/> | |
| 9827 <rdf:li rdf:resource="https://identifiers.org/ChEBI/60468"/> | |
| 9828 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMPR03020001"/> | |
| 9829 </rdf:Bag> | |
| 9830 </bqbiol:is> | |
| 9831 </rdf:Description> | |
| 9832 </rdf:RDF> | |
| 9833 </annotation> | |
| 9834 </species> | |
| 9835 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H23OSR" hasOnlySubstanceUnits="false" id="C05223" metaid="_4728dfa3-97dc-4f56-9248-2045bd4a3d3d" name="Dodecanoyl-[acyl-carrier protein]" sboTerm="SBO:0000240"> | |
| 9836 <notes> | |
| 9837 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9838 <p>kegg.compound: C05223</p> | |
| 9839 <p>PubChem: 7620</p> | |
| 9840 <p>formula: C12H23OSR</p> | |
| 9841 </body> | |
| 9842 </notes> | |
| 9843 <annotation> | |
| 9844 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9845 <rdf:Description rdf:about="#_4728dfa3-97dc-4f56-9248-2045bd4a3d3d"> | |
| 9846 <bqbiol:is> | |
| 9847 <rdf:Bag> | |
| 9848 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05223"/> | |
| 9849 </rdf:Bag> | |
| 9850 </bqbiol:is> | |
| 9851 </rdf:Description> | |
| 9852 </rdf:RDF> | |
| 9853 </annotation> | |
| 9854 </species> | |
| 9855 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C8H15N2O9P" hasOnlySubstanceUnits="false" id="C04376" metaid="_53390ea6-e931-46c5-928c-dd79dd753bf5" name="5'-Phosphoribosyl-N-formylglycinamide" sboTerm="SBO:0000240"> | |
| 9856 <notes> | |
| 9857 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9858 <p>kegg.compound: C04376</p> | |
| 9859 <p>KNApSAcK: C00019642</p> | |
| 9860 <p>CAS: 349-34-8</p> | |
| 9861 <p>PubChem: 7017</p> | |
| 9862 <p>3DMET: B04939</p> | |
| 9863 <p>PDB-CCD: FGR</p> | |
| 9864 <p>ChEBI: 18272</p> | |
| 9865 <p>NIKKAJI: J40.075K</p> | |
| 9866 <p>formula: C8H15N2O9P</p> | |
| 9867 <p>weight: 314.1865</p> | |
| 9868 </body> | |
| 9869 </notes> | |
| 9870 <annotation> | |
| 9871 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9872 <rdf:Description rdf:about="#_53390ea6-e931-46c5-928c-dd79dd753bf5"> | |
| 9873 <bqbiol:is> | |
| 9874 <rdf:Bag> | |
| 9875 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04376"/> | |
| 9876 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019642"/> | |
| 9877 <rdf:li rdf:resource="https://identifiers.org/CAS/349-34-8"/> | |
| 9878 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04939"/> | |
| 9879 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/FGR"/> | |
| 9880 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18272"/> | |
| 9881 </rdf:Bag> | |
| 9882 </bqbiol:is> | |
| 9883 </rdf:Description> | |
| 9884 </rdf:RDF> | |
| 9885 </annotation> | |
| 9886 </species> | |
| 9887 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H12NO8P" hasOnlySubstanceUnits="false" id="C04133" metaid="_0bf32e72-ae97-48fe-ad5a-bb164505d08b" name="N-Acetyl-L-glutamate 5-phosphate" sboTerm="SBO:0000240"> | |
| 9888 <notes> | |
| 9889 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9890 <p>kegg.compound: C04133</p> | |
| 9891 <p>PubChem: 6819</p> | |
| 9892 <p>3DMET: B00683</p> | |
| 9893 <p>PDB-CCD: X2W</p> | |
| 9894 <p>ChEBI: 16878</p> | |
| 9895 <p>NIKKAJI: J37.496B</p> | |
| 9896 <p>formula: C7H12NO8P</p> | |
| 9897 <p>weight: 269.1458</p> | |
| 9898 </body> | |
| 9899 </notes> | |
| 9900 <annotation> | |
| 9901 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9902 <rdf:Description rdf:about="#_0bf32e72-ae97-48fe-ad5a-bb164505d08b"> | |
| 9903 <bqbiol:is> | |
| 9904 <rdf:Bag> | |
| 9905 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04133"/> | |
| 9906 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00683"/> | |
| 9907 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/X2W"/> | |
| 9908 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16878"/> | |
| 9909 </rdf:Bag> | |
| 9910 </bqbiol:is> | |
| 9911 </rdf:Description> | |
| 9912 </rdf:RDF> | |
| 9913 </annotation> | |
| 9914 </species> | |
| 9915 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H13O9P" hasOnlySubstanceUnits="false" id="C05345" metaid="_796df8e4-3bed-4406-be2d-1e81d8a291e4" name="beta-D-Fructose 6-phosphate" sboTerm="SBO:0000240"> | |
| 9916 <notes> | |
| 9917 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9918 <p>kegg.compound: C05345</p> | |
| 9919 <p>KNApSAcK: C00019548</p> | |
| 9920 <p>PubChem: 7723</p> | |
| 9921 <p>3DMET: B01846</p> | |
| 9922 <p>PDB-CCD: F6P</p> | |
| 9923 <p>ChEBI: 16084</p> | |
| 9924 <p>NIKKAJI: J879.002G</p> | |
| 9925 <p>formula: C6H13O9P</p> | |
| 9926 <p>weight: 260.1358</p> | |
| 9927 </body> | |
| 9928 </notes> | |
| 9929 <annotation> | |
| 9930 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9931 <rdf:Description rdf:about="#_796df8e4-3bed-4406-be2d-1e81d8a291e4"> | |
| 9932 <bqbiol:is> | |
| 9933 <rdf:Bag> | |
| 9934 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05345"/> | |
| 9935 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019548"/> | |
| 9936 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01846"/> | |
| 9937 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/F6P"/> | |
| 9938 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16084"/> | |
| 9939 </rdf:Bag> | |
| 9940 </bqbiol:is> | |
| 9941 </rdf:Description> | |
| 9942 </rdf:RDF> | |
| 9943 </annotation> | |
| 9944 </species> | |
| 9945 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C31H45N6O16P" hasOnlySubstanceUnits="false" id="C04377" metaid="f2768c35-4a85-4a96-b817-d76487b595d8" name="5,10-Methylenetetrahydromethanopterin" sboTerm="SBO:0000240"> | |
| 9946 <notes> | |
| 9947 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9948 <p>kegg.compound: C04377</p> | |
| 9949 <p>PubChem: 7018</p> | |
| 9950 <p>3DMET: B01737</p> | |
| 9951 <p>PDB-CCD: H4M</p> | |
| 9952 <p>ChEBI: 16568</p> | |
| 9953 <p>formula: C31H45N6O16P</p> | |
| 9954 <p>weight: 788.6934</p> | |
| 9955 </body> | |
| 9956 </notes> | |
| 9957 <annotation> | |
| 9958 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9959 <rdf:Description rdf:about="#f2768c35-4a85-4a96-b817-d76487b595d8"> | |
| 9960 <bqbiol:is> | |
| 9961 <rdf:Bag> | |
| 9962 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04377"/> | |
| 9963 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01737"/> | |
| 9964 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/H4M"/> | |
| 9965 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16568"/> | |
| 9966 </rdf:Bag> | |
| 9967 </bqbiol:is> | |
| 9968 </rdf:Description> | |
| 9969 </rdf:RDF> | |
| 9970 </annotation> | |
| 9971 </species> | |
| 9972 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H20NO4S2R" hasOnlySubstanceUnits="false" id="C16254" metaid="_04a4877c-84f4-49fc-a603-50fba7973d03" name="[Dihydrolipoyllysine-residue succinyltransferase] S-succinyldihydrolipoyllysine" sboTerm="SBO:0000240"> | |
| 9973 <notes> | |
| 9974 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9975 <p>kegg.compound: C16254</p> | |
| 9976 <p>PubChem: 47205562</p> | |
| 9977 <p>ChEBI: 80403</p> | |
| 9978 <p>formula: C12H20NO4S2R</p> | |
| 9979 </body> | |
| 9980 </notes> | |
| 9981 <annotation> | |
| 9982 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 9983 <rdf:Description rdf:about="#_04a4877c-84f4-49fc-a603-50fba7973d03"> | |
| 9984 <bqbiol:is> | |
| 9985 <rdf:Bag> | |
| 9986 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C16254"/> | |
| 9987 <rdf:li rdf:resource="https://identifiers.org/ChEBI/80403"/> | |
| 9988 </rdf:Bag> | |
| 9989 </bqbiol:is> | |
| 9990 </rdf:Description> | |
| 9991 </rdf:RDF> | |
| 9992 </annotation> | |
| 9993 </species> | |
| 9994 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H18O5S" hasOnlySubstanceUnits="false" id="C17222" metaid="_102278fe-9182-4282-8f57-402e479720b8" name="2-(5'-Methylthio)pentylmalic acid" sboTerm="SBO:0000240"> | |
| 9995 <notes> | |
| 9996 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 9997 <p>kegg.compound: C17222</p> | |
| 9998 <p>KNApSAcK: C00007642</p> | |
| 9999 <p>PubChem: 96023630</p> | |
| 10000 <p>ChEBI: 80969</p> | |
| 10001 <p>NIKKAJI: J2.806.003C</p> | |
| 10002 <p>formula: C10H18O5S</p> | |
| 10003 <p>weight: 250.3119</p> | |
| 10004 </body> | |
| 10005 </notes> | |
| 10006 <annotation> | |
| 10007 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10008 <rdf:Description rdf:about="#_102278fe-9182-4282-8f57-402e479720b8"> | |
| 10009 <bqbiol:is> | |
| 10010 <rdf:Bag> | |
| 10011 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C17222"/> | |
| 10012 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007642"/> | |
| 10013 <rdf:li rdf:resource="https://identifiers.org/ChEBI/80969"/> | |
| 10014 </rdf:Bag> | |
| 10015 </bqbiol:is> | |
| 10016 </rdf:Description> | |
| 10017 </rdf:RDF> | |
| 10018 </annotation> | |
| 10019 </species> | |
| 10020 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H18NO2S2R" hasOnlySubstanceUnits="false" id="C16255" metaid="c2612d43-407a-43ba-9054-88718d8a003d" name="[Dihydrolipoyllysine-residue acetyltransferase] S-acetyldihydrolipoyllysine" sboTerm="SBO:0000240"> | |
| 10021 <notes> | |
| 10022 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10023 <p>kegg.compound: C16255</p> | |
| 10024 <p>PubChem: 47205563</p> | |
| 10025 <p>ChEBI: 80404</p> | |
| 10026 <p>LIPIDMAPS: LMFA08020202</p> | |
| 10027 <p>formula: C10H18NO2S2R</p> | |
| 10028 </body> | |
| 10029 </notes> | |
| 10030 <annotation> | |
| 10031 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10032 <rdf:Description rdf:about="#c2612d43-407a-43ba-9054-88718d8a003d"> | |
| 10033 <bqbiol:is> | |
| 10034 <rdf:Bag> | |
| 10035 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C16255"/> | |
| 10036 <rdf:li rdf:resource="https://identifiers.org/ChEBI/80404"/> | |
| 10037 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA08020202"/> | |
| 10038 </rdf:Bag> | |
| 10039 </bqbiol:is> | |
| 10040 </rdf:Description> | |
| 10041 </rdf:RDF> | |
| 10042 </annotation> | |
| 10043 </species> | |
| 10044 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H18O5S" hasOnlySubstanceUnits="false" id="C17223" metaid="ae105d81-4ea0-49c9-a48a-4f99cce1ff51" name="3-(5'-Methylthio)pentylmalic acid" sboTerm="SBO:0000240"> | |
| 10045 <notes> | |
| 10046 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10047 <p>kegg.compound: C17223</p> | |
| 10048 <p>PubChem: 96023631</p> | |
| 10049 <p>ChEBI: 80970</p> | |
| 10050 <p>NIKKAJI: J2.806.004A</p> | |
| 10051 <p>formula: C10H18O5S</p> | |
| 10052 <p>weight: 250.3119</p> | |
| 10053 </body> | |
| 10054 </notes> | |
| 10055 <annotation> | |
| 10056 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10057 <rdf:Description rdf:about="#ae105d81-4ea0-49c9-a48a-4f99cce1ff51"> | |
| 10058 <bqbiol:is> | |
| 10059 <rdf:Bag> | |
| 10060 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C17223"/> | |
| 10061 <rdf:li rdf:resource="https://identifiers.org/ChEBI/80970"/> | |
| 10062 </rdf:Bag> | |
| 10063 </bqbiol:is> | |
| 10064 </rdf:Description> | |
| 10065 </rdf:RDF> | |
| 10066 </annotation> | |
| 10067 </species> | |
| 10068 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C11H20O5S" hasOnlySubstanceUnits="false" id="C17226" metaid="d90eebaf-8e08-4c4b-81bf-fd60d1c662fc" name="2-(6'-Methylthio)hexylmalic acid" sboTerm="SBO:0000240"> | |
| 10069 <notes> | |
| 10070 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10071 <p>kegg.compound: C17226</p> | |
| 10072 <p>KNApSAcK: C00007653</p> | |
| 10073 <p>PubChem: 96023634</p> | |
| 10074 <p>ChEBI: 80972</p> | |
| 10075 <p>NIKKAJI: J2.806.057B</p> | |
| 10076 <p>formula: C11H20O5S</p> | |
| 10077 <p>weight: 264.3385</p> | |
| 10078 </body> | |
| 10079 </notes> | |
| 10080 <annotation> | |
| 10081 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10082 <rdf:Description rdf:about="#d90eebaf-8e08-4c4b-81bf-fd60d1c662fc"> | |
| 10083 <bqbiol:is> | |
| 10084 <rdf:Bag> | |
| 10085 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C17226"/> | |
| 10086 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007653"/> | |
| 10087 <rdf:li rdf:resource="https://identifiers.org/ChEBI/80972"/> | |
| 10088 </rdf:Bag> | |
| 10089 </bqbiol:is> | |
| 10090 </rdf:Description> | |
| 10091 </rdf:RDF> | |
| 10092 </annotation> | |
| 10093 </species> | |
| 10094 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C11H20O5S" hasOnlySubstanceUnits="false" id="C17227" metaid="a300b325-bbc3-403f-abc9-d76e6fe06a7b" name="3-(6'-Methylthio)hexylmalic acid" sboTerm="SBO:0000240"> | |
| 10095 <notes> | |
| 10096 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10097 <p>kegg.compound: C17227</p> | |
| 10098 <p>PubChem: 96023635</p> | |
| 10099 <p>ChEBI: 80973</p> | |
| 10100 <p>NIKKAJI: J2.806.075K</p> | |
| 10101 <p>formula: C11H20O5S</p> | |
| 10102 <p>weight: 264.3385</p> | |
| 10103 </body> | |
| 10104 </notes> | |
| 10105 <annotation> | |
| 10106 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10107 <rdf:Description rdf:about="#a300b325-bbc3-403f-abc9-d76e6fe06a7b"> | |
| 10108 <bqbiol:is> | |
| 10109 <rdf:Bag> | |
| 10110 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C17227"/> | |
| 10111 <rdf:li rdf:resource="https://identifiers.org/ChEBI/80973"/> | |
| 10112 </rdf:Bag> | |
| 10113 </bqbiol:is> | |
| 10114 </rdf:Description> | |
| 10115 </rdf:RDF> | |
| 10116 </annotation> | |
| 10117 </species> | |
| 10118 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C03294" metaid="bf19718a-3c17-4710-8209-b724911d3549" name="N-Formylmethionyl-tRNA" sboTerm="SBO:0000240"> | |
| 10119 <notes> | |
| 10120 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10121 <p>kegg.compound: C03294</p> | |
| 10122 <p>PubChem: 6151</p> | |
| 10123 <p>ChEBI: 17119</p> | |
| 10124 <p>formula: C21H30N6O12PSR(C5H8O6PR)n</p> | |
| 10125 </body> | |
| 10126 </notes> | |
| 10127 <annotation> | |
| 10128 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10129 <rdf:Description rdf:about="#bf19718a-3c17-4710-8209-b724911d3549"> | |
| 10130 <bqbiol:is> | |
| 10131 <rdf:Bag> | |
| 10132 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03294"/> | |
| 10133 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17119"/> | |
| 10134 </rdf:Bag> | |
| 10135 </bqbiol:is> | |
| 10136 </rdf:Description> | |
| 10137 </rdf:RDF> | |
| 10138 </annotation> | |
| 10139 </species> | |
| 10140 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H9N4O5PR2" hasOnlySubstanceUnits="false" id="C04261" metaid="_49c8f6fb-7b4b-45d5-aca3-48f54f2c88a1" name="Protein N(pi)-phospho-L-histidine" sboTerm="SBO:0000240"> | |
| 10141 <notes> | |
| 10142 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10143 <p>kegg.compound: C04261</p> | |
| 10144 <p>PubChem: 6926</p> | |
| 10145 <p>formula: C7H9N4O5PR2</p> | |
| 10146 </body> | |
| 10147 </notes> | |
| 10148 <annotation> | |
| 10149 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10150 <rdf:Description rdf:about="#_49c8f6fb-7b4b-45d5-aca3-48f54f2c88a1"> | |
| 10151 <bqbiol:is> | |
| 10152 <rdf:Bag> | |
| 10153 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04261"/> | |
| 10154 </rdf:Bag> | |
| 10155 </bqbiol:is> | |
| 10156 </rdf:Description> | |
| 10157 </rdf:RDF> | |
| 10158 </annotation> | |
| 10159 </species> | |
| 10160 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H11O8P" hasOnlySubstanceUnits="false" id="C03175" metaid="_6211f490-84d7-4e01-ad2e-f40c3a849d3b" name="Shikimate 3-phosphate" sboTerm="SBO:0000240"> | |
| 10161 <notes> | |
| 10162 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10163 <p>kegg.compound: C03175</p> | |
| 10164 <p>KNApSAcK: C00000002</p> | |
| 10165 <p>PubChem: 6057</p> | |
| 10166 <p>3DMET: B01636</p> | |
| 10167 <p>PDB-CCD: S3P</p> | |
| 10168 <p>ChEBI: 17052</p> | |
| 10169 <p>NIKKAJI: J746.034A</p> | |
| 10170 <p>formula: C7H11O8P</p> | |
| 10171 <p>weight: 254.1312</p> | |
| 10172 </body> | |
| 10173 </notes> | |
| 10174 <annotation> | |
| 10175 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10176 <rdf:Description rdf:about="#_6211f490-84d7-4e01-ad2e-f40c3a849d3b"> | |
| 10177 <bqbiol:is> | |
| 10178 <rdf:Bag> | |
| 10179 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03175"/> | |
| 10180 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00000002"/> | |
| 10181 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01636"/> | |
| 10182 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/S3P"/> | |
| 10183 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17052"/> | |
| 10184 </rdf:Bag> | |
| 10185 </bqbiol:is> | |
| 10186 </rdf:Description> | |
| 10187 </rdf:RDF> | |
| 10188 </annotation> | |
| 10189 </species> | |
| 10190 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C29H37N9O12" hasOnlySubstanceUnits="false" id="C04144" metaid="_7eae7a16-97f0-4fba-a1f0-1ed11195cc30" name="Tetrahydropteroyltri-L-glutamate" sboTerm="SBO:0000240"> | |
| 10191 <notes> | |
| 10192 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10193 <p>kegg.compound: C04144</p> | |
| 10194 <p>PubChem: 6829</p> | |
| 10195 <p>PDB-CCD: 39S</p> | |
| 10196 <p>ChEBI: 17420</p> | |
| 10197 <p>NIKKAJI: J2.747.003C</p> | |
| 10198 <p>formula: C29H37N9O12</p> | |
| 10199 <p>weight: 703.6572</p> | |
| 10200 </body> | |
| 10201 </notes> | |
| 10202 <annotation> | |
| 10203 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10204 <rdf:Description rdf:about="#_7eae7a16-97f0-4fba-a1f0-1ed11195cc30"> | |
| 10205 <bqbiol:is> | |
| 10206 <rdf:Bag> | |
| 10207 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04144"/> | |
| 10208 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/39S"/> | |
| 10209 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17420"/> | |
| 10210 </rdf:Bag> | |
| 10211 </bqbiol:is> | |
| 10212 </rdf:Description> | |
| 10213 </rdf:RDF> | |
| 10214 </annotation> | |
| 10215 </species> | |
| 10216 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C05359" metaid="_0370943d-0b8b-4fe0-8a3f-27aa616999e0" name="e-" sboTerm="SBO:0000240"> | |
| 10217 <notes> | |
| 10218 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10219 <p>kegg.compound: C05359</p> | |
| 10220 <p>PubChem: 7736</p> | |
| 10221 <p>ChEBI: 10545</p> | |
| 10222 </body> | |
| 10223 </notes> | |
| 10224 <annotation> | |
| 10225 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10226 <rdf:Description rdf:about="#_0370943d-0b8b-4fe0-8a3f-27aa616999e0"> | |
| 10227 <bqbiol:is> | |
| 10228 <rdf:Bag> | |
| 10229 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05359"/> | |
| 10230 <rdf:li rdf:resource="https://identifiers.org/ChEBI/10545"/> | |
| 10231 </rdf:Bag> | |
| 10232 </bqbiol:is> | |
| 10233 </rdf:Description> | |
| 10234 </rdf:RDF> | |
| 10235 </annotation> | |
| 10236 </species> | |
| 10237 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H12O5S" hasOnlySubstanceUnits="false" id="C17210" metaid="a795afb8-f490-4522-b4ae-772c2195d110" name="2-(2'-Methylthio)ethylmalic acid" sboTerm="SBO:0000240"> | |
| 10238 <notes> | |
| 10239 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10240 <p>kegg.compound: C17210</p> | |
| 10241 <p>KNApSAcK: C00007647</p> | |
| 10242 <p>PubChem: 96023618</p> | |
| 10243 <p>ChEBI: 50261</p> | |
| 10244 <p>NIKKAJI: J2.805.977I</p> | |
| 10245 <p>formula: C7H12O5S</p> | |
| 10246 <p>weight: 208.2322</p> | |
| 10247 </body> | |
| 10248 </notes> | |
| 10249 <annotation> | |
| 10250 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10251 <rdf:Description rdf:about="#a795afb8-f490-4522-b4ae-772c2195d110"> | |
| 10252 <bqbiol:is> | |
| 10253 <rdf:Bag> | |
| 10254 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C17210"/> | |
| 10255 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007647"/> | |
| 10256 <rdf:li rdf:resource="https://identifiers.org/ChEBI/50261"/> | |
| 10257 </rdf:Bag> | |
| 10258 </bqbiol:is> | |
| 10259 </rdf:Description> | |
| 10260 </rdf:RDF> | |
| 10261 </annotation> | |
| 10262 </species> | |
| 10263 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H12O5S" hasOnlySubstanceUnits="false" id="C17212" metaid="_732a29f9-f650-4097-97cd-1cdfac88f4df" name="3-(2'-Methylthio)ethylmalic acid" sboTerm="SBO:0000240"> | |
| 10264 <notes> | |
| 10265 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10266 <p>kegg.compound: C17212</p> | |
| 10267 <p>PubChem: 96023620</p> | |
| 10268 <p>ChEBI: 80963</p> | |
| 10269 <p>NIKKAJI: J2.805.980I</p> | |
| 10270 <p>formula: C7H12O5S</p> | |
| 10271 <p>weight: 208.2322</p> | |
| 10272 </body> | |
| 10273 </notes> | |
| 10274 <annotation> | |
| 10275 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10276 <rdf:Description rdf:about="#_732a29f9-f650-4097-97cd-1cdfac88f4df"> | |
| 10277 <bqbiol:is> | |
| 10278 <rdf:Bag> | |
| 10279 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C17212"/> | |
| 10280 <rdf:li rdf:resource="https://identifiers.org/ChEBI/80963"/> | |
| 10281 </rdf:Bag> | |
| 10282 </bqbiol:is> | |
| 10283 </rdf:Description> | |
| 10284 </rdf:RDF> | |
| 10285 </annotation> | |
| 10286 </species> | |
| 10287 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C8H14O5S" hasOnlySubstanceUnits="false" id="C17214" metaid="_9aa5aa26-1212-4a68-bf09-a9abd8b8f50e" name="2-(3'-Methylthio)propylmalic acid" sboTerm="SBO:0000240"> | |
| 10288 <notes> | |
| 10289 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10290 <p>kegg.compound: C17214</p> | |
| 10291 <p>KNApSAcK: C00007646</p> | |
| 10292 <p>PubChem: 96023622</p> | |
| 10293 <p>ChEBI: 50262</p> | |
| 10294 <p>NIKKAJI: J2.805.984A</p> | |
| 10295 <p>formula: C8H14O5S</p> | |
| 10296 <p>weight: 222.2588</p> | |
| 10297 </body> | |
| 10298 </notes> | |
| 10299 <annotation> | |
| 10300 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10301 <rdf:Description rdf:about="#_9aa5aa26-1212-4a68-bf09-a9abd8b8f50e"> | |
| 10302 <bqbiol:is> | |
| 10303 <rdf:Bag> | |
| 10304 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C17214"/> | |
| 10305 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007646"/> | |
| 10306 <rdf:li rdf:resource="https://identifiers.org/ChEBI/50262"/> | |
| 10307 </rdf:Bag> | |
| 10308 </bqbiol:is> | |
| 10309 </rdf:Description> | |
| 10310 </rdf:RDF> | |
| 10311 </annotation> | |
| 10312 </species> | |
| 10313 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C8H14O5S" hasOnlySubstanceUnits="false" id="C17215" metaid="_816b5ed6-e376-46e4-a7fd-c5f8eadb48ce" name="3-(3'-Methylthio)propylmalic acid" sboTerm="SBO:0000240"> | |
| 10314 <notes> | |
| 10315 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10316 <p>kegg.compound: C17215</p> | |
| 10317 <p>PubChem: 96023623</p> | |
| 10318 <p>ChEBI: 80964</p> | |
| 10319 <p>NIKKAJI: J2.805.985J</p> | |
| 10320 <p>formula: C8H14O5S</p> | |
| 10321 <p>weight: 222.2588</p> | |
| 10322 </body> | |
| 10323 </notes> | |
| 10324 <annotation> | |
| 10325 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10326 <rdf:Description rdf:about="#_816b5ed6-e376-46e4-a7fd-c5f8eadb48ce"> | |
| 10327 <bqbiol:is> | |
| 10328 <rdf:Bag> | |
| 10329 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C17215"/> | |
| 10330 <rdf:li rdf:resource="https://identifiers.org/ChEBI/80964"/> | |
| 10331 </rdf:Bag> | |
| 10332 </bqbiol:is> | |
| 10333 </rdf:Description> | |
| 10334 </rdf:RDF> | |
| 10335 </annotation> | |
| 10336 </species> | |
| 10337 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H15O10P" hasOnlySubstanceUnits="false" id="C19878" metaid="c1969382-3a7d-47ae-9892-697920810b76" name="D-glycero-alpha-D-manno-Heptose 7-phosphate" sboTerm="SBO:0000240"> | |
| 10338 <notes> | |
| 10339 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10340 <p>kegg.compound: C19878</p> | |
| 10341 <p>PubChem: 135626344</p> | |
| 10342 <p>PDB-CCD: M7P</p> | |
| 10343 <p>formula: C7H15O10P</p> | |
| 10344 <p>weight: 290.1618</p> | |
| 10345 </body> | |
| 10346 </notes> | |
| 10347 <annotation> | |
| 10348 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10349 <rdf:Description rdf:about="#c1969382-3a7d-47ae-9892-697920810b76"> | |
| 10350 <bqbiol:is> | |
| 10351 <rdf:Bag> | |
| 10352 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C19878"/> | |
| 10353 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/M7P"/> | |
| 10354 </rdf:Bag> | |
| 10355 </bqbiol:is> | |
| 10356 </rdf:Description> | |
| 10357 </rdf:RDF> | |
| 10358 </annotation> | |
| 10359 </species> | |
| 10360 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H16O5S" hasOnlySubstanceUnits="false" id="C17218" metaid="_99544bf3-b52c-4164-b72f-7527dac6b954" name="2-(4'-Methylthio)butylmalic acid" sboTerm="SBO:0000240"> | |
| 10361 <notes> | |
| 10362 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10363 <p>kegg.compound: C17218</p> | |
| 10364 <p>KNApSAcK: C00007644</p> | |
| 10365 <p>PubChem: 96023626</p> | |
| 10366 <p>ChEBI: 80966</p> | |
| 10367 <p>NIKKAJI: J2.805.987F</p> | |
| 10368 <p>formula: C9H16O5S</p> | |
| 10369 <p>weight: 236.2853</p> | |
| 10370 </body> | |
| 10371 </notes> | |
| 10372 <annotation> | |
| 10373 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10374 <rdf:Description rdf:about="#_99544bf3-b52c-4164-b72f-7527dac6b954"> | |
| 10375 <bqbiol:is> | |
| 10376 <rdf:Bag> | |
| 10377 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C17218"/> | |
| 10378 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007644"/> | |
| 10379 <rdf:li rdf:resource="https://identifiers.org/ChEBI/80966"/> | |
| 10380 </rdf:Bag> | |
| 10381 </bqbiol:is> | |
| 10382 </rdf:Description> | |
| 10383 </rdf:RDF> | |
| 10384 </annotation> | |
| 10385 </species> | |
| 10386 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H16O5S" hasOnlySubstanceUnits="false" id="C17219" metaid="_2c114b93-7772-4cfb-88fa-7041c96616e1" name="3-(4'-Methylthio)butylmalic acid" sboTerm="SBO:0000240"> | |
| 10387 <notes> | |
| 10388 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10389 <p>kegg.compound: C17219</p> | |
| 10390 <p>PubChem: 96023627</p> | |
| 10391 <p>ChEBI: 80967</p> | |
| 10392 <p>NIKKAJI: J2.806.001G</p> | |
| 10393 <p>formula: C9H16O5S</p> | |
| 10394 <p>weight: 236.2853</p> | |
| 10395 </body> | |
| 10396 </notes> | |
| 10397 <annotation> | |
| 10398 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10399 <rdf:Description rdf:about="#_2c114b93-7772-4cfb-88fa-7041c96616e1"> | |
| 10400 <bqbiol:is> | |
| 10401 <rdf:Bag> | |
| 10402 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C17219"/> | |
| 10403 <rdf:li rdf:resource="https://identifiers.org/ChEBI/80967"/> | |
| 10404 </rdf:Bag> | |
| 10405 </bqbiol:is> | |
| 10406 </rdf:Description> | |
| 10407 </rdf:RDF> | |
| 10408 </annotation> | |
| 10409 </species> | |
| 10410 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H10O4" hasOnlySubstanceUnits="false" id="C04272" metaid="b454bd5c-22e8-49db-ac9f-c7d2ec452e8b" name="(R)-2,3-Dihydroxy-3-methylbutanoate" sboTerm="SBO:0000240"> | |
| 10411 <notes> | |
| 10412 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10413 <p>kegg.compound: C04272</p> | |
| 10414 <p>PubChem: 6935</p> | |
| 10415 <p>3DMET: B01729</p> | |
| 10416 <p>ChEBI: 15684 49072</p> | |
| 10417 <p>LIPIDMAPS: LMFA01050453</p> | |
| 10418 <p>NIKKAJI: J57.649B</p> | |
| 10419 <p>formula: C5H10O4</p> | |
| 10420 <p>weight: 134.1305</p> | |
| 10421 </body> | |
| 10422 </notes> | |
| 10423 <annotation> | |
| 10424 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10425 <rdf:Description rdf:about="#b454bd5c-22e8-49db-ac9f-c7d2ec452e8b"> | |
| 10426 <bqbiol:is> | |
| 10427 <rdf:Bag> | |
| 10428 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04272"/> | |
| 10429 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01729"/> | |
| 10430 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15684 49072"/> | |
| 10431 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA01050453"/> | |
| 10432 </rdf:Bag> | |
| 10433 </bqbiol:is> | |
| 10434 </rdf:Description> | |
| 10435 </rdf:RDF> | |
| 10436 </annotation> | |
| 10437 </species> | |
| 10438 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C14H23N4O8P2S" hasOnlySubstanceUnits="false" id="C05125" metaid="b099da62-085e-46ce-9a3a-c94f68824cb9" name="2-(alpha-Hydroxyethyl)thiamine diphosphate" sboTerm="SBO:0000240"> | |
| 10439 <notes> | |
| 10440 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10441 <p>kegg.compound: C05125</p> | |
| 10442 <p>PubChem: 7546</p> | |
| 10443 <p>3DMET: B04982</p> | |
| 10444 <p>ChEBI: 978</p> | |
| 10445 <p>NIKKAJI: J683.157E</p> | |
| 10446 <p>formula: C14H23N4O8P2S</p> | |
| 10447 <p>weight: 469.3669</p> | |
| 10448 </body> | |
| 10449 </notes> | |
| 10450 <annotation> | |
| 10451 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10452 <rdf:Description rdf:about="#b099da62-085e-46ce-9a3a-c94f68824cb9"> | |
| 10453 <bqbiol:is> | |
| 10454 <rdf:Bag> | |
| 10455 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05125"/> | |
| 10456 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04982"/> | |
| 10457 <rdf:li rdf:resource="https://identifiers.org/ChEBI/978"/> | |
| 10458 </rdf:Bag> | |
| 10459 </bqbiol:is> | |
| 10460 </rdf:Description> | |
| 10461 </rdf:RDF> | |
| 10462 </annotation> | |
| 10463 </species> | |
| 10464 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H12O8P2" hasOnlySubstanceUnits="false" id="C11811" metaid="_7fc7d0dc-08e5-4871-a3c4-483534dc29a3" name="1-Hydroxy-2-methyl-2-butenyl 4-diphosphate" sboTerm="SBO:0000240"> | |
| 10465 <notes> | |
| 10466 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10467 <p>kegg.compound: C11811</p> | |
| 10468 <p>KNApSAcK: C00007567</p> | |
| 10469 <p>PubChem: 13975</p> | |
| 10470 <p>3DMET: B04320</p> | |
| 10471 <p>PDB-CCD: H6P</p> | |
| 10472 <p>ChEBI: 15664</p> | |
| 10473 <p>LIPIDMAPS: LMPR01010009</p> | |
| 10474 <p>NIKKAJI: J1.669.907A</p> | |
| 10475 <p>formula: C5H12O8P2</p> | |
| 10476 <p>weight: 262.0915</p> | |
| 10477 </body> | |
| 10478 </notes> | |
| 10479 <annotation> | |
| 10480 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10481 <rdf:Description rdf:about="#_7fc7d0dc-08e5-4871-a3c4-483534dc29a3"> | |
| 10482 <bqbiol:is> | |
| 10483 <rdf:Bag> | |
| 10484 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C11811"/> | |
| 10485 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007567"/> | |
| 10486 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04320"/> | |
| 10487 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/H6P"/> | |
| 10488 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15664"/> | |
| 10489 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMPR01010009"/> | |
| 10490 </rdf:Bag> | |
| 10491 </bqbiol:is> | |
| 10492 </rdf:Description> | |
| 10493 </rdf:RDF> | |
| 10494 </annotation> | |
| 10495 </species> | |
| 10496 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C14H14N6O3" hasOnlySubstanceUnits="false" id="C00921" metaid="b1e4da0f-5746-42ea-98ea-edfa7ec2dfdf" name="Dihydropteroate" sboTerm="SBO:0000240"> | |
| 10497 <notes> | |
| 10498 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10499 <p>kegg.compound: C00921</p> | |
| 10500 <p>KNApSAcK: C00007228</p> | |
| 10501 <p>PubChem: 4175</p> | |
| 10502 <p>3DMET: B01352</p> | |
| 10503 <p>PDB-CCD: 78H</p> | |
| 10504 <p>ChEBI: 17839 4581</p> | |
| 10505 <p>NIKKAJI: J670.934F</p> | |
| 10506 <p>formula: C14H14N6O3</p> | |
| 10507 <p>weight: 314.2994</p> | |
| 10508 </body> | |
| 10509 </notes> | |
| 10510 <annotation> | |
| 10511 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10512 <rdf:Description rdf:about="#b1e4da0f-5746-42ea-98ea-edfa7ec2dfdf"> | |
| 10513 <bqbiol:is> | |
| 10514 <rdf:Bag> | |
| 10515 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00921"/> | |
| 10516 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007228"/> | |
| 10517 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01352"/> | |
| 10518 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/78H"/> | |
| 10519 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17839 4581"/> | |
| 10520 </rdf:Bag> | |
| 10521 </bqbiol:is> | |
| 10522 </rdf:Description> | |
| 10523 </rdf:RDF> | |
| 10524 </annotation> | |
| 10525 </species> | |
| 10526 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H14O12P2" hasOnlySubstanceUnits="false" id="C05378" metaid="_1b12b4fa-4cc3-4b0e-a8d4-483122a9769c" name="beta-D-Fructose 1,6-bisphosphate" sboTerm="SBO:0000240"> | |
| 10527 <notes> | |
| 10528 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10529 <p>kegg.compound: C05378</p> | |
| 10530 <p>PubChem: 7752</p> | |
| 10531 <p>3DMET: B01851</p> | |
| 10532 <p>PDB-CCD: FBP</p> | |
| 10533 <p>ChEBI: 28013</p> | |
| 10534 <p>NIKKAJI: J322.162H</p> | |
| 10535 <p>formula: C6H14O12P2</p> | |
| 10536 <p>weight: 340.1157</p> | |
| 10537 </body> | |
| 10538 </notes> | |
| 10539 <annotation> | |
| 10540 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10541 <rdf:Description rdf:about="#_1b12b4fa-4cc3-4b0e-a8d4-483122a9769c"> | |
| 10542 <bqbiol:is> | |
| 10543 <rdf:Bag> | |
| 10544 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05378"/> | |
| 10545 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01851"/> | |
| 10546 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/FBP"/> | |
| 10547 <rdf:li rdf:resource="https://identifiers.org/ChEBI/28013"/> | |
| 10548 </rdf:Bag> | |
| 10549 </bqbiol:is> | |
| 10550 </rdf:Description> | |
| 10551 </rdf:RDF> | |
| 10552 </annotation> | |
| 10553 </species> | |
| 10554 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H22O5S" hasOnlySubstanceUnits="false" id="C17230" metaid="_5678a8e1-7b5f-41c8-8cbf-e9aa024ef84a" name="2-(7'-Methylthio)heptylmalic acid" sboTerm="SBO:0000240"> | |
| 10555 <notes> | |
| 10556 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10557 <p>kegg.compound: C17230</p> | |
| 10558 <p>KNApSAcK: C00007650</p> | |
| 10559 <p>PubChem: 96023638</p> | |
| 10560 <p>ChEBI: 80975</p> | |
| 10561 <p>NIKKAJI: J2.806.128E</p> | |
| 10562 <p>formula: C12H22O5S</p> | |
| 10563 <p>weight: 278.3651</p> | |
| 10564 </body> | |
| 10565 </notes> | |
| 10566 <annotation> | |
| 10567 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10568 <rdf:Description rdf:about="#_5678a8e1-7b5f-41c8-8cbf-e9aa024ef84a"> | |
| 10569 <bqbiol:is> | |
| 10570 <rdf:Bag> | |
| 10571 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C17230"/> | |
| 10572 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007650"/> | |
| 10573 <rdf:li rdf:resource="https://identifiers.org/ChEBI/80975"/> | |
| 10574 </rdf:Bag> | |
| 10575 </bqbiol:is> | |
| 10576 </rdf:Description> | |
| 10577 </rdf:RDF> | |
| 10578 </annotation> | |
| 10579 </species> | |
| 10580 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H22O5S" hasOnlySubstanceUnits="false" id="C17231" metaid="ceef3508-230a-4bcd-80fa-eaf9d17bf0ce" name="3-(7'-Methylthio)heptylmalic acid" sboTerm="SBO:0000240"> | |
| 10581 <notes> | |
| 10582 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10583 <p>kegg.compound: C17231</p> | |
| 10584 <p>PubChem: 96023639</p> | |
| 10585 <p>ChEBI: 80976</p> | |
| 10586 <p>NIKKAJI: J2.806.164A</p> | |
| 10587 <p>formula: C12H22O5S</p> | |
| 10588 <p>weight: 278.3651</p> | |
| 10589 </body> | |
| 10590 </notes> | |
| 10591 <annotation> | |
| 10592 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10593 <rdf:Description rdf:about="#ceef3508-230a-4bcd-80fa-eaf9d17bf0ce"> | |
| 10594 <bqbiol:is> | |
| 10595 <rdf:Bag> | |
| 10596 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C17231"/> | |
| 10597 <rdf:li rdf:resource="https://identifiers.org/ChEBI/80976"/> | |
| 10598 </rdf:Bag> | |
| 10599 </bqbiol:is> | |
| 10600 </rdf:Description> | |
| 10601 </rdf:RDF> | |
| 10602 </annotation> | |
| 10603 </species> | |
| 10604 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H18N2O3" hasOnlySubstanceUnits="false" id="C01909" metaid="_3a1fa587-8677-41a3-a876-46183ce6c2cc" name="Dethiobiotin" sboTerm="SBO:0000240"> | |
| 10605 <notes> | |
| 10606 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10607 <p>kegg.compound: C01909</p> | |
| 10608 <p>KNApSAcK: C00000757</p> | |
| 10609 <p>CAS: 533-48-2</p> | |
| 10610 <p>PubChem: 5017</p> | |
| 10611 <p>3DMET: B04822</p> | |
| 10612 <p>ChEBI: 16691</p> | |
| 10613 <p>NIKKAJI: J9.406D</p> | |
| 10614 <p>formula: C10H18N2O3</p> | |
| 10615 <p>weight: 214.2615</p> | |
| 10616 </body> | |
| 10617 </notes> | |
| 10618 <annotation> | |
| 10619 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10620 <rdf:Description rdf:about="#_3a1fa587-8677-41a3-a876-46183ce6c2cc"> | |
| 10621 <bqbiol:is> | |
| 10622 <rdf:Bag> | |
| 10623 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01909"/> | |
| 10624 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00000757"/> | |
| 10625 <rdf:li rdf:resource="https://identifiers.org/CAS/533-48-2"/> | |
| 10626 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04822"/> | |
| 10627 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16691"/> | |
| 10628 </rdf:Bag> | |
| 10629 </bqbiol:is> | |
| 10630 </rdf:Description> | |
| 10631 </rdf:RDF> | |
| 10632 </annotation> | |
| 10633 </species> | |
| 10634 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H15O10P" hasOnlySubstanceUnits="false" id="C05382" metaid="_65b0d548-67e8-49a8-aa12-1a5e21339cf5" name="Sedoheptulose 7-phosphate" sboTerm="SBO:0000240"> | |
| 10635 <notes> | |
| 10636 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10637 <p>kegg.compound: C05382</p> | |
| 10638 <p>KNApSAcK: C00019575</p> | |
| 10639 <p>PubChem: 7756</p> | |
| 10640 <p>3DMET: B05013</p> | |
| 10641 <p>PDB-CCD: I22</p> | |
| 10642 <p>ChEBI: 15721</p> | |
| 10643 <p>NIKKAJI: J604.570G</p> | |
| 10644 <p>formula: C7H15O10P</p> | |
| 10645 <p>weight: 290.1618</p> | |
| 10646 </body> | |
| 10647 </notes> | |
| 10648 <annotation> | |
| 10649 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10650 <rdf:Description rdf:about="#_65b0d548-67e8-49a8-aa12-1a5e21339cf5"> | |
| 10651 <bqbiol:is> | |
| 10652 <rdf:Bag> | |
| 10653 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05382"/> | |
| 10654 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019575"/> | |
| 10655 <rdf:li rdf:resource="https://identifiers.org/3DMET/B05013"/> | |
| 10656 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/I22"/> | |
| 10657 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15721"/> | |
| 10658 </rdf:Bag> | |
| 10659 </bqbiol:is> | |
| 10660 </rdf:Description> | |
| 10661 </rdf:RDF> | |
| 10662 </annotation> | |
| 10663 </species> | |
| 10664 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C16H25N4O10P2S" hasOnlySubstanceUnits="false" id="C05381" metaid="cd65a145-5171-4f38-bc5d-965a1df8b523" name="3-Carboxy-1-hydroxypropyl-ThPP" sboTerm="SBO:0000240"> | |
| 10665 <notes> | |
| 10666 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10667 <p>kegg.compound: C05381</p> | |
| 10668 <p>PubChem: 7755</p> | |
| 10669 <p>ChEBI: 1463</p> | |
| 10670 <p>NIKKAJI: J2.755.812G</p> | |
| 10671 <p>formula: C16H25N4O10P2S</p> | |
| 10672 <p>weight: 527.403</p> | |
| 10673 </body> | |
| 10674 </notes> | |
| 10675 <annotation> | |
| 10676 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10677 <rdf:Description rdf:about="#cd65a145-5171-4f38-bc5d-965a1df8b523"> | |
| 10678 <bqbiol:is> | |
| 10679 <rdf:Bag> | |
| 10680 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05381"/> | |
| 10681 <rdf:li rdf:resource="https://identifiers.org/ChEBI/1463"/> | |
| 10682 </rdf:Bag> | |
| 10683 </bqbiol:is> | |
| 10684 </rdf:Description> | |
| 10685 </rdf:RDF> | |
| 10686 </annotation> | |
| 10687 </species> | |
| 10688 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H8NO7P" hasOnlySubstanceUnits="false" id="C03082" metaid="f6cd9322-9a86-45b4-911c-6802c9a3d7b7" name="4-Phospho-L-aspartate" sboTerm="SBO:0000240"> | |
| 10689 <notes> | |
| 10690 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10691 <p>kegg.compound: C03082</p> | |
| 10692 <p>KNApSAcK: C00007471</p> | |
| 10693 <p>CAS: 22138-53-0</p> | |
| 10694 <p>PubChem: 5980</p> | |
| 10695 <p>3DMET: B01629</p> | |
| 10696 <p>PDB-CCD: PHD</p> | |
| 10697 <p>ChEBI: 15836</p> | |
| 10698 <p>NIKKAJI: J37.493H</p> | |
| 10699 <p>formula: C4H8NO7P</p> | |
| 10700 <p>weight: 213.0826</p> | |
| 10701 </body> | |
| 10702 </notes> | |
| 10703 <annotation> | |
| 10704 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10705 <rdf:Description rdf:about="#f6cd9322-9a86-45b4-911c-6802c9a3d7b7"> | |
| 10706 <bqbiol:is> | |
| 10707 <rdf:Bag> | |
| 10708 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03082"/> | |
| 10709 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007471"/> | |
| 10710 <rdf:li rdf:resource="https://identifiers.org/CAS/22138-53-0"/> | |
| 10711 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01629"/> | |
| 10712 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/PHD"/> | |
| 10713 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15836"/> | |
| 10714 </rdf:Bag> | |
| 10715 </bqbiol:is> | |
| 10716 </rdf:Description> | |
| 10717 </rdf:RDF> | |
| 10718 </annotation> | |
| 10719 </species> | |
| 10720 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O4S" hasOnlySubstanceUnits="false" id="C03089" metaid="_8ff05696-83cc-41fa-9c3f-f8e2fd9945f7" name="5-Methylthio-D-ribose" sboTerm="SBO:0000240"> | |
| 10721 <notes> | |
| 10722 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10723 <p>kegg.compound: C03089</p> | |
| 10724 <p>PubChem: 5987</p> | |
| 10725 <p>3DMET: B01630</p> | |
| 10726 <p>PDB-CCD: SR1</p> | |
| 10727 <p>ChEBI: 78440</p> | |
| 10728 <p>NIKKAJI: J1.615.621C</p> | |
| 10729 <p>formula: C6H12O4S</p> | |
| 10730 <p>weight: 180.2221</p> | |
| 10731 </body> | |
| 10732 </notes> | |
| 10733 <annotation> | |
| 10734 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10735 <rdf:Description rdf:about="#_8ff05696-83cc-41fa-9c3f-f8e2fd9945f7"> | |
| 10736 <bqbiol:is> | |
| 10737 <rdf:Bag> | |
| 10738 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03089"/> | |
| 10739 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01630"/> | |
| 10740 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/SR1"/> | |
| 10741 <rdf:li rdf:resource="https://identifiers.org/ChEBI/78440"/> | |
| 10742 </rdf:Bag> | |
| 10743 </bqbiol:is> | |
| 10744 </rdf:Description> | |
| 10745 </rdf:RDF> | |
| 10746 </annotation> | |
| 10747 </species> | |
| 10748 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H14N2O4" hasOnlySubstanceUnits="false" id="C00931" metaid="c72305bf-148c-4da3-9952-5b504a691112" name="Porphobilinogen" sboTerm="SBO:0000240"> | |
| 10749 <notes> | |
| 10750 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10751 <p>kegg.compound: C00931</p> | |
| 10752 <p>KNApSAcK: C00007339</p> | |
| 10753 <p>CAS: 487-90-1</p> | |
| 10754 <p>PubChem: 4184</p> | |
| 10755 <p>3DMET: B00202</p> | |
| 10756 <p>PDB-CCD: PBG</p> | |
| 10757 <p>ChEBI: 17381</p> | |
| 10758 <p>NIKKAJI: J6.026G</p> | |
| 10759 <p>formula: C10H14N2O4</p> | |
| 10760 <p>weight: 226.2292</p> | |
| 10761 </body> | |
| 10762 </notes> | |
| 10763 <annotation> | |
| 10764 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10765 <rdf:Description rdf:about="#c72305bf-148c-4da3-9952-5b504a691112"> | |
| 10766 <bqbiol:is> | |
| 10767 <rdf:Bag> | |
| 10768 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00931"/> | |
| 10769 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007339"/> | |
| 10770 <rdf:li rdf:resource="https://identifiers.org/CAS/487-90-1"/> | |
| 10771 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00202"/> | |
| 10772 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/PBG"/> | |
| 10773 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17381"/> | |
| 10774 </rdf:Bag> | |
| 10775 </bqbiol:is> | |
| 10776 </rdf:Description> | |
| 10777 </rdf:RDF> | |
| 10778 </annotation> | |
| 10779 </species> | |
| 10780 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C23H38N7O17P3S" hasOnlySubstanceUnits="false" id="C00024" metaid="ee9eb419-ca13-4606-ba06-170486a0f95d" name="Acetyl-CoA" sboTerm="SBO:0000240"> | |
| 10781 <notes> | |
| 10782 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10783 <p>kegg.compound: C00024</p> | |
| 10784 <p>KNApSAcK: C00007259</p> | |
| 10785 <p>CAS: 72-89-9</p> | |
| 10786 <p>PubChem: 3326</p> | |
| 10787 <p>3DMET: B04621</p> | |
| 10788 <p>PDB-CCD: ACO</p> | |
| 10789 <p>ChEBI: 15351</p> | |
| 10790 <p>LIPIDMAPS: LMFA07050281</p> | |
| 10791 <p>NIKKAJI: J192.549K</p> | |
| 10792 <p>formula: C23H38N7O17P3S</p> | |
| 10793 <p>weight: 809.5708</p> | |
| 10794 </body> | |
| 10795 </notes> | |
| 10796 <annotation> | |
| 10797 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10798 <rdf:Description rdf:about="#ee9eb419-ca13-4606-ba06-170486a0f95d"> | |
| 10799 <bqbiol:is> | |
| 10800 <rdf:Bag> | |
| 10801 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00024"/> | |
| 10802 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007259"/> | |
| 10803 <rdf:li rdf:resource="https://identifiers.org/CAS/72-89-9"/> | |
| 10804 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04621"/> | |
| 10805 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/ACO"/> | |
| 10806 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15351"/> | |
| 10807 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA07050281"/> | |
| 10808 </rdf:Bag> | |
| 10809 </bqbiol:is> | |
| 10810 </rdf:Description> | |
| 10811 </rdf:RDF> | |
| 10812 </annotation> | |
| 10813 </species> | |
| 10814 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H13N5O5" hasOnlySubstanceUnits="false" id="C00387" metaid="_96468db1-f9ff-4b4e-9a26-0a2fade02dc0" name="Guanosine" sboTerm="SBO:0000240"> | |
| 10815 <notes> | |
| 10816 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10817 <p>kegg.compound: C00387</p> | |
| 10818 <p>KNApSAcK: C00019679</p> | |
| 10819 <p>CAS: 118-00-3</p> | |
| 10820 <p>PubChem: 3677</p> | |
| 10821 <p>3DMET: B01233</p> | |
| 10822 <p>PDB-CCD: GMP</p> | |
| 10823 <p>ChEBI: 16750</p> | |
| 10824 <p>NIKKAJI: J10.076E</p> | |
| 10825 <p>formula: C10H13N5O5</p> | |
| 10826 <p>weight: 283.2407</p> | |
| 10827 </body> | |
| 10828 </notes> | |
| 10829 <annotation> | |
| 10830 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10831 <rdf:Description rdf:about="#_96468db1-f9ff-4b4e-9a26-0a2fade02dc0"> | |
| 10832 <bqbiol:is> | |
| 10833 <rdf:Bag> | |
| 10834 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00387"/> | |
| 10835 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019679"/> | |
| 10836 <rdf:li rdf:resource="https://identifiers.org/CAS/118-00-3"/> | |
| 10837 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01233"/> | |
| 10838 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/GMP"/> | |
| 10839 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16750"/> | |
| 10840 </rdf:Bag> | |
| 10841 </bqbiol:is> | |
| 10842 </rdf:Description> | |
| 10843 </rdf:RDF> | |
| 10844 </annotation> | |
| 10845 </species> | |
| 10846 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H14N5O8P" hasOnlySubstanceUnits="false" id="C00144" metaid="_5b3a8b43-7367-4114-b1e3-e250128e9d67" name="GMP" sboTerm="SBO:0000240"> | |
| 10847 <notes> | |
| 10848 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10849 <p>kegg.compound: C00144</p> | |
| 10850 <p>KNApSAcK: C00019635</p> | |
| 10851 <p>CAS: 85-32-5</p> | |
| 10852 <p>PubChem: 3444</p> | |
| 10853 <p>3DMET: B01172</p> | |
| 10854 <p>PDB-CCD: 5GP G</p> | |
| 10855 <p>ChEBI: 17345</p> | |
| 10856 <p>NIKKAJI: J10.615A</p> | |
| 10857 <p>formula: C10H14N5O8P</p> | |
| 10858 <p>weight: 363.2206</p> | |
| 10859 </body> | |
| 10860 </notes> | |
| 10861 <annotation> | |
| 10862 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10863 <rdf:Description rdf:about="#_5b3a8b43-7367-4114-b1e3-e250128e9d67"> | |
| 10864 <bqbiol:is> | |
| 10865 <rdf:Bag> | |
| 10866 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00144"/> | |
| 10867 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019635"/> | |
| 10868 <rdf:li rdf:resource="https://identifiers.org/CAS/85-32-5"/> | |
| 10869 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01172"/> | |
| 10870 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/5GP G"/> | |
| 10871 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17345"/> | |
| 10872 </rdf:Bag> | |
| 10873 </bqbiol:is> | |
| 10874 </rdf:Description> | |
| 10875 </rdf:RDF> | |
| 10876 </annotation> | |
| 10877 </species> | |
| 10878 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H11O9P" hasOnlySubstanceUnits="false" id="C01236" metaid="dc8574b9-5da1-444f-bd28-6c75bf57f808" name="D-Glucono-1,5-lactone 6-phosphate" sboTerm="SBO:0000240"> | |
| 10879 <notes> | |
| 10880 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10881 <p>kegg.compound: C01236</p> | |
| 10882 <p>PubChem: 4457</p> | |
| 10883 <p>3DMET: B01420</p> | |
| 10884 <p>ChEBI: 16938</p> | |
| 10885 <p>NIKKAJI: J40.067J</p> | |
| 10886 <p>formula: C6H11O9P</p> | |
| 10887 <p>weight: 258.1199</p> | |
| 10888 </body> | |
| 10889 </notes> | |
| 10890 <annotation> | |
| 10891 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10892 <rdf:Description rdf:about="#dc8574b9-5da1-444f-bd28-6c75bf57f808"> | |
| 10893 <bqbiol:is> | |
| 10894 <rdf:Bag> | |
| 10895 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01236"/> | |
| 10896 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01420"/> | |
| 10897 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16938"/> | |
| 10898 </rdf:Bag> | |
| 10899 </bqbiol:is> | |
| 10900 </rdf:Description> | |
| 10901 </rdf:RDF> | |
| 10902 </annotation> | |
| 10903 </species> | |
| 10904 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H4O3" hasOnlySubstanceUnits="false" id="C00022" metaid="_06da994b-2ad6-4e7f-9373-809a936292b2" name="Pyruvate" sboTerm="SBO:0000240"> | |
| 10905 <notes> | |
| 10906 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10907 <p>kegg.compound: C00022</p> | |
| 10908 <p>KNApSAcK: C00001200</p> | |
| 10909 <p>CAS: 127-17-3</p> | |
| 10910 <p>PubChem: 3324</p> | |
| 10911 <p>3DMET: B00006</p> | |
| 10912 <p>PDB-CCD: PYR</p> | |
| 10913 <p>ChEBI: 15361 32816</p> | |
| 10914 <p>LIPIDMAPS: LMFA01060077</p> | |
| 10915 <p>LipidBank: DFA0385</p> | |
| 10916 <p>NIKKAJI: J2.015J</p> | |
| 10917 <p>formula: C3H4O3</p> | |
| 10918 <p>weight: 88.0621</p> | |
| 10919 </body> | |
| 10920 </notes> | |
| 10921 <annotation> | |
| 10922 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10923 <rdf:Description rdf:about="#_06da994b-2ad6-4e7f-9373-809a936292b2"> | |
| 10924 <bqbiol:is> | |
| 10925 <rdf:Bag> | |
| 10926 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00022"/> | |
| 10927 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001200"/> | |
| 10928 <rdf:li rdf:resource="https://identifiers.org/CAS/127-17-3"/> | |
| 10929 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00006"/> | |
| 10930 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/PYR"/> | |
| 10931 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15361 32816"/> | |
| 10932 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA01060077"/> | |
| 10933 <rdf:li rdf:resource="https://identifiers.org/LipidBank/DFA0385"/> | |
| 10934 </rdf:Bag> | |
| 10935 </bqbiol:is> | |
| 10936 </rdf:Description> | |
| 10937 </rdf:RDF> | |
| 10938 </annotation> | |
| 10939 </species> | |
| 10940 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C20H23N7O6" hasOnlySubstanceUnits="false" id="C00143" metaid="_61e4c5e6-4278-46f9-93e0-a2cfca105f87" name="5,10-Methylenetetrahydrofolate" sboTerm="SBO:0000240"> | |
| 10941 <notes> | |
| 10942 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10943 <p>kegg.compound: C00143</p> | |
| 10944 <p>KNApSAcK: C00007250</p> | |
| 10945 <p>CAS: 3432-99-3</p> | |
| 10946 <p>PubChem: 3443</p> | |
| 10947 <p>3DMET: B04640</p> | |
| 10948 <p>PDB-CCD: MEF MHF</p> | |
| 10949 <p>ChEBI: 1989</p> | |
| 10950 <p>NIKKAJI: J356.347B</p> | |
| 10951 <p>formula: C20H23N7O6</p> | |
| 10952 <p>weight: 457.4399</p> | |
| 10953 </body> | |
| 10954 </notes> | |
| 10955 <annotation> | |
| 10956 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10957 <rdf:Description rdf:about="#_61e4c5e6-4278-46f9-93e0-a2cfca105f87"> | |
| 10958 <bqbiol:is> | |
| 10959 <rdf:Bag> | |
| 10960 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00143"/> | |
| 10961 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007250"/> | |
| 10962 <rdf:li rdf:resource="https://identifiers.org/CAS/3432-99-3"/> | |
| 10963 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04640"/> | |
| 10964 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/MEF MHF"/> | |
| 10965 <rdf:li rdf:resource="https://identifiers.org/ChEBI/1989"/> | |
| 10966 </rdf:Bag> | |
| 10967 </bqbiol:is> | |
| 10968 </rdf:Description> | |
| 10969 </rdf:RDF> | |
| 10970 </annotation> | |
| 10971 </species> | |
| 10972 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H4N4O2" hasOnlySubstanceUnits="false" id="C00385" metaid="a5e8e88e-de5c-49ba-86e5-bd780be486e1" name="Xanthine" sboTerm="SBO:0000240"> | |
| 10973 <notes> | |
| 10974 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 10975 <p>kegg.compound: C00385</p> | |
| 10976 <p>KNApSAcK: C00019660</p> | |
| 10977 <p>CAS: 69-89-6</p> | |
| 10978 <p>PubChem: 3675</p> | |
| 10979 <p>3DMET: B00099</p> | |
| 10980 <p>PDB-CCD: XAN</p> | |
| 10981 <p>ChEBI: 17712 48517</p> | |
| 10982 <p>NIKKAJI: J2.371J</p> | |
| 10983 <p>formula: C5H4N4O2</p> | |
| 10984 <p>weight: 152.1109</p> | |
| 10985 </body> | |
| 10986 </notes> | |
| 10987 <annotation> | |
| 10988 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 10989 <rdf:Description rdf:about="#a5e8e88e-de5c-49ba-86e5-bd780be486e1"> | |
| 10990 <bqbiol:is> | |
| 10991 <rdf:Bag> | |
| 10992 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00385"/> | |
| 10993 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019660"/> | |
| 10994 <rdf:li rdf:resource="https://identifiers.org/CAS/69-89-6"/> | |
| 10995 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00099"/> | |
| 10996 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/XAN"/> | |
| 10997 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17712 48517"/> | |
| 10998 </rdf:Bag> | |
| 10999 </bqbiol:is> | |
| 11000 </rdf:Description> | |
| 11001 </rdf:RDF> | |
| 11002 </annotation> | |
| 11003 </species> | |
| 11004 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H9NO3" hasOnlySubstanceUnits="false" id="C00263" metaid="cb9d5716-c337-486c-9357-9a057558c075" name="L-Homoserine" sboTerm="SBO:0000240"> | |
| 11005 <notes> | |
| 11006 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11007 <p>kegg.compound: C00263</p> | |
| 11008 <p>KNApSAcK: C00001366</p> | |
| 11009 <p>CAS: 672-15-1</p> | |
| 11010 <p>PubChem: 3561</p> | |
| 11011 <p>3DMET: B01202</p> | |
| 11012 <p>PDB-CCD: HSE</p> | |
| 11013 <p>ChEBI: 15699</p> | |
| 11014 <p>NIKKAJI: J9.199E</p> | |
| 11015 <p>formula: C4H9NO3</p> | |
| 11016 <p>weight: 119.1192</p> | |
| 11017 </body> | |
| 11018 </notes> | |
| 11019 <annotation> | |
| 11020 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11021 <rdf:Description rdf:about="#cb9d5716-c337-486c-9357-9a057558c075"> | |
| 11022 <bqbiol:is> | |
| 11023 <rdf:Bag> | |
| 11024 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00263"/> | |
| 11025 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001366"/> | |
| 11026 <rdf:li rdf:resource="https://identifiers.org/CAS/672-15-1"/> | |
| 11027 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01202"/> | |
| 11028 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/HSE"/> | |
| 11029 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15699"/> | |
| 11030 </rdf:Bag> | |
| 11031 </bqbiol:is> | |
| 11032 </rdf:Description> | |
| 11033 </rdf:RDF> | |
| 11034 </annotation> | |
| 11035 </species> | |
| 11036 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C14H20N6O5S" hasOnlySubstanceUnits="false" id="C00021" metaid="_094cdf67-b05d-42e4-baba-0e39abed8fe6" name="S-Adenosyl-L-homocysteine" sboTerm="SBO:0000240"> | |
| 11037 <notes> | |
| 11038 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11039 <p>kegg.compound: C00021</p> | |
| 11040 <p>KNApSAcK: C00007230</p> | |
| 11041 <p>CAS: 979-92-0</p> | |
| 11042 <p>PubChem: 3323</p> | |
| 11043 <p>3DMET: B01134</p> | |
| 11044 <p>PDB-CCD: SAH SAO</p> | |
| 11045 <p>ChEBI: 16680 181457</p> | |
| 11046 <p>NIKKAJI: J14.397I</p> | |
| 11047 <p>formula: C14H20N6O5S</p> | |
| 11048 <p>weight: 384.4108</p> | |
| 11049 </body> | |
| 11050 </notes> | |
| 11051 <annotation> | |
| 11052 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11053 <rdf:Description rdf:about="#_094cdf67-b05d-42e4-baba-0e39abed8fe6"> | |
| 11054 <bqbiol:is> | |
| 11055 <rdf:Bag> | |
| 11056 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00021"/> | |
| 11057 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007230"/> | |
| 11058 <rdf:li rdf:resource="https://identifiers.org/CAS/979-92-0"/> | |
| 11059 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01134"/> | |
| 11060 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/SAH SAO"/> | |
| 11061 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16680 181457"/> | |
| 11062 </rdf:Bag> | |
| 11063 </bqbiol:is> | |
| 11064 </rdf:Description> | |
| 11065 </rdf:RDF> | |
| 11066 </annotation> | |
| 11067 </species> | |
| 11068 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C14H8N2O8" hasOnlySubstanceUnits="false" id="C01359" metaid="_6c8d3fbd-ccf1-4c51-8a2a-06613c1102de" name="PQQH2" sboTerm="SBO:0000240"> | |
| 11069 <notes> | |
| 11070 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11071 <p>kegg.compound: C01359</p> | |
| 11072 <p>CAS: 79127-57-4</p> | |
| 11073 <p>PubChem: 4562</p> | |
| 11074 <p>3DMET: B00277</p> | |
| 11075 <p>ChEBI: 18356</p> | |
| 11076 <p>NIKKAJI: J264.250F</p> | |
| 11077 <p>formula: C14H8N2O8</p> | |
| 11078 <p>weight: 332.2219</p> | |
| 11079 </body> | |
| 11080 </notes> | |
| 11081 <annotation> | |
| 11082 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11083 <rdf:Description rdf:about="#_6c8d3fbd-ccf1-4c51-8a2a-06613c1102de"> | |
| 11084 <bqbiol:is> | |
| 11085 <rdf:Bag> | |
| 11086 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01359"/> | |
| 11087 <rdf:li rdf:resource="https://identifiers.org/CAS/79127-57-4"/> | |
| 11088 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00277"/> | |
| 11089 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18356"/> | |
| 11090 </rdf:Bag> | |
| 11091 </bqbiol:is> | |
| 11092 </rdf:Description> | |
| 11093 </rdf:RDF> | |
| 11094 </annotation> | |
| 11095 </species> | |
| 11096 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H4N4O" hasOnlySubstanceUnits="false" id="C00262" metaid="_0dafde0e-d332-4365-86bc-35cefceb05ef" name="Hypoxanthine" sboTerm="SBO:0000240"> | |
| 11097 <notes> | |
| 11098 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11099 <p>kegg.compound: C00262</p> | |
| 11100 <p>KNApSAcK: C00001502</p> | |
| 11101 <p>CAS: 68-94-0</p> | |
| 11102 <p>PubChem: 3560</p> | |
| 11103 <p>3DMET: B00078</p> | |
| 11104 <p>PDB-CCD: HPA</p> | |
| 11105 <p>ChEBI: 17368</p> | |
| 11106 <p>NIKKAJI: J1.934H</p> | |
| 11107 <p>formula: C5H4N4O</p> | |
| 11108 <p>weight: 136.1115</p> | |
| 11109 </body> | |
| 11110 </notes> | |
| 11111 <annotation> | |
| 11112 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11113 <rdf:Description rdf:about="#_0dafde0e-d332-4365-86bc-35cefceb05ef"> | |
| 11114 <bqbiol:is> | |
| 11115 <rdf:Bag> | |
| 11116 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00262"/> | |
| 11117 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001502"/> | |
| 11118 <rdf:li rdf:resource="https://identifiers.org/CAS/68-94-0"/> | |
| 11119 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00078"/> | |
| 11120 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/HPA"/> | |
| 11121 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17368"/> | |
| 11122 </rdf:Bag> | |
| 11123 </bqbiol:is> | |
| 11124 </rdf:Description> | |
| 11125 </rdf:RDF> | |
| 11126 </annotation> | |
| 11127 </species> | |
| 11128 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H14N5O7P" hasOnlySubstanceUnits="false" id="C00020" metaid="_76ac6050-ef92-40d9-aacb-2162ff843058" name="AMP" sboTerm="SBO:0000240"> | |
| 11129 <notes> | |
| 11130 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11131 <p>kegg.compound: C00020</p> | |
| 11132 <p>KNApSAcK: C00019347</p> | |
| 11133 <p>CAS: 61-19-8</p> | |
| 11134 <p>PubChem: 3322</p> | |
| 11135 <p>3DMET: B01133</p> | |
| 11136 <p>PDB-CCD: A AMP AP7</p> | |
| 11137 <p>ChEBI: 16027</p> | |
| 11138 <p>NIKKAJI: J4.814C</p> | |
| 11139 <p>formula: C10H14N5O7P</p> | |
| 11140 <p>weight: 347.2212</p> | |
| 11141 </body> | |
| 11142 </notes> | |
| 11143 <annotation> | |
| 11144 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11145 <rdf:Description rdf:about="#_76ac6050-ef92-40d9-aacb-2162ff843058"> | |
| 11146 <bqbiol:is> | |
| 11147 <rdf:Bag> | |
| 11148 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00020"/> | |
| 11149 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019347"/> | |
| 11150 <rdf:li rdf:resource="https://identifiers.org/CAS/61-19-8"/> | |
| 11151 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01133"/> | |
| 11152 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/A AMP AP7"/> | |
| 11153 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16027"/> | |
| 11154 </rdf:Bag> | |
| 11155 </bqbiol:is> | |
| 11156 </rdf:Description> | |
| 11157 </rdf:RDF> | |
| 11158 </annotation> | |
| 11159 </species> | |
| 11160 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H17NO6S" hasOnlySubstanceUnits="false" id="C03539" metaid="_3814a8bc-d6d6-4adc-9ea0-48fdb3b49d10" name="S-Ribosyl-L-homocysteine" sboTerm="SBO:0000240"> | |
| 11161 <notes> | |
| 11162 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11163 <p>kegg.compound: C03539</p> | |
| 11164 <p>PubChem: 6343</p> | |
| 11165 <p>3DMET: B01667</p> | |
| 11166 <p>PDB-CCD: 2WP RHC</p> | |
| 11167 <p>NIKKAJI: J1.589.202A</p> | |
| 11168 <p>formula: C9H17NO6S</p> | |
| 11169 <p>weight: 267.2994</p> | |
| 11170 </body> | |
| 11171 </notes> | |
| 11172 <annotation> | |
| 11173 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11174 <rdf:Description rdf:about="#_3814a8bc-d6d6-4adc-9ea0-48fdb3b49d10"> | |
| 11175 <bqbiol:is> | |
| 11176 <rdf:Bag> | |
| 11177 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03539"/> | |
| 11178 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01667"/> | |
| 11179 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/2WP RHC"/> | |
| 11180 </rdf:Bag> | |
| 11181 </bqbiol:is> | |
| 11182 </rdf:Description> | |
| 11183 </rdf:RDF> | |
| 11184 </annotation> | |
| 11185 </species> | |
| 11186 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H8O3" hasOnlySubstanceUnits="false" id="C00141" metaid="a0ee8b04-a925-4aac-9238-a48052c93f87" name="3-Methyl-2-oxobutanoic acid" sboTerm="SBO:0000240"> | |
| 11187 <notes> | |
| 11188 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11189 <p>kegg.compound: C00141</p> | |
| 11190 <p>KNApSAcK: C00007623</p> | |
| 11191 <p>CAS: 759-05-7</p> | |
| 11192 <p>PubChem: 3441</p> | |
| 11193 <p>3DMET: B00039</p> | |
| 11194 <p>PDB-CCD: KIV</p> | |
| 11195 <p>ChEBI: 11851 16530</p> | |
| 11196 <p>LIPIDMAPS: LMFA01020274</p> | |
| 11197 <p>LipidBank: DFA0388</p> | |
| 11198 <p>NIKKAJI: J39.558G</p> | |
| 11199 <p>formula: C5H8O3</p> | |
| 11200 <p>weight: 116.1152</p> | |
| 11201 </body> | |
| 11202 </notes> | |
| 11203 <annotation> | |
| 11204 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11205 <rdf:Description rdf:about="#a0ee8b04-a925-4aac-9238-a48052c93f87"> | |
| 11206 <bqbiol:is> | |
| 11207 <rdf:Bag> | |
| 11208 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00141"/> | |
| 11209 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007623"/> | |
| 11210 <rdf:li rdf:resource="https://identifiers.org/CAS/759-05-7"/> | |
| 11211 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00039"/> | |
| 11212 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/KIV"/> | |
| 11213 <rdf:li rdf:resource="https://identifiers.org/ChEBI/11851 16530"/> | |
| 11214 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA01020274"/> | |
| 11215 <rdf:li rdf:resource="https://identifiers.org/LipidBank/DFA0388"/> | |
| 11216 </rdf:Bag> | |
| 11217 </bqbiol:is> | |
| 11218 </rdf:Description> | |
| 11219 </rdf:RDF> | |
| 11220 </annotation> | |
| 11221 </species> | |
| 11222 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C8H15NO6" hasOnlySubstanceUnits="false" id="C00140" metaid="_2a5f3a6f-cf87-4eb0-9e4b-78bfd0d773eb" name="N-Acetyl-D-glucosamine" sboTerm="SBO:0000240"> | |
| 11223 <notes> | |
| 11224 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11225 <p>kegg.compound: C00140</p> | |
| 11226 <p>CAS: 7512-17-6</p> | |
| 11227 <p>PubChem: 3440</p> | |
| 11228 <p>3DMET: B04639</p> | |
| 11229 <p>PDB-CCD: NAG NDG</p> | |
| 11230 <p>ChEBI: 506227</p> | |
| 11231 <p>NIKKAJI: J81.413J</p> | |
| 11232 <p>formula: C8H15NO6</p> | |
| 11233 <p>weight: 221.2078</p> | |
| 11234 </body> | |
| 11235 </notes> | |
| 11236 <annotation> | |
| 11237 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11238 <rdf:Description rdf:about="#_2a5f3a6f-cf87-4eb0-9e4b-78bfd0d773eb"> | |
| 11239 <bqbiol:is> | |
| 11240 <rdf:Bag> | |
| 11241 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00140"/> | |
| 11242 <rdf:li rdf:resource="https://identifiers.org/CAS/7512-17-6"/> | |
| 11243 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04639"/> | |
| 11244 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/NAG NDG"/> | |
| 11245 <rdf:li rdf:resource="https://identifiers.org/ChEBI/506227"/> | |
| 11246 </rdf:Bag> | |
| 11247 </bqbiol:is> | |
| 11248 </rdf:Description> | |
| 11249 </rdf:RDF> | |
| 11250 </annotation> | |
| 11251 </species> | |
| 11252 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C8H15O2SR" hasOnlySubstanceUnits="false" id="C04620" metaid="_56258017-9bfa-4605-9a0a-445831d2dcc9" name="(3R)-3-Hydroxyoctanoyl-[acyl-carrier protein]" sboTerm="SBO:0000240"> | |
| 11253 <notes> | |
| 11254 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11255 <p>kegg.compound: C04620</p> | |
| 11256 <p>PubChem: 7210</p> | |
| 11257 <p>formula: C8H15O2SR</p> | |
| 11258 </body> | |
| 11259 </notes> | |
| 11260 <annotation> | |
| 11261 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11262 <rdf:Description rdf:about="#_56258017-9bfa-4605-9a0a-445831d2dcc9"> | |
| 11263 <bqbiol:is> | |
| 11264 <rdf:Bag> | |
| 11265 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04620"/> | |
| 11266 </rdf:Bag> | |
| 11267 </bqbiol:is> | |
| 11268 </rdf:Description> | |
| 11269 </rdf:RDF> | |
| 11270 </annotation> | |
| 11271 </species> | |
| 11272 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C00028" metaid="_1b1cb19b-1772-42b0-a0dd-9b699c268530" name="Acceptor" sboTerm="SBO:0000240"> | |
| 11273 <notes> | |
| 11274 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11275 <p>kegg.compound: C00028</p> | |
| 11276 <p>PubChem: 3330</p> | |
| 11277 <p>ChEBI: 15339</p> | |
| 11278 </body> | |
| 11279 </notes> | |
| 11280 <annotation> | |
| 11281 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11282 <rdf:Description rdf:about="#_1b1cb19b-1772-42b0-a0dd-9b699c268530"> | |
| 11283 <bqbiol:is> | |
| 11284 <rdf:Bag> | |
| 11285 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00028"/> | |
| 11286 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15339"/> | |
| 11287 </rdf:Bag> | |
| 11288 </bqbiol:is> | |
| 11289 </rdf:Description> | |
| 11290 </rdf:RDF> | |
| 11291 </annotation> | |
| 11292 </species> | |
| 11293 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="H2O2" hasOnlySubstanceUnits="false" id="C00027" metaid="_3213aff9-ff1f-4061-87b3-5d09db16db34" name="Hydrogen peroxide" sboTerm="SBO:0000240"> | |
| 11294 <notes> | |
| 11295 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11296 <p>kegg.compound: C00027</p> | |
| 11297 <p>CAS: 7722-84-1</p> | |
| 11298 <p>PubChem: 3329</p> | |
| 11299 <p>PDB-CCD: PEO</p> | |
| 11300 <p>ChEBI: 16240</p> | |
| 11301 <p>NIKKAJI: J98.262H</p> | |
| 11302 <p>formula: H2O2</p> | |
| 11303 <p>weight: 34.0147</p> | |
| 11304 </body> | |
| 11305 </notes> | |
| 11306 <annotation> | |
| 11307 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11308 <rdf:Description rdf:about="#_3213aff9-ff1f-4061-87b3-5d09db16db34"> | |
| 11309 <bqbiol:is> | |
| 11310 <rdf:Bag> | |
| 11311 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00027"/> | |
| 11312 <rdf:li rdf:resource="https://identifiers.org/CAS/7722-84-1"/> | |
| 11313 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/PEO"/> | |
| 11314 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16240"/> | |
| 11315 </rdf:Bag> | |
| 11316 </bqbiol:is> | |
| 11317 </rdf:Description> | |
| 11318 </rdf:RDF> | |
| 11319 </annotation> | |
| 11320 </species> | |
| 11321 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H9NO2" hasOnlySubstanceUnits="false" id="C00148" metaid="fff30e9c-90ea-413e-9a13-defd2b833839" name="L-Proline" sboTerm="SBO:0000240"> | |
| 11322 <notes> | |
| 11323 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11324 <p>kegg.compound: C00148</p> | |
| 11325 <p>KNApSAcK: C00001388</p> | |
| 11326 <p>CAS: 147-85-3</p> | |
| 11327 <p>PubChem: 3448</p> | |
| 11328 <p>3DMET: B01173</p> | |
| 11329 <p>PDB-CCD: PRO</p> | |
| 11330 <p>ChEBI: 17203</p> | |
| 11331 <p>NIKKAJI: J9.117K</p> | |
| 11332 <p>formula: C5H9NO2</p> | |
| 11333 <p>weight: 115.1305</p> | |
| 11334 </body> | |
| 11335 </notes> | |
| 11336 <annotation> | |
| 11337 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11338 <rdf:Description rdf:about="#fff30e9c-90ea-413e-9a13-defd2b833839"> | |
| 11339 <bqbiol:is> | |
| 11340 <rdf:Bag> | |
| 11341 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00148"/> | |
| 11342 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001388"/> | |
| 11343 <rdf:li rdf:resource="https://identifiers.org/CAS/147-85-3"/> | |
| 11344 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01173"/> | |
| 11345 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/PRO"/> | |
| 11346 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17203"/> | |
| 11347 </rdf:Bag> | |
| 11348 </bqbiol:is> | |
| 11349 </rdf:Description> | |
| 11350 </rdf:RDF> | |
| 11351 </annotation> | |
| 11352 </species> | |
| 11353 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H6O5" hasOnlySubstanceUnits="false" id="C00026" metaid="_93659e69-1dbc-4708-8ff4-04891ef33884" name="2-Oxoglutarate" sboTerm="SBO:0000240"> | |
| 11354 <notes> | |
| 11355 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11356 <p>kegg.compound: C00026</p> | |
| 11357 <p>KNApSAcK: C00000769</p> | |
| 11358 <p>CAS: 328-50-7</p> | |
| 11359 <p>PubChem: 3328</p> | |
| 11360 <p>3DMET: B00008</p> | |
| 11361 <p>PDB-CCD: AKG</p> | |
| 11362 <p>ChEBI: 16810 30915</p> | |
| 11363 <p>NIKKAJI: J11.847H</p> | |
| 11364 <p>formula: C5H6O5</p> | |
| 11365 <p>weight: 146.0981</p> | |
| 11366 </body> | |
| 11367 </notes> | |
| 11368 <annotation> | |
| 11369 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11370 <rdf:Description rdf:about="#_93659e69-1dbc-4708-8ff4-04891ef33884"> | |
| 11371 <bqbiol:is> | |
| 11372 <rdf:Bag> | |
| 11373 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00026"/> | |
| 11374 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00000769"/> | |
| 11375 <rdf:li rdf:resource="https://identifiers.org/CAS/328-50-7"/> | |
| 11376 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00008"/> | |
| 11377 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/AKG"/> | |
| 11378 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16810 30915"/> | |
| 11379 </rdf:Bag> | |
| 11380 </bqbiol:is> | |
| 11381 </rdf:Description> | |
| 11382 </rdf:RDF> | |
| 11383 </annotation> | |
| 11384 </species> | |
| 11385 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H5N5" hasOnlySubstanceUnits="false" id="C00147" metaid="_16575da3-3221-4d78-817d-8fe11d647945" name="Adenine" sboTerm="SBO:0000240"> | |
| 11386 <notes> | |
| 11387 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11388 <p>kegg.compound: C00147</p> | |
| 11389 <p>KNApSAcK: C00001490</p> | |
| 11390 <p>CAS: 73-24-5</p> | |
| 11391 <p>PubChem: 3447</p> | |
| 11392 <p>3DMET: B00041</p> | |
| 11393 <p>PDB-CCD: ADE</p> | |
| 11394 <p>ChEBI: 16708</p> | |
| 11395 <p>NIKKAJI: J5.257D</p> | |
| 11396 <p>formula: C5H5N5</p> | |
| 11397 <p>weight: 135.1267</p> | |
| 11398 </body> | |
| 11399 </notes> | |
| 11400 <annotation> | |
| 11401 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11402 <rdf:Description rdf:about="#_16575da3-3221-4d78-817d-8fe11d647945"> | |
| 11403 <bqbiol:is> | |
| 11404 <rdf:Bag> | |
| 11405 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00147"/> | |
| 11406 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001490"/> | |
| 11407 <rdf:li rdf:resource="https://identifiers.org/CAS/73-24-5"/> | |
| 11408 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00041"/> | |
| 11409 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/ADE"/> | |
| 11410 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16708"/> | |
| 11411 </rdf:Bag> | |
| 11412 </bqbiol:is> | |
| 11413 </rdf:Description> | |
| 11414 </rdf:RDF> | |
| 11415 </annotation> | |
| 11416 </species> | |
| 11417 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C8H16NO9P" hasOnlySubstanceUnits="false" id="C04501" metaid="_31dfdfcb-031a-40ca-8438-42e49a504f8c" name="N-Acetyl-alpha-D-glucosamine 1-phosphate" sboTerm="SBO:0000240"> | |
| 11418 <notes> | |
| 11419 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11420 <p>kegg.compound: C04501</p> | |
| 11421 <p>PubChem: 7115</p> | |
| 11422 <p>3DMET: B01749</p> | |
| 11423 <p>PDB-CCD: GN1</p> | |
| 11424 <p>ChEBI: 16446</p> | |
| 11425 <p>NIKKAJI: J442.512J</p> | |
| 11426 <p>formula: C8H16NO9P</p> | |
| 11427 <p>weight: 301.1877</p> | |
| 11428 </body> | |
| 11429 </notes> | |
| 11430 <annotation> | |
| 11431 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11432 <rdf:Description rdf:about="#_31dfdfcb-031a-40ca-8438-42e49a504f8c"> | |
| 11433 <bqbiol:is> | |
| 11434 <rdf:Bag> | |
| 11435 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04501"/> | |
| 11436 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01749"/> | |
| 11437 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/GN1"/> | |
| 11438 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16446"/> | |
| 11439 </rdf:Bag> | |
| 11440 </bqbiol:is> | |
| 11441 </rdf:Description> | |
| 11442 </rdf:RDF> | |
| 11443 </annotation> | |
| 11444 </species> | |
| 11445 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H9NO4" hasOnlySubstanceUnits="false" id="C00025" metaid="eb34fc89-e4f2-4158-bdef-dc5189b1b12f" name="L-Glutamate" sboTerm="SBO:0000240"> | |
| 11446 <notes> | |
| 11447 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11448 <p>kegg.compound: C00025</p> | |
| 11449 <p>KNApSAcK: C00001358</p> | |
| 11450 <p>CAS: 56-86-0</p> | |
| 11451 <p>PubChem: 3327</p> | |
| 11452 <p>3DMET: B00007</p> | |
| 11453 <p>PDB-CCD: GGL GLU</p> | |
| 11454 <p>ChEBI: 16015</p> | |
| 11455 <p>NIKKAJI: J9.171E</p> | |
| 11456 <p>formula: C5H9NO4</p> | |
| 11457 <p>weight: 147.1293</p> | |
| 11458 </body> | |
| 11459 </notes> | |
| 11460 <annotation> | |
| 11461 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11462 <rdf:Description rdf:about="#eb34fc89-e4f2-4158-bdef-dc5189b1b12f"> | |
| 11463 <bqbiol:is> | |
| 11464 <rdf:Bag> | |
| 11465 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00025"/> | |
| 11466 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001358"/> | |
| 11467 <rdf:li rdf:resource="https://identifiers.org/CAS/56-86-0"/> | |
| 11468 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00007"/> | |
| 11469 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/GGL GLU"/> | |
| 11470 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16015"/> | |
| 11471 </rdf:Bag> | |
| 11472 </bqbiol:is> | |
| 11473 </rdf:Description> | |
| 11474 </rdf:RDF> | |
| 11475 </annotation> | |
| 11476 </species> | |
| 11477 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H15N5O11P2" hasOnlySubstanceUnits="false" id="C00035" metaid="_52e68449-a5b8-40a3-b532-bd62ecaffac0" name="GDP" sboTerm="SBO:0000240"> | |
| 11478 <notes> | |
| 11479 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11480 <p>kegg.compound: C00035</p> | |
| 11481 <p>CAS: 146-91-8</p> | |
| 11482 <p>PubChem: 3337</p> | |
| 11483 <p>3DMET: B01135</p> | |
| 11484 <p>PDB-CCD: GDP</p> | |
| 11485 <p>ChEBI: 17552</p> | |
| 11486 <p>NIKKAJI: J40.056D</p> | |
| 11487 <p>formula: C10H15N5O11P2</p> | |
| 11488 <p>weight: 443.2005</p> | |
| 11489 </body> | |
| 11490 </notes> | |
| 11491 <annotation> | |
| 11492 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11493 <rdf:Description rdf:about="#_52e68449-a5b8-40a3-b532-bd62ecaffac0"> | |
| 11494 <bqbiol:is> | |
| 11495 <rdf:Bag> | |
| 11496 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00035"/> | |
| 11497 <rdf:li rdf:resource="https://identifiers.org/CAS/146-91-8"/> | |
| 11498 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01135"/> | |
| 11499 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/GDP"/> | |
| 11500 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17552"/> | |
| 11501 </rdf:Bag> | |
| 11502 </bqbiol:is> | |
| 11503 </rdf:Description> | |
| 11504 </rdf:RDF> | |
| 11505 </annotation> | |
| 11506 </species> | |
| 11507 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C35H55N7O26P2" hasOnlySubstanceUnits="false" id="C04877" metaid="b696df93-ee26-41ad-9e7f-75cd75501621" name="UDP-N-acetylmuramoyl-L-alanyl-gamma-D-glutamyl-meso-2,6-diaminopimelate" sboTerm="SBO:0000240"> | |
| 11508 <notes> | |
| 11509 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11510 <p>kegg.compound: C04877</p> | |
| 11511 <p>PubChem: 7429</p> | |
| 11512 <p>3DMET: B04971</p> | |
| 11513 <p>ChEBI: 84805</p> | |
| 11514 <p>NIKKAJI: J2.757.188C</p> | |
| 11515 <p>formula: C35H55N7O26P2</p> | |
| 11516 <p>weight: 1051.79</p> | |
| 11517 </body> | |
| 11518 </notes> | |
| 11519 <annotation> | |
| 11520 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11521 <rdf:Description rdf:about="#b696df93-ee26-41ad-9e7f-75cd75501621"> | |
| 11522 <bqbiol:is> | |
| 11523 <rdf:Bag> | |
| 11524 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04877"/> | |
| 11525 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04971"/> | |
| 11526 <rdf:li rdf:resource="https://identifiers.org/ChEBI/84805"/> | |
| 11527 </rdf:Bag> | |
| 11528 </bqbiol:is> | |
| 11529 </rdf:Description> | |
| 11530 </rdf:RDF> | |
| 11531 </annotation> | |
| 11532 </species> | |
| 11533 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H13O9P" hasOnlySubstanceUnits="false" id="C03546" metaid="_6a497cf6-69b2-4db0-a2f0-696253c50973" name="myo-Inositol 4-phosphate" sboTerm="SBO:0000240"> | |
| 11534 <notes> | |
| 11535 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11536 <p>kegg.compound: C03546</p> | |
| 11537 <p>CAS: 46495-39-0</p> | |
| 11538 <p>PubChem: 6349</p> | |
| 11539 <p>3DMET: B01669</p> | |
| 11540 <p>PDB-CCD: I4D</p> | |
| 11541 <p>ChEBI: 166491 18384</p> | |
| 11542 <p>NIKKAJI: J392.708C</p> | |
| 11543 <p>formula: C6H13O9P</p> | |
| 11544 <p>weight: 260.1358</p> | |
| 11545 </body> | |
| 11546 </notes> | |
| 11547 <annotation> | |
| 11548 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11549 <rdf:Description rdf:about="#_6a497cf6-69b2-4db0-a2f0-696253c50973"> | |
| 11550 <bqbiol:is> | |
| 11551 <rdf:Bag> | |
| 11552 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03546"/> | |
| 11553 <rdf:li rdf:resource="https://identifiers.org/CAS/46495-39-0"/> | |
| 11554 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01669"/> | |
| 11555 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/I4D"/> | |
| 11556 <rdf:li rdf:resource="https://identifiers.org/ChEBI/166491 18384"/> | |
| 11557 </rdf:Bag> | |
| 11558 </bqbiol:is> | |
| 11559 </rdf:Description> | |
| 11560 </rdf:RDF> | |
| 11561 </annotation> | |
| 11562 </species> | |
| 11563 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H6NO2SR" hasOnlySubstanceUnits="false" id="C05726" metaid="db81cb4d-ca4e-423e-985f-f9135eabe920" name="S-Substituted L-cysteine" sboTerm="SBO:0000240"> | |
| 11564 <notes> | |
| 11565 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11566 <p>kegg.compound: C05726</p> | |
| 11567 <p>PubChem: 8029</p> | |
| 11568 <p>ChEBI: 47910</p> | |
| 11569 <p>formula: C3H6NO2SR</p> | |
| 11570 </body> | |
| 11571 </notes> | |
| 11572 <annotation> | |
| 11573 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11574 <rdf:Description rdf:about="#db81cb4d-ca4e-423e-985f-f9135eabe920"> | |
| 11575 <bqbiol:is> | |
| 11576 <rdf:Bag> | |
| 11577 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05726"/> | |
| 11578 <rdf:li rdf:resource="https://identifiers.org/ChEBI/47910"/> | |
| 11579 </rdf:Bag> | |
| 11580 </bqbiol:is> | |
| 11581 </rdf:Description> | |
| 11582 </rdf:RDF> | |
| 11583 </annotation> | |
| 11584 </species> | |
| 11585 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H9NO2S" hasOnlySubstanceUnits="false" id="C00155" metaid="b1e679f1-05b1-400e-bedf-28915cc85019" name="L-Homocysteine" sboTerm="SBO:0000240"> | |
| 11586 <notes> | |
| 11587 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11588 <p>kegg.compound: C00155</p> | |
| 11589 <p>KNApSAcK: C00001365</p> | |
| 11590 <p>CAS: 6027-13-0</p> | |
| 11591 <p>PubChem: 3455</p> | |
| 11592 <p>3DMET: B01174</p> | |
| 11593 <p>PDB-CCD: HCS</p> | |
| 11594 <p>ChEBI: 17588</p> | |
| 11595 <p>NIKKAJI: J228C</p> | |
| 11596 <p>formula: C4H9NO2S</p> | |
| 11597 <p>weight: 135.1848</p> | |
| 11598 </body> | |
| 11599 </notes> | |
| 11600 <annotation> | |
| 11601 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11602 <rdf:Description rdf:about="#b1e679f1-05b1-400e-bedf-28915cc85019"> | |
| 11603 <bqbiol:is> | |
| 11604 <rdf:Bag> | |
| 11605 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00155"/> | |
| 11606 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001365"/> | |
| 11607 <rdf:li rdf:resource="https://identifiers.org/CAS/6027-13-0"/> | |
| 11608 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01174"/> | |
| 11609 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/HCS"/> | |
| 11610 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17588"/> | |
| 11611 </rdf:Bag> | |
| 11612 </bqbiol:is> | |
| 11613 </rdf:Description> | |
| 11614 </rdf:RDF> | |
| 11615 </annotation> | |
| 11616 </species> | |
| 11617 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H8NO6P" hasOnlySubstanceUnits="false" id="C01005" metaid="bbf4ce7a-e31e-42e7-b894-c7427d61a52b" name="O-Phospho-L-serine" sboTerm="SBO:0000240"> | |
| 11618 <notes> | |
| 11619 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11620 <p>kegg.compound: C01005</p> | |
| 11621 <p>KNApSAcK: C00007287</p> | |
| 11622 <p>CAS: 407-41-0</p> | |
| 11623 <p>PubChem: 4251</p> | |
| 11624 <p>3DMET: B01366</p> | |
| 11625 <p>PDB-CCD: SEP</p> | |
| 11626 <p>ChEBI: 15811</p> | |
| 11627 <p>NIKKAJI: J136.545B</p> | |
| 11628 <p>formula: C3H8NO6P</p> | |
| 11629 <p>weight: 185.0725</p> | |
| 11630 </body> | |
| 11631 </notes> | |
| 11632 <annotation> | |
| 11633 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11634 <rdf:Description rdf:about="#bbf4ce7a-e31e-42e7-b894-c7427d61a52b"> | |
| 11635 <bqbiol:is> | |
| 11636 <rdf:Bag> | |
| 11637 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01005"/> | |
| 11638 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007287"/> | |
| 11639 <rdf:li rdf:resource="https://identifiers.org/CAS/407-41-0"/> | |
| 11640 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01366"/> | |
| 11641 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/SEP"/> | |
| 11642 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15811"/> | |
| 11643 </rdf:Bag> | |
| 11644 </bqbiol:is> | |
| 11645 </rdf:Description> | |
| 11646 </rdf:RDF> | |
| 11647 </annotation> | |
| 11648 </species> | |
| 11649 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C2H4O2" hasOnlySubstanceUnits="false" id="C00033" metaid="dab8338c-d561-4c3e-b7e5-1b7584a1221f" name="Acetate" sboTerm="SBO:0000240"> | |
| 11650 <notes> | |
| 11651 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11652 <p>kegg.compound: C00033</p> | |
| 11653 <p>KNApSAcK: C00001176</p> | |
| 11654 <p>CAS: 64-19-7</p> | |
| 11655 <p>PubChem: 3335</p> | |
| 11656 <p>3DMET: B00009</p> | |
| 11657 <p>PDB-CCD: ACT ACY</p> | |
| 11658 <p>ChEBI: 15366 30089</p> | |
| 11659 <p>LIPIDMAPS: LMFA01010002</p> | |
| 11660 <p>LipidBank: DFA0002</p> | |
| 11661 <p>NIKKAJI: J2.355H</p> | |
| 11662 <p>formula: C2H4O2</p> | |
| 11663 <p>weight: 60.052</p> | |
| 11664 </body> | |
| 11665 </notes> | |
| 11666 <annotation> | |
| 11667 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11668 <rdf:Description rdf:about="#dab8338c-d561-4c3e-b7e5-1b7584a1221f"> | |
| 11669 <bqbiol:is> | |
| 11670 <rdf:Bag> | |
| 11671 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00033"/> | |
| 11672 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001176"/> | |
| 11673 <rdf:li rdf:resource="https://identifiers.org/CAS/64-19-7"/> | |
| 11674 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00009"/> | |
| 11675 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/ACT ACY"/> | |
| 11676 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15366 30089"/> | |
| 11677 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA01010002"/> | |
| 11678 <rdf:li rdf:resource="https://identifiers.org/LipidBank/DFA0002"/> | |
| 11679 </rdf:Bag> | |
| 11680 </bqbiol:is> | |
| 11681 </rdf:Description> | |
| 11682 </rdf:RDF> | |
| 11683 </annotation> | |
| 11684 </species> | |
| 11685 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H6N2O" hasOnlySubstanceUnits="false" id="C00153" metaid="_6de9b081-1c2c-4cf4-9008-949b9bdf724e" name="Nicotinamide" sboTerm="SBO:0000240"> | |
| 11686 <notes> | |
| 11687 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11688 <p>kegg.compound: C00153</p> | |
| 11689 <p>KNApSAcK: C00000209</p> | |
| 11690 <p>CAS: 98-92-0</p> | |
| 11691 <p>PubChem: 3453</p> | |
| 11692 <p>3DMET: B00044</p> | |
| 11693 <p>PDB-CCD: NCA</p> | |
| 11694 <p>ChEBI: 17154</p> | |
| 11695 <p>NIKKAJI: J3.988H</p> | |
| 11696 <p>formula: C6H6N2O</p> | |
| 11697 <p>weight: 122.1246</p> | |
| 11698 </body> | |
| 11699 </notes> | |
| 11700 <annotation> | |
| 11701 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11702 <rdf:Description rdf:about="#_6de9b081-1c2c-4cf4-9008-949b9bdf724e"> | |
| 11703 <bqbiol:is> | |
| 11704 <rdf:Bag> | |
| 11705 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00153"/> | |
| 11706 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00000209"/> | |
| 11707 <rdf:li rdf:resource="https://identifiers.org/CAS/98-92-0"/> | |
| 11708 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00044"/> | |
| 11709 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/NCA"/> | |
| 11710 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17154"/> | |
| 11711 </rdf:Bag> | |
| 11712 </bqbiol:is> | |
| 11713 </rdf:Description> | |
| 11714 </rdf:RDF> | |
| 11715 </annotation> | |
| 11716 </species> | |
| 11717 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C34H32FeN4O4" hasOnlySubstanceUnits="false" id="C00032" metaid="_356ec25e-29e5-444a-b753-ae0105a4cd2f" name="Heme" sboTerm="SBO:0000240"> | |
| 11718 <notes> | |
| 11719 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11720 <p>kegg.compound: C00032</p> | |
| 11721 <p>CAS: 14875-96-8</p> | |
| 11722 <p>PubChem: 3334</p> | |
| 11723 <p>PDB-CCD: HEM</p> | |
| 11724 <p>ChEBI: 17627 26355 30413</p> | |
| 11725 <p>formula: C34H32FeN4O4</p> | |
| 11726 <p>weight: 616.4873</p> | |
| 11727 </body> | |
| 11728 </notes> | |
| 11729 <annotation> | |
| 11730 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11731 <rdf:Description rdf:about="#_356ec25e-29e5-444a-b753-ae0105a4cd2f"> | |
| 11732 <bqbiol:is> | |
| 11733 <rdf:Bag> | |
| 11734 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00032"/> | |
| 11735 <rdf:li rdf:resource="https://identifiers.org/CAS/14875-96-8"/> | |
| 11736 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/HEM"/> | |
| 11737 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17627 26355 30413"/> | |
| 11738 </rdf:Bag> | |
| 11739 </bqbiol:is> | |
| 11740 </rdf:Description> | |
| 11741 </rdf:RDF> | |
| 11742 </annotation> | |
| 11743 </species> | |
| 11744 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C8H16NOR" hasOnlySubstanceUnits="false" id="C22160" metaid="f68dc49b-cd10-48e7-b3ed-70aa4edaac60" name="[Lipoyl-carrier protein E2]-N6-octanoyl-L-lysine" sboTerm="SBO:0000240"> | |
| 11745 <notes> | |
| 11746 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11747 <p>kegg.compound: C22160</p> | |
| 11748 <p>PubChem: 405226351</p> | |
| 11749 <p>formula: C8H16NOR</p> | |
| 11750 </body> | |
| 11751 </notes> | |
| 11752 <annotation> | |
| 11753 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11754 <rdf:Description rdf:about="#f68dc49b-cd10-48e7-b3ed-70aa4edaac60"> | |
| 11755 <bqbiol:is> | |
| 11756 <rdf:Bag> | |
| 11757 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C22160"/> | |
| 11758 </rdf:Bag> | |
| 11759 </bqbiol:is> | |
| 11760 </rdf:Description> | |
| 11761 </rdf:RDF> | |
| 11762 </annotation> | |
| 11763 </species> | |
| 11764 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O6" hasOnlySubstanceUnits="false" id="C00031" metaid="_46349695-4305-4148-880e-72618a6557d1" name="D-Glucose" sboTerm="SBO:0000240"> | |
| 11765 <notes> | |
| 11766 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11767 <p>kegg.compound: C00031</p> | |
| 11768 <p>KNApSAcK: C00042470</p> | |
| 11769 <p>CAS: 50-99-7 2280-44-6</p> | |
| 11770 <p>PubChem: 3333</p> | |
| 11771 <p>3DMET: B04623</p> | |
| 11772 <p>PDB-CCD: BGC GLC</p> | |
| 11773 <p>ChEBI: 4167</p> | |
| 11774 <p>NIKKAJI: J4.109B</p> | |
| 11775 <p>formula: C6H12O6</p> | |
| 11776 <p>weight: 180.1559</p> | |
| 11777 </body> | |
| 11778 </notes> | |
| 11779 <annotation> | |
| 11780 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11781 <rdf:Description rdf:about="#_46349695-4305-4148-880e-72618a6557d1"> | |
| 11782 <bqbiol:is> | |
| 11783 <rdf:Bag> | |
| 11784 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00031"/> | |
| 11785 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00042470"/> | |
| 11786 <rdf:li rdf:resource="https://identifiers.org/CAS/50-99-7 2280-44-6"/> | |
| 11787 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04623"/> | |
| 11788 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/BGC GLC"/> | |
| 11789 <rdf:li rdf:resource="https://identifiers.org/ChEBI/4167"/> | |
| 11790 </rdf:Bag> | |
| 11791 </bqbiol:is> | |
| 11792 </rdf:Description> | |
| 11793 </rdf:RDF> | |
| 11794 </annotation> | |
| 11795 </species> | |
| 11796 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H9N2O3SR" hasOnlySubstanceUnits="false" id="C05729" metaid="_40c73e4f-bd1c-4850-bad1-c14308931d72" name="R-S-Cysteinylglycine" sboTerm="SBO:0000240"> | |
| 11797 <notes> | |
| 11798 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11799 <p>kegg.compound: C05729</p> | |
| 11800 <p>PubChem: 8031</p> | |
| 11801 <p>ChEBI: 8744</p> | |
| 11802 <p>formula: C5H9N2O3SR</p> | |
| 11803 </body> | |
| 11804 </notes> | |
| 11805 <annotation> | |
| 11806 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11807 <rdf:Description rdf:about="#_40c73e4f-bd1c-4850-bad1-c14308931d72"> | |
| 11808 <bqbiol:is> | |
| 11809 <rdf:Bag> | |
| 11810 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05729"/> | |
| 11811 <rdf:li rdf:resource="https://identifiers.org/ChEBI/8744"/> | |
| 11812 </rdf:Bag> | |
| 11813 </bqbiol:is> | |
| 11814 </rdf:Description> | |
| 11815 </rdf:RDF> | |
| 11816 </annotation> | |
| 11817 </species> | |
| 11818 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H8N2O3" hasOnlySubstanceUnits="false" id="C00152" metaid="_402c15da-2b62-4a86-a3fd-9fbf981b7e2a" name="L-Asparagine" sboTerm="SBO:0000240"> | |
| 11819 <notes> | |
| 11820 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11821 <p>kegg.compound: C00152</p> | |
| 11822 <p>KNApSAcK: C00001341 C00034027</p> | |
| 11823 <p>CAS: 70-47-3</p> | |
| 11824 <p>PubChem: 3452</p> | |
| 11825 <p>3DMET: B00043</p> | |
| 11826 <p>PDB-CCD: 41Q ASN</p> | |
| 11827 <p>ChEBI: 17196</p> | |
| 11828 <p>NIKKAJI: J9.178B</p> | |
| 11829 <p>formula: C4H8N2O3</p> | |
| 11830 <p>weight: 132.1179</p> | |
| 11831 </body> | |
| 11832 </notes> | |
| 11833 <annotation> | |
| 11834 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11835 <rdf:Description rdf:about="#_402c15da-2b62-4a86-a3fd-9fbf981b7e2a"> | |
| 11836 <bqbiol:is> | |
| 11837 <rdf:Bag> | |
| 11838 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00152"/> | |
| 11839 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001341 C00034027"/> | |
| 11840 <rdf:li rdf:resource="https://identifiers.org/CAS/70-47-3"/> | |
| 11841 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00043"/> | |
| 11842 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/41Q ASN"/> | |
| 11843 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17196"/> | |
| 11844 </rdf:Bag> | |
| 11845 </bqbiol:is> | |
| 11846 </rdf:Description> | |
| 11847 </rdf:RDF> | |
| 11848 </annotation> | |
| 11849 </species> | |
| 11850 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H15N5O3" hasOnlySubstanceUnits="false" id="C00272" metaid="cd0bdb48-3aa5-4e0f-889f-211c9a101902" name="Tetrahydrobiopterin" sboTerm="SBO:0000240"> | |
| 11851 <notes> | |
| 11852 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11853 <p>kegg.compound: C00272</p> | |
| 11854 <p>KNApSAcK: C00018229</p> | |
| 11855 <p>CAS: 17528-72-2</p> | |
| 11856 <p>PubChem: 3570</p> | |
| 11857 <p>3DMET: B04659</p> | |
| 11858 <p>PDB-CCD: H4B</p> | |
| 11859 <p>ChEBI: 15372 59560</p> | |
| 11860 <p>NIKKAJI: J247.815C</p> | |
| 11861 <p>formula: C9H15N5O3</p> | |
| 11862 <p>weight: 241.2471</p> | |
| 11863 </body> | |
| 11864 </notes> | |
| 11865 <annotation> | |
| 11866 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11867 <rdf:Description rdf:about="#cd0bdb48-3aa5-4e0f-889f-211c9a101902"> | |
| 11868 <bqbiol:is> | |
| 11869 <rdf:Bag> | |
| 11870 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00272"/> | |
| 11871 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00018229"/> | |
| 11872 <rdf:li rdf:resource="https://identifiers.org/CAS/17528-72-2"/> | |
| 11873 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04659"/> | |
| 11874 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/H4B"/> | |
| 11875 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15372 59560"/> | |
| 11876 </rdf:Bag> | |
| 11877 </bqbiol:is> | |
| 11878 </rdf:Description> | |
| 11879 </rdf:RDF> | |
| 11880 </annotation> | |
| 11881 </species> | |
| 11882 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C00030" metaid="ac19599f-f503-43c1-9f61-cba7cae9f728" name="Reduced acceptor" sboTerm="SBO:0000240"> | |
| 11883 <notes> | |
| 11884 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11885 <p>kegg.compound: C00030</p> | |
| 11886 <p>PubChem: 3332</p> | |
| 11887 <p>ChEBI: 17499</p> | |
| 11888 </body> | |
| 11889 </notes> | |
| 11890 <annotation> | |
| 11891 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11892 <rdf:Description rdf:about="#ac19599f-f503-43c1-9f61-cba7cae9f728"> | |
| 11893 <bqbiol:is> | |
| 11894 <rdf:Bag> | |
| 11895 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00030"/> | |
| 11896 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17499"/> | |
| 11897 </rdf:Bag> | |
| 11898 </bqbiol:is> | |
| 11899 </rdf:Description> | |
| 11900 </rdf:RDF> | |
| 11901 </annotation> | |
| 11902 </species> | |
| 11903 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H14O6" hasOnlySubstanceUnits="false" id="C00392" metaid="c82aefef-d56c-4952-816b-9f3bd5e89744" name="Mannitol" sboTerm="SBO:0000240"> | |
| 11904 <notes> | |
| 11905 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11906 <p>kegg.compound: C00392</p> | |
| 11907 <p>KNApSAcK: C00001165</p> | |
| 11908 <p>CAS: 69-65-8</p> | |
| 11909 <p>PubChem: 3682</p> | |
| 11910 <p>3DMET: B04676</p> | |
| 11911 <p>PDB-CCD: MTL</p> | |
| 11912 <p>ChEBI: 16899</p> | |
| 11913 <p>NIKKAJI: J2.369H</p> | |
| 11914 <p>formula: C6H14O6</p> | |
| 11915 <p>weight: 182.1718</p> | |
| 11916 </body> | |
| 11917 </notes> | |
| 11918 <annotation> | |
| 11919 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11920 <rdf:Description rdf:about="#c82aefef-d56c-4952-816b-9f3bd5e89744"> | |
| 11921 <bqbiol:is> | |
| 11922 <rdf:Bag> | |
| 11923 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00392"/> | |
| 11924 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001165"/> | |
| 11925 <rdf:li rdf:resource="https://identifiers.org/CAS/69-65-8"/> | |
| 11926 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04676"/> | |
| 11927 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/MTL"/> | |
| 11928 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16899"/> | |
| 11929 </rdf:Bag> | |
| 11930 </bqbiol:is> | |
| 11931 </rdf:Description> | |
| 11932 </rdf:RDF> | |
| 11933 </annotation> | |
| 11934 </species> | |
| 11935 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="CH4O2Se" hasOnlySubstanceUnits="false" id="C18902" metaid="_1ec50536-7cc4-4aea-9ef6-c91da9d6db9e" name="Methylselenic acid" sboTerm="SBO:0000240"> | |
| 11936 <notes> | |
| 11937 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11938 <p>kegg.compound: C18902</p> | |
| 11939 <p>PubChem: 124489574</p> | |
| 11940 <p>ChEBI: 77012</p> | |
| 11941 <p>formula: CH4O2Se</p> | |
| 11942 <p>weight: 127.0013</p> | |
| 11943 </body> | |
| 11944 </notes> | |
| 11945 <annotation> | |
| 11946 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11947 <rdf:Description rdf:about="#_1ec50536-7cc4-4aea-9ef6-c91da9d6db9e"> | |
| 11948 <bqbiol:is> | |
| 11949 <rdf:Bag> | |
| 11950 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C18902"/> | |
| 11951 <rdf:li rdf:resource="https://identifiers.org/ChEBI/77012"/> | |
| 11952 </rdf:Bag> | |
| 11953 </bqbiol:is> | |
| 11954 </rdf:Description> | |
| 11955 </rdf:RDF> | |
| 11956 </annotation> | |
| 11957 </species> | |
| 11958 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C20H29N3O19P2" hasOnlySubstanceUnits="false" id="C04631" metaid="_396ba695-6169-499b-9e2c-ed89e3aa58b5" name="UDP-N-acetyl-3-(1-carboxyvinyl)-D-glucosamine" sboTerm="SBO:0000240"> | |
| 11959 <notes> | |
| 11960 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11961 <p>kegg.compound: C04631</p> | |
| 11962 <p>KNApSAcK: C00019554</p> | |
| 11963 <p>CAS: 70222-94-5</p> | |
| 11964 <p>PubChem: 7220</p> | |
| 11965 <p>3DMET: B01767</p> | |
| 11966 <p>PDB-CCD: EPU</p> | |
| 11967 <p>ChEBI: 68507</p> | |
| 11968 <p>NIKKAJI: J711.509A</p> | |
| 11969 <p>formula: C20H29N3O19P2</p> | |
| 11970 <p>weight: 677.4005</p> | |
| 11971 </body> | |
| 11972 </notes> | |
| 11973 <annotation> | |
| 11974 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11975 <rdf:Description rdf:about="#_396ba695-6169-499b-9e2c-ed89e3aa58b5"> | |
| 11976 <bqbiol:is> | |
| 11977 <rdf:Bag> | |
| 11978 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04631"/> | |
| 11979 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019554"/> | |
| 11980 <rdf:li rdf:resource="https://identifiers.org/CAS/70222-94-5"/> | |
| 11981 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01767"/> | |
| 11982 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/EPU"/> | |
| 11983 <rdf:li rdf:resource="https://identifiers.org/ChEBI/68507"/> | |
| 11984 </rdf:Bag> | |
| 11985 </bqbiol:is> | |
| 11986 </rdf:Description> | |
| 11987 </rdf:RDF> | |
| 11988 </annotation> | |
| 11989 </species> | |
| 11990 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H19N2OS2R" hasOnlySubstanceUnits="false" id="C01242" metaid="_5176eadb-f4e2-4b46-949e-6998af03ba85" name="[Protein]-S8-aminomethyldihydrolipoyllysine" sboTerm="SBO:0000240"> | |
| 11991 <notes> | |
| 11992 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 11993 <p>kegg.compound: C01242</p> | |
| 11994 <p>PubChem: 4463</p> | |
| 11995 <p>ChEBI: 16882</p> | |
| 11996 <p>formula: C9H19N2OS2R</p> | |
| 11997 </body> | |
| 11998 </notes> | |
| 11999 <annotation> | |
| 12000 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12001 <rdf:Description rdf:about="#_5176eadb-f4e2-4b46-949e-6998af03ba85"> | |
| 12002 <bqbiol:is> | |
| 12003 <rdf:Bag> | |
| 12004 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01242"/> | |
| 12005 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16882"/> | |
| 12006 </rdf:Bag> | |
| 12007 </bqbiol:is> | |
| 12008 </rdf:Description> | |
| 12009 </rdf:RDF> | |
| 12010 </annotation> | |
| 12011 </species> | |
| 12012 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C03541" metaid="ce0f0173-58aa-4504-90a7-b34a82a510d8" name="THF-polyglutamate" sboTerm="SBO:0000240"> | |
| 12013 <notes> | |
| 12014 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12015 <p>kegg.compound: C03541</p> | |
| 12016 <p>PubChem: 6345</p> | |
| 12017 <p>ChEBI: 28624</p> | |
| 12018 <p>formula: C24H30N8O9(C5H7NO3)n-2</p> | |
| 12019 </body> | |
| 12020 </notes> | |
| 12021 <annotation> | |
| 12022 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12023 <rdf:Description rdf:about="#ce0f0173-58aa-4504-90a7-b34a82a510d8"> | |
| 12024 <bqbiol:is> | |
| 12025 <rdf:Bag> | |
| 12026 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03541"/> | |
| 12027 <rdf:li rdf:resource="https://identifiers.org/ChEBI/28624"/> | |
| 12028 </rdf:Bag> | |
| 12029 </bqbiol:is> | |
| 12030 </rdf:Description> | |
| 12031 </rdf:RDF> | |
| 12032 </annotation> | |
| 12033 </species> | |
| 12034 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C2H5NO2" hasOnlySubstanceUnits="false" id="C00037" metaid="f7cc8908-d95e-41a9-a4d9-1c63d49a6535" name="Glycine" sboTerm="SBO:0000240"> | |
| 12035 <notes> | |
| 12036 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12037 <p>kegg.compound: C00037</p> | |
| 12038 <p>KNApSAcK: C00001361</p> | |
| 12039 <p>CAS: 56-40-6</p> | |
| 12040 <p>PubChem: 3339</p> | |
| 12041 <p>3DMET: B01136</p> | |
| 12042 <p>PDB-CCD: GLY</p> | |
| 12043 <p>ChEBI: 15428</p> | |
| 12044 <p>NIKKAJI: J1.163K</p> | |
| 12045 <p>formula: C2H5NO2</p> | |
| 12046 <p>weight: 75.0666</p> | |
| 12047 </body> | |
| 12048 </notes> | |
| 12049 <annotation> | |
| 12050 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12051 <rdf:Description rdf:about="#f7cc8908-d95e-41a9-a4d9-1c63d49a6535"> | |
| 12052 <bqbiol:is> | |
| 12053 <rdf:Bag> | |
| 12054 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00037"/> | |
| 12055 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001361"/> | |
| 12056 <rdf:li rdf:resource="https://identifiers.org/CAS/56-40-6"/> | |
| 12057 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01136"/> | |
| 12058 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/GLY"/> | |
| 12059 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15428"/> | |
| 12060 </rdf:Bag> | |
| 12061 </bqbiol:is> | |
| 12062 </rdf:Description> | |
| 12063 </rdf:RDF> | |
| 12064 </annotation> | |
| 12065 </species> | |
| 12066 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H9O7P" hasOnlySubstanceUnits="false" id="C00279" metaid="_80258cc0-51ae-4f22-8677-dc5c27d80850" name="D-Erythrose 4-phosphate" sboTerm="SBO:0000240"> | |
| 12067 <notes> | |
| 12068 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12069 <p>kegg.compound: C00279</p> | |
| 12070 <p>KNApSAcK: C00007472</p> | |
| 12071 <p>CAS: 585-18-2</p> | |
| 12072 <p>PubChem: 3574</p> | |
| 12073 <p>3DMET: B04660</p> | |
| 12074 <p>PDB-CCD: E4P</p> | |
| 12075 <p>ChEBI: 48153</p> | |
| 12076 <p>NIKKAJI: J39.057G</p> | |
| 12077 <p>formula: C4H9O7P</p> | |
| 12078 <p>weight: 200.0838</p> | |
| 12079 </body> | |
| 12080 </notes> | |
| 12081 <annotation> | |
| 12082 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12083 <rdf:Description rdf:about="#_80258cc0-51ae-4f22-8677-dc5c27d80850"> | |
| 12084 <bqbiol:is> | |
| 12085 <rdf:Bag> | |
| 12086 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00279"/> | |
| 12087 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007472"/> | |
| 12088 <rdf:li rdf:resource="https://identifiers.org/CAS/585-18-2"/> | |
| 12089 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04660"/> | |
| 12090 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/E4P"/> | |
| 12091 <rdf:li rdf:resource="https://identifiers.org/ChEBI/48153"/> | |
| 12092 </rdf:Bag> | |
| 12093 </bqbiol:is> | |
| 12094 </rdf:Description> | |
| 12095 </rdf:RDF> | |
| 12096 </annotation> | |
| 12097 </species> | |
| 12098 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C16H31O2SR" hasOnlySubstanceUnits="false" id="C04633" metaid="_6c18e0a0-aaf6-4aa2-8678-e8a2a1edb674" name="(3R)-3-Hydroxypalmitoyl-[acyl-carrier protein]" sboTerm="SBO:0000240"> | |
| 12099 <notes> | |
| 12100 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12101 <p>kegg.compound: C04633</p> | |
| 12102 <p>PubChem: 7222</p> | |
| 12103 <p>formula: C16H31O2SR</p> | |
| 12104 </body> | |
| 12105 </notes> | |
| 12106 <annotation> | |
| 12107 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12108 <rdf:Description rdf:about="#_6c18e0a0-aaf6-4aa2-8678-e8a2a1edb674"> | |
| 12109 <bqbiol:is> | |
| 12110 <rdf:Bag> | |
| 12111 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04633"/> | |
| 12112 </rdf:Bag> | |
| 12113 </bqbiol:is> | |
| 12114 </rdf:Description> | |
| 12115 </rdf:RDF> | |
| 12116 </annotation> | |
| 12117 </species> | |
| 12118 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C11H14NO6" hasOnlySubstanceUnits="false" id="C05841" metaid="_3c913abc-e65e-4a35-afb6-0eab824e7b22" name="Nicotinate D-ribonucleoside" sboTerm="SBO:0000240"> | |
| 12119 <notes> | |
| 12120 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12121 <p>kegg.compound: C05841</p> | |
| 12122 <p>PubChem: 8134</p> | |
| 12123 <p>3DMET: B01901</p> | |
| 12124 <p>ChEBI: 27748</p> | |
| 12125 <p>NIKKAJI: J2.759.974E</p> | |
| 12126 <p>formula: C11H14NO6</p> | |
| 12127 <p>weight: 256.232</p> | |
| 12128 </body> | |
| 12129 </notes> | |
| 12130 <annotation> | |
| 12131 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12132 <rdf:Description rdf:about="#_3c913abc-e65e-4a35-afb6-0eab824e7b22"> | |
| 12133 <bqbiol:is> | |
| 12134 <rdf:Bag> | |
| 12135 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05841"/> | |
| 12136 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01901"/> | |
| 12137 <rdf:li rdf:resource="https://identifiers.org/ChEBI/27748"/> | |
| 12138 </rdf:Bag> | |
| 12139 </bqbiol:is> | |
| 12140 </rdf:Description> | |
| 12141 </rdf:RDF> | |
| 12142 </annotation> | |
| 12143 </species> | |
| 12144 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H14O12P2" hasOnlySubstanceUnits="false" id="C03785" metaid="b7afa3ab-c8fc-45ce-b795-69255ec557d6" name="D-Tagatose 1,6-bisphosphate" sboTerm="SBO:0000240"> | |
| 12145 <notes> | |
| 12146 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12147 <p>kegg.compound: C03785</p> | |
| 12148 <p>PubChem: 6535</p> | |
| 12149 <p>3DMET: B04913</p> | |
| 12150 <p>ChEBI: 4250</p> | |
| 12151 <p>NIKKAJI: J2.748.254F</p> | |
| 12152 <p>formula: C6H14O12P2</p> | |
| 12153 <p>weight: 340.1157</p> | |
| 12154 </body> | |
| 12155 </notes> | |
| 12156 <annotation> | |
| 12157 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12158 <rdf:Description rdf:about="#b7afa3ab-c8fc-45ce-b795-69255ec557d6"> | |
| 12159 <bqbiol:is> | |
| 12160 <rdf:Bag> | |
| 12161 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03785"/> | |
| 12162 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04913"/> | |
| 12163 <rdf:li rdf:resource="https://identifiers.org/ChEBI/4250"/> | |
| 12164 </rdf:Bag> | |
| 12165 </bqbiol:is> | |
| 12166 </rdf:Description> | |
| 12167 </rdf:RDF> | |
| 12168 </annotation> | |
| 12169 </species> | |
| 12170 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="HCO3" hasOnlySubstanceUnits="false" id="C00288" metaid="_8dccd112-8109-47dd-acac-d9bd96af5ddb" name="HCO3-" sboTerm="SBO:0000240"> | |
| 12171 <notes> | |
| 12172 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12173 <p>kegg.compound: C00288</p> | |
| 12174 <p>CAS: 71-52-3</p> | |
| 12175 <p>PubChem: 3583</p> | |
| 12176 <p>3DMET: B00080</p> | |
| 12177 <p>PDB-CCD: BCT</p> | |
| 12178 <p>ChEBI: 17544</p> | |
| 12179 <p>formula: HCO3</p> | |
| 12180 <p>weight: 61.0168</p> | |
| 12181 </body> | |
| 12182 </notes> | |
| 12183 <annotation> | |
| 12184 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12185 <rdf:Description rdf:about="#_8dccd112-8109-47dd-acac-d9bd96af5ddb"> | |
| 12186 <bqbiol:is> | |
| 12187 <rdf:Bag> | |
| 12188 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00288"/> | |
| 12189 <rdf:li rdf:resource="https://identifiers.org/CAS/71-52-3"/> | |
| 12190 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00080"/> | |
| 12191 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/BCT"/> | |
| 12192 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17544"/> | |
| 12193 </rdf:Bag> | |
| 12194 </bqbiol:is> | |
| 12195 </rdf:Description> | |
| 12196 </rdf:RDF> | |
| 12197 </annotation> | |
| 12198 </species> | |
| 12199 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H8O3" hasOnlySubstanceUnits="false" id="C00166" metaid="bdc10df3-5e17-42f5-b9ba-553dc105b397" name="Phenylpyruvate" sboTerm="SBO:0000240"> | |
| 12200 <notes> | |
| 12201 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12202 <p>kegg.compound: C00166</p> | |
| 12203 <p>KNApSAcK: C00000751</p> | |
| 12204 <p>CAS: 156-06-9</p> | |
| 12205 <p>PubChem: 3466</p> | |
| 12206 <p>3DMET: B00048</p> | |
| 12207 <p>PDB-CCD: PPY</p> | |
| 12208 <p>ChEBI: 18005 30851</p> | |
| 12209 <p>NIKKAJI: J11.025F</p> | |
| 12210 <p>formula: C9H8O3</p> | |
| 12211 <p>weight: 164.158</p> | |
| 12212 </body> | |
| 12213 </notes> | |
| 12214 <annotation> | |
| 12215 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12216 <rdf:Description rdf:about="#bdc10df3-5e17-42f5-b9ba-553dc105b397"> | |
| 12217 <bqbiol:is> | |
| 12218 <rdf:Bag> | |
| 12219 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00166"/> | |
| 12220 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00000751"/> | |
| 12221 <rdf:li rdf:resource="https://identifiers.org/CAS/156-06-9"/> | |
| 12222 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00048"/> | |
| 12223 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/PPY"/> | |
| 12224 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18005 30851"/> | |
| 12225 </rdf:Bag> | |
| 12226 </bqbiol:is> | |
| 12227 </rdf:Description> | |
| 12228 </rdf:RDF> | |
| 12229 </annotation> | |
| 12230 </species> | |
| 12231 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C14H23N6O3S" hasOnlySubstanceUnits="false" id="C01137" metaid="_3142e8d5-ef2c-4b15-a3ef-16b3478f4901" name="S-Adenosylmethioninamine" sboTerm="SBO:0000240"> | |
| 12232 <notes> | |
| 12233 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12234 <p>kegg.compound: C01137</p> | |
| 12235 <p>PubChem: 4368</p> | |
| 12236 <p>3DMET: B04775</p> | |
| 12237 <p>ChEBI: 15625</p> | |
| 12238 <p>NIKKAJI: J39.567F</p> | |
| 12239 <p>formula: C14H23N6O3S</p> | |
| 12240 <p>weight: 355.4358</p> | |
| 12241 </body> | |
| 12242 </notes> | |
| 12243 <annotation> | |
| 12244 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12245 <rdf:Description rdf:about="#_3142e8d5-ef2c-4b15-a3ef-16b3478f4901"> | |
| 12246 <bqbiol:is> | |
| 12247 <rdf:Bag> | |
| 12248 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01137"/> | |
| 12249 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04775"/> | |
| 12250 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15625"/> | |
| 12251 </rdf:Bag> | |
| 12252 </bqbiol:is> | |
| 12253 </rdf:Description> | |
| 12254 </rdf:RDF> | |
| 12255 </annotation> | |
| 12256 </species> | |
| 12257 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H6O4" hasOnlySubstanceUnits="false" id="C02226" metaid="_499883d6-2e85-4e10-97e9-8ade80c6bed8" name="2-Methylmaleate" sboTerm="SBO:0000240"> | |
| 12258 <notes> | |
| 12259 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12260 <p>kegg.compound: C02226</p> | |
| 12261 <p>CAS: 498-23-7</p> | |
| 12262 <p>PubChem: 5291</p> | |
| 12263 <p>3DMET: B00408</p> | |
| 12264 <p>PDB-CCD: CIZ</p> | |
| 12265 <p>ChEBI: 17626 30719</p> | |
| 12266 <p>LIPIDMAPS: LMFA01170099</p> | |
| 12267 <p>NIKKAJI: J6.106I</p> | |
| 12268 <p>formula: C5H6O4</p> | |
| 12269 <p>weight: 130.0987</p> | |
| 12270 </body> | |
| 12271 </notes> | |
| 12272 <annotation> | |
| 12273 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12274 <rdf:Description rdf:about="#_499883d6-2e85-4e10-97e9-8ade80c6bed8"> | |
| 12275 <bqbiol:is> | |
| 12276 <rdf:Bag> | |
| 12277 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02226"/> | |
| 12278 <rdf:li rdf:resource="https://identifiers.org/CAS/498-23-7"/> | |
| 12279 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00408"/> | |
| 12280 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/CIZ"/> | |
| 12281 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17626 30719"/> | |
| 12282 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA01170099"/> | |
| 12283 </rdf:Bag> | |
| 12284 </bqbiol:is> | |
| 12285 </rdf:Description> | |
| 12286 </rdf:RDF> | |
| 12287 </annotation> | |
| 12288 </species> | |
| 12289 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H16N5O13P3" hasOnlySubstanceUnits="false" id="C00286" metaid="_0b95010c-037b-4e62-a8de-77061b201682" name="dGTP" sboTerm="SBO:0000240"> | |
| 12290 <notes> | |
| 12291 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12292 <p>kegg.compound: C00286</p> | |
| 12293 <p>KNApSAcK: C00019346</p> | |
| 12294 <p>CAS: 2564-35-4</p> | |
| 12295 <p>PubChem: 3581</p> | |
| 12296 <p>3DMET: B01207</p> | |
| 12297 <p>PDB-CCD: DGT</p> | |
| 12298 <p>ChEBI: 16497</p> | |
| 12299 <p>NIKKAJI: J192.065K</p> | |
| 12300 <p>formula: C10H16N5O13P3</p> | |
| 12301 <p>weight: 507.181</p> | |
| 12302 </body> | |
| 12303 </notes> | |
| 12304 <annotation> | |
| 12305 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12306 <rdf:Description rdf:about="#_0b95010c-037b-4e62-a8de-77061b201682"> | |
| 12307 <bqbiol:is> | |
| 12308 <rdf:Bag> | |
| 12309 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00286"/> | |
| 12310 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019346"/> | |
| 12311 <rdf:li rdf:resource="https://identifiers.org/CAS/2564-35-4"/> | |
| 12312 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01207"/> | |
| 12313 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/DGT"/> | |
| 12314 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16497"/> | |
| 12315 </rdf:Bag> | |
| 12316 </bqbiol:is> | |
| 12317 </rdf:Description> | |
| 12318 </rdf:RDF> | |
| 12319 </annotation> | |
| 12320 </species> | |
| 12321 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H16N5O14P3" hasOnlySubstanceUnits="false" id="C00044" metaid="_8a2df9c4-6cc2-4d8b-83dd-8c934ff1cbab" name="GTP" sboTerm="SBO:0000240"> | |
| 12322 <notes> | |
| 12323 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12324 <p>kegg.compound: C00044</p> | |
| 12325 <p>KNApSAcK: C00007223</p> | |
| 12326 <p>CAS: 86-01-1</p> | |
| 12327 <p>PubChem: 3346</p> | |
| 12328 <p>3DMET: B01137</p> | |
| 12329 <p>PDB-CCD: GTP</p> | |
| 12330 <p>ChEBI: 15996</p> | |
| 12331 <p>NIKKAJI: J40.055F</p> | |
| 12332 <p>formula: C10H16N5O14P3</p> | |
| 12333 <p>weight: 523.1804</p> | |
| 12334 </body> | |
| 12335 </notes> | |
| 12336 <annotation> | |
| 12337 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12338 <rdf:Description rdf:about="#_8a2df9c4-6cc2-4d8b-83dd-8c934ff1cbab"> | |
| 12339 <bqbiol:is> | |
| 12340 <rdf:Bag> | |
| 12341 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00044"/> | |
| 12342 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007223"/> | |
| 12343 <rdf:li rdf:resource="https://identifiers.org/CAS/86-01-1"/> | |
| 12344 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01137"/> | |
| 12345 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/GTP"/> | |
| 12346 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15996"/> | |
| 12347 </rdf:Bag> | |
| 12348 </bqbiol:is> | |
| 12349 </rdf:Description> | |
| 12350 </rdf:RDF> | |
| 12351 </annotation> | |
| 12352 </species> | |
| 12353 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C17H27N3O17P2" hasOnlySubstanceUnits="false" id="C00043" metaid="_5bad7a56-7e24-41b2-b289-f9b3cca2c3ef" name="UDP-N-acetyl-alpha-D-glucosamine" sboTerm="SBO:0000240"> | |
| 12354 <notes> | |
| 12355 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12356 <p>kegg.compound: C00043</p> | |
| 12357 <p>KNApSAcK: C00019358</p> | |
| 12358 <p>CAS: 528-04-1</p> | |
| 12359 <p>PubChem: 3345</p> | |
| 12360 <p>3DMET: B04624</p> | |
| 12361 <p>PDB-CCD: UD1</p> | |
| 12362 <p>ChEBI: 16264</p> | |
| 12363 <p>LIPIDMAPS: LMSL01010002</p> | |
| 12364 <p>NIKKAJI: J506.541K</p> | |
| 12365 <p>formula: C17H27N3O17P2</p> | |
| 12366 <p>weight: 607.3537</p> | |
| 12367 </body> | |
| 12368 </notes> | |
| 12369 <annotation> | |
| 12370 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12371 <rdf:Description rdf:about="#_5bad7a56-7e24-41b2-b289-f9b3cca2c3ef"> | |
| 12372 <bqbiol:is> | |
| 12373 <rdf:Bag> | |
| 12374 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00043"/> | |
| 12375 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019358"/> | |
| 12376 <rdf:li rdf:resource="https://identifiers.org/CAS/528-04-1"/> | |
| 12377 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04624"/> | |
| 12378 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/UD1"/> | |
| 12379 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16264"/> | |
| 12380 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMSL01010002"/> | |
| 12381 </rdf:Bag> | |
| 12382 </bqbiol:is> | |
| 12383 </rdf:Description> | |
| 12384 </rdf:RDF> | |
| 12385 </annotation> | |
| 12386 </species> | |
| 12387 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H6O4" hasOnlySubstanceUnits="false" id="C00042" metaid="_0a54e836-39f7-48d0-b182-d2e709563592" name="Succinate" sboTerm="SBO:0000240"> | |
| 12388 <notes> | |
| 12389 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12390 <p>kegg.compound: C00042</p> | |
| 12391 <p>KNApSAcK: C00001205</p> | |
| 12392 <p>CAS: 110-15-6</p> | |
| 12393 <p>PubChem: 3344</p> | |
| 12394 <p>3DMET: B00012</p> | |
| 12395 <p>PDB-CCD: SIN</p> | |
| 12396 <p>ChEBI: 15741</p> | |
| 12397 <p>LIPIDMAPS: LMFA01170043</p> | |
| 12398 <p>NIKKAJI: J2.879G</p> | |
| 12399 <p>formula: C4H6O4</p> | |
| 12400 <p>weight: 118.088</p> | |
| 12401 </body> | |
| 12402 </notes> | |
| 12403 <annotation> | |
| 12404 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12405 <rdf:Description rdf:about="#_0a54e836-39f7-48d0-b182-d2e709563592"> | |
| 12406 <bqbiol:is> | |
| 12407 <rdf:Bag> | |
| 12408 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00042"/> | |
| 12409 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001205"/> | |
| 12410 <rdf:li rdf:resource="https://identifiers.org/CAS/110-15-6"/> | |
| 12411 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00012"/> | |
| 12412 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/SIN"/> | |
| 12413 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15741"/> | |
| 12414 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA01170043"/> | |
| 12415 </rdf:Bag> | |
| 12416 </bqbiol:is> | |
| 12417 </rdf:Description> | |
| 12418 </rdf:RDF> | |
| 12419 </annotation> | |
| 12420 </species> | |
| 12421 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H6O2" hasOnlySubstanceUnits="false" id="C00163" metaid="_28b52ac2-7f33-499f-9d09-fba79c2b4915" name="Propanoate" sboTerm="SBO:0000240"> | |
| 12422 <notes> | |
| 12423 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12424 <p>kegg.compound: C00163</p> | |
| 12425 <p>KNApSAcK: C00044287</p> | |
| 12426 <p>CAS: 79-09-4</p> | |
| 12427 <p>PubChem: 3463</p> | |
| 12428 <p>3DMET: B01176</p> | |
| 12429 <p>PDB-CCD: PPI</p> | |
| 12430 <p>ChEBI: 17272 30768</p> | |
| 12431 <p>LIPIDMAPS: LMFA01010003</p> | |
| 12432 <p>LipidBank: DFA0003</p> | |
| 12433 <p>NIKKAJI: J1.963A</p> | |
| 12434 <p>formula: C3H6O2</p> | |
| 12435 <p>weight: 74.0785</p> | |
| 12436 </body> | |
| 12437 </notes> | |
| 12438 <annotation> | |
| 12439 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12440 <rdf:Description rdf:about="#_28b52ac2-7f33-499f-9d09-fba79c2b4915"> | |
| 12441 <bqbiol:is> | |
| 12442 <rdf:Bag> | |
| 12443 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00163"/> | |
| 12444 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00044287"/> | |
| 12445 <rdf:li rdf:resource="https://identifiers.org/CAS/79-09-4"/> | |
| 12446 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01176"/> | |
| 12447 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/PPI"/> | |
| 12448 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17272 30768"/> | |
| 12449 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA01010003"/> | |
| 12450 <rdf:li rdf:resource="https://identifiers.org/LipidBank/DFA0003"/> | |
| 12451 </rdf:Bag> | |
| 12452 </bqbiol:is> | |
| 12453 </rdf:Description> | |
| 12454 </rdf:RDF> | |
| 12455 </annotation> | |
| 12456 </species> | |
| 12457 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="H2S" hasOnlySubstanceUnits="false" id="C00283" metaid="c9c957b4-c088-49ed-8ee8-ef7527606de3" name="Hydrogen sulfide" sboTerm="SBO:0000240"> | |
| 12458 <notes> | |
| 12459 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12460 <p>kegg.compound: C00283</p> | |
| 12461 <p>KNApSAcK: C00007266</p> | |
| 12462 <p>CAS: 7783-06-4</p> | |
| 12463 <p>PubChem: 3578</p> | |
| 12464 <p>3DMET: B01206</p> | |
| 12465 <p>PDB-CCD: H2S</p> | |
| 12466 <p>ChEBI: 16136</p> | |
| 12467 <p>NIKKAJI: J3.759A</p> | |
| 12468 <p>formula: H2S</p> | |
| 12469 <p>weight: 34.0809</p> | |
| 12470 </body> | |
| 12471 </notes> | |
| 12472 <annotation> | |
| 12473 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12474 <rdf:Description rdf:about="#c9c957b4-c088-49ed-8ee8-ef7527606de3"> | |
| 12475 <bqbiol:is> | |
| 12476 <rdf:Bag> | |
| 12477 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00283"/> | |
| 12478 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007266"/> | |
| 12479 <rdf:li rdf:resource="https://identifiers.org/CAS/7783-06-4"/> | |
| 12480 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01206"/> | |
| 12481 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/H2S"/> | |
| 12482 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16136"/> | |
| 12483 </rdf:Bag> | |
| 12484 </bqbiol:is> | |
| 12485 </rdf:Description> | |
| 12486 </rdf:RDF> | |
| 12487 </annotation> | |
| 12488 </species> | |
| 12489 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H7NO2" hasOnlySubstanceUnits="false" id="C00041" metaid="_39193ae1-ddbc-4adb-b20f-65fe29921afe" name="L-Alanine" sboTerm="SBO:0000240"> | |
| 12490 <notes> | |
| 12491 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12492 <p>kegg.compound: C00041</p> | |
| 12493 <p>KNApSAcK: C00001332</p> | |
| 12494 <p>CAS: 56-41-7</p> | |
| 12495 <p>PubChem: 3343</p> | |
| 12496 <p>3DMET: B00011</p> | |
| 12497 <p>PDB-CCD: ALA</p> | |
| 12498 <p>ChEBI: 16977</p> | |
| 12499 <p>NIKKAJI: J9.168E</p> | |
| 12500 <p>formula: C3H7NO2</p> | |
| 12501 <p>weight: 89.0932</p> | |
| 12502 </body> | |
| 12503 </notes> | |
| 12504 <annotation> | |
| 12505 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12506 <rdf:Description rdf:about="#_39193ae1-ddbc-4adb-b20f-65fe29921afe"> | |
| 12507 <bqbiol:is> | |
| 12508 <rdf:Bag> | |
| 12509 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00041"/> | |
| 12510 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001332"/> | |
| 12511 <rdf:li rdf:resource="https://identifiers.org/CAS/56-41-7"/> | |
| 12512 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00011"/> | |
| 12513 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/ALA"/> | |
| 12514 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16977"/> | |
| 12515 </rdf:Bag> | |
| 12516 </bqbiol:is> | |
| 12517 </rdf:Description> | |
| 12518 </rdf:RDF> | |
| 12519 </annotation> | |
| 12520 </species> | |
| 12521 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C16636" metaid="d6a836c2-f31f-4aa2-92b5-bf357848be06" name="tRNA(Sec)" sboTerm="SBO:0000240"> | |
| 12522 <notes> | |
| 12523 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12524 <p>kegg.compound: C16636</p> | |
| 12525 <p>PubChem: 51090962</p> | |
| 12526 </body> | |
| 12527 </notes> | |
| 12528 <annotation> | |
| 12529 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12530 <rdf:Description rdf:about="#d6a836c2-f31f-4aa2-92b5-bf357848be06"> | |
| 12531 <bqbiol:is> | |
| 12532 <rdf:Bag> | |
| 12533 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C16636"/> | |
| 12534 </rdf:Bag> | |
| 12535 </bqbiol:is> | |
| 12536 </rdf:Description> | |
| 12537 </rdf:RDF> | |
| 12538 </annotation> | |
| 12539 </species> | |
| 12540 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H11NO4" hasOnlySubstanceUnits="false" id="C01250" metaid="_02f7cc87-d01b-4a0f-8cea-7b15234efa08" name="N-Acetyl-L-glutamate 5-semialdehyde" sboTerm="SBO:0000240"> | |
| 12541 <notes> | |
| 12542 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12543 <p>kegg.compound: C01250</p> | |
| 12544 <p>PubChem: 4470</p> | |
| 12545 <p>3DMET: B00264</p> | |
| 12546 <p>ChEBI: 16319 29123</p> | |
| 12547 <p>NIKKAJI: J37.498I</p> | |
| 12548 <p>formula: C7H11NO4</p> | |
| 12549 <p>weight: 173.1665</p> | |
| 12550 </body> | |
| 12551 </notes> | |
| 12552 <annotation> | |
| 12553 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12554 <rdf:Description rdf:about="#_02f7cc87-d01b-4a0f-8cea-7b15234efa08"> | |
| 12555 <bqbiol:is> | |
| 12556 <rdf:Bag> | |
| 12557 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01250"/> | |
| 12558 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00264"/> | |
| 12559 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16319 29123"/> | |
| 12560 </rdf:Bag> | |
| 12561 </bqbiol:is> | |
| 12562 </rdf:Description> | |
| 12563 </rdf:RDF> | |
| 12564 </annotation> | |
| 12565 </species> | |
| 12566 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C41H65N9O28P2" hasOnlySubstanceUnits="false" id="C04882" metaid="_48bdbce4-5874-49d2-be6d-10ccb6683414" name="UDP-N-acetylmuramoyl-L-alanyl-D-glutamyl-6-carboxy-L-lysyl-D-alanyl-D-alanine" sboTerm="SBO:0000240"> | |
| 12567 <notes> | |
| 12568 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12569 <p>kegg.compound: C04882</p> | |
| 12570 <p>PubChem: 7434</p> | |
| 12571 <p>3DMET: B04972</p> | |
| 12572 <p>ChEBI: 18199</p> | |
| 12573 <p>NIKKAJI: J2.754.729J</p> | |
| 12574 <p>formula: C41H65N9O28P2</p> | |
| 12575 <p>weight: 1193.9458</p> | |
| 12576 </body> | |
| 12577 </notes> | |
| 12578 <annotation> | |
| 12579 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12580 <rdf:Description rdf:about="#_48bdbce4-5874-49d2-be6d-10ccb6683414"> | |
| 12581 <bqbiol:is> | |
| 12582 <rdf:Bag> | |
| 12583 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04882"/> | |
| 12584 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04972"/> | |
| 12585 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18199"/> | |
| 12586 </rdf:Bag> | |
| 12587 </bqbiol:is> | |
| 12588 </rdf:Description> | |
| 12589 </rdf:RDF> | |
| 12590 </annotation> | |
| 12591 </species> | |
| 12592 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H9N3O3S2R2" hasOnlySubstanceUnits="false" id="C02582" metaid="d1090bdc-8939-41f9-8c67-caef4a9ba86d" name="Protein disulfide" sboTerm="SBO:0000240"> | |
| 12593 <notes> | |
| 12594 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12595 <p>kegg.compound: C02582</p> | |
| 12596 <p>PubChem: 5577</p> | |
| 12597 <p>ChEBI: 16249</p> | |
| 12598 <p>formula: C7H9N3O3S2R2</p> | |
| 12599 </body> | |
| 12600 </notes> | |
| 12601 <annotation> | |
| 12602 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12603 <rdf:Description rdf:about="#d1090bdc-8939-41f9-8c67-caef4a9ba86d"> | |
| 12604 <bqbiol:is> | |
| 12605 <rdf:Bag> | |
| 12606 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02582"/> | |
| 12607 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16249"/> | |
| 12608 </rdf:Bag> | |
| 12609 </bqbiol:is> | |
| 12610 </rdf:Description> | |
| 12611 </rdf:RDF> | |
| 12612 </annotation> | |
| 12613 </species> | |
| 12614 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C42H48N4O16" hasOnlySubstanceUnits="false" id="C02463" metaid="f8d7190b-fc57-4068-91da-9dfa2bbffe38" name="Precorrin 2" sboTerm="SBO:0000240"> | |
| 12615 <notes> | |
| 12616 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12617 <p>kegg.compound: C02463</p> | |
| 12618 <p>KNApSAcK: C00007375</p> | |
| 12619 <p>CAS: 82542-92-5</p> | |
| 12620 <p>PubChem: 5480</p> | |
| 12621 <p>3DMET: B01575</p> | |
| 12622 <p>ChEBI: 50602</p> | |
| 12623 <p>NIKKAJI: J966.387H</p> | |
| 12624 <p>formula: C42H48N4O16</p> | |
| 12625 <p>weight: 864.8477</p> | |
| 12626 </body> | |
| 12627 </notes> | |
| 12628 <annotation> | |
| 12629 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12630 <rdf:Description rdf:about="#f8d7190b-fc57-4068-91da-9dfa2bbffe38"> | |
| 12631 <bqbiol:is> | |
| 12632 <rdf:Bag> | |
| 12633 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02463"/> | |
| 12634 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007375"/> | |
| 12635 <rdf:li rdf:resource="https://identifiers.org/CAS/82542-92-5"/> | |
| 12636 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01575"/> | |
| 12637 <rdf:li rdf:resource="https://identifiers.org/ChEBI/50602"/> | |
| 12638 </rdf:Bag> | |
| 12639 </bqbiol:is> | |
| 12640 </rdf:Description> | |
| 12641 </rdf:RDF> | |
| 12642 </annotation> | |
| 12643 </species> | |
| 12644 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H7NO4" hasOnlySubstanceUnits="false" id="C00049" metaid="_48ee3166-c3ca-4344-a73d-19d99d239bbb" name="L-Aspartate" sboTerm="SBO:0000240"> | |
| 12645 <notes> | |
| 12646 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12647 <p>kegg.compound: C00049</p> | |
| 12648 <p>KNApSAcK: C00001342</p> | |
| 12649 <p>CAS: 56-84-8</p> | |
| 12650 <p>PubChem: 3351</p> | |
| 12651 <p>3DMET: B00015</p> | |
| 12652 <p>PDB-CCD: ASP IAS</p> | |
| 12653 <p>ChEBI: 17053</p> | |
| 12654 <p>NIKKAJI: J9.169C</p> | |
| 12655 <p>formula: C4H7NO4</p> | |
| 12656 <p>weight: 133.1027</p> | |
| 12657 </body> | |
| 12658 </notes> | |
| 12659 <annotation> | |
| 12660 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12661 <rdf:Description rdf:about="#_48ee3166-c3ca-4344-a73d-19d99d239bbb"> | |
| 12662 <bqbiol:is> | |
| 12663 <rdf:Bag> | |
| 12664 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00049"/> | |
| 12665 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001342"/> | |
| 12666 <rdf:li rdf:resource="https://identifiers.org/CAS/56-84-8"/> | |
| 12667 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00015"/> | |
| 12668 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/ASP IAS"/> | |
| 12669 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17053"/> | |
| 12670 </rdf:Bag> | |
| 12671 </bqbiol:is> | |
| 12672 </rdf:Description> | |
| 12673 </rdf:RDF> | |
| 12674 </annotation> | |
| 12675 </species> | |
| 12676 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C14H18N5O11P" hasOnlySubstanceUnits="false" id="C03794" metaid="eff7db45-9a8c-48f0-93ed-bfcec96ab2c3" name="N6-(1,2-Dicarboxyethyl)-AMP" sboTerm="SBO:0000240"> | |
| 12677 <notes> | |
| 12678 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12679 <p>kegg.compound: C03794</p> | |
| 12680 <p>KNApSAcK: C00007229</p> | |
| 12681 <p>CAS: 19046-78-7</p> | |
| 12682 <p>PubChem: 6543</p> | |
| 12683 <p>3DMET: B04914</p> | |
| 12684 <p>PDB-CCD: 2SA</p> | |
| 12685 <p>ChEBI: 15919</p> | |
| 12686 <p>NIKKAJI: J37.503I</p> | |
| 12687 <p>formula: C14H18N5O11P</p> | |
| 12688 <p>weight: 463.2934</p> | |
| 12689 </body> | |
| 12690 </notes> | |
| 12691 <annotation> | |
| 12692 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12693 <rdf:Description rdf:about="#eff7db45-9a8c-48f0-93ed-bfcec96ab2c3"> | |
| 12694 <bqbiol:is> | |
| 12695 <rdf:Bag> | |
| 12696 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03794"/> | |
| 12697 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007229"/> | |
| 12698 <rdf:li rdf:resource="https://identifiers.org/CAS/19046-78-7"/> | |
| 12699 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04914"/> | |
| 12700 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/2SA"/> | |
| 12701 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15919"/> | |
| 12702 </rdf:Bag> | |
| 12703 </bqbiol:is> | |
| 12704 </rdf:Description> | |
| 12705 </rdf:RDF> | |
| 12706 </annotation> | |
| 12707 </species> | |
| 12708 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="CH4NO5P" hasOnlySubstanceUnits="false" id="C00169" metaid="ed5770dc-02a0-425c-98ab-54cf4d07e737" name="Carbamoyl phosphate" sboTerm="SBO:0000240"> | |
| 12709 <notes> | |
| 12710 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12711 <p>kegg.compound: C00169</p> | |
| 12712 <p>KNApSAcK: C00007513</p> | |
| 12713 <p>CAS: 590-55-6</p> | |
| 12714 <p>PubChem: 3469</p> | |
| 12715 <p>3DMET: B00050</p> | |
| 12716 <p>PDB-CCD: CP</p> | |
| 12717 <p>ChEBI: 17672</p> | |
| 12718 <p>NIKKAJI: J39.574I</p> | |
| 12719 <p>formula: CH4NO5P</p> | |
| 12720 <p>weight: 141.0199</p> | |
| 12721 </body> | |
| 12722 </notes> | |
| 12723 <annotation> | |
| 12724 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12725 <rdf:Description rdf:about="#ed5770dc-02a0-425c-98ab-54cf4d07e737"> | |
| 12726 <bqbiol:is> | |
| 12727 <rdf:Bag> | |
| 12728 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00169"/> | |
| 12729 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007513"/> | |
| 12730 <rdf:li rdf:resource="https://identifiers.org/CAS/590-55-6"/> | |
| 12731 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00050"/> | |
| 12732 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/CP"/> | |
| 12733 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17672"/> | |
| 12734 </rdf:Bag> | |
| 12735 </bqbiol:is> | |
| 12736 </rdf:Description> | |
| 12737 </rdf:RDF> | |
| 12738 </annotation> | |
| 12739 </species> | |
| 12740 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C11H23N2O7PS" hasOnlySubstanceUnits="false" id="C01134" metaid="_84a64b2d-cdb4-4d23-a54a-eb4f887596b9" name="Pantetheine 4'-phosphate" sboTerm="SBO:0000240"> | |
| 12741 <notes> | |
| 12742 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12743 <p>kegg.compound: C01134</p> | |
| 12744 <p>PubChem: 4365</p> | |
| 12745 <p>3DMET: B04774</p> | |
| 12746 <p>PDB-CCD: PNS</p> | |
| 12747 <p>ChEBI: 16858 4222</p> | |
| 12748 <p>NIKKAJI: J1.112.929C</p> | |
| 12749 <p>formula: C11H23N2O7PS</p> | |
| 12750 <p>weight: 358.3483</p> | |
| 12751 </body> | |
| 12752 </notes> | |
| 12753 <annotation> | |
| 12754 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12755 <rdf:Description rdf:about="#_84a64b2d-cdb4-4d23-a54a-eb4f887596b9"> | |
| 12756 <bqbiol:is> | |
| 12757 <rdf:Bag> | |
| 12758 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01134"/> | |
| 12759 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04774"/> | |
| 12760 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/PNS"/> | |
| 12761 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16858 4222"/> | |
| 12762 </rdf:Bag> | |
| 12763 </bqbiol:is> | |
| 12764 </rdf:Description> | |
| 12765 </rdf:RDF> | |
| 12766 </annotation> | |
| 12767 </species> | |
| 12768 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H14N2O2" hasOnlySubstanceUnits="false" id="C00047" metaid="_9b64d3b3-b549-437c-8a9d-6b484c590baf" name="L-Lysine" sboTerm="SBO:0000240"> | |
| 12769 <notes> | |
| 12770 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12771 <p>kegg.compound: C00047</p> | |
| 12772 <p>KNApSAcK: C00001378</p> | |
| 12773 <p>CAS: 56-87-1</p> | |
| 12774 <p>PubChem: 3349</p> | |
| 12775 <p>3DMET: B00013</p> | |
| 12776 <p>PDB-CCD: LYS</p> | |
| 12777 <p>ChEBI: 18019</p> | |
| 12778 <p>NIKKAJI: J9.176F</p> | |
| 12779 <p>formula: C6H14N2O2</p> | |
| 12780 <p>weight: 146.1876</p> | |
| 12781 </body> | |
| 12782 </notes> | |
| 12783 <annotation> | |
| 12784 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12785 <rdf:Description rdf:about="#_9b64d3b3-b549-437c-8a9d-6b484c590baf"> | |
| 12786 <bqbiol:is> | |
| 12787 <rdf:Bag> | |
| 12788 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00047"/> | |
| 12789 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001378"/> | |
| 12790 <rdf:li rdf:resource="https://identifiers.org/CAS/56-87-1"/> | |
| 12791 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00013"/> | |
| 12792 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/LYS"/> | |
| 12793 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18019"/> | |
| 12794 </rdf:Bag> | |
| 12795 </bqbiol:is> | |
| 12796 </rdf:Description> | |
| 12797 </rdf:RDF> | |
| 12798 </annotation> | |
| 12799 </species> | |
| 12800 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H9NO2" hasOnlySubstanceUnits="false" id="C01026" metaid="_50f1d3ad-5669-405c-95f2-bffd6c9c891a" name="N,N-Dimethylglycine" sboTerm="SBO:0000240"> | |
| 12801 <notes> | |
| 12802 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12803 <p>kegg.compound: C01026</p> | |
| 12804 <p>CAS: 1118-68-9</p> | |
| 12805 <p>PubChem: 4271</p> | |
| 12806 <p>3DMET: B00224</p> | |
| 12807 <p>PDB-CCD: DMG</p> | |
| 12808 <p>ChEBI: 17724</p> | |
| 12809 <p>NIKKAJI: J135.420E</p> | |
| 12810 <p>formula: C4H9NO2</p> | |
| 12811 <p>weight: 103.1198</p> | |
| 12812 </body> | |
| 12813 </notes> | |
| 12814 <annotation> | |
| 12815 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12816 <rdf:Description rdf:about="#_50f1d3ad-5669-405c-95f2-bffd6c9c891a"> | |
| 12817 <bqbiol:is> | |
| 12818 <rdf:Bag> | |
| 12819 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01026"/> | |
| 12820 <rdf:li rdf:resource="https://identifiers.org/CAS/1118-68-9"/> | |
| 12821 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00224"/> | |
| 12822 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/DMG"/> | |
| 12823 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17724"/> | |
| 12824 </rdf:Bag> | |
| 12825 </bqbiol:is> | |
| 12826 </rdf:Description> | |
| 12827 </rdf:RDF> | |
| 12828 </annotation> | |
| 12829 </species> | |
| 12830 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H15N4O9P" hasOnlySubstanceUnits="false" id="C01268" metaid="_78145ad1-3e82-4f10-b143-7c689ce51c45" name="5-Amino-6-(5'-phosphoribosylamino)uracil" sboTerm="SBO:0000240"> | |
| 12831 <notes> | |
| 12832 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12833 <p>kegg.compound: C01268</p> | |
| 12834 <p>KNApSAcK: C00019665</p> | |
| 12835 <p>PubChem: 4487</p> | |
| 12836 <p>3DMET: B01428</p> | |
| 12837 <p>PDB-CCD: AOF</p> | |
| 12838 <p>ChEBI: 18337</p> | |
| 12839 <p>NIKKAJI: J1.722.459J</p> | |
| 12840 <p>formula: C9H15N4O9P</p> | |
| 12841 <p>weight: 354.2106</p> | |
| 12842 </body> | |
| 12843 </notes> | |
| 12844 <annotation> | |
| 12845 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12846 <rdf:Description rdf:about="#_78145ad1-3e82-4f10-b143-7c689ce51c45"> | |
| 12847 <bqbiol:is> | |
| 12848 <rdf:Bag> | |
| 12849 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01268"/> | |
| 12850 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019665"/> | |
| 12851 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01428"/> | |
| 12852 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/AOF"/> | |
| 12853 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18337"/> | |
| 12854 </rdf:Bag> | |
| 12855 </bqbiol:is> | |
| 12856 </rdf:Description> | |
| 12857 </rdf:RDF> | |
| 12858 </annotation> | |
| 12859 </species> | |
| 12860 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H11O2SR" hasOnlySubstanceUnits="false" id="C05747" metaid="d0248c0e-7e95-4230-9fdb-1c0706fe0eb6" name="(R)-3-Hydroxyhexanoyl-[acp]" sboTerm="SBO:0000240"> | |
| 12861 <notes> | |
| 12862 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12863 <p>kegg.compound: C05747</p> | |
| 12864 <p>PubChem: 8042</p> | |
| 12865 <p>ChEBI: 326</p> | |
| 12866 <p>formula: C6H11O2SR</p> | |
| 12867 </body> | |
| 12868 </notes> | |
| 12869 <annotation> | |
| 12870 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12871 <rdf:Description rdf:about="#d0248c0e-7e95-4230-9fdb-1c0706fe0eb6"> | |
| 12872 <bqbiol:is> | |
| 12873 <rdf:Bag> | |
| 12874 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05747"/> | |
| 12875 <rdf:li rdf:resource="https://identifiers.org/ChEBI/326"/> | |
| 12876 </rdf:Bag> | |
| 12877 </bqbiol:is> | |
| 12878 </rdf:Description> | |
| 12879 </rdf:RDF> | |
| 12880 </annotation> | |
| 12881 </species> | |
| 12882 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H9NO3" hasOnlySubstanceUnits="false" id="C02115" metaid="_2a955a48-013d-4321-b47f-e1daefb444cc" name="2-Methylserine" sboTerm="SBO:0000240"> | |
| 12883 <notes> | |
| 12884 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12885 <p>kegg.compound: C02115</p> | |
| 12886 <p>CAS: 5424-29-3</p> | |
| 12887 <p>PubChem: 5195</p> | |
| 12888 <p>ChEBI: 17799 74819</p> | |
| 12889 <p>NIKKAJI: J220.018J J35.792H</p> | |
| 12890 <p>formula: C4H9NO3</p> | |
| 12891 <p>weight: 119.1192</p> | |
| 12892 </body> | |
| 12893 </notes> | |
| 12894 <annotation> | |
| 12895 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12896 <rdf:Description rdf:about="#_2a955a48-013d-4321-b47f-e1daefb444cc"> | |
| 12897 <bqbiol:is> | |
| 12898 <rdf:Bag> | |
| 12899 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02115"/> | |
| 12900 <rdf:li rdf:resource="https://identifiers.org/CAS/5424-29-3"/> | |
| 12901 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17799 74819"/> | |
| 12902 </rdf:Bag> | |
| 12903 </bqbiol:is> | |
| 12904 </rdf:Description> | |
| 12905 </rdf:RDF> | |
| 12906 </annotation> | |
| 12907 </species> | |
| 12908 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C03688" metaid="_22390f37-ded7-47b3-af04-0c7b004ba792" name="Apo-[acyl-carrier-protein]" sboTerm="SBO:0000240"> | |
| 12909 <notes> | |
| 12910 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12911 <p>kegg.compound: C03688</p> | |
| 12912 <p>PubChem: 6463</p> | |
| 12913 <p>ChEBI: 16139</p> | |
| 12914 </body> | |
| 12915 </notes> | |
| 12916 <annotation> | |
| 12917 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12918 <rdf:Description rdf:about="#_22390f37-ded7-47b3-af04-0c7b004ba792"> | |
| 12919 <bqbiol:is> | |
| 12920 <rdf:Bag> | |
| 12921 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03688"/> | |
| 12922 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16139"/> | |
| 12923 </rdf:Bag> | |
| 12924 </bqbiol:is> | |
| 12925 </rdf:Description> | |
| 12926 </rdf:RDF> | |
| 12927 </annotation> | |
| 12928 </species> | |
| 12929 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H13O10P" hasOnlySubstanceUnits="false" id="C01269" metaid="_8d151a0f-ba7b-4c69-9ab3-cc0859202779" name="5-O-(1-Carboxyvinyl)-3-phosphoshikimate" sboTerm="SBO:0000240"> | |
| 12930 <notes> | |
| 12931 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12932 <p>kegg.compound: C01269</p> | |
| 12933 <p>KNApSAcK: C00007627</p> | |
| 12934 <p>PubChem: 4488</p> | |
| 12935 <p>3DMET: B01429</p> | |
| 12936 <p>PDB-CCD: EPS</p> | |
| 12937 <p>ChEBI: 16257</p> | |
| 12938 <p>NIKKAJI: J630.842B</p> | |
| 12939 <p>formula: C10H13O10P</p> | |
| 12940 <p>weight: 324.178</p> | |
| 12941 </body> | |
| 12942 </notes> | |
| 12943 <annotation> | |
| 12944 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12945 <rdf:Description rdf:about="#_8d151a0f-ba7b-4c69-9ab3-cc0859202779"> | |
| 12946 <bqbiol:is> | |
| 12947 <rdf:Bag> | |
| 12948 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01269"/> | |
| 12949 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007627"/> | |
| 12950 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01429"/> | |
| 12951 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/EPS"/> | |
| 12952 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16257"/> | |
| 12953 </rdf:Bag> | |
| 12954 </bqbiol:is> | |
| 12955 </rdf:Description> | |
| 12956 </rdf:RDF> | |
| 12957 </annotation> | |
| 12958 </species> | |
| 12959 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H9OSR" hasOnlySubstanceUnits="false" id="C05748" metaid="_52766580-36ba-495a-a8ad-df04ea6462c5" name="trans-Hex-2-enoyl-[acp]" sboTerm="SBO:0000240"> | |
| 12960 <notes> | |
| 12961 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12962 <p>kegg.compound: C05748</p> | |
| 12963 <p>PubChem: 8043</p> | |
| 12964 <p>ChEBI: 10727</p> | |
| 12965 <p>formula: C6H9OSR</p> | |
| 12966 </body> | |
| 12967 </notes> | |
| 12968 <annotation> | |
| 12969 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12970 <rdf:Description rdf:about="#_52766580-36ba-495a-a8ad-df04ea6462c5"> | |
| 12971 <bqbiol:is> | |
| 12972 <rdf:Bag> | |
| 12973 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05748"/> | |
| 12974 <rdf:li rdf:resource="https://identifiers.org/ChEBI/10727"/> | |
| 12975 </rdf:Bag> | |
| 12976 </bqbiol:is> | |
| 12977 </rdf:Description> | |
| 12978 </rdf:RDF> | |
| 12979 </annotation> | |
| 12980 </species> | |
| 12981 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H14N3O8P" hasOnlySubstanceUnits="false" id="C00055" metaid="c7abf917-672d-49ef-ac0f-945373187cd6" name="CMP" sboTerm="SBO:0000240"> | |
| 12982 <notes> | |
| 12983 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 12984 <p>kegg.compound: C00055</p> | |
| 12985 <p>CAS: 63-37-6</p> | |
| 12986 <p>PubChem: 3357</p> | |
| 12987 <p>3DMET: B01141</p> | |
| 12988 <p>PDB-CCD: C C5P</p> | |
| 12989 <p>ChEBI: 17361 181630</p> | |
| 12990 <p>NIKKAJI: J60.869F</p> | |
| 12991 <p>formula: C9H14N3O8P</p> | |
| 12992 <p>weight: 323.1965</p> | |
| 12993 </body> | |
| 12994 </notes> | |
| 12995 <annotation> | |
| 12996 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 12997 <rdf:Description rdf:about="#c7abf917-672d-49ef-ac0f-945373187cd6"> | |
| 12998 <bqbiol:is> | |
| 12999 <rdf:Bag> | |
| 13000 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00055"/> | |
| 13001 <rdf:li rdf:resource="https://identifiers.org/CAS/63-37-6"/> | |
| 13002 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01141"/> | |
| 13003 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/C C5P"/> | |
| 13004 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17361 181630"/> | |
| 13005 </rdf:Bag> | |
| 13006 </bqbiol:is> | |
| 13007 </rdf:Description> | |
| 13008 </rdf:RDF> | |
| 13009 </annotation> | |
| 13010 </species> | |
| 13011 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H7OSR" hasOnlySubstanceUnits="false" id="C05745" metaid="b89cb359-b1a5-42f4-979b-0746afec5f76" name="Butyryl-[acp]" sboTerm="SBO:0000240"> | |
| 13012 <notes> | |
| 13013 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13014 <p>kegg.compound: C05745</p> | |
| 13015 <p>PubChem: 8040</p> | |
| 13016 <p>ChEBI: 3247</p> | |
| 13017 <p>formula: C4H7OSR</p> | |
| 13018 </body> | |
| 13019 </notes> | |
| 13020 <annotation> | |
| 13021 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13022 <rdf:Description rdf:about="#b89cb359-b1a5-42f4-979b-0746afec5f76"> | |
| 13023 <bqbiol:is> | |
| 13024 <rdf:Bag> | |
| 13025 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05745"/> | |
| 13026 <rdf:li rdf:resource="https://identifiers.org/ChEBI/3247"/> | |
| 13027 </rdf:Bag> | |
| 13028 </bqbiol:is> | |
| 13029 </rdf:Description> | |
| 13030 </rdf:RDF> | |
| 13031 </annotation> | |
| 13032 </species> | |
| 13033 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H15N5O10P2" hasOnlySubstanceUnits="false" id="C00054" metaid="a63150e2-c435-438c-837e-0335af7958d5" name="Adenosine 3',5'-bisphosphate" sboTerm="SBO:0000240"> | |
| 13034 <notes> | |
| 13035 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13036 <p>kegg.compound: C00054</p> | |
| 13037 <p>KNApSAcK: C00019352</p> | |
| 13038 <p>CAS: 1053-73-2</p> | |
| 13039 <p>PubChem: 3356</p> | |
| 13040 <p>3DMET: B01140</p> | |
| 13041 <p>PDB-CCD: A3P</p> | |
| 13042 <p>ChEBI: 17985</p> | |
| 13043 <p>NIKKAJI: J14.396K</p> | |
| 13044 <p>formula: C10H15N5O10P2</p> | |
| 13045 <p>weight: 427.2011</p> | |
| 13046 </body> | |
| 13047 </notes> | |
| 13048 <annotation> | |
| 13049 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13050 <rdf:Description rdf:about="#a63150e2-c435-438c-837e-0335af7958d5"> | |
| 13051 <bqbiol:is> | |
| 13052 <rdf:Bag> | |
| 13053 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00054"/> | |
| 13054 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019352"/> | |
| 13055 <rdf:li rdf:resource="https://identifiers.org/CAS/1053-73-2"/> | |
| 13056 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01140"/> | |
| 13057 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/A3P"/> | |
| 13058 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17985"/> | |
| 13059 </rdf:Bag> | |
| 13060 </bqbiol:is> | |
| 13061 </rdf:Description> | |
| 13062 </rdf:RDF> | |
| 13063 </annotation> | |
| 13064 </species> | |
| 13065 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H9O2SR" hasOnlySubstanceUnits="false" id="C05746" metaid="_8bb7e6a9-0ee6-490a-9809-1bdaf4eac3b2" name="3-Oxohexanoyl-[acp]" sboTerm="SBO:0000240"> | |
| 13066 <notes> | |
| 13067 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13068 <p>kegg.compound: C05746</p> | |
| 13069 <p>PubChem: 8041</p> | |
| 13070 <p>ChEBI: 1642</p> | |
| 13071 <p>formula: C6H9O2SR</p> | |
| 13072 </body> | |
| 13073 </notes> | |
| 13074 <annotation> | |
| 13075 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13076 <rdf:Description rdf:about="#_8bb7e6a9-0ee6-490a-9809-1bdaf4eac3b2"> | |
| 13077 <bqbiol:is> | |
| 13078 <rdf:Bag> | |
| 13079 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05746"/> | |
| 13080 <rdf:li rdf:resource="https://identifiers.org/ChEBI/1642"/> | |
| 13081 </rdf:Bag> | |
| 13082 </bqbiol:is> | |
| 13083 </rdf:Description> | |
| 13084 </rdf:RDF> | |
| 13085 </annotation> | |
| 13086 </species> | |
| 13087 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H4N2O4" hasOnlySubstanceUnits="false" id="C00295" metaid="_41b4841d-8a4e-43a9-87a5-c3832eaa8eed" name="Orotate" sboTerm="SBO:0000240"> | |
| 13088 <notes> | |
| 13089 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13090 <p>kegg.compound: C00295</p> | |
| 13091 <p>KNApSAcK: C00007300 C00019689</p> | |
| 13092 <p>CAS: 65-86-1</p> | |
| 13093 <p>PubChem: 3589</p> | |
| 13094 <p>3DMET: B00083</p> | |
| 13095 <p>PDB-CCD: ORO</p> | |
| 13096 <p>ChEBI: 16742</p> | |
| 13097 <p>NIKKAJI: J2.359K</p> | |
| 13098 <p>formula: C5H4N2O4</p> | |
| 13099 <p>weight: 156.0963</p> | |
| 13100 </body> | |
| 13101 </notes> | |
| 13102 <annotation> | |
| 13103 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13104 <rdf:Description rdf:about="#_41b4841d-8a4e-43a9-87a5-c3832eaa8eed"> | |
| 13105 <bqbiol:is> | |
| 13106 <rdf:Bag> | |
| 13107 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00295"/> | |
| 13108 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007300 C00019689"/> | |
| 13109 <rdf:li rdf:resource="https://identifiers.org/CAS/65-86-1"/> | |
| 13110 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00083"/> | |
| 13111 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/ORO"/> | |
| 13112 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16742"/> | |
| 13113 </rdf:Bag> | |
| 13114 </bqbiol:is> | |
| 13115 </rdf:Description> | |
| 13116 </rdf:RDF> | |
| 13117 </annotation> | |
| 13118 </species> | |
| 13119 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H15N5O13P2S" hasOnlySubstanceUnits="false" id="C00053" metaid="c31ddcea-f177-4bd6-bc7c-f08f44c94312" name="3'-Phosphoadenylyl sulfate" sboTerm="SBO:0000240"> | |
| 13120 <notes> | |
| 13121 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13122 <p>kegg.compound: C00053</p> | |
| 13123 <p>KNApSAcK: C00007446</p> | |
| 13124 <p>CAS: 482-67-7</p> | |
| 13125 <p>PubChem: 3355</p> | |
| 13126 <p>3DMET: B01139</p> | |
| 13127 <p>PDB-CCD: PPS</p> | |
| 13128 <p>ChEBI: 17980</p> | |
| 13129 <p>NIKKAJI: J372.802A</p> | |
| 13130 <p>formula: C10H15N5O13P2S</p> | |
| 13131 <p>weight: 507.2643</p> | |
| 13132 </body> | |
| 13133 </notes> | |
| 13134 <annotation> | |
| 13135 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13136 <rdf:Description rdf:about="#c31ddcea-f177-4bd6-bc7c-f08f44c94312"> | |
| 13137 <bqbiol:is> | |
| 13138 <rdf:Bag> | |
| 13139 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00053"/> | |
| 13140 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007446"/> | |
| 13141 <rdf:li rdf:resource="https://identifiers.org/CAS/482-67-7"/> | |
| 13142 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01139"/> | |
| 13143 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/PPS"/> | |
| 13144 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17980"/> | |
| 13145 </rdf:Bag> | |
| 13146 </bqbiol:is> | |
| 13147 </rdf:Description> | |
| 13148 </rdf:RDF> | |
| 13149 </annotation> | |
| 13150 </species> | |
| 13151 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H4OSR2" hasOnlySubstanceUnits="false" id="C00173" metaid="c94cc1dd-6b2a-43fc-9d87-c27ab8f158d5" name="Acyl-[acyl-carrier protein]" sboTerm="SBO:0000240"> | |
| 13152 <notes> | |
| 13153 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13154 <p>kegg.compound: C00173</p> | |
| 13155 <p>PubChem: 3473</p> | |
| 13156 <p>ChEBI: 16018</p> | |
| 13157 <p>formula: C3H4OSR2</p> | |
| 13158 </body> | |
| 13159 </notes> | |
| 13160 <annotation> | |
| 13161 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13162 <rdf:Description rdf:about="#c94cc1dd-6b2a-43fc-9d87-c27ab8f158d5"> | |
| 13163 <bqbiol:is> | |
| 13164 <rdf:Bag> | |
| 13165 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00173"/> | |
| 13166 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16018"/> | |
| 13167 </rdf:Bag> | |
| 13168 </bqbiol:is> | |
| 13169 </rdf:Description> | |
| 13170 </rdf:RDF> | |
| 13171 </annotation> | |
| 13172 </species> | |
| 13173 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H12N4O5" hasOnlySubstanceUnits="false" id="C00294" metaid="_5c97d4f0-8039-4d31-b645-393cd8850239" name="Inosine" sboTerm="SBO:0000240"> | |
| 13174 <notes> | |
| 13175 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13176 <p>kegg.compound: C00294</p> | |
| 13177 <p>KNApSAcK: C00019692</p> | |
| 13178 <p>CAS: 58-63-9</p> | |
| 13179 <p>PubChem: 3588</p> | |
| 13180 <p>3DMET: B01208</p> | |
| 13181 <p>PDB-CCD: NOS</p> | |
| 13182 <p>ChEBI: 17596</p> | |
| 13183 <p>NIKKAJI: J1.388I</p> | |
| 13184 <p>formula: C10H12N4O5</p> | |
| 13185 <p>weight: 268.2261</p> | |
| 13186 </body> | |
| 13187 </notes> | |
| 13188 <annotation> | |
| 13189 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13190 <rdf:Description rdf:about="#_5c97d4f0-8039-4d31-b645-393cd8850239"> | |
| 13191 <bqbiol:is> | |
| 13192 <rdf:Bag> | |
| 13193 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00294"/> | |
| 13194 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019692"/> | |
| 13195 <rdf:li rdf:resource="https://identifiers.org/CAS/58-63-9"/> | |
| 13196 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01208"/> | |
| 13197 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/NOS"/> | |
| 13198 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17596"/> | |
| 13199 </rdf:Bag> | |
| 13200 </bqbiol:is> | |
| 13201 </rdf:Description> | |
| 13202 </rdf:RDF> | |
| 13203 </annotation> | |
| 13204 </species> | |
| 13205 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H17N3O6S" hasOnlySubstanceUnits="false" id="C00051" metaid="_25405e91-9d26-4274-80da-dd352d11d041" name="Glutathione" sboTerm="SBO:0000240"> | |
| 13206 <notes> | |
| 13207 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13208 <p>kegg.compound: C00051</p> | |
| 13209 <p>KNApSAcK: C00001518</p> | |
| 13210 <p>CAS: 70-18-8</p> | |
| 13211 <p>PubChem: 3353</p> | |
| 13212 <p>3DMET: B01138</p> | |
| 13213 <p>PDB-CCD: GSH VDW</p> | |
| 13214 <p>ChEBI: 16856</p> | |
| 13215 <p>NIKKAJI: J10.686K</p> | |
| 13216 <p>formula: C10H17N3O6S</p> | |
| 13217 <p>weight: 307.3235</p> | |
| 13218 </body> | |
| 13219 </notes> | |
| 13220 <annotation> | |
| 13221 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13222 <rdf:Description rdf:about="#_25405e91-9d26-4274-80da-dd352d11d041"> | |
| 13223 <bqbiol:is> | |
| 13224 <rdf:Bag> | |
| 13225 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00051"/> | |
| 13226 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001518"/> | |
| 13227 <rdf:li rdf:resource="https://identifiers.org/CAS/70-18-8"/> | |
| 13228 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01138"/> | |
| 13229 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/GSH VDW"/> | |
| 13230 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16856"/> | |
| 13231 </rdf:Bag> | |
| 13232 </bqbiol:is> | |
| 13233 </rdf:Description> | |
| 13234 </rdf:RDF> | |
| 13235 </annotation> | |
| 13236 </species> | |
| 13237 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H11OSR" hasOnlySubstanceUnits="false" id="C05749" metaid="_3e86f1b0-de41-4ba3-a0bd-772e187343c2" name="Hexanoyl-[acp]" sboTerm="SBO:0000240"> | |
| 13238 <notes> | |
| 13239 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13240 <p>kegg.compound: C05749</p> | |
| 13241 <p>PubChem: 8044</p> | |
| 13242 <p>ChEBI: 5704</p> | |
| 13243 <p>formula: C6H11OSR</p> | |
| 13244 </body> | |
| 13245 </notes> | |
| 13246 <annotation> | |
| 13247 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13248 <rdf:Description rdf:about="#_3e86f1b0-de41-4ba3-a0bd-772e187343c2"> | |
| 13249 <bqbiol:is> | |
| 13250 <rdf:Bag> | |
| 13251 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05749"/> | |
| 13252 <rdf:li rdf:resource="https://identifiers.org/ChEBI/5704"/> | |
| 13253 </rdf:Bag> | |
| 13254 </bqbiol:is> | |
| 13255 </rdf:Description> | |
| 13256 </rdf:RDF> | |
| 13257 </annotation> | |
| 13258 </species> | |
| 13259 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C11H15N5O3S" hasOnlySubstanceUnits="false" id="C00170" metaid="af4c9051-5e65-4e15-9b34-78e25d3b9de5" name="5'-Methylthioadenosine" sboTerm="SBO:0000240"> | |
| 13260 <notes> | |
| 13261 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13262 <p>kegg.compound: C00170</p> | |
| 13263 <p>CAS: 2457-80-9</p> | |
| 13264 <p>PubChem: 3470</p> | |
| 13265 <p>3DMET: B01178</p> | |
| 13266 <p>PDB-CCD: MTA</p> | |
| 13267 <p>ChEBI: 17509 180963</p> | |
| 13268 <p>NIKKAJI: J22.737D</p> | |
| 13269 <p>formula: C11H15N5O3S</p> | |
| 13270 <p>weight: 297.3335</p> | |
| 13271 </body> | |
| 13272 </notes> | |
| 13273 <annotation> | |
| 13274 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13275 <rdf:Description rdf:about="#af4c9051-5e65-4e15-9b34-78e25d3b9de5"> | |
| 13276 <bqbiol:is> | |
| 13277 <rdf:Bag> | |
| 13278 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00170"/> | |
| 13279 <rdf:li rdf:resource="https://identifiers.org/CAS/2457-80-9"/> | |
| 13280 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01178"/> | |
| 13281 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/MTA"/> | |
| 13282 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17509 180963"/> | |
| 13283 </rdf:Bag> | |
| 13284 </bqbiol:is> | |
| 13285 </rdf:Description> | |
| 13286 </rdf:RDF> | |
| 13287 </annotation> | |
| 13288 </species> | |
| 13289 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C8H15N3O4" hasOnlySubstanceUnits="false" id="C15532" metaid="dcf1a29a-6ab9-4ebf-ab2c-4ed8013d827f" name="N-Acetyl-L-citrulline" sboTerm="SBO:0000240"> | |
| 13290 <notes> | |
| 13291 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13292 <p>kegg.compound: C15532</p> | |
| 13293 <p>PubChem: 17396524</p> | |
| 13294 <p>PDB-CCD: OLN</p> | |
| 13295 <p>ChEBI: 49002</p> | |
| 13296 <p>NIKKAJI: J2.794.851K</p> | |
| 13297 <p>formula: C8H15N3O4</p> | |
| 13298 <p>weight: 217.2224</p> | |
| 13299 </body> | |
| 13300 </notes> | |
| 13301 <annotation> | |
| 13302 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13303 <rdf:Description rdf:about="#dcf1a29a-6ab9-4ebf-ab2c-4ed8013d827f"> | |
| 13304 <bqbiol:is> | |
| 13305 <rdf:Bag> | |
| 13306 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C15532"/> | |
| 13307 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/OLN"/> | |
| 13308 <rdf:li rdf:resource="https://identifiers.org/ChEBI/49002"/> | |
| 13309 </rdf:Bag> | |
| 13310 </bqbiol:is> | |
| 13311 </rdf:Description> | |
| 13312 </rdf:RDF> | |
| 13313 </annotation> | |
| 13314 </species> | |
| 13315 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C20H28N10O19P4" hasOnlySubstanceUnits="false" id="C01260" metaid="_11982dea-d048-4459-aa6f-96c938a143ca" name="P1,P4-Bis(5'-adenosyl)tetraphosphate" sboTerm="SBO:0000240"> | |
| 13316 <notes> | |
| 13317 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13318 <p>kegg.compound: C01260</p> | |
| 13319 <p>PubChem: 4479</p> | |
| 13320 <p>3DMET: B01424</p> | |
| 13321 <p>PDB-CCD: B4P</p> | |
| 13322 <p>ChEBI: 17422</p> | |
| 13323 <p>NIKKAJI: J313.703A</p> | |
| 13324 <p>formula: C20H28N10O19P4</p> | |
| 13325 <p>weight: 836.387</p> | |
| 13326 </body> | |
| 13327 </notes> | |
| 13328 <annotation> | |
| 13329 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13330 <rdf:Description rdf:about="#_11982dea-d048-4459-aa6f-96c938a143ca"> | |
| 13331 <bqbiol:is> | |
| 13332 <rdf:Bag> | |
| 13333 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01260"/> | |
| 13334 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01424"/> | |
| 13335 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/B4P"/> | |
| 13336 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17422"/> | |
| 13337 </rdf:Bag> | |
| 13338 </bqbiol:is> | |
| 13339 </rdf:Description> | |
| 13340 </rdf:RDF> | |
| 13341 </annotation> | |
| 13342 </species> | |
| 13343 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C13H18O17P2R4" hasOnlySubstanceUnits="false" id="C05980" metaid="_61d3d9eb-9f4b-4a51-a50c-358dc5f3be29" name="Cardiolipin" sboTerm="SBO:0000240"> | |
| 13344 <notes> | |
| 13345 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13346 <p>kegg.compound: C05980</p> | |
| 13347 <p>PubChem: 8259</p> | |
| 13348 <p>ChEBI: 28494</p> | |
| 13349 <p>NIKKAJI: J294.528B</p> | |
| 13350 <p>formula: C13H18O17P2R4</p> | |
| 13351 </body> | |
| 13352 </notes> | |
| 13353 <annotation> | |
| 13354 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13355 <rdf:Description rdf:about="#_61d3d9eb-9f4b-4a51-a50c-358dc5f3be29"> | |
| 13356 <bqbiol:is> | |
| 13357 <rdf:Bag> | |
| 13358 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05980"/> | |
| 13359 <rdf:li rdf:resource="https://identifiers.org/ChEBI/28494"/> | |
| 13360 </rdf:Bag> | |
| 13361 </bqbiol:is> | |
| 13362 </rdf:Description> | |
| 13363 </rdf:RDF> | |
| 13364 </annotation> | |
| 13365 </species> | |
| 13366 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H12O5" hasOnlySubstanceUnits="false" id="C04411" metaid="_5eaa7600-5c9e-462f-8f5b-bcd44f6a8adc" name="(2R,3S)-3-Isopropylmalate" sboTerm="SBO:0000240"> | |
| 13367 <notes> | |
| 13368 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13369 <p>kegg.compound: C04411</p> | |
| 13370 <p>KNApSAcK: C00019691</p> | |
| 13371 <p>PubChem: 7045</p> | |
| 13372 <p>3DMET: B01741</p> | |
| 13373 <p>PDB-CCD: IPM</p> | |
| 13374 <p>ChEBI: 35121 43468</p> | |
| 13375 <p>NIKKAJI: J1.641.400J</p> | |
| 13376 <p>formula: C7H12O5</p> | |
| 13377 <p>weight: 176.1672</p> | |
| 13378 </body> | |
| 13379 </notes> | |
| 13380 <annotation> | |
| 13381 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13382 <rdf:Description rdf:about="#_5eaa7600-5c9e-462f-8f5b-bcd44f6a8adc"> | |
| 13383 <bqbiol:is> | |
| 13384 <rdf:Bag> | |
| 13385 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04411"/> | |
| 13386 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019691"/> | |
| 13387 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01741"/> | |
| 13388 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/IPM"/> | |
| 13389 <rdf:li rdf:resource="https://identifiers.org/ChEBI/35121 43468"/> | |
| 13390 </rdf:Bag> | |
| 13391 </bqbiol:is> | |
| 13392 </rdf:Description> | |
| 13393 </rdf:RDF> | |
| 13394 </annotation> | |
| 13395 </species> | |
| 13396 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H5O2SR" hasOnlySubstanceUnits="false" id="C05744" metaid="fc15235f-d408-41ba-91e9-c5e3f892298a" name="Acetoacetyl-[acp]" sboTerm="SBO:0000240"> | |
| 13397 <notes> | |
| 13398 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13399 <p>kegg.compound: C05744</p> | |
| 13400 <p>PubChem: 8039</p> | |
| 13401 <p>ChEBI: 2393</p> | |
| 13402 <p>formula: C4H5O2SR</p> | |
| 13403 </body> | |
| 13404 </notes> | |
| 13405 <annotation> | |
| 13406 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13407 <rdf:Description rdf:about="#fc15235f-d408-41ba-91e9-c5e3f892298a"> | |
| 13408 <bqbiol:is> | |
| 13409 <rdf:Bag> | |
| 13410 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05744"/> | |
| 13411 <rdf:li rdf:resource="https://identifiers.org/ChEBI/2393"/> | |
| 13412 </rdf:Bag> | |
| 13413 </bqbiol:is> | |
| 13414 </rdf:Description> | |
| 13415 </rdf:RDF> | |
| 13416 </annotation> | |
| 13417 </species> | |
| 13418 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="H2SO4" hasOnlySubstanceUnits="false" id="C00059" metaid="cec72c6b-5165-41c1-b73f-1fee07cb5c51" name="Sulfate" sboTerm="SBO:0000240"> | |
| 13419 <notes> | |
| 13420 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13421 <p>kegg.compound: C00059</p> | |
| 13422 <p>KNApSAcK: C00007530</p> | |
| 13423 <p>CAS: 7664-93-9</p> | |
| 13424 <p>PubChem: 3359</p> | |
| 13425 <p>3DMET: B00016</p> | |
| 13426 <p>PDB-CCD: SO4</p> | |
| 13427 <p>ChEBI: 16189 26836</p> | |
| 13428 <p>NIKKAJI: J3.749D</p> | |
| 13429 <p>formula: H2SO4</p> | |
| 13430 <p>weight: 98.0785</p> | |
| 13431 </body> | |
| 13432 </notes> | |
| 13433 <annotation> | |
| 13434 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13435 <rdf:Description rdf:about="#cec72c6b-5165-41c1-b73f-1fee07cb5c51"> | |
| 13436 <bqbiol:is> | |
| 13437 <rdf:Bag> | |
| 13438 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00059"/> | |
| 13439 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007530"/> | |
| 13440 <rdf:li rdf:resource="https://identifiers.org/CAS/7664-93-9"/> | |
| 13441 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00016"/> | |
| 13442 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/SO4"/> | |
| 13443 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16189 26836"/> | |
| 13444 </rdf:Bag> | |
| 13445 </bqbiol:is> | |
| 13446 </rdf:Description> | |
| 13447 </rdf:RDF> | |
| 13448 </annotation> | |
| 13449 </species> | |
| 13450 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C40H46N4O17" hasOnlySubstanceUnits="false" id="C01024" metaid="a8672164-7926-4787-ba06-c182c2ebe6a4" name="Hydroxymethylbilane" sboTerm="SBO:0000240"> | |
| 13451 <notes> | |
| 13452 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13453 <p>kegg.compound: C01024</p> | |
| 13454 <p>KNApSAcK: C00007374</p> | |
| 13455 <p>CAS: 71861-60-4</p> | |
| 13456 <p>PubChem: 4269</p> | |
| 13457 <p>3DMET: B00223</p> | |
| 13458 <p>ChEBI: 16645</p> | |
| 13459 <p>NIKKAJI: J618.630K</p> | |
| 13460 <p>formula: C40H46N4O17</p> | |
| 13461 <p>weight: 854.8098</p> | |
| 13462 </body> | |
| 13463 </notes> | |
| 13464 <annotation> | |
| 13465 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13466 <rdf:Description rdf:about="#a8672164-7926-4787-ba06-c182c2ebe6a4"> | |
| 13467 <bqbiol:is> | |
| 13468 <rdf:Bag> | |
| 13469 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01024"/> | |
| 13470 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007374"/> | |
| 13471 <rdf:li rdf:resource="https://identifiers.org/CAS/71861-60-4"/> | |
| 13472 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00223"/> | |
| 13473 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16645"/> | |
| 13474 </rdf:Bag> | |
| 13475 </bqbiol:is> | |
| 13476 </rdf:Description> | |
| 13477 </rdf:RDF> | |
| 13478 </annotation> | |
| 13479 </species> | |
| 13480 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="CH2O2" hasOnlySubstanceUnits="false" id="C00058" metaid="c630d3d6-b1e9-4924-b082-1e321fc9c69e" name="Formate" sboTerm="SBO:0000240"> | |
| 13481 <notes> | |
| 13482 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13483 <p>kegg.compound: C00058</p> | |
| 13484 <p>KNApSAcK: C00001182</p> | |
| 13485 <p>CAS: 64-18-6</p> | |
| 13486 <p>PubChem: 3358</p> | |
| 13487 <p>3DMET: B01142</p> | |
| 13488 <p>PDB-CCD: FMT</p> | |
| 13489 <p>ChEBI: 15740 30751</p> | |
| 13490 <p>LipidBank: DFA0001</p> | |
| 13491 <p>NIKKAJI: J1.402H</p> | |
| 13492 <p>formula: CH2O2</p> | |
| 13493 <p>weight: 46.0254</p> | |
| 13494 </body> | |
| 13495 </notes> | |
| 13496 <annotation> | |
| 13497 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13498 <rdf:Description rdf:about="#c630d3d6-b1e9-4924-b082-1e321fc9c69e"> | |
| 13499 <bqbiol:is> | |
| 13500 <rdf:Bag> | |
| 13501 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00058"/> | |
| 13502 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001182"/> | |
| 13503 <rdf:li rdf:resource="https://identifiers.org/CAS/64-18-6"/> | |
| 13504 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01142"/> | |
| 13505 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/FMT"/> | |
| 13506 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15740 30751"/> | |
| 13507 <rdf:li rdf:resource="https://identifiers.org/LipidBank/DFA0001"/> | |
| 13508 </rdf:Bag> | |
| 13509 </bqbiol:is> | |
| 13510 </rdf:Description> | |
| 13511 </rdf:RDF> | |
| 13512 </annotation> | |
| 13513 </species> | |
| 13514 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C15H25N5O15P2" hasOnlySubstanceUnits="false" id="C04896" metaid="_4ac04249-4a70-4909-afb1-df58a5e127aa" name="5-(5-Phospho-D-ribosylaminoformimino)-1-(5-phosphoribosyl)-imidazole-4-carboxamide" sboTerm="SBO:0000240"> | |
| 13515 <notes> | |
| 13516 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13517 <p>kegg.compound: C04896</p> | |
| 13518 <p>PubChem: 7447</p> | |
| 13519 <p>3DMET: B01802</p> | |
| 13520 <p>PDB-CCD: GUO</p> | |
| 13521 <p>ChEBI: 18302</p> | |
| 13522 <p>NIKKAJI: J574.865H</p> | |
| 13523 <p>formula: C15H25N5O15P2</p> | |
| 13524 <p>weight: 577.331</p> | |
| 13525 </body> | |
| 13526 </notes> | |
| 13527 <annotation> | |
| 13528 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13529 <rdf:Description rdf:about="#_4ac04249-4a70-4909-afb1-df58a5e127aa"> | |
| 13530 <bqbiol:is> | |
| 13531 <rdf:Bag> | |
| 13532 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04896"/> | |
| 13533 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01802"/> | |
| 13534 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/GUO"/> | |
| 13535 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18302"/> | |
| 13536 </rdf:Bag> | |
| 13537 </bqbiol:is> | |
| 13538 </rdf:Description> | |
| 13539 </rdf:RDF> | |
| 13540 </annotation> | |
| 13541 </species> | |
| 13542 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H9N2O5P" hasOnlySubstanceUnits="false" id="C01267" metaid="_23e50065-df73-478f-8d5d-b4ec0d4f6bcf" name="3-(Imidazol-4-yl)-2-oxopropyl phosphate" sboTerm="SBO:0000240"> | |
| 13543 <notes> | |
| 13544 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13545 <p>kegg.compound: C01267</p> | |
| 13546 <p>KNApSAcK: C00007308</p> | |
| 13547 <p>PubChem: 4486</p> | |
| 13548 <p>3DMET: B00269</p> | |
| 13549 <p>ChEBI: 16426</p> | |
| 13550 <p>NIKKAJI: J670.555C</p> | |
| 13551 <p>formula: C6H9N2O5P</p> | |
| 13552 <p>weight: 220.1198</p> | |
| 13553 </body> | |
| 13554 </notes> | |
| 13555 <annotation> | |
| 13556 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13557 <rdf:Description rdf:about="#_23e50065-df73-478f-8d5d-b4ec0d4f6bcf"> | |
| 13558 <bqbiol:is> | |
| 13559 <rdf:Bag> | |
| 13560 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01267"/> | |
| 13561 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007308"/> | |
| 13562 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00269"/> | |
| 13563 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16426"/> | |
| 13564 </rdf:Bag> | |
| 13565 </bqbiol:is> | |
| 13566 </rdf:Description> | |
| 13567 </rdf:RDF> | |
| 13568 </annotation> | |
| 13569 </species> | |
| 13570 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H9NO2" hasOnlySubstanceUnits="false" id="C02356" metaid="_5956f7b6-fc16-42e0-820d-4355d2a290d0" name="(S)-2-Aminobutanoate" sboTerm="SBO:0000240"> | |
| 13571 <notes> | |
| 13572 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13573 <p>kegg.compound: C02356</p> | |
| 13574 <p>PubChem: 5403</p> | |
| 13575 <p>3DMET: B01567</p> | |
| 13576 <p>PDB-CCD: ABA UNK</p> | |
| 13577 <p>ChEBI: 28340 35619 74359</p> | |
| 13578 <p>LIPIDMAPS: LMFA01100034</p> | |
| 13579 <p>NIKKAJI: J7.749F</p> | |
| 13580 <p>formula: C4H9NO2</p> | |
| 13581 <p>weight: 103.1198</p> | |
| 13582 </body> | |
| 13583 </notes> | |
| 13584 <annotation> | |
| 13585 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13586 <rdf:Description rdf:about="#_5956f7b6-fc16-42e0-820d-4355d2a290d0"> | |
| 13587 <bqbiol:is> | |
| 13588 <rdf:Bag> | |
| 13589 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02356"/> | |
| 13590 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01567"/> | |
| 13591 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/ABA UNK"/> | |
| 13592 <rdf:li rdf:resource="https://identifiers.org/ChEBI/28340 35619 74359"/> | |
| 13593 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA01100034"/> | |
| 13594 </rdf:Bag> | |
| 13595 </bqbiol:is> | |
| 13596 </rdf:Description> | |
| 13597 </rdf:RDF> | |
| 13598 </annotation> | |
| 13599 </species> | |
| 13600 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H19N4O7P2S" hasOnlySubstanceUnits="false" id="C00068" metaid="c0d8925e-72f8-42e0-9e6f-cf5aee11fbbd" name="Thiamin diphosphate" sboTerm="SBO:0000240"> | |
| 13601 <notes> | |
| 13602 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13603 <p>kegg.compound: C00068</p> | |
| 13604 <p>KNApSAcK: C00019627</p> | |
| 13605 <p>PubChem: 3368</p> | |
| 13606 <p>3DMET: B01146</p> | |
| 13607 <p>PDB-CCD: TDP TPP</p> | |
| 13608 <p>ChEBI: 9532</p> | |
| 13609 <p>NIKKAJI: J184.400H J232.214E</p> | |
| 13610 <p>formula: C12H19N4O7P2S</p> | |
| 13611 <p>weight: 425.3144</p> | |
| 13612 </body> | |
| 13613 </notes> | |
| 13614 <annotation> | |
| 13615 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13616 <rdf:Description rdf:about="#c0d8925e-72f8-42e0-9e6f-cf5aee11fbbd"> | |
| 13617 <bqbiol:is> | |
| 13618 <rdf:Bag> | |
| 13619 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00068"/> | |
| 13620 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019627"/> | |
| 13621 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01146"/> | |
| 13622 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/TDP TPP"/> | |
| 13623 <rdf:li rdf:resource="https://identifiers.org/ChEBI/9532"/> | |
| 13624 </rdf:Bag> | |
| 13625 </bqbiol:is> | |
| 13626 </rdf:Description> | |
| 13627 </rdf:RDF> | |
| 13628 </annotation> | |
| 13629 </species> | |
| 13630 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H20N2O2" hasOnlySubstanceUnits="false" id="C01037" metaid="a5197048-b521-4d1f-b2af-b4f383670ec7" name="7,8-Diaminononanoate" sboTerm="SBO:0000240"> | |
| 13631 <notes> | |
| 13632 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13633 <p>kegg.compound: C01037</p> | |
| 13634 <p>PubChem: 4280</p> | |
| 13635 <p>3DMET: B04758</p> | |
| 13636 <p>ChEBI: 17830 2247</p> | |
| 13637 <p>LIPIDMAPS: LMFA01100062</p> | |
| 13638 <p>NIKKAJI: J511.020C</p> | |
| 13639 <p>formula: C9H20N2O2</p> | |
| 13640 <p>weight: 188.2673</p> | |
| 13641 </body> | |
| 13642 </notes> | |
| 13643 <annotation> | |
| 13644 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13645 <rdf:Description rdf:about="#a5197048-b521-4d1f-b2af-b4f383670ec7"> | |
| 13646 <bqbiol:is> | |
| 13647 <rdf:Bag> | |
| 13648 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01037"/> | |
| 13649 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04758"/> | |
| 13650 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17830 2247"/> | |
| 13651 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA01100062"/> | |
| 13652 </rdf:Bag> | |
| 13653 </bqbiol:is> | |
| 13654 </rdf:Description> | |
| 13655 </rdf:RDF> | |
| 13656 </annotation> | |
| 13657 </species> | |
| 13658 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C2H7NO" hasOnlySubstanceUnits="false" id="C00189" metaid="e2302a3f-3ee6-4c08-b2d2-a8a5195a1544" name="Ethanolamine" sboTerm="SBO:0000240"> | |
| 13659 <notes> | |
| 13660 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13661 <p>kegg.compound: C00189</p> | |
| 13662 <p>KNApSAcK: C00007279</p> | |
| 13663 <p>CAS: 141-43-5</p> | |
| 13664 <p>PubChem: 3489</p> | |
| 13665 <p>3DMET: B01183</p> | |
| 13666 <p>PDB-CCD: ETA</p> | |
| 13667 <p>ChEBI: 16000</p> | |
| 13668 <p>NIKKAJI: J2.536D</p> | |
| 13669 <p>formula: C2H7NO</p> | |
| 13670 <p>weight: 61.0831</p> | |
| 13671 </body> | |
| 13672 </notes> | |
| 13673 <annotation> | |
| 13674 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13675 <rdf:Description rdf:about="#e2302a3f-3ee6-4c08-b2d2-a8a5195a1544"> | |
| 13676 <bqbiol:is> | |
| 13677 <rdf:Bag> | |
| 13678 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00189"/> | |
| 13679 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007279"/> | |
| 13680 <rdf:li rdf:resource="https://identifiers.org/CAS/141-43-5"/> | |
| 13681 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01183"/> | |
| 13682 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/ETA"/> | |
| 13683 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16000"/> | |
| 13684 </rdf:Bag> | |
| 13685 </bqbiol:is> | |
| 13686 </rdf:Description> | |
| 13687 </rdf:RDF> | |
| 13688 </annotation> | |
| 13689 </species> | |
| 13690 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C28H41N8O17P3S" hasOnlySubstanceUnits="false" id="C02247" metaid="cd68c297-83c3-4648-bffe-692ca3f581ed" name="Anthraniloyl-CoA" sboTerm="SBO:0000240"> | |
| 13691 <notes> | |
| 13692 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13693 <p>kegg.compound: C02247</p> | |
| 13694 <p>PubChem: 5310</p> | |
| 13695 <p>PDB-CCD: COW</p> | |
| 13696 <p>ChEBI: 15472</p> | |
| 13697 <p>LIPIDMAPS: LMFA07050287</p> | |
| 13698 <p>NIKKAJI: J653.552F</p> | |
| 13699 <p>formula: C28H41N8O17P3S</p> | |
| 13700 <p>weight: 886.6548</p> | |
| 13701 </body> | |
| 13702 </notes> | |
| 13703 <annotation> | |
| 13704 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13705 <rdf:Description rdf:about="#cd68c297-83c3-4648-bffe-692ca3f581ed"> | |
| 13706 <bqbiol:is> | |
| 13707 <rdf:Bag> | |
| 13708 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02247"/> | |
| 13709 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/COW"/> | |
| 13710 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15472"/> | |
| 13711 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA07050287"/> | |
| 13712 </rdf:Bag> | |
| 13713 </bqbiol:is> | |
| 13714 </rdf:Description> | |
| 13715 </rdf:RDF> | |
| 13716 </annotation> | |
| 13717 </species> | |
| 13718 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H21OSR" hasOnlySubstanceUnits="false" id="C05758" metaid="_3fff999e-4acf-4d69-b897-e2a75ad9e631" name="trans-Dodec-2-enoyl-[acp]" sboTerm="SBO:0000240"> | |
| 13719 <notes> | |
| 13720 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13721 <p>kegg.compound: C05758</p> | |
| 13722 <p>PubChem: 8053</p> | |
| 13723 <p>ChEBI: 10725</p> | |
| 13724 <p>formula: C12H21OSR</p> | |
| 13725 </body> | |
| 13726 </notes> | |
| 13727 <annotation> | |
| 13728 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13729 <rdf:Description rdf:about="#_3fff999e-4acf-4d69-b897-e2a75ad9e631"> | |
| 13730 <bqbiol:is> | |
| 13731 <rdf:Bag> | |
| 13732 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05758"/> | |
| 13733 <rdf:li rdf:resource="https://identifiers.org/ChEBI/10725"/> | |
| 13734 </rdf:Bag> | |
| 13735 </bqbiol:is> | |
| 13736 </rdf:Description> | |
| 13737 </rdf:RDF> | |
| 13738 </annotation> | |
| 13739 </species> | |
| 13740 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C14H25O2SR" hasOnlySubstanceUnits="false" id="C05759" metaid="b7fd8bbd-18f1-4f46-a619-4a6d2c0577d5" name="3-Oxotetradecanoyl-[acp]" sboTerm="SBO:0000240"> | |
| 13741 <notes> | |
| 13742 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13743 <p>kegg.compound: C05759</p> | |
| 13744 <p>PubChem: 8054</p> | |
| 13745 <p>ChEBI: 1655</p> | |
| 13746 <p>formula: C14H25O2SR</p> | |
| 13747 </body> | |
| 13748 </notes> | |
| 13749 <annotation> | |
| 13750 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13751 <rdf:Description rdf:about="#b7fd8bbd-18f1-4f46-a619-4a6d2c0577d5"> | |
| 13752 <bqbiol:is> | |
| 13753 <rdf:Bag> | |
| 13754 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05759"/> | |
| 13755 <rdf:li rdf:resource="https://identifiers.org/ChEBI/1655"/> | |
| 13756 </rdf:Bag> | |
| 13757 </bqbiol:is> | |
| 13758 </rdf:Description> | |
| 13759 </rdf:RDF> | |
| 13760 </annotation> | |
| 13761 </species> | |
| 13762 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H9NO3" hasOnlySubstanceUnits="false" id="C00188" metaid="d08d064a-d146-4d49-8f9a-c59a827a3370" name="L-Threonine" sboTerm="SBO:0000240"> | |
| 13763 <notes> | |
| 13764 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13765 <p>kegg.compound: C00188</p> | |
| 13766 <p>KNApSAcK: C00001394</p> | |
| 13767 <p>CAS: 72-19-5</p> | |
| 13768 <p>PubChem: 3488</p> | |
| 13769 <p>3DMET: B01182</p> | |
| 13770 <p>PDB-CCD: THR</p> | |
| 13771 <p>ChEBI: 16857</p> | |
| 13772 <p>NIKKAJI: J21.883I</p> | |
| 13773 <p>formula: C4H9NO3</p> | |
| 13774 <p>weight: 119.1192</p> | |
| 13775 </body> | |
| 13776 </notes> | |
| 13777 <annotation> | |
| 13778 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13779 <rdf:Description rdf:about="#d08d064a-d146-4d49-8f9a-c59a827a3370"> | |
| 13780 <bqbiol:is> | |
| 13781 <rdf:Bag> | |
| 13782 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00188"/> | |
| 13783 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001394"/> | |
| 13784 <rdf:li rdf:resource="https://identifiers.org/CAS/72-19-5"/> | |
| 13785 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01182"/> | |
| 13786 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/THR"/> | |
| 13787 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16857"/> | |
| 13788 </rdf:Bag> | |
| 13789 </bqbiol:is> | |
| 13790 </rdf:Description> | |
| 13791 </rdf:RDF> | |
| 13792 </annotation> | |
| 13793 </species> | |
| 13794 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C15H20N5O6S" hasOnlySubstanceUnits="false" id="C04425" metaid="df7395fe-74f0-4155-b478-8628974f8020" name="S-Adenosyl-4-methylthio-2-oxobutanoate" sboTerm="SBO:0000240"> | |
| 13795 <notes> | |
| 13796 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13797 <p>kegg.compound: C04425</p> | |
| 13798 <p>PubChem: 7057</p> | |
| 13799 <p>ChEBI: 8944</p> | |
| 13800 <p>NIKKAJI: J2.751.123F</p> | |
| 13801 <p>formula: C15H20N5O6S</p> | |
| 13802 <p>weight: 398.4142</p> | |
| 13803 </body> | |
| 13804 </notes> | |
| 13805 <annotation> | |
| 13806 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13807 <rdf:Description rdf:about="#df7395fe-74f0-4155-b478-8628974f8020"> | |
| 13808 <bqbiol:is> | |
| 13809 <rdf:Bag> | |
| 13810 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04425"/> | |
| 13811 <rdf:li rdf:resource="https://identifiers.org/ChEBI/8944"/> | |
| 13812 </rdf:Bag> | |
| 13813 </bqbiol:is> | |
| 13814 </rdf:Description> | |
| 13815 </rdf:RDF> | |
| 13816 </annotation> | |
| 13817 </species> | |
| 13818 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H21O2SR" hasOnlySubstanceUnits="false" id="C05756" metaid="_967144b2-ef12-4e84-9ab7-cc412470509f" name="3-Oxododecanoyl-[acp]" sboTerm="SBO:0000240"> | |
| 13819 <notes> | |
| 13820 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13821 <p>kegg.compound: C05756</p> | |
| 13822 <p>PubChem: 8051</p> | |
| 13823 <p>ChEBI: 1637</p> | |
| 13824 <p>formula: C12H21O2SR</p> | |
| 13825 </body> | |
| 13826 </notes> | |
| 13827 <annotation> | |
| 13828 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13829 <rdf:Description rdf:about="#_967144b2-ef12-4e84-9ab7-cc412470509f"> | |
| 13830 <bqbiol:is> | |
| 13831 <rdf:Bag> | |
| 13832 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05756"/> | |
| 13833 <rdf:li rdf:resource="https://identifiers.org/ChEBI/1637"/> | |
| 13834 </rdf:Bag> | |
| 13835 </bqbiol:is> | |
| 13836 </rdf:Description> | |
| 13837 </rdf:RDF> | |
| 13838 </annotation> | |
| 13839 </species> | |
| 13840 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H7NO3" hasOnlySubstanceUnits="false" id="C00065" metaid="_8790094c-da29-4d4b-afab-489a1cce3ce9" name="L-Serine" sboTerm="SBO:0000240"> | |
| 13841 <notes> | |
| 13842 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13843 <p>kegg.compound: C00065</p> | |
| 13844 <p>KNApSAcK: C00001393</p> | |
| 13845 <p>CAS: 56-45-1</p> | |
| 13846 <p>PubChem: 3365</p> | |
| 13847 <p>3DMET: B01145</p> | |
| 13848 <p>PDB-CCD: SER</p> | |
| 13849 <p>ChEBI: 17115</p> | |
| 13850 <p>NIKKAJI: J1.195I</p> | |
| 13851 <p>formula: C3H7NO3</p> | |
| 13852 <p>weight: 105.0926</p> | |
| 13853 </body> | |
| 13854 </notes> | |
| 13855 <annotation> | |
| 13856 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13857 <rdf:Description rdf:about="#_8790094c-da29-4d4b-afab-489a1cce3ce9"> | |
| 13858 <bqbiol:is> | |
| 13859 <rdf:Bag> | |
| 13860 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00065"/> | |
| 13861 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001393"/> | |
| 13862 <rdf:li rdf:resource="https://identifiers.org/CAS/56-45-1"/> | |
| 13863 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01145"/> | |
| 13864 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/SER"/> | |
| 13865 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17115"/> | |
| 13866 </rdf:Bag> | |
| 13867 </bqbiol:is> | |
| 13868 </rdf:Description> | |
| 13869 </rdf:RDF> | |
| 13870 </annotation> | |
| 13871 </species> | |
| 13872 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H23O2SR" hasOnlySubstanceUnits="false" id="C05757" metaid="ab1d7286-81ed-408b-a81b-4e97ed8ddd3d" name="(R)-3-Hydroxydodecanoyl-[acp]" sboTerm="SBO:0000240"> | |
| 13873 <notes> | |
| 13874 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13875 <p>kegg.compound: C05757</p> | |
| 13876 <p>PubChem: 8052</p> | |
| 13877 <p>ChEBI: 325</p> | |
| 13878 <p>formula: C12H23O2SR</p> | |
| 13879 </body> | |
| 13880 </notes> | |
| 13881 <annotation> | |
| 13882 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13883 <rdf:Description rdf:about="#ab1d7286-81ed-408b-a81b-4e97ed8ddd3d"> | |
| 13884 <bqbiol:is> | |
| 13885 <rdf:Bag> | |
| 13886 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05757"/> | |
| 13887 <rdf:li rdf:resource="https://identifiers.org/ChEBI/325"/> | |
| 13888 </rdf:Bag> | |
| 13889 </bqbiol:is> | |
| 13890 </rdf:Description> | |
| 13891 </rdf:RDF> | |
| 13892 </annotation> | |
| 13893 </species> | |
| 13894 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H10N2O3" hasOnlySubstanceUnits="false" id="C00064" metaid="f405b137-a081-4be0-8d89-cee795b6d638" name="L-Glutamine" sboTerm="SBO:0000240"> | |
| 13895 <notes> | |
| 13896 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13897 <p>kegg.compound: C00064</p> | |
| 13898 <p>KNApSAcK: C00001359</p> | |
| 13899 <p>CAS: 56-85-9</p> | |
| 13900 <p>PubChem: 3364</p> | |
| 13901 <p>3DMET: B00017</p> | |
| 13902 <p>PDB-CCD: GLN</p> | |
| 13903 <p>ChEBI: 18050</p> | |
| 13904 <p>NIKKAJI: J9.170G</p> | |
| 13905 <p>formula: C5H10N2O3</p> | |
| 13906 <p>weight: 146.1445</p> | |
| 13907 </body> | |
| 13908 </notes> | |
| 13909 <annotation> | |
| 13910 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13911 <rdf:Description rdf:about="#f405b137-a081-4be0-8d89-cee795b6d638"> | |
| 13912 <bqbiol:is> | |
| 13913 <rdf:Bag> | |
| 13914 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00064"/> | |
| 13915 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001359"/> | |
| 13916 <rdf:li rdf:resource="https://identifiers.org/CAS/56-85-9"/> | |
| 13917 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00017"/> | |
| 13918 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/GLN"/> | |
| 13919 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18050"/> | |
| 13920 </rdf:Bag> | |
| 13921 </bqbiol:is> | |
| 13922 </rdf:Description> | |
| 13923 </rdf:RDF> | |
| 13924 </annotation> | |
| 13925 </species> | |
| 13926 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H16N3O14P3" hasOnlySubstanceUnits="false" id="C00063" metaid="b75ffdfb-0812-4a4d-92d1-5dc47adad9d5" name="CTP" sboTerm="SBO:0000240"> | |
| 13927 <notes> | |
| 13928 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13929 <p>kegg.compound: C00063</p> | |
| 13930 <p>KNApSAcK: C00019639</p> | |
| 13931 <p>CAS: 65-47-4</p> | |
| 13932 <p>PubChem: 3363</p> | |
| 13933 <p>3DMET: B01144</p> | |
| 13934 <p>PDB-CCD: CTP</p> | |
| 13935 <p>ChEBI: 17677</p> | |
| 13936 <p>NIKKAJI: J213.552C</p> | |
| 13937 <p>formula: C9H16N3O14P3</p> | |
| 13938 <p>weight: 483.1563</p> | |
| 13939 </body> | |
| 13940 </notes> | |
| 13941 <annotation> | |
| 13942 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13943 <rdf:Description rdf:about="#b75ffdfb-0812-4a4d-92d1-5dc47adad9d5"> | |
| 13944 <bqbiol:is> | |
| 13945 <rdf:Bag> | |
| 13946 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00063"/> | |
| 13947 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019639"/> | |
| 13948 <rdf:li rdf:resource="https://identifiers.org/CAS/65-47-4"/> | |
| 13949 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01144"/> | |
| 13950 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/CTP"/> | |
| 13951 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17677"/> | |
| 13952 </rdf:Bag> | |
| 13953 </bqbiol:is> | |
| 13954 </rdf:Description> | |
| 13955 </rdf:RDF> | |
| 13956 </annotation> | |
| 13957 </species> | |
| 13958 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H11NO2" hasOnlySubstanceUnits="false" id="C00183" metaid="_2caa2f90-96a7-4258-9efc-3ce76bc2e847" name="L-Valine" sboTerm="SBO:0000240"> | |
| 13959 <notes> | |
| 13960 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13961 <p>kegg.compound: C00183</p> | |
| 13962 <p>KNApSAcK: C00001398</p> | |
| 13963 <p>CAS: 72-18-4</p> | |
| 13964 <p>PubChem: 3483</p> | |
| 13965 <p>3DMET: B00054</p> | |
| 13966 <p>PDB-CCD: VAL</p> | |
| 13967 <p>ChEBI: 16414</p> | |
| 13968 <p>NIKKAJI: J9.179K</p> | |
| 13969 <p>formula: C5H11NO2</p> | |
| 13970 <p>weight: 117.1463</p> | |
| 13971 </body> | |
| 13972 </notes> | |
| 13973 <annotation> | |
| 13974 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 13975 <rdf:Description rdf:about="#_2caa2f90-96a7-4258-9efc-3ce76bc2e847"> | |
| 13976 <bqbiol:is> | |
| 13977 <rdf:Bag> | |
| 13978 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00183"/> | |
| 13979 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001398"/> | |
| 13980 <rdf:li rdf:resource="https://identifiers.org/CAS/72-18-4"/> | |
| 13981 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00054"/> | |
| 13982 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/VAL"/> | |
| 13983 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16414"/> | |
| 13984 </rdf:Bag> | |
| 13985 </bqbiol:is> | |
| 13986 </rdf:Description> | |
| 13987 </rdf:RDF> | |
| 13988 </annotation> | |
| 13989 </species> | |
| 13990 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H14N4O2" hasOnlySubstanceUnits="false" id="C00062" metaid="d7c10da3-eaf1-41c2-8e86-1a5339285cf9" name="L-Arginine" sboTerm="SBO:0000240"> | |
| 13991 <notes> | |
| 13992 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 13993 <p>kegg.compound: C00062</p> | |
| 13994 <p>KNApSAcK: C00001340</p> | |
| 13995 <p>CAS: 74-79-3</p> | |
| 13996 <p>PubChem: 3362</p> | |
| 13997 <p>3DMET: B01143</p> | |
| 13998 <p>PDB-CCD: ARG GND</p> | |
| 13999 <p>ChEBI: 16467</p> | |
| 14000 <p>NIKKAJI: J9.182K</p> | |
| 14001 <p>formula: C6H14N4O2</p> | |
| 14002 <p>weight: 174.201</p> | |
| 14003 </body> | |
| 14004 </notes> | |
| 14005 <annotation> | |
| 14006 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14007 <rdf:Description rdf:about="#d7c10da3-eaf1-41c2-8e86-1a5339285cf9"> | |
| 14008 <bqbiol:is> | |
| 14009 <rdf:Bag> | |
| 14010 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00062"/> | |
| 14011 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001340"/> | |
| 14012 <rdf:li rdf:resource="https://identifiers.org/CAS/74-79-3"/> | |
| 14013 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01143"/> | |
| 14014 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/ARG GND"/> | |
| 14015 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16467"/> | |
| 14016 </rdf:Bag> | |
| 14017 </bqbiol:is> | |
| 14018 </rdf:Description> | |
| 14019 </rdf:RDF> | |
| 14020 </annotation> | |
| 14021 </species> | |
| 14022 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C17H21N4O9P" hasOnlySubstanceUnits="false" id="C00061" metaid="_35a20cc6-ca03-4fcc-baab-4fcc0f0ab501" name="FMN" sboTerm="SBO:0000240"> | |
| 14023 <notes> | |
| 14024 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14025 <p>kegg.compound: C00061</p> | |
| 14026 <p>KNApSAcK: C00019686</p> | |
| 14027 <p>CAS: 146-17-8</p> | |
| 14028 <p>PubChem: 3361</p> | |
| 14029 <p>3DMET: B04626</p> | |
| 14030 <p>PDB-CCD: FMN</p> | |
| 14031 <p>ChEBI: 17621</p> | |
| 14032 <p>NIKKAJI: J30.175B</p> | |
| 14033 <p>formula: C17H21N4O9P</p> | |
| 14034 <p>weight: 456.3438</p> | |
| 14035 </body> | |
| 14036 </notes> | |
| 14037 <annotation> | |
| 14038 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14039 <rdf:Description rdf:about="#_35a20cc6-ca03-4fcc-baab-4fcc0f0ab501"> | |
| 14040 <bqbiol:is> | |
| 14041 <rdf:Bag> | |
| 14042 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00061"/> | |
| 14043 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019686"/> | |
| 14044 <rdf:li rdf:resource="https://identifiers.org/CAS/146-17-8"/> | |
| 14045 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04626"/> | |
| 14046 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/FMN"/> | |
| 14047 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17621"/> | |
| 14048 </rdf:Bag> | |
| 14049 </bqbiol:is> | |
| 14050 </rdf:Description> | |
| 14051 </rdf:RDF> | |
| 14052 </annotation> | |
| 14053 </species> | |
| 14054 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H10O4" hasOnlySubstanceUnits="false" id="C14463" metaid="b9b1b44d-9872-46b6-bd0d-e34b9aa7f5b3" name="(R)-3-Hydroxy-3-methyl-2-oxopentanoate" sboTerm="SBO:0000240"> | |
| 14055 <notes> | |
| 14056 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14057 <p>kegg.compound: C14463</p> | |
| 14058 <p>PubChem: 17395463</p> | |
| 14059 <p>ChEBI: 34008 49257</p> | |
| 14060 <p>LIPIDMAPS: LMFA01050457</p> | |
| 14061 <p>NIKKAJI: J2.788.388E</p> | |
| 14062 <p>formula: C6H10O4</p> | |
| 14063 <p>weight: 146.1412</p> | |
| 14064 </body> | |
| 14065 </notes> | |
| 14066 <annotation> | |
| 14067 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14068 <rdf:Description rdf:about="#b9b1b44d-9872-46b6-bd0d-e34b9aa7f5b3"> | |
| 14069 <bqbiol:is> | |
| 14070 <rdf:Bag> | |
| 14071 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C14463"/> | |
| 14072 <rdf:li rdf:resource="https://identifiers.org/ChEBI/34008 49257"/> | |
| 14073 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA01050457"/> | |
| 14074 </rdf:Bag> | |
| 14075 </bqbiol:is> | |
| 14076 </rdf:Description> | |
| 14077 </rdf:RDF> | |
| 14078 </annotation> | |
| 14079 </species> | |
| 14080 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H4O2SR2" hasOnlySubstanceUnits="false" id="C01271" metaid="_11580088-aaf4-4e2b-b8a1-984bfc5bf212" name="(3R)-3-Hydroxyacyl-[acyl-carrier protein]" sboTerm="SBO:0000240"> | |
| 14081 <notes> | |
| 14082 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14083 <p>kegg.compound: C01271</p> | |
| 14084 <p>PubChem: 4490</p> | |
| 14085 <p>formula: C3H4O2SR2</p> | |
| 14086 </body> | |
| 14087 </notes> | |
| 14088 <annotation> | |
| 14089 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14090 <rdf:Description rdf:about="#_11580088-aaf4-4e2b-b8a1-984bfc5bf212"> | |
| 14091 <bqbiol:is> | |
| 14092 <rdf:Bag> | |
| 14093 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01271"/> | |
| 14094 </rdf:Bag> | |
| 14095 </bqbiol:is> | |
| 14096 </rdf:Description> | |
| 14097 </rdf:RDF> | |
| 14098 </annotation> | |
| 14099 </species> | |
| 14100 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C8H13O2SR" hasOnlySubstanceUnits="false" id="C05750" metaid="af74faea-b29d-4568-84fa-aa6648a9a258" name="3-Oxooctanoyl-[acp]" sboTerm="SBO:0000240"> | |
| 14101 <notes> | |
| 14102 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14103 <p>kegg.compound: C05750</p> | |
| 14104 <p>PubChem: 8045</p> | |
| 14105 <p>ChEBI: 1646</p> | |
| 14106 <p>formula: C8H13O2SR</p> | |
| 14107 </body> | |
| 14108 </notes> | |
| 14109 <annotation> | |
| 14110 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14111 <rdf:Description rdf:about="#af74faea-b29d-4568-84fa-aa6648a9a258"> | |
| 14112 <bqbiol:is> | |
| 14113 <rdf:Bag> | |
| 14114 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05750"/> | |
| 14115 <rdf:li rdf:resource="https://identifiers.org/ChEBI/1646"/> | |
| 14116 </rdf:Bag> | |
| 14117 </bqbiol:is> | |
| 14118 </rdf:Description> | |
| 14119 </rdf:RDF> | |
| 14120 </annotation> | |
| 14121 </species> | |
| 14122 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C8H13OSR" hasOnlySubstanceUnits="false" id="C05751" metaid="_5b7d8e3a-57ce-49e4-a07f-9577c59954c2" name="trans-Oct-2-enoyl-[acp]" sboTerm="SBO:0000240"> | |
| 14123 <notes> | |
| 14124 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14125 <p>kegg.compound: C05751</p> | |
| 14126 <p>PubChem: 8046</p> | |
| 14127 <p>formula: C8H13OSR</p> | |
| 14128 </body> | |
| 14129 </notes> | |
| 14130 <annotation> | |
| 14131 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14132 <rdf:Description rdf:about="#_5b7d8e3a-57ce-49e4-a07f-9577c59954c2"> | |
| 14133 <bqbiol:is> | |
| 14134 <rdf:Bag> | |
| 14135 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05751"/> | |
| 14136 </rdf:Bag> | |
| 14137 </bqbiol:is> | |
| 14138 </rdf:Description> | |
| 14139 </rdf:RDF> | |
| 14140 </annotation> | |
| 14141 </species> | |
| 14142 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C13H21N3O8S" hasOnlySubstanceUnits="false" id="C03451" metaid="_7580f25a-30cb-4f7d-98eb-9966e37b14e0" name="(R)-S-Lactoylglutathione" sboTerm="SBO:0000240"> | |
| 14143 <notes> | |
| 14144 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14145 <p>kegg.compound: C03451</p> | |
| 14146 <p>PubChem: 6272</p> | |
| 14147 <p>3DMET: B01661</p> | |
| 14148 <p>ChEBI: 15694</p> | |
| 14149 <p>NIKKAJI: J524.698I</p> | |
| 14150 <p>formula: C13H21N3O8S</p> | |
| 14151 <p>weight: 379.3861</p> | |
| 14152 </body> | |
| 14153 </notes> | |
| 14154 <annotation> | |
| 14155 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14156 <rdf:Description rdf:about="#_7580f25a-30cb-4f7d-98eb-9966e37b14e0"> | |
| 14157 <bqbiol:is> | |
| 14158 <rdf:Bag> | |
| 14159 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03451"/> | |
| 14160 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01661"/> | |
| 14161 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15694"/> | |
| 14162 </rdf:Bag> | |
| 14163 </bqbiol:is> | |
| 14164 </rdf:Description> | |
| 14165 </rdf:RDF> | |
| 14166 </annotation> | |
| 14167 </species> | |
| 14168 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H17OSR" hasOnlySubstanceUnits="false" id="C05754" metaid="_2b12b41c-132c-4689-8a6b-c46a1646ad6c" name="trans-Dec-2-enoyl-[acp]" sboTerm="SBO:0000240"> | |
| 14169 <notes> | |
| 14170 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14171 <p>kegg.compound: C05754</p> | |
| 14172 <p>PubChem: 8049</p> | |
| 14173 <p>ChEBI: 10724</p> | |
| 14174 <p>formula: C10H17OSR</p> | |
| 14175 </body> | |
| 14176 </notes> | |
| 14177 <annotation> | |
| 14178 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14179 <rdf:Description rdf:about="#_2b12b41c-132c-4689-8a6b-c46a1646ad6c"> | |
| 14180 <bqbiol:is> | |
| 14181 <rdf:Bag> | |
| 14182 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05754"/> | |
| 14183 <rdf:li rdf:resource="https://identifiers.org/ChEBI/10724"/> | |
| 14184 </rdf:Bag> | |
| 14185 </bqbiol:is> | |
| 14186 </rdf:Description> | |
| 14187 </rdf:RDF> | |
| 14188 </annotation> | |
| 14189 </species> | |
| 14190 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C11H18N2O7" hasOnlySubstanceUnits="false" id="C04421" metaid="dc087689-ecab-41ec-a348-d299485bffed" name="N-Succinyl-LL-2,6-diaminoheptanedioate" sboTerm="SBO:0000240"> | |
| 14191 <notes> | |
| 14192 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14193 <p>kegg.compound: C04421</p> | |
| 14194 <p>KNApSAcK: C00007597</p> | |
| 14195 <p>PubChem: 7053</p> | |
| 14196 <p>3DMET: B01743</p> | |
| 14197 <p>ChEBI: 165894 17279</p> | |
| 14198 <p>NIKKAJI: J978.287G</p> | |
| 14199 <p>formula: C11H18N2O7</p> | |
| 14200 <p>weight: 290.2698</p> | |
| 14201 </body> | |
| 14202 </notes> | |
| 14203 <annotation> | |
| 14204 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14205 <rdf:Description rdf:about="#dc087689-ecab-41ec-a348-d299485bffed"> | |
| 14206 <bqbiol:is> | |
| 14207 <rdf:Bag> | |
| 14208 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04421"/> | |
| 14209 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007597"/> | |
| 14210 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01743"/> | |
| 14211 <rdf:li rdf:resource="https://identifiers.org/ChEBI/165894 17279"/> | |
| 14212 </rdf:Bag> | |
| 14213 </bqbiol:is> | |
| 14214 </rdf:Description> | |
| 14215 </rdf:RDF> | |
| 14216 </annotation> | |
| 14217 </species> | |
| 14218 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H19OSR" hasOnlySubstanceUnits="false" id="C05755" metaid="_2ee8919d-13c6-4ab3-8d68-02814bfb11dc" name="Decanoyl-[acp]" sboTerm="SBO:0000240"> | |
| 14219 <notes> | |
| 14220 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14221 <p>kegg.compound: C05755</p> | |
| 14222 <p>PubChem: 8050</p> | |
| 14223 <p>ChEBI: 4349</p> | |
| 14224 <p>formula: C10H19OSR</p> | |
| 14225 </body> | |
| 14226 </notes> | |
| 14227 <annotation> | |
| 14228 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14229 <rdf:Description rdf:about="#_2ee8919d-13c6-4ab3-8d68-02814bfb11dc"> | |
| 14230 <bqbiol:is> | |
| 14231 <rdf:Bag> | |
| 14232 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05755"/> | |
| 14233 <rdf:li rdf:resource="https://identifiers.org/ChEBI/4349"/> | |
| 14234 </rdf:Bag> | |
| 14235 </bqbiol:is> | |
| 14236 </rdf:Description> | |
| 14237 </rdf:RDF> | |
| 14238 </annotation> | |
| 14239 </species> | |
| 14240 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C8H15OSR" hasOnlySubstanceUnits="false" id="C05752" metaid="f6c62785-fcc8-4347-88d0-d5d59616d40c" name="Octanoyl-[acp]" sboTerm="SBO:0000240"> | |
| 14241 <notes> | |
| 14242 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14243 <p>kegg.compound: C05752</p> | |
| 14244 <p>PubChem: 8047</p> | |
| 14245 <p>ChEBI: 7725</p> | |
| 14246 <p>formula: C8H15OSR</p> | |
| 14247 </body> | |
| 14248 </notes> | |
| 14249 <annotation> | |
| 14250 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14251 <rdf:Description rdf:about="#f6c62785-fcc8-4347-88d0-d5d59616d40c"> | |
| 14252 <bqbiol:is> | |
| 14253 <rdf:Bag> | |
| 14254 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05752"/> | |
| 14255 <rdf:li rdf:resource="https://identifiers.org/ChEBI/7725"/> | |
| 14256 </rdf:Bag> | |
| 14257 </bqbiol:is> | |
| 14258 </rdf:Description> | |
| 14259 </rdf:RDF> | |
| 14260 </annotation> | |
| 14261 </species> | |
| 14262 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H11N2O6P" hasOnlySubstanceUnits="false" id="C04666" metaid="_75d60452-2431-4f9a-afd0-6fe7d0239f72" name="D-erythro-1-(Imidazol-4-yl)glycerol 3-phosphate" sboTerm="SBO:0000240"> | |
| 14263 <notes> | |
| 14264 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14265 <p>kegg.compound: C04666</p> | |
| 14266 <p>KNApSAcK: C00007478</p> | |
| 14267 <p>PubChem: 7249</p> | |
| 14268 <p>3DMET: B01771</p> | |
| 14269 <p>PDB-CCD: IYP</p> | |
| 14270 <p>ChEBI: 17805</p> | |
| 14271 <p>NIKKAJI: J721.046I</p> | |
| 14272 <p>formula: C6H11N2O6P</p> | |
| 14273 <p>weight: 238.1351</p> | |
| 14274 </body> | |
| 14275 </notes> | |
| 14276 <annotation> | |
| 14277 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14278 <rdf:Description rdf:about="#_75d60452-2431-4f9a-afd0-6fe7d0239f72"> | |
| 14279 <bqbiol:is> | |
| 14280 <rdf:Bag> | |
| 14281 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04666"/> | |
| 14282 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007478"/> | |
| 14283 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01771"/> | |
| 14284 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/IYP"/> | |
| 14285 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17805"/> | |
| 14286 </rdf:Bag> | |
| 14287 </bqbiol:is> | |
| 14288 </rdf:Description> | |
| 14289 </rdf:RDF> | |
| 14290 </annotation> | |
| 14291 </species> | |
| 14292 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H12N4O4" hasOnlySubstanceUnits="false" id="C05512" metaid="_693d45fe-c66f-41d2-a8a6-9604e981ae1e" name="Deoxyinosine" sboTerm="SBO:0000240"> | |
| 14293 <notes> | |
| 14294 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14295 <p>kegg.compound: C05512</p> | |
| 14296 <p>CAS: 890-38-0</p> | |
| 14297 <p>PubChem: 7859</p> | |
| 14298 <p>3DMET: B01869</p> | |
| 14299 <p>PDB-CCD: 2ND</p> | |
| 14300 <p>ChEBI: 28997</p> | |
| 14301 <p>NIKKAJI: J128.131C</p> | |
| 14302 <p>formula: C10H12N4O4</p> | |
| 14303 <p>weight: 252.2267</p> | |
| 14304 </body> | |
| 14305 </notes> | |
| 14306 <annotation> | |
| 14307 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14308 <rdf:Description rdf:about="#_693d45fe-c66f-41d2-a8a6-9604e981ae1e"> | |
| 14309 <bqbiol:is> | |
| 14310 <rdf:Bag> | |
| 14311 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05512"/> | |
| 14312 <rdf:li rdf:resource="https://identifiers.org/CAS/890-38-0"/> | |
| 14313 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01869"/> | |
| 14314 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/2ND"/> | |
| 14315 <rdf:li rdf:resource="https://identifiers.org/ChEBI/28997"/> | |
| 14316 </rdf:Bag> | |
| 14317 </bqbiol:is> | |
| 14318 </rdf:Description> | |
| 14319 </rdf:RDF> | |
| 14320 </annotation> | |
| 14321 </species> | |
| 14322 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H17O2SR" hasOnlySubstanceUnits="false" id="C05753" metaid="_405cb86e-c5e1-4736-984c-ea4ec6d232a4" name="3-Oxodecanoyl-[acp]" sboTerm="SBO:0000240"> | |
| 14323 <notes> | |
| 14324 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14325 <p>kegg.compound: C05753</p> | |
| 14326 <p>PubChem: 8048</p> | |
| 14327 <p>ChEBI: 1634</p> | |
| 14328 <p>formula: C10H17O2SR</p> | |
| 14329 </body> | |
| 14330 </notes> | |
| 14331 <annotation> | |
| 14332 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14333 <rdf:Description rdf:about="#_405cb86e-c5e1-4736-984c-ea4ec6d232a4"> | |
| 14334 <bqbiol:is> | |
| 14335 <rdf:Bag> | |
| 14336 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05753"/> | |
| 14337 <rdf:li rdf:resource="https://identifiers.org/ChEBI/1634"/> | |
| 14338 </rdf:Bag> | |
| 14339 </bqbiol:is> | |
| 14340 </rdf:Description> | |
| 14341 </rdf:RDF> | |
| 14342 </annotation> | |
| 14343 </species> | |
| 14344 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H16NO9P" hasOnlySubstanceUnits="false" id="C04302" metaid="_8e647360-eedb-4b43-967d-d8198fd7602d" name="N-(5-Phospho-D-ribosyl)anthranilate" sboTerm="SBO:0000240"> | |
| 14345 <notes> | |
| 14346 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14347 <p>kegg.compound: C04302</p> | |
| 14348 <p>KNApSAcK: C00007384</p> | |
| 14349 <p>PubChem: 6961</p> | |
| 14350 <p>3DMET: B01733</p> | |
| 14351 <p>ChEBI: 18277 7091</p> | |
| 14352 <p>NIKKAJI: J1.544.460F</p> | |
| 14353 <p>formula: C12H16NO9P</p> | |
| 14354 <p>weight: 349.2305</p> | |
| 14355 </body> | |
| 14356 </notes> | |
| 14357 <annotation> | |
| 14358 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14359 <rdf:Description rdf:about="#_8e647360-eedb-4b43-967d-d8198fd7602d"> | |
| 14360 <bqbiol:is> | |
| 14361 <rdf:Bag> | |
| 14362 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04302"/> | |
| 14363 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007384"/> | |
| 14364 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01733"/> | |
| 14365 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18277 7091"/> | |
| 14366 </rdf:Bag> | |
| 14367 </bqbiol:is> | |
| 14368 </rdf:Description> | |
| 14369 </rdf:RDF> | |
| 14370 </annotation> | |
| 14371 </species> | |
| 14372 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H11NO2" hasOnlySubstanceUnits="false" id="C00079" metaid="f63432ec-ac82-4b1d-a798-2e595a84c3c6" name="L-Phenylalanine" sboTerm="SBO:0000240"> | |
| 14373 <notes> | |
| 14374 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14375 <p>kegg.compound: C00079</p> | |
| 14376 <p>KNApSAcK: C00001386</p> | |
| 14377 <p>CAS: 63-91-2</p> | |
| 14378 <p>PubChem: 3379</p> | |
| 14379 <p>3DMET: B01151</p> | |
| 14380 <p>PDB-CCD: PHE</p> | |
| 14381 <p>ChEBI: 17295</p> | |
| 14382 <p>NIKKAJI: J9.175H</p> | |
| 14383 <p>formula: C9H11NO2</p> | |
| 14384 <p>weight: 165.1891</p> | |
| 14385 </body> | |
| 14386 </notes> | |
| 14387 <annotation> | |
| 14388 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14389 <rdf:Description rdf:about="#f63432ec-ac82-4b1d-a798-2e595a84c3c6"> | |
| 14390 <bqbiol:is> | |
| 14391 <rdf:Bag> | |
| 14392 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00079"/> | |
| 14393 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001386"/> | |
| 14394 <rdf:li rdf:resource="https://identifiers.org/CAS/63-91-2"/> | |
| 14395 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01151"/> | |
| 14396 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/PHE"/> | |
| 14397 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17295"/> | |
| 14398 </rdf:Bag> | |
| 14399 </bqbiol:is> | |
| 14400 </rdf:Description> | |
| 14401 </rdf:RDF> | |
| 14402 </annotation> | |
| 14403 </species> | |
| 14404 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H11O8P" hasOnlySubstanceUnits="false" id="C00199" metaid="c25407cb-4f2c-4744-be59-5fa3e7d9968a" name="D-Ribulose 5-phosphate" sboTerm="SBO:0000240"> | |
| 14405 <notes> | |
| 14406 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14407 <p>kegg.compound: C00199</p> | |
| 14408 <p>CAS: 551-85-9</p> | |
| 14409 <p>PubChem: 3499</p> | |
| 14410 <p>3DMET: B01187</p> | |
| 14411 <p>PDB-CCD: 5RP</p> | |
| 14412 <p>ChEBI: 17363</p> | |
| 14413 <p>NIKKAJI: J275.266B</p> | |
| 14414 <p>formula: C5H11O8P</p> | |
| 14415 <p>weight: 230.1098</p> | |
| 14416 </body> | |
| 14417 </notes> | |
| 14418 <annotation> | |
| 14419 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14420 <rdf:Description rdf:about="#c25407cb-4f2c-4744-be59-5fa3e7d9968a"> | |
| 14421 <bqbiol:is> | |
| 14422 <rdf:Bag> | |
| 14423 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00199"/> | |
| 14424 <rdf:li rdf:resource="https://identifiers.org/CAS/551-85-9"/> | |
| 14425 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01187"/> | |
| 14426 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/5RP"/> | |
| 14427 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17363"/> | |
| 14428 </rdf:Bag> | |
| 14429 </bqbiol:is> | |
| 14430 </rdf:Description> | |
| 14431 </rdf:RDF> | |
| 14432 </annotation> | |
| 14433 </species> | |
| 14434 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C11H12N2O2" hasOnlySubstanceUnits="false" id="C00078" metaid="_68eb41aa-7f61-4e30-a39e-ba1adf0867e4" name="L-Tryptophan" sboTerm="SBO:0000240"> | |
| 14435 <notes> | |
| 14436 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14437 <p>kegg.compound: C00078</p> | |
| 14438 <p>KNApSAcK: C00001396</p> | |
| 14439 <p>CAS: 73-22-3</p> | |
| 14440 <p>PubChem: 3378</p> | |
| 14441 <p>3DMET: B01150</p> | |
| 14442 <p>PDB-CCD: TRP</p> | |
| 14443 <p>ChEBI: 16828</p> | |
| 14444 <p>NIKKAJI: J9.181B</p> | |
| 14445 <p>formula: C11H12N2O2</p> | |
| 14446 <p>weight: 204.2252</p> | |
| 14447 </body> | |
| 14448 </notes> | |
| 14449 <annotation> | |
| 14450 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14451 <rdf:Description rdf:about="#_68eb41aa-7f61-4e30-a39e-ba1adf0867e4"> | |
| 14452 <bqbiol:is> | |
| 14453 <rdf:Bag> | |
| 14454 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00078"/> | |
| 14455 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001396"/> | |
| 14456 <rdf:li rdf:resource="https://identifiers.org/CAS/73-22-3"/> | |
| 14457 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01150"/> | |
| 14458 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/TRP"/> | |
| 14459 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16828"/> | |
| 14460 </rdf:Bag> | |
| 14461 </bqbiol:is> | |
| 14462 </rdf:Description> | |
| 14463 </rdf:RDF> | |
| 14464 </annotation> | |
| 14465 </species> | |
| 14466 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H12N2O2" hasOnlySubstanceUnits="false" id="C00077" metaid="_91b2ce97-1261-454c-93fd-a7e73b27c6d1" name="L-Ornithine" sboTerm="SBO:0000240"> | |
| 14467 <notes> | |
| 14468 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14469 <p>kegg.compound: C00077</p> | |
| 14470 <p>KNApSAcK: C00001384</p> | |
| 14471 <p>CAS: 70-26-8</p> | |
| 14472 <p>PubChem: 3377</p> | |
| 14473 <p>3DMET: B00020</p> | |
| 14474 <p>PDB-CCD: ORN</p> | |
| 14475 <p>ChEBI: 15729</p> | |
| 14476 <p>NIKKAJI: J9.177D</p> | |
| 14477 <p>formula: C5H12N2O2</p> | |
| 14478 <p>weight: 132.161</p> | |
| 14479 </body> | |
| 14480 </notes> | |
| 14481 <annotation> | |
| 14482 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14483 <rdf:Description rdf:about="#_91b2ce97-1261-454c-93fd-a7e73b27c6d1"> | |
| 14484 <bqbiol:is> | |
| 14485 <rdf:Bag> | |
| 14486 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00077"/> | |
| 14487 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001384"/> | |
| 14488 <rdf:li rdf:resource="https://identifiers.org/CAS/70-26-8"/> | |
| 14489 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00020"/> | |
| 14490 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/ORN"/> | |
| 14491 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15729"/> | |
| 14492 </rdf:Bag> | |
| 14493 </bqbiol:is> | |
| 14494 </rdf:Description> | |
| 14495 </rdf:RDF> | |
| 14496 </annotation> | |
| 14497 </species> | |
| 14498 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H7O7P" hasOnlySubstanceUnits="false" id="C00197" metaid="_4d7809ae-b1cd-408b-9335-29a338a43c24" name="3-Phospho-D-glycerate" sboTerm="SBO:0000240"> | |
| 14499 <notes> | |
| 14500 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14501 <p>kegg.compound: C00197</p> | |
| 14502 <p>KNApSAcK: C00019551</p> | |
| 14503 <p>PubChem: 3497</p> | |
| 14504 <p>3DMET: B01185</p> | |
| 14505 <p>PDB-CCD: 3PG</p> | |
| 14506 <p>ChEBI: 17794</p> | |
| 14507 <p>NIKKAJI: J40.061K</p> | |
| 14508 <p>formula: C3H7O7P</p> | |
| 14509 <p>weight: 186.0572</p> | |
| 14510 </body> | |
| 14511 </notes> | |
| 14512 <annotation> | |
| 14513 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14514 <rdf:Description rdf:about="#_4d7809ae-b1cd-408b-9335-29a338a43c24"> | |
| 14515 <bqbiol:is> | |
| 14516 <rdf:Bag> | |
| 14517 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00197"/> | |
| 14518 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019551"/> | |
| 14519 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01185"/> | |
| 14520 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/3PG"/> | |
| 14521 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17794"/> | |
| 14522 </rdf:Bag> | |
| 14523 </bqbiol:is> | |
| 14524 </rdf:Description> | |
| 14525 </rdf:RDF> | |
| 14526 </annotation> | |
| 14527 </species> | |
| 14528 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H15N2O15P3" hasOnlySubstanceUnits="false" id="C00075" metaid="_23d272dc-1a7e-486a-abfc-5a76fa14e858" name="UTP" sboTerm="SBO:0000240"> | |
| 14529 <notes> | |
| 14530 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14531 <p>kegg.compound: C00075</p> | |
| 14532 <p>CAS: 63-39-8</p> | |
| 14533 <p>PubChem: 3375</p> | |
| 14534 <p>3DMET: B01149</p> | |
| 14535 <p>PDB-CCD: UTP</p> | |
| 14536 <p>ChEBI: 15713</p> | |
| 14537 <p>NIKKAJI: J4.827E</p> | |
| 14538 <p>formula: C9H15N2O15P3</p> | |
| 14539 <p>weight: 484.1411</p> | |
| 14540 </body> | |
| 14541 </notes> | |
| 14542 <annotation> | |
| 14543 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14544 <rdf:Description rdf:about="#_23d272dc-1a7e-486a-abfc-5a76fa14e858"> | |
| 14545 <bqbiol:is> | |
| 14546 <rdf:Bag> | |
| 14547 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00075"/> | |
| 14548 <rdf:li rdf:resource="https://identifiers.org/CAS/63-39-8"/> | |
| 14549 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01149"/> | |
| 14550 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/UTP"/> | |
| 14551 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15713"/> | |
| 14552 </rdf:Bag> | |
| 14553 </bqbiol:is> | |
| 14554 </rdf:Description> | |
| 14555 </rdf:RDF> | |
| 14556 </annotation> | |
| 14557 </species> | |
| 14558 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H5O6P" hasOnlySubstanceUnits="false" id="C00074" metaid="ade0621b-c2c2-43e0-a0fd-577d1f783e15" name="Phosphoenolpyruvate" sboTerm="SBO:0000240"> | |
| 14559 <notes> | |
| 14560 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14561 <p>kegg.compound: C00074</p> | |
| 14562 <p>KNApSAcK: C00000798</p> | |
| 14563 <p>CAS: 138-08-9</p> | |
| 14564 <p>PubChem: 3374</p> | |
| 14565 <p>3DMET: B00019</p> | |
| 14566 <p>PDB-CCD: PEP</p> | |
| 14567 <p>ChEBI: 18021 44897</p> | |
| 14568 <p>NIKKAJI: J9.706C</p> | |
| 14569 <p>formula: C3H5O6P</p> | |
| 14570 <p>weight: 168.042</p> | |
| 14571 </body> | |
| 14572 </notes> | |
| 14573 <annotation> | |
| 14574 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14575 <rdf:Description rdf:about="#ade0621b-c2c2-43e0-a0fd-577d1f783e15"> | |
| 14576 <bqbiol:is> | |
| 14577 <rdf:Bag> | |
| 14578 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00074"/> | |
| 14579 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00000798"/> | |
| 14580 <rdf:li rdf:resource="https://identifiers.org/CAS/138-08-9"/> | |
| 14581 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00019"/> | |
| 14582 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/PEP"/> | |
| 14583 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18021 44897"/> | |
| 14584 </rdf:Bag> | |
| 14585 </bqbiol:is> | |
| 14586 </rdf:Description> | |
| 14587 </rdf:RDF> | |
| 14588 </annotation> | |
| 14589 </species> | |
| 14590 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H11NO2S" hasOnlySubstanceUnits="false" id="C00073" metaid="bbf13680-5997-459a-bd72-a18359ea62d6" name="L-Methionine" sboTerm="SBO:0000240"> | |
| 14591 <notes> | |
| 14592 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14593 <p>kegg.compound: C00073</p> | |
| 14594 <p>KNApSAcK: C00001379</p> | |
| 14595 <p>CAS: 63-68-3</p> | |
| 14596 <p>PubChem: 3373</p> | |
| 14597 <p>3DMET: B01148</p> | |
| 14598 <p>PDB-CCD: MET</p> | |
| 14599 <p>ChEBI: 16643</p> | |
| 14600 <p>NIKKAJI: J9.174J</p> | |
| 14601 <p>formula: C5H11NO2S</p> | |
| 14602 <p>weight: 149.2113</p> | |
| 14603 </body> | |
| 14604 </notes> | |
| 14605 <annotation> | |
| 14606 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14607 <rdf:Description rdf:about="#bbf13680-5997-459a-bd72-a18359ea62d6"> | |
| 14608 <bqbiol:is> | |
| 14609 <rdf:Bag> | |
| 14610 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00073"/> | |
| 14611 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001379"/> | |
| 14612 <rdf:li rdf:resource="https://identifiers.org/CAS/63-68-3"/> | |
| 14613 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01148"/> | |
| 14614 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/MET"/> | |
| 14615 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16643"/> | |
| 14616 </rdf:Bag> | |
| 14617 </bqbiol:is> | |
| 14618 </rdf:Description> | |
| 14619 </rdf:RDF> | |
| 14620 </annotation> | |
| 14621 </species> | |
| 14622 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C49H58FeN4O5" hasOnlySubstanceUnits="false" id="C15672" metaid="_59331a63-6313-4bb7-863b-0c2dde302026" name="Heme O" sboTerm="SBO:0000240"> | |
| 14623 <notes> | |
| 14624 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14625 <p>kegg.compound: C15672</p> | |
| 14626 <p>CAS: 137397-56-9</p> | |
| 14627 <p>PubChem: 47204998</p> | |
| 14628 <p>ChEBI: 24480</p> | |
| 14629 <p>formula: C49H58FeN4O5</p> | |
| 14630 <p>weight: 838.8536</p> | |
| 14631 </body> | |
| 14632 </notes> | |
| 14633 <annotation> | |
| 14634 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14635 <rdf:Description rdf:about="#_59331a63-6313-4bb7-863b-0c2dde302026"> | |
| 14636 <bqbiol:is> | |
| 14637 <rdf:Bag> | |
| 14638 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C15672"/> | |
| 14639 <rdf:li rdf:resource="https://identifiers.org/CAS/137397-56-9"/> | |
| 14640 <rdf:li rdf:resource="https://identifiers.org/ChEBI/24480"/> | |
| 14641 </rdf:Bag> | |
| 14642 </bqbiol:is> | |
| 14643 </rdf:Description> | |
| 14644 </rdf:RDF> | |
| 14645 </annotation> | |
| 14646 </species> | |
| 14647 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C4H9O6P" hasOnlySubstanceUnits="false" id="C15556" metaid="_98453e8a-43fb-444c-ab5f-f96641e5c2c9" name="L-3,4-Dihydroxybutan-2-one 4-phosphate" sboTerm="SBO:0000240"> | |
| 14648 <notes> | |
| 14649 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14650 <p>kegg.compound: C15556</p> | |
| 14651 <p>PubChem: 17396548</p> | |
| 14652 <p>ChEBI: 50606</p> | |
| 14653 <p>NIKKAJI: J1.171.796I</p> | |
| 14654 <p>formula: C4H9O6P</p> | |
| 14655 <p>weight: 184.0844</p> | |
| 14656 </body> | |
| 14657 </notes> | |
| 14658 <annotation> | |
| 14659 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14660 <rdf:Description rdf:about="#_98453e8a-43fb-444c-ab5f-f96641e5c2c9"> | |
| 14661 <bqbiol:is> | |
| 14662 <rdf:Bag> | |
| 14663 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C15556"/> | |
| 14664 <rdf:li rdf:resource="https://identifiers.org/ChEBI/50606"/> | |
| 14665 </rdf:Bag> | |
| 14666 </bqbiol:is> | |
| 14667 </rdf:Description> | |
| 14668 </rdf:RDF> | |
| 14669 </annotation> | |
| 14670 </species> | |
| 14671 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C14H27OSR" hasOnlySubstanceUnits="false" id="C05761" metaid="_88c4caea-561e-4bf1-8ae8-e20641454bbf" name="Tetradecanoyl-[acp]" sboTerm="SBO:0000240"> | |
| 14672 <notes> | |
| 14673 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14674 <p>kegg.compound: C05761</p> | |
| 14675 <p>PubChem: 8056</p> | |
| 14676 <p>ChEBI: 50651</p> | |
| 14677 <p>formula: C14H27OSR</p> | |
| 14678 </body> | |
| 14679 </notes> | |
| 14680 <annotation> | |
| 14681 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14682 <rdf:Description rdf:about="#_88c4caea-561e-4bf1-8ae8-e20641454bbf"> | |
| 14683 <bqbiol:is> | |
| 14684 <rdf:Bag> | |
| 14685 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05761"/> | |
| 14686 <rdf:li rdf:resource="https://identifiers.org/ChEBI/50651"/> | |
| 14687 </rdf:Bag> | |
| 14688 </bqbiol:is> | |
| 14689 </rdf:Description> | |
| 14690 </rdf:RDF> | |
| 14691 </annotation> | |
| 14692 </species> | |
| 14693 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C16H29O2SR" hasOnlySubstanceUnits="false" id="C05762" metaid="_5757d534-b849-4c12-98f1-b9aae0dee932" name="3-Oxohexadecanoyl-[acp]" sboTerm="SBO:0000240"> | |
| 14694 <notes> | |
| 14695 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14696 <p>kegg.compound: C05762</p> | |
| 14697 <p>PubChem: 8057</p> | |
| 14698 <p>ChEBI: 1639</p> | |
| 14699 <p>formula: C16H29O2SR</p> | |
| 14700 </body> | |
| 14701 </notes> | |
| 14702 <annotation> | |
| 14703 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14704 <rdf:Description rdf:about="#_5757d534-b849-4c12-98f1-b9aae0dee932"> | |
| 14705 <bqbiol:is> | |
| 14706 <rdf:Bag> | |
| 14707 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05762"/> | |
| 14708 <rdf:li rdf:resource="https://identifiers.org/ChEBI/1639"/> | |
| 14709 </rdf:Bag> | |
| 14710 </bqbiol:is> | |
| 14711 </rdf:Description> | |
| 14712 </rdf:RDF> | |
| 14713 </annotation> | |
| 14714 </species> | |
| 14715 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C14H25OSR" hasOnlySubstanceUnits="false" id="C05760" metaid="_7b4e8b71-ce68-4328-b3e9-8645271955a0" name="trans-Tetradec-2-enoyl-[acp]" sboTerm="SBO:0000240"> | |
| 14716 <notes> | |
| 14717 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14718 <p>kegg.compound: C05760</p> | |
| 14719 <p>PubChem: 8055</p> | |
| 14720 <p>ChEBI: 10735</p> | |
| 14721 <p>formula: C14H25OSR</p> | |
| 14722 </body> | |
| 14723 </notes> | |
| 14724 <annotation> | |
| 14725 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14726 <rdf:Description rdf:about="#_7b4e8b71-ce68-4328-b3e9-8645271955a0"> | |
| 14727 <bqbiol:is> | |
| 14728 <rdf:Bag> | |
| 14729 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05760"/> | |
| 14730 <rdf:li rdf:resource="https://identifiers.org/ChEBI/10735"/> | |
| 14731 </rdf:Bag> | |
| 14732 </bqbiol:is> | |
| 14733 </rdf:Description> | |
| 14734 </rdf:RDF> | |
| 14735 </annotation> | |
| 14736 </species> | |
| 14737 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C04432" metaid="bb1248be-5985-4b58-b4c2-4356ca0f5207" name="tRNA containing 6-isopentenyladenosine" sboTerm="SBO:0000240"> | |
| 14738 <notes> | |
| 14739 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14740 <p>kegg.compound: C04432</p> | |
| 14741 <p>PubChem: 7063</p> | |
| 14742 <p>formula: C15H22N5O7P(C5H8O6PR)n(C5H8O6PR)n</p> | |
| 14743 </body> | |
| 14744 </notes> | |
| 14745 <annotation> | |
| 14746 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14747 <rdf:Description rdf:about="#bb1248be-5985-4b58-b4c2-4356ca0f5207"> | |
| 14748 <bqbiol:is> | |
| 14749 <rdf:Bag> | |
| 14750 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04432"/> | |
| 14751 </rdf:Bag> | |
| 14752 </bqbiol:is> | |
| 14753 </rdf:Description> | |
| 14754 </rdf:RDF> | |
| 14755 </annotation> | |
| 14756 </species> | |
| 14757 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H15N4O8P" hasOnlySubstanceUnits="false" id="C04677" metaid="_19b87d24-bcd8-4a2a-bf49-40bc0247fbb3" name="1-(5'-Phosphoribosyl)-5-amino-4-imidazolecarboxamide" sboTerm="SBO:0000240"> | |
| 14758 <notes> | |
| 14759 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14760 <p>kegg.compound: C04677</p> | |
| 14761 <p>KNApSAcK: C00007383</p> | |
| 14762 <p>CAS: 3031-94-5</p> | |
| 14763 <p>PubChem: 7258</p> | |
| 14764 <p>3DMET: B01774</p> | |
| 14765 <p>PDB-CCD: AMZ</p> | |
| 14766 <p>ChEBI: 18406</p> | |
| 14767 <p>NIKKAJI: J7.665A</p> | |
| 14768 <p>formula: C9H15N4O8P</p> | |
| 14769 <p>weight: 338.2112</p> | |
| 14770 </body> | |
| 14771 </notes> | |
| 14772 <annotation> | |
| 14773 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14774 <rdf:Description rdf:about="#_19b87d24-bcd8-4a2a-bf49-40bc0247fbb3"> | |
| 14775 <bqbiol:is> | |
| 14776 <rdf:Bag> | |
| 14777 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04677"/> | |
| 14778 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007383"/> | |
| 14779 <rdf:li rdf:resource="https://identifiers.org/CAS/3031-94-5"/> | |
| 14780 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01774"/> | |
| 14781 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/AMZ"/> | |
| 14782 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18406"/> | |
| 14783 </rdf:Bag> | |
| 14784 </bqbiol:is> | |
| 14785 </rdf:Description> | |
| 14786 </rdf:RDF> | |
| 14787 </annotation> | |
| 14788 </species> | |
| 14789 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C16H29OSR" hasOnlySubstanceUnits="false" id="C05763" metaid="_8a1d13c3-03e3-4bea-912f-56fbff071b8b" name="trans-Hexadec-2-enoyl-[acp]" sboTerm="SBO:0000240"> | |
| 14790 <notes> | |
| 14791 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14792 <p>kegg.compound: C05763</p> | |
| 14793 <p>PubChem: 8058</p> | |
| 14794 <p>ChEBI: 10729</p> | |
| 14795 <p>formula: C16H29OSR</p> | |
| 14796 </body> | |
| 14797 </notes> | |
| 14798 <annotation> | |
| 14799 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14800 <rdf:Description rdf:about="#_8a1d13c3-03e3-4bea-912f-56fbff071b8b"> | |
| 14801 <bqbiol:is> | |
| 14802 <rdf:Bag> | |
| 14803 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05763"/> | |
| 14804 <rdf:li rdf:resource="https://identifiers.org/ChEBI/10729"/> | |
| 14805 </rdf:Bag> | |
| 14806 </bqbiol:is> | |
| 14807 </rdf:Description> | |
| 14808 </rdf:RDF> | |
| 14809 </annotation> | |
| 14810 </species> | |
| 14811 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C16H31OSR" hasOnlySubstanceUnits="false" id="C05764" metaid="_4c648c15-505f-4bb9-af3b-14b84fdf6b75" name="Hexadecanoyl-[acp]" sboTerm="SBO:0000240"> | |
| 14812 <notes> | |
| 14813 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14814 <p>kegg.compound: C05764</p> | |
| 14815 <p>PubChem: 8059</p> | |
| 14816 <p>ChEBI: 5697</p> | |
| 14817 <p>formula: C16H31OSR</p> | |
| 14818 </body> | |
| 14819 </notes> | |
| 14820 <annotation> | |
| 14821 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14822 <rdf:Description rdf:about="#_4c648c15-505f-4bb9-af3b-14b84fdf6b75"> | |
| 14823 <bqbiol:is> | |
| 14824 <rdf:Bag> | |
| 14825 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05764"/> | |
| 14826 <rdf:li rdf:resource="https://identifiers.org/ChEBI/5697"/> | |
| 14827 </rdf:Bag> | |
| 14828 </bqbiol:is> | |
| 14829 </rdf:Description> | |
| 14830 </rdf:RDF> | |
| 14831 </annotation> | |
| 14832 </species> | |
| 14833 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C42H46N4O16" hasOnlySubstanceUnits="false" id="C05778" metaid="cb09a721-f9ba-4635-91dd-211b871c8d81" name="Sirohydrochlorin" sboTerm="SBO:0000240"> | |
| 14834 <notes> | |
| 14835 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14836 <p>kegg.compound: C05778</p> | |
| 14837 <p>KNApSAcK: C00007315</p> | |
| 14838 <p>CAS: 65207-12-7</p> | |
| 14839 <p>PubChem: 8073</p> | |
| 14840 <p>3DMET: B01893</p> | |
| 14841 <p>ChEBI: 18023</p> | |
| 14842 <p>NIKKAJI: J18.481K</p> | |
| 14843 <p>formula: C42H46N4O16</p> | |
| 14844 <p>weight: 862.8318</p> | |
| 14845 </body> | |
| 14846 </notes> | |
| 14847 <annotation> | |
| 14848 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14849 <rdf:Description rdf:about="#cb09a721-f9ba-4635-91dd-211b871c8d81"> | |
| 14850 <bqbiol:is> | |
| 14851 <rdf:Bag> | |
| 14852 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05778"/> | |
| 14853 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007315"/> | |
| 14854 <rdf:li rdf:resource="https://identifiers.org/CAS/65207-12-7"/> | |
| 14855 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01893"/> | |
| 14856 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18023"/> | |
| 14857 </rdf:Bag> | |
| 14858 </bqbiol:is> | |
| 14859 </rdf:Description> | |
| 14860 </rdf:RDF> | |
| 14861 </annotation> | |
| 14862 </species> | |
| 14863 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H15O10P" hasOnlySubstanceUnits="false" id="C07836" metaid="cd310250-0246-4462-a5f0-ef90a808fdda" name="D-glycero-beta-D-manno-Heptose 7-phosphate" sboTerm="SBO:0000240"> | |
| 14864 <notes> | |
| 14865 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14866 <p>kegg.compound: C07836</p> | |
| 14867 <p>PubChem: 10038</p> | |
| 14868 <p>3DMET: B05257</p> | |
| 14869 <p>PDB-CCD: M7B</p> | |
| 14870 <p>ChEBI: 28723</p> | |
| 14871 <p>NIKKAJI: J2.185.467K</p> | |
| 14872 <p>formula: C7H15O10P</p> | |
| 14873 <p>weight: 290.1618</p> | |
| 14874 </body> | |
| 14875 </notes> | |
| 14876 <annotation> | |
| 14877 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14878 <rdf:Description rdf:about="#cd310250-0246-4462-a5f0-ef90a808fdda"> | |
| 14879 <bqbiol:is> | |
| 14880 <rdf:Bag> | |
| 14881 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C07836"/> | |
| 14882 <rdf:li rdf:resource="https://identifiers.org/3DMET/B05257"/> | |
| 14883 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/M7B"/> | |
| 14884 <rdf:li rdf:resource="https://identifiers.org/ChEBI/28723"/> | |
| 14885 </rdf:Bag> | |
| 14886 </bqbiol:is> | |
| 14887 </rdf:Description> | |
| 14888 </rdf:RDF> | |
| 14889 </annotation> | |
| 14890 </species> | |
| 14891 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H13O9P" hasOnlySubstanceUnits="false" id="C00085" metaid="_263bab43-aa5f-47b9-b331-aa78641affda" name="D-Fructose 6-phosphate" sboTerm="SBO:0000240"> | |
| 14892 <notes> | |
| 14893 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14894 <p>kegg.compound: C00085</p> | |
| 14895 <p>KNApSAcK: C00007305</p> | |
| 14896 <p>CAS: 643-13-0</p> | |
| 14897 <p>PubChem: 3385</p> | |
| 14898 <p>3DMET: B04628</p> | |
| 14899 <p>PDB-CCD: F6P P6P</p> | |
| 14900 <p>ChEBI: 15946 61553</p> | |
| 14901 <p>NIKKAJI: J92.807K</p> | |
| 14902 <p>formula: C6H13O9P</p> | |
| 14903 <p>weight: 260.1358</p> | |
| 14904 </body> | |
| 14905 </notes> | |
| 14906 <annotation> | |
| 14907 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14908 <rdf:Description rdf:about="#_263bab43-aa5f-47b9-b331-aa78641affda"> | |
| 14909 <bqbiol:is> | |
| 14910 <rdf:Bag> | |
| 14911 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00085"/> | |
| 14912 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007305"/> | |
| 14913 <rdf:li rdf:resource="https://identifiers.org/CAS/643-13-0"/> | |
| 14914 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04628"/> | |
| 14915 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/F6P P6P"/> | |
| 14916 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15946 61553"/> | |
| 14917 </rdf:Bag> | |
| 14918 </bqbiol:is> | |
| 14919 </rdf:Description> | |
| 14920 </rdf:RDF> | |
| 14921 </annotation> | |
| 14922 </species> | |
| 14923 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C24H38N7O19P3S" hasOnlySubstanceUnits="false" id="C00083" metaid="_840ea75e-1158-493b-a48e-c9a91493daa7" name="Malonyl-CoA" sboTerm="SBO:0000240"> | |
| 14924 <notes> | |
| 14925 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14926 <p>kegg.compound: C00083</p> | |
| 14927 <p>KNApSAcK: C00007260</p> | |
| 14928 <p>CAS: 524-14-1</p> | |
| 14929 <p>PubChem: 3383</p> | |
| 14930 <p>3DMET: B04627</p> | |
| 14931 <p>PDB-CCD: MLC</p> | |
| 14932 <p>ChEBI: 15531</p> | |
| 14933 <p>LIPIDMAPS: LMFA07050345</p> | |
| 14934 <p>NIKKAJI: J203.864A</p> | |
| 14935 <p>formula: C24H38N7O19P3S</p> | |
| 14936 <p>weight: 853.5803</p> | |
| 14937 </body> | |
| 14938 </notes> | |
| 14939 <annotation> | |
| 14940 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14941 <rdf:Description rdf:about="#_840ea75e-1158-493b-a48e-c9a91493daa7"> | |
| 14942 <bqbiol:is> | |
| 14943 <rdf:Bag> | |
| 14944 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00083"/> | |
| 14945 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007260"/> | |
| 14946 <rdf:li rdf:resource="https://identifiers.org/CAS/524-14-1"/> | |
| 14947 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04627"/> | |
| 14948 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/MLC"/> | |
| 14949 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15531"/> | |
| 14950 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA07050345"/> | |
| 14951 </rdf:Bag> | |
| 14952 </bqbiol:is> | |
| 14953 </rdf:Description> | |
| 14954 </rdf:RDF> | |
| 14955 </annotation> | |
| 14956 </species> | |
| 14957 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H11NO3" hasOnlySubstanceUnits="false" id="C00082" metaid="_123b407b-c87b-4d37-a05e-06527ad21faa" name="L-Tyrosine" sboTerm="SBO:0000240"> | |
| 14958 <notes> | |
| 14959 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14960 <p>kegg.compound: C00082</p> | |
| 14961 <p>KNApSAcK: C00001397</p> | |
| 14962 <p>CAS: 60-18-4</p> | |
| 14963 <p>PubChem: 3382</p> | |
| 14964 <p>3DMET: B01154</p> | |
| 14965 <p>PDB-CCD: TYR</p> | |
| 14966 <p>ChEBI: 17895</p> | |
| 14967 <p>NIKKAJI: J9.173A</p> | |
| 14968 <p>formula: C9H11NO3</p> | |
| 14969 <p>weight: 181.1885</p> | |
| 14970 </body> | |
| 14971 </notes> | |
| 14972 <annotation> | |
| 14973 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 14974 <rdf:Description rdf:about="#_123b407b-c87b-4d37-a05e-06527ad21faa"> | |
| 14975 <bqbiol:is> | |
| 14976 <rdf:Bag> | |
| 14977 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00082"/> | |
| 14978 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001397"/> | |
| 14979 <rdf:li rdf:resource="https://identifiers.org/CAS/60-18-4"/> | |
| 14980 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01154"/> | |
| 14981 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/TYR"/> | |
| 14982 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17895"/> | |
| 14983 </rdf:Bag> | |
| 14984 </bqbiol:is> | |
| 14985 </rdf:Description> | |
| 14986 </rdf:RDF> | |
| 14987 </annotation> | |
| 14988 </species> | |
| 14989 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C10H15N4O14P3" hasOnlySubstanceUnits="false" id="C00081" metaid="_20f7f0e8-6654-43d3-8417-b2d47a23e060" name="ITP" sboTerm="SBO:0000240"> | |
| 14990 <notes> | |
| 14991 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 14992 <p>kegg.compound: C00081</p> | |
| 14993 <p>CAS: 132-06-9</p> | |
| 14994 <p>PubChem: 3381</p> | |
| 14995 <p>3DMET: B01153</p> | |
| 14996 <p>PDB-CCD: CZU ITT</p> | |
| 14997 <p>ChEBI: 16039</p> | |
| 14998 <p>NIKKAJI: J38.562J</p> | |
| 14999 <p>formula: C10H15N4O14P3</p> | |
| 15000 <p>weight: 508.1658</p> | |
| 15001 </body> | |
| 15002 </notes> | |
| 15003 <annotation> | |
| 15004 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15005 <rdf:Description rdf:about="#_20f7f0e8-6654-43d3-8417-b2d47a23e060"> | |
| 15006 <bqbiol:is> | |
| 15007 <rdf:Bag> | |
| 15008 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00081"/> | |
| 15009 <rdf:li rdf:resource="https://identifiers.org/CAS/132-06-9"/> | |
| 15010 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01153"/> | |
| 15011 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/CZU ITT"/> | |
| 15012 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16039"/> | |
| 15013 </rdf:Bag> | |
| 15014 </bqbiol:is> | |
| 15015 </rdf:Description> | |
| 15016 </rdf:RDF> | |
| 15017 </annotation> | |
| 15018 </species> | |
| 15019 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="H" hasOnlySubstanceUnits="false" id="C00080" metaid="b3b639b8-d35a-4072-8066-5a5b54d5557a" name="H+" sboTerm="SBO:0000240"> | |
| 15020 <notes> | |
| 15021 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15022 <p>kegg.compound: C00080</p> | |
| 15023 <p>PubChem: 3380</p> | |
| 15024 <p>ChEBI: 15378 24636</p> | |
| 15025 <p>formula: H</p> | |
| 15026 <p>weight: 1.0079</p> | |
| 15027 </body> | |
| 15028 </notes> | |
| 15029 <annotation> | |
| 15030 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15031 <rdf:Description rdf:about="#b3b639b8-d35a-4072-8066-5a5b54d5557a"> | |
| 15032 <bqbiol:is> | |
| 15033 <rdf:Bag> | |
| 15034 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00080"/> | |
| 15035 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15378 24636"/> | |
| 15036 </rdf:Bag> | |
| 15037 </bqbiol:is> | |
| 15038 </rdf:Description> | |
| 15039 </rdf:RDF> | |
| 15040 </annotation> | |
| 15041 </species> | |
| 15042 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C20H31N3O19P2" hasOnlySubstanceUnits="false" id="C01050" metaid="_928343a1-e2f4-4eca-bd49-c668f6eb9ca2" name="UDP-N-acetylmuramate" sboTerm="SBO:0000240"> | |
| 15043 <notes> | |
| 15044 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15045 <p>kegg.compound: C01050</p> | |
| 15046 <p>PubChem: 4292</p> | |
| 15047 <p>3DMET: B04759</p> | |
| 15048 <p>PDB-CCD: EPZ</p> | |
| 15049 <p>ChEBI: 70765</p> | |
| 15050 <p>NIKKAJI: J710.466I</p> | |
| 15051 <p>formula: C20H31N3O19P2</p> | |
| 15052 <p>weight: 679.4164</p> | |
| 15053 </body> | |
| 15054 </notes> | |
| 15055 <annotation> | |
| 15056 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15057 <rdf:Description rdf:about="#_928343a1-e2f4-4eca-bd49-c668f6eb9ca2"> | |
| 15058 <bqbiol:is> | |
| 15059 <rdf:Bag> | |
| 15060 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01050"/> | |
| 15061 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04759"/> | |
| 15062 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/EPZ"/> | |
| 15063 <rdf:li rdf:resource="https://identifiers.org/ChEBI/70765"/> | |
| 15064 </rdf:Bag> | |
| 15065 </bqbiol:is> | |
| 15066 </rdf:Description> | |
| 15067 </rdf:RDF> | |
| 15068 </annotation> | |
| 15069 </species> | |
| 15070 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H13O9P" hasOnlySubstanceUnits="false" id="C01172" metaid="_45d18f8c-7e72-4968-9f02-5b9bc6aac4ba" name="beta-D-Glucose 6-phosphate" sboTerm="SBO:0000240"> | |
| 15071 <notes> | |
| 15072 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15073 <p>kegg.compound: C01172</p> | |
| 15074 <p>PubChem: 4399</p> | |
| 15075 <p>3DMET: B01400</p> | |
| 15076 <p>PDB-CCD: BG6</p> | |
| 15077 <p>ChEBI: 17719</p> | |
| 15078 <p>NIKKAJI: J396.144C</p> | |
| 15079 <p>formula: C6H13O9P</p> | |
| 15080 <p>weight: 260.1358</p> | |
| 15081 </body> | |
| 15082 </notes> | |
| 15083 <annotation> | |
| 15084 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15085 <rdf:Description rdf:about="#_45d18f8c-7e72-4968-9f02-5b9bc6aac4ba"> | |
| 15086 <bqbiol:is> | |
| 15087 <rdf:Bag> | |
| 15088 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01172"/> | |
| 15089 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01400"/> | |
| 15090 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/BG6"/> | |
| 15091 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17719"/> | |
| 15092 </rdf:Bag> | |
| 15093 </bqbiol:is> | |
| 15094 </rdf:Description> | |
| 15095 </rdf:RDF> | |
| 15096 </annotation> | |
| 15097 </species> | |
| 15098 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C94H156N8O26P2" hasOnlySubstanceUnits="false" id="C05893" metaid="aa49681b-2d67-43fa-a41a-edddf010afef" name="Undecaprenyl-diphospho-N-acetylmuramoyl-(N-acetylglucosamine)-L-alanyl-gamma-D-glutamyl-L-lysyl-D-alanyl-D-alanine" sboTerm="SBO:0000240"> | |
| 15099 <notes> | |
| 15100 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15101 <p>kegg.compound: C05893</p> | |
| 15102 <p>PubChem: 8181</p> | |
| 15103 <p>3DMET: B05130</p> | |
| 15104 <p>ChEBI: 27692</p> | |
| 15105 <p>NIKKAJI: J2.760.261D</p> | |
| 15106 <p>formula: C94H156N8O26P2</p> | |
| 15107 <p>weight: 1876.23</p> | |
| 15108 </body> | |
| 15109 </notes> | |
| 15110 <annotation> | |
| 15111 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15112 <rdf:Description rdf:about="#aa49681b-2d67-43fa-a41a-edddf010afef"> | |
| 15113 <bqbiol:is> | |
| 15114 <rdf:Bag> | |
| 15115 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05893"/> | |
| 15116 <rdf:li rdf:resource="https://identifiers.org/3DMET/B05130"/> | |
| 15117 <rdf:li rdf:resource="https://identifiers.org/ChEBI/27692"/> | |
| 15118 </rdf:Bag> | |
| 15119 </bqbiol:is> | |
| 15120 </rdf:Description> | |
| 15121 </rdf:RDF> | |
| 15122 </annotation> | |
| 15123 </species> | |
| 15124 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C40H44N4O16" hasOnlySubstanceUnits="false" id="C01051" metaid="_6f0295aa-6404-48a8-8337-bd238196adfa" name="Uroporphyrinogen III" sboTerm="SBO:0000240"> | |
| 15125 <notes> | |
| 15126 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15127 <p>kegg.compound: C01051</p> | |
| 15128 <p>KNApSAcK: C00007373</p> | |
| 15129 <p>CAS: 1976-85-8</p> | |
| 15130 <p>PubChem: 4293</p> | |
| 15131 <p>3DMET: B00231</p> | |
| 15132 <p>PDB-CCD: UP2</p> | |
| 15133 <p>ChEBI: 15437</p> | |
| 15134 <p>NIKKAJI: J39.044E</p> | |
| 15135 <p>formula: C40H44N4O16</p> | |
| 15136 <p>weight: 836.7946</p> | |
| 15137 </body> | |
| 15138 </notes> | |
| 15139 <annotation> | |
| 15140 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15141 <rdf:Description rdf:about="#_6f0295aa-6404-48a8-8337-bd238196adfa"> | |
| 15142 <bqbiol:is> | |
| 15143 <rdf:Bag> | |
| 15144 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01051"/> | |
| 15145 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007373"/> | |
| 15146 <rdf:li rdf:resource="https://identifiers.org/CAS/1976-85-8"/> | |
| 15147 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00231"/> | |
| 15148 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/UP2"/> | |
| 15149 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15437"/> | |
| 15150 </rdf:Bag> | |
| 15151 </bqbiol:is> | |
| 15152 </rdf:Description> | |
| 15153 </rdf:RDF> | |
| 15154 </annotation> | |
| 15155 </species> | |
| 15156 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H5O7P" hasOnlySubstanceUnits="false" id="C03232" metaid="_1bab3a60-748e-4858-8270-8737237fa689" name="3-Phosphonooxypyruvate" sboTerm="SBO:0000240"> | |
| 15157 <notes> | |
| 15158 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15159 <p>kegg.compound: C03232</p> | |
| 15160 <p>KNApSAcK: C00019657</p> | |
| 15161 <p>CAS: 3913-50-6</p> | |
| 15162 <p>PubChem: 6103</p> | |
| 15163 <p>3DMET: B00565</p> | |
| 15164 <p>PDB-CCD: HPV</p> | |
| 15165 <p>ChEBI: 18110 30933</p> | |
| 15166 <p>NIKKAJI: J2.180.747H</p> | |
| 15167 <p>formula: C3H5O7P</p> | |
| 15168 <p>weight: 184.0414</p> | |
| 15169 </body> | |
| 15170 </notes> | |
| 15171 <annotation> | |
| 15172 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15173 <rdf:Description rdf:about="#_1bab3a60-748e-4858-8270-8737237fa689"> | |
| 15174 <bqbiol:is> | |
| 15175 <rdf:Bag> | |
| 15176 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03232"/> | |
| 15177 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019657"/> | |
| 15178 <rdf:li rdf:resource="https://identifiers.org/CAS/3913-50-6"/> | |
| 15179 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00565"/> | |
| 15180 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/HPV"/> | |
| 15181 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18110 30933"/> | |
| 15182 </rdf:Bag> | |
| 15183 </bqbiol:is> | |
| 15184 </rdf:Description> | |
| 15185 </rdf:RDF> | |
| 15186 </annotation> | |
| 15187 </species> | |
| 15188 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C34H55N7O24P2" hasOnlySubstanceUnits="false" id="C05892" metaid="fbbab4e0-b8bc-4a4d-b3fc-3983e8a846ce" name="UDP-N-acetylmuramoyl-L-alanyl-gamma-D-glutamyl-L-lysine" sboTerm="SBO:0000240"> | |
| 15189 <notes> | |
| 15190 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15191 <p>kegg.compound: C05892</p> | |
| 15192 <p>PubChem: 8180</p> | |
| 15193 <p>3DMET: B05129</p> | |
| 15194 <p>PDB-CCD: UML</p> | |
| 15195 <p>ChEBI: 16329</p> | |
| 15196 <p>NIKKAJI: J2.760.227D</p> | |
| 15197 <p>formula: C34H55N7O24P2</p> | |
| 15198 <p>weight: 1007.7805</p> | |
| 15199 </body> | |
| 15200 </notes> | |
| 15201 <annotation> | |
| 15202 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15203 <rdf:Description rdf:about="#fbbab4e0-b8bc-4a4d-b3fc-3983e8a846ce"> | |
| 15204 <bqbiol:is> | |
| 15205 <rdf:Bag> | |
| 15206 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05892"/> | |
| 15207 <rdf:li rdf:resource="https://identifiers.org/3DMET/B05129"/> | |
| 15208 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/UML"/> | |
| 15209 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16329"/> | |
| 15210 </rdf:Bag> | |
| 15211 </bqbiol:is> | |
| 15212 </rdf:Description> | |
| 15213 </rdf:RDF> | |
| 15214 </annotation> | |
| 15215 </species> | |
| 15216 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C87H143N7O23P2" hasOnlySubstanceUnits="false" id="C05897" metaid="f333a9d0-32ad-4b37-8f85-508c25ef8353" name="Undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine" sboTerm="SBO:0000240"> | |
| 15217 <notes> | |
| 15218 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15219 <p>kegg.compound: C05897</p> | |
| 15220 <p>PubChem: 8185</p> | |
| 15221 <p>3DMET: B05133</p> | |
| 15222 <p>NIKKAJI: J2.760.323H</p> | |
| 15223 <p>formula: C87H143N7O23P2</p> | |
| 15224 <p>weight: 1717.0469</p> | |
| 15225 </body> | |
| 15226 </notes> | |
| 15227 <annotation> | |
| 15228 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15229 <rdf:Description rdf:about="#f333a9d0-32ad-4b37-8f85-508c25ef8353"> | |
| 15230 <bqbiol:is> | |
| 15231 <rdf:Bag> | |
| 15232 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05897"/> | |
| 15233 <rdf:li rdf:resource="https://identifiers.org/3DMET/B05133"/> | |
| 15234 </rdf:Bag> | |
| 15235 </bqbiol:is> | |
| 15236 </rdf:Description> | |
| 15237 </rdf:RDF> | |
| 15238 </annotation> | |
| 15239 </species> | |
| 15240 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H13O9P" hasOnlySubstanceUnits="false" id="C01177" metaid="f2eaaccb-0799-495d-a63d-ebabbd5ddc07" name="Inositol 1-phosphate" sboTerm="SBO:0000240"> | |
| 15241 <notes> | |
| 15242 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15243 <p>kegg.compound: C01177</p> | |
| 15244 <p>KNApSAcK: C00007483</p> | |
| 15245 <p>PubChem: 4404</p> | |
| 15246 <p>3DMET: B01403</p> | |
| 15247 <p>PDB-CCD: IPD</p> | |
| 15248 <p>ChEBI: 18297</p> | |
| 15249 <p>NIKKAJI: J6.548J</p> | |
| 15250 <p>formula: C6H13O9P</p> | |
| 15251 <p>weight: 260.1358</p> | |
| 15252 </body> | |
| 15253 </notes> | |
| 15254 <annotation> | |
| 15255 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15256 <rdf:Description rdf:about="#f2eaaccb-0799-495d-a63d-ebabbd5ddc07"> | |
| 15257 <bqbiol:is> | |
| 15258 <rdf:Bag> | |
| 15259 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01177"/> | |
| 15260 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007483"/> | |
| 15261 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01403"/> | |
| 15262 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/IPD"/> | |
| 15263 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18297"/> | |
| 15264 </rdf:Bag> | |
| 15265 </bqbiol:is> | |
| 15266 </rdf:Description> | |
| 15267 </rdf:RDF> | |
| 15268 </annotation> | |
| 15269 </species> | |
| 15270 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C95H156N8O28P2" hasOnlySubstanceUnits="false" id="C05898" metaid="d3ae6f5f-8da2-4649-bba3-68f87e09e87e" name="Undecaprenyl-diphospho-N-acetylmuramoyl-(N-acetylglucosamine)-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine" sboTerm="SBO:0000240"> | |
| 15271 <notes> | |
| 15272 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15273 <p>kegg.compound: C05898</p> | |
| 15274 <p>PubChem: 8186</p> | |
| 15275 <p>3DMET: B05134</p> | |
| 15276 <p>ChEBI: 28138</p> | |
| 15277 <p>NIKKAJI: J2.760.508G</p> | |
| 15278 <p>formula: C95H156N8O28P2</p> | |
| 15279 <p>weight: 1920.2395</p> | |
| 15280 </body> | |
| 15281 </notes> | |
| 15282 <annotation> | |
| 15283 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15284 <rdf:Description rdf:about="#d3ae6f5f-8da2-4649-bba3-68f87e09e87e"> | |
| 15285 <bqbiol:is> | |
| 15286 <rdf:Bag> | |
| 15287 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05898"/> | |
| 15288 <rdf:li rdf:resource="https://identifiers.org/3DMET/B05134"/> | |
| 15289 <rdf:li rdf:resource="https://identifiers.org/ChEBI/28138"/> | |
| 15290 </rdf:Bag> | |
| 15291 </bqbiol:is> | |
| 15292 </rdf:Description> | |
| 15293 </rdf:RDF> | |
| 15294 </annotation> | |
| 15295 </species> | |
| 15296 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C14H27O2SR" hasOnlySubstanceUnits="false" id="C04688" metaid="eb4bfd2b-0c08-4a6e-abf8-3b5ce9030023" name="(3R)-3-Hydroxytetradecanoyl-[acyl-carrier protein]" sboTerm="SBO:0000240"> | |
| 15297 <notes> | |
| 15298 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15299 <p>kegg.compound: C04688</p> | |
| 15300 <p>PubChem: 7269</p> | |
| 15301 <p>formula: C14H27O2SR</p> | |
| 15302 </body> | |
| 15303 </notes> | |
| 15304 <annotation> | |
| 15305 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15306 <rdf:Description rdf:about="#eb4bfd2b-0c08-4a6e-abf8-3b5ce9030023"> | |
| 15307 <bqbiol:is> | |
| 15308 <rdf:Bag> | |
| 15309 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04688"/> | |
| 15310 </rdf:Bag> | |
| 15311 </bqbiol:is> | |
| 15312 </rdf:Description> | |
| 15313 </rdf:RDF> | |
| 15314 </annotation> | |
| 15315 </species> | |
| 15316 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H8O4" hasOnlySubstanceUnits="false" id="C01179" metaid="_79a20721-2ee3-4b14-a978-be472a62453f" name="3-(4-Hydroxyphenyl)pyruvate" sboTerm="SBO:0000240"> | |
| 15317 <notes> | |
| 15318 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15319 <p>kegg.compound: C01179</p> | |
| 15320 <p>KNApSAcK: C00007512</p> | |
| 15321 <p>CAS: 156-39-8</p> | |
| 15322 <p>PubChem: 4406</p> | |
| 15323 <p>3DMET: B00254</p> | |
| 15324 <p>PDB-CCD: ENO</p> | |
| 15325 <p>ChEBI: 15999 36242</p> | |
| 15326 <p>NIKKAJI: J101.877I</p> | |
| 15327 <p>formula: C9H8O4</p> | |
| 15328 <p>weight: 180.1574</p> | |
| 15329 </body> | |
| 15330 </notes> | |
| 15331 <annotation> | |
| 15332 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15333 <rdf:Description rdf:about="#_79a20721-2ee3-4b14-a978-be472a62453f"> | |
| 15334 <bqbiol:is> | |
| 15335 <rdf:Bag> | |
| 15336 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01179"/> | |
| 15337 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007512"/> | |
| 15338 <rdf:li rdf:resource="https://identifiers.org/CAS/156-39-8"/> | |
| 15339 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00254"/> | |
| 15340 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/ENO"/> | |
| 15341 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15999 36242"/> | |
| 15342 </rdf:Bag> | |
| 15343 </bqbiol:is> | |
| 15344 </rdf:Description> | |
| 15345 </rdf:RDF> | |
| 15346 </annotation> | |
| 15347 </species> | |
| 15348 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C03127" metaid="_97f18043-f33f-4556-9d2d-c1cf797977a6" name="L-Isoleucyl-tRNA(Ile)" sboTerm="SBO:0000240"> | |
| 15349 <notes> | |
| 15350 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15351 <p>kegg.compound: C03127</p> | |
| 15352 <p>PubChem: 6020</p> | |
| 15353 <p>ChEBI: 29160</p> | |
| 15354 <p>formula: C21H32N6O11PR(C5H8O6PR)n</p> | |
| 15355 </body> | |
| 15356 </notes> | |
| 15357 <annotation> | |
| 15358 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15359 <rdf:Description rdf:about="#_97f18043-f33f-4556-9d2d-c1cf797977a6"> | |
| 15360 <bqbiol:is> | |
| 15361 <rdf:Bag> | |
| 15362 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03127"/> | |
| 15363 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29160"/> | |
| 15364 </rdf:Bag> | |
| 15365 </bqbiol:is> | |
| 15366 </rdf:Description> | |
| 15367 </rdf:RDF> | |
| 15368 </annotation> | |
| 15369 </species> | |
| 15370 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H7NO2" hasOnlySubstanceUnits="false" id="C00099" metaid="be78a34f-adc1-4509-a6f1-efea3e689fa2" name="beta-Alanine" sboTerm="SBO:0000240"> | |
| 15371 <notes> | |
| 15372 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15373 <p>kegg.compound: C00099</p> | |
| 15374 <p>KNApSAcK: C00001333</p> | |
| 15375 <p>CAS: 107-95-9</p> | |
| 15376 <p>PubChem: 3399</p> | |
| 15377 <p>3DMET: B00025</p> | |
| 15378 <p>PDB-CCD: BAL</p> | |
| 15379 <p>ChEBI: 16958</p> | |
| 15380 <p>NIKKAJI: J4.070C</p> | |
| 15381 <p>formula: C3H7NO2</p> | |
| 15382 <p>weight: 89.0932</p> | |
| 15383 </body> | |
| 15384 </notes> | |
| 15385 <annotation> | |
| 15386 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15387 <rdf:Description rdf:about="#be78a34f-adc1-4509-a6f1-efea3e689fa2"> | |
| 15388 <bqbiol:is> | |
| 15389 <rdf:Bag> | |
| 15390 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00099"/> | |
| 15391 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001333"/> | |
| 15392 <rdf:li rdf:resource="https://identifiers.org/CAS/107-95-9"/> | |
| 15393 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00025"/> | |
| 15394 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/BAL"/> | |
| 15395 <rdf:li rdf:resource="https://identifiers.org/ChEBI/16958"/> | |
| 15396 </rdf:Bag> | |
| 15397 </bqbiol:is> | |
| 15398 </rdf:Description> | |
| 15399 </rdf:RDF> | |
| 15400 </annotation> | |
| 15401 </species> | |
| 15402 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H7NO2S" hasOnlySubstanceUnits="false" id="C00097" metaid="_9917a819-3394-4802-a572-f8c2369b14a8" name="L-Cysteine" sboTerm="SBO:0000240"> | |
| 15403 <notes> | |
| 15404 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15405 <p>kegg.compound: C00097</p> | |
| 15406 <p>KNApSAcK: C00001351</p> | |
| 15407 <p>CAS: 52-90-4</p> | |
| 15408 <p>PubChem: 3397</p> | |
| 15409 <p>3DMET: B01159</p> | |
| 15410 <p>PDB-CCD: CYS</p> | |
| 15411 <p>ChEBI: 17561</p> | |
| 15412 <p>NIKKAJI: J9.167G</p> | |
| 15413 <p>formula: C3H7NO2S</p> | |
| 15414 <p>weight: 121.1582</p> | |
| 15415 </body> | |
| 15416 </notes> | |
| 15417 <annotation> | |
| 15418 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15419 <rdf:Description rdf:about="#_9917a819-3394-4802-a572-f8c2369b14a8"> | |
| 15420 <bqbiol:is> | |
| 15421 <rdf:Bag> | |
| 15422 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00097"/> | |
| 15423 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00001351"/> | |
| 15424 <rdf:li rdf:resource="https://identifiers.org/CAS/52-90-4"/> | |
| 15425 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01159"/> | |
| 15426 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/CYS"/> | |
| 15427 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17561"/> | |
| 15428 </rdf:Bag> | |
| 15429 </bqbiol:is> | |
| 15430 </rdf:Description> | |
| 15431 </rdf:RDF> | |
| 15432 </annotation> | |
| 15433 </species> | |
| 15434 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="H2SO3" hasOnlySubstanceUnits="false" id="C00094" metaid="_57562170-02ab-4144-80b1-8e78153b62ec" name="Sulfite" sboTerm="SBO:0000240"> | |
| 15435 <notes> | |
| 15436 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15437 <p>kegg.compound: C00094</p> | |
| 15438 <p>PubChem: 3394</p> | |
| 15439 <p>3DMET: B00024</p> | |
| 15440 <p>PDB-CCD: SO3</p> | |
| 15441 <p>ChEBI: 48854</p> | |
| 15442 <p>NIKKAJI: J54.364K</p> | |
| 15443 <p>formula: H2SO3</p> | |
| 15444 <p>weight: 82.0791</p> | |
| 15445 </body> | |
| 15446 </notes> | |
| 15447 <annotation> | |
| 15448 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15449 <rdf:Description rdf:about="#_57562170-02ab-4144-80b1-8e78153b62ec"> | |
| 15450 <bqbiol:is> | |
| 15451 <rdf:Bag> | |
| 15452 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00094"/> | |
| 15453 <rdf:li rdf:resource="https://identifiers.org/3DMET/B00024"/> | |
| 15454 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/SO3"/> | |
| 15455 <rdf:li rdf:resource="https://identifiers.org/ChEBI/48854"/> | |
| 15456 </rdf:Bag> | |
| 15457 </bqbiol:is> | |
| 15458 </rdf:Description> | |
| 15459 </rdf:RDF> | |
| 15460 </annotation> | |
| 15461 </species> | |
| 15462 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H13O9P" hasOnlySubstanceUnits="false" id="C00092" metaid="d8be6b94-2976-408c-a595-0b49c54f8dc8" name="D-Glucose 6-phosphate" sboTerm="SBO:0000240"> | |
| 15463 <notes> | |
| 15464 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15465 <p>kegg.compound: C00092</p> | |
| 15466 <p>KNApSAcK: C00007306</p> | |
| 15467 <p>CAS: 56-73-5</p> | |
| 15468 <p>PubChem: 3392</p> | |
| 15469 <p>3DMET: B04630</p> | |
| 15470 <p>PDB-CCD: BG6 G6P</p> | |
| 15471 <p>ChEBI: 4170</p> | |
| 15472 <p>NIKKAJI: J166.116G J40.066A</p> | |
| 15473 <p>formula: C6H13O9P</p> | |
| 15474 <p>weight: 260.1358</p> | |
| 15475 </body> | |
| 15476 </notes> | |
| 15477 <annotation> | |
| 15478 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15479 <rdf:Description rdf:about="#d8be6b94-2976-408c-a595-0b49c54f8dc8"> | |
| 15480 <bqbiol:is> | |
| 15481 <rdf:Bag> | |
| 15482 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00092"/> | |
| 15483 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007306"/> | |
| 15484 <rdf:li rdf:resource="https://identifiers.org/CAS/56-73-5"/> | |
| 15485 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04630"/> | |
| 15486 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/BG6 G6P"/> | |
| 15487 <rdf:li rdf:resource="https://identifiers.org/ChEBI/4170"/> | |
| 15488 </rdf:Bag> | |
| 15489 </bqbiol:is> | |
| 15490 </rdf:Description> | |
| 15491 </rdf:RDF> | |
| 15492 </annotation> | |
| 15493 </species> | |
| 15494 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C25H40N7O19P3S" hasOnlySubstanceUnits="false" id="C00091" metaid="_97443f30-c4e2-46c5-827a-56de320b1504" name="Succinyl-CoA" sboTerm="SBO:0000240"> | |
| 15495 <notes> | |
| 15496 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15497 <p>kegg.compound: C00091</p> | |
| 15498 <p>KNApSAcK: C00019546</p> | |
| 15499 <p>CAS: 604-98-8</p> | |
| 15500 <p>PubChem: 3391</p> | |
| 15501 <p>3DMET: B04629</p> | |
| 15502 <p>PDB-CCD: SCA</p> | |
| 15503 <p>ChEBI: 15380</p> | |
| 15504 <p>LIPIDMAPS: LMFA07050370</p> | |
| 15505 <p>NIKKAJI: J252.493G</p> | |
| 15506 <p>formula: C25H40N7O19P3S</p> | |
| 15507 <p>weight: 867.6069</p> | |
| 15508 </body> | |
| 15509 </notes> | |
| 15510 <annotation> | |
| 15511 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15512 <rdf:Description rdf:about="#_97443f30-c4e2-46c5-827a-56de320b1504"> | |
| 15513 <bqbiol:is> | |
| 15514 <rdf:Bag> | |
| 15515 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00091"/> | |
| 15516 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019546"/> | |
| 15517 <rdf:li rdf:resource="https://identifiers.org/CAS/604-98-8"/> | |
| 15518 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04629"/> | |
| 15519 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/SCA"/> | |
| 15520 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15380"/> | |
| 15521 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMFA07050370"/> | |
| 15522 </rdf:Bag> | |
| 15523 </bqbiol:is> | |
| 15524 </rdf:Description> | |
| 15525 </rdf:RDF> | |
| 15526 </annotation> | |
| 15527 </species> | |
| 15528 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H13O10P" hasOnlySubstanceUnits="false" id="C04691" metaid="_6315a6ef-e406-4ede-84d9-fdd2d38f99e9" name="2-Dehydro-3-deoxy-D-arabino-heptonate 7-phosphate" sboTerm="SBO:0000240"> | |
| 15529 <notes> | |
| 15530 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15531 <p>kegg.compound: C04691</p> | |
| 15532 <p>KNApSAcK: C00007497</p> | |
| 15533 <p>CAS: 2627-73-8</p> | |
| 15534 <p>PubChem: 7271</p> | |
| 15535 <p>3DMET: B01776</p> | |
| 15536 <p>ChEBI: 18150</p> | |
| 15537 <p>NIKKAJI: J1.124.411D</p> | |
| 15538 <p>formula: C7H13O10P</p> | |
| 15539 <p>weight: 288.1459</p> | |
| 15540 </body> | |
| 15541 </notes> | |
| 15542 <annotation> | |
| 15543 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15544 <rdf:Description rdf:about="#_6315a6ef-e406-4ede-84d9-fdd2d38f99e9"> | |
| 15545 <bqbiol:is> | |
| 15546 <rdf:Bag> | |
| 15547 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04691"/> | |
| 15548 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007497"/> | |
| 15549 <rdf:li rdf:resource="https://identifiers.org/CAS/2627-73-8"/> | |
| 15550 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01776"/> | |
| 15551 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18150"/> | |
| 15552 </rdf:Bag> | |
| 15553 </bqbiol:is> | |
| 15554 </rdf:Description> | |
| 15555 </rdf:RDF> | |
| 15556 </annotation> | |
| 15557 </species> | |
| 15558 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C11H15NO9P" hasOnlySubstanceUnits="false" id="C01185" metaid="_9e52da50-c478-45fd-841d-f8226d86a2b4" name="Nicotinate D-ribonucleotide" sboTerm="SBO:0000240"> | |
| 15559 <notes> | |
| 15560 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15561 <p>kegg.compound: C01185</p> | |
| 15562 <p>KNApSAcK: C00007447</p> | |
| 15563 <p>PubChem: 4411</p> | |
| 15564 <p>3DMET: B01404</p> | |
| 15565 <p>PDB-CCD: NCN</p> | |
| 15566 <p>ChEBI: 15763</p> | |
| 15567 <p>NIKKAJI: J1.028.429E</p> | |
| 15568 <p>formula: C11H15NO9P</p> | |
| 15569 <p>weight: 336.2119</p> | |
| 15570 </body> | |
| 15571 </notes> | |
| 15572 <annotation> | |
| 15573 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15574 <rdf:Description rdf:about="#_9e52da50-c478-45fd-841d-f8226d86a2b4"> | |
| 15575 <bqbiol:is> | |
| 15576 <rdf:Bag> | |
| 15577 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01185"/> | |
| 15578 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00007447"/> | |
| 15579 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01404"/> | |
| 15580 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/NCN"/> | |
| 15581 <rdf:li rdf:resource="https://identifiers.org/ChEBI/15763"/> | |
| 15582 </rdf:Bag> | |
| 15583 </bqbiol:is> | |
| 15584 </rdf:Description> | |
| 15585 </rdf:RDF> | |
| 15586 </annotation> | |
| 15587 </species> | |
| 15588 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C55H92O7P2" hasOnlySubstanceUnits="false" id="C04574" metaid="_7cc53b32-0430-40ff-a183-9247ee2be63d" name="di-trans,poly-cis-Undecaprenyl diphosphate" sboTerm="SBO:0000240"> | |
| 15589 <notes> | |
| 15590 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15591 <p>kegg.compound: C04574</p> | |
| 15592 <p>PubChem: 7175</p> | |
| 15593 <p>3DMET: B01759</p> | |
| 15594 <p>ChEBI: 18197</p> | |
| 15595 <p>LIPIDMAPS: LMPR03030008</p> | |
| 15596 <p>LipidBank: IIP0027</p> | |
| 15597 <p>NIKKAJI: J1.283.781J</p> | |
| 15598 <p>formula: C55H92O7P2</p> | |
| 15599 <p>weight: 927.2623</p> | |
| 15600 </body> | |
| 15601 </notes> | |
| 15602 <annotation> | |
| 15603 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15604 <rdf:Description rdf:about="#_7cc53b32-0430-40ff-a183-9247ee2be63d"> | |
| 15605 <bqbiol:is> | |
| 15606 <rdf:Bag> | |
| 15607 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04574"/> | |
| 15608 <rdf:li rdf:resource="https://identifiers.org/3DMET/B01759"/> | |
| 15609 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18197"/> | |
| 15610 <rdf:li rdf:resource="https://identifiers.org/LIPIDMAPS/LMPR03030008"/> | |
| 15611 <rdf:li rdf:resource="https://identifiers.org/LipidBank/IIP0027"/> | |
| 15612 </rdf:Bag> | |
| 15613 </bqbiol:is> | |
| 15614 </rdf:Description> | |
| 15615 </rdf:RDF> | |
| 15616 </annotation> | |
| 15617 </species> | |
| 15618 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C13H18N4O6" hasOnlySubstanceUnits="false" id="C04332" metaid="_63de7cb2-58b8-4f87-9b9c-38f09154530f" name="6,7-Dimethyl-8-(D-ribityl)lumazine" sboTerm="SBO:0000240"> | |
| 15619 <notes> | |
| 15620 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15621 <p>kegg.compound: C04332</p> | |
| 15622 <p>KNApSAcK: C00019640</p> | |
| 15623 <p>CAS: 5118-16-1</p> | |
| 15624 <p>PubChem: 6983</p> | |
| 15625 <p>3DMET: B04936</p> | |
| 15626 <p>PDB-CCD: DLZ</p> | |
| 15627 <p>ChEBI: 17601</p> | |
| 15628 <p>NIKKAJI: J643.571H</p> | |
| 15629 <p>formula: C13H18N4O6</p> | |
| 15630 <p>weight: 326.3052</p> | |
| 15631 </body> | |
| 15632 </notes> | |
| 15633 <annotation> | |
| 15634 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15635 <rdf:Description rdf:about="#_63de7cb2-58b8-4f87-9b9c-38f09154530f"> | |
| 15636 <bqbiol:is> | |
| 15637 <rdf:Bag> | |
| 15638 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04332"/> | |
| 15639 <rdf:li rdf:resource="https://identifiers.org/KNApSAcK/C00019640"/> | |
| 15640 <rdf:li rdf:resource="https://identifiers.org/CAS/5118-16-1"/> | |
| 15641 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04936"/> | |
| 15642 <rdf:li rdf:resource="https://identifiers.org/PDB-CCD/DLZ"/> | |
| 15643 <rdf:li rdf:resource="https://identifiers.org/ChEBI/17601"/> | |
| 15644 </rdf:Bag> | |
| 15645 </bqbiol:is> | |
| 15646 </rdf:Description> | |
| 15647 </rdf:RDF> | |
| 15648 </annotation> | |
| 15649 </species> | |
| 15650 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H17N4O9P" hasOnlySubstanceUnits="false" id="C04454" metaid="f220bfdb-e712-4d4b-a91e-62fa09e1e342" name="5-Amino-6-(5'-phospho-D-ribitylamino)uracil" sboTerm="SBO:0000240"> | |
| 15651 <notes> | |
| 15652 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15653 <p>kegg.compound: C04454</p> | |
| 15654 <p>PubChem: 7081</p> | |
| 15655 <p>3DMET: B04942</p> | |
| 15656 <p>ChEBI: 18247</p> | |
| 15657 <p>NIKKAJI: J1.722.458A</p> | |
| 15658 <p>formula: C9H17N4O9P</p> | |
| 15659 <p>weight: 356.2264</p> | |
| 15660 </body> | |
| 15661 </notes> | |
| 15662 <annotation> | |
| 15663 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15664 <rdf:Description rdf:about="#f220bfdb-e712-4d4b-a91e-62fa09e1e342"> | |
| 15665 <bqbiol:is> | |
| 15666 <rdf:Bag> | |
| 15667 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C04454"/> | |
| 15668 <rdf:li rdf:resource="https://identifiers.org/3DMET/B04942"/> | |
| 15669 <rdf:li rdf:resource="https://identifiers.org/ChEBI/18247"/> | |
| 15670 </rdf:Bag> | |
| 15671 </bqbiol:is> | |
| 15672 </rdf:Description> | |
| 15673 </rdf:RDF> | |
| 15674 </annotation> | |
| 15675 </species> | |
| 15676 <species boundaryCondition="false" compartment="default" constant="false" fbc:charge="0" hasOnlySubstanceUnits="false" id="C03125" metaid="_6b20f2e9-a0e9-439f-b302-dd1895c3ffa3" name="L-Cysteinyl-tRNA(Cys)" sboTerm="SBO:0000240"> | |
| 15677 <notes> | |
| 15678 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15679 <p>kegg.compound: C03125</p> | |
| 15680 <p>PubChem: 6018</p> | |
| 15681 <p>ChEBI: 29152</p> | |
| 15682 <p>formula: C18H26N6O11PSR(C5H8O6PR)n</p> | |
| 15683 </body> | |
| 15684 </notes> | |
| 15685 <annotation> | |
| 15686 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15687 <rdf:Description rdf:about="#_6b20f2e9-a0e9-439f-b302-dd1895c3ffa3"> | |
| 15688 <bqbiol:is> | |
| 15689 <rdf:Bag> | |
| 15690 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03125"/> | |
| 15691 <rdf:li rdf:resource="https://identifiers.org/ChEBI/29152"/> | |
| 15692 </rdf:Bag> | |
| 15693 </bqbiol:is> | |
| 15694 </rdf:Description> | |
| 15695 </rdf:RDF> | |
| 15696 </annotation> | |
| 15697 </species> | |
| 15698 </listOfSpecies> | |
| 15699 <listOfParameters> | |
| 15700 <parameter constant="true" id="UPPER_BOUND_99999_0" units="mmol_per_gDW_per_hr" value="99999"/> | |
| 15701 <parameter constant="true" id="LOWER_BOUND_0_0" units="mmol_per_gDW_per_hr" value="0"/> | |
| 15702 <parameter constant="true" id="LOWER_BOUND_99999_0" units="mmol_per_gDW_per_hr" value="-99999"/> | |
| 15703 </listOfParameters> | |
| 15704 <listOfReactions> | |
| 15705 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04929" metaid="f5f80fe6-f246-4adf-9291-6164c5c06ef9" name="ATP:selenate adenylyltransferase" reversible="false"> | |
| 15706 <notes> | |
| 15707 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15708 <p>SUBSYSTEM: Selenocompound metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 15709 <p>EC_NUMBER: 2.7.7.4</p> | |
| 15710 <p>GENE_ASSOCIATION: ( buc_BU423 ) OR ( buc_BU424 )</p> | |
| 15711 </body> | |
| 15712 </notes> | |
| 15713 <annotation> | |
| 15714 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15715 <rdf:Description rdf:about="#f5f80fe6-f246-4adf-9291-6164c5c06ef9"> | |
| 15716 <bqbiol:is> | |
| 15717 <rdf:Bag> | |
| 15718 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.7.4"/> | |
| 15719 </rdf:Bag> | |
| 15720 </bqbiol:is> | |
| 15721 </rdf:Description> | |
| 15722 </rdf:RDF> | |
| 15723 </annotation> | |
| 15724 <fbc:geneProductAssociation> | |
| 15725 <fbc:or> | |
| 15726 <fbc:geneProductRef fbc:geneProduct="buc_BU423"/> | |
| 15727 <fbc:geneProductRef fbc:geneProduct="buc_BU424"/> | |
| 15728 </fbc:or> | |
| 15729 </fbc:geneProductAssociation> | |
| 15730 <listOfReactants> | |
| 15731 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 15732 <speciesReference constant="true" species="C05697" stoichiometry="1"/> | |
| 15733 </listOfReactants> | |
| 15734 <listOfProducts> | |
| 15735 <speciesReference constant="true" species="C05686" stoichiometry="1"/> | |
| 15736 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 15737 </listOfProducts> | |
| 15738 </reaction> | |
| 15739 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00209" metaid="_4afe6965-22ce-4e04-aa52-991df80f3d00" name="pyruvate:NAD+ 2-oxidoreductase (CoA-acetylating)" reversible="true"> | |
| 15740 <notes> | |
| 15741 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15742 <p>SUBSYSTEM: Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 15743 <p>GENE_ASSOCIATION: ( buc_BU205 ) OR ( buc_BU206 ) OR ( buc_BU207 )</p> | |
| 15744 </body> | |
| 15745 </notes> | |
| 15746 <fbc:geneProductAssociation> | |
| 15747 <fbc:or> | |
| 15748 <fbc:geneProductRef fbc:geneProduct="buc_BU206"/> | |
| 15749 <fbc:geneProductRef fbc:geneProduct="buc_BU207"/> | |
| 15750 <fbc:geneProductRef fbc:geneProduct="buc_BU205"/> | |
| 15751 </fbc:or> | |
| 15752 </fbc:geneProductAssociation> | |
| 15753 <listOfReactants> | |
| 15754 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 15755 <speciesReference constant="true" species="C00022" stoichiometry="1"/> | |
| 15756 <speciesReference constant="true" species="C00010" stoichiometry="1"/> | |
| 15757 </listOfReactants> | |
| 15758 <listOfProducts> | |
| 15759 <speciesReference constant="true" species="C00024" stoichiometry="1"/> | |
| 15760 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 15761 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 15762 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 15763 </listOfProducts> | |
| 15764 </reaction> | |
| 15765 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02749" metaid="ef8a999f-f905-4438-8ca6-a8ac08349be2" name="2-deoxy-D-ribose 1-phosphate 1,5-phosphomutase" reversible="true"> | |
| 15766 <notes> | |
| 15767 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15768 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pentose phosphate pathway - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 15769 <p>EC_NUMBER: 5.4.2.7</p> | |
| 15770 <p>GENE_ASSOCIATION: buc_BU542</p> | |
| 15771 </body> | |
| 15772 </notes> | |
| 15773 <annotation> | |
| 15774 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15775 <rdf:Description rdf:about="#ef8a999f-f905-4438-8ca6-a8ac08349be2"> | |
| 15776 <bqbiol:is> | |
| 15777 <rdf:Bag> | |
| 15778 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.4.2.7"/> | |
| 15779 </rdf:Bag> | |
| 15780 </bqbiol:is> | |
| 15781 </rdf:Description> | |
| 15782 </rdf:RDF> | |
| 15783 </annotation> | |
| 15784 <fbc:geneProductAssociation> | |
| 15785 <fbc:geneProductRef fbc:geneProduct="buc_BU542"/> | |
| 15786 </fbc:geneProductAssociation> | |
| 15787 <listOfReactants> | |
| 15788 <speciesReference constant="true" species="C00672" stoichiometry="1"/> | |
| 15789 </listOfReactants> | |
| 15790 <listOfProducts> | |
| 15791 <speciesReference constant="true" species="C00673" stoichiometry="1"/> | |
| 15792 </listOfProducts> | |
| 15793 </reaction> | |
| 15794 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00200" metaid="c7b80ac8-e43a-4e62-a75d-aa395640574d" name="ATP:pyruvate 2-O-phosphotransferase" reversible="true"> | |
| 15795 <notes> | |
| 15796 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15797 <p>SUBSYSTEM: Pyruvate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glycolysis / Gluconeogenesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 15798 <p>EC_NUMBER: 2.7.1.40</p> | |
| 15799 <p>GENE_ASSOCIATION: buc_BU319</p> | |
| 15800 </body> | |
| 15801 </notes> | |
| 15802 <annotation> | |
| 15803 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15804 <rdf:Description rdf:about="#c7b80ac8-e43a-4e62-a75d-aa395640574d"> | |
| 15805 <bqbiol:is> | |
| 15806 <rdf:Bag> | |
| 15807 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.40"/> | |
| 15808 </rdf:Bag> | |
| 15809 </bqbiol:is> | |
| 15810 </rdf:Description> | |
| 15811 </rdf:RDF> | |
| 15812 </annotation> | |
| 15813 <fbc:geneProductAssociation> | |
| 15814 <fbc:geneProductRef fbc:geneProduct="buc_BU319"/> | |
| 15815 </fbc:geneProductAssociation> | |
| 15816 <listOfReactants> | |
| 15817 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 15818 <speciesReference constant="true" species="C00022" stoichiometry="1"/> | |
| 15819 </listOfReactants> | |
| 15820 <listOfProducts> | |
| 15821 <speciesReference constant="true" species="C00074" stoichiometry="1"/> | |
| 15822 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 15823 </listOfProducts> | |
| 15824 </reaction> | |
| 15825 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01773" metaid="ec0b73ec-46b0-4598-a14a-f75a1862dbfa" name="L-Homoserine:NAD+ oxidoreductase" reversible="true"> | |
| 15826 <notes> | |
| 15827 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15828 <p>SUBSYSTEM: Lysine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glycine, serine and threonine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Cysteine and methionine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 15829 <p>EC_NUMBER: 1.1.1.3</p> | |
| 15830 <p>GENE_ASSOCIATION: buc_BU194</p> | |
| 15831 </body> | |
| 15832 </notes> | |
| 15833 <annotation> | |
| 15834 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15835 <rdf:Description rdf:about="#ec0b73ec-46b0-4598-a14a-f75a1862dbfa"> | |
| 15836 <bqbiol:is> | |
| 15837 <rdf:Bag> | |
| 15838 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.3"/> | |
| 15839 </rdf:Bag> | |
| 15840 </bqbiol:is> | |
| 15841 </rdf:Description> | |
| 15842 </rdf:RDF> | |
| 15843 </annotation> | |
| 15844 <fbc:geneProductAssociation> | |
| 15845 <fbc:geneProductRef fbc:geneProduct="buc_BU194"/> | |
| 15846 </fbc:geneProductAssociation> | |
| 15847 <listOfReactants> | |
| 15848 <speciesReference constant="true" species="C00263" stoichiometry="1"/> | |
| 15849 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 15850 </listOfReactants> | |
| 15851 <listOfProducts> | |
| 15852 <speciesReference constant="true" species="C00441" stoichiometry="1"/> | |
| 15853 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 15854 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 15855 </listOfProducts> | |
| 15856 </reaction> | |
| 15857 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01652" metaid="c6023841-3f83-45fa-9e73-f3d27b4b5b47" name="R01652" reversible="false"> | |
| 15858 <notes> | |
| 15859 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15860 <p>SUBSYSTEM: 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 15861 <p>EC_NUMBER: 1.1.1.85</p> | |
| 15862 <p>GENE_ASSOCIATION: buc_BUpL05</p> | |
| 15863 </body> | |
| 15864 </notes> | |
| 15865 <annotation> | |
| 15866 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15867 <rdf:Description rdf:about="#c6023841-3f83-45fa-9e73-f3d27b4b5b47"> | |
| 15868 <bqbiol:is> | |
| 15869 <rdf:Bag> | |
| 15870 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.85"/> | |
| 15871 </rdf:Bag> | |
| 15872 </bqbiol:is> | |
| 15873 </rdf:Description> | |
| 15874 </rdf:RDF> | |
| 15875 </annotation> | |
| 15876 <fbc:geneProductAssociation> | |
| 15877 <fbc:geneProductRef fbc:geneProduct="buc_BUpL05"/> | |
| 15878 </fbc:geneProductAssociation> | |
| 15879 <listOfReactants> | |
| 15880 <speciesReference constant="true" species="C00233" stoichiometry="1"/> | |
| 15881 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 15882 </listOfReactants> | |
| 15883 <listOfProducts> | |
| 15884 <speciesReference constant="true" species="C04236" stoichiometry="1"/> | |
| 15885 </listOfProducts> | |
| 15886 </reaction> | |
| 15887 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01775" metaid="d8c183a2-e2a6-49d7-8880-eda67772ae83" name="L-homoserine:NADP+ oxidoreductase" reversible="true"> | |
| 15888 <notes> | |
| 15889 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15890 <p>SUBSYSTEM: Lysine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glycine, serine and threonine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Cysteine and methionine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 15891 <p>EC_NUMBER: 1.1.1.3</p> | |
| 15892 <p>GENE_ASSOCIATION: buc_BU194</p> | |
| 15893 </body> | |
| 15894 </notes> | |
| 15895 <annotation> | |
| 15896 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15897 <rdf:Description rdf:about="#d8c183a2-e2a6-49d7-8880-eda67772ae83"> | |
| 15898 <bqbiol:is> | |
| 15899 <rdf:Bag> | |
| 15900 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.3"/> | |
| 15901 </rdf:Bag> | |
| 15902 </bqbiol:is> | |
| 15903 </rdf:Description> | |
| 15904 </rdf:RDF> | |
| 15905 </annotation> | |
| 15906 <fbc:geneProductAssociation> | |
| 15907 <fbc:geneProductRef fbc:geneProduct="buc_BU194"/> | |
| 15908 </fbc:geneProductAssociation> | |
| 15909 <listOfReactants> | |
| 15910 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 15911 <speciesReference constant="true" species="C00263" stoichiometry="1"/> | |
| 15912 </listOfReactants> | |
| 15913 <listOfProducts> | |
| 15914 <speciesReference constant="true" species="C00441" stoichiometry="1"/> | |
| 15915 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 15916 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 15917 </listOfProducts> | |
| 15918 </reaction> | |
| 15919 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01655" metaid="b40fd82d-d087-4fca-bfe2-1e4dea44b2d0" name="5,10-Methenyltetrahydrofolate 5-hydrolase (decyclizing)" reversible="true"> | |
| 15920 <notes> | |
| 15921 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15922 <p>SUBSYSTEM: Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || One carbon pool by folate - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 15923 <p>EC_NUMBER: 3.5.4.9</p> | |
| 15924 <p>GENE_ASSOCIATION: buc_BU486</p> | |
| 15925 </body> | |
| 15926 </notes> | |
| 15927 <annotation> | |
| 15928 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15929 <rdf:Description rdf:about="#b40fd82d-d087-4fca-bfe2-1e4dea44b2d0"> | |
| 15930 <bqbiol:is> | |
| 15931 <rdf:Bag> | |
| 15932 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.5.4.9"/> | |
| 15933 </rdf:Bag> | |
| 15934 </bqbiol:is> | |
| 15935 </rdf:Description> | |
| 15936 </rdf:RDF> | |
| 15937 </annotation> | |
| 15938 <fbc:geneProductAssociation> | |
| 15939 <fbc:geneProductRef fbc:geneProduct="buc_BU486"/> | |
| 15940 </fbc:geneProductAssociation> | |
| 15941 <listOfReactants> | |
| 15942 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 15943 <speciesReference constant="true" species="C00445" stoichiometry="1"/> | |
| 15944 </listOfReactants> | |
| 15945 <listOfProducts> | |
| 15946 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 15947 <speciesReference constant="true" species="C00234" stoichiometry="1"/> | |
| 15948 </listOfProducts> | |
| 15949 </reaction> | |
| 15950 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02864" metaid="bcd40531-ad37-402b-b70c-6285e30c34ab" name="S-Adenosyl-L-methionine:uroporphyrin-III C-methyltransferase" reversible="true"> | |
| 15951 <notes> | |
| 15952 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15953 <p>SUBSYSTEM: Porphyrin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 15954 <p>EC_NUMBER: 4.99.1.4</p> | |
| 15955 <p>GENE_ASSOCIATION: buc_BU425</p> | |
| 15956 </body> | |
| 15957 </notes> | |
| 15958 <annotation> | |
| 15959 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 15960 <rdf:Description rdf:about="#bcd40531-ad37-402b-b70c-6285e30c34ab"> | |
| 15961 <bqbiol:is> | |
| 15962 <rdf:Bag> | |
| 15963 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.99.1.4"/> | |
| 15964 </rdf:Bag> | |
| 15965 </bqbiol:is> | |
| 15966 </rdf:Description> | |
| 15967 </rdf:RDF> | |
| 15968 </annotation> | |
| 15969 <fbc:geneProductAssociation> | |
| 15970 <fbc:geneProductRef fbc:geneProduct="buc_BU425"/> | |
| 15971 </fbc:geneProductAssociation> | |
| 15972 <listOfReactants> | |
| 15973 <speciesReference constant="true" species="C00748" stoichiometry="1"/> | |
| 15974 <speciesReference constant="true" species="C00080" stoichiometry="2"/> | |
| 15975 </listOfReactants> | |
| 15976 <listOfProducts> | |
| 15977 <speciesReference constant="true" species="C14818" stoichiometry="1"/> | |
| 15978 <speciesReference constant="true" species="C05778" stoichiometry="1"/> | |
| 15979 </listOfProducts> | |
| 15980 </reaction> | |
| 15981 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00688" metaid="f22a3db8-7d6c-46c2-8dae-929253bdedc9" name="L-phenylalanine:NAD+ oxidoreductase (deaminating)" reversible="true"> | |
| 15982 <notes> | |
| 15983 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 15984 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 15985 <p>GENE_ASSOCIATION: buc_BU101</p> | |
| 15986 </body> | |
| 15987 </notes> | |
| 15988 <fbc:geneProductAssociation> | |
| 15989 <fbc:geneProductRef fbc:geneProduct="buc_BU101"/> | |
| 15990 </fbc:geneProductAssociation> | |
| 15991 <listOfReactants> | |
| 15992 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 15993 <speciesReference constant="true" species="C00079" stoichiometry="1"/> | |
| 15994 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 15995 </listOfReactants> | |
| 15996 <listOfProducts> | |
| 15997 <speciesReference constant="true" species="C00166" stoichiometry="1"/> | |
| 15998 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 15999 <speciesReference constant="true" species="C00014" stoichiometry="1"/> | |
| 16000 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 16001 </listOfProducts> | |
| 16002 </reaction> | |
| 16003 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00689" metaid="_7938bee4-73ac-49fe-94b6-282ff413620a" name="L-Phenylalanine:oxygen oxidoreductase (deaminating)" reversible="true"> | |
| 16004 <notes> | |
| 16005 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16006 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16007 <p>GENE_ASSOCIATION: buc_BU101</p> | |
| 16008 </body> | |
| 16009 </notes> | |
| 16010 <fbc:geneProductAssociation> | |
| 16011 <fbc:geneProductRef fbc:geneProduct="buc_BU101"/> | |
| 16012 </fbc:geneProductAssociation> | |
| 16013 <listOfReactants> | |
| 16014 <speciesReference constant="true" species="C00007" stoichiometry="1"/> | |
| 16015 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 16016 <speciesReference constant="true" species="C00079" stoichiometry="1"/> | |
| 16017 </listOfReactants> | |
| 16018 <listOfProducts> | |
| 16019 <speciesReference constant="true" species="C00166" stoichiometry="1"/> | |
| 16020 <speciesReference constant="true" species="C00014" stoichiometry="1"/> | |
| 16021 <speciesReference constant="true" species="C00027" stoichiometry="1"/> | |
| 16022 </listOfProducts> | |
| 16023 </reaction> | |
| 16024 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02748" metaid="fdc39e9d-fb53-47f8-a291-7c02e39a62d4" name="Deoxyinosine:orthophosphate ribosyltransferase" reversible="true"> | |
| 16025 <notes> | |
| 16026 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16027 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16028 <p>EC_NUMBER: 2.4.2.1</p> | |
| 16029 <p>GENE_ASSOCIATION: buc_BU541</p> | |
| 16030 </body> | |
| 16031 </notes> | |
| 16032 <annotation> | |
| 16033 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16034 <rdf:Description rdf:about="#fdc39e9d-fb53-47f8-a291-7c02e39a62d4"> | |
| 16035 <bqbiol:is> | |
| 16036 <rdf:Bag> | |
| 16037 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.4.2.1"/> | |
| 16038 </rdf:Bag> | |
| 16039 </bqbiol:is> | |
| 16040 </rdf:Description> | |
| 16041 </rdf:RDF> | |
| 16042 </annotation> | |
| 16043 <fbc:geneProductAssociation> | |
| 16044 <fbc:geneProductRef fbc:geneProduct="buc_BU541"/> | |
| 16045 </fbc:geneProductAssociation> | |
| 16046 <listOfReactants> | |
| 16047 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 16048 <speciesReference constant="true" species="C05512" stoichiometry="1"/> | |
| 16049 </listOfReactants> | |
| 16050 <listOfProducts> | |
| 16051 <speciesReference constant="true" species="C00262" stoichiometry="1"/> | |
| 16052 <speciesReference constant="true" species="C00672" stoichiometry="1"/> | |
| 16053 </listOfProducts> | |
| 16054 </reaction> | |
| 16055 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00206" metaid="_56e26dfa-2825-4548-92f5-113e87568d23" name="ATP:pyruvate,phosphate phosphotransferase" reversible="true"> | |
| 16056 <notes> | |
| 16057 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16058 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16059 <p>GENE_ASSOCIATION: buc_BU319</p> | |
| 16060 </body> | |
| 16061 </notes> | |
| 16062 <fbc:geneProductAssociation> | |
| 16063 <fbc:geneProductRef fbc:geneProduct="buc_BU319"/> | |
| 16064 </fbc:geneProductAssociation> | |
| 16065 <listOfReactants> | |
| 16066 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 16067 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 16068 <speciesReference constant="true" species="C00022" stoichiometry="1"/> | |
| 16069 </listOfReactants> | |
| 16070 <listOfProducts> | |
| 16071 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 16072 <speciesReference constant="true" species="C00074" stoichiometry="1"/> | |
| 16073 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 16074 </listOfProducts> | |
| 16075 </reaction> | |
| 16076 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01658" metaid="_68799231-0925-4cd4-a4ff-1ba3d159d5d1" name="Dimethylallyl-diphosphate:isopentenyl-diphosphate dimethylallyltranstransferase" reversible="true"> | |
| 16077 <notes> | |
| 16078 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16079 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Terpenoid backbone biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16080 <p>EC_NUMBER: 2.5.1.1</p> | |
| 16081 <p>GENE_ASSOCIATION: buc_BU465</p> | |
| 16082 </body> | |
| 16083 </notes> | |
| 16084 <annotation> | |
| 16085 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16086 <rdf:Description rdf:about="#_68799231-0925-4cd4-a4ff-1ba3d159d5d1"> | |
| 16087 <bqbiol:is> | |
| 16088 <rdf:Bag> | |
| 16089 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.5.1.1"/> | |
| 16090 </rdf:Bag> | |
| 16091 </bqbiol:is> | |
| 16092 </rdf:Description> | |
| 16093 </rdf:RDF> | |
| 16094 </annotation> | |
| 16095 <fbc:geneProductAssociation> | |
| 16096 <fbc:geneProductRef fbc:geneProduct="buc_BU465"/> | |
| 16097 </fbc:geneProductAssociation> | |
| 16098 <listOfReactants> | |
| 16099 <speciesReference constant="true" species="C00129" stoichiometry="1"/> | |
| 16100 <speciesReference constant="true" species="C00235" stoichiometry="1"/> | |
| 16101 </listOfReactants> | |
| 16102 <listOfProducts> | |
| 16103 <speciesReference constant="true" species="C00341" stoichiometry="1"/> | |
| 16104 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 16105 </listOfProducts> | |
| 16106 </reaction> | |
| 16107 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00328" metaid="_7136cc26-8b4c-4b42-b2bd-8517f64486b0" name="GDP phosphohydrolase" reversible="true"> | |
| 16108 <notes> | |
| 16109 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16110 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16111 <p>GENE_ASSOCIATION: buc_BU434</p> | |
| 16112 </body> | |
| 16113 </notes> | |
| 16114 <fbc:geneProductAssociation> | |
| 16115 <fbc:geneProductRef fbc:geneProduct="buc_BU434"/> | |
| 16116 </fbc:geneProductAssociation> | |
| 16117 <listOfReactants> | |
| 16118 <speciesReference constant="true" species="C00035" stoichiometry="1"/> | |
| 16119 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 16120 </listOfReactants> | |
| 16121 <listOfProducts> | |
| 16122 <speciesReference constant="true" species="C00144" stoichiometry="1"/> | |
| 16123 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 16124 </listOfProducts> | |
| 16125 </reaction> | |
| 16126 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R12428" metaid="c835a612-c511-453b-b5e3-c91a8936b73d" name="octanoyl-[acp]:Glycine-cleavage-system-H N-octanoyltransferase" reversible="true"> | |
| 16127 <notes> | |
| 16128 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16129 <p>SUBSYSTEM: Lipoic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16130 <p>EC_NUMBER: 2.3.1.181</p> | |
| 16131 <p>GENE_ASSOCIATION: buc_BU268</p> | |
| 16132 </body> | |
| 16133 </notes> | |
| 16134 <annotation> | |
| 16135 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16136 <rdf:Description rdf:about="#c835a612-c511-453b-b5e3-c91a8936b73d"> | |
| 16137 <bqbiol:is> | |
| 16138 <rdf:Bag> | |
| 16139 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.3.1.181"/> | |
| 16140 </rdf:Bag> | |
| 16141 </bqbiol:is> | |
| 16142 </rdf:Description> | |
| 16143 </rdf:RDF> | |
| 16144 </annotation> | |
| 16145 <fbc:geneProductAssociation> | |
| 16146 <fbc:geneProductRef fbc:geneProduct="buc_BU268"/> | |
| 16147 </fbc:geneProductAssociation> | |
| 16148 <listOfReactants> | |
| 16149 <speciesReference constant="true" species="C22157" stoichiometry="1"/> | |
| 16150 <speciesReference constant="true" species="C05752" stoichiometry="1"/> | |
| 16151 </listOfReactants> | |
| 16152 <listOfProducts> | |
| 16153 <speciesReference constant="true" species="C22159" stoichiometry="1"/> | |
| 16154 <speciesReference constant="true" species="C00229" stoichiometry="1"/> | |
| 16155 </listOfProducts> | |
| 16156 </reaction> | |
| 16157 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R12427" metaid="_3119b3cf-dbac-4a9b-9f0c-84849249bd89" name="octanoyl-[acp]:lipoyl-carrier-protein-E2 N-octanoyltransferase" reversible="true"> | |
| 16158 <notes> | |
| 16159 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16160 <p>SUBSYSTEM: Lipoic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16161 <p>EC_NUMBER: 2.3.1.181</p> | |
| 16162 <p>GENE_ASSOCIATION: buc_BU268</p> | |
| 16163 </body> | |
| 16164 </notes> | |
| 16165 <annotation> | |
| 16166 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16167 <rdf:Description rdf:about="#_3119b3cf-dbac-4a9b-9f0c-84849249bd89"> | |
| 16168 <bqbiol:is> | |
| 16169 <rdf:Bag> | |
| 16170 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.3.1.181"/> | |
| 16171 </rdf:Bag> | |
| 16172 </bqbiol:is> | |
| 16173 </rdf:Description> | |
| 16174 </rdf:RDF> | |
| 16175 </annotation> | |
| 16176 <fbc:geneProductAssociation> | |
| 16177 <fbc:geneProductRef fbc:geneProduct="buc_BU268"/> | |
| 16178 </fbc:geneProductAssociation> | |
| 16179 <listOfReactants> | |
| 16180 <speciesReference constant="true" species="C22158" stoichiometry="1"/> | |
| 16181 <speciesReference constant="true" species="C05752" stoichiometry="1"/> | |
| 16182 </listOfReactants> | |
| 16183 <listOfProducts> | |
| 16184 <speciesReference constant="true" species="C00229" stoichiometry="1"/> | |
| 16185 <speciesReference constant="true" species="C22160" stoichiometry="1"/> | |
| 16186 </listOfProducts> | |
| 16187 </reaction> | |
| 16188 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R12424" metaid="_0828e363-26a8-4c08-94c0-f8c0c6e587e4" name="[glycine cleavage system H]-N6-octanoyl-L-lysine:[Fe-S] cluster scaffold protein carrying a [4Fe-4S]2+ cluster sulfurtransferase" reversible="true"> | |
| 16189 <notes> | |
| 16190 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16191 <p>SUBSYSTEM: Lipoic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16192 <p>EC_NUMBER: 2.8.1.8</p> | |
| 16193 <p>GENE_ASSOCIATION: buc_BU269</p> | |
| 16194 </body> | |
| 16195 </notes> | |
| 16196 <annotation> | |
| 16197 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16198 <rdf:Description rdf:about="#_0828e363-26a8-4c08-94c0-f8c0c6e587e4"> | |
| 16199 <bqbiol:is> | |
| 16200 <rdf:Bag> | |
| 16201 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.8.1.8"/> | |
| 16202 </rdf:Bag> | |
| 16203 </bqbiol:is> | |
| 16204 </rdf:Description> | |
| 16205 </rdf:RDF> | |
| 16206 </annotation> | |
| 16207 <fbc:geneProductAssociation> | |
| 16208 <fbc:geneProductRef fbc:geneProduct="buc_BU269"/> | |
| 16209 </fbc:geneProductAssociation> | |
| 16210 <listOfReactants> | |
| 16211 <speciesReference constant="true" species="C00080" stoichiometry="8"/> | |
| 16212 <speciesReference constant="true" species="C22159" stoichiometry="1"/> | |
| 16213 <speciesReference constant="true" species="C22150" stoichiometry="2"/> | |
| 16214 <speciesReference constant="true" species="C22154" stoichiometry="1"/> | |
| 16215 <speciesReference constant="true" species="C00019" stoichiometry="2"/> | |
| 16216 </listOfReactants> | |
| 16217 <listOfProducts> | |
| 16218 <speciesReference constant="true" species="C14818" stoichiometry="4"/> | |
| 16219 <speciesReference constant="true" species="C00073" stoichiometry="2"/> | |
| 16220 <speciesReference constant="true" species="C05198" stoichiometry="2"/> | |
| 16221 <speciesReference constant="true" species="C22155" stoichiometry="1"/> | |
| 16222 <speciesReference constant="true" species="C22151" stoichiometry="2"/> | |
| 16223 <speciesReference constant="true" species="C02972" stoichiometry="1"/> | |
| 16224 <speciesReference constant="true" species="C00283" stoichiometry="2"/> | |
| 16225 </listOfProducts> | |
| 16226 </reaction> | |
| 16227 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00691" metaid="_169a7f77-3fb2-4b1e-8681-b2f03671ca56" name="L-arogenate hydro-lyase (decarboxylating L-phenylalanine-forming)" reversible="true"> | |
| 16228 <notes> | |
| 16229 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16230 <p>SUBSYSTEM: Phenylalanine, tyrosine and tryptophan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16231 <p>EC_NUMBER: 4.2.1.51</p> | |
| 16232 <p>GENE_ASSOCIATION: buc_BU392</p> | |
| 16233 </body> | |
| 16234 </notes> | |
| 16235 <annotation> | |
| 16236 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16237 <rdf:Description rdf:about="#_169a7f77-3fb2-4b1e-8681-b2f03671ca56"> | |
| 16238 <bqbiol:is> | |
| 16239 <rdf:Bag> | |
| 16240 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.2.1.51"/> | |
| 16241 </rdf:Bag> | |
| 16242 </bqbiol:is> | |
| 16243 </rdf:Description> | |
| 16244 </rdf:RDF> | |
| 16245 </annotation> | |
| 16246 <fbc:geneProductAssociation> | |
| 16247 <fbc:geneProductRef fbc:geneProduct="buc_BU392"/> | |
| 16248 </fbc:geneProductAssociation> | |
| 16249 <listOfReactants> | |
| 16250 <speciesReference constant="true" species="C00826" stoichiometry="1"/> | |
| 16251 </listOfReactants> | |
| 16252 <listOfProducts> | |
| 16253 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 16254 <speciesReference constant="true" species="C00079" stoichiometry="1"/> | |
| 16255 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 16256 </listOfProducts> | |
| 16257 </reaction> | |
| 16258 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R12423" metaid="_6fc2d95c-781d-4f5a-9e47-06f4203b2866" name="[lipoyl-carrier protein E2]-N6-(octanoyl)-L-lysine:[Fe-S] cluster scaffold protein carrying a [4Fe-4S]2+ cluster sulfurtransferase" reversible="true"> | |
| 16259 <notes> | |
| 16260 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16261 <p>SUBSYSTEM: Lipoic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16262 <p>EC_NUMBER: 2.8.1.8</p> | |
| 16263 <p>GENE_ASSOCIATION: buc_BU269</p> | |
| 16264 </body> | |
| 16265 </notes> | |
| 16266 <annotation> | |
| 16267 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16268 <rdf:Description rdf:about="#_6fc2d95c-781d-4f5a-9e47-06f4203b2866"> | |
| 16269 <bqbiol:is> | |
| 16270 <rdf:Bag> | |
| 16271 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.8.1.8"/> | |
| 16272 </rdf:Bag> | |
| 16273 </bqbiol:is> | |
| 16274 </rdf:Description> | |
| 16275 </rdf:RDF> | |
| 16276 </annotation> | |
| 16277 <fbc:geneProductAssociation> | |
| 16278 <fbc:geneProductRef fbc:geneProduct="buc_BU269"/> | |
| 16279 </fbc:geneProductAssociation> | |
| 16280 <listOfReactants> | |
| 16281 <speciesReference constant="true" species="C00080" stoichiometry="8"/> | |
| 16282 <speciesReference constant="true" species="C22160" stoichiometry="1"/> | |
| 16283 <speciesReference constant="true" species="C22150" stoichiometry="2"/> | |
| 16284 <speciesReference constant="true" species="C22154" stoichiometry="1"/> | |
| 16285 <speciesReference constant="true" species="C00019" stoichiometry="2"/> | |
| 16286 </listOfReactants> | |
| 16287 <listOfProducts> | |
| 16288 <speciesReference constant="true" species="C14818" stoichiometry="4"/> | |
| 16289 <speciesReference constant="true" species="C15973" stoichiometry="1"/> | |
| 16290 <speciesReference constant="true" species="C00073" stoichiometry="2"/> | |
| 16291 <speciesReference constant="true" species="C05198" stoichiometry="2"/> | |
| 16292 <speciesReference constant="true" species="C22155" stoichiometry="1"/> | |
| 16293 <speciesReference constant="true" species="C22151" stoichiometry="2"/> | |
| 16294 <speciesReference constant="true" species="C00283" stoichiometry="2"/> | |
| 16295 </listOfProducts> | |
| 16296 </reaction> | |
| 16297 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00571" metaid="cf43f72f-961d-4e13-804a-f90af670618f" name="UTP:ammonia ligase (ADP-forming)" reversible="true"> | |
| 16298 <notes> | |
| 16299 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16300 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pyrimidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16301 <p>EC_NUMBER: 6.3.4.2</p> | |
| 16302 <p>GENE_ASSOCIATION: buc_BU416</p> | |
| 16303 </body> | |
| 16304 </notes> | |
| 16305 <annotation> | |
| 16306 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16307 <rdf:Description rdf:about="#cf43f72f-961d-4e13-804a-f90af670618f"> | |
| 16308 <bqbiol:is> | |
| 16309 <rdf:Bag> | |
| 16310 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.3.4.2"/> | |
| 16311 </rdf:Bag> | |
| 16312 </bqbiol:is> | |
| 16313 </rdf:Description> | |
| 16314 </rdf:RDF> | |
| 16315 </annotation> | |
| 16316 <fbc:geneProductAssociation> | |
| 16317 <fbc:geneProductRef fbc:geneProduct="buc_BU416"/> | |
| 16318 </fbc:geneProductAssociation> | |
| 16319 <listOfReactants> | |
| 16320 <speciesReference constant="true" species="C00075" stoichiometry="1"/> | |
| 16321 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 16322 <speciesReference constant="true" species="C00014" stoichiometry="1"/> | |
| 16323 </listOfReactants> | |
| 16324 <listOfProducts> | |
| 16325 <speciesReference constant="true" species="C00063" stoichiometry="1"/> | |
| 16326 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 16327 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 16328 </listOfProducts> | |
| 16329 </reaction> | |
| 16330 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00692" metaid="_94e13eb9-eb48-497e-b0b0-48643ea217f1" name="L-phenylalanine:pyruvate aminotransferase" reversible="true"> | |
| 16331 <notes> | |
| 16332 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16333 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16334 <p>GENE_ASSOCIATION: buc_BU101</p> | |
| 16335 </body> | |
| 16336 </notes> | |
| 16337 <fbc:geneProductAssociation> | |
| 16338 <fbc:geneProductRef fbc:geneProduct="buc_BU101"/> | |
| 16339 </fbc:geneProductAssociation> | |
| 16340 <listOfReactants> | |
| 16341 <speciesReference constant="true" species="C00022" stoichiometry="1"/> | |
| 16342 <speciesReference constant="true" species="C00079" stoichiometry="1"/> | |
| 16343 </listOfReactants> | |
| 16344 <listOfProducts> | |
| 16345 <speciesReference constant="true" species="C00166" stoichiometry="1"/> | |
| 16346 <speciesReference constant="true" species="C00041" stoichiometry="1"/> | |
| 16347 </listOfProducts> | |
| 16348 </reaction> | |
| 16349 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00451" metaid="_31d55e2b-c930-450a-8e1f-082db9ab4005" name="meso-2,6-diaminoheptanedioate carboxy-lyase (L-lysine-forming)" reversible="true"> | |
| 16350 <notes> | |
| 16351 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16352 <p>SUBSYSTEM: Lysine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || D-Amino acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16353 <p>EC_NUMBER: 4.1.1.20</p> | |
| 16354 <p>GENE_ASSOCIATION: buc_BU438</p> | |
| 16355 </body> | |
| 16356 </notes> | |
| 16357 <annotation> | |
| 16358 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16359 <rdf:Description rdf:about="#_31d55e2b-c930-450a-8e1f-082db9ab4005"> | |
| 16360 <bqbiol:is> | |
| 16361 <rdf:Bag> | |
| 16362 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.1.1.20"/> | |
| 16363 </rdf:Bag> | |
| 16364 </bqbiol:is> | |
| 16365 </rdf:Description> | |
| 16366 </rdf:RDF> | |
| 16367 </annotation> | |
| 16368 <fbc:geneProductAssociation> | |
| 16369 <fbc:geneProductRef fbc:geneProduct="buc_BU438"/> | |
| 16370 </fbc:geneProductAssociation> | |
| 16371 <listOfReactants> | |
| 16372 <speciesReference constant="true" species="C00680" stoichiometry="1"/> | |
| 16373 </listOfReactants> | |
| 16374 <listOfProducts> | |
| 16375 <speciesReference constant="true" species="C00047" stoichiometry="1"/> | |
| 16376 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 16377 </listOfProducts> | |
| 16378 </reaction> | |
| 16379 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R10122" metaid="_125cb085-fb23-424b-ac47-79b03bb936ad" name="pimelyl-[acyl-carrier protein]-methyl-ester:NADP+ oxidoreductase" reversible="true"> | |
| 16380 <notes> | |
| 16381 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16382 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biotin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16383 <p>EC_NUMBER: 1.3.1.10</p> | |
| 16384 <p>GENE_ASSOCIATION: buc_BU265</p> | |
| 16385 </body> | |
| 16386 </notes> | |
| 16387 <annotation> | |
| 16388 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16389 <rdf:Description rdf:about="#_125cb085-fb23-424b-ac47-79b03bb936ad"> | |
| 16390 <bqbiol:is> | |
| 16391 <rdf:Bag> | |
| 16392 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.3.1.10"/> | |
| 16393 </rdf:Bag> | |
| 16394 </bqbiol:is> | |
| 16395 </rdf:Description> | |
| 16396 </rdf:RDF> | |
| 16397 </annotation> | |
| 16398 <fbc:geneProductAssociation> | |
| 16399 <fbc:geneProductRef fbc:geneProduct="buc_BU265"/> | |
| 16400 </fbc:geneProductAssociation> | |
| 16401 <listOfReactants> | |
| 16402 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 16403 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 16404 <speciesReference constant="true" species="C20378" stoichiometry="1"/> | |
| 16405 </listOfReactants> | |
| 16406 <listOfProducts> | |
| 16407 <speciesReference constant="true" species="C19846" stoichiometry="1"/> | |
| 16408 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 16409 </listOfProducts> | |
| 16410 </reaction> | |
| 16411 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00573" metaid="_788a048e-a5a1-40ad-bc39-e476f781578c" name="UTP:L-glutamine amido-ligase (ADP-forming)" reversible="true"> | |
| 16412 <notes> | |
| 16413 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16414 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pyrimidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16415 <p>EC_NUMBER: 6.3.4.2</p> | |
| 16416 <p>GENE_ASSOCIATION: buc_BU416</p> | |
| 16417 </body> | |
| 16418 </notes> | |
| 16419 <annotation> | |
| 16420 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16421 <rdf:Description rdf:about="#_788a048e-a5a1-40ad-bc39-e476f781578c"> | |
| 16422 <bqbiol:is> | |
| 16423 <rdf:Bag> | |
| 16424 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.3.4.2"/> | |
| 16425 </rdf:Bag> | |
| 16426 </bqbiol:is> | |
| 16427 </rdf:Description> | |
| 16428 </rdf:RDF> | |
| 16429 </annotation> | |
| 16430 <fbc:geneProductAssociation> | |
| 16431 <fbc:geneProductRef fbc:geneProduct="buc_BU416"/> | |
| 16432 </fbc:geneProductAssociation> | |
| 16433 <listOfReactants> | |
| 16434 <speciesReference constant="true" species="C00075" stoichiometry="1"/> | |
| 16435 <speciesReference constant="true" species="C00064" stoichiometry="1"/> | |
| 16436 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 16437 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 16438 </listOfReactants> | |
| 16439 <listOfProducts> | |
| 16440 <speciesReference constant="true" species="C00063" stoichiometry="1"/> | |
| 16441 <speciesReference constant="true" species="C00025" stoichiometry="1"/> | |
| 16442 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 16443 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 16444 </listOfProducts> | |
| 16445 </reaction> | |
| 16446 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00694" metaid="c21e7bf2-dca4-4d16-830f-9b5c6f984d37" name="L-Phenylalanine:2-oxoglutarate aminotransferase" reversible="true"> | |
| 16447 <notes> | |
| 16448 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16449 <p>SUBSYSTEM: Phenylalanine, tyrosine and tryptophan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16450 <p>EC_NUMBER: 2.6.1.9</p> | |
| 16451 <p>GENE_ASSOCIATION: buc_BU101</p> | |
| 16452 </body> | |
| 16453 </notes> | |
| 16454 <annotation> | |
| 16455 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16456 <rdf:Description rdf:about="#c21e7bf2-dca4-4d16-830f-9b5c6f984d37"> | |
| 16457 <bqbiol:is> | |
| 16458 <rdf:Bag> | |
| 16459 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.6.1.9"/> | |
| 16460 </rdf:Bag> | |
| 16461 </bqbiol:is> | |
| 16462 </rdf:Description> | |
| 16463 </rdf:RDF> | |
| 16464 </annotation> | |
| 16465 <fbc:geneProductAssociation> | |
| 16466 <fbc:geneProductRef fbc:geneProduct="buc_BU101"/> | |
| 16467 </fbc:geneProductAssociation> | |
| 16468 <listOfReactants> | |
| 16469 <speciesReference constant="true" species="C00026" stoichiometry="1"/> | |
| 16470 <speciesReference constant="true" species="C00079" stoichiometry="1"/> | |
| 16471 </listOfReactants> | |
| 16472 <listOfProducts> | |
| 16473 <speciesReference constant="true" species="C00166" stoichiometry="1"/> | |
| 16474 <speciesReference constant="true" species="C00025" stoichiometry="1"/> | |
| 16475 </listOfProducts> | |
| 16476 </reaction> | |
| 16477 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01528" metaid="_6f463c04-1979-4c91-ace6-43b09c5c5fa4" name="6-phospho-D-gluconate:NADP+ 2-oxidoreductase (decarboxylating)" reversible="true"> | |
| 16478 <notes> | |
| 16479 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16480 <p>SUBSYSTEM: Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glutathione metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pentose phosphate pathway - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16481 <p>EC_NUMBER: 1.1.1.44</p> | |
| 16482 <p>GENE_ASSOCIATION: buc_BU107</p> | |
| 16483 </body> | |
| 16484 </notes> | |
| 16485 <annotation> | |
| 16486 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16487 <rdf:Description rdf:about="#_6f463c04-1979-4c91-ace6-43b09c5c5fa4"> | |
| 16488 <bqbiol:is> | |
| 16489 <rdf:Bag> | |
| 16490 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.44"/> | |
| 16491 </rdf:Bag> | |
| 16492 </bqbiol:is> | |
| 16493 </rdf:Description> | |
| 16494 </rdf:RDF> | |
| 16495 </annotation> | |
| 16496 <fbc:geneProductAssociation> | |
| 16497 <fbc:geneProductRef fbc:geneProduct="buc_BU107"/> | |
| 16498 </fbc:geneProductAssociation> | |
| 16499 <listOfReactants> | |
| 16500 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 16501 <speciesReference constant="true" species="C00345" stoichiometry="1"/> | |
| 16502 </listOfReactants> | |
| 16503 <listOfProducts> | |
| 16504 <speciesReference constant="true" species="C00199" stoichiometry="1"/> | |
| 16505 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 16506 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 16507 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 16508 </listOfProducts> | |
| 16509 </reaction> | |
| 16510 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02739" metaid="_93520f03-9a0c-4a49-a814-6da50415531c" name="alpha-D-Glucose 6-phosphate ketol-isomerase" reversible="true"> | |
| 16511 <notes> | |
| 16512 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16513 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glycolysis / Gluconeogenesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pentose phosphate pathway - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16514 <p>EC_NUMBER: 5.3.1.9</p> | |
| 16515 <p>GENE_ASSOCIATION: buc_BU573</p> | |
| 16516 </body> | |
| 16517 </notes> | |
| 16518 <annotation> | |
| 16519 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16520 <rdf:Description rdf:about="#_93520f03-9a0c-4a49-a814-6da50415531c"> | |
| 16521 <bqbiol:is> | |
| 16522 <rdf:Bag> | |
| 16523 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.3.1.9"/> | |
| 16524 </rdf:Bag> | |
| 16525 </bqbiol:is> | |
| 16526 </rdf:Description> | |
| 16527 </rdf:RDF> | |
| 16528 </annotation> | |
| 16529 <fbc:geneProductAssociation> | |
| 16530 <fbc:geneProductRef fbc:geneProduct="buc_BU573"/> | |
| 16531 </fbc:geneProductAssociation> | |
| 16532 <listOfReactants> | |
| 16533 <speciesReference constant="true" species="C00668" stoichiometry="1"/> | |
| 16534 </listOfReactants> | |
| 16535 <listOfProducts> | |
| 16536 <speciesReference constant="true" species="C01172" stoichiometry="1"/> | |
| 16537 </listOfProducts> | |
| 16538 </reaction> | |
| 16539 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01529" metaid="_6ae26d9f-2eab-4288-ab8f-0001881d8604" name="D-Ribulose-5-phosphate 3-epimerase" reversible="true"> | |
| 16540 <notes> | |
| 16541 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16542 <p>SUBSYSTEM: Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pentose phosphate pathway - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16543 <p>EC_NUMBER: 5.1.3.1</p> | |
| 16544 <p>GENE_ASSOCIATION: buc_BU537</p> | |
| 16545 </body> | |
| 16546 </notes> | |
| 16547 <annotation> | |
| 16548 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16549 <rdf:Description rdf:about="#_6ae26d9f-2eab-4288-ab8f-0001881d8604"> | |
| 16550 <bqbiol:is> | |
| 16551 <rdf:Bag> | |
| 16552 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.1.3.1"/> | |
| 16553 </rdf:Bag> | |
| 16554 </bqbiol:is> | |
| 16555 </rdf:Description> | |
| 16556 </rdf:RDF> | |
| 16557 </annotation> | |
| 16558 <fbc:geneProductAssociation> | |
| 16559 <fbc:geneProductRef fbc:geneProduct="buc_BU537"/> | |
| 16560 </fbc:geneProductAssociation> | |
| 16561 <listOfReactants> | |
| 16562 <speciesReference constant="true" species="C00199" stoichiometry="1"/> | |
| 16563 </listOfReactants> | |
| 16564 <listOfProducts> | |
| 16565 <speciesReference constant="true" species="C00231" stoichiometry="1"/> | |
| 16566 </listOfProducts> | |
| 16567 </reaction> | |
| 16568 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02738" metaid="_22d6ca72-6fb1-4e6a-bc51-a8081e3df115" name="protein-N(pi)-phosphohistidine:D-glucose 6-phosphotransferase" reversible="false"> | |
| 16569 <notes> | |
| 16570 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16571 <p>SUBSYSTEM: Amino sugar and nucleotide sugar metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glycolysis / Gluconeogenesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16572 <p>EC_NUMBER: 2.7.1.199</p> | |
| 16573 <p>GENE_ASSOCIATION: ( buc_BU063 ) OR ( buc_BU356 )</p> | |
| 16574 </body> | |
| 16575 </notes> | |
| 16576 <annotation> | |
| 16577 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16578 <rdf:Description rdf:about="#_22d6ca72-6fb1-4e6a-bc51-a8081e3df115"> | |
| 16579 <bqbiol:is> | |
| 16580 <rdf:Bag> | |
| 16581 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.199"/> | |
| 16582 </rdf:Bag> | |
| 16583 </bqbiol:is> | |
| 16584 </rdf:Description> | |
| 16585 </rdf:RDF> | |
| 16586 </annotation> | |
| 16587 <fbc:geneProductAssociation> | |
| 16588 <fbc:or> | |
| 16589 <fbc:geneProductRef fbc:geneProduct="buc_BU356"/> | |
| 16590 <fbc:geneProductRef fbc:geneProduct="buc_BU063"/> | |
| 16591 </fbc:or> | |
| 16592 </fbc:geneProductAssociation> | |
| 16593 <listOfReactants> | |
| 16594 <speciesReference constant="true" species="C04261" stoichiometry="1"/> | |
| 16595 <speciesReference constant="true" species="C00031" stoichiometry="1"/> | |
| 16596 </listOfReactants> | |
| 16597 <listOfProducts> | |
| 16598 <speciesReference constant="true" species="C00615" stoichiometry="1"/> | |
| 16599 <speciesReference constant="true" species="C00668" stoichiometry="1"/> | |
| 16600 </listOfProducts> | |
| 16601 </reaction> | |
| 16602 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01641" metaid="b1377c13-e348-4439-bc72-575b973ec66b" name="sedoheptulose-7-phosphate:D-glyceraldehyde-3-phosphate glycolaldehyde transferase" reversible="true"> | |
| 16603 <notes> | |
| 16604 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16605 <p>SUBSYSTEM: Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pentose phosphate pathway - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16606 <p>EC_NUMBER: 2.2.1.1</p> | |
| 16607 <p>GENE_ASSOCIATION: buc_BU094</p> | |
| 16608 </body> | |
| 16609 </notes> | |
| 16610 <annotation> | |
| 16611 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16612 <rdf:Description rdf:about="#b1377c13-e348-4439-bc72-575b973ec66b"> | |
| 16613 <bqbiol:is> | |
| 16614 <rdf:Bag> | |
| 16615 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.2.1.1"/> | |
| 16616 </rdf:Bag> | |
| 16617 </bqbiol:is> | |
| 16618 </rdf:Description> | |
| 16619 </rdf:RDF> | |
| 16620 </annotation> | |
| 16621 <fbc:geneProductAssociation> | |
| 16622 <fbc:geneProductRef fbc:geneProduct="buc_BU094"/> | |
| 16623 </fbc:geneProductAssociation> | |
| 16624 <listOfReactants> | |
| 16625 <speciesReference constant="true" species="C05382" stoichiometry="1"/> | |
| 16626 <speciesReference constant="true" species="C00118" stoichiometry="1"/> | |
| 16627 </listOfReactants> | |
| 16628 <listOfProducts> | |
| 16629 <speciesReference constant="true" species="C00117" stoichiometry="1"/> | |
| 16630 <speciesReference constant="true" species="C00231" stoichiometry="1"/> | |
| 16631 </listOfProducts> | |
| 16632 </reaction> | |
| 16633 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R10120" metaid="_331f00fa-1476-48e1-ab43-88e8ad148844" name="3-hydroxypimeloyl-[acp]-methyl-ester:NADP+ oxidoreductase" reversible="true"> | |
| 16634 <notes> | |
| 16635 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16636 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biotin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16637 <p>EC_NUMBER: 1.1.1.100</p> | |
| 16638 <p>GENE_ASSOCIATION: buc_BU351</p> | |
| 16639 </body> | |
| 16640 </notes> | |
| 16641 <annotation> | |
| 16642 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16643 <rdf:Description rdf:about="#_331f00fa-1476-48e1-ab43-88e8ad148844"> | |
| 16644 <bqbiol:is> | |
| 16645 <rdf:Bag> | |
| 16646 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.100"/> | |
| 16647 </rdf:Bag> | |
| 16648 </bqbiol:is> | |
| 16649 </rdf:Description> | |
| 16650 </rdf:RDF> | |
| 16651 </annotation> | |
| 16652 <fbc:geneProductAssociation> | |
| 16653 <fbc:geneProductRef fbc:geneProduct="buc_BU351"/> | |
| 16654 </fbc:geneProductAssociation> | |
| 16655 <listOfReactants> | |
| 16656 <speciesReference constant="true" species="C20376" stoichiometry="1"/> | |
| 16657 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 16658 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 16659 </listOfReactants> | |
| 16660 <listOfProducts> | |
| 16661 <speciesReference constant="true" species="C20377" stoichiometry="1"/> | |
| 16662 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 16663 </listOfProducts> | |
| 16664 </reaction> | |
| 16665 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00673" metaid="_9d06aab0-0d9d-4364-bc0e-0f1f0ce17531" name="L-tryptophan indole-lyase (deaminating pyruvate-forming)" reversible="true"> | |
| 16666 <notes> | |
| 16667 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16668 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16669 <p>GENE_ASSOCIATION: ( buc_BU277 ) OR ( buc_BU278 )</p> | |
| 16670 </body> | |
| 16671 </notes> | |
| 16672 <fbc:geneProductAssociation> | |
| 16673 <fbc:or> | |
| 16674 <fbc:geneProductRef fbc:geneProduct="buc_BU277"/> | |
| 16675 <fbc:geneProductRef fbc:geneProduct="buc_BU278"/> | |
| 16676 </fbc:or> | |
| 16677 </fbc:geneProductAssociation> | |
| 16678 <listOfReactants> | |
| 16679 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 16680 <speciesReference constant="true" species="C00078" stoichiometry="1"/> | |
| 16681 </listOfReactants> | |
| 16682 <listOfProducts> | |
| 16683 <speciesReference constant="true" species="C00463" stoichiometry="1"/> | |
| 16684 <speciesReference constant="true" species="C00014" stoichiometry="1"/> | |
| 16685 <speciesReference constant="true" species="C00022" stoichiometry="1"/> | |
| 16686 </listOfProducts> | |
| 16687 </reaction> | |
| 16688 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03940" metaid="_8427c2e9-e53e-40fc-b399-7ebf7d0e57e0" name="10-Formyltetrahydrofolate:L-methionyl-tRNA N-formyltransferase" reversible="true"> | |
| 16689 <notes> | |
| 16690 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16691 <p>SUBSYSTEM: Aminoacyl-tRNA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || One carbon pool by folate - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16692 <p>EC_NUMBER: 2.1.2.9</p> | |
| 16693 <p>GENE_ASSOCIATION: buc_BU497</p> | |
| 16694 </body> | |
| 16695 </notes> | |
| 16696 <annotation> | |
| 16697 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16698 <rdf:Description rdf:about="#_8427c2e9-e53e-40fc-b399-7ebf7d0e57e0"> | |
| 16699 <bqbiol:is> | |
| 16700 <rdf:Bag> | |
| 16701 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.1.2.9"/> | |
| 16702 </rdf:Bag> | |
| 16703 </bqbiol:is> | |
| 16704 </rdf:Description> | |
| 16705 </rdf:RDF> | |
| 16706 </annotation> | |
| 16707 <fbc:geneProductAssociation> | |
| 16708 <fbc:geneProductRef fbc:geneProduct="buc_BU497"/> | |
| 16709 </fbc:geneProductAssociation> | |
| 16710 <listOfReactants> | |
| 16711 <speciesReference constant="true" species="C02430" stoichiometry="1"/> | |
| 16712 <speciesReference constant="true" species="C00234" stoichiometry="1"/> | |
| 16713 </listOfReactants> | |
| 16714 <listOfProducts> | |
| 16715 <speciesReference constant="true" species="C00101" stoichiometry="1"/> | |
| 16716 <speciesReference constant="true" species="C03294" stoichiometry="1"/> | |
| 16717 </listOfProducts> | |
| 16718 </reaction> | |
| 16719 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00674" metaid="bf17bbbe-93ee-4e21-aa16-03e4fc4d0e55" name="L-serine hydro-lyase (adding indole L-tryptophan-forming)" reversible="true"> | |
| 16720 <notes> | |
| 16721 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16722 <p>SUBSYSTEM: Phenylalanine, tyrosine and tryptophan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16723 <p>EC_NUMBER: 4.2.1.20</p> | |
| 16724 <p>GENE_ASSOCIATION: buc_BU278</p> | |
| 16725 </body> | |
| 16726 </notes> | |
| 16727 <annotation> | |
| 16728 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16729 <rdf:Description rdf:about="#bf17bbbe-93ee-4e21-aa16-03e4fc4d0e55"> | |
| 16730 <bqbiol:is> | |
| 16731 <rdf:Bag> | |
| 16732 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.2.1.20"/> | |
| 16733 </rdf:Bag> | |
| 16734 </bqbiol:is> | |
| 16735 </rdf:Description> | |
| 16736 </rdf:RDF> | |
| 16737 </annotation> | |
| 16738 <fbc:geneProductAssociation> | |
| 16739 <fbc:geneProductRef fbc:geneProduct="buc_BU278"/> | |
| 16740 </fbc:geneProductAssociation> | |
| 16741 <listOfReactants> | |
| 16742 <speciesReference constant="true" species="C00065" stoichiometry="1"/> | |
| 16743 <speciesReference constant="true" species="C00463" stoichiometry="1"/> | |
| 16744 </listOfReactants> | |
| 16745 <listOfProducts> | |
| 16746 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 16747 <speciesReference constant="true" species="C00078" stoichiometry="1"/> | |
| 16748 </listOfProducts> | |
| 16749 </reaction> | |
| 16750 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01401" metaid="a557b283-ecb4-4c01-989c-93336b18db68" name="methylthioadenosine methylthioribohydrolase" reversible="true"> | |
| 16751 <notes> | |
| 16752 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16753 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Cysteine and methionine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16754 <p>EC_NUMBER: 3.2.2.9</p> | |
| 16755 <p>GENE_ASSOCIATION: buc_BU210</p> | |
| 16756 </body> | |
| 16757 </notes> | |
| 16758 <annotation> | |
| 16759 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16760 <rdf:Description rdf:about="#a557b283-ecb4-4c01-989c-93336b18db68"> | |
| 16761 <bqbiol:is> | |
| 16762 <rdf:Bag> | |
| 16763 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.2.2.9"/> | |
| 16764 </rdf:Bag> | |
| 16765 </bqbiol:is> | |
| 16766 </rdf:Description> | |
| 16767 </rdf:RDF> | |
| 16768 </annotation> | |
| 16769 <fbc:geneProductAssociation> | |
| 16770 <fbc:geneProductRef fbc:geneProduct="buc_BU210"/> | |
| 16771 </fbc:geneProductAssociation> | |
| 16772 <listOfReactants> | |
| 16773 <speciesReference constant="true" species="C00170" stoichiometry="1"/> | |
| 16774 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 16775 </listOfReactants> | |
| 16776 <listOfProducts> | |
| 16777 <speciesReference constant="true" species="C03089" stoichiometry="1"/> | |
| 16778 <speciesReference constant="true" species="C00147" stoichiometry="1"/> | |
| 16779 </listOfProducts> | |
| 16780 </reaction> | |
| 16781 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02735" metaid="_1a8fbaab-1509-4348-94c4-83f5d64b7961" name="LL-2,6-Diaminoheptanedioate 2-epimerase" reversible="true"> | |
| 16782 <notes> | |
| 16783 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16784 <p>SUBSYSTEM: Lysine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || D-Amino acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16785 <p>EC_NUMBER: 5.1.1.7</p> | |
| 16786 <p>GENE_ASSOCIATION: buc_BU589</p> | |
| 16787 </body> | |
| 16788 </notes> | |
| 16789 <annotation> | |
| 16790 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16791 <rdf:Description rdf:about="#_1a8fbaab-1509-4348-94c4-83f5d64b7961"> | |
| 16792 <bqbiol:is> | |
| 16793 <rdf:Bag> | |
| 16794 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.1.1.7"/> | |
| 16795 </rdf:Bag> | |
| 16796 </bqbiol:is> | |
| 16797 </rdf:Description> | |
| 16798 </rdf:RDF> | |
| 16799 </annotation> | |
| 16800 <fbc:geneProductAssociation> | |
| 16801 <fbc:geneProductRef fbc:geneProduct="buc_BU589"/> | |
| 16802 </fbc:geneProductAssociation> | |
| 16803 <listOfReactants> | |
| 16804 <speciesReference constant="true" species="C00666" stoichiometry="1"/> | |
| 16805 </listOfReactants> | |
| 16806 <listOfProducts> | |
| 16807 <speciesReference constant="true" species="C00680" stoichiometry="1"/> | |
| 16808 </listOfProducts> | |
| 16809 </reaction> | |
| 16810 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01403" metaid="b6f25ab9-c01c-4302-ad9d-7c6a42ff9af0" name="acyl-[acyl-carrier-protein]:NAD+ oxidoreductase" reversible="true"> | |
| 16811 <notes> | |
| 16812 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16813 <p>SUBSYSTEM: Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16814 <p>EC_NUMBER: 1.3.1.9</p> | |
| 16815 <p>GENE_ASSOCIATION: buc_BU265</p> | |
| 16816 </body> | |
| 16817 </notes> | |
| 16818 <annotation> | |
| 16819 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16820 <rdf:Description rdf:about="#b6f25ab9-c01c-4302-ad9d-7c6a42ff9af0"> | |
| 16821 <bqbiol:is> | |
| 16822 <rdf:Bag> | |
| 16823 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.3.1.9"/> | |
| 16824 </rdf:Bag> | |
| 16825 </bqbiol:is> | |
| 16826 </rdf:Description> | |
| 16827 </rdf:RDF> | |
| 16828 </annotation> | |
| 16829 <fbc:geneProductAssociation> | |
| 16830 <fbc:geneProductRef fbc:geneProduct="buc_BU265"/> | |
| 16831 </fbc:geneProductAssociation> | |
| 16832 <listOfReactants> | |
| 16833 <speciesReference constant="true" species="C00173" stoichiometry="1"/> | |
| 16834 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 16835 </listOfReactants> | |
| 16836 <listOfProducts> | |
| 16837 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 16838 <speciesReference constant="true" species="C00693" stoichiometry="1"/> | |
| 16839 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 16840 </listOfProducts> | |
| 16841 </reaction> | |
| 16842 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00315" metaid="_1996eed3-0dc8-4c97-8453-5e1b7d3a7501" name="ATP:acetate phosphotransferase" reversible="true"> | |
| 16843 <notes> | |
| 16844 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16845 <p>SUBSYSTEM: Pyruvate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Taurine and hypotaurine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Methane metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16846 <p>EC_NUMBER: 2.7.2.1</p> | |
| 16847 <p>GENE_ASSOCIATION: buc_BU175</p> | |
| 16848 </body> | |
| 16849 </notes> | |
| 16850 <annotation> | |
| 16851 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16852 <rdf:Description rdf:about="#_1996eed3-0dc8-4c97-8453-5e1b7d3a7501"> | |
| 16853 <bqbiol:is> | |
| 16854 <rdf:Bag> | |
| 16855 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.2.1"/> | |
| 16856 </rdf:Bag> | |
| 16857 </bqbiol:is> | |
| 16858 </rdf:Description> | |
| 16859 </rdf:RDF> | |
| 16860 </annotation> | |
| 16861 <fbc:geneProductAssociation> | |
| 16862 <fbc:geneProductRef fbc:geneProduct="buc_BU175"/> | |
| 16863 </fbc:geneProductAssociation> | |
| 16864 <listOfReactants> | |
| 16865 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 16866 <speciesReference constant="true" species="C00033" stoichiometry="1"/> | |
| 16867 </listOfReactants> | |
| 16868 <listOfProducts> | |
| 16869 <speciesReference constant="true" species="C00227" stoichiometry="1"/> | |
| 16870 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 16871 </listOfProducts> | |
| 16872 </reaction> | |
| 16873 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02734" metaid="c9f56ad7-52a7-4fbb-b6f6-35698c47d4ff" name="N-Succinyl-LL-2,6-diaminoheptanedioate amidohydrolase" reversible="true"> | |
| 16874 <notes> | |
| 16875 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16876 <p>SUBSYSTEM: Lysine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16877 <p>EC_NUMBER: 3.5.1.18</p> | |
| 16878 <p>GENE_ASSOCIATION: buc_BU095</p> | |
| 16879 </body> | |
| 16880 </notes> | |
| 16881 <annotation> | |
| 16882 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16883 <rdf:Description rdf:about="#c9f56ad7-52a7-4fbb-b6f6-35698c47d4ff"> | |
| 16884 <bqbiol:is> | |
| 16885 <rdf:Bag> | |
| 16886 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.5.1.18"/> | |
| 16887 </rdf:Bag> | |
| 16888 </bqbiol:is> | |
| 16889 </rdf:Description> | |
| 16890 </rdf:RDF> | |
| 16891 </annotation> | |
| 16892 <fbc:geneProductAssociation> | |
| 16893 <fbc:geneProductRef fbc:geneProduct="buc_BU095"/> | |
| 16894 </fbc:geneProductAssociation> | |
| 16895 <listOfReactants> | |
| 16896 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 16897 <speciesReference constant="true" species="C04421" stoichiometry="1"/> | |
| 16898 </listOfReactants> | |
| 16899 <listOfProducts> | |
| 16900 <speciesReference constant="true" species="C00042" stoichiometry="1"/> | |
| 16901 <speciesReference constant="true" species="C00666" stoichiometry="1"/> | |
| 16902 </listOfProducts> | |
| 16903 </reaction> | |
| 16904 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01404" metaid="fe8c7a32-0c98-4760-a03b-99582f3cc0a8" name="acyl-[acyl-carrier protein]:NADP+ oxidoreductase" reversible="true"> | |
| 16905 <notes> | |
| 16906 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16907 <p>SUBSYSTEM: Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16908 <p>EC_NUMBER: 1.3.1.10</p> | |
| 16909 <p>GENE_ASSOCIATION: buc_BU265</p> | |
| 16910 </body> | |
| 16911 </notes> | |
| 16912 <annotation> | |
| 16913 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16914 <rdf:Description rdf:about="#fe8c7a32-0c98-4760-a03b-99582f3cc0a8"> | |
| 16915 <bqbiol:is> | |
| 16916 <rdf:Bag> | |
| 16917 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.3.1.10"/> | |
| 16918 </rdf:Bag> | |
| 16919 </bqbiol:is> | |
| 16920 </rdf:Description> | |
| 16921 </rdf:RDF> | |
| 16922 </annotation> | |
| 16923 <fbc:geneProductAssociation> | |
| 16924 <fbc:geneProductRef fbc:geneProduct="buc_BU265"/> | |
| 16925 </fbc:geneProductAssociation> | |
| 16926 <listOfReactants> | |
| 16927 <speciesReference constant="true" species="C00173" stoichiometry="1"/> | |
| 16928 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 16929 </listOfReactants> | |
| 16930 <listOfProducts> | |
| 16931 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 16932 <speciesReference constant="true" species="C00693" stoichiometry="1"/> | |
| 16933 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 16934 </listOfProducts> | |
| 16935 </reaction> | |
| 16936 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03947" metaid="_640a5762-7e4a-438e-8dd2-18d61ad1dc74" name="S-adenosyl-L-methionine:uroporphyrin-III C-methyltransferase" reversible="true"> | |
| 16937 <notes> | |
| 16938 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16939 <p>SUBSYSTEM: Porphyrin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16940 <p>EC_NUMBER: 1.3.1.76</p> | |
| 16941 <p>GENE_ASSOCIATION: buc_BU425</p> | |
| 16942 </body> | |
| 16943 </notes> | |
| 16944 <annotation> | |
| 16945 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16946 <rdf:Description rdf:about="#_640a5762-7e4a-438e-8dd2-18d61ad1dc74"> | |
| 16947 <bqbiol:is> | |
| 16948 <rdf:Bag> | |
| 16949 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.3.1.76"/> | |
| 16950 </rdf:Bag> | |
| 16951 </bqbiol:is> | |
| 16952 </rdf:Description> | |
| 16953 </rdf:RDF> | |
| 16954 </annotation> | |
| 16955 <fbc:geneProductAssociation> | |
| 16956 <fbc:geneProductRef fbc:geneProduct="buc_BU425"/> | |
| 16957 </fbc:geneProductAssociation> | |
| 16958 <listOfReactants> | |
| 16959 <speciesReference constant="true" species="C02463" stoichiometry="1"/> | |
| 16960 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 16961 </listOfReactants> | |
| 16962 <listOfProducts> | |
| 16963 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 16964 <speciesReference constant="true" species="C05778" stoichiometry="1"/> | |
| 16965 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 16966 </listOfProducts> | |
| 16967 </reaction> | |
| 16968 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02736" metaid="e82b4fc6-77ad-4156-a4cc-548069496035" name="beta-D-glucose-6-phosphate:NADP+ 1-oxoreductase" reversible="true"> | |
| 16969 <notes> | |
| 16970 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 16971 <p>SUBSYSTEM: Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glutathione metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pentose phosphate pathway - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 16972 <p>EC_NUMBER: 1.1.1.49 / 1.1.1.363</p> | |
| 16973 <p>GENE_ASSOCIATION: buc_BU320</p> | |
| 16974 </body> | |
| 16975 </notes> | |
| 16976 <annotation> | |
| 16977 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 16978 <rdf:Description rdf:about="#e82b4fc6-77ad-4156-a4cc-548069496035"> | |
| 16979 <bqbiol:is> | |
| 16980 <rdf:Bag> | |
| 16981 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.49 / 1.1.1.363"/> | |
| 16982 </rdf:Bag> | |
| 16983 </bqbiol:is> | |
| 16984 </rdf:Description> | |
| 16985 </rdf:RDF> | |
| 16986 </annotation> | |
| 16987 <fbc:geneProductAssociation> | |
| 16988 <fbc:geneProductRef fbc:geneProduct="buc_BU320"/> | |
| 16989 </fbc:geneProductAssociation> | |
| 16990 <listOfReactants> | |
| 16991 <speciesReference constant="true" species="C01172" stoichiometry="1"/> | |
| 16992 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 16993 </listOfReactants> | |
| 16994 <listOfProducts> | |
| 16995 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 16996 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 16997 <speciesReference constant="true" species="C01236" stoichiometry="1"/> | |
| 16998 </listOfProducts> | |
| 16999 </reaction> | |
| 17000 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00317" metaid="_26061c89-c809-481a-8c70-c5fdb0f7b165" name="Acetyl phosphate phosphohydrolase" reversible="true"> | |
| 17001 <notes> | |
| 17002 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17003 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17004 <p>GENE_ASSOCIATION: buc_BU175</p> | |
| 17005 </body> | |
| 17006 </notes> | |
| 17007 <fbc:geneProductAssociation> | |
| 17008 <fbc:geneProductRef fbc:geneProduct="buc_BU175"/> | |
| 17009 </fbc:geneProductAssociation> | |
| 17010 <listOfReactants> | |
| 17011 <speciesReference constant="true" species="C00227" stoichiometry="1"/> | |
| 17012 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 17013 </listOfReactants> | |
| 17014 <listOfProducts> | |
| 17015 <speciesReference constant="true" species="C00033" stoichiometry="1"/> | |
| 17016 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 17017 </listOfProducts> | |
| 17018 </reaction> | |
| 17019 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R10118" metaid="_626bfdd5-eb74-4528-85cc-f44667f490e0" name="glutaryl-[acp]-methyl-ester:NADP+ oxidoreductase" reversible="true"> | |
| 17020 <notes> | |
| 17021 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17022 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biotin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17023 <p>EC_NUMBER: 1.3.1.10</p> | |
| 17024 <p>GENE_ASSOCIATION: buc_BU265</p> | |
| 17025 </body> | |
| 17026 </notes> | |
| 17027 <annotation> | |
| 17028 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 17029 <rdf:Description rdf:about="#_626bfdd5-eb74-4528-85cc-f44667f490e0"> | |
| 17030 <bqbiol:is> | |
| 17031 <rdf:Bag> | |
| 17032 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.3.1.10"/> | |
| 17033 </rdf:Bag> | |
| 17034 </bqbiol:is> | |
| 17035 </rdf:Description> | |
| 17036 </rdf:RDF> | |
| 17037 </annotation> | |
| 17038 <fbc:geneProductAssociation> | |
| 17039 <fbc:geneProductRef fbc:geneProduct="buc_BU265"/> | |
| 17040 </fbc:geneProductAssociation> | |
| 17041 <listOfReactants> | |
| 17042 <speciesReference constant="true" species="C20374" stoichiometry="1"/> | |
| 17043 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 17044 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 17045 </listOfReactants> | |
| 17046 <listOfProducts> | |
| 17047 <speciesReference constant="true" species="C20375" stoichiometry="1"/> | |
| 17048 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 17049 </listOfProducts> | |
| 17050 </reaction> | |
| 17051 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R10115" metaid="cbffe6b6-0c81-417c-9182-636f2d88d5e8" name="malonyl-[acyl-carrier protein]-methyl-ester:malonyl-[acyl-carrier protein] C-acyltransferase" reversible="true"> | |
| 17052 <notes> | |
| 17053 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17054 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biotin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17055 <p>EC_NUMBER: 2.3.1.41</p> | |
| 17056 <p>GENE_ASSOCIATION: buc_BU092</p> | |
| 17057 </body> | |
| 17058 </notes> | |
| 17059 <annotation> | |
| 17060 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 17061 <rdf:Description rdf:about="#cbffe6b6-0c81-417c-9182-636f2d88d5e8"> | |
| 17062 <bqbiol:is> | |
| 17063 <rdf:Bag> | |
| 17064 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.3.1.41"/> | |
| 17065 </rdf:Bag> | |
| 17066 </bqbiol:is> | |
| 17067 </rdf:Description> | |
| 17068 </rdf:RDF> | |
| 17069 </annotation> | |
| 17070 <fbc:geneProductAssociation> | |
| 17071 <fbc:geneProductRef fbc:geneProduct="buc_BU092"/> | |
| 17072 </fbc:geneProductAssociation> | |
| 17073 <listOfReactants> | |
| 17074 <speciesReference constant="true" species="C19673" stoichiometry="1"/> | |
| 17075 <speciesReference constant="true" species="C01209" stoichiometry="1"/> | |
| 17076 </listOfReactants> | |
| 17077 <listOfProducts> | |
| 17078 <speciesReference constant="true" species="C20372" stoichiometry="1"/> | |
| 17079 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 17080 <speciesReference constant="true" species="C00229" stoichiometry="1"/> | |
| 17081 </listOfProducts> | |
| 17082 </reaction> | |
| 17083 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R10116" metaid="_26d60613-639e-45f3-87bf-32857f244156" name="3-hydroxyglutaryl-[acp]-methyl-ester:NADP+ oxidoreductase" reversible="true"> | |
| 17084 <notes> | |
| 17085 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17086 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biotin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17087 <p>EC_NUMBER: 1.1.1.100</p> | |
| 17088 <p>GENE_ASSOCIATION: buc_BU351</p> | |
| 17089 </body> | |
| 17090 </notes> | |
| 17091 <annotation> | |
| 17092 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 17093 <rdf:Description rdf:about="#_26d60613-639e-45f3-87bf-32857f244156"> | |
| 17094 <bqbiol:is> | |
| 17095 <rdf:Bag> | |
| 17096 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.100"/> | |
| 17097 </rdf:Bag> | |
| 17098 </bqbiol:is> | |
| 17099 </rdf:Description> | |
| 17100 </rdf:RDF> | |
| 17101 </annotation> | |
| 17102 <fbc:geneProductAssociation> | |
| 17103 <fbc:geneProductRef fbc:geneProduct="buc_BU351"/> | |
| 17104 </fbc:geneProductAssociation> | |
| 17105 <listOfReactants> | |
| 17106 <speciesReference constant="true" species="C20372" stoichiometry="1"/> | |
| 17107 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 17108 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 17109 </listOfReactants> | |
| 17110 <listOfProducts> | |
| 17111 <speciesReference constant="true" species="C20373" stoichiometry="1"/> | |
| 17112 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 17113 </listOfProducts> | |
| 17114 </reaction> | |
| 17115 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01770" metaid="_874bc740-63a6-452e-af7a-efac1a2e6f9d" name="inosine ribohydrolase" reversible="true"> | |
| 17116 <notes> | |
| 17117 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17118 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17119 <p>GENE_ASSOCIATION: buc_BU541</p> | |
| 17120 </body> | |
| 17121 </notes> | |
| 17122 <fbc:geneProductAssociation> | |
| 17123 <fbc:geneProductRef fbc:geneProduct="buc_BU541"/> | |
| 17124 </fbc:geneProductAssociation> | |
| 17125 <listOfReactants> | |
| 17126 <speciesReference constant="true" species="C00294" stoichiometry="1"/> | |
| 17127 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 17128 </listOfReactants> | |
| 17129 <listOfProducts> | |
| 17130 <speciesReference constant="true" species="C00121" stoichiometry="1"/> | |
| 17131 <speciesReference constant="true" species="C00262" stoichiometry="1"/> | |
| 17132 </listOfProducts> | |
| 17133 </reaction> | |
| 17134 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02740" metaid="_074ab53d-726c-4c6b-97ba-3ef15252337c" name="alpha-D-Glucose 6-phosphate ketol-isomerase" reversible="true"> | |
| 17135 <notes> | |
| 17136 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17137 <p>SUBSYSTEM: Amino sugar and nucleotide sugar metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glycolysis / Gluconeogenesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of nucleotide sugars - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pentose phosphate pathway - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17138 <p>EC_NUMBER: 5.3.1.9</p> | |
| 17139 <p>GENE_ASSOCIATION: buc_BU573</p> | |
| 17140 </body> | |
| 17141 </notes> | |
| 17142 <annotation> | |
| 17143 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 17144 <rdf:Description rdf:about="#_074ab53d-726c-4c6b-97ba-3ef15252337c"> | |
| 17145 <bqbiol:is> | |
| 17146 <rdf:Bag> | |
| 17147 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.3.1.9"/> | |
| 17148 </rdf:Bag> | |
| 17149 </bqbiol:is> | |
| 17150 </rdf:Description> | |
| 17151 </rdf:RDF> | |
| 17152 </annotation> | |
| 17153 <fbc:geneProductAssociation> | |
| 17154 <fbc:geneProductRef fbc:geneProduct="buc_BU573"/> | |
| 17155 </fbc:geneProductAssociation> | |
| 17156 <listOfReactants> | |
| 17157 <speciesReference constant="true" species="C00668" stoichiometry="1"/> | |
| 17158 </listOfReactants> | |
| 17159 <listOfProducts> | |
| 17160 <speciesReference constant="true" species="C05345" stoichiometry="1"/> | |
| 17161 </listOfProducts> | |
| 17162 </reaction> | |
| 17163 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01771" metaid="eb816d93-1d48-4d2a-8679-5507cf1abeee" name="ATP:L-homoserine O-phosphotransferase" reversible="true"> | |
| 17164 <notes> | |
| 17165 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17166 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glycine, serine and threonine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17167 <p>EC_NUMBER: 2.7.1.39</p> | |
| 17168 <p>GENE_ASSOCIATION: buc_BU193</p> | |
| 17169 </body> | |
| 17170 </notes> | |
| 17171 <annotation> | |
| 17172 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 17173 <rdf:Description rdf:about="#eb816d93-1d48-4d2a-8679-5507cf1abeee"> | |
| 17174 <bqbiol:is> | |
| 17175 <rdf:Bag> | |
| 17176 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.39"/> | |
| 17177 </rdf:Bag> | |
| 17178 </bqbiol:is> | |
| 17179 </rdf:Description> | |
| 17180 </rdf:RDF> | |
| 17181 </annotation> | |
| 17182 <fbc:geneProductAssociation> | |
| 17183 <fbc:geneProductRef fbc:geneProduct="buc_BU193"/> | |
| 17184 </fbc:geneProductAssociation> | |
| 17185 <listOfReactants> | |
| 17186 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 17187 <speciesReference constant="true" species="C00263" stoichiometry="1"/> | |
| 17188 </listOfReactants> | |
| 17189 <listOfProducts> | |
| 17190 <speciesReference constant="true" species="C01102" stoichiometry="1"/> | |
| 17191 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 17192 </listOfProducts> | |
| 17193 </reaction> | |
| 17194 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00320" metaid="_998bc5d3-dd92-4d5d-979c-9d441f6d36cf" name="diphosphate:acetate phosphotransferase" reversible="true"> | |
| 17195 <notes> | |
| 17196 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17197 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17198 <p>GENE_ASSOCIATION: buc_BU175</p> | |
| 17199 </body> | |
| 17200 </notes> | |
| 17201 <fbc:geneProductAssociation> | |
| 17202 <fbc:geneProductRef fbc:geneProduct="buc_BU175"/> | |
| 17203 </fbc:geneProductAssociation> | |
| 17204 <listOfReactants> | |
| 17205 <speciesReference constant="true" species="C00033" stoichiometry="1"/> | |
| 17206 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 17207 </listOfReactants> | |
| 17208 <listOfProducts> | |
| 17209 <speciesReference constant="true" species="C00227" stoichiometry="1"/> | |
| 17210 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 17211 </listOfProducts> | |
| 17212 </reaction> | |
| 17213 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R09254" metaid="_9b1d3096-925d-4566-af35-ddd8e873ddca" name="L-tyrosine:pyruvate aminotransferase" reversible="true"> | |
| 17214 <notes> | |
| 17215 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17216 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17217 <p>GENE_ASSOCIATION: buc_BU101</p> | |
| 17218 </body> | |
| 17219 </notes> | |
| 17220 <fbc:geneProductAssociation> | |
| 17221 <fbc:geneProductRef fbc:geneProduct="buc_BU101"/> | |
| 17222 </fbc:geneProductAssociation> | |
| 17223 <listOfReactants> | |
| 17224 <speciesReference constant="true" species="C00082" stoichiometry="1"/> | |
| 17225 <speciesReference constant="true" species="C00022" stoichiometry="1"/> | |
| 17226 </listOfReactants> | |
| 17227 <listOfProducts> | |
| 17228 <speciesReference constant="true" species="C00041" stoichiometry="1"/> | |
| 17229 <speciesReference constant="true" species="C01179" stoichiometry="1"/> | |
| 17230 </listOfProducts> | |
| 17231 </reaction> | |
| 17232 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R10119" metaid="af7926ae-a5b0-40df-ad8f-5a8cca924a9a" name="glutaryl-[acp]-methyl-ester:malonyl-[acyl-carrier protein] C-acyltransferase (decarboxylating)" reversible="true"> | |
| 17233 <notes> | |
| 17234 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17235 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biotin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17236 <p>EC_NUMBER: 2.3.1.41</p> | |
| 17237 <p>GENE_ASSOCIATION: buc_BU092</p> | |
| 17238 </body> | |
| 17239 </notes> | |
| 17240 <annotation> | |
| 17241 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 17242 <rdf:Description rdf:about="#af7926ae-a5b0-40df-ad8f-5a8cca924a9a"> | |
| 17243 <bqbiol:is> | |
| 17244 <rdf:Bag> | |
| 17245 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.3.1.41"/> | |
| 17246 </rdf:Bag> | |
| 17247 </bqbiol:is> | |
| 17248 </rdf:Description> | |
| 17249 </rdf:RDF> | |
| 17250 </annotation> | |
| 17251 <fbc:geneProductAssociation> | |
| 17252 <fbc:geneProductRef fbc:geneProduct="buc_BU092"/> | |
| 17253 </fbc:geneProductAssociation> | |
| 17254 <listOfReactants> | |
| 17255 <speciesReference constant="true" species="C20375" stoichiometry="1"/> | |
| 17256 <speciesReference constant="true" species="C01209" stoichiometry="1"/> | |
| 17257 </listOfReactants> | |
| 17258 <listOfProducts> | |
| 17259 <speciesReference constant="true" species="C20376" stoichiometry="1"/> | |
| 17260 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 17261 <speciesReference constant="true" species="C00229" stoichiometry="1"/> | |
| 17262 </listOfProducts> | |
| 17263 </reaction> | |
| 17264 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R09372" metaid="f7de6999-538d-4419-81bb-73718b15340c" name="methaneselenol:NADP+ oxidoreductase" reversible="false"> | |
| 17265 <notes> | |
| 17266 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17267 <p>SUBSYSTEM: Selenocompound metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17268 <p>EC_NUMBER: 1.8.1.9</p> | |
| 17269 <p>GENE_ASSOCIATION: buc_BU314</p> | |
| 17270 </body> | |
| 17271 </notes> | |
| 17272 <annotation> | |
| 17273 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 17274 <rdf:Description rdf:about="#f7de6999-538d-4419-81bb-73718b15340c"> | |
| 17275 <bqbiol:is> | |
| 17276 <rdf:Bag> | |
| 17277 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.8.1.9"/> | |
| 17278 </rdf:Bag> | |
| 17279 </bqbiol:is> | |
| 17280 </rdf:Description> | |
| 17281 </rdf:RDF> | |
| 17282 </annotation> | |
| 17283 <fbc:geneProductAssociation> | |
| 17284 <fbc:geneProductRef fbc:geneProduct="buc_BU314"/> | |
| 17285 </fbc:geneProductAssociation> | |
| 17286 <listOfReactants> | |
| 17287 <speciesReference constant="true" species="C00080" stoichiometry="2"/> | |
| 17288 <speciesReference constant="true" species="C00005" stoichiometry="2"/> | |
| 17289 <speciesReference constant="true" species="C18902" stoichiometry="1"/> | |
| 17290 </listOfReactants> | |
| 17291 <listOfProducts> | |
| 17292 <speciesReference constant="true" species="C00006" stoichiometry="2"/> | |
| 17293 <speciesReference constant="true" species="C05703" stoichiometry="1"/> | |
| 17294 <speciesReference constant="true" species="C00001" stoichiometry="2"/> | |
| 17295 </listOfProducts> | |
| 17296 </reaction> | |
| 17297 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00586" metaid="_75d0b5b1-724a-4ac0-b59e-1e809e19ee32" name="acetyl-CoA:L-serine O-acetyltransferase" reversible="true"> | |
| 17298 <notes> | |
| 17299 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17300 <p>SUBSYSTEM: Sulfur metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Cysteine and methionine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17301 <p>EC_NUMBER: 2.3.1.30</p> | |
| 17302 <p>GENE_ASSOCIATION: buc_BU054</p> | |
| 17303 </body> | |
| 17304 </notes> | |
| 17305 <annotation> | |
| 17306 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 17307 <rdf:Description rdf:about="#_75d0b5b1-724a-4ac0-b59e-1e809e19ee32"> | |
| 17308 <bqbiol:is> | |
| 17309 <rdf:Bag> | |
| 17310 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.3.1.30"/> | |
| 17311 </rdf:Bag> | |
| 17312 </bqbiol:is> | |
| 17313 </rdf:Description> | |
| 17314 </rdf:RDF> | |
| 17315 </annotation> | |
| 17316 <fbc:geneProductAssociation> | |
| 17317 <fbc:geneProductRef fbc:geneProduct="buc_BU054"/> | |
| 17318 </fbc:geneProductAssociation> | |
| 17319 <listOfReactants> | |
| 17320 <speciesReference constant="true" species="C00024" stoichiometry="1"/> | |
| 17321 <speciesReference constant="true" species="C00065" stoichiometry="1"/> | |
| 17322 </listOfReactants> | |
| 17323 <listOfProducts> | |
| 17324 <speciesReference constant="true" species="C00979" stoichiometry="1"/> | |
| 17325 <speciesReference constant="true" species="C00010" stoichiometry="1"/> | |
| 17326 </listOfProducts> | |
| 17327 </reaction> | |
| 17328 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00103" metaid="e5bb421f-f000-4ecf-8207-25b84330f42a" name="NAD+ phosphohydrolase" reversible="true"> | |
| 17329 <notes> | |
| 17330 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17331 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17332 <p>GENE_ASSOCIATION: buc_BU446</p> | |
| 17333 </body> | |
| 17334 </notes> | |
| 17335 <fbc:geneProductAssociation> | |
| 17336 <fbc:geneProductRef fbc:geneProduct="buc_BU446"/> | |
| 17337 </fbc:geneProductAssociation> | |
| 17338 <listOfReactants> | |
| 17339 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 17340 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 17341 </listOfReactants> | |
| 17342 <listOfProducts> | |
| 17343 <speciesReference constant="true" species="C00455" stoichiometry="1"/> | |
| 17344 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 17345 </listOfProducts> | |
| 17346 </reaction> | |
| 17347 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00104" metaid="_3e7e8c17-4b4c-439c-bdcf-745a9aea14be" name="ATP:NAD+ 2'-phosphotransferase" reversible="true"> | |
| 17348 <notes> | |
| 17349 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17350 <p>SUBSYSTEM: Nicotinate and nicotinamide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17351 <p>EC_NUMBER: 2.7.1.23</p> | |
| 17352 <p>GENE_ASSOCIATION: buc_BU185</p> | |
| 17353 </body> | |
| 17354 </notes> | |
| 17355 <annotation> | |
| 17356 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 17357 <rdf:Description rdf:about="#_3e7e8c17-4b4c-439c-bdcf-745a9aea14be"> | |
| 17358 <bqbiol:is> | |
| 17359 <rdf:Bag> | |
| 17360 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.23"/> | |
| 17361 </rdf:Bag> | |
| 17362 </bqbiol:is> | |
| 17363 </rdf:Description> | |
| 17364 </rdf:RDF> | |
| 17365 </annotation> | |
| 17366 <fbc:geneProductAssociation> | |
| 17367 <fbc:geneProductRef fbc:geneProduct="buc_BU185"/> | |
| 17368 </fbc:geneProductAssociation> | |
| 17369 <listOfReactants> | |
| 17370 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 17371 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 17372 </listOfReactants> | |
| 17373 <listOfProducts> | |
| 17374 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 17375 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 17376 </listOfProducts> | |
| 17377 </reaction> | |
| 17378 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01677" metaid="_256e5213-84d0-482b-abc3-a3dadc6a2def" name="guanosine ribohydrolase" reversible="true"> | |
| 17379 <notes> | |
| 17380 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17381 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17382 <p>GENE_ASSOCIATION: buc_BU541</p> | |
| 17383 </body> | |
| 17384 </notes> | |
| 17385 <fbc:geneProductAssociation> | |
| 17386 <fbc:geneProductRef fbc:geneProduct="buc_BU541"/> | |
| 17387 </fbc:geneProductAssociation> | |
| 17388 <listOfReactants> | |
| 17389 <speciesReference constant="true" species="C00387" stoichiometry="1"/> | |
| 17390 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 17391 </listOfReactants> | |
| 17392 <listOfProducts> | |
| 17393 <speciesReference constant="true" species="C00121" stoichiometry="1"/> | |
| 17394 <speciesReference constant="true" species="C00242" stoichiometry="1"/> | |
| 17395 </listOfProducts> | |
| 17396 </reaction> | |
| 17397 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00226" metaid="_0a654c65-dbd8-4097-9012-ce0a406e21f5" name="pyruvate:pyruvate acetaldehydetransferase (decarboxylating)" reversible="true"> | |
| 17398 <notes> | |
| 17399 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17400 <p>SUBSYSTEM: C5-Branched dibasic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pantothenate and CoA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Valine, leucine and isoleucine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17401 <p>EC_NUMBER: 2.2.1.6</p> | |
| 17402 <p>GENE_ASSOCIATION: ( buc_BU225 ) OR ( buc_BU226 )</p> | |
| 17403 </body> | |
| 17404 </notes> | |
| 17405 <annotation> | |
| 17406 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 17407 <rdf:Description rdf:about="#_0a654c65-dbd8-4097-9012-ce0a406e21f5"> | |
| 17408 <bqbiol:is> | |
| 17409 <rdf:Bag> | |
| 17410 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.2.1.6"/> | |
| 17411 </rdf:Bag> | |
| 17412 </bqbiol:is> | |
| 17413 </rdf:Description> | |
| 17414 </rdf:RDF> | |
| 17415 </annotation> | |
| 17416 <fbc:geneProductAssociation> | |
| 17417 <fbc:or> | |
| 17418 <fbc:geneProductRef fbc:geneProduct="buc_BU225"/> | |
| 17419 <fbc:geneProductRef fbc:geneProduct="buc_BU226"/> | |
| 17420 </fbc:or> | |
| 17421 </fbc:geneProductAssociation> | |
| 17422 <listOfReactants> | |
| 17423 <speciesReference constant="true" species="C06010" stoichiometry="1"/> | |
| 17424 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 17425 </listOfReactants> | |
| 17426 <listOfProducts> | |
| 17427 <speciesReference constant="true" species="C00022" stoichiometry="2"/> | |
| 17428 </listOfProducts> | |
| 17429 </reaction> | |
| 17430 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02768" metaid="b6cb54d2-a123-4abc-8f3b-fe0b3ca9d70f" name="acyl-[acyl-carrier-protein]:malonyl-[acyl-carrier-protein] C-acyltransferase (decarboxylating)" reversible="false"> | |
| 17431 <notes> | |
| 17432 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17433 <p>SUBSYSTEM: Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17434 <p>EC_NUMBER: 2.3.1.41</p> | |
| 17435 <p>GENE_ASSOCIATION: buc_BU092</p> | |
| 17436 </body> | |
| 17437 </notes> | |
| 17438 <annotation> | |
| 17439 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 17440 <rdf:Description rdf:about="#b6cb54d2-a123-4abc-8f3b-fe0b3ca9d70f"> | |
| 17441 <bqbiol:is> | |
| 17442 <rdf:Bag> | |
| 17443 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.3.1.41"/> | |
| 17444 </rdf:Bag> | |
| 17445 </bqbiol:is> | |
| 17446 </rdf:Description> | |
| 17447 </rdf:RDF> | |
| 17448 </annotation> | |
| 17449 <fbc:geneProductAssociation> | |
| 17450 <fbc:geneProductRef fbc:geneProduct="buc_BU092"/> | |
| 17451 </fbc:geneProductAssociation> | |
| 17452 <listOfReactants> | |
| 17453 <speciesReference constant="true" species="C00173" stoichiometry="1"/> | |
| 17454 <speciesReference constant="true" species="C01209" stoichiometry="1"/> | |
| 17455 </listOfReactants> | |
| 17456 <listOfProducts> | |
| 17457 <speciesReference constant="true" species="C00685" stoichiometry="1"/> | |
| 17458 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 17459 <speciesReference constant="true" species="C00229" stoichiometry="1"/> | |
| 17460 </listOfProducts> | |
| 17461 </reaction> | |
| 17462 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R12691" metaid="_4d601935-f394-4d24-b7cc-75d1719185d8" name="R12691" reversible="true"> | |
| 17463 <notes> | |
| 17464 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17465 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17466 <p>GENE_ASSOCIATION: buc_BU269</p> | |
| 17467 </body> | |
| 17468 </notes> | |
| 17469 <fbc:geneProductAssociation> | |
| 17470 <fbc:geneProductRef fbc:geneProduct="buc_BU269"/> | |
| 17471 </fbc:geneProductAssociation> | |
| 17472 <listOfReactants> | |
| 17473 <speciesReference constant="true" species="C22159" stoichiometry="1"/> | |
| 17474 </listOfReactants> | |
| 17475 <listOfProducts> | |
| 17476 <speciesReference constant="true" species="C02972" stoichiometry="1"/> | |
| 17477 </listOfProducts> | |
| 17478 </reaction> | |
| 17479 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02767" metaid="_5ed74d1e-56f1-471e-a76b-98cc6e32df36" name="(3R)-3-hydroxyacyl-[acyl-carrier-protein]:NADP+ oxidoreductase" reversible="true"> | |
| 17480 <notes> | |
| 17481 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17482 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17483 <p>EC_NUMBER: 1.1.1.100</p> | |
| 17484 <p>GENE_ASSOCIATION: buc_BU351</p> | |
| 17485 </body> | |
| 17486 </notes> | |
| 17487 <annotation> | |
| 17488 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 17489 <rdf:Description rdf:about="#_5ed74d1e-56f1-471e-a76b-98cc6e32df36"> | |
| 17490 <bqbiol:is> | |
| 17491 <rdf:Bag> | |
| 17492 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.100"/> | |
| 17493 </rdf:Bag> | |
| 17494 </bqbiol:is> | |
| 17495 </rdf:Description> | |
| 17496 </rdf:RDF> | |
| 17497 </annotation> | |
| 17498 <fbc:geneProductAssociation> | |
| 17499 <fbc:geneProductRef fbc:geneProduct="buc_BU351"/> | |
| 17500 </fbc:geneProductAssociation> | |
| 17501 <listOfReactants> | |
| 17502 <speciesReference constant="true" species="C01271" stoichiometry="1"/> | |
| 17503 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 17504 </listOfReactants> | |
| 17505 <listOfProducts> | |
| 17506 <speciesReference constant="true" species="C00685" stoichiometry="1"/> | |
| 17507 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 17508 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 17509 </listOfProducts> | |
| 17510 </reaction> | |
| 17511 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02649" metaid="cb0c6089-a7bd-4797-935f-415d39196e2d" name="ATP:N-acetyl-L-glutamate 5-phosphotransferase" reversible="true"> | |
| 17512 <notes> | |
| 17513 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17514 <p>SUBSYSTEM: Arginine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17515 <p>EC_NUMBER: 2.7.2.8</p> | |
| 17516 <p>GENE_ASSOCIATION: buc_BU049</p> | |
| 17517 </body> | |
| 17518 </notes> | |
| 17519 <annotation> | |
| 17520 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 17521 <rdf:Description rdf:about="#cb0c6089-a7bd-4797-935f-415d39196e2d"> | |
| 17522 <bqbiol:is> | |
| 17523 <rdf:Bag> | |
| 17524 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.2.8"/> | |
| 17525 </rdf:Bag> | |
| 17526 </bqbiol:is> | |
| 17527 </rdf:Description> | |
| 17528 </rdf:RDF> | |
| 17529 </annotation> | |
| 17530 <fbc:geneProductAssociation> | |
| 17531 <fbc:geneProductRef fbc:geneProduct="buc_BU049"/> | |
| 17532 </fbc:geneProductAssociation> | |
| 17533 <listOfReactants> | |
| 17534 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 17535 <speciesReference constant="true" species="C00624" stoichiometry="1"/> | |
| 17536 </listOfReactants> | |
| 17537 <listOfProducts> | |
| 17538 <speciesReference constant="true" species="C04133" stoichiometry="1"/> | |
| 17539 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 17540 </listOfProducts> | |
| 17541 </reaction> | |
| 17542 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R10146" metaid="_59ff58c2-4b1b-470f-bb81-b2822ebb6f96" name="R10146" reversible="true"> | |
| 17543 <notes> | |
| 17544 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17545 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17546 <p>GENE_ASSOCIATION: ( buc_BU427 ) OR ( buc_BU428 )</p> | |
| 17547 </body> | |
| 17548 </notes> | |
| 17549 <fbc:geneProductAssociation> | |
| 17550 <fbc:or> | |
| 17551 <fbc:geneProductRef fbc:geneProduct="buc_BU427"/> | |
| 17552 <fbc:geneProductRef fbc:geneProduct="buc_BU428"/> | |
| 17553 </fbc:or> | |
| 17554 </fbc:geneProductAssociation> | |
| 17555 <listOfReactants> | |
| 17556 <speciesReference constant="true" species="C00080" stoichiometry="3"/> | |
| 17557 <speciesReference constant="true" species="C00004" stoichiometry="3"/> | |
| 17558 <speciesReference constant="true" species="C00094" stoichiometry="1"/> | |
| 17559 </listOfReactants> | |
| 17560 <listOfProducts> | |
| 17561 <speciesReference constant="true" species="C00001" stoichiometry="3"/> | |
| 17562 <speciesReference constant="true" species="C00003" stoichiometry="3"/> | |
| 17563 <speciesReference constant="true" species="C00283" stoichiometry="1"/> | |
| 17564 </listOfProducts> | |
| 17565 </reaction> | |
| 17566 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01561" metaid="_96380344-3bbc-4a51-9ac5-c7f61cb390f9" name="adenosine:phosphate alpha-D-ribosyltransferase" reversible="true"> | |
| 17567 <notes> | |
| 17568 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17569 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17570 <p>EC_NUMBER: 2.4.2.1</p> | |
| 17571 <p>GENE_ASSOCIATION: buc_BU541</p> | |
| 17572 </body> | |
| 17573 </notes> | |
| 17574 <annotation> | |
| 17575 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 17576 <rdf:Description rdf:about="#_96380344-3bbc-4a51-9ac5-c7f61cb390f9"> | |
| 17577 <bqbiol:is> | |
| 17578 <rdf:Bag> | |
| 17579 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.4.2.1"/> | |
| 17580 </rdf:Bag> | |
| 17581 </bqbiol:is> | |
| 17582 </rdf:Description> | |
| 17583 </rdf:RDF> | |
| 17584 </annotation> | |
| 17585 <fbc:geneProductAssociation> | |
| 17586 <fbc:geneProductRef fbc:geneProduct="buc_BU541"/> | |
| 17587 </fbc:geneProductAssociation> | |
| 17588 <listOfReactants> | |
| 17589 <speciesReference constant="true" species="C00212" stoichiometry="1"/> | |
| 17590 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 17591 </listOfReactants> | |
| 17592 <listOfProducts> | |
| 17593 <speciesReference constant="true" species="C00620" stoichiometry="1"/> | |
| 17594 <speciesReference constant="true" species="C00147" stoichiometry="1"/> | |
| 17595 </listOfProducts> | |
| 17596 </reaction> | |
| 17597 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00230" metaid="_4319e2ee-a8da-46e1-8f57-069851d769d7" name="acetyl-CoA:phosphate acetyltransferase" reversible="true"> | |
| 17598 <notes> | |
| 17599 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17600 <p>SUBSYSTEM: Pyruvate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Taurine and hypotaurine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Methane metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17601 <p>EC_NUMBER: 2.3.1.8</p> | |
| 17602 <p>GENE_ASSOCIATION: buc_BU176</p> | |
| 17603 </body> | |
| 17604 </notes> | |
| 17605 <annotation> | |
| 17606 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 17607 <rdf:Description rdf:about="#_4319e2ee-a8da-46e1-8f57-069851d769d7"> | |
| 17608 <bqbiol:is> | |
| 17609 <rdf:Bag> | |
| 17610 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.3.1.8"/> | |
| 17611 </rdf:Bag> | |
| 17612 </bqbiol:is> | |
| 17613 </rdf:Description> | |
| 17614 </rdf:RDF> | |
| 17615 </annotation> | |
| 17616 <fbc:geneProductAssociation> | |
| 17617 <fbc:geneProductRef fbc:geneProduct="buc_BU176"/> | |
| 17618 </fbc:geneProductAssociation> | |
| 17619 <listOfReactants> | |
| 17620 <speciesReference constant="true" species="C00024" stoichiometry="1"/> | |
| 17621 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 17622 </listOfReactants> | |
| 17623 <listOfProducts> | |
| 17624 <speciesReference constant="true" species="C00227" stoichiometry="1"/> | |
| 17625 <speciesReference constant="true" species="C00010" stoichiometry="1"/> | |
| 17626 </listOfProducts> | |
| 17627 </reaction> | |
| 17628 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R10147" metaid="e2cf822b-c57a-4db9-8827-e5638cfaf218" name="L-aspartate-4-semialdehyde hydro-lyase [adding pyruvate and cyclizing (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate-forming]" reversible="true"> | |
| 17629 <notes> | |
| 17630 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17631 <p>SUBSYSTEM: Lysine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Monobactam biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17632 <p>EC_NUMBER: 4.3.3.7</p> | |
| 17633 <p>GENE_ASSOCIATION: buc_BU096</p> | |
| 17634 </body> | |
| 17635 </notes> | |
| 17636 <annotation> | |
| 17637 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 17638 <rdf:Description rdf:about="#e2cf822b-c57a-4db9-8827-e5638cfaf218"> | |
| 17639 <bqbiol:is> | |
| 17640 <rdf:Bag> | |
| 17641 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.3.3.7"/> | |
| 17642 </rdf:Bag> | |
| 17643 </bqbiol:is> | |
| 17644 </rdf:Description> | |
| 17645 </rdf:RDF> | |
| 17646 </annotation> | |
| 17647 <fbc:geneProductAssociation> | |
| 17648 <fbc:geneProductRef fbc:geneProduct="buc_BU096"/> | |
| 17649 </fbc:geneProductAssociation> | |
| 17650 <listOfReactants> | |
| 17651 <speciesReference constant="true" species="C00441" stoichiometry="1"/> | |
| 17652 <speciesReference constant="true" species="C00022" stoichiometry="1"/> | |
| 17653 </listOfReactants> | |
| 17654 <listOfProducts> | |
| 17655 <speciesReference constant="true" species="C20258" stoichiometry="1"/> | |
| 17656 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 17657 </listOfProducts> | |
| 17658 </reaction> | |
| 17659 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04951" metaid="_848cca1f-6910-4688-a4d3-a15608f18f47" name="R04951" reversible="true"> | |
| 17660 <notes> | |
| 17661 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17662 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glutathione metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17663 <p>EC_NUMBER: 3.4.11.1</p> | |
| 17664 <p>GENE_ASSOCIATION: buc_BU367</p> | |
| 17665 </body> | |
| 17666 </notes> | |
| 17667 <annotation> | |
| 17668 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 17669 <rdf:Description rdf:about="#_848cca1f-6910-4688-a4d3-a15608f18f47"> | |
| 17670 <bqbiol:is> | |
| 17671 <rdf:Bag> | |
| 17672 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.4.11.1"/> | |
| 17673 </rdf:Bag> | |
| 17674 </bqbiol:is> | |
| 17675 </rdf:Description> | |
| 17676 </rdf:RDF> | |
| 17677 </annotation> | |
| 17678 <fbc:geneProductAssociation> | |
| 17679 <fbc:geneProductRef fbc:geneProduct="buc_BU367"/> | |
| 17680 </fbc:geneProductAssociation> | |
| 17681 <listOfReactants> | |
| 17682 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 17683 <speciesReference constant="true" species="C05729" stoichiometry="1"/> | |
| 17684 </listOfReactants> | |
| 17685 <listOfProducts> | |
| 17686 <speciesReference constant="true" species="C05726" stoichiometry="1"/> | |
| 17687 <speciesReference constant="true" species="C00037" stoichiometry="1"/> | |
| 17688 </listOfProducts> | |
| 17689 </reaction> | |
| 17690 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00332" metaid="_2c27d46b-3668-4992-bcf5-da71790f6180" name="ATP:GMP phosphotransferase" reversible="true"> | |
| 17691 <notes> | |
| 17692 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17693 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17694 <p>EC_NUMBER: 2.7.4.8</p> | |
| 17695 <p>GENE_ASSOCIATION: buc_BU434</p> | |
| 17696 </body> | |
| 17697 </notes> | |
| 17698 <annotation> | |
| 17699 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 17700 <rdf:Description rdf:about="#_2c27d46b-3668-4992-bcf5-da71790f6180"> | |
| 17701 <bqbiol:is> | |
| 17702 <rdf:Bag> | |
| 17703 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.4.8"/> | |
| 17704 </rdf:Bag> | |
| 17705 </bqbiol:is> | |
| 17706 </rdf:Description> | |
| 17707 </rdf:RDF> | |
| 17708 </annotation> | |
| 17709 <fbc:geneProductAssociation> | |
| 17710 <fbc:geneProductRef fbc:geneProduct="buc_BU434"/> | |
| 17711 </fbc:geneProductAssociation> | |
| 17712 <listOfReactants> | |
| 17713 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 17714 <speciesReference constant="true" species="C00144" stoichiometry="1"/> | |
| 17715 </listOfReactants> | |
| 17716 <listOfProducts> | |
| 17717 <speciesReference constant="true" species="C00035" stoichiometry="1"/> | |
| 17718 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 17719 </listOfProducts> | |
| 17720 </reaction> | |
| 17721 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00212" metaid="_57028170-b75b-4d23-8846-979259107672" name="Acetyl-CoA:formate C-acetyltransferase" reversible="true"> | |
| 17722 <notes> | |
| 17723 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17724 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17725 <p>GENE_ASSOCIATION: ( buc_BU205 ) OR ( buc_BU206 ) OR ( buc_BU207 )</p> | |
| 17726 </body> | |
| 17727 </notes> | |
| 17728 <fbc:geneProductAssociation> | |
| 17729 <fbc:or> | |
| 17730 <fbc:geneProductRef fbc:geneProduct="buc_BU206"/> | |
| 17731 <fbc:geneProductRef fbc:geneProduct="buc_BU207"/> | |
| 17732 <fbc:geneProductRef fbc:geneProduct="buc_BU205"/> | |
| 17733 </fbc:or> | |
| 17734 </fbc:geneProductAssociation> | |
| 17735 <listOfReactants> | |
| 17736 <speciesReference constant="true" species="C00024" stoichiometry="1"/> | |
| 17737 <speciesReference constant="true" species="C00058" stoichiometry="1"/> | |
| 17738 </listOfReactants> | |
| 17739 <listOfProducts> | |
| 17740 <speciesReference constant="true" species="C00022" stoichiometry="1"/> | |
| 17741 <speciesReference constant="true" species="C00010" stoichiometry="1"/> | |
| 17742 </listOfProducts> | |
| 17743 </reaction> | |
| 17744 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00333" metaid="a1e1a992-5387-4263-a2d8-0a1e925df656" name="nucleoside-triphosphate:AMP phosphotransferase" reversible="true"> | |
| 17745 <notes> | |
| 17746 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17747 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17748 <p>GENE_ASSOCIATION: buc_BU484</p> | |
| 17749 </body> | |
| 17750 </notes> | |
| 17751 <fbc:geneProductAssociation> | |
| 17752 <fbc:geneProductRef fbc:geneProduct="buc_BU484"/> | |
| 17753 </fbc:geneProductAssociation> | |
| 17754 <listOfReactants> | |
| 17755 <speciesReference constant="true" species="C00201" stoichiometry="1"/> | |
| 17756 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 17757 </listOfReactants> | |
| 17758 <listOfProducts> | |
| 17759 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 17760 <speciesReference constant="true" species="C00454" stoichiometry="1"/> | |
| 17761 </listOfProducts> | |
| 17762 </reaction> | |
| 17763 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00575" metaid="_38953f21-9f91-419a-a3e3-2333e0c63d3e" name="HCO3-:L-glutamine amido-ligase (ADP-forming, carbamate-phosphorylating)" reversible="true"> | |
| 17764 <notes> | |
| 17765 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17766 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pyrimidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Alanine, aspartate and glutamate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17767 <p>EC_NUMBER: 6.3.5.5</p> | |
| 17768 <p>GENE_ASSOCIATION: ( buc_BU144 ) OR ( buc_BU145 )</p> | |
| 17769 </body> | |
| 17770 </notes> | |
| 17771 <annotation> | |
| 17772 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 17773 <rdf:Description rdf:about="#_38953f21-9f91-419a-a3e3-2333e0c63d3e"> | |
| 17774 <bqbiol:is> | |
| 17775 <rdf:Bag> | |
| 17776 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.3.5.5"/> | |
| 17777 </rdf:Bag> | |
| 17778 </bqbiol:is> | |
| 17779 </rdf:Description> | |
| 17780 </rdf:RDF> | |
| 17781 </annotation> | |
| 17782 <fbc:geneProductAssociation> | |
| 17783 <fbc:or> | |
| 17784 <fbc:geneProductRef fbc:geneProduct="buc_BU144"/> | |
| 17785 <fbc:geneProductRef fbc:geneProduct="buc_BU145"/> | |
| 17786 </fbc:or> | |
| 17787 </fbc:geneProductAssociation> | |
| 17788 <listOfReactants> | |
| 17789 <speciesReference constant="true" species="C00064" stoichiometry="1"/> | |
| 17790 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 17791 <speciesReference constant="true" species="C00288" stoichiometry="1"/> | |
| 17792 <speciesReference constant="true" species="C00002" stoichiometry="2"/> | |
| 17793 </listOfReactants> | |
| 17794 <listOfProducts> | |
| 17795 <speciesReference constant="true" species="C00025" stoichiometry="1"/> | |
| 17796 <speciesReference constant="true" species="C00169" stoichiometry="1"/> | |
| 17797 <speciesReference constant="true" species="C00008" stoichiometry="2"/> | |
| 17798 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 17799 </listOfProducts> | |
| 17800 </reaction> | |
| 17801 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01547" metaid="_35959575-86e5-444a-bc18-029a99d66a96" name="ATP:dAMP phosphotransferase" reversible="true"> | |
| 17802 <notes> | |
| 17803 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17804 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17805 <p>EC_NUMBER: 2.7.4.3</p> | |
| 17806 <p>GENE_ASSOCIATION: buc_BU484</p> | |
| 17807 </body> | |
| 17808 </notes> | |
| 17809 <annotation> | |
| 17810 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 17811 <rdf:Description rdf:about="#_35959575-86e5-444a-bc18-029a99d66a96"> | |
| 17812 <bqbiol:is> | |
| 17813 <rdf:Bag> | |
| 17814 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.4.3"/> | |
| 17815 </rdf:Bag> | |
| 17816 </bqbiol:is> | |
| 17817 </rdf:Description> | |
| 17818 </rdf:RDF> | |
| 17819 </annotation> | |
| 17820 <fbc:geneProductAssociation> | |
| 17821 <fbc:geneProductRef fbc:geneProduct="buc_BU484"/> | |
| 17822 </fbc:geneProductAssociation> | |
| 17823 <listOfReactants> | |
| 17824 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 17825 <speciesReference constant="true" species="C00360" stoichiometry="1"/> | |
| 17826 </listOfReactants> | |
| 17827 <listOfProducts> | |
| 17828 <speciesReference constant="true" species="C00206" stoichiometry="1"/> | |
| 17829 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 17830 </listOfProducts> | |
| 17831 </reaction> | |
| 17832 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01669" metaid="_7e49e710-7409-43a5-ba76-99bcd0d7c8bc" name="5,10-methylenetetrahydrofolate:deoxycytidylate 5-hydroxymethyltransferase" reversible="true"> | |
| 17833 <notes> | |
| 17834 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17835 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17836 <p>GENE_ASSOCIATION: buc_BU289</p> | |
| 17837 </body> | |
| 17838 </notes> | |
| 17839 <fbc:geneProductAssociation> | |
| 17840 <fbc:geneProductRef fbc:geneProduct="buc_BU289"/> | |
| 17841 </fbc:geneProductAssociation> | |
| 17842 <listOfReactants> | |
| 17843 <speciesReference constant="true" species="C00239" stoichiometry="1"/> | |
| 17844 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 17845 <speciesReference constant="true" species="C00143" stoichiometry="1"/> | |
| 17846 </listOfReactants> | |
| 17847 <listOfProducts> | |
| 17848 <speciesReference constant="true" species="C00101" stoichiometry="1"/> | |
| 17849 <speciesReference constant="true" species="C03997" stoichiometry="1"/> | |
| 17850 </listOfProducts> | |
| 17851 </reaction> | |
| 17852 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03968" metaid="_6aec24f1-d911-4aad-84dc-2b806a796319" name="2-Isopropylmalate hydro-lyase" reversible="true"> | |
| 17853 <notes> | |
| 17854 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17855 <p>SUBSYSTEM: 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Valine, leucine and isoleucine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17856 <p>EC_NUMBER: 4.2.1.33</p> | |
| 17857 <p>GENE_ASSOCIATION: ( buc_BUpL06 ) OR ( buc_BUpL07 )</p> | |
| 17858 </body> | |
| 17859 </notes> | |
| 17860 <annotation> | |
| 17861 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 17862 <rdf:Description rdf:about="#_6aec24f1-d911-4aad-84dc-2b806a796319"> | |
| 17863 <bqbiol:is> | |
| 17864 <rdf:Bag> | |
| 17865 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.2.1.33"/> | |
| 17866 </rdf:Bag> | |
| 17867 </bqbiol:is> | |
| 17868 </rdf:Description> | |
| 17869 </rdf:RDF> | |
| 17870 </annotation> | |
| 17871 <fbc:geneProductAssociation> | |
| 17872 <fbc:or> | |
| 17873 <fbc:geneProductRef fbc:geneProduct="buc_BUpL06"/> | |
| 17874 <fbc:geneProductRef fbc:geneProduct="buc_BUpL07"/> | |
| 17875 </fbc:or> | |
| 17876 </fbc:geneProductAssociation> | |
| 17877 <listOfReactants> | |
| 17878 <speciesReference constant="true" species="C02504" stoichiometry="1"/> | |
| 17879 </listOfReactants> | |
| 17880 <listOfProducts> | |
| 17881 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 17882 <speciesReference constant="true" species="C02631" stoichiometry="1"/> | |
| 17883 </listOfProducts> | |
| 17884 </reaction> | |
| 17885 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01858" metaid="b3dea714-a468-4e20-93b3-52ed2214d53e" name="dGTP:pyruvate 2-O-phosphotransferase" reversible="true"> | |
| 17886 <notes> | |
| 17887 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17888 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17889 <p>EC_NUMBER: 2.7.1.40</p> | |
| 17890 <p>GENE_ASSOCIATION: buc_BU319</p> | |
| 17891 </body> | |
| 17892 </notes> | |
| 17893 <annotation> | |
| 17894 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 17895 <rdf:Description rdf:about="#b3dea714-a468-4e20-93b3-52ed2214d53e"> | |
| 17896 <bqbiol:is> | |
| 17897 <rdf:Bag> | |
| 17898 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.40"/> | |
| 17899 </rdf:Bag> | |
| 17900 </bqbiol:is> | |
| 17901 </rdf:Description> | |
| 17902 </rdf:RDF> | |
| 17903 </annotation> | |
| 17904 <fbc:geneProductAssociation> | |
| 17905 <fbc:geneProductRef fbc:geneProduct="buc_BU319"/> | |
| 17906 </fbc:geneProductAssociation> | |
| 17907 <listOfReactants> | |
| 17908 <speciesReference constant="true" species="C00286" stoichiometry="1"/> | |
| 17909 <speciesReference constant="true" species="C00022" stoichiometry="1"/> | |
| 17910 </listOfReactants> | |
| 17911 <listOfProducts> | |
| 17912 <speciesReference constant="true" species="C00074" stoichiometry="1"/> | |
| 17913 <speciesReference constant="true" species="C00361" stoichiometry="1"/> | |
| 17914 </listOfProducts> | |
| 17915 </reaction> | |
| 17916 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00529" metaid="_7742a71e-96a8-4de6-a4e7-0ac83f07d2ee" name="ATP:sulfate adenylyltransferase" reversible="true"> | |
| 17917 <notes> | |
| 17918 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17919 <p>SUBSYSTEM: Sulfur metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Monobactam biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17920 <p>EC_NUMBER: 2.7.7.4</p> | |
| 17921 <p>GENE_ASSOCIATION: ( buc_BU423 ) OR ( buc_BU424 )</p> | |
| 17922 </body> | |
| 17923 </notes> | |
| 17924 <annotation> | |
| 17925 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 17926 <rdf:Description rdf:about="#_7742a71e-96a8-4de6-a4e7-0ac83f07d2ee"> | |
| 17927 <bqbiol:is> | |
| 17928 <rdf:Bag> | |
| 17929 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.7.4"/> | |
| 17930 </rdf:Bag> | |
| 17931 </bqbiol:is> | |
| 17932 </rdf:Description> | |
| 17933 </rdf:RDF> | |
| 17934 </annotation> | |
| 17935 <fbc:geneProductAssociation> | |
| 17936 <fbc:or> | |
| 17937 <fbc:geneProductRef fbc:geneProduct="buc_BU423"/> | |
| 17938 <fbc:geneProductRef fbc:geneProduct="buc_BU424"/> | |
| 17939 </fbc:or> | |
| 17940 </fbc:geneProductAssociation> | |
| 17941 <listOfReactants> | |
| 17942 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 17943 <speciesReference constant="true" species="C00059" stoichiometry="1"/> | |
| 17944 </listOfReactants> | |
| 17945 <listOfProducts> | |
| 17946 <speciesReference constant="true" species="C00224" stoichiometry="1"/> | |
| 17947 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 17948 </listOfProducts> | |
| 17949 </reaction> | |
| 17950 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00761" metaid="_9d1fd446-aa3a-446c-bd1f-9a862799dc91" name="D-fructose-6-phosphate D-erythrose-4-phosphate-lyase (adding phosphate acetyl-phosphate-forming)" reversible="true"> | |
| 17951 <notes> | |
| 17952 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17953 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17954 <p>GENE_ASSOCIATION: buc_BU094</p> | |
| 17955 </body> | |
| 17956 </notes> | |
| 17957 <fbc:geneProductAssociation> | |
| 17958 <fbc:geneProductRef fbc:geneProduct="buc_BU094"/> | |
| 17959 </fbc:geneProductAssociation> | |
| 17960 <listOfReactants> | |
| 17961 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 17962 <speciesReference constant="true" species="C00085" stoichiometry="1"/> | |
| 17963 </listOfReactants> | |
| 17964 <listOfProducts> | |
| 17965 <speciesReference constant="true" species="C00227" stoichiometry="1"/> | |
| 17966 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 17967 <speciesReference constant="true" species="C00279" stoichiometry="1"/> | |
| 17968 </listOfProducts> | |
| 17969 </reaction> | |
| 17970 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00762" metaid="e335aae7-304b-4dd0-8145-8de060dfb6c4" name="D-Fructose-1,6-bisphosphate 1-phosphohydrolase" reversible="true"> | |
| 17971 <notes> | |
| 17972 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17973 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17974 <p>GENE_ASSOCIATION: buc_BU305</p> | |
| 17975 </body> | |
| 17976 </notes> | |
| 17977 <fbc:geneProductAssociation> | |
| 17978 <fbc:geneProductRef fbc:geneProduct="buc_BU305"/> | |
| 17979 </fbc:geneProductAssociation> | |
| 17980 <listOfReactants> | |
| 17981 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 17982 <speciesReference constant="true" species="C00354" stoichiometry="1"/> | |
| 17983 </listOfReactants> | |
| 17984 <listOfProducts> | |
| 17985 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 17986 <speciesReference constant="true" species="C00085" stoichiometry="1"/> | |
| 17987 </listOfProducts> | |
| 17988 </reaction> | |
| 17989 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02821" metaid="bbe8ce3f-c48e-47fa-9a52-54f87c598143" name="Trimethylaminoacetate:L-homosysteine S-methyltransferase" reversible="true"> | |
| 17990 <notes> | |
| 17991 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 17992 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 17993 <p>GENE_ASSOCIATION: buc_BU030</p> | |
| 17994 </body> | |
| 17995 </notes> | |
| 17996 <fbc:geneProductAssociation> | |
| 17997 <fbc:geneProductRef fbc:geneProduct="buc_BU030"/> | |
| 17998 </fbc:geneProductAssociation> | |
| 17999 <listOfReactants> | |
| 18000 <speciesReference constant="true" species="C00719" stoichiometry="1"/> | |
| 18001 <speciesReference constant="true" species="C00155" stoichiometry="1"/> | |
| 18002 </listOfReactants> | |
| 18003 <listOfProducts> | |
| 18004 <speciesReference constant="true" species="C00073" stoichiometry="1"/> | |
| 18005 <speciesReference constant="true" species="C01026" stoichiometry="1"/> | |
| 18006 </listOfProducts> | |
| 18007 </reaction> | |
| 18008 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02704" metaid="_51a066ee-1339-4046-9d86-7392f1a4115d" name="protein-N(pi)-phosphohistidine:mannitol 1-phosphotransferase" reversible="true"> | |
| 18009 <notes> | |
| 18010 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18011 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fructose and mannose metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18012 <p>EC_NUMBER: 2.7.1.197</p> | |
| 18013 <p>GENE_ASSOCIATION: buc_BU572</p> | |
| 18014 </body> | |
| 18015 </notes> | |
| 18016 <annotation> | |
| 18017 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18018 <rdf:Description rdf:about="#_51a066ee-1339-4046-9d86-7392f1a4115d"> | |
| 18019 <bqbiol:is> | |
| 18020 <rdf:Bag> | |
| 18021 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.197"/> | |
| 18022 </rdf:Bag> | |
| 18023 </bqbiol:is> | |
| 18024 </rdf:Description> | |
| 18025 </rdf:RDF> | |
| 18026 </annotation> | |
| 18027 <fbc:geneProductAssociation> | |
| 18028 <fbc:geneProductRef fbc:geneProduct="buc_BU572"/> | |
| 18029 </fbc:geneProductAssociation> | |
| 18030 <listOfReactants> | |
| 18031 <speciesReference constant="true" species="C04261" stoichiometry="1"/> | |
| 18032 <speciesReference constant="true" species="C00392" stoichiometry="1"/> | |
| 18033 </listOfReactants> | |
| 18034 <listOfProducts> | |
| 18035 <speciesReference constant="true" species="C00615" stoichiometry="1"/> | |
| 18036 <speciesReference constant="true" species="C00644" stoichiometry="1"/> | |
| 18037 </listOfProducts> | |
| 18038 </reaction> | |
| 18039 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01736" metaid="_312115e6-4cfc-4997-ae02-325eacdea938" name="(R)-S-Lactoylglutathione hydrolase" reversible="true"> | |
| 18040 <notes> | |
| 18041 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18042 <p>SUBSYSTEM: Pyruvate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18043 <p>EC_NUMBER: 3.1.2.6</p> | |
| 18044 <p>GENE_ASSOCIATION: buc_BU246</p> | |
| 18045 </body> | |
| 18046 </notes> | |
| 18047 <annotation> | |
| 18048 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18049 <rdf:Description rdf:about="#_312115e6-4cfc-4997-ae02-325eacdea938"> | |
| 18050 <bqbiol:is> | |
| 18051 <rdf:Bag> | |
| 18052 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.1.2.6"/> | |
| 18053 </rdf:Bag> | |
| 18054 </bqbiol:is> | |
| 18055 </rdf:Description> | |
| 18056 </rdf:RDF> | |
| 18057 </annotation> | |
| 18058 <fbc:geneProductAssociation> | |
| 18059 <fbc:geneProductRef fbc:geneProduct="buc_BU246"/> | |
| 18060 </fbc:geneProductAssociation> | |
| 18061 <listOfReactants> | |
| 18062 <speciesReference constant="true" species="C03451" stoichiometry="1"/> | |
| 18063 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 18064 </listOfReactants> | |
| 18065 <listOfProducts> | |
| 18066 <speciesReference constant="true" species="C00051" stoichiometry="1"/> | |
| 18067 <speciesReference constant="true" species="C00256" stoichiometry="1"/> | |
| 18068 </listOfProducts> | |
| 18069 </reaction> | |
| 18070 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00768" metaid="_98c8ff73-464b-46a7-8698-de218847db72" name="L-glutamine:D-fructose-6-phosphate isomerase (deaminating)" reversible="true"> | |
| 18071 <notes> | |
| 18072 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18073 <p>SUBSYSTEM: Amino sugar and nucleotide sugar metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Alanine, aspartate and glutamate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of nucleotide sugars - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18074 <p>EC_NUMBER: 2.6.1.16</p> | |
| 18075 <p>GENE_ASSOCIATION: buc_BU026</p> | |
| 18076 </body> | |
| 18077 </notes> | |
| 18078 <annotation> | |
| 18079 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18080 <rdf:Description rdf:about="#_98c8ff73-464b-46a7-8698-de218847db72"> | |
| 18081 <bqbiol:is> | |
| 18082 <rdf:Bag> | |
| 18083 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.6.1.16"/> | |
| 18084 </rdf:Bag> | |
| 18085 </bqbiol:is> | |
| 18086 </rdf:Description> | |
| 18087 </rdf:RDF> | |
| 18088 </annotation> | |
| 18089 <fbc:geneProductAssociation> | |
| 18090 <fbc:geneProductRef fbc:geneProduct="buc_BU026"/> | |
| 18091 </fbc:geneProductAssociation> | |
| 18092 <listOfReactants> | |
| 18093 <speciesReference constant="true" species="C00064" stoichiometry="1"/> | |
| 18094 <speciesReference constant="true" species="C00085" stoichiometry="1"/> | |
| 18095 </listOfReactants> | |
| 18096 <listOfProducts> | |
| 18097 <speciesReference constant="true" species="C00025" stoichiometry="1"/> | |
| 18098 <speciesReference constant="true" species="C00352" stoichiometry="1"/> | |
| 18099 </listOfProducts> | |
| 18100 </reaction> | |
| 18101 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02703" metaid="_9ac6f2be-6d36-4395-939e-4277cb11d97c" name="D-Mannitol-1-phosphate:NAD+ 5-oxidoreductase" reversible="true"> | |
| 18102 <notes> | |
| 18103 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18104 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fructose and mannose metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18105 <p>EC_NUMBER: 1.1.1.17</p> | |
| 18106 <p>GENE_ASSOCIATION: buc_BU571</p> | |
| 18107 </body> | |
| 18108 </notes> | |
| 18109 <annotation> | |
| 18110 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18111 <rdf:Description rdf:about="#_9ac6f2be-6d36-4395-939e-4277cb11d97c"> | |
| 18112 <bqbiol:is> | |
| 18113 <rdf:Bag> | |
| 18114 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.17"/> | |
| 18115 </rdf:Bag> | |
| 18116 </bqbiol:is> | |
| 18117 </rdf:Description> | |
| 18118 </rdf:RDF> | |
| 18119 </annotation> | |
| 18120 <fbc:geneProductAssociation> | |
| 18121 <fbc:geneProductRef fbc:geneProduct="buc_BU571"/> | |
| 18122 </fbc:geneProductAssociation> | |
| 18123 <listOfReactants> | |
| 18124 <speciesReference constant="true" species="C00644" stoichiometry="1"/> | |
| 18125 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 18126 </listOfReactants> | |
| 18127 <listOfProducts> | |
| 18128 <speciesReference constant="true" species="C05345" stoichiometry="1"/> | |
| 18129 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 18130 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 18131 </listOfProducts> | |
| 18132 </reaction> | |
| 18133 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01857" metaid="a72ac4bb-0fdb-4748-bac3-f918b54be6c7" name="ATP:dGDP phosphotransferase" reversible="true"> | |
| 18134 <notes> | |
| 18135 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18136 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18137 <p>GENE_ASSOCIATION: buc_BU319</p> | |
| 18138 </body> | |
| 18139 </notes> | |
| 18140 <fbc:geneProductAssociation> | |
| 18141 <fbc:geneProductRef fbc:geneProduct="buc_BU319"/> | |
| 18142 </fbc:geneProductAssociation> | |
| 18143 <listOfReactants> | |
| 18144 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 18145 <speciesReference constant="true" species="C00361" stoichiometry="1"/> | |
| 18146 </listOfReactants> | |
| 18147 <listOfProducts> | |
| 18148 <speciesReference constant="true" species="C00286" stoichiometry="1"/> | |
| 18149 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 18150 </listOfProducts> | |
| 18151 </reaction> | |
| 18152 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R07168" metaid="_1c565225-c390-4dbf-a8c1-f824ea66622c" name="5-methyltetrahydrofolate:NAD+ oxidoreductase" reversible="true"> | |
| 18153 <notes> | |
| 18154 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18155 <p>SUBSYSTEM: Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || One carbon pool by folate - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18156 <p>EC_NUMBER: 1.5.1.54</p> | |
| 18157 <p>GENE_ASSOCIATION: buc_BU046</p> | |
| 18158 </body> | |
| 18159 </notes> | |
| 18160 <annotation> | |
| 18161 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18162 <rdf:Description rdf:about="#_1c565225-c390-4dbf-a8c1-f824ea66622c"> | |
| 18163 <bqbiol:is> | |
| 18164 <rdf:Bag> | |
| 18165 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.5.1.54"/> | |
| 18166 </rdf:Bag> | |
| 18167 </bqbiol:is> | |
| 18168 </rdf:Description> | |
| 18169 </rdf:RDF> | |
| 18170 </annotation> | |
| 18171 <fbc:geneProductAssociation> | |
| 18172 <fbc:geneProductRef fbc:geneProduct="buc_BU046"/> | |
| 18173 </fbc:geneProductAssociation> | |
| 18174 <listOfReactants> | |
| 18175 <speciesReference constant="true" species="C00440" stoichiometry="1"/> | |
| 18176 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 18177 </listOfReactants> | |
| 18178 <listOfProducts> | |
| 18179 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 18180 <speciesReference constant="true" species="C00143" stoichiometry="1"/> | |
| 18181 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 18182 </listOfProducts> | |
| 18183 </reaction> | |
| 18184 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R09107" metaid="ef79363c-2de5-4e91-93ba-e8046371ca3c" name="N-acetyl-L-citrulline amidohydrolase" reversible="true"> | |
| 18185 <notes> | |
| 18186 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18187 <p>SUBSYSTEM: Arginine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18188 <p>EC_NUMBER: 3.5.1.16</p> | |
| 18189 <p>GENE_ASSOCIATION: buc_BU047</p> | |
| 18190 </body> | |
| 18191 </notes> | |
| 18192 <annotation> | |
| 18193 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18194 <rdf:Description rdf:about="#ef79363c-2de5-4e91-93ba-e8046371ca3c"> | |
| 18195 <bqbiol:is> | |
| 18196 <rdf:Bag> | |
| 18197 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.5.1.16"/> | |
| 18198 </rdf:Bag> | |
| 18199 </bqbiol:is> | |
| 18200 </rdf:Description> | |
| 18201 </rdf:RDF> | |
| 18202 </annotation> | |
| 18203 <fbc:geneProductAssociation> | |
| 18204 <fbc:geneProductRef fbc:geneProduct="buc_BU047"/> | |
| 18205 </fbc:geneProductAssociation> | |
| 18206 <listOfReactants> | |
| 18207 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 18208 <speciesReference constant="true" species="C15532" stoichiometry="1"/> | |
| 18209 </listOfReactants> | |
| 18210 <listOfProducts> | |
| 18211 <speciesReference constant="true" species="C00033" stoichiometry="1"/> | |
| 18212 <speciesReference constant="true" species="C00327" stoichiometry="1"/> | |
| 18213 </listOfProducts> | |
| 18214 </reaction> | |
| 18215 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00771" metaid="d03a53fe-4c04-485f-aa63-b016ac6d9c81" name="D-glucose-6-phosphate aldose-ketose-isomerase" reversible="true"> | |
| 18216 <notes> | |
| 18217 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18218 <p>SUBSYSTEM: Starch and sucrose metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18219 <p>EC_NUMBER: 5.3.1.9</p> | |
| 18220 <p>GENE_ASSOCIATION: buc_BU573</p> | |
| 18221 </body> | |
| 18222 </notes> | |
| 18223 <annotation> | |
| 18224 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18225 <rdf:Description rdf:about="#d03a53fe-4c04-485f-aa63-b016ac6d9c81"> | |
| 18226 <bqbiol:is> | |
| 18227 <rdf:Bag> | |
| 18228 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.3.1.9"/> | |
| 18229 </rdf:Bag> | |
| 18230 </bqbiol:is> | |
| 18231 </rdf:Description> | |
| 18232 </rdf:RDF> | |
| 18233 </annotation> | |
| 18234 <fbc:geneProductAssociation> | |
| 18235 <fbc:geneProductRef fbc:geneProduct="buc_BU573"/> | |
| 18236 </fbc:geneProductAssociation> | |
| 18237 <listOfReactants> | |
| 18238 <speciesReference constant="true" species="C00092" stoichiometry="1"/> | |
| 18239 </listOfReactants> | |
| 18240 <listOfProducts> | |
| 18241 <speciesReference constant="true" species="C00085" stoichiometry="1"/> | |
| 18242 </listOfProducts> | |
| 18243 </reaction> | |
| 18244 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00650" metaid="_716a0710-2600-4356-9019-6ca2c4c1cb19" name="S-Adenosyl-L-methionine:L-homocysteine S-methyltransferase" reversible="true"> | |
| 18245 <notes> | |
| 18246 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18247 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18248 <p>GENE_ASSOCIATION: buc_BU030</p> | |
| 18249 </body> | |
| 18250 </notes> | |
| 18251 <fbc:geneProductAssociation> | |
| 18252 <fbc:geneProductRef fbc:geneProduct="buc_BU030"/> | |
| 18253 </fbc:geneProductAssociation> | |
| 18254 <listOfReactants> | |
| 18255 <speciesReference constant="true" species="C00019" stoichiometry="1"/> | |
| 18256 <speciesReference constant="true" species="C00155" stoichiometry="1"/> | |
| 18257 </listOfReactants> | |
| 18258 <listOfProducts> | |
| 18259 <speciesReference constant="true" species="C00021" stoichiometry="1"/> | |
| 18260 <speciesReference constant="true" species="C00073" stoichiometry="1"/> | |
| 18261 </listOfProducts> | |
| 18262 </reaction> | |
| 18263 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R07281" metaid="_7857b3e6-65d9-446f-affb-5a6b7c292ff7" name="D-ribulose 5-phosphate formate-lyase (L-3,4-dihydroxybutan-2-one 4-phosphate-forming)" reversible="true"> | |
| 18264 <notes> | |
| 18265 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18266 <p>SUBSYSTEM: Riboflavin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18267 <p>EC_NUMBER: 4.1.99.12</p> | |
| 18268 <p>GENE_ASSOCIATION: buc_BU059</p> | |
| 18269 </body> | |
| 18270 </notes> | |
| 18271 <annotation> | |
| 18272 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18273 <rdf:Description rdf:about="#_7857b3e6-65d9-446f-affb-5a6b7c292ff7"> | |
| 18274 <bqbiol:is> | |
| 18275 <rdf:Bag> | |
| 18276 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.1.99.12"/> | |
| 18277 </rdf:Bag> | |
| 18278 </bqbiol:is> | |
| 18279 </rdf:Description> | |
| 18280 </rdf:RDF> | |
| 18281 </annotation> | |
| 18282 <fbc:geneProductAssociation> | |
| 18283 <fbc:geneProductRef fbc:geneProduct="buc_BU059"/> | |
| 18284 </fbc:geneProductAssociation> | |
| 18285 <listOfReactants> | |
| 18286 <speciesReference constant="true" species="C00199" stoichiometry="1"/> | |
| 18287 </listOfReactants> | |
| 18288 <listOfProducts> | |
| 18289 <speciesReference constant="true" species="C15556" stoichiometry="1"/> | |
| 18290 <speciesReference constant="true" species="C00058" stoichiometry="1"/> | |
| 18291 </listOfProducts> | |
| 18292 </reaction> | |
| 18293 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01969" metaid="_86a57f69-628c-4d02-8bb0-6b2221c2b1ec" name="Deoxyguanosine:orthophosphate ribosyltransferase" reversible="true"> | |
| 18294 <notes> | |
| 18295 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18296 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18297 <p>EC_NUMBER: 2.4.2.1</p> | |
| 18298 <p>GENE_ASSOCIATION: buc_BU541</p> | |
| 18299 </body> | |
| 18300 </notes> | |
| 18301 <annotation> | |
| 18302 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18303 <rdf:Description rdf:about="#_86a57f69-628c-4d02-8bb0-6b2221c2b1ec"> | |
| 18304 <bqbiol:is> | |
| 18305 <rdf:Bag> | |
| 18306 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.4.2.1"/> | |
| 18307 </rdf:Bag> | |
| 18308 </bqbiol:is> | |
| 18309 </rdf:Description> | |
| 18310 </rdf:RDF> | |
| 18311 </annotation> | |
| 18312 <fbc:geneProductAssociation> | |
| 18313 <fbc:geneProductRef fbc:geneProduct="buc_BU541"/> | |
| 18314 </fbc:geneProductAssociation> | |
| 18315 <listOfReactants> | |
| 18316 <speciesReference constant="true" species="C00330" stoichiometry="1"/> | |
| 18317 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 18318 </listOfReactants> | |
| 18319 <listOfProducts> | |
| 18320 <speciesReference constant="true" species="C00672" stoichiometry="1"/> | |
| 18321 <speciesReference constant="true" species="C00242" stoichiometry="1"/> | |
| 18322 </listOfProducts> | |
| 18323 </reaction> | |
| 18324 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00994" metaid="_94c4f90f-911f-4d39-9874-5ecbf3b59a28" name="(2R,3S)-3-methylmalate:NAD+ oxidoreductase" reversible="true"> | |
| 18325 <notes> | |
| 18326 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18327 <p>SUBSYSTEM: C5-Branched dibasic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Valine, leucine and isoleucine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18328 <p>EC_NUMBER: 1.1.1.85</p> | |
| 18329 <p>GENE_ASSOCIATION: buc_BUpL05</p> | |
| 18330 </body> | |
| 18331 </notes> | |
| 18332 <annotation> | |
| 18333 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18334 <rdf:Description rdf:about="#_94c4f90f-911f-4d39-9874-5ecbf3b59a28"> | |
| 18335 <bqbiol:is> | |
| 18336 <rdf:Bag> | |
| 18337 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.85"/> | |
| 18338 </rdf:Bag> | |
| 18339 </bqbiol:is> | |
| 18340 </rdf:Description> | |
| 18341 </rdf:RDF> | |
| 18342 </annotation> | |
| 18343 <fbc:geneProductAssociation> | |
| 18344 <fbc:geneProductRef fbc:geneProduct="buc_BUpL05"/> | |
| 18345 </fbc:geneProductAssociation> | |
| 18346 <listOfReactants> | |
| 18347 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 18348 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 18349 <speciesReference constant="true" species="C00109" stoichiometry="1"/> | |
| 18350 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 18351 </listOfReactants> | |
| 18352 <listOfProducts> | |
| 18353 <speciesReference constant="true" species="C06032" stoichiometry="1"/> | |
| 18354 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 18355 </listOfProducts> | |
| 18356 </reaction> | |
| 18357 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00756" metaid="_59c42c08-3b73-4cb6-997e-cc563aa99249" name="ATP:D-fructose-6-phosphate 1-phosphotransferase" reversible="true"> | |
| 18358 <notes> | |
| 18359 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18360 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Methane metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18361 <p>EC_NUMBER: 2.7.1.11</p> | |
| 18362 <p>GENE_ASSOCIATION: buc_BU305</p> | |
| 18363 </body> | |
| 18364 </notes> | |
| 18365 <annotation> | |
| 18366 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18367 <rdf:Description rdf:about="#_59c42c08-3b73-4cb6-997e-cc563aa99249"> | |
| 18368 <bqbiol:is> | |
| 18369 <rdf:Bag> | |
| 18370 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.11"/> | |
| 18371 </rdf:Bag> | |
| 18372 </bqbiol:is> | |
| 18373 </rdf:Description> | |
| 18374 </rdf:RDF> | |
| 18375 </annotation> | |
| 18376 <fbc:geneProductAssociation> | |
| 18377 <fbc:geneProductRef fbc:geneProduct="buc_BU305"/> | |
| 18378 </fbc:geneProductAssociation> | |
| 18379 <listOfReactants> | |
| 18380 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 18381 <speciesReference constant="true" species="C00085" stoichiometry="1"/> | |
| 18382 </listOfReactants> | |
| 18383 <listOfProducts> | |
| 18384 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 18385 <speciesReference constant="true" species="C00354" stoichiometry="1"/> | |
| 18386 </listOfProducts> | |
| 18387 </reaction> | |
| 18388 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01724" metaid="bd0acf5a-7917-45d7-9865-ec8210d87f69" name="5-phospho-alpha-D-ribose 1-diphosphate:nicotinate ligase (ADP, diphosphate-forming)" reversible="true"> | |
| 18389 <notes> | |
| 18390 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18391 <p>SUBSYSTEM: Nicotinate and nicotinamide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18392 <p>EC_NUMBER: 6.3.4.21</p> | |
| 18393 <p>GENE_ASSOCIATION: buc_BU361</p> | |
| 18394 </body> | |
| 18395 </notes> | |
| 18396 <annotation> | |
| 18397 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18398 <rdf:Description rdf:about="#bd0acf5a-7917-45d7-9865-ec8210d87f69"> | |
| 18399 <bqbiol:is> | |
| 18400 <rdf:Bag> | |
| 18401 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.3.4.21"/> | |
| 18402 </rdf:Bag> | |
| 18403 </bqbiol:is> | |
| 18404 </rdf:Description> | |
| 18405 </rdf:RDF> | |
| 18406 </annotation> | |
| 18407 <fbc:geneProductAssociation> | |
| 18408 <fbc:geneProductRef fbc:geneProduct="buc_BU361"/> | |
| 18409 </fbc:geneProductAssociation> | |
| 18410 <listOfReactants> | |
| 18411 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 18412 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 18413 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 18414 <speciesReference constant="true" species="C01185" stoichiometry="1"/> | |
| 18415 </listOfReactants> | |
| 18416 <listOfProducts> | |
| 18417 <speciesReference constant="true" species="C00119" stoichiometry="1"/> | |
| 18418 <speciesReference constant="true" species="C00253" stoichiometry="1"/> | |
| 18419 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 18420 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 18421 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 18422 </listOfProducts> | |
| 18423 </reaction> | |
| 18424 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R07279" metaid="f8d26638-c44c-4fe5-a02b-0dd5e1ebc61f" name="ATP:1D-myo-inositol 3-phosphotransferase" reversible="true"> | |
| 18425 <notes> | |
| 18426 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18427 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18428 <p>GENE_ASSOCIATION: buc_BU285</p> | |
| 18429 </body> | |
| 18430 </notes> | |
| 18431 <fbc:geneProductAssociation> | |
| 18432 <fbc:geneProductRef fbc:geneProduct="buc_BU285"/> | |
| 18433 </fbc:geneProductAssociation> | |
| 18434 <listOfReactants> | |
| 18435 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 18436 <speciesReference constant="true" species="C00137" stoichiometry="1"/> | |
| 18437 </listOfReactants> | |
| 18438 <listOfProducts> | |
| 18439 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 18440 <speciesReference constant="true" species="C04006" stoichiometry="1"/> | |
| 18441 </listOfProducts> | |
| 18442 </reaction> | |
| 18443 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R11765" metaid="_72629d05-49d0-45a0-85b5-7d1f9a0aebd7" name="tetrahydrobiopterin:NADP+ oxidoreductase (7,8-dihydrobiopterin-forming)" reversible="true"> | |
| 18444 <notes> | |
| 18445 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18446 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Folate biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18447 <p>EC_NUMBER: 1.5.1.3</p> | |
| 18448 <p>GENE_ASSOCIATION: buc_BU143</p> | |
| 18449 </body> | |
| 18450 </notes> | |
| 18451 <annotation> | |
| 18452 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18453 <rdf:Description rdf:about="#_72629d05-49d0-45a0-85b5-7d1f9a0aebd7"> | |
| 18454 <bqbiol:is> | |
| 18455 <rdf:Bag> | |
| 18456 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.5.1.3"/> | |
| 18457 </rdf:Bag> | |
| 18458 </bqbiol:is> | |
| 18459 </rdf:Description> | |
| 18460 </rdf:RDF> | |
| 18461 </annotation> | |
| 18462 <fbc:geneProductAssociation> | |
| 18463 <fbc:geneProductRef fbc:geneProduct="buc_BU143"/> | |
| 18464 </fbc:geneProductAssociation> | |
| 18465 <listOfReactants> | |
| 18466 <speciesReference constant="true" species="C00272" stoichiometry="1"/> | |
| 18467 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 18468 </listOfReactants> | |
| 18469 <listOfProducts> | |
| 18470 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 18471 <speciesReference constant="true" species="C02953" stoichiometry="1"/> | |
| 18472 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 18473 </listOfProducts> | |
| 18474 </reaction> | |
| 18475 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R12852" metaid="_790e8412-0845-4d88-b095-f31ec00cbd63" name="guanylate kinase" reversible="false"> | |
| 18476 <notes> | |
| 18477 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18478 <p>SUBSYSTEM: Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18479 <p>EC_NUMBER: 2.7.4.8</p> | |
| 18480 <p>GENE_ASSOCIATION: buc_BU434</p> | |
| 18481 </body> | |
| 18482 </notes> | |
| 18483 <annotation> | |
| 18484 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18485 <rdf:Description rdf:about="#_790e8412-0845-4d88-b095-f31ec00cbd63"> | |
| 18486 <bqbiol:is> | |
| 18487 <rdf:Bag> | |
| 18488 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.4.8"/> | |
| 18489 </rdf:Bag> | |
| 18490 </bqbiol:is> | |
| 18491 </rdf:Description> | |
| 18492 </rdf:RDF> | |
| 18493 </annotation> | |
| 18494 <fbc:geneProductAssociation> | |
| 18495 <fbc:geneProductRef fbc:geneProduct="buc_BU434"/> | |
| 18496 </fbc:geneProductAssociation> | |
| 18497 <listOfReactants> | |
| 18498 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 18499 <speciesReference constant="true" species="C22441" stoichiometry="1"/> | |
| 18500 </listOfReactants> | |
| 18501 <listOfProducts> | |
| 18502 <speciesReference constant="true" species="C22442" stoichiometry="1"/> | |
| 18503 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 18504 </listOfProducts> | |
| 18505 </reaction> | |
| 18506 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R12851" metaid="f35a6086-9823-4432-8a6b-e65381a4ae04" name="adenylosuccinate lyase" reversible="false"> | |
| 18507 <notes> | |
| 18508 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18509 <p>SUBSYSTEM: Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18510 <p>EC_NUMBER: 4.3.2.2</p> | |
| 18511 <p>GENE_ASSOCIATION: buc_BU263</p> | |
| 18512 </body> | |
| 18513 </notes> | |
| 18514 <annotation> | |
| 18515 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18516 <rdf:Description rdf:about="#f35a6086-9823-4432-8a6b-e65381a4ae04"> | |
| 18517 <bqbiol:is> | |
| 18518 <rdf:Bag> | |
| 18519 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.3.2.2"/> | |
| 18520 </rdf:Bag> | |
| 18521 </bqbiol:is> | |
| 18522 </rdf:Description> | |
| 18523 </rdf:RDF> | |
| 18524 </annotation> | |
| 18525 <fbc:geneProductAssociation> | |
| 18526 <fbc:geneProductRef fbc:geneProduct="buc_BU263"/> | |
| 18527 </fbc:geneProductAssociation> | |
| 18528 <listOfReactants> | |
| 18529 <speciesReference constant="true" species="C22395" stoichiometry="1"/> | |
| 18530 </listOfReactants> | |
| 18531 <listOfProducts> | |
| 18532 <speciesReference constant="true" species="C22441" stoichiometry="1"/> | |
| 18533 <speciesReference constant="true" species="C00122" stoichiometry="1"/> | |
| 18534 </listOfProducts> | |
| 18535 </reaction> | |
| 18536 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R07390" metaid="_8b12a7b0-579d-4b71-96a6-ba84ee36e742" name="R07390" reversible="true"> | |
| 18537 <notes> | |
| 18538 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18539 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18540 <p>GENE_ASSOCIATION: buc_BU273</p> | |
| 18541 </body> | |
| 18542 </notes> | |
| 18543 <fbc:geneProductAssociation> | |
| 18544 <fbc:geneProductRef fbc:geneProduct="buc_BU273"/> | |
| 18545 </fbc:geneProductAssociation> | |
| 18546 <listOfReactants> | |
| 18547 <speciesReference constant="true" species="C00344" stoichiometry="2"/> | |
| 18548 </listOfReactants> | |
| 18549 <listOfProducts> | |
| 18550 <speciesReference constant="true" species="C00116" stoichiometry="1"/> | |
| 18551 <speciesReference constant="true" species="C05980" stoichiometry="1"/> | |
| 18552 </listOfProducts> | |
| 18553 </reaction> | |
| 18554 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R07274" metaid="ce068998-409d-4322-8579-aa766ef52d1b" name="O-phospho-L-serine:hydrogen-sulfide 2-amino-2-carboxyethyltransferase" reversible="true"> | |
| 18555 <notes> | |
| 18556 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18557 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Cysteine and methionine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18558 <p>EC_NUMBER: 2.5.1.47</p> | |
| 18559 <p>GENE_ASSOCIATION: buc_BU066</p> | |
| 18560 </body> | |
| 18561 </notes> | |
| 18562 <annotation> | |
| 18563 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18564 <rdf:Description rdf:about="#ce068998-409d-4322-8579-aa766ef52d1b"> | |
| 18565 <bqbiol:is> | |
| 18566 <rdf:Bag> | |
| 18567 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.5.1.47"/> | |
| 18568 </rdf:Bag> | |
| 18569 </bqbiol:is> | |
| 18570 </rdf:Description> | |
| 18571 </rdf:RDF> | |
| 18572 </annotation> | |
| 18573 <fbc:geneProductAssociation> | |
| 18574 <fbc:geneProductRef fbc:geneProduct="buc_BU066"/> | |
| 18575 </fbc:geneProductAssociation> | |
| 18576 <listOfReactants> | |
| 18577 <speciesReference constant="true" species="C01005" stoichiometry="1"/> | |
| 18578 <speciesReference constant="true" species="C00283" stoichiometry="1"/> | |
| 18579 </listOfReactants> | |
| 18580 <listOfProducts> | |
| 18581 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 18582 <speciesReference constant="true" species="C00097" stoichiometry="1"/> | |
| 18583 </listOfProducts> | |
| 18584 </reaction> | |
| 18585 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00549" metaid="_158255ca-8921-4a32-8939-b0b265bc3029" name="ATP:riboflavin 5'-phosphotransferase" reversible="true"> | |
| 18586 <notes> | |
| 18587 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18588 <p>SUBSYSTEM: Riboflavin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18589 <p>EC_NUMBER: 2.7.1.26</p> | |
| 18590 <p>GENE_ASSOCIATION: buc_BU150</p> | |
| 18591 </body> | |
| 18592 </notes> | |
| 18593 <annotation> | |
| 18594 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18595 <rdf:Description rdf:about="#_158255ca-8921-4a32-8939-b0b265bc3029"> | |
| 18596 <bqbiol:is> | |
| 18597 <rdf:Bag> | |
| 18598 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.26"/> | |
| 18599 </rdf:Bag> | |
| 18600 </bqbiol:is> | |
| 18601 </rdf:Description> | |
| 18602 </rdf:RDF> | |
| 18603 </annotation> | |
| 18604 <fbc:geneProductAssociation> | |
| 18605 <fbc:geneProductRef fbc:geneProduct="buc_BU150"/> | |
| 18606 </fbc:geneProductAssociation> | |
| 18607 <listOfReactants> | |
| 18608 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 18609 <speciesReference constant="true" species="C00255" stoichiometry="1"/> | |
| 18610 </listOfReactants> | |
| 18611 <listOfProducts> | |
| 18612 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 18613 <speciesReference constant="true" species="C00061" stoichiometry="1"/> | |
| 18614 </listOfProducts> | |
| 18615 </reaction> | |
| 18616 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01518" metaid="_75f38789-89a7-4d14-b28c-99c4d7beb751" name="D-phosphoglycerate 2,3-phosphomutase" reversible="true"> | |
| 18617 <notes> | |
| 18618 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18619 <p>SUBSYSTEM: Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glycolysis / Gluconeogenesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Methane metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glycine, serine and threonine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18620 <p>EC_NUMBER: 5.4.2.11</p> | |
| 18621 <p>GENE_ASSOCIATION: buc_BU304</p> | |
| 18622 </body> | |
| 18623 </notes> | |
| 18624 <annotation> | |
| 18625 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18626 <rdf:Description rdf:about="#_75f38789-89a7-4d14-b28c-99c4d7beb751"> | |
| 18627 <bqbiol:is> | |
| 18628 <rdf:Bag> | |
| 18629 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.4.2.11"/> | |
| 18630 </rdf:Bag> | |
| 18631 </bqbiol:is> | |
| 18632 </rdf:Description> | |
| 18633 </rdf:RDF> | |
| 18634 </annotation> | |
| 18635 <fbc:geneProductAssociation> | |
| 18636 <fbc:geneProductRef fbc:geneProduct="buc_BU304"/> | |
| 18637 </fbc:geneProductAssociation> | |
| 18638 <listOfReactants> | |
| 18639 <speciesReference constant="true" species="C00631" stoichiometry="1"/> | |
| 18640 </listOfReactants> | |
| 18641 <listOfProducts> | |
| 18642 <speciesReference constant="true" species="C00197" stoichiometry="1"/> | |
| 18643 </listOfProducts> | |
| 18644 </reaction> | |
| 18645 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01993" metaid="d658015b-71d0-4849-923a-836613c07778" name="(S)-dihydroorotate amidohydrolase" reversible="true"> | |
| 18646 <notes> | |
| 18647 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18648 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pyrimidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18649 <p>EC_NUMBER: 3.5.2.3</p> | |
| 18650 <p>GENE_ASSOCIATION: buc_BU334</p> | |
| 18651 </body> | |
| 18652 </notes> | |
| 18653 <annotation> | |
| 18654 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18655 <rdf:Description rdf:about="#d658015b-71d0-4849-923a-836613c07778"> | |
| 18656 <bqbiol:is> | |
| 18657 <rdf:Bag> | |
| 18658 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.5.2.3"/> | |
| 18659 </rdf:Bag> | |
| 18660 </bqbiol:is> | |
| 18661 </rdf:Description> | |
| 18662 </rdf:RDF> | |
| 18663 </annotation> | |
| 18664 <fbc:geneProductAssociation> | |
| 18665 <fbc:geneProductRef fbc:geneProduct="buc_BU334"/> | |
| 18666 </fbc:geneProductAssociation> | |
| 18667 <listOfReactants> | |
| 18668 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 18669 <speciesReference constant="true" species="C00337" stoichiometry="1"/> | |
| 18670 </listOfReactants> | |
| 18671 <listOfProducts> | |
| 18672 <speciesReference constant="true" species="C00438" stoichiometry="1"/> | |
| 18673 </listOfProducts> | |
| 18674 </reaction> | |
| 18675 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02722" metaid="b90ec3ed-ce74-4ec3-b934-b933e16a9dc3" name="L-serine hydro-lyase [adding 1-C-(indol-3-yl)glycerol 3-phosphate L-tryptophan and glyceraldehyde-3-phosphate-forming]" reversible="true"> | |
| 18676 <notes> | |
| 18677 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18678 <p>SUBSYSTEM: Phenylalanine, tyrosine and tryptophan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glycine, serine and threonine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18679 <p>EC_NUMBER: 4.2.1.20</p> | |
| 18680 <p>GENE_ASSOCIATION: ( buc_BU277 ) OR ( buc_BU278 )</p> | |
| 18681 </body> | |
| 18682 </notes> | |
| 18683 <annotation> | |
| 18684 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18685 <rdf:Description rdf:about="#b90ec3ed-ce74-4ec3-b934-b933e16a9dc3"> | |
| 18686 <bqbiol:is> | |
| 18687 <rdf:Bag> | |
| 18688 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.2.1.20"/> | |
| 18689 </rdf:Bag> | |
| 18690 </bqbiol:is> | |
| 18691 </rdf:Description> | |
| 18692 </rdf:RDF> | |
| 18693 </annotation> | |
| 18694 <fbc:geneProductAssociation> | |
| 18695 <fbc:or> | |
| 18696 <fbc:geneProductRef fbc:geneProduct="buc_BU277"/> | |
| 18697 <fbc:geneProductRef fbc:geneProduct="buc_BU278"/> | |
| 18698 </fbc:or> | |
| 18699 </fbc:geneProductAssociation> | |
| 18700 <listOfReactants> | |
| 18701 <speciesReference constant="true" species="C00065" stoichiometry="1"/> | |
| 18702 <speciesReference constant="true" species="C03506" stoichiometry="1"/> | |
| 18703 </listOfReactants> | |
| 18704 <listOfProducts> | |
| 18705 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 18706 <speciesReference constant="true" species="C00118" stoichiometry="1"/> | |
| 18707 <speciesReference constant="true" species="C00078" stoichiometry="1"/> | |
| 18708 </listOfProducts> | |
| 18709 </reaction> | |
| 18710 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01512" metaid="cd5a7596-ddc4-4d6c-ae67-b914fdc28cd9" name="ATP:3-phospho-D-glycerate 1-phosphotransferase" reversible="true"> | |
| 18711 <notes> | |
| 18712 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18713 <p>SUBSYSTEM: Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glycolysis / Gluconeogenesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18714 <p>EC_NUMBER: 2.7.2.3</p> | |
| 18715 <p>GENE_ASSOCIATION: buc_BU450</p> | |
| 18716 </body> | |
| 18717 </notes> | |
| 18718 <annotation> | |
| 18719 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18720 <rdf:Description rdf:about="#cd5a7596-ddc4-4d6c-ae67-b914fdc28cd9"> | |
| 18721 <bqbiol:is> | |
| 18722 <rdf:Bag> | |
| 18723 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.2.3"/> | |
| 18724 </rdf:Bag> | |
| 18725 </bqbiol:is> | |
| 18726 </rdf:Description> | |
| 18727 </rdf:RDF> | |
| 18728 </annotation> | |
| 18729 <fbc:geneProductAssociation> | |
| 18730 <fbc:geneProductRef fbc:geneProduct="buc_BU450"/> | |
| 18731 </fbc:geneProductAssociation> | |
| 18732 <listOfReactants> | |
| 18733 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 18734 <speciesReference constant="true" species="C00197" stoichiometry="1"/> | |
| 18735 </listOfReactants> | |
| 18736 <listOfProducts> | |
| 18737 <speciesReference constant="true" species="C00236" stoichiometry="1"/> | |
| 18738 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 18739 </listOfProducts> | |
| 18740 </reaction> | |
| 18741 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00425" metaid="ffbb0039-d3c0-4b5c-8792-5a5d543f379a" name="GTP 7,8-8,9-dihydrolase (diphosphate-forming)" reversible="true"> | |
| 18742 <notes> | |
| 18743 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18744 <p>SUBSYSTEM: Riboflavin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Folate biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18745 <p>EC_NUMBER: 3.5.4.25</p> | |
| 18746 <p>GENE_ASSOCIATION: buc_BU271</p> | |
| 18747 </body> | |
| 18748 </notes> | |
| 18749 <annotation> | |
| 18750 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18751 <rdf:Description rdf:about="#ffbb0039-d3c0-4b5c-8792-5a5d543f379a"> | |
| 18752 <bqbiol:is> | |
| 18753 <rdf:Bag> | |
| 18754 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.5.4.25"/> | |
| 18755 </rdf:Bag> | |
| 18756 </bqbiol:is> | |
| 18757 </rdf:Description> | |
| 18758 </rdf:RDF> | |
| 18759 </annotation> | |
| 18760 <fbc:geneProductAssociation> | |
| 18761 <fbc:geneProductRef fbc:geneProduct="buc_BU271"/> | |
| 18762 </fbc:geneProductAssociation> | |
| 18763 <listOfReactants> | |
| 18764 <speciesReference constant="true" species="C00001" stoichiometry="4"/> | |
| 18765 <speciesReference constant="true" species="C00044" stoichiometry="1"/> | |
| 18766 </listOfReactants> | |
| 18767 <listOfProducts> | |
| 18768 <speciesReference constant="true" species="C00009" stoichiometry="2"/> | |
| 18769 <speciesReference constant="true" species="C01304" stoichiometry="1"/> | |
| 18770 <speciesReference constant="true" species="C00058" stoichiometry="1"/> | |
| 18771 </listOfProducts> | |
| 18772 </reaction> | |
| 18773 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03815" metaid="_9b8cfb9e-7688-4ae5-8c15-2796fc0753da" name="dihydrolipoylprotein:NAD+ oxidoreductase" reversible="false"> | |
| 18774 <notes> | |
| 18775 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18776 <p>SUBSYSTEM: Glycine, serine and threonine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18777 <p>EC_NUMBER: 1.8.1.4</p> | |
| 18778 <p>GENE_ASSOCIATION: buc_BU207</p> | |
| 18779 </body> | |
| 18780 </notes> | |
| 18781 <annotation> | |
| 18782 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18783 <rdf:Description rdf:about="#_9b8cfb9e-7688-4ae5-8c15-2796fc0753da"> | |
| 18784 <bqbiol:is> | |
| 18785 <rdf:Bag> | |
| 18786 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.8.1.4"/> | |
| 18787 </rdf:Bag> | |
| 18788 </bqbiol:is> | |
| 18789 </rdf:Description> | |
| 18790 </rdf:RDF> | |
| 18791 </annotation> | |
| 18792 <fbc:geneProductAssociation> | |
| 18793 <fbc:geneProductRef fbc:geneProduct="buc_BU207"/> | |
| 18794 </fbc:geneProductAssociation> | |
| 18795 <listOfReactants> | |
| 18796 <speciesReference constant="true" species="C02972" stoichiometry="1"/> | |
| 18797 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 18798 </listOfReactants> | |
| 18799 <listOfProducts> | |
| 18800 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 18801 <speciesReference constant="true" species="C02051" stoichiometry="1"/> | |
| 18802 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 18803 </listOfProducts> | |
| 18804 </reaction> | |
| 18805 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00669" metaid="_6c1c62a8-2f95-4e5b-8caf-598a5bee4e25" name="N2-Acetyl-L-ornithine amidohydrolase" reversible="true"> | |
| 18806 <notes> | |
| 18807 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18808 <p>SUBSYSTEM: Arginine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18809 <p>EC_NUMBER: 3.5.1.16</p> | |
| 18810 <p>GENE_ASSOCIATION: buc_BU047</p> | |
| 18811 </body> | |
| 18812 </notes> | |
| 18813 <annotation> | |
| 18814 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18815 <rdf:Description rdf:about="#_6c1c62a8-2f95-4e5b-8caf-598a5bee4e25"> | |
| 18816 <bqbiol:is> | |
| 18817 <rdf:Bag> | |
| 18818 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.5.1.16"/> | |
| 18819 </rdf:Bag> | |
| 18820 </bqbiol:is> | |
| 18821 </rdf:Description> | |
| 18822 </rdf:RDF> | |
| 18823 </annotation> | |
| 18824 <fbc:geneProductAssociation> | |
| 18825 <fbc:geneProductRef fbc:geneProduct="buc_BU047"/> | |
| 18826 </fbc:geneProductAssociation> | |
| 18827 <listOfReactants> | |
| 18828 <speciesReference constant="true" species="C00437" stoichiometry="1"/> | |
| 18829 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 18830 </listOfReactants> | |
| 18831 <listOfProducts> | |
| 18832 <speciesReference constant="true" species="C00077" stoichiometry="1"/> | |
| 18833 <speciesReference constant="true" species="C00033" stoichiometry="1"/> | |
| 18834 </listOfProducts> | |
| 18835 </reaction> | |
| 18836 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00548" metaid="_43a81f51-53be-46b5-b478-2da49696439e" name="riboflavin-5-phosphate phosphohydrolase" reversible="true"> | |
| 18837 <notes> | |
| 18838 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18839 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18840 <p>GENE_ASSOCIATION: buc_BU150</p> | |
| 18841 </body> | |
| 18842 </notes> | |
| 18843 <fbc:geneProductAssociation> | |
| 18844 <fbc:geneProductRef fbc:geneProduct="buc_BU150"/> | |
| 18845 </fbc:geneProductAssociation> | |
| 18846 <listOfReactants> | |
| 18847 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 18848 <speciesReference constant="true" species="C00061" stoichiometry="1"/> | |
| 18849 </listOfReactants> | |
| 18850 <listOfProducts> | |
| 18851 <speciesReference constant="true" species="C00255" stoichiometry="1"/> | |
| 18852 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 18853 </listOfProducts> | |
| 18854 </reaction> | |
| 18855 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R12885" metaid="_324ec9ef-e6b0-4478-965c-d4650033e102" name="R12885" reversible="false"> | |
| 18856 <notes> | |
| 18857 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18858 <p>SUBSYSTEM: Biosynthesis of various plant secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18859 <p>EC_NUMBER: 1.1.1.25</p> | |
| 18860 <p>GENE_ASSOCIATION: buc_BU493</p> | |
| 18861 </body> | |
| 18862 </notes> | |
| 18863 <annotation> | |
| 18864 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18865 <rdf:Description rdf:about="#_324ec9ef-e6b0-4478-965c-d4650033e102"> | |
| 18866 <bqbiol:is> | |
| 18867 <rdf:Bag> | |
| 18868 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.25"/> | |
| 18869 </rdf:Bag> | |
| 18870 </bqbiol:is> | |
| 18871 </rdf:Description> | |
| 18872 </rdf:RDF> | |
| 18873 </annotation> | |
| 18874 <fbc:geneProductAssociation> | |
| 18875 <fbc:geneProductRef fbc:geneProduct="buc_BU493"/> | |
| 18876 </fbc:geneProductAssociation> | |
| 18877 <listOfReactants> | |
| 18878 <speciesReference constant="true" species="C02637" stoichiometry="1"/> | |
| 18879 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 18880 </listOfReactants> | |
| 18881 <listOfProducts> | |
| 18882 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 18883 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 18884 <speciesReference constant="true" species="C22438" stoichiometry="1"/> | |
| 18885 </listOfProducts> | |
| 18886 </reaction> | |
| 18887 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R10221" metaid="_6176c6f8-5991-4125-b8f1-8805f031111c" name="6-phospho-D-gluconate:NAD+ 2-oxidoreductase (decarboxylating)" reversible="true"> | |
| 18888 <notes> | |
| 18889 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18890 <p>SUBSYSTEM: Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pentose phosphate pathway - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18891 <p>EC_NUMBER: 1.1.1.343</p> | |
| 18892 <p>GENE_ASSOCIATION: buc_BU107</p> | |
| 18893 </body> | |
| 18894 </notes> | |
| 18895 <annotation> | |
| 18896 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18897 <rdf:Description rdf:about="#_6176c6f8-5991-4125-b8f1-8805f031111c"> | |
| 18898 <bqbiol:is> | |
| 18899 <rdf:Bag> | |
| 18900 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.343"/> | |
| 18901 </rdf:Bag> | |
| 18902 </bqbiol:is> | |
| 18903 </rdf:Description> | |
| 18904 </rdf:RDF> | |
| 18905 </annotation> | |
| 18906 <fbc:geneProductAssociation> | |
| 18907 <fbc:geneProductRef fbc:geneProduct="buc_BU107"/> | |
| 18908 </fbc:geneProductAssociation> | |
| 18909 <listOfReactants> | |
| 18910 <speciesReference constant="true" species="C00345" stoichiometry="1"/> | |
| 18911 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 18912 </listOfReactants> | |
| 18913 <listOfProducts> | |
| 18914 <speciesReference constant="true" species="C00199" stoichiometry="1"/> | |
| 18915 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 18916 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 18917 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 18918 </listOfProducts> | |
| 18919 </reaction> | |
| 18920 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00550" metaid="_1ff95437-267a-4081-b60d-e6180cbf66e8" name="D-Glucose-1-phosphate:riboflavin 5'-phosphotransferase" reversible="true"> | |
| 18921 <notes> | |
| 18922 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18923 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18924 <p>GENE_ASSOCIATION: buc_BU150</p> | |
| 18925 </body> | |
| 18926 </notes> | |
| 18927 <fbc:geneProductAssociation> | |
| 18928 <fbc:geneProductRef fbc:geneProduct="buc_BU150"/> | |
| 18929 </fbc:geneProductAssociation> | |
| 18930 <listOfReactants> | |
| 18931 <speciesReference constant="true" species="C00255" stoichiometry="1"/> | |
| 18932 <speciesReference constant="true" species="C00103" stoichiometry="1"/> | |
| 18933 </listOfReactants> | |
| 18934 <listOfProducts> | |
| 18935 <speciesReference constant="true" species="C00031" stoichiometry="1"/> | |
| 18936 <speciesReference constant="true" species="C00061" stoichiometry="1"/> | |
| 18937 </listOfProducts> | |
| 18938 </reaction> | |
| 18939 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R09365" metaid="_081259d3-041d-4e25-8c3d-4c8d6d1e27d5" name="5-methyltetrahydropteroyltri-L-glutamate:L-selenohomocysteine Se-methyltransferase" reversible="true"> | |
| 18940 <notes> | |
| 18941 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18942 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Selenocompound metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18943 <p>EC_NUMBER: 2.1.1.14</p> | |
| 18944 <p>GENE_ASSOCIATION: buc_BU030</p> | |
| 18945 </body> | |
| 18946 </notes> | |
| 18947 <annotation> | |
| 18948 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18949 <rdf:Description rdf:about="#_081259d3-041d-4e25-8c3d-4c8d6d1e27d5"> | |
| 18950 <bqbiol:is> | |
| 18951 <rdf:Bag> | |
| 18952 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.1.1.14"/> | |
| 18953 </rdf:Bag> | |
| 18954 </bqbiol:is> | |
| 18955 </rdf:Description> | |
| 18956 </rdf:RDF> | |
| 18957 </annotation> | |
| 18958 <fbc:geneProductAssociation> | |
| 18959 <fbc:geneProductRef fbc:geneProduct="buc_BU030"/> | |
| 18960 </fbc:geneProductAssociation> | |
| 18961 <listOfReactants> | |
| 18962 <speciesReference constant="true" species="C05698" stoichiometry="1"/> | |
| 18963 <speciesReference constant="true" species="C04489" stoichiometry="1"/> | |
| 18964 </listOfReactants> | |
| 18965 <listOfProducts> | |
| 18966 <speciesReference constant="true" species="C04144" stoichiometry="1"/> | |
| 18967 <speciesReference constant="true" species="C05335" stoichiometry="1"/> | |
| 18968 </listOfProducts> | |
| 18969 </reaction> | |
| 18970 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R11319" metaid="_313dbbc1-0741-43a3-9374-3ab01500e49e" name="ADP:thiamin-diphosphate phosphotransferase" reversible="true"> | |
| 18971 <notes> | |
| 18972 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 18973 <p>SUBSYSTEM: Thiamine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 18974 <p>EC_NUMBER: 2.7.4.3</p> | |
| 18975 <p>GENE_ASSOCIATION: buc_BU484</p> | |
| 18976 </body> | |
| 18977 </notes> | |
| 18978 <annotation> | |
| 18979 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 18980 <rdf:Description rdf:about="#_313dbbc1-0741-43a3-9374-3ab01500e49e"> | |
| 18981 <bqbiol:is> | |
| 18982 <rdf:Bag> | |
| 18983 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.4.3"/> | |
| 18984 </rdf:Bag> | |
| 18985 </bqbiol:is> | |
| 18986 </rdf:Description> | |
| 18987 </rdf:RDF> | |
| 18988 </annotation> | |
| 18989 <fbc:geneProductAssociation> | |
| 18990 <fbc:geneProductRef fbc:geneProduct="buc_BU484"/> | |
| 18991 </fbc:geneProductAssociation> | |
| 18992 <listOfReactants> | |
| 18993 <speciesReference constant="true" species="C00068" stoichiometry="1"/> | |
| 18994 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 18995 </listOfReactants> | |
| 18996 <listOfProducts> | |
| 18997 <speciesReference constant="true" species="C03028" stoichiometry="1"/> | |
| 18998 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 18999 </listOfProducts> | |
| 19000 </reaction> | |
| 19001 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01869" metaid="_53210686-0cd1-46c6-9224-b280cf66c119" name="(S)-dihydroorotate:NAD+ oxidoreductase" reversible="true"> | |
| 19002 <notes> | |
| 19003 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19004 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19005 <p>GENE_ASSOCIATION: buc_BU362</p> | |
| 19006 </body> | |
| 19007 </notes> | |
| 19008 <fbc:geneProductAssociation> | |
| 19009 <fbc:geneProductRef fbc:geneProduct="buc_BU362"/> | |
| 19010 </fbc:geneProductAssociation> | |
| 19011 <listOfReactants> | |
| 19012 <speciesReference constant="true" species="C00337" stoichiometry="1"/> | |
| 19013 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 19014 </listOfReactants> | |
| 19015 <listOfProducts> | |
| 19016 <speciesReference constant="true" species="C00295" stoichiometry="1"/> | |
| 19017 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 19018 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 19019 </listOfProducts> | |
| 19020 </reaction> | |
| 19021 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00530" metaid="_259e875d-b239-4241-85ec-3d55e72d6fe1" name="ADP:sulfate adenylyltransferase" reversible="true"> | |
| 19022 <notes> | |
| 19023 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19024 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19025 <p>GENE_ASSOCIATION: ( buc_BU423 ) OR ( buc_BU424 )</p> | |
| 19026 </body> | |
| 19027 </notes> | |
| 19028 <fbc:geneProductAssociation> | |
| 19029 <fbc:or> | |
| 19030 <fbc:geneProductRef fbc:geneProduct="buc_BU423"/> | |
| 19031 <fbc:geneProductRef fbc:geneProduct="buc_BU424"/> | |
| 19032 </fbc:or> | |
| 19033 </fbc:geneProductAssociation> | |
| 19034 <listOfReactants> | |
| 19035 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 19036 <speciesReference constant="true" species="C00059" stoichiometry="1"/> | |
| 19037 </listOfReactants> | |
| 19038 <listOfProducts> | |
| 19039 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 19040 <speciesReference constant="true" species="C00224" stoichiometry="1"/> | |
| 19041 </listOfProducts> | |
| 19042 </reaction> | |
| 19043 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R11671" metaid="c31cd4e2-ca76-4aec-82b2-3e9302d82ca7" name="R11671" reversible="true"> | |
| 19044 <notes> | |
| 19045 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19046 <p>SUBSYSTEM: Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19047 <p>GENE_ASSOCIATION: ( buc_BU265 ) OR ( buc_BU351 )</p> | |
| 19048 </body> | |
| 19049 </notes> | |
| 19050 <fbc:geneProductAssociation> | |
| 19051 <fbc:or> | |
| 19052 <fbc:geneProductRef fbc:geneProduct="buc_BU265"/> | |
| 19053 <fbc:geneProductRef fbc:geneProduct="buc_BU351"/> | |
| 19054 </fbc:or> | |
| 19055 </fbc:geneProductAssociation> | |
| 19056 <listOfReactants> | |
| 19057 <speciesReference constant="true" species="C00024" stoichiometry="1"/> | |
| 19058 <speciesReference constant="true" species="C00083" stoichiometry="1"/> | |
| 19059 </listOfReactants> | |
| 19060 <listOfProducts> | |
| 19061 <speciesReference constant="true" species="C05223" stoichiometry="1"/> | |
| 19062 </listOfProducts> | |
| 19063 </reaction> | |
| 19064 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00894" metaid="cdd13cb4-6176-47e5-9acd-8cef91a634a3" name="L-glutamate:L-cysteine gamma-ligase (ADP-forming)" reversible="true"> | |
| 19065 <notes> | |
| 19066 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19067 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glutathione metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19068 <p>EC_NUMBER: 6.3.2.2</p> | |
| 19069 <p>GENE_ASSOCIATION: buc_BU407</p> | |
| 19070 </body> | |
| 19071 </notes> | |
| 19072 <annotation> | |
| 19073 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 19074 <rdf:Description rdf:about="#cdd13cb4-6176-47e5-9acd-8cef91a634a3"> | |
| 19075 <bqbiol:is> | |
| 19076 <rdf:Bag> | |
| 19077 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.3.2.2"/> | |
| 19078 </rdf:Bag> | |
| 19079 </bqbiol:is> | |
| 19080 </rdf:Description> | |
| 19081 </rdf:RDF> | |
| 19082 </annotation> | |
| 19083 <fbc:geneProductAssociation> | |
| 19084 <fbc:geneProductRef fbc:geneProduct="buc_BU407"/> | |
| 19085 </fbc:geneProductAssociation> | |
| 19086 <listOfReactants> | |
| 19087 <speciesReference constant="true" species="C00025" stoichiometry="1"/> | |
| 19088 <speciesReference constant="true" species="C00097" stoichiometry="1"/> | |
| 19089 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 19090 </listOfReactants> | |
| 19091 <listOfProducts> | |
| 19092 <speciesReference constant="true" species="C00669" stoichiometry="1"/> | |
| 19093 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 19094 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 19095 </listOfProducts> | |
| 19096 </reaction> | |
| 19097 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00531" metaid="c4b1545f-7821-4930-8e01-2883c64658b0" name="Adenylylsulfate sulfohydrolase" reversible="true"> | |
| 19098 <notes> | |
| 19099 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19100 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19101 <p>GENE_ASSOCIATION: ( buc_BU423 ) OR ( buc_BU424 )</p> | |
| 19102 </body> | |
| 19103 </notes> | |
| 19104 <fbc:geneProductAssociation> | |
| 19105 <fbc:or> | |
| 19106 <fbc:geneProductRef fbc:geneProduct="buc_BU423"/> | |
| 19107 <fbc:geneProductRef fbc:geneProduct="buc_BU424"/> | |
| 19108 </fbc:or> | |
| 19109 </fbc:geneProductAssociation> | |
| 19110 <listOfReactants> | |
| 19111 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 19112 <speciesReference constant="true" species="C00224" stoichiometry="1"/> | |
| 19113 </listOfReactants> | |
| 19114 <listOfProducts> | |
| 19115 <speciesReference constant="true" species="C00059" stoichiometry="1"/> | |
| 19116 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 19117 </listOfProducts> | |
| 19118 </reaction> | |
| 19119 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01863" metaid="_86c9eed2-24ad-4558-9f54-2789fd52335f" name="inosine:phosphate alpha-D-ribosyltransferase" reversible="true"> | |
| 19120 <notes> | |
| 19121 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19122 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19123 <p>EC_NUMBER: 2.4.2.1</p> | |
| 19124 <p>GENE_ASSOCIATION: buc_BU541</p> | |
| 19125 </body> | |
| 19126 </notes> | |
| 19127 <annotation> | |
| 19128 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 19129 <rdf:Description rdf:about="#_86c9eed2-24ad-4558-9f54-2789fd52335f"> | |
| 19130 <bqbiol:is> | |
| 19131 <rdf:Bag> | |
| 19132 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.4.2.1"/> | |
| 19133 </rdf:Bag> | |
| 19134 </bqbiol:is> | |
| 19135 </rdf:Description> | |
| 19136 </rdf:RDF> | |
| 19137 </annotation> | |
| 19138 <fbc:geneProductAssociation> | |
| 19139 <fbc:geneProductRef fbc:geneProduct="buc_BU541"/> | |
| 19140 </fbc:geneProductAssociation> | |
| 19141 <listOfReactants> | |
| 19142 <speciesReference constant="true" species="C00294" stoichiometry="1"/> | |
| 19143 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 19144 </listOfReactants> | |
| 19145 <listOfProducts> | |
| 19146 <speciesReference constant="true" species="C00262" stoichiometry="1"/> | |
| 19147 <speciesReference constant="true" species="C00620" stoichiometry="1"/> | |
| 19148 </listOfProducts> | |
| 19149 </reaction> | |
| 19150 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00897" metaid="b542de60-0253-4048-9c5e-0b80efbef331" name="O3-acetyl-L-serine:hydrogen-sulfide 2-amino-2-carboxyethyltransferase" reversible="true"> | |
| 19151 <notes> | |
| 19152 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19153 <p>SUBSYSTEM: Sulfur metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Cysteine and methionine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19154 <p>EC_NUMBER: 2.5.1.47</p> | |
| 19155 <p>GENE_ASSOCIATION: buc_BU066</p> | |
| 19156 </body> | |
| 19157 </notes> | |
| 19158 <annotation> | |
| 19159 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 19160 <rdf:Description rdf:about="#b542de60-0253-4048-9c5e-0b80efbef331"> | |
| 19161 <bqbiol:is> | |
| 19162 <rdf:Bag> | |
| 19163 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.5.1.47"/> | |
| 19164 </rdf:Bag> | |
| 19165 </bqbiol:is> | |
| 19166 </rdf:Description> | |
| 19167 </rdf:RDF> | |
| 19168 </annotation> | |
| 19169 <fbc:geneProductAssociation> | |
| 19170 <fbc:geneProductRef fbc:geneProduct="buc_BU066"/> | |
| 19171 </fbc:geneProductAssociation> | |
| 19172 <listOfReactants> | |
| 19173 <speciesReference constant="true" species="C00979" stoichiometry="1"/> | |
| 19174 <speciesReference constant="true" species="C00283" stoichiometry="1"/> | |
| 19175 </listOfReactants> | |
| 19176 <listOfProducts> | |
| 19177 <speciesReference constant="true" species="C00033" stoichiometry="1"/> | |
| 19178 <speciesReference constant="true" species="C00097" stoichiometry="1"/> | |
| 19179 </listOfProducts> | |
| 19180 </reaction> | |
| 19181 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01867" metaid="_4c3562f0-7717-4262-b50f-06dff87aecc6" name="(S)-dihydroorotate:fumarate oxidoreductase" reversible="true"> | |
| 19182 <notes> | |
| 19183 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19184 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19185 <p>GENE_ASSOCIATION: buc_BU362</p> | |
| 19186 </body> | |
| 19187 </notes> | |
| 19188 <fbc:geneProductAssociation> | |
| 19189 <fbc:geneProductRef fbc:geneProduct="buc_BU362"/> | |
| 19190 </fbc:geneProductAssociation> | |
| 19191 <listOfReactants> | |
| 19192 <speciesReference constant="true" species="C00337" stoichiometry="1"/> | |
| 19193 <speciesReference constant="true" species="C00122" stoichiometry="1"/> | |
| 19194 </listOfReactants> | |
| 19195 <listOfProducts> | |
| 19196 <speciesReference constant="true" species="C00042" stoichiometry="1"/> | |
| 19197 <speciesReference constant="true" species="C00295" stoichiometry="1"/> | |
| 19198 </listOfProducts> | |
| 19199 </reaction> | |
| 19200 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00899" metaid="_8453430d-e841-44cf-85d3-7925d6dddd38" name="L-cysteinylglycine dipeptidase" reversible="true"> | |
| 19201 <notes> | |
| 19202 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19203 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glutathione metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19204 <p>EC_NUMBER: 3.4.11.1</p> | |
| 19205 <p>GENE_ASSOCIATION: buc_BU367</p> | |
| 19206 </body> | |
| 19207 </notes> | |
| 19208 <annotation> | |
| 19209 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 19210 <rdf:Description rdf:about="#_8453430d-e841-44cf-85d3-7925d6dddd38"> | |
| 19211 <bqbiol:is> | |
| 19212 <rdf:Bag> | |
| 19213 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.4.11.1"/> | |
| 19214 </rdf:Bag> | |
| 19215 </bqbiol:is> | |
| 19216 </rdf:Description> | |
| 19217 </rdf:RDF> | |
| 19218 </annotation> | |
| 19219 <fbc:geneProductAssociation> | |
| 19220 <fbc:geneProductRef fbc:geneProduct="buc_BU367"/> | |
| 19221 </fbc:geneProductAssociation> | |
| 19222 <listOfReactants> | |
| 19223 <speciesReference constant="true" species="C01419" stoichiometry="1"/> | |
| 19224 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 19225 </listOfReactants> | |
| 19226 <listOfProducts> | |
| 19227 <speciesReference constant="true" species="C00097" stoichiometry="1"/> | |
| 19228 <speciesReference constant="true" species="C00037" stoichiometry="1"/> | |
| 19229 </listOfProducts> | |
| 19230 </reaction> | |
| 19231 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01625" metaid="_9b11eb20-102c-455d-8da3-5a20ce8699ba" name="CoA:apo-[acyl-carrier-protein] pantetheinephosphotransferase" reversible="true"> | |
| 19232 <notes> | |
| 19233 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19234 <p>SUBSYSTEM: Pantothenate and CoA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19235 <p>EC_NUMBER: 2.7.8.7</p> | |
| 19236 <p>GENE_ASSOCIATION: buc_BU256</p> | |
| 19237 </body> | |
| 19238 </notes> | |
| 19239 <annotation> | |
| 19240 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 19241 <rdf:Description rdf:about="#_9b11eb20-102c-455d-8da3-5a20ce8699ba"> | |
| 19242 <bqbiol:is> | |
| 19243 <rdf:Bag> | |
| 19244 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.8.7"/> | |
| 19245 </rdf:Bag> | |
| 19246 </bqbiol:is> | |
| 19247 </rdf:Description> | |
| 19248 </rdf:RDF> | |
| 19249 </annotation> | |
| 19250 <fbc:geneProductAssociation> | |
| 19251 <fbc:geneProductRef fbc:geneProduct="buc_BU256"/> | |
| 19252 </fbc:geneProductAssociation> | |
| 19253 <listOfReactants> | |
| 19254 <speciesReference constant="true" species="C00010" stoichiometry="1"/> | |
| 19255 <speciesReference constant="true" species="C03688" stoichiometry="1"/> | |
| 19256 </listOfReactants> | |
| 19257 <listOfProducts> | |
| 19258 <speciesReference constant="true" species="C00229" stoichiometry="1"/> | |
| 19259 <speciesReference constant="true" species="C00054" stoichiometry="1"/> | |
| 19260 </listOfProducts> | |
| 19261 </reaction> | |
| 19262 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00658" metaid="_47fb88ea-a359-4ecb-8d92-6a4c82f10cf6" name="2-phospho-D-glycerate hydro-lyase (phosphoenolpyruvate-forming)" reversible="true"> | |
| 19263 <notes> | |
| 19264 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19265 <p>SUBSYSTEM: Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glycolysis / Gluconeogenesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Methane metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19266 <p>EC_NUMBER: 4.2.1.11</p> | |
| 19267 <p>GENE_ASSOCIATION: buc_BU417</p> | |
| 19268 </body> | |
| 19269 </notes> | |
| 19270 <annotation> | |
| 19271 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 19272 <rdf:Description rdf:about="#_47fb88ea-a359-4ecb-8d92-6a4c82f10cf6"> | |
| 19273 <bqbiol:is> | |
| 19274 <rdf:Bag> | |
| 19275 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.2.1.11"/> | |
| 19276 </rdf:Bag> | |
| 19277 </bqbiol:is> | |
| 19278 </rdf:Description> | |
| 19279 </rdf:RDF> | |
| 19280 </annotation> | |
| 19281 <fbc:geneProductAssociation> | |
| 19282 <fbc:geneProductRef fbc:geneProduct="buc_BU417"/> | |
| 19283 </fbc:geneProductAssociation> | |
| 19284 <listOfReactants> | |
| 19285 <speciesReference constant="true" species="C00631" stoichiometry="1"/> | |
| 19286 </listOfReactants> | |
| 19287 <listOfProducts> | |
| 19288 <speciesReference constant="true" species="C00074" stoichiometry="1"/> | |
| 19289 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 19290 </listOfProducts> | |
| 19291 </reaction> | |
| 19292 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01868" metaid="be64ed6f-3bef-4f40-82f9-41226d1a7c90" name="(S)-dihydroorotate:quinone oxidoreductase" reversible="true"> | |
| 19293 <notes> | |
| 19294 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19295 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pyrimidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19296 <p>EC_NUMBER: 1.3.5.2</p> | |
| 19297 <p>GENE_ASSOCIATION: buc_BU362</p> | |
| 19298 </body> | |
| 19299 </notes> | |
| 19300 <annotation> | |
| 19301 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 19302 <rdf:Description rdf:about="#be64ed6f-3bef-4f40-82f9-41226d1a7c90"> | |
| 19303 <bqbiol:is> | |
| 19304 <rdf:Bag> | |
| 19305 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.3.5.2"/> | |
| 19306 </rdf:Bag> | |
| 19307 </bqbiol:is> | |
| 19308 </rdf:Description> | |
| 19309 </rdf:RDF> | |
| 19310 </annotation> | |
| 19311 <fbc:geneProductAssociation> | |
| 19312 <fbc:geneProductRef fbc:geneProduct="buc_BU362"/> | |
| 19313 </fbc:geneProductAssociation> | |
| 19314 <listOfReactants> | |
| 19315 <speciesReference constant="true" species="C00337" stoichiometry="1"/> | |
| 19316 <speciesReference constant="true" species="C15602" stoichiometry="1"/> | |
| 19317 </listOfReactants> | |
| 19318 <listOfProducts> | |
| 19319 <speciesReference constant="true" species="C15603" stoichiometry="1"/> | |
| 19320 <speciesReference constant="true" species="C00295" stoichiometry="1"/> | |
| 19321 </listOfProducts> | |
| 19322 </reaction> | |
| 19323 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00416" metaid="e7c91da0-e461-4b45-b6c5-7ca43c5764d2" name="UTP:N-acetyl-alpha-D-glucosamine-1-phosphate uridylyltransferase" reversible="true"> | |
| 19324 <notes> | |
| 19325 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19326 <p>SUBSYSTEM: Amino sugar and nucleotide sugar metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of nucleotide sugars - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19327 <p>EC_NUMBER: 2.7.7.23</p> | |
| 19328 <p>GENE_ASSOCIATION: buc_BU027</p> | |
| 19329 </body> | |
| 19330 </notes> | |
| 19331 <annotation> | |
| 19332 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 19333 <rdf:Description rdf:about="#e7c91da0-e461-4b45-b6c5-7ca43c5764d2"> | |
| 19334 <bqbiol:is> | |
| 19335 <rdf:Bag> | |
| 19336 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.7.23"/> | |
| 19337 </rdf:Bag> | |
| 19338 </bqbiol:is> | |
| 19339 </rdf:Description> | |
| 19340 </rdf:RDF> | |
| 19341 </annotation> | |
| 19342 <fbc:geneProductAssociation> | |
| 19343 <fbc:geneProductRef fbc:geneProduct="buc_BU027"/> | |
| 19344 </fbc:geneProductAssociation> | |
| 19345 <listOfReactants> | |
| 19346 <speciesReference constant="true" species="C00075" stoichiometry="1"/> | |
| 19347 <speciesReference constant="true" species="C04501" stoichiometry="1"/> | |
| 19348 </listOfReactants> | |
| 19349 <listOfProducts> | |
| 19350 <speciesReference constant="true" species="C00043" stoichiometry="1"/> | |
| 19351 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 19352 </listOfProducts> | |
| 19353 </reaction> | |
| 19354 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R10699" metaid="f5071ec6-3e0e-44e5-b5c8-8e3a515242e4" name="L-lysine:8-amino-7-oxononanoate aminotransferase" reversible="true"> | |
| 19355 <notes> | |
| 19356 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19357 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19358 <p>GENE_ASSOCIATION: buc_BU292</p> | |
| 19359 </body> | |
| 19360 </notes> | |
| 19361 <fbc:geneProductAssociation> | |
| 19362 <fbc:geneProductRef fbc:geneProduct="buc_BU292"/> | |
| 19363 </fbc:geneProductAssociation> | |
| 19364 <listOfReactants> | |
| 19365 <speciesReference constant="true" species="C00047" stoichiometry="1"/> | |
| 19366 <speciesReference constant="true" species="C01092" stoichiometry="1"/> | |
| 19367 </listOfReactants> | |
| 19368 <listOfProducts> | |
| 19369 <speciesReference constant="true" species="C01037" stoichiometry="1"/> | |
| 19370 <speciesReference constant="true" species="C04076" stoichiometry="1"/> | |
| 19371 </listOfProducts> | |
| 19372 </reaction> | |
| 19373 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01870" metaid="bd305f8f-a15b-4a86-8071-f488f7fdb28e" name="Orotidine-5'-phosphate:diphosphate phospho-alpha-D-ribosyl-transferase" reversible="true"> | |
| 19374 <notes> | |
| 19375 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19376 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pyrimidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19377 <p>EC_NUMBER: 2.4.2.10</p> | |
| 19378 <p>GENE_ASSOCIATION: buc_BU559</p> | |
| 19379 </body> | |
| 19380 </notes> | |
| 19381 <annotation> | |
| 19382 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 19383 <rdf:Description rdf:about="#bd305f8f-a15b-4a86-8071-f488f7fdb28e"> | |
| 19384 <bqbiol:is> | |
| 19385 <rdf:Bag> | |
| 19386 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.4.2.10"/> | |
| 19387 </rdf:Bag> | |
| 19388 </bqbiol:is> | |
| 19389 </rdf:Description> | |
| 19390 </rdf:RDF> | |
| 19391 </annotation> | |
| 19392 <fbc:geneProductAssociation> | |
| 19393 <fbc:geneProductRef fbc:geneProduct="buc_BU559"/> | |
| 19394 </fbc:geneProductAssociation> | |
| 19395 <listOfReactants> | |
| 19396 <speciesReference constant="true" species="C01103" stoichiometry="1"/> | |
| 19397 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 19398 </listOfReactants> | |
| 19399 <listOfProducts> | |
| 19400 <speciesReference constant="true" species="C00119" stoichiometry="1"/> | |
| 19401 <speciesReference constant="true" species="C00295" stoichiometry="1"/> | |
| 19402 </listOfProducts> | |
| 19403 </reaction> | |
| 19404 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00660" metaid="_5709297b-acec-4f89-8673-cfb4c8cdb15e" name="Phosphoenolpyruvate:UDP-N-acetyl-D-glucosamine 1-carboxyvinyl-transferase" reversible="true"> | |
| 19405 <notes> | |
| 19406 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19407 <p>SUBSYSTEM: Amino sugar and nucleotide sugar metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Peptidoglycan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of nucleotide sugars - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19408 <p>EC_NUMBER: 2.5.1.7</p> | |
| 19409 <p>GENE_ASSOCIATION: buc_BU386</p> | |
| 19410 </body> | |
| 19411 </notes> | |
| 19412 <annotation> | |
| 19413 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 19414 <rdf:Description rdf:about="#_5709297b-acec-4f89-8673-cfb4c8cdb15e"> | |
| 19415 <bqbiol:is> | |
| 19416 <rdf:Bag> | |
| 19417 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.5.1.7"/> | |
| 19418 </rdf:Bag> | |
| 19419 </bqbiol:is> | |
| 19420 </rdf:Description> | |
| 19421 </rdf:RDF> | |
| 19422 </annotation> | |
| 19423 <fbc:geneProductAssociation> | |
| 19424 <fbc:geneProductRef fbc:geneProduct="buc_BU386"/> | |
| 19425 </fbc:geneProductAssociation> | |
| 19426 <listOfReactants> | |
| 19427 <speciesReference constant="true" species="C00074" stoichiometry="1"/> | |
| 19428 <speciesReference constant="true" species="C00043" stoichiometry="1"/> | |
| 19429 </listOfReactants> | |
| 19430 <listOfProducts> | |
| 19431 <speciesReference constant="true" species="C04631" stoichiometry="1"/> | |
| 19432 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 19433 </listOfProducts> | |
| 19434 </reaction> | |
| 19435 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01135" metaid="_559ed3c0-4be9-44e9-8afe-d292943d732c" name="IMP:L-aspartate ligase (GDP-forming)" reversible="true"> | |
| 19436 <notes> | |
| 19437 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19438 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Alanine, aspartate and glutamate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19439 <p>EC_NUMBER: 6.3.4.4</p> | |
| 19440 <p>GENE_ASSOCIATION: buc_BU566</p> | |
| 19441 </body> | |
| 19442 </notes> | |
| 19443 <annotation> | |
| 19444 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 19445 <rdf:Description rdf:about="#_559ed3c0-4be9-44e9-8afe-d292943d732c"> | |
| 19446 <bqbiol:is> | |
| 19447 <rdf:Bag> | |
| 19448 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.3.4.4"/> | |
| 19449 </rdf:Bag> | |
| 19450 </bqbiol:is> | |
| 19451 </rdf:Description> | |
| 19452 </rdf:RDF> | |
| 19453 </annotation> | |
| 19454 <fbc:geneProductAssociation> | |
| 19455 <fbc:geneProductRef fbc:geneProduct="buc_BU566"/> | |
| 19456 </fbc:geneProductAssociation> | |
| 19457 <listOfReactants> | |
| 19458 <speciesReference constant="true" species="C00049" stoichiometry="1"/> | |
| 19459 <speciesReference constant="true" species="C00044" stoichiometry="1"/> | |
| 19460 <speciesReference constant="true" species="C00130" stoichiometry="1"/> | |
| 19461 </listOfReactants> | |
| 19462 <listOfProducts> | |
| 19463 <speciesReference constant="true" species="C00035" stoichiometry="1"/> | |
| 19464 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 19465 <speciesReference constant="true" species="C03794" stoichiometry="1"/> | |
| 19466 </listOfProducts> | |
| 19467 </reaction> | |
| 19468 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01015" metaid="_85325534-4889-439b-a18a-6787c0395e18" name="D-glyceraldehyde-3-phosphate aldose-ketose-isomerase" reversible="true"> | |
| 19469 <notes> | |
| 19470 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19471 <p>SUBSYSTEM: Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Inositol phosphate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glycolysis / Gluconeogenesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fructose and mannose metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19472 <p>EC_NUMBER: 5.3.1.1</p> | |
| 19473 <p>GENE_ASSOCIATION: buc_BU307</p> | |
| 19474 </body> | |
| 19475 </notes> | |
| 19476 <annotation> | |
| 19477 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 19478 <rdf:Description rdf:about="#_85325534-4889-439b-a18a-6787c0395e18"> | |
| 19479 <bqbiol:is> | |
| 19480 <rdf:Bag> | |
| 19481 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.3.1.1"/> | |
| 19482 </rdf:Bag> | |
| 19483 </bqbiol:is> | |
| 19484 </rdf:Description> | |
| 19485 </rdf:RDF> | |
| 19486 </annotation> | |
| 19487 <fbc:geneProductAssociation> | |
| 19488 <fbc:geneProductRef fbc:geneProduct="buc_BU307"/> | |
| 19489 </fbc:geneProductAssociation> | |
| 19490 <listOfReactants> | |
| 19491 <speciesReference constant="true" species="C00118" stoichiometry="1"/> | |
| 19492 </listOfReactants> | |
| 19493 <listOfProducts> | |
| 19494 <speciesReference constant="true" species="C00111" stoichiometry="1"/> | |
| 19495 </listOfProducts> | |
| 19496 </reaction> | |
| 19497 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04405" metaid="_7692e259-a4fc-4317-b850-405c8d1cadbe" name="5-Methyltetrahydropteroyltri-L-glutamate:L-homocysteine S-methyltransferase" reversible="true"> | |
| 19498 <notes> | |
| 19499 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19500 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Cysteine and methionine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19501 <p>EC_NUMBER: 2.1.1.14</p> | |
| 19502 <p>GENE_ASSOCIATION: buc_BU030</p> | |
| 19503 </body> | |
| 19504 </notes> | |
| 19505 <annotation> | |
| 19506 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 19507 <rdf:Description rdf:about="#_7692e259-a4fc-4317-b850-405c8d1cadbe"> | |
| 19508 <bqbiol:is> | |
| 19509 <rdf:Bag> | |
| 19510 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.1.1.14"/> | |
| 19511 </rdf:Bag> | |
| 19512 </bqbiol:is> | |
| 19513 </rdf:Description> | |
| 19514 </rdf:RDF> | |
| 19515 </annotation> | |
| 19516 <fbc:geneProductAssociation> | |
| 19517 <fbc:geneProductRef fbc:geneProduct="buc_BU030"/> | |
| 19518 </fbc:geneProductAssociation> | |
| 19519 <listOfReactants> | |
| 19520 <speciesReference constant="true" species="C00155" stoichiometry="1"/> | |
| 19521 <speciesReference constant="true" species="C04489" stoichiometry="1"/> | |
| 19522 </listOfReactants> | |
| 19523 <listOfProducts> | |
| 19524 <speciesReference constant="true" species="C04144" stoichiometry="1"/> | |
| 19525 <speciesReference constant="true" species="C00073" stoichiometry="1"/> | |
| 19526 </listOfProducts> | |
| 19527 </reaction> | |
| 19528 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03316" metaid="ab4c5ea2-0bcf-47c9-b3b3-46cc8cbff1e5" name="R03316" reversible="false"> | |
| 19529 <notes> | |
| 19530 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19531 <p>SUBSYSTEM: Citrate cycle (TCA cycle) - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19532 <p>EC_NUMBER: 1.2.4.2</p> | |
| 19533 <p>GENE_ASSOCIATION: buc_BU302</p> | |
| 19534 </body> | |
| 19535 </notes> | |
| 19536 <annotation> | |
| 19537 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 19538 <rdf:Description rdf:about="#ab4c5ea2-0bcf-47c9-b3b3-46cc8cbff1e5"> | |
| 19539 <bqbiol:is> | |
| 19540 <rdf:Bag> | |
| 19541 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.2.4.2"/> | |
| 19542 </rdf:Bag> | |
| 19543 </bqbiol:is> | |
| 19544 </rdf:Description> | |
| 19545 </rdf:RDF> | |
| 19546 </annotation> | |
| 19547 <fbc:geneProductAssociation> | |
| 19548 <fbc:geneProductRef fbc:geneProduct="buc_BU302"/> | |
| 19549 </fbc:geneProductAssociation> | |
| 19550 <listOfReactants> | |
| 19551 <speciesReference constant="true" species="C15972" stoichiometry="1"/> | |
| 19552 <speciesReference constant="true" species="C05381" stoichiometry="1"/> | |
| 19553 </listOfReactants> | |
| 19554 <listOfProducts> | |
| 19555 <speciesReference constant="true" species="C16254" stoichiometry="1"/> | |
| 19556 <speciesReference constant="true" species="C00068" stoichiometry="1"/> | |
| 19557 </listOfProducts> | |
| 19558 </reaction> | |
| 19559 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01137" metaid="f442447f-e227-4bf1-9307-99e40ba5a7db" name="ATP:dADP phosphotransferase" reversible="true"> | |
| 19560 <notes> | |
| 19561 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19562 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19563 <p>GENE_ASSOCIATION: buc_BU319</p> | |
| 19564 </body> | |
| 19565 </notes> | |
| 19566 <fbc:geneProductAssociation> | |
| 19567 <fbc:geneProductRef fbc:geneProduct="buc_BU319"/> | |
| 19568 </fbc:geneProductAssociation> | |
| 19569 <listOfReactants> | |
| 19570 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 19571 <speciesReference constant="true" species="C00206" stoichiometry="1"/> | |
| 19572 </listOfReactants> | |
| 19573 <listOfProducts> | |
| 19574 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 19575 <speciesReference constant="true" species="C00131" stoichiometry="1"/> | |
| 19576 </listOfProducts> | |
| 19577 </reaction> | |
| 19578 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01138" metaid="_7297bdae-bdc1-4b09-804e-3df3e36195fb" name="dATP:pyruvate 2-O-phosphotransferase" reversible="true"> | |
| 19579 <notes> | |
| 19580 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19581 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19582 <p>EC_NUMBER: 2.7.1.40</p> | |
| 19583 <p>GENE_ASSOCIATION: buc_BU319</p> | |
| 19584 </body> | |
| 19585 </notes> | |
| 19586 <annotation> | |
| 19587 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 19588 <rdf:Description rdf:about="#_7297bdae-bdc1-4b09-804e-3df3e36195fb"> | |
| 19589 <bqbiol:is> | |
| 19590 <rdf:Bag> | |
| 19591 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.40"/> | |
| 19592 </rdf:Bag> | |
| 19593 </bqbiol:is> | |
| 19594 </rdf:Description> | |
| 19595 </rdf:RDF> | |
| 19596 </annotation> | |
| 19597 <fbc:geneProductAssociation> | |
| 19598 <fbc:geneProductRef fbc:geneProduct="buc_BU319"/> | |
| 19599 </fbc:geneProductAssociation> | |
| 19600 <listOfReactants> | |
| 19601 <speciesReference constant="true" species="C00022" stoichiometry="1"/> | |
| 19602 <speciesReference constant="true" species="C00131" stoichiometry="1"/> | |
| 19603 </listOfReactants> | |
| 19604 <listOfProducts> | |
| 19605 <speciesReference constant="true" species="C00206" stoichiometry="1"/> | |
| 19606 <speciesReference constant="true" species="C00074" stoichiometry="1"/> | |
| 19607 </listOfProducts> | |
| 19608 </reaction> | |
| 19609 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R11062" metaid="fda4dff2-484d-4d2e-99c5-92efd7151cb8" name="phosphatidylethanolamine:phosphatidylglycerol 3-phosphatidyltransferase" reversible="true"> | |
| 19610 <notes> | |
| 19611 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19612 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19613 <p>GENE_ASSOCIATION: buc_BU273</p> | |
| 19614 </body> | |
| 19615 </notes> | |
| 19616 <fbc:geneProductAssociation> | |
| 19617 <fbc:geneProductRef fbc:geneProduct="buc_BU273"/> | |
| 19618 </fbc:geneProductAssociation> | |
| 19619 <listOfReactants> | |
| 19620 <speciesReference constant="true" species="C00350" stoichiometry="1"/> | |
| 19621 <speciesReference constant="true" species="C00344" stoichiometry="1"/> | |
| 19622 </listOfReactants> | |
| 19623 <listOfProducts> | |
| 19624 <speciesReference constant="true" species="C05980" stoichiometry="1"/> | |
| 19625 <speciesReference constant="true" species="C00189" stoichiometry="1"/> | |
| 19626 </listOfProducts> | |
| 19627 </reaction> | |
| 19628 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03321" metaid="_073b7c58-91c7-49af-a781-a2d5c4036870" name="beta-D-Glucose 6-phosphate ketol-isomerase" reversible="true"> | |
| 19629 <notes> | |
| 19630 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19631 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glycolysis / Gluconeogenesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19632 <p>EC_NUMBER: 5.3.1.9</p> | |
| 19633 <p>GENE_ASSOCIATION: buc_BU573</p> | |
| 19634 </body> | |
| 19635 </notes> | |
| 19636 <annotation> | |
| 19637 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 19638 <rdf:Description rdf:about="#_073b7c58-91c7-49af-a781-a2d5c4036870"> | |
| 19639 <bqbiol:is> | |
| 19640 <rdf:Bag> | |
| 19641 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.3.1.9"/> | |
| 19642 </rdf:Bag> | |
| 19643 </bqbiol:is> | |
| 19644 </rdf:Description> | |
| 19645 </rdf:RDF> | |
| 19646 </annotation> | |
| 19647 <fbc:geneProductAssociation> | |
| 19648 <fbc:geneProductRef fbc:geneProduct="buc_BU573"/> | |
| 19649 </fbc:geneProductAssociation> | |
| 19650 <listOfReactants> | |
| 19651 <speciesReference constant="true" species="C01172" stoichiometry="1"/> | |
| 19652 </listOfReactants> | |
| 19653 <listOfProducts> | |
| 19654 <speciesReference constant="true" species="C05345" stoichiometry="1"/> | |
| 19655 </listOfProducts> | |
| 19656 </reaction> | |
| 19657 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02474" metaid="_22ef0dab-f71d-420a-a62f-be20d9d1f611" name="Pantothenate amidohydrolase" reversible="true"> | |
| 19658 <notes> | |
| 19659 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19660 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19661 <p>GENE_ASSOCIATION: buc_BU196</p> | |
| 19662 </body> | |
| 19663 </notes> | |
| 19664 <fbc:geneProductAssociation> | |
| 19665 <fbc:geneProductRef fbc:geneProduct="buc_BU196"/> | |
| 19666 </fbc:geneProductAssociation> | |
| 19667 <listOfReactants> | |
| 19668 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 19669 <speciesReference constant="true" species="C00864" stoichiometry="1"/> | |
| 19670 </listOfReactants> | |
| 19671 <listOfProducts> | |
| 19672 <speciesReference constant="true" species="C00099" stoichiometry="1"/> | |
| 19673 <speciesReference constant="true" species="C00522" stoichiometry="1"/> | |
| 19674 </listOfProducts> | |
| 19675 </reaction> | |
| 19676 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02473" metaid="aaf95929-0ec4-4f22-b3ad-7d8c65022023" name="(R)-Pantoate:beta-alanine ligase (AMP-forming)" reversible="true"> | |
| 19677 <notes> | |
| 19678 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19679 <p>SUBSYSTEM: Pantothenate and CoA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19680 <p>EC_NUMBER: 6.3.2.1</p> | |
| 19681 <p>GENE_ASSOCIATION: buc_BU196</p> | |
| 19682 </body> | |
| 19683 </notes> | |
| 19684 <annotation> | |
| 19685 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 19686 <rdf:Description rdf:about="#aaf95929-0ec4-4f22-b3ad-7d8c65022023"> | |
| 19687 <bqbiol:is> | |
| 19688 <rdf:Bag> | |
| 19689 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.3.2.1"/> | |
| 19690 </rdf:Bag> | |
| 19691 </bqbiol:is> | |
| 19692 </rdf:Description> | |
| 19693 </rdf:RDF> | |
| 19694 </annotation> | |
| 19695 <fbc:geneProductAssociation> | |
| 19696 <fbc:geneProductRef fbc:geneProduct="buc_BU196"/> | |
| 19697 </fbc:geneProductAssociation> | |
| 19698 <listOfReactants> | |
| 19699 <speciesReference constant="true" species="C00099" stoichiometry="1"/> | |
| 19700 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 19701 <speciesReference constant="true" species="C00522" stoichiometry="1"/> | |
| 19702 </listOfReactants> | |
| 19703 <listOfProducts> | |
| 19704 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 19705 <speciesReference constant="true" species="C00864" stoichiometry="1"/> | |
| 19706 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 19707 </listOfProducts> | |
| 19708 </reaction> | |
| 19709 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04533" metaid="_8f4bdeb8-04db-4cdd-b01b-4dcff686bd87" name="(3R)-3-hydroxybutanoyl-[acyl-carrier protein]:NADP+ oxidoreductase" reversible="true"> | |
| 19710 <notes> | |
| 19711 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19712 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19713 <p>EC_NUMBER: 1.1.1.100</p> | |
| 19714 <p>GENE_ASSOCIATION: buc_BU351</p> | |
| 19715 </body> | |
| 19716 </notes> | |
| 19717 <annotation> | |
| 19718 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 19719 <rdf:Description rdf:about="#_8f4bdeb8-04db-4cdd-b01b-4dcff686bd87"> | |
| 19720 <bqbiol:is> | |
| 19721 <rdf:Bag> | |
| 19722 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.100"/> | |
| 19723 </rdf:Bag> | |
| 19724 </bqbiol:is> | |
| 19725 </rdf:Description> | |
| 19726 </rdf:RDF> | |
| 19727 </annotation> | |
| 19728 <fbc:geneProductAssociation> | |
| 19729 <fbc:geneProductRef fbc:geneProduct="buc_BU351"/> | |
| 19730 </fbc:geneProductAssociation> | |
| 19731 <listOfReactants> | |
| 19732 <speciesReference constant="true" species="C04618" stoichiometry="1"/> | |
| 19733 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 19734 </listOfReactants> | |
| 19735 <listOfProducts> | |
| 19736 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 19737 <speciesReference constant="true" species="C05744" stoichiometry="1"/> | |
| 19738 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 19739 </listOfProducts> | |
| 19740 </reaction> | |
| 19741 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00177" metaid="_6638368a-2b26-413b-b3b7-52b89f43f3d1" name="ATP:L-methionine S-adenosyltransferase" reversible="true"> | |
| 19742 <notes> | |
| 19743 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19744 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum) || Cysteine and methionine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of various plant secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19745 <p>EC_NUMBER: 2.5.1.6</p> | |
| 19746 <p>GENE_ASSOCIATION: buc_BU408</p> | |
| 19747 </body> | |
| 19748 </notes> | |
| 19749 <annotation> | |
| 19750 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 19751 <rdf:Description rdf:about="#_6638368a-2b26-413b-b3b7-52b89f43f3d1"> | |
| 19752 <bqbiol:is> | |
| 19753 <rdf:Bag> | |
| 19754 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.5.1.6"/> | |
| 19755 </rdf:Bag> | |
| 19756 </bqbiol:is> | |
| 19757 </rdf:Description> | |
| 19758 </rdf:RDF> | |
| 19759 </annotation> | |
| 19760 <fbc:geneProductAssociation> | |
| 19761 <fbc:geneProductRef fbc:geneProduct="buc_BU408"/> | |
| 19762 </fbc:geneProductAssociation> | |
| 19763 <listOfReactants> | |
| 19764 <speciesReference constant="true" species="C00019" stoichiometry="1"/> | |
| 19765 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 19766 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 19767 </listOfReactants> | |
| 19768 <listOfProducts> | |
| 19769 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 19770 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 19771 <speciesReference constant="true" species="C00073" stoichiometry="1"/> | |
| 19772 </listOfProducts> | |
| 19773 </reaction> | |
| 19774 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03443" metaid="bddf0974-3834-4ad9-9f75-3f0d1f1b9057" name="N-acetyl-L-glutamate-5-semialdehyde:NADP+ 5-oxidoreductase (phosphrylating)" reversible="true"> | |
| 19775 <notes> | |
| 19776 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19777 <p>SUBSYSTEM: Arginine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19778 <p>EC_NUMBER: 1.2.1.38</p> | |
| 19779 <p>GENE_ASSOCIATION: buc_BU048</p> | |
| 19780 </body> | |
| 19781 </notes> | |
| 19782 <annotation> | |
| 19783 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 19784 <rdf:Description rdf:about="#bddf0974-3834-4ad9-9f75-3f0d1f1b9057"> | |
| 19785 <bqbiol:is> | |
| 19786 <rdf:Bag> | |
| 19787 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.2.1.38"/> | |
| 19788 </rdf:Bag> | |
| 19789 </bqbiol:is> | |
| 19790 </rdf:Description> | |
| 19791 </rdf:RDF> | |
| 19792 </annotation> | |
| 19793 <fbc:geneProductAssociation> | |
| 19794 <fbc:geneProductRef fbc:geneProduct="buc_BU048"/> | |
| 19795 </fbc:geneProductAssociation> | |
| 19796 <listOfReactants> | |
| 19797 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 19798 <speciesReference constant="true" species="C01250" stoichiometry="1"/> | |
| 19799 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 19800 </listOfReactants> | |
| 19801 <listOfProducts> | |
| 19802 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 19803 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 19804 <speciesReference constant="true" species="C04133" stoichiometry="1"/> | |
| 19805 </listOfProducts> | |
| 19806 </reaction> | |
| 19807 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04773" metaid="dd848ad2-bf85-4256-847b-c22d61d127ae" name="Selenomethionine:tRNAMet ligase (AMP-forming)" reversible="true"> | |
| 19808 <notes> | |
| 19809 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19810 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Selenocompound metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19811 <p>EC_NUMBER: 6.1.1.10</p> | |
| 19812 <p>GENE_ASSOCIATION: buc_BU109</p> | |
| 19813 </body> | |
| 19814 </notes> | |
| 19815 <annotation> | |
| 19816 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 19817 <rdf:Description rdf:about="#dd848ad2-bf85-4256-847b-c22d61d127ae"> | |
| 19818 <bqbiol:is> | |
| 19819 <rdf:Bag> | |
| 19820 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.1.1.10"/> | |
| 19821 </rdf:Bag> | |
| 19822 </bqbiol:is> | |
| 19823 </rdf:Description> | |
| 19824 </rdf:RDF> | |
| 19825 </annotation> | |
| 19826 <fbc:geneProductAssociation> | |
| 19827 <fbc:geneProductRef fbc:geneProduct="buc_BU109"/> | |
| 19828 </fbc:geneProductAssociation> | |
| 19829 <listOfReactants> | |
| 19830 <speciesReference constant="true" species="C05335" stoichiometry="1"/> | |
| 19831 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 19832 <speciesReference constant="true" species="C01647" stoichiometry="1"/> | |
| 19833 </listOfReactants> | |
| 19834 <listOfProducts> | |
| 19835 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 19836 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 19837 <speciesReference constant="true" species="C05336" stoichiometry="1"/> | |
| 19838 </listOfProducts> | |
| 19839 </reaction> | |
| 19840 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01245" metaid="a24830a5-1ca2-4e7a-b22f-d40d4b806ee7" name="adenosine ribohydrolase" reversible="true"> | |
| 19841 <notes> | |
| 19842 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19843 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19844 <p>GENE_ASSOCIATION: buc_BU541</p> | |
| 19845 </body> | |
| 19846 </notes> | |
| 19847 <fbc:geneProductAssociation> | |
| 19848 <fbc:geneProductRef fbc:geneProduct="buc_BU541"/> | |
| 19849 </fbc:geneProductAssociation> | |
| 19850 <listOfReactants> | |
| 19851 <speciesReference constant="true" species="C00212" stoichiometry="1"/> | |
| 19852 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 19853 </listOfReactants> | |
| 19854 <listOfProducts> | |
| 19855 <speciesReference constant="true" species="C00121" stoichiometry="1"/> | |
| 19856 <speciesReference constant="true" species="C00147" stoichiometry="1"/> | |
| 19857 </listOfProducts> | |
| 19858 </reaction> | |
| 19859 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03665" metaid="d0da7cb7-6e15-41e8-9138-b551c2ef7586" name="L-Valine:tRNAVal ligase (AMP-forming)" reversible="false"> | |
| 19860 <notes> | |
| 19861 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19862 <p>SUBSYSTEM: Aminoacyl-tRNA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19863 <p>EC_NUMBER: 6.1.1.9</p> | |
| 19864 <p>GENE_ASSOCIATION: buc_BU366</p> | |
| 19865 </body> | |
| 19866 </notes> | |
| 19867 <annotation> | |
| 19868 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 19869 <rdf:Description rdf:about="#d0da7cb7-6e15-41e8-9138-b551c2ef7586"> | |
| 19870 <bqbiol:is> | |
| 19871 <rdf:Bag> | |
| 19872 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.1.1.9"/> | |
| 19873 </rdf:Bag> | |
| 19874 </bqbiol:is> | |
| 19875 </rdf:Description> | |
| 19876 </rdf:RDF> | |
| 19877 </annotation> | |
| 19878 <fbc:geneProductAssociation> | |
| 19879 <fbc:geneProductRef fbc:geneProduct="buc_BU366"/> | |
| 19880 </fbc:geneProductAssociation> | |
| 19881 <listOfReactants> | |
| 19882 <speciesReference constant="true" species="C00183" stoichiometry="1"/> | |
| 19883 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 19884 <speciesReference constant="true" species="C01653" stoichiometry="1"/> | |
| 19885 </listOfReactants> | |
| 19886 <listOfProducts> | |
| 19887 <speciesReference constant="true" species="C02554" stoichiometry="1"/> | |
| 19888 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 19889 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 19890 </listOfProducts> | |
| 19891 </reaction> | |
| 19892 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00158" metaid="_61c28cfd-193a-4c59-bd16-732a3d399ac1" name="ATP:UMP phosphotransferase" reversible="true"> | |
| 19893 <notes> | |
| 19894 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19895 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pyrimidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19896 <p>EC_NUMBER: 2.7.4.22</p> | |
| 19897 <p>GENE_ASSOCIATION: buc_BU233</p> | |
| 19898 </body> | |
| 19899 </notes> | |
| 19900 <annotation> | |
| 19901 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 19902 <rdf:Description rdf:about="#_61c28cfd-193a-4c59-bd16-732a3d399ac1"> | |
| 19903 <bqbiol:is> | |
| 19904 <rdf:Bag> | |
| 19905 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.4.22"/> | |
| 19906 </rdf:Bag> | |
| 19907 </bqbiol:is> | |
| 19908 </rdf:Description> | |
| 19909 </rdf:RDF> | |
| 19910 </annotation> | |
| 19911 <fbc:geneProductAssociation> | |
| 19912 <fbc:geneProductRef fbc:geneProduct="buc_BU233"/> | |
| 19913 </fbc:geneProductAssociation> | |
| 19914 <listOfReactants> | |
| 19915 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 19916 <speciesReference constant="true" species="C00105" stoichiometry="1"/> | |
| 19917 </listOfReactants> | |
| 19918 <listOfProducts> | |
| 19919 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 19920 <speciesReference constant="true" species="C00015" stoichiometry="1"/> | |
| 19921 </listOfProducts> | |
| 19922 </reaction> | |
| 19923 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01127" metaid="_49e56453-3517-42b9-88f8-a5736d5140f0" name="IMP 1,2-hydrolase (decyclizing)" reversible="true"> | |
| 19924 <notes> | |
| 19925 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19926 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19927 <p>EC_NUMBER: 3.5.4.10</p> | |
| 19928 <p>GENE_ASSOCIATION: buc_BU031</p> | |
| 19929 </body> | |
| 19930 </notes> | |
| 19931 <annotation> | |
| 19932 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 19933 <rdf:Description rdf:about="#_49e56453-3517-42b9-88f8-a5736d5140f0"> | |
| 19934 <bqbiol:is> | |
| 19935 <rdf:Bag> | |
| 19936 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.5.4.10"/> | |
| 19937 </rdf:Bag> | |
| 19938 </bqbiol:is> | |
| 19939 </rdf:Description> | |
| 19940 </rdf:RDF> | |
| 19941 </annotation> | |
| 19942 <fbc:geneProductAssociation> | |
| 19943 <fbc:geneProductRef fbc:geneProduct="buc_BU031"/> | |
| 19944 </fbc:geneProductAssociation> | |
| 19945 <listOfReactants> | |
| 19946 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 19947 <speciesReference constant="true" species="C00130" stoichiometry="1"/> | |
| 19948 </listOfReactants> | |
| 19949 <listOfProducts> | |
| 19950 <speciesReference constant="true" species="C04734" stoichiometry="1"/> | |
| 19951 </listOfProducts> | |
| 19952 </reaction> | |
| 19953 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00160" metaid="_8e97b5e9-0f7c-4993-871b-6163c26c7f93" name="FAD nucleotidohydrolase" reversible="true"> | |
| 19954 <notes> | |
| 19955 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19956 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19957 <p>GENE_ASSOCIATION: buc_BU150</p> | |
| 19958 </body> | |
| 19959 </notes> | |
| 19960 <fbc:geneProductAssociation> | |
| 19961 <fbc:geneProductRef fbc:geneProduct="buc_BU150"/> | |
| 19962 </fbc:geneProductAssociation> | |
| 19963 <listOfReactants> | |
| 19964 <speciesReference constant="true" species="C00016" stoichiometry="1"/> | |
| 19965 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 19966 </listOfReactants> | |
| 19967 <listOfProducts> | |
| 19968 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 19969 <speciesReference constant="true" species="C00061" stoichiometry="1"/> | |
| 19970 </listOfProducts> | |
| 19971 </reaction> | |
| 19972 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00161" metaid="_26ced404-6ce6-473f-a5f7-ddfa5511b196" name="ATP:FMN adenylyltransferase" reversible="true"> | |
| 19973 <notes> | |
| 19974 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 19975 <p>SUBSYSTEM: Riboflavin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 19976 <p>EC_NUMBER: 2.7.7.2</p> | |
| 19977 <p>GENE_ASSOCIATION: buc_BU150</p> | |
| 19978 </body> | |
| 19979 </notes> | |
| 19980 <annotation> | |
| 19981 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 19982 <rdf:Description rdf:about="#_26ced404-6ce6-473f-a5f7-ddfa5511b196"> | |
| 19983 <bqbiol:is> | |
| 19984 <rdf:Bag> | |
| 19985 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.7.2"/> | |
| 19986 </rdf:Bag> | |
| 19987 </bqbiol:is> | |
| 19988 </rdf:Description> | |
| 19989 </rdf:RDF> | |
| 19990 </annotation> | |
| 19991 <fbc:geneProductAssociation> | |
| 19992 <fbc:geneProductRef fbc:geneProduct="buc_BU150"/> | |
| 19993 </fbc:geneProductAssociation> | |
| 19994 <listOfReactants> | |
| 19995 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 19996 <speciesReference constant="true" species="C00061" stoichiometry="1"/> | |
| 19997 </listOfReactants> | |
| 19998 <listOfProducts> | |
| 19999 <speciesReference constant="true" species="C00016" stoichiometry="1"/> | |
| 20000 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 20001 </listOfProducts> | |
| 20002 </reaction> | |
| 20003 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02340" metaid="f58725b3-482d-47dc-9bc2-d9bcd7ed7b96" name="(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate D-glyceraldehyde-3-phosphate-lyase" reversible="true"> | |
| 20004 <notes> | |
| 20005 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20006 <p>SUBSYSTEM: Phenylalanine, tyrosine and tryptophan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20007 <p>EC_NUMBER: 4.2.1.20</p> | |
| 20008 <p>GENE_ASSOCIATION: buc_BU277</p> | |
| 20009 </body> | |
| 20010 </notes> | |
| 20011 <annotation> | |
| 20012 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20013 <rdf:Description rdf:about="#f58725b3-482d-47dc-9bc2-d9bcd7ed7b96"> | |
| 20014 <bqbiol:is> | |
| 20015 <rdf:Bag> | |
| 20016 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.2.1.20"/> | |
| 20017 </rdf:Bag> | |
| 20018 </bqbiol:is> | |
| 20019 </rdf:Description> | |
| 20020 </rdf:RDF> | |
| 20021 </annotation> | |
| 20022 <fbc:geneProductAssociation> | |
| 20023 <fbc:geneProductRef fbc:geneProduct="buc_BU277"/> | |
| 20024 </fbc:geneProductAssociation> | |
| 20025 <listOfReactants> | |
| 20026 <speciesReference constant="true" species="C03506" stoichiometry="1"/> | |
| 20027 </listOfReactants> | |
| 20028 <listOfProducts> | |
| 20029 <speciesReference constant="true" species="C00118" stoichiometry="1"/> | |
| 20030 <speciesReference constant="true" species="C00463" stoichiometry="1"/> | |
| 20031 </listOfProducts> | |
| 20032 </reaction> | |
| 20033 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02100" metaid="_5352f7b7-ae70-415d-8102-8012129bbedf" name="dUTP nucleotidohydrolase" reversible="true"> | |
| 20034 <notes> | |
| 20035 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20036 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pyrimidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20037 <p>EC_NUMBER: 3.6.1.23</p> | |
| 20038 <p>GENE_ASSOCIATION: buc_BU560</p> | |
| 20039 </body> | |
| 20040 </notes> | |
| 20041 <annotation> | |
| 20042 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20043 <rdf:Description rdf:about="#_5352f7b7-ae70-415d-8102-8012129bbedf"> | |
| 20044 <bqbiol:is> | |
| 20045 <rdf:Bag> | |
| 20046 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.6.1.23"/> | |
| 20047 </rdf:Bag> | |
| 20048 </bqbiol:is> | |
| 20049 </rdf:Description> | |
| 20050 </rdf:RDF> | |
| 20051 </annotation> | |
| 20052 <fbc:geneProductAssociation> | |
| 20053 <fbc:geneProductRef fbc:geneProduct="buc_BU560"/> | |
| 20054 </fbc:geneProductAssociation> | |
| 20055 <listOfReactants> | |
| 20056 <speciesReference constant="true" species="C00460" stoichiometry="1"/> | |
| 20057 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 20058 </listOfReactants> | |
| 20059 <listOfProducts> | |
| 20060 <speciesReference constant="true" species="C00365" stoichiometry="1"/> | |
| 20061 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 20062 </listOfProducts> | |
| 20063 </reaction> | |
| 20064 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01373" metaid="_70ac2ae9-fc6a-463c-9bc3-9ee3224ada5d" name="prephenate hydro-lyase (decarboxylating phenylpyruvate-forming)" reversible="true"> | |
| 20065 <notes> | |
| 20066 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20067 <p>SUBSYSTEM: Phenylalanine, tyrosine and tryptophan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20068 <p>EC_NUMBER: 4.2.1.51</p> | |
| 20069 <p>GENE_ASSOCIATION: buc_BU392</p> | |
| 20070 </body> | |
| 20071 </notes> | |
| 20072 <annotation> | |
| 20073 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20074 <rdf:Description rdf:about="#_70ac2ae9-fc6a-463c-9bc3-9ee3224ada5d"> | |
| 20075 <bqbiol:is> | |
| 20076 <rdf:Bag> | |
| 20077 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.2.1.51"/> | |
| 20078 </rdf:Bag> | |
| 20079 </bqbiol:is> | |
| 20080 </rdf:Description> | |
| 20081 </rdf:RDF> | |
| 20082 </annotation> | |
| 20083 <fbc:geneProductAssociation> | |
| 20084 <fbc:geneProductRef fbc:geneProduct="buc_BU392"/> | |
| 20085 </fbc:geneProductAssociation> | |
| 20086 <listOfReactants> | |
| 20087 <speciesReference constant="true" species="C00254" stoichiometry="1"/> | |
| 20088 </listOfReactants> | |
| 20089 <listOfProducts> | |
| 20090 <speciesReference constant="true" species="C00166" stoichiometry="1"/> | |
| 20091 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 20092 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 20093 </listOfProducts> | |
| 20094 </reaction> | |
| 20095 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01132" metaid="d2407316-3ae0-4a6a-b954-ca31216072fe" name="IMP:diphosphate phospho-D-ribosyltransferase" reversible="true"> | |
| 20096 <notes> | |
| 20097 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20098 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20099 <p>EC_NUMBER: 2.4.2.8</p> | |
| 20100 <p>GENE_ASSOCIATION: buc_BU195</p> | |
| 20101 </body> | |
| 20102 </notes> | |
| 20103 <annotation> | |
| 20104 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20105 <rdf:Description rdf:about="#d2407316-3ae0-4a6a-b954-ca31216072fe"> | |
| 20106 <bqbiol:is> | |
| 20107 <rdf:Bag> | |
| 20108 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.4.2.8"/> | |
| 20109 </rdf:Bag> | |
| 20110 </bqbiol:is> | |
| 20111 </rdf:Description> | |
| 20112 </rdf:RDF> | |
| 20113 </annotation> | |
| 20114 <fbc:geneProductAssociation> | |
| 20115 <fbc:geneProductRef fbc:geneProduct="buc_BU195"/> | |
| 20116 </fbc:geneProductAssociation> | |
| 20117 <listOfReactants> | |
| 20118 <speciesReference constant="true" species="C00130" stoichiometry="1"/> | |
| 20119 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 20120 </listOfReactants> | |
| 20121 <listOfProducts> | |
| 20122 <speciesReference constant="true" species="C00262" stoichiometry="1"/> | |
| 20123 <speciesReference constant="true" species="C00119" stoichiometry="1"/> | |
| 20124 </listOfProducts> | |
| 20125 </reaction> | |
| 20126 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04640" metaid="_82bc6201-a831-4fba-bcae-db0298a8b97e" name="N-(5'-phospho-D-ribosylformimino)-5-amino-1- (5''-phospho-D-ribosyl)-4-imidazolecarboxamide ketol-isomerase" reversible="true"> | |
| 20127 <notes> | |
| 20128 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20129 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Histidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20130 <p>EC_NUMBER: 5.3.1.16</p> | |
| 20131 <p>GENE_ASSOCIATION: buc_BU104</p> | |
| 20132 </body> | |
| 20133 </notes> | |
| 20134 <annotation> | |
| 20135 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20136 <rdf:Description rdf:about="#_82bc6201-a831-4fba-bcae-db0298a8b97e"> | |
| 20137 <bqbiol:is> | |
| 20138 <rdf:Bag> | |
| 20139 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.3.1.16"/> | |
| 20140 </rdf:Bag> | |
| 20141 </bqbiol:is> | |
| 20142 </rdf:Description> | |
| 20143 </rdf:RDF> | |
| 20144 </annotation> | |
| 20145 <fbc:geneProductAssociation> | |
| 20146 <fbc:geneProductRef fbc:geneProduct="buc_BU104"/> | |
| 20147 </fbc:geneProductAssociation> | |
| 20148 <listOfReactants> | |
| 20149 <speciesReference constant="true" species="C04896" stoichiometry="1"/> | |
| 20150 </listOfReactants> | |
| 20151 <listOfProducts> | |
| 20152 <speciesReference constant="true" species="C04916" stoichiometry="1"/> | |
| 20153 </listOfProducts> | |
| 20154 </reaction> | |
| 20155 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01134" metaid="_2183f5f4-7e4e-4285-b8f4-ef6f770a03f0" name="inosine-5'-phosphate:NADP+ oxidoreductase (aminating)" reversible="true"> | |
| 20156 <notes> | |
| 20157 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20158 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20159 <p>EC_NUMBER: 1.7.1.7</p> | |
| 20160 <p>GENE_ASSOCIATION: buc_BU204</p> | |
| 20161 </body> | |
| 20162 </notes> | |
| 20163 <annotation> | |
| 20164 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20165 <rdf:Description rdf:about="#_2183f5f4-7e4e-4285-b8f4-ef6f770a03f0"> | |
| 20166 <bqbiol:is> | |
| 20167 <rdf:Bag> | |
| 20168 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.7.1.7"/> | |
| 20169 </rdf:Bag> | |
| 20170 </bqbiol:is> | |
| 20171 </rdf:Description> | |
| 20172 </rdf:RDF> | |
| 20173 </annotation> | |
| 20174 <fbc:geneProductAssociation> | |
| 20175 <fbc:geneProductRef fbc:geneProduct="buc_BU204"/> | |
| 20176 </fbc:geneProductAssociation> | |
| 20177 <listOfReactants> | |
| 20178 <speciesReference constant="true" species="C00130" stoichiometry="1"/> | |
| 20179 <speciesReference constant="true" species="C00014" stoichiometry="1"/> | |
| 20180 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 20181 </listOfReactants> | |
| 20182 <listOfProducts> | |
| 20183 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 20184 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 20185 <speciesReference constant="true" species="C00144" stoichiometry="1"/> | |
| 20186 </listOfProducts> | |
| 20187 </reaction> | |
| 20188 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02101" metaid="_46cd2838-ac0a-4293-bf90-9861e9b13a3a" name="5,10-Methylenetetrahydrofolate:dUMP C-methyltransferase" reversible="true"> | |
| 20189 <notes> | |
| 20190 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20191 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || One carbon pool by folate - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pyrimidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20192 <p>EC_NUMBER: 2.1.1.45</p> | |
| 20193 <p>GENE_ASSOCIATION: buc_BU440</p> | |
| 20194 </body> | |
| 20195 </notes> | |
| 20196 <annotation> | |
| 20197 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20198 <rdf:Description rdf:about="#_46cd2838-ac0a-4293-bf90-9861e9b13a3a"> | |
| 20199 <bqbiol:is> | |
| 20200 <rdf:Bag> | |
| 20201 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.1.1.45"/> | |
| 20202 </rdf:Bag> | |
| 20203 </bqbiol:is> | |
| 20204 </rdf:Description> | |
| 20205 </rdf:RDF> | |
| 20206 </annotation> | |
| 20207 <fbc:geneProductAssociation> | |
| 20208 <fbc:geneProductRef fbc:geneProduct="buc_BU440"/> | |
| 20209 </fbc:geneProductAssociation> | |
| 20210 <listOfReactants> | |
| 20211 <speciesReference constant="true" species="C00365" stoichiometry="1"/> | |
| 20212 <speciesReference constant="true" species="C00143" stoichiometry="1"/> | |
| 20213 </listOfReactants> | |
| 20214 <listOfProducts> | |
| 20215 <speciesReference constant="true" species="C00364" stoichiometry="1"/> | |
| 20216 <speciesReference constant="true" species="C00415" stoichiometry="1"/> | |
| 20217 </listOfProducts> | |
| 20218 </reaction> | |
| 20219 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R09099" metaid="_7341b491-c29b-47cc-8dd0-d85d688be245" name="5,10-methylenetetrahydromethanopterin:glycine hydroxymethyltransferase" reversible="true"> | |
| 20220 <notes> | |
| 20221 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20222 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Methane metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20223 <p>EC_NUMBER: 2.1.2.1</p> | |
| 20224 <p>GENE_ASSOCIATION: buc_BU289</p> | |
| 20225 </body> | |
| 20226 </notes> | |
| 20227 <annotation> | |
| 20228 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20229 <rdf:Description rdf:about="#_7341b491-c29b-47cc-8dd0-d85d688be245"> | |
| 20230 <bqbiol:is> | |
| 20231 <rdf:Bag> | |
| 20232 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.1.2.1"/> | |
| 20233 </rdf:Bag> | |
| 20234 </bqbiol:is> | |
| 20235 </rdf:Description> | |
| 20236 </rdf:RDF> | |
| 20237 </annotation> | |
| 20238 <fbc:geneProductAssociation> | |
| 20239 <fbc:geneProductRef fbc:geneProduct="buc_BU289"/> | |
| 20240 </fbc:geneProductAssociation> | |
| 20241 <listOfReactants> | |
| 20242 <speciesReference constant="true" species="C01217" stoichiometry="1"/> | |
| 20243 <speciesReference constant="true" species="C00065" stoichiometry="1"/> | |
| 20244 </listOfReactants> | |
| 20245 <listOfProducts> | |
| 20246 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 20247 <speciesReference constant="true" species="C04377" stoichiometry="1"/> | |
| 20248 <speciesReference constant="true" species="C00037" stoichiometry="1"/> | |
| 20249 </listOfProducts> | |
| 20250 </reaction> | |
| 20251 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00189" metaid="aa174d72-b9dc-4d68-994b-22b8f515a63b" name="deamido-NAD+:ammonia ligase (AMP-forming)" reversible="true"> | |
| 20252 <notes> | |
| 20253 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20254 <p>SUBSYSTEM: Nicotinate and nicotinamide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20255 <p>EC_NUMBER: 6.3.1.5</p> | |
| 20256 <p>GENE_ASSOCIATION: buc_BU174</p> | |
| 20257 </body> | |
| 20258 </notes> | |
| 20259 <annotation> | |
| 20260 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20261 <rdf:Description rdf:about="#aa174d72-b9dc-4d68-994b-22b8f515a63b"> | |
| 20262 <bqbiol:is> | |
| 20263 <rdf:Bag> | |
| 20264 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.3.1.5"/> | |
| 20265 </rdf:Bag> | |
| 20266 </bqbiol:is> | |
| 20267 </rdf:Description> | |
| 20268 </rdf:RDF> | |
| 20269 </annotation> | |
| 20270 <fbc:geneProductAssociation> | |
| 20271 <fbc:geneProductRef fbc:geneProduct="buc_BU174"/> | |
| 20272 </fbc:geneProductAssociation> | |
| 20273 <listOfReactants> | |
| 20274 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 20275 <speciesReference constant="true" species="C00014" stoichiometry="1"/> | |
| 20276 <speciesReference constant="true" species="C00857" stoichiometry="1"/> | |
| 20277 </listOfReactants> | |
| 20278 <listOfProducts> | |
| 20279 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 20280 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 20281 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 20282 </listOfProducts> | |
| 20283 </reaction> | |
| 20284 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R05636" metaid="_8463aec3-81c7-4f64-825e-2c8120d22dd8" name="1-Deoxy-D-xylulose-5-phosphate pyruvate-lyase (carboxylating)" reversible="true"> | |
| 20285 <notes> | |
| 20286 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20287 <p>SUBSYSTEM: Thiamine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Terpenoid backbone biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20288 <p>EC_NUMBER: 2.2.1.7</p> | |
| 20289 <p>GENE_ASSOCIATION: buc_BU464</p> | |
| 20290 </body> | |
| 20291 </notes> | |
| 20292 <annotation> | |
| 20293 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20294 <rdf:Description rdf:about="#_8463aec3-81c7-4f64-825e-2c8120d22dd8"> | |
| 20295 <bqbiol:is> | |
| 20296 <rdf:Bag> | |
| 20297 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.2.1.7"/> | |
| 20298 </rdf:Bag> | |
| 20299 </bqbiol:is> | |
| 20300 </rdf:Description> | |
| 20301 </rdf:RDF> | |
| 20302 </annotation> | |
| 20303 <fbc:geneProductAssociation> | |
| 20304 <fbc:geneProductRef fbc:geneProduct="buc_BU464"/> | |
| 20305 </fbc:geneProductAssociation> | |
| 20306 <listOfReactants> | |
| 20307 <speciesReference constant="true" species="C00022" stoichiometry="1"/> | |
| 20308 <speciesReference constant="true" species="C00118" stoichiometry="1"/> | |
| 20309 </listOfReactants> | |
| 20310 <listOfProducts> | |
| 20311 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 20312 <speciesReference constant="true" species="C11437" stoichiometry="1"/> | |
| 20313 </listOfProducts> | |
| 20314 </reaction> | |
| 20315 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04426" metaid="_81314b0a-3a01-4309-9a68-3559157aee0a" name="(2R,3S)-3-isopropylmalate:NAD+ oxidoreductase" reversible="true"> | |
| 20316 <notes> | |
| 20317 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20318 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Valine, leucine and isoleucine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20319 <p>EC_NUMBER: 1.1.1.85</p> | |
| 20320 <p>GENE_ASSOCIATION: buc_BUpL05</p> | |
| 20321 </body> | |
| 20322 </notes> | |
| 20323 <annotation> | |
| 20324 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20325 <rdf:Description rdf:about="#_81314b0a-3a01-4309-9a68-3559157aee0a"> | |
| 20326 <bqbiol:is> | |
| 20327 <rdf:Bag> | |
| 20328 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.85"/> | |
| 20329 </rdf:Bag> | |
| 20330 </bqbiol:is> | |
| 20331 </rdf:Description> | |
| 20332 </rdf:RDF> | |
| 20333 </annotation> | |
| 20334 <fbc:geneProductAssociation> | |
| 20335 <fbc:geneProductRef fbc:geneProduct="buc_BUpL05"/> | |
| 20336 </fbc:geneProductAssociation> | |
| 20337 <listOfReactants> | |
| 20338 <speciesReference constant="true" species="C04411" stoichiometry="1"/> | |
| 20339 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 20340 </listOfReactants> | |
| 20341 <listOfProducts> | |
| 20342 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 20343 <speciesReference constant="true" species="C04236" stoichiometry="1"/> | |
| 20344 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 20345 </listOfProducts> | |
| 20346 </reaction> | |
| 20347 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03457" metaid="fc0fce5a-5202-4db3-9366-bb05e1453118" name="D-erythro-1-(Imidazol-4-yl)glycerol 3-phosphate hydro-lyase" reversible="true"> | |
| 20348 <notes> | |
| 20349 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20350 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Histidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20351 <p>EC_NUMBER: 4.2.1.19</p> | |
| 20352 <p>GENE_ASSOCIATION: buc_BU102</p> | |
| 20353 </body> | |
| 20354 </notes> | |
| 20355 <annotation> | |
| 20356 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20357 <rdf:Description rdf:about="#fc0fce5a-5202-4db3-9366-bb05e1453118"> | |
| 20358 <bqbiol:is> | |
| 20359 <rdf:Bag> | |
| 20360 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.2.1.19"/> | |
| 20361 </rdf:Bag> | |
| 20362 </bqbiol:is> | |
| 20363 </rdf:Description> | |
| 20364 </rdf:RDF> | |
| 20365 </annotation> | |
| 20366 <fbc:geneProductAssociation> | |
| 20367 <fbc:geneProductRef fbc:geneProduct="buc_BU102"/> | |
| 20368 </fbc:geneProductAssociation> | |
| 20369 <listOfReactants> | |
| 20370 <speciesReference constant="true" species="C04666" stoichiometry="1"/> | |
| 20371 </listOfReactants> | |
| 20372 <listOfProducts> | |
| 20373 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 20374 <speciesReference constant="true" species="C01267" stoichiometry="1"/> | |
| 20375 </listOfProducts> | |
| 20376 </reaction> | |
| 20377 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R06847" metaid="_94b6f387-6af6-4b83-ac03-e9cb3179a031" name="shikimate:NAD+ 3-oxidoreductase" reversible="true"> | |
| 20378 <notes> | |
| 20379 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20380 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20381 <p>GENE_ASSOCIATION: buc_BU493</p> | |
| 20382 </body> | |
| 20383 </notes> | |
| 20384 <fbc:geneProductAssociation> | |
| 20385 <fbc:geneProductRef fbc:geneProduct="buc_BU493"/> | |
| 20386 </fbc:geneProductAssociation> | |
| 20387 <listOfReactants> | |
| 20388 <speciesReference constant="true" species="C00493" stoichiometry="1"/> | |
| 20389 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 20390 </listOfReactants> | |
| 20391 <listOfProducts> | |
| 20392 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 20393 <speciesReference constant="true" species="C02637" stoichiometry="1"/> | |
| 20394 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 20395 </listOfProducts> | |
| 20396 </reaction> | |
| 20397 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R05637" metaid="_7e162891-b3c7-4c2b-a9dd-268b02b27346" name="2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol CMP-lyase (cyclizing)" reversible="true"> | |
| 20398 <notes> | |
| 20399 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20400 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Terpenoid backbone biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20401 <p>EC_NUMBER: 4.6.1.12</p> | |
| 20402 <p>GENE_ASSOCIATION: buc_BU419</p> | |
| 20403 </body> | |
| 20404 </notes> | |
| 20405 <annotation> | |
| 20406 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20407 <rdf:Description rdf:about="#_7e162891-b3c7-4c2b-a9dd-268b02b27346"> | |
| 20408 <bqbiol:is> | |
| 20409 <rdf:Bag> | |
| 20410 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.6.1.12"/> | |
| 20411 </rdf:Bag> | |
| 20412 </bqbiol:is> | |
| 20413 </rdf:Description> | |
| 20414 </rdf:RDF> | |
| 20415 </annotation> | |
| 20416 <fbc:geneProductAssociation> | |
| 20417 <fbc:geneProductRef fbc:geneProduct="buc_BU419"/> | |
| 20418 </fbc:geneProductAssociation> | |
| 20419 <listOfReactants> | |
| 20420 <speciesReference constant="true" species="C11436" stoichiometry="1"/> | |
| 20421 </listOfReactants> | |
| 20422 <listOfProducts> | |
| 20423 <speciesReference constant="true" species="C00055" stoichiometry="1"/> | |
| 20424 <speciesReference constant="true" species="C11453" stoichiometry="1"/> | |
| 20425 </listOfProducts> | |
| 20426 </reaction> | |
| 20427 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01158" metaid="_0509c91d-6307-4e12-adf6-f9aeab24ddca" name="L-histidinol:NAD+ oxidoreductase" reversible="false"> | |
| 20428 <notes> | |
| 20429 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20430 <p>SUBSYSTEM: Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20431 <p>EC_NUMBER: 1.1.1.23</p> | |
| 20432 <p>GENE_ASSOCIATION: buc_BU100</p> | |
| 20433 </body> | |
| 20434 </notes> | |
| 20435 <annotation> | |
| 20436 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20437 <rdf:Description rdf:about="#_0509c91d-6307-4e12-adf6-f9aeab24ddca"> | |
| 20438 <bqbiol:is> | |
| 20439 <rdf:Bag> | |
| 20440 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.23"/> | |
| 20441 </rdf:Bag> | |
| 20442 </bqbiol:is> | |
| 20443 </rdf:Description> | |
| 20444 </rdf:RDF> | |
| 20445 </annotation> | |
| 20446 <fbc:geneProductAssociation> | |
| 20447 <fbc:geneProductRef fbc:geneProduct="buc_BU100"/> | |
| 20448 </fbc:geneProductAssociation> | |
| 20449 <listOfReactants> | |
| 20450 <speciesReference constant="true" species="C00860" stoichiometry="1"/> | |
| 20451 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 20452 <speciesReference constant="true" species="C00003" stoichiometry="2"/> | |
| 20453 </listOfReactants> | |
| 20454 <listOfProducts> | |
| 20455 <speciesReference constant="true" species="C00080" stoichiometry="2"/> | |
| 20456 <speciesReference constant="true" species="C00004" stoichiometry="2"/> | |
| 20457 <speciesReference constant="true" species="C00135" stoichiometry="1"/> | |
| 20458 </listOfProducts> | |
| 20459 </reaction> | |
| 20460 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03459" metaid="e2ed8741-7bc0-4385-bec8-b2c4407f15fa" name="2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)-pyrimidine 2-aminohydrolase" reversible="true"> | |
| 20461 <notes> | |
| 20462 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20463 <p>SUBSYSTEM: Riboflavin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20464 <p>EC_NUMBER: 3.5.4.26</p> | |
| 20465 <p>GENE_ASSOCIATION: buc_BU461</p> | |
| 20466 </body> | |
| 20467 </notes> | |
| 20468 <annotation> | |
| 20469 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20470 <rdf:Description rdf:about="#e2ed8741-7bc0-4385-bec8-b2c4407f15fa"> | |
| 20471 <bqbiol:is> | |
| 20472 <rdf:Bag> | |
| 20473 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.5.4.26"/> | |
| 20474 </rdf:Bag> | |
| 20475 </bqbiol:is> | |
| 20476 </rdf:Description> | |
| 20477 </rdf:RDF> | |
| 20478 </annotation> | |
| 20479 <fbc:geneProductAssociation> | |
| 20480 <fbc:geneProductRef fbc:geneProduct="buc_BU461"/> | |
| 20481 </fbc:geneProductAssociation> | |
| 20482 <listOfReactants> | |
| 20483 <speciesReference constant="true" species="C01304" stoichiometry="1"/> | |
| 20484 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 20485 </listOfReactants> | |
| 20486 <listOfProducts> | |
| 20487 <speciesReference constant="true" species="C00014" stoichiometry="1"/> | |
| 20488 <speciesReference constant="true" species="C01268" stoichiometry="1"/> | |
| 20489 </listOfProducts> | |
| 20490 </reaction> | |
| 20491 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R05634" metaid="_80955609-7d00-4e8b-b3d0-7d8439e217c1" name="ATP:4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol 2-phosphotransferase" reversible="true"> | |
| 20492 <notes> | |
| 20493 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20494 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Terpenoid backbone biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20495 <p>EC_NUMBER: 2.7.1.148</p> | |
| 20496 <p>GENE_ASSOCIATION: buc_BU170</p> | |
| 20497 </body> | |
| 20498 </notes> | |
| 20499 <annotation> | |
| 20500 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20501 <rdf:Description rdf:about="#_80955609-7d00-4e8b-b3d0-7d8439e217c1"> | |
| 20502 <bqbiol:is> | |
| 20503 <rdf:Bag> | |
| 20504 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.148"/> | |
| 20505 </rdf:Bag> | |
| 20506 </bqbiol:is> | |
| 20507 </rdf:Description> | |
| 20508 </rdf:RDF> | |
| 20509 </annotation> | |
| 20510 <fbc:geneProductAssociation> | |
| 20511 <fbc:geneProductRef fbc:geneProduct="buc_BU170"/> | |
| 20512 </fbc:geneProductAssociation> | |
| 20513 <listOfReactants> | |
| 20514 <speciesReference constant="true" species="C11435" stoichiometry="1"/> | |
| 20515 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 20516 </listOfReactants> | |
| 20517 <listOfProducts> | |
| 20518 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 20519 <speciesReference constant="true" species="C11436" stoichiometry="1"/> | |
| 20520 </listOfProducts> | |
| 20521 </reaction> | |
| 20522 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03458" metaid="c4743fae-de5c-4452-9fea-30b67b7dd860" name="5-amino-6-(5-phosphoribitylamino)uracil:NADP+ 1'-oxidoreductase" reversible="true"> | |
| 20523 <notes> | |
| 20524 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20525 <p>SUBSYSTEM: Riboflavin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20526 <p>EC_NUMBER: 1.1.1.193</p> | |
| 20527 <p>GENE_ASSOCIATION: buc_BU462</p> | |
| 20528 </body> | |
| 20529 </notes> | |
| 20530 <annotation> | |
| 20531 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20532 <rdf:Description rdf:about="#c4743fae-de5c-4452-9fea-30b67b7dd860"> | |
| 20533 <bqbiol:is> | |
| 20534 <rdf:Bag> | |
| 20535 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.193"/> | |
| 20536 </rdf:Bag> | |
| 20537 </bqbiol:is> | |
| 20538 </rdf:Description> | |
| 20539 </rdf:RDF> | |
| 20540 </annotation> | |
| 20541 <fbc:geneProductAssociation> | |
| 20542 <fbc:geneProductRef fbc:geneProduct="buc_BU462"/> | |
| 20543 </fbc:geneProductAssociation> | |
| 20544 <listOfReactants> | |
| 20545 <speciesReference constant="true" species="C04454" stoichiometry="1"/> | |
| 20546 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 20547 </listOfReactants> | |
| 20548 <listOfProducts> | |
| 20549 <speciesReference constant="true" species="C01268" stoichiometry="1"/> | |
| 20550 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 20551 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 20552 </listOfProducts> | |
| 20553 </reaction> | |
| 20554 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04429" metaid="_77560a46-efd5-4230-a0fe-ae4a49d80343" name="butyryl-[acp]:NAD+ trans-2-oxidoreductase" reversible="true"> | |
| 20555 <notes> | |
| 20556 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20557 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20558 <p>EC_NUMBER: 1.3.1.9</p> | |
| 20559 <p>GENE_ASSOCIATION: buc_BU265</p> | |
| 20560 </body> | |
| 20561 </notes> | |
| 20562 <annotation> | |
| 20563 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20564 <rdf:Description rdf:about="#_77560a46-efd5-4230-a0fe-ae4a49d80343"> | |
| 20565 <bqbiol:is> | |
| 20566 <rdf:Bag> | |
| 20567 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.3.1.9"/> | |
| 20568 </rdf:Bag> | |
| 20569 </bqbiol:is> | |
| 20570 </rdf:Description> | |
| 20571 </rdf:RDF> | |
| 20572 </annotation> | |
| 20573 <fbc:geneProductAssociation> | |
| 20574 <fbc:geneProductRef fbc:geneProduct="buc_BU265"/> | |
| 20575 </fbc:geneProductAssociation> | |
| 20576 <listOfReactants> | |
| 20577 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 20578 <speciesReference constant="true" species="C05745" stoichiometry="1"/> | |
| 20579 </listOfReactants> | |
| 20580 <listOfProducts> | |
| 20581 <speciesReference constant="true" species="C04246" stoichiometry="1"/> | |
| 20582 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 20583 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 20584 </listOfProducts> | |
| 20585 </reaction> | |
| 20586 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03460" metaid="b66a8999-bd13-490c-8cb4-0d893421c114" name="phosphoenolpyruvate:3-phosphoshikimate 5-O-(1-carboxyvinyl)-transferase" reversible="true"> | |
| 20587 <notes> | |
| 20588 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20589 <p>SUBSYSTEM: Phenylalanine, tyrosine and tryptophan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20590 <p>EC_NUMBER: 2.5.1.19</p> | |
| 20591 <p>GENE_ASSOCIATION: buc_BU311</p> | |
| 20592 </body> | |
| 20593 </notes> | |
| 20594 <annotation> | |
| 20595 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20596 <rdf:Description rdf:about="#b66a8999-bd13-490c-8cb4-0d893421c114"> | |
| 20597 <bqbiol:is> | |
| 20598 <rdf:Bag> | |
| 20599 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.5.1.19"/> | |
| 20600 </rdf:Bag> | |
| 20601 </bqbiol:is> | |
| 20602 </rdf:Description> | |
| 20603 </rdf:RDF> | |
| 20604 </annotation> | |
| 20605 <fbc:geneProductAssociation> | |
| 20606 <fbc:geneProductRef fbc:geneProduct="buc_BU311"/> | |
| 20607 </fbc:geneProductAssociation> | |
| 20608 <listOfReactants> | |
| 20609 <speciesReference constant="true" species="C00074" stoichiometry="1"/> | |
| 20610 <speciesReference constant="true" species="C03175" stoichiometry="1"/> | |
| 20611 </listOfReactants> | |
| 20612 <listOfProducts> | |
| 20613 <speciesReference constant="true" species="C01269" stoichiometry="1"/> | |
| 20614 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 20615 </listOfProducts> | |
| 20616 </reaction> | |
| 20617 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04430" metaid="_0a89a4b9-6a21-4e33-a348-c85cd07af00b" name="butyryl-[acp]:NADP+ trans-2-oxidoreductase" reversible="true"> | |
| 20618 <notes> | |
| 20619 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20620 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20621 <p>EC_NUMBER: 1.3.1.10</p> | |
| 20622 <p>GENE_ASSOCIATION: buc_BU265</p> | |
| 20623 </body> | |
| 20624 </notes> | |
| 20625 <annotation> | |
| 20626 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20627 <rdf:Description rdf:about="#_0a89a4b9-6a21-4e33-a348-c85cd07af00b"> | |
| 20628 <bqbiol:is> | |
| 20629 <rdf:Bag> | |
| 20630 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.3.1.10"/> | |
| 20631 </rdf:Bag> | |
| 20632 </bqbiol:is> | |
| 20633 </rdf:Description> | |
| 20634 </rdf:RDF> | |
| 20635 </annotation> | |
| 20636 <fbc:geneProductAssociation> | |
| 20637 <fbc:geneProductRef fbc:geneProduct="buc_BU265"/> | |
| 20638 </fbc:geneProductAssociation> | |
| 20639 <listOfReactants> | |
| 20640 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 20641 <speciesReference constant="true" species="C05745" stoichiometry="1"/> | |
| 20642 </listOfReactants> | |
| 20643 <listOfProducts> | |
| 20644 <speciesReference constant="true" species="C04246" stoichiometry="1"/> | |
| 20645 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 20646 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 20647 </listOfProducts> | |
| 20648 </reaction> | |
| 20649 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00194" metaid="af8d133c-c2c4-4018-9aee-2bfa227d7ccc" name="S-Adenosyl-L-homocysteine homocysteinylribohydrolase" reversible="true"> | |
| 20650 <notes> | |
| 20651 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20652 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Cysteine and methionine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20653 <p>EC_NUMBER: 3.2.2.9</p> | |
| 20654 <p>GENE_ASSOCIATION: buc_BU210</p> | |
| 20655 </body> | |
| 20656 </notes> | |
| 20657 <annotation> | |
| 20658 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20659 <rdf:Description rdf:about="#af8d133c-c2c4-4018-9aee-2bfa227d7ccc"> | |
| 20660 <bqbiol:is> | |
| 20661 <rdf:Bag> | |
| 20662 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.2.2.9"/> | |
| 20663 </rdf:Bag> | |
| 20664 </bqbiol:is> | |
| 20665 </rdf:Description> | |
| 20666 </rdf:RDF> | |
| 20667 </annotation> | |
| 20668 <fbc:geneProductAssociation> | |
| 20669 <fbc:geneProductRef fbc:geneProduct="buc_BU210"/> | |
| 20670 </fbc:geneProductAssociation> | |
| 20671 <listOfReactants> | |
| 20672 <speciesReference constant="true" species="C00021" stoichiometry="1"/> | |
| 20673 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 20674 </listOfReactants> | |
| 20675 <listOfProducts> | |
| 20676 <speciesReference constant="true" species="C03539" stoichiometry="1"/> | |
| 20677 <speciesReference constant="true" species="C00147" stoichiometry="1"/> | |
| 20678 </listOfProducts> | |
| 20679 </reaction> | |
| 20680 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01163" metaid="bc4e8f37-0fa5-42d2-8a4c-df761ef11344" name="L-histidinal:NAD+ oxidoreductase" reversible="true"> | |
| 20681 <notes> | |
| 20682 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20683 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Histidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20684 <p>EC_NUMBER: 1.1.1.23</p> | |
| 20685 <p>GENE_ASSOCIATION: buc_BU100</p> | |
| 20686 </body> | |
| 20687 </notes> | |
| 20688 <annotation> | |
| 20689 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20690 <rdf:Description rdf:about="#bc4e8f37-0fa5-42d2-8a4c-df761ef11344"> | |
| 20691 <bqbiol:is> | |
| 20692 <rdf:Bag> | |
| 20693 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.23"/> | |
| 20694 </rdf:Bag> | |
| 20695 </bqbiol:is> | |
| 20696 </rdf:Description> | |
| 20697 </rdf:RDF> | |
| 20698 </annotation> | |
| 20699 <fbc:geneProductAssociation> | |
| 20700 <fbc:geneProductRef fbc:geneProduct="buc_BU100"/> | |
| 20701 </fbc:geneProductAssociation> | |
| 20702 <listOfReactants> | |
| 20703 <speciesReference constant="true" species="C01929" stoichiometry="1"/> | |
| 20704 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 20705 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 20706 </listOfReactants> | |
| 20707 <listOfProducts> | |
| 20708 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 20709 <speciesReference constant="true" species="C00135" stoichiometry="1"/> | |
| 20710 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 20711 </listOfProducts> | |
| 20712 </reaction> | |
| 20713 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R06975" metaid="ca94bf84-f898-42bb-90ea-458e8e3db118" name="formate:5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxamide ligase (ADP-forming)" reversible="true"> | |
| 20714 <notes> | |
| 20715 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20716 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20717 <p>GENE_ASSOCIATION: buc_BU031</p> | |
| 20718 </body> | |
| 20719 </notes> | |
| 20720 <fbc:geneProductAssociation> | |
| 20721 <fbc:geneProductRef fbc:geneProduct="buc_BU031"/> | |
| 20722 </fbc:geneProductAssociation> | |
| 20723 <listOfReactants> | |
| 20724 <speciesReference constant="true" species="C00058" stoichiometry="1"/> | |
| 20725 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 20726 <speciesReference constant="true" species="C04677" stoichiometry="1"/> | |
| 20727 </listOfReactants> | |
| 20728 <listOfProducts> | |
| 20729 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 20730 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 20731 <speciesReference constant="true" species="C04734" stoichiometry="1"/> | |
| 20732 </listOfProducts> | |
| 20733 </reaction> | |
| 20734 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R12049" metaid="_74e85786-44dd-48b6-8002-f2e7dff66c10" name="R12049" reversible="true"> | |
| 20735 <notes> | |
| 20736 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20737 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20738 <p>GENE_ASSOCIATION: buc_BU352</p> | |
| 20739 </body> | |
| 20740 </notes> | |
| 20741 <fbc:geneProductAssociation> | |
| 20742 <fbc:geneProductRef fbc:geneProduct="buc_BU352"/> | |
| 20743 </fbc:geneProductAssociation> | |
| 20744 <listOfReactants> | |
| 20745 <speciesReference constant="true" species="C00083" stoichiometry="2"/> | |
| 20746 <speciesReference constant="true" species="C02247" stoichiometry="1"/> | |
| 20747 </listOfReactants> | |
| 20748 <listOfProducts> | |
| 20749 <speciesReference constant="true" species="C00010" stoichiometry="3"/> | |
| 20750 <speciesReference constant="true" species="C00011" stoichiometry="3"/> | |
| 20751 <speciesReference constant="true" species="C21873" stoichiometry="1"/> | |
| 20752 </listOfProducts> | |
| 20753 </reaction> | |
| 20754 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00199" metaid="f28d8825-5116-41e7-97b4-77f32150f60d" name="ATP:pyruvate,water phosphotransferase" reversible="true"> | |
| 20755 <notes> | |
| 20756 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20757 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20758 <p>GENE_ASSOCIATION: buc_BU319</p> | |
| 20759 </body> | |
| 20760 </notes> | |
| 20761 <fbc:geneProductAssociation> | |
| 20762 <fbc:geneProductRef fbc:geneProduct="buc_BU319"/> | |
| 20763 </fbc:geneProductAssociation> | |
| 20764 <listOfReactants> | |
| 20765 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 20766 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 20767 <speciesReference constant="true" species="C00022" stoichiometry="1"/> | |
| 20768 </listOfReactants> | |
| 20769 <listOfProducts> | |
| 20770 <speciesReference constant="true" species="C00074" stoichiometry="1"/> | |
| 20771 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 20772 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 20773 </listOfProducts> | |
| 20774 </reaction> | |
| 20775 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R05884" metaid="_8efd0e3a-aac4-45b6-bab6-a511885f9447" name="isopentenyl-diphosphate:ferredoxin oxidoreductase" reversible="true"> | |
| 20776 <notes> | |
| 20777 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20778 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Terpenoid backbone biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20779 <p>EC_NUMBER: 1.17.7.4</p> | |
| 20780 <p>GENE_ASSOCIATION: buc_BU147</p> | |
| 20781 </body> | |
| 20782 </notes> | |
| 20783 <annotation> | |
| 20784 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20785 <rdf:Description rdf:about="#_8efd0e3a-aac4-45b6-bab6-a511885f9447"> | |
| 20786 <bqbiol:is> | |
| 20787 <rdf:Bag> | |
| 20788 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.17.7.4"/> | |
| 20789 </rdf:Bag> | |
| 20790 </bqbiol:is> | |
| 20791 </rdf:Description> | |
| 20792 </rdf:RDF> | |
| 20793 </annotation> | |
| 20794 <fbc:geneProductAssociation> | |
| 20795 <fbc:geneProductRef fbc:geneProduct="buc_BU147"/> | |
| 20796 </fbc:geneProductAssociation> | |
| 20797 <listOfReactants> | |
| 20798 <speciesReference constant="true" species="C11811" stoichiometry="1"/> | |
| 20799 <speciesReference constant="true" species="C00080" stoichiometry="2"/> | |
| 20800 <speciesReference constant="true" species="C00138" stoichiometry="2"/> | |
| 20801 </listOfReactants> | |
| 20802 <listOfProducts> | |
| 20803 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 20804 <speciesReference constant="true" species="C00139" stoichiometry="2"/> | |
| 20805 <speciesReference constant="true" species="C00129" stoichiometry="1"/> | |
| 20806 </listOfProducts> | |
| 20807 </reaction> | |
| 20808 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02236" metaid="_5adf20ce-abd9-40e2-8abd-4f315c1644f8" name="dihydrofolate:NADP+ oxidoreductase" reversible="true"> | |
| 20809 <notes> | |
| 20810 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20811 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || One carbon pool by folate - Buchnera aphidicola APS (Acyrthosiphon pisum) || Folate biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20812 <p>EC_NUMBER: 1.5.1.3</p> | |
| 20813 <p>GENE_ASSOCIATION: buc_BU143</p> | |
| 20814 </body> | |
| 20815 </notes> | |
| 20816 <annotation> | |
| 20817 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20818 <rdf:Description rdf:about="#_5adf20ce-abd9-40e2-8abd-4f315c1644f8"> | |
| 20819 <bqbiol:is> | |
| 20820 <rdf:Bag> | |
| 20821 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.5.1.3"/> | |
| 20822 </rdf:Bag> | |
| 20823 </bqbiol:is> | |
| 20824 </rdf:Description> | |
| 20825 </rdf:RDF> | |
| 20826 </annotation> | |
| 20827 <fbc:geneProductAssociation> | |
| 20828 <fbc:geneProductRef fbc:geneProduct="buc_BU143"/> | |
| 20829 </fbc:geneProductAssociation> | |
| 20830 <listOfReactants> | |
| 20831 <speciesReference constant="true" species="C00415" stoichiometry="1"/> | |
| 20832 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 20833 </listOfReactants> | |
| 20834 <listOfProducts> | |
| 20835 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 20836 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 20837 <speciesReference constant="true" species="C00504" stoichiometry="1"/> | |
| 20838 </listOfProducts> | |
| 20839 </reaction> | |
| 20840 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00178" metaid="_41e1e82b-6bbc-40e8-b2b4-f7258f15201e" name="S-adenosyl-L-methionine carboxy-lyase [S-adenosyl 3-(methylsulfanyl)propylamine-forming]" reversible="true"> | |
| 20841 <notes> | |
| 20842 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20843 <p>SUBSYSTEM: Arginine and proline metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Cysteine and methionine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20844 <p>EC_NUMBER: 4.1.1.50</p> | |
| 20845 <p>GENE_ASSOCIATION: buc_BU208</p> | |
| 20846 </body> | |
| 20847 </notes> | |
| 20848 <annotation> | |
| 20849 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20850 <rdf:Description rdf:about="#_41e1e82b-6bbc-40e8-b2b4-f7258f15201e"> | |
| 20851 <bqbiol:is> | |
| 20852 <rdf:Bag> | |
| 20853 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.1.1.50"/> | |
| 20854 </rdf:Bag> | |
| 20855 </bqbiol:is> | |
| 20856 </rdf:Description> | |
| 20857 </rdf:RDF> | |
| 20858 </annotation> | |
| 20859 <fbc:geneProductAssociation> | |
| 20860 <fbc:geneProductRef fbc:geneProduct="buc_BU208"/> | |
| 20861 </fbc:geneProductAssociation> | |
| 20862 <listOfReactants> | |
| 20863 <speciesReference constant="true" species="C00019" stoichiometry="1"/> | |
| 20864 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 20865 </listOfReactants> | |
| 20866 <listOfProducts> | |
| 20867 <speciesReference constant="true" species="C01137" stoichiometry="1"/> | |
| 20868 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 20869 </listOfProducts> | |
| 20870 </reaction> | |
| 20871 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04536" metaid="e333412b-d506-472e-b7d9-12e97cc2d3cf" name="(3R)-3-hydroxyoctanoyl-[acyl-carrier-protein]:NADP+ oxidoreductase" reversible="true"> | |
| 20872 <notes> | |
| 20873 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20874 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20875 <p>EC_NUMBER: 1.1.1.100</p> | |
| 20876 <p>GENE_ASSOCIATION: buc_BU351</p> | |
| 20877 </body> | |
| 20878 </notes> | |
| 20879 <annotation> | |
| 20880 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20881 <rdf:Description rdf:about="#e333412b-d506-472e-b7d9-12e97cc2d3cf"> | |
| 20882 <bqbiol:is> | |
| 20883 <rdf:Bag> | |
| 20884 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.100"/> | |
| 20885 </rdf:Bag> | |
| 20886 </bqbiol:is> | |
| 20887 </rdf:Description> | |
| 20888 </rdf:RDF> | |
| 20889 </annotation> | |
| 20890 <fbc:geneProductAssociation> | |
| 20891 <fbc:geneProductRef fbc:geneProduct="buc_BU351"/> | |
| 20892 </fbc:geneProductAssociation> | |
| 20893 <listOfReactants> | |
| 20894 <speciesReference constant="true" species="C04620" stoichiometry="1"/> | |
| 20895 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 20896 </listOfReactants> | |
| 20897 <listOfProducts> | |
| 20898 <speciesReference constant="true" species="C05750" stoichiometry="1"/> | |
| 20899 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 20900 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 20901 </listOfProducts> | |
| 20902 </reaction> | |
| 20903 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02235" metaid="_573db7e2-10cc-4daa-83f4-0d90ca9f614a" name="dihydrofolate:NAD+ oxidoreductase" reversible="true"> | |
| 20904 <notes> | |
| 20905 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20906 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || One carbon pool by folate - Buchnera aphidicola APS (Acyrthosiphon pisum) || Folate biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20907 <p>EC_NUMBER: 1.5.1.3</p> | |
| 20908 <p>GENE_ASSOCIATION: buc_BU143</p> | |
| 20909 </body> | |
| 20910 </notes> | |
| 20911 <annotation> | |
| 20912 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20913 <rdf:Description rdf:about="#_573db7e2-10cc-4daa-83f4-0d90ca9f614a"> | |
| 20914 <bqbiol:is> | |
| 20915 <rdf:Bag> | |
| 20916 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.5.1.3"/> | |
| 20917 </rdf:Bag> | |
| 20918 </bqbiol:is> | |
| 20919 </rdf:Description> | |
| 20920 </rdf:RDF> | |
| 20921 </annotation> | |
| 20922 <fbc:geneProductAssociation> | |
| 20923 <fbc:geneProductRef fbc:geneProduct="buc_BU143"/> | |
| 20924 </fbc:geneProductAssociation> | |
| 20925 <listOfReactants> | |
| 20926 <speciesReference constant="true" species="C00415" stoichiometry="1"/> | |
| 20927 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 20928 </listOfReactants> | |
| 20929 <listOfProducts> | |
| 20930 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 20931 <speciesReference constant="true" species="C00504" stoichiometry="1"/> | |
| 20932 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 20933 </listOfProducts> | |
| 20934 </reaction> | |
| 20935 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04779" metaid="_233cfb25-b558-40aa-9d00-97f80ff09398" name="ATP:D-fructose-6-phosphate 1-phosphotransferase" reversible="true"> | |
| 20936 <notes> | |
| 20937 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20938 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glycolysis / Gluconeogenesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fructose and mannose metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pentose phosphate pathway - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20939 <p>EC_NUMBER: 2.7.1.11</p> | |
| 20940 <p>GENE_ASSOCIATION: buc_BU305</p> | |
| 20941 </body> | |
| 20942 </notes> | |
| 20943 <annotation> | |
| 20944 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20945 <rdf:Description rdf:about="#_233cfb25-b558-40aa-9d00-97f80ff09398"> | |
| 20946 <bqbiol:is> | |
| 20947 <rdf:Bag> | |
| 20948 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.11"/> | |
| 20949 </rdf:Bag> | |
| 20950 </bqbiol:is> | |
| 20951 </rdf:Description> | |
| 20952 </rdf:RDF> | |
| 20953 </annotation> | |
| 20954 <fbc:geneProductAssociation> | |
| 20955 <fbc:geneProductRef fbc:geneProduct="buc_BU305"/> | |
| 20956 </fbc:geneProductAssociation> | |
| 20957 <listOfReactants> | |
| 20958 <speciesReference constant="true" species="C05345" stoichiometry="1"/> | |
| 20959 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 20960 </listOfReactants> | |
| 20961 <listOfProducts> | |
| 20962 <speciesReference constant="true" species="C05378" stoichiometry="1"/> | |
| 20963 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 20964 </listOfProducts> | |
| 20965 </reaction> | |
| 20966 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04534" metaid="fb19aa5b-2577-4df4-9c1f-8ffd422e1fca" name="(3R)-3-hydroxydecanoyl-[acyl-carrier-protein]:NADP+ oxidoreductase" reversible="true"> | |
| 20967 <notes> | |
| 20968 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 20969 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 20970 <p>EC_NUMBER: 1.1.1.100</p> | |
| 20971 <p>GENE_ASSOCIATION: buc_BU351</p> | |
| 20972 </body> | |
| 20973 </notes> | |
| 20974 <annotation> | |
| 20975 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 20976 <rdf:Description rdf:about="#fb19aa5b-2577-4df4-9c1f-8ffd422e1fca"> | |
| 20977 <bqbiol:is> | |
| 20978 <rdf:Bag> | |
| 20979 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.100"/> | |
| 20980 </rdf:Bag> | |
| 20981 </bqbiol:is> | |
| 20982 </rdf:Description> | |
| 20983 </rdf:RDF> | |
| 20984 </annotation> | |
| 20985 <fbc:geneProductAssociation> | |
| 20986 <fbc:geneProductRef fbc:geneProduct="buc_BU351"/> | |
| 20987 </fbc:geneProductAssociation> | |
| 20988 <listOfReactants> | |
| 20989 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 20990 <speciesReference constant="true" species="C04619" stoichiometry="1"/> | |
| 20991 </listOfReactants> | |
| 20992 <listOfProducts> | |
| 20993 <speciesReference constant="true" species="C05753" stoichiometry="1"/> | |
| 20994 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 20995 </listOfProducts> | |
| 20996 </reaction> | |
| 20997 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02237" metaid="ce0f68ec-b6e2-4325-89bf-1933eab6af4c" name="7,8-dihydropteroate:L-glutamate ligase (ADP-forming)" reversible="true"> | |
| 20998 <notes> | |
| 20999 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21000 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Folate biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21001 <p>EC_NUMBER: 6.3.2.12 / 6.3.2.17</p> | |
| 21002 <p>GENE_ASSOCIATION: buc_BU167</p> | |
| 21003 </body> | |
| 21004 </notes> | |
| 21005 <annotation> | |
| 21006 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21007 <rdf:Description rdf:about="#ce0f68ec-b6e2-4325-89bf-1933eab6af4c"> | |
| 21008 <bqbiol:is> | |
| 21009 <rdf:Bag> | |
| 21010 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.3.2.12 / 6.3.2.17"/> | |
| 21011 </rdf:Bag> | |
| 21012 </bqbiol:is> | |
| 21013 </rdf:Description> | |
| 21014 </rdf:RDF> | |
| 21015 </annotation> | |
| 21016 <fbc:geneProductAssociation> | |
| 21017 <fbc:geneProductRef fbc:geneProduct="buc_BU167"/> | |
| 21018 </fbc:geneProductAssociation> | |
| 21019 <listOfReactants> | |
| 21020 <speciesReference constant="true" species="C00025" stoichiometry="1"/> | |
| 21021 <speciesReference constant="true" species="C00921" stoichiometry="1"/> | |
| 21022 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 21023 </listOfReactants> | |
| 21024 <listOfProducts> | |
| 21025 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 21026 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 21027 <speciesReference constant="true" species="C00415" stoichiometry="1"/> | |
| 21028 </listOfProducts> | |
| 21029 </reaction> | |
| 21030 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R05629" metaid="_2b66a674-8669-4206-a427-01e2a758bad5" name="UDPMurAc(oyl-L-Ala-D-gamma-Glu-L-Lys-D-Ala-D-Ala):undecaprenyl-phosphate phospho-N-acetylmuramoyl-pentapeptide-transferase" reversible="true"> | |
| 21031 <notes> | |
| 21032 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21033 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Peptidoglycan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21034 <p>EC_NUMBER: 2.7.8.13</p> | |
| 21035 <p>GENE_ASSOCIATION: buc_BU219</p> | |
| 21036 </body> | |
| 21037 </notes> | |
| 21038 <annotation> | |
| 21039 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21040 <rdf:Description rdf:about="#_2b66a674-8669-4206-a427-01e2a758bad5"> | |
| 21041 <bqbiol:is> | |
| 21042 <rdf:Bag> | |
| 21043 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.8.13"/> | |
| 21044 </rdf:Bag> | |
| 21045 </bqbiol:is> | |
| 21046 </rdf:Description> | |
| 21047 </rdf:RDF> | |
| 21048 </annotation> | |
| 21049 <fbc:geneProductAssociation> | |
| 21050 <fbc:geneProductRef fbc:geneProduct="buc_BU219"/> | |
| 21051 </fbc:geneProductAssociation> | |
| 21052 <listOfReactants> | |
| 21053 <speciesReference constant="true" species="C17556" stoichiometry="1"/> | |
| 21054 <speciesReference constant="true" species="C04702" stoichiometry="1"/> | |
| 21055 </listOfReactants> | |
| 21056 <listOfProducts> | |
| 21057 <speciesReference constant="true" species="C00105" stoichiometry="1"/> | |
| 21058 <speciesReference constant="true" species="C04851" stoichiometry="1"/> | |
| 21059 </listOfProducts> | |
| 21060 </reaction> | |
| 21061 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R05627" metaid="_29de804f-e546-40df-8498-a7f6bb11f6b5" name="undecaprenyl-diphosphate phosphohydrolase" reversible="false"> | |
| 21062 <notes> | |
| 21063 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21064 <p>SUBSYSTEM: Teichoic acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Peptidoglycan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21065 <p>EC_NUMBER: 3.6.1.27</p> | |
| 21066 <p>GENE_ASSOCIATION: buc_BU062</p> | |
| 21067 </body> | |
| 21068 </notes> | |
| 21069 <annotation> | |
| 21070 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21071 <rdf:Description rdf:about="#_29de804f-e546-40df-8498-a7f6bb11f6b5"> | |
| 21072 <bqbiol:is> | |
| 21073 <rdf:Bag> | |
| 21074 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.6.1.27"/> | |
| 21075 </rdf:Bag> | |
| 21076 </bqbiol:is> | |
| 21077 </rdf:Description> | |
| 21078 </rdf:RDF> | |
| 21079 </annotation> | |
| 21080 <fbc:geneProductAssociation> | |
| 21081 <fbc:geneProductRef fbc:geneProduct="buc_BU062"/> | |
| 21082 </fbc:geneProductAssociation> | |
| 21083 <listOfReactants> | |
| 21084 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 21085 <speciesReference constant="true" species="C04574" stoichiometry="1"/> | |
| 21086 </listOfReactants> | |
| 21087 <listOfProducts> | |
| 21088 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 21089 <speciesReference constant="true" species="C17556" stoichiometry="1"/> | |
| 21090 </listOfProducts> | |
| 21091 </reaction> | |
| 21092 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04780" metaid="bc1aaf90-4f80-4533-81c3-dd99c760bccf" name="beta-D-Fructose 1,6-bisphosphate 1-phosphohydrolase" reversible="true"> | |
| 21093 <notes> | |
| 21094 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21095 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21096 <p>GENE_ASSOCIATION: buc_BU305</p> | |
| 21097 </body> | |
| 21098 </notes> | |
| 21099 <fbc:geneProductAssociation> | |
| 21100 <fbc:geneProductRef fbc:geneProduct="buc_BU305"/> | |
| 21101 </fbc:geneProductAssociation> | |
| 21102 <listOfReactants> | |
| 21103 <speciesReference constant="true" species="C05378" stoichiometry="1"/> | |
| 21104 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 21105 </listOfReactants> | |
| 21106 <listOfProducts> | |
| 21107 <speciesReference constant="true" species="C05345" stoichiometry="1"/> | |
| 21108 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 21109 </listOfProducts> | |
| 21110 </reaction> | |
| 21111 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01273" metaid="_0ed2f7ba-6193-4d78-b289-30ce610aaceb" name="N-ribosylnicotinamide ribohydrolase" reversible="true"> | |
| 21112 <notes> | |
| 21113 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21114 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21115 <p>GENE_ASSOCIATION: buc_BU541</p> | |
| 21116 </body> | |
| 21117 </notes> | |
| 21118 <fbc:geneProductAssociation> | |
| 21119 <fbc:geneProductRef fbc:geneProduct="buc_BU541"/> | |
| 21120 </fbc:geneProductAssociation> | |
| 21121 <listOfReactants> | |
| 21122 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 21123 <speciesReference constant="true" species="C03150" stoichiometry="1"/> | |
| 21124 </listOfReactants> | |
| 21125 <listOfProducts> | |
| 21126 <speciesReference constant="true" species="C00121" stoichiometry="1"/> | |
| 21127 <speciesReference constant="true" species="C00153" stoichiometry="1"/> | |
| 21128 </listOfProducts> | |
| 21129 </reaction> | |
| 21130 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04543" metaid="d2ad6bc7-1cb3-4824-94e9-44967ed44059" name="(3R)-3-hydroxypalmitoyl-[acyl-carrier-protein]:NADP+ oxidoreductase" reversible="true"> | |
| 21131 <notes> | |
| 21132 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21133 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21134 <p>EC_NUMBER: 1.1.1.100</p> | |
| 21135 <p>GENE_ASSOCIATION: buc_BU351</p> | |
| 21136 </body> | |
| 21137 </notes> | |
| 21138 <annotation> | |
| 21139 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21140 <rdf:Description rdf:about="#d2ad6bc7-1cb3-4824-94e9-44967ed44059"> | |
| 21141 <bqbiol:is> | |
| 21142 <rdf:Bag> | |
| 21143 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.100"/> | |
| 21144 </rdf:Bag> | |
| 21145 </bqbiol:is> | |
| 21146 </rdf:Description> | |
| 21147 </rdf:RDF> | |
| 21148 </annotation> | |
| 21149 <fbc:geneProductAssociation> | |
| 21150 <fbc:geneProductRef fbc:geneProduct="buc_BU351"/> | |
| 21151 </fbc:geneProductAssociation> | |
| 21152 <listOfReactants> | |
| 21153 <speciesReference constant="true" species="C04633" stoichiometry="1"/> | |
| 21154 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 21155 </listOfReactants> | |
| 21156 <listOfProducts> | |
| 21157 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 21158 <speciesReference constant="true" species="C05762" stoichiometry="1"/> | |
| 21159 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 21160 </listOfProducts> | |
| 21161 </reaction> | |
| 21162 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R05633" metaid="_42789bf5-b17e-4c79-a21a-3531ea3bfc8c" name="CTP: 2-C-Methyl-D-erythritol 4-phosphate cytidylyltransferase" reversible="true"> | |
| 21163 <notes> | |
| 21164 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21165 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Terpenoid backbone biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21166 <p>EC_NUMBER: 2.7.7.60</p> | |
| 21167 <p>GENE_ASSOCIATION: buc_BU420</p> | |
| 21168 </body> | |
| 21169 </notes> | |
| 21170 <annotation> | |
| 21171 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21172 <rdf:Description rdf:about="#_42789bf5-b17e-4c79-a21a-3531ea3bfc8c"> | |
| 21173 <bqbiol:is> | |
| 21174 <rdf:Bag> | |
| 21175 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.7.60"/> | |
| 21176 </rdf:Bag> | |
| 21177 </bqbiol:is> | |
| 21178 </rdf:Description> | |
| 21179 </rdf:RDF> | |
| 21180 </annotation> | |
| 21181 <fbc:geneProductAssociation> | |
| 21182 <fbc:geneProductRef fbc:geneProduct="buc_BU420"/> | |
| 21183 </fbc:geneProductAssociation> | |
| 21184 <listOfReactants> | |
| 21185 <speciesReference constant="true" species="C00063" stoichiometry="1"/> | |
| 21186 <speciesReference constant="true" species="C11434" stoichiometry="1"/> | |
| 21187 </listOfReactants> | |
| 21188 <listOfProducts> | |
| 21189 <speciesReference constant="true" species="C11435" stoichiometry="1"/> | |
| 21190 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 21191 </listOfProducts> | |
| 21192 </reaction> | |
| 21193 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00066" metaid="_14eeb8d6-6e59-4729-b6c0-53000a94c3f4" name="6,7-Dimethyl-8-(1-D-ribityl)lumazine:6,7-dimethyl-8-(1-D-ribityl)lumazine 2,3-butanediyltransferase" reversible="true"> | |
| 21194 <notes> | |
| 21195 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21196 <p>SUBSYSTEM: Riboflavin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21197 <p>EC_NUMBER: 2.5.1.9</p> | |
| 21198 <p>GENE_ASSOCIATION: buc_BU112</p> | |
| 21199 </body> | |
| 21200 </notes> | |
| 21201 <annotation> | |
| 21202 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21203 <rdf:Description rdf:about="#_14eeb8d6-6e59-4729-b6c0-53000a94c3f4"> | |
| 21204 <bqbiol:is> | |
| 21205 <rdf:Bag> | |
| 21206 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.5.1.9"/> | |
| 21207 </rdf:Bag> | |
| 21208 </bqbiol:is> | |
| 21209 </rdf:Description> | |
| 21210 </rdf:RDF> | |
| 21211 </annotation> | |
| 21212 <fbc:geneProductAssociation> | |
| 21213 <fbc:geneProductRef fbc:geneProduct="buc_BU112"/> | |
| 21214 </fbc:geneProductAssociation> | |
| 21215 <listOfReactants> | |
| 21216 <speciesReference constant="true" species="C04332" stoichiometry="2"/> | |
| 21217 </listOfReactants> | |
| 21218 <listOfProducts> | |
| 21219 <speciesReference constant="true" species="C00255" stoichiometry="1"/> | |
| 21220 <speciesReference constant="true" species="C04732" stoichiometry="1"/> | |
| 21221 </listOfProducts> | |
| 21222 </reaction> | |
| 21223 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01397" metaid="b79b72e6-556a-4281-9faa-66ab9ae2d8ff" name="carbamoyl-phosphate:L-aspartate carbamoyltransferase" reversible="true"> | |
| 21224 <notes> | |
| 21225 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21226 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pyrimidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Alanine, aspartate and glutamate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21227 <p>EC_NUMBER: 2.1.3.2</p> | |
| 21228 <p>GENE_ASSOCIATION: ( buc_BU369 ) OR ( buc_BU370 )</p> | |
| 21229 </body> | |
| 21230 </notes> | |
| 21231 <annotation> | |
| 21232 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21233 <rdf:Description rdf:about="#b79b72e6-556a-4281-9faa-66ab9ae2d8ff"> | |
| 21234 <bqbiol:is> | |
| 21235 <rdf:Bag> | |
| 21236 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.1.3.2"/> | |
| 21237 </rdf:Bag> | |
| 21238 </bqbiol:is> | |
| 21239 </rdf:Description> | |
| 21240 </rdf:RDF> | |
| 21241 </annotation> | |
| 21242 <fbc:geneProductAssociation> | |
| 21243 <fbc:or> | |
| 21244 <fbc:geneProductRef fbc:geneProduct="buc_BU370"/> | |
| 21245 <fbc:geneProductRef fbc:geneProduct="buc_BU369"/> | |
| 21246 </fbc:or> | |
| 21247 </fbc:geneProductAssociation> | |
| 21248 <listOfReactants> | |
| 21249 <speciesReference constant="true" species="C00169" stoichiometry="1"/> | |
| 21250 <speciesReference constant="true" species="C00049" stoichiometry="1"/> | |
| 21251 </listOfReactants> | |
| 21252 <listOfProducts> | |
| 21253 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 21254 <speciesReference constant="true" species="C00438" stoichiometry="1"/> | |
| 21255 </listOfProducts> | |
| 21256 </reaction> | |
| 21257 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02003" metaid="_7a222bc3-ac54-41c0-b540-35d1e859771c" name="Geranyl-diphosphate:isopentenyl-diphosphate geranyltrans-transferase" reversible="true"> | |
| 21258 <notes> | |
| 21259 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21260 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Terpenoid backbone biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21261 <p>EC_NUMBER: 2.5.1.10</p> | |
| 21262 <p>GENE_ASSOCIATION: buc_BU465</p> | |
| 21263 </body> | |
| 21264 </notes> | |
| 21265 <annotation> | |
| 21266 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21267 <rdf:Description rdf:about="#_7a222bc3-ac54-41c0-b540-35d1e859771c"> | |
| 21268 <bqbiol:is> | |
| 21269 <rdf:Bag> | |
| 21270 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.5.1.10"/> | |
| 21271 </rdf:Bag> | |
| 21272 </bqbiol:is> | |
| 21273 </rdf:Description> | |
| 21274 </rdf:RDF> | |
| 21275 </annotation> | |
| 21276 <fbc:geneProductAssociation> | |
| 21277 <fbc:geneProductRef fbc:geneProduct="buc_BU465"/> | |
| 21278 </fbc:geneProductAssociation> | |
| 21279 <listOfReactants> | |
| 21280 <speciesReference constant="true" species="C00129" stoichiometry="1"/> | |
| 21281 <speciesReference constant="true" species="C00341" stoichiometry="1"/> | |
| 21282 </listOfReactants> | |
| 21283 <listOfProducts> | |
| 21284 <speciesReference constant="true" species="C00448" stoichiometry="1"/> | |
| 21285 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 21286 </listOfProducts> | |
| 21287 </reaction> | |
| 21288 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R05630" metaid="_37191053-21ae-448d-8635-a99329a0f96b" name="UDP-N-acetylmuramoyl-L-alanyl-gamma-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine:undecaprenyl-phosphate phospho-N-acetylmuramoyl-pentapeptide-transferase" reversible="true"> | |
| 21289 <notes> | |
| 21290 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21291 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Peptidoglycan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21292 <p>EC_NUMBER: 2.7.8.13</p> | |
| 21293 <p>GENE_ASSOCIATION: buc_BU219</p> | |
| 21294 </body> | |
| 21295 </notes> | |
| 21296 <annotation> | |
| 21297 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21298 <rdf:Description rdf:about="#_37191053-21ae-448d-8635-a99329a0f96b"> | |
| 21299 <bqbiol:is> | |
| 21300 <rdf:Bag> | |
| 21301 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.8.13"/> | |
| 21302 </rdf:Bag> | |
| 21303 </bqbiol:is> | |
| 21304 </rdf:Description> | |
| 21305 </rdf:RDF> | |
| 21306 </annotation> | |
| 21307 <fbc:geneProductAssociation> | |
| 21308 <fbc:geneProductRef fbc:geneProduct="buc_BU219"/> | |
| 21309 </fbc:geneProductAssociation> | |
| 21310 <listOfReactants> | |
| 21311 <speciesReference constant="true" species="C17556" stoichiometry="1"/> | |
| 21312 <speciesReference constant="true" species="C04882" stoichiometry="1"/> | |
| 21313 </listOfReactants> | |
| 21314 <listOfProducts> | |
| 21315 <speciesReference constant="true" species="C00105" stoichiometry="1"/> | |
| 21316 <speciesReference constant="true" species="C05897" stoichiometry="1"/> | |
| 21317 </listOfProducts> | |
| 21318 </reaction> | |
| 21319 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01398" metaid="_6b11fc56-bd6a-411b-b707-62ee95334854" name="Carbamoyl-phosphate:L-ornithine carbamoyltransferase" reversible="true"> | |
| 21320 <notes> | |
| 21321 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21322 <p>SUBSYSTEM: Arginine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21323 <p>EC_NUMBER: 2.1.3.3</p> | |
| 21324 <p>GENE_ASSOCIATION: buc_BU368</p> | |
| 21325 </body> | |
| 21326 </notes> | |
| 21327 <annotation> | |
| 21328 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21329 <rdf:Description rdf:about="#_6b11fc56-bd6a-411b-b707-62ee95334854"> | |
| 21330 <bqbiol:is> | |
| 21331 <rdf:Bag> | |
| 21332 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.1.3.3"/> | |
| 21333 </rdf:Bag> | |
| 21334 </bqbiol:is> | |
| 21335 </rdf:Description> | |
| 21336 </rdf:RDF> | |
| 21337 </annotation> | |
| 21338 <fbc:geneProductAssociation> | |
| 21339 <fbc:geneProductRef fbc:geneProduct="buc_BU368"/> | |
| 21340 </fbc:geneProductAssociation> | |
| 21341 <listOfReactants> | |
| 21342 <speciesReference constant="true" species="C00077" stoichiometry="1"/> | |
| 21343 <speciesReference constant="true" species="C00169" stoichiometry="1"/> | |
| 21344 </listOfReactants> | |
| 21345 <listOfProducts> | |
| 21346 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 21347 <speciesReference constant="true" species="C00327" stoichiometry="1"/> | |
| 21348 </listOfProducts> | |
| 21349 </reaction> | |
| 21350 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01213" metaid="_04ea75c8-0e37-4bfb-9ac6-f99d6497f42e" name="acetyl-CoA:3-methyl-2-oxobutanoate C-acetyltransferase (thioester-hydrolysing, carboxymethyl-forming)" reversible="true"> | |
| 21351 <notes> | |
| 21352 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21353 <p>SUBSYSTEM: Pyruvate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Valine, leucine and isoleucine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21354 <p>EC_NUMBER: 2.3.3.13</p> | |
| 21355 <p>GENE_ASSOCIATION: buc_BUpL04</p> | |
| 21356 </body> | |
| 21357 </notes> | |
| 21358 <annotation> | |
| 21359 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21360 <rdf:Description rdf:about="#_04ea75c8-0e37-4bfb-9ac6-f99d6497f42e"> | |
| 21361 <bqbiol:is> | |
| 21362 <rdf:Bag> | |
| 21363 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.3.3.13"/> | |
| 21364 </rdf:Bag> | |
| 21365 </bqbiol:is> | |
| 21366 </rdf:Description> | |
| 21367 </rdf:RDF> | |
| 21368 </annotation> | |
| 21369 <fbc:geneProductAssociation> | |
| 21370 <fbc:geneProductRef fbc:geneProduct="buc_BUpL04"/> | |
| 21371 </fbc:geneProductAssociation> | |
| 21372 <listOfReactants> | |
| 21373 <speciesReference constant="true" species="C00010" stoichiometry="1"/> | |
| 21374 <speciesReference constant="true" species="C02504" stoichiometry="1"/> | |
| 21375 </listOfReactants> | |
| 21376 <listOfProducts> | |
| 21377 <speciesReference constant="true" species="C00024" stoichiometry="1"/> | |
| 21378 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 21379 <speciesReference constant="true" species="C00141" stoichiometry="1"/> | |
| 21380 </listOfProducts> | |
| 21381 </reaction> | |
| 21382 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04724" metaid="_89f6b855-9b5b-4982-b30e-2df52c20e312" name="dodecanoyl-[acp]:NAD+ trans-2-oxidoreductase" reversible="true"> | |
| 21383 <notes> | |
| 21384 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21385 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21386 <p>EC_NUMBER: 1.3.1.9</p> | |
| 21387 <p>GENE_ASSOCIATION: buc_BU265</p> | |
| 21388 </body> | |
| 21389 </notes> | |
| 21390 <annotation> | |
| 21391 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21392 <rdf:Description rdf:about="#_89f6b855-9b5b-4982-b30e-2df52c20e312"> | |
| 21393 <bqbiol:is> | |
| 21394 <rdf:Bag> | |
| 21395 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.3.1.9"/> | |
| 21396 </rdf:Bag> | |
| 21397 </bqbiol:is> | |
| 21398 </rdf:Description> | |
| 21399 </rdf:RDF> | |
| 21400 </annotation> | |
| 21401 <fbc:geneProductAssociation> | |
| 21402 <fbc:geneProductRef fbc:geneProduct="buc_BU265"/> | |
| 21403 </fbc:geneProductAssociation> | |
| 21404 <listOfReactants> | |
| 21405 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 21406 <speciesReference constant="true" species="C05223" stoichiometry="1"/> | |
| 21407 </listOfReactants> | |
| 21408 <listOfProducts> | |
| 21409 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 21410 <speciesReference constant="true" species="C05758" stoichiometry="1"/> | |
| 21411 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 21412 </listOfProducts> | |
| 21413 </reaction> | |
| 21414 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04966" metaid="_810c4611-e437-453c-8f00-e22c7ca797fd" name="tetradecanoyl-[acp]:NAD+ trans-2-oxidoreductase" reversible="true"> | |
| 21415 <notes> | |
| 21416 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21417 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21418 <p>EC_NUMBER: 1.3.1.9</p> | |
| 21419 <p>GENE_ASSOCIATION: buc_BU265</p> | |
| 21420 </body> | |
| 21421 </notes> | |
| 21422 <annotation> | |
| 21423 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21424 <rdf:Description rdf:about="#_810c4611-e437-453c-8f00-e22c7ca797fd"> | |
| 21425 <bqbiol:is> | |
| 21426 <rdf:Bag> | |
| 21427 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.3.1.9"/> | |
| 21428 </rdf:Bag> | |
| 21429 </bqbiol:is> | |
| 21430 </rdf:Description> | |
| 21431 </rdf:RDF> | |
| 21432 </annotation> | |
| 21433 <fbc:geneProductAssociation> | |
| 21434 <fbc:geneProductRef fbc:geneProduct="buc_BU265"/> | |
| 21435 </fbc:geneProductAssociation> | |
| 21436 <listOfReactants> | |
| 21437 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 21438 <speciesReference constant="true" species="C05761" stoichiometry="1"/> | |
| 21439 </listOfReactants> | |
| 21440 <listOfProducts> | |
| 21441 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 21442 <speciesReference constant="true" species="C05760" stoichiometry="1"/> | |
| 21443 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 21444 </listOfProducts> | |
| 21445 </reaction> | |
| 21446 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00125" metaid="_9ba7400b-526d-495b-aa8d-7da9249e2c3f" name="P1,P4-bis(5'-adenosyl)-tetraphosphate nucleotidebisphosphohydrolase" reversible="true"> | |
| 21447 <notes> | |
| 21448 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21449 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21450 <p>EC_NUMBER: 3.6.1.41</p> | |
| 21451 <p>GENE_ASSOCIATION: buc_BU142</p> | |
| 21452 </body> | |
| 21453 </notes> | |
| 21454 <annotation> | |
| 21455 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21456 <rdf:Description rdf:about="#_9ba7400b-526d-495b-aa8d-7da9249e2c3f"> | |
| 21457 <bqbiol:is> | |
| 21458 <rdf:Bag> | |
| 21459 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.6.1.41"/> | |
| 21460 </rdf:Bag> | |
| 21461 </bqbiol:is> | |
| 21462 </rdf:Description> | |
| 21463 </rdf:RDF> | |
| 21464 </annotation> | |
| 21465 <fbc:geneProductAssociation> | |
| 21466 <fbc:geneProductRef fbc:geneProduct="buc_BU142"/> | |
| 21467 </fbc:geneProductAssociation> | |
| 21468 <listOfReactants> | |
| 21469 <speciesReference constant="true" species="C01260" stoichiometry="1"/> | |
| 21470 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 21471 </listOfReactants> | |
| 21472 <listOfProducts> | |
| 21473 <speciesReference constant="true" species="C00008" stoichiometry="2"/> | |
| 21474 </listOfProducts> | |
| 21475 </reaction> | |
| 21476 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02788" metaid="_0e75ba6f-39a3-4d54-9844-e161b0af3151" name="UDP-N-acetylmuramoyl-L-alanyl-D-glutamate:(L)-meso-2,6-diaminoheptanedioate gamma-ligase (ADP-forming)" reversible="true"> | |
| 21477 <notes> | |
| 21478 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21479 <p>SUBSYSTEM: Lysine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Peptidoglycan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21480 <p>EC_NUMBER: 6.3.2.13</p> | |
| 21481 <p>GENE_ASSOCIATION: buc_BU221</p> | |
| 21482 </body> | |
| 21483 </notes> | |
| 21484 <annotation> | |
| 21485 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21486 <rdf:Description rdf:about="#_0e75ba6f-39a3-4d54-9844-e161b0af3151"> | |
| 21487 <bqbiol:is> | |
| 21488 <rdf:Bag> | |
| 21489 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.3.2.13"/> | |
| 21490 </rdf:Bag> | |
| 21491 </bqbiol:is> | |
| 21492 </rdf:Description> | |
| 21493 </rdf:RDF> | |
| 21494 </annotation> | |
| 21495 <fbc:geneProductAssociation> | |
| 21496 <fbc:geneProductRef fbc:geneProduct="buc_BU221"/> | |
| 21497 </fbc:geneProductAssociation> | |
| 21498 <listOfReactants> | |
| 21499 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 21500 <speciesReference constant="true" species="C00680" stoichiometry="1"/> | |
| 21501 <speciesReference constant="true" species="C00692" stoichiometry="1"/> | |
| 21502 </listOfReactants> | |
| 21503 <listOfProducts> | |
| 21504 <speciesReference constant="true" species="C04877" stoichiometry="1"/> | |
| 21505 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 21506 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 21507 </listOfProducts> | |
| 21508 </reaction> | |
| 21509 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04963" metaid="_1ef02294-fc7b-4e70-bb94-a863b768a972" name="Decanoyl-[acyl-carrier protein]:malonyl-[acyl-carrier-protein] C-acyltransferase (decarboxylating)" reversible="true"> | |
| 21510 <notes> | |
| 21511 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21512 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21513 <p>EC_NUMBER: 2.3.1.41</p> | |
| 21514 <p>GENE_ASSOCIATION: buc_BU092</p> | |
| 21515 </body> | |
| 21516 </notes> | |
| 21517 <annotation> | |
| 21518 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21519 <rdf:Description rdf:about="#_1ef02294-fc7b-4e70-bb94-a863b768a972"> | |
| 21520 <bqbiol:is> | |
| 21521 <rdf:Bag> | |
| 21522 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.3.1.41"/> | |
| 21523 </rdf:Bag> | |
| 21524 </bqbiol:is> | |
| 21525 </rdf:Description> | |
| 21526 </rdf:RDF> | |
| 21527 </annotation> | |
| 21528 <fbc:geneProductAssociation> | |
| 21529 <fbc:geneProductRef fbc:geneProduct="buc_BU092"/> | |
| 21530 </fbc:geneProductAssociation> | |
| 21531 <listOfReactants> | |
| 21532 <speciesReference constant="true" species="C01209" stoichiometry="1"/> | |
| 21533 <speciesReference constant="true" species="C05755" stoichiometry="1"/> | |
| 21534 </listOfReactants> | |
| 21535 <listOfProducts> | |
| 21536 <speciesReference constant="true" species="C05756" stoichiometry="1"/> | |
| 21537 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 21538 <speciesReference constant="true" species="C00229" stoichiometry="1"/> | |
| 21539 </listOfProducts> | |
| 21540 </reaction> | |
| 21541 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R10052" metaid="_79354782-52be-4480-aa18-b534037ae685" name="(2R,3S)-3-isopropylmalate:NAD+ oxidoreductase" reversible="false"> | |
| 21542 <notes> | |
| 21543 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21544 <p>SUBSYSTEM: 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21545 <p>EC_NUMBER: 1.1.1.85</p> | |
| 21546 <p>GENE_ASSOCIATION: buc_BUpL05</p> | |
| 21547 </body> | |
| 21548 </notes> | |
| 21549 <annotation> | |
| 21550 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21551 <rdf:Description rdf:about="#_79354782-52be-4480-aa18-b534037ae685"> | |
| 21552 <bqbiol:is> | |
| 21553 <rdf:Bag> | |
| 21554 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.85"/> | |
| 21555 </rdf:Bag> | |
| 21556 </bqbiol:is> | |
| 21557 </rdf:Description> | |
| 21558 </rdf:RDF> | |
| 21559 </annotation> | |
| 21560 <fbc:geneProductAssociation> | |
| 21561 <fbc:geneProductRef fbc:geneProduct="buc_BUpL05"/> | |
| 21562 </fbc:geneProductAssociation> | |
| 21563 <listOfReactants> | |
| 21564 <speciesReference constant="true" species="C04411" stoichiometry="1"/> | |
| 21565 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 21566 </listOfReactants> | |
| 21567 <listOfProducts> | |
| 21568 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 21569 <speciesReference constant="true" species="C00233" stoichiometry="1"/> | |
| 21570 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 21571 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 21572 </listOfProducts> | |
| 21573 </reaction> | |
| 21574 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04964" metaid="_24408e48-be99-4913-b024-f70ef71dfebd" name="(3R)-3-hydroxydodecanoyl-[acyl-carrier-protein]:NADP+ oxidoreductase" reversible="true"> | |
| 21575 <notes> | |
| 21576 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21577 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21578 <p>EC_NUMBER: 1.1.1.100</p> | |
| 21579 <p>GENE_ASSOCIATION: buc_BU351</p> | |
| 21580 </body> | |
| 21581 </notes> | |
| 21582 <annotation> | |
| 21583 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21584 <rdf:Description rdf:about="#_24408e48-be99-4913-b024-f70ef71dfebd"> | |
| 21585 <bqbiol:is> | |
| 21586 <rdf:Bag> | |
| 21587 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.100"/> | |
| 21588 </rdf:Bag> | |
| 21589 </bqbiol:is> | |
| 21590 </rdf:Description> | |
| 21591 </rdf:RDF> | |
| 21592 </annotation> | |
| 21593 <fbc:geneProductAssociation> | |
| 21594 <fbc:geneProductRef fbc:geneProduct="buc_BU351"/> | |
| 21595 </fbc:geneProductAssociation> | |
| 21596 <listOfReactants> | |
| 21597 <speciesReference constant="true" species="C05757" stoichiometry="1"/> | |
| 21598 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 21599 </listOfReactants> | |
| 21600 <listOfProducts> | |
| 21601 <speciesReference constant="true" species="C05756" stoichiometry="1"/> | |
| 21602 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 21603 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 21604 </listOfProducts> | |
| 21605 </reaction> | |
| 21606 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00126" metaid="_4b484690-ecb5-4f3d-a096-e213402042ae" name="ADP:ATP adenylyltransferase" reversible="true"> | |
| 21607 <notes> | |
| 21608 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21609 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21610 <p>GENE_ASSOCIATION: buc_BU142</p> | |
| 21611 </body> | |
| 21612 </notes> | |
| 21613 <fbc:geneProductAssociation> | |
| 21614 <fbc:geneProductRef fbc:geneProduct="buc_BU142"/> | |
| 21615 </fbc:geneProductAssociation> | |
| 21616 <listOfReactants> | |
| 21617 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 21618 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 21619 </listOfReactants> | |
| 21620 <listOfProducts> | |
| 21621 <speciesReference constant="true" species="C01260" stoichiometry="1"/> | |
| 21622 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 21623 </listOfProducts> | |
| 21624 </reaction> | |
| 21625 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00127" metaid="_5676af1e-8556-4af1-8a8b-46f26f5b919a" name="ATP:AMP phosphotransferase" reversible="true"> | |
| 21626 <notes> | |
| 21627 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21628 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21629 <p>EC_NUMBER: 2.7.4.3</p> | |
| 21630 <p>GENE_ASSOCIATION: buc_BU484</p> | |
| 21631 </body> | |
| 21632 </notes> | |
| 21633 <annotation> | |
| 21634 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21635 <rdf:Description rdf:about="#_5676af1e-8556-4af1-8a8b-46f26f5b919a"> | |
| 21636 <bqbiol:is> | |
| 21637 <rdf:Bag> | |
| 21638 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.4.3"/> | |
| 21639 </rdf:Bag> | |
| 21640 </bqbiol:is> | |
| 21641 </rdf:Description> | |
| 21642 </rdf:RDF> | |
| 21643 </annotation> | |
| 21644 <fbc:geneProductAssociation> | |
| 21645 <fbc:geneProductRef fbc:geneProduct="buc_BU484"/> | |
| 21646 </fbc:geneProductAssociation> | |
| 21647 <listOfReactants> | |
| 21648 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 21649 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 21650 </listOfReactants> | |
| 21651 <listOfProducts> | |
| 21652 <speciesReference constant="true" species="C00008" stoichiometry="2"/> | |
| 21653 </listOfProducts> | |
| 21654 </reaction> | |
| 21655 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04969" metaid="eceb0fe9-8f76-4ddf-83de-69485e92c089" name="hexadecanoyl-[acp]:NAD+ trans-2-oxidoreductase" reversible="true"> | |
| 21656 <notes> | |
| 21657 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21658 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21659 <p>EC_NUMBER: 1.3.1.9</p> | |
| 21660 <p>GENE_ASSOCIATION: buc_BU265</p> | |
| 21661 </body> | |
| 21662 </notes> | |
| 21663 <annotation> | |
| 21664 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21665 <rdf:Description rdf:about="#eceb0fe9-8f76-4ddf-83de-69485e92c089"> | |
| 21666 <bqbiol:is> | |
| 21667 <rdf:Bag> | |
| 21668 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.3.1.9"/> | |
| 21669 </rdf:Bag> | |
| 21670 </bqbiol:is> | |
| 21671 </rdf:Description> | |
| 21672 </rdf:RDF> | |
| 21673 </annotation> | |
| 21674 <fbc:geneProductAssociation> | |
| 21675 <fbc:geneProductRef fbc:geneProduct="buc_BU265"/> | |
| 21676 </fbc:geneProductAssociation> | |
| 21677 <listOfReactants> | |
| 21678 <speciesReference constant="true" species="C05764" stoichiometry="1"/> | |
| 21679 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 21680 </listOfReactants> | |
| 21681 <listOfProducts> | |
| 21682 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 21683 <speciesReference constant="true" species="C05763" stoichiometry="1"/> | |
| 21684 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 21685 </listOfProducts> | |
| 21686 </reaction> | |
| 21687 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01217" metaid="_429205da-18cf-44e6-840c-0949c70d2171" name="5-methyltetrahydrofolate:ferredoxin oxidoreductase" reversible="true"> | |
| 21688 <notes> | |
| 21689 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21690 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21691 <p>GENE_ASSOCIATION: buc_BU046</p> | |
| 21692 </body> | |
| 21693 </notes> | |
| 21694 <fbc:geneProductAssociation> | |
| 21695 <fbc:geneProductRef fbc:geneProduct="buc_BU046"/> | |
| 21696 </fbc:geneProductAssociation> | |
| 21697 <listOfReactants> | |
| 21698 <speciesReference constant="true" species="C00080" stoichiometry="2"/> | |
| 21699 <speciesReference constant="true" species="C00143" stoichiometry="1"/> | |
| 21700 <speciesReference constant="true" species="C00138" stoichiometry="2"/> | |
| 21701 </listOfReactants> | |
| 21702 <listOfProducts> | |
| 21703 <speciesReference constant="true" species="C00440" stoichiometry="1"/> | |
| 21704 <speciesReference constant="true" species="C00139" stoichiometry="2"/> | |
| 21705 </listOfProducts> | |
| 21706 </reaction> | |
| 21707 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01218" metaid="f535a73e-03dc-44d3-82f3-4128e7af3d8b" name="5,10-methylenetetrahydrofolate:NAD+ oxidoreductase" reversible="true"> | |
| 21708 <notes> | |
| 21709 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21710 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21711 <p>GENE_ASSOCIATION: buc_BU486</p> | |
| 21712 </body> | |
| 21713 </notes> | |
| 21714 <fbc:geneProductAssociation> | |
| 21715 <fbc:geneProductRef fbc:geneProduct="buc_BU486"/> | |
| 21716 </fbc:geneProductAssociation> | |
| 21717 <listOfReactants> | |
| 21718 <speciesReference constant="true" species="C00143" stoichiometry="1"/> | |
| 21719 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 21720 </listOfReactants> | |
| 21721 <listOfProducts> | |
| 21722 <speciesReference constant="true" species="C00445" stoichiometry="1"/> | |
| 21723 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 21724 </listOfProducts> | |
| 21725 </reaction> | |
| 21726 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04725" metaid="a1543c54-33b6-412b-9aeb-bc8d06ed71a1" name="dodecanoyl-[acp]:NADP+ trans-2-oxidoreductase" reversible="true"> | |
| 21727 <notes> | |
| 21728 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21729 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21730 <p>EC_NUMBER: 1.3.1.10</p> | |
| 21731 <p>GENE_ASSOCIATION: buc_BU265</p> | |
| 21732 </body> | |
| 21733 </notes> | |
| 21734 <annotation> | |
| 21735 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21736 <rdf:Description rdf:about="#a1543c54-33b6-412b-9aeb-bc8d06ed71a1"> | |
| 21737 <bqbiol:is> | |
| 21738 <rdf:Bag> | |
| 21739 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.3.1.10"/> | |
| 21740 </rdf:Bag> | |
| 21741 </bqbiol:is> | |
| 21742 </rdf:Description> | |
| 21743 </rdf:RDF> | |
| 21744 </annotation> | |
| 21745 <fbc:geneProductAssociation> | |
| 21746 <fbc:geneProductRef fbc:geneProduct="buc_BU265"/> | |
| 21747 </fbc:geneProductAssociation> | |
| 21748 <listOfReactants> | |
| 21749 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 21750 <speciesReference constant="true" species="C05223" stoichiometry="1"/> | |
| 21751 </listOfReactants> | |
| 21752 <listOfProducts> | |
| 21753 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 21754 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 21755 <speciesReference constant="true" species="C05758" stoichiometry="1"/> | |
| 21756 </listOfProducts> | |
| 21757 </reaction> | |
| 21758 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04967" metaid="cda2ca9d-3843-43cf-a642-1dd2ffde9fee" name="tetradecanoyl-[acp]:NADP+ trans-2-oxidoreductase" reversible="true"> | |
| 21759 <notes> | |
| 21760 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21761 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21762 <p>EC_NUMBER: 1.3.1.10</p> | |
| 21763 <p>GENE_ASSOCIATION: buc_BU265</p> | |
| 21764 </body> | |
| 21765 </notes> | |
| 21766 <annotation> | |
| 21767 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21768 <rdf:Description rdf:about="#cda2ca9d-3843-43cf-a642-1dd2ffde9fee"> | |
| 21769 <bqbiol:is> | |
| 21770 <rdf:Bag> | |
| 21771 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.3.1.10"/> | |
| 21772 </rdf:Bag> | |
| 21773 </bqbiol:is> | |
| 21774 </rdf:Description> | |
| 21775 </rdf:RDF> | |
| 21776 </annotation> | |
| 21777 <fbc:geneProductAssociation> | |
| 21778 <fbc:geneProductRef fbc:geneProduct="buc_BU265"/> | |
| 21779 </fbc:geneProductAssociation> | |
| 21780 <listOfReactants> | |
| 21781 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 21782 <speciesReference constant="true" species="C05761" stoichiometry="1"/> | |
| 21783 </listOfReactants> | |
| 21784 <listOfProducts> | |
| 21785 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 21786 <speciesReference constant="true" species="C05760" stoichiometry="1"/> | |
| 21787 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 21788 </listOfProducts> | |
| 21789 </reaction> | |
| 21790 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04726" metaid="_1e159ed2-9730-4fc1-929e-d07f88a4342b" name="dodecanoyl-[acyl-carrier-protein]:malonyl-[acyl-carrier-protein] C-acyltransferase (decarboxylating)" reversible="true"> | |
| 21791 <notes> | |
| 21792 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21793 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21794 <p>EC_NUMBER: 2.3.1.41</p> | |
| 21795 <p>GENE_ASSOCIATION: buc_BU092</p> | |
| 21796 </body> | |
| 21797 </notes> | |
| 21798 <annotation> | |
| 21799 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21800 <rdf:Description rdf:about="#_1e159ed2-9730-4fc1-929e-d07f88a4342b"> | |
| 21801 <bqbiol:is> | |
| 21802 <rdf:Bag> | |
| 21803 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.3.1.41"/> | |
| 21804 </rdf:Bag> | |
| 21805 </bqbiol:is> | |
| 21806 </rdf:Description> | |
| 21807 </rdf:RDF> | |
| 21808 </annotation> | |
| 21809 <fbc:geneProductAssociation> | |
| 21810 <fbc:geneProductRef fbc:geneProduct="buc_BU092"/> | |
| 21811 </fbc:geneProductAssociation> | |
| 21812 <listOfReactants> | |
| 21813 <speciesReference constant="true" species="C01209" stoichiometry="1"/> | |
| 21814 <speciesReference constant="true" species="C05223" stoichiometry="1"/> | |
| 21815 </listOfReactants> | |
| 21816 <listOfProducts> | |
| 21817 <speciesReference constant="true" species="C05759" stoichiometry="1"/> | |
| 21818 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 21819 <speciesReference constant="true" species="C00229" stoichiometry="1"/> | |
| 21820 </listOfProducts> | |
| 21821 </reaction> | |
| 21822 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04968" metaid="_73789c9e-8611-472e-9af6-d09adb86cbc4" name="Tetradecanoyl-[acyl-carrier protein]:malonyl-[acyl-carrier-protein] C-acyltransferase (decarboxylating)" reversible="true"> | |
| 21823 <notes> | |
| 21824 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21825 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21826 <p>EC_NUMBER: 2.3.1.41</p> | |
| 21827 <p>GENE_ASSOCIATION: buc_BU092</p> | |
| 21828 </body> | |
| 21829 </notes> | |
| 21830 <annotation> | |
| 21831 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21832 <rdf:Description rdf:about="#_73789c9e-8611-472e-9af6-d09adb86cbc4"> | |
| 21833 <bqbiol:is> | |
| 21834 <rdf:Bag> | |
| 21835 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.3.1.41"/> | |
| 21836 </rdf:Bag> | |
| 21837 </bqbiol:is> | |
| 21838 </rdf:Description> | |
| 21839 </rdf:RDF> | |
| 21840 </annotation> | |
| 21841 <fbc:geneProductAssociation> | |
| 21842 <fbc:geneProductRef fbc:geneProduct="buc_BU092"/> | |
| 21843 </fbc:geneProductAssociation> | |
| 21844 <listOfReactants> | |
| 21845 <speciesReference constant="true" species="C01209" stoichiometry="1"/> | |
| 21846 <speciesReference constant="true" species="C05761" stoichiometry="1"/> | |
| 21847 </listOfReactants> | |
| 21848 <listOfProducts> | |
| 21849 <speciesReference constant="true" species="C05762" stoichiometry="1"/> | |
| 21850 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 21851 <speciesReference constant="true" species="C00229" stoichiometry="1"/> | |
| 21852 </listOfProducts> | |
| 21853 </reaction> | |
| 21854 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R10170" metaid="b01d5bf2-5ca1-44ae-a736-e57ce6b93e8d" name="(2R,3S)-3-isopropylmalate hydro-lyase (2-isopropylmaleate-forming)" reversible="false"> | |
| 21855 <notes> | |
| 21856 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21857 <p>SUBSYSTEM: 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21858 <p>EC_NUMBER: 4.2.1.33</p> | |
| 21859 <p>GENE_ASSOCIATION: ( buc_BUpL06 ) OR ( buc_BUpL07 )</p> | |
| 21860 </body> | |
| 21861 </notes> | |
| 21862 <annotation> | |
| 21863 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21864 <rdf:Description rdf:about="#b01d5bf2-5ca1-44ae-a736-e57ce6b93e8d"> | |
| 21865 <bqbiol:is> | |
| 21866 <rdf:Bag> | |
| 21867 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.2.1.33"/> | |
| 21868 </rdf:Bag> | |
| 21869 </bqbiol:is> | |
| 21870 </rdf:Description> | |
| 21871 </rdf:RDF> | |
| 21872 </annotation> | |
| 21873 <fbc:geneProductAssociation> | |
| 21874 <fbc:or> | |
| 21875 <fbc:geneProductRef fbc:geneProduct="buc_BUpL06"/> | |
| 21876 <fbc:geneProductRef fbc:geneProduct="buc_BUpL07"/> | |
| 21877 </fbc:or> | |
| 21878 </fbc:geneProductAssociation> | |
| 21879 <listOfReactants> | |
| 21880 <speciesReference constant="true" species="C04411" stoichiometry="1"/> | |
| 21881 </listOfReactants> | |
| 21882 <listOfProducts> | |
| 21883 <speciesReference constant="true" species="C02504" stoichiometry="1"/> | |
| 21884 </listOfProducts> | |
| 21885 </reaction> | |
| 21886 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00130" metaid="e3463609-034d-455a-8670-ed462d51e437" name="ATP:dephospho-CoA 3'-phosphotransferase" reversible="true"> | |
| 21887 <notes> | |
| 21888 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21889 <p>SUBSYSTEM: Pantothenate and CoA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21890 <p>EC_NUMBER: 2.7.1.24</p> | |
| 21891 <p>GENE_ASSOCIATION: buc_BU203</p> | |
| 21892 </body> | |
| 21893 </notes> | |
| 21894 <annotation> | |
| 21895 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21896 <rdf:Description rdf:about="#e3463609-034d-455a-8670-ed462d51e437"> | |
| 21897 <bqbiol:is> | |
| 21898 <rdf:Bag> | |
| 21899 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.24"/> | |
| 21900 </rdf:Bag> | |
| 21901 </bqbiol:is> | |
| 21902 </rdf:Description> | |
| 21903 </rdf:RDF> | |
| 21904 </annotation> | |
| 21905 <fbc:geneProductAssociation> | |
| 21906 <fbc:geneProductRef fbc:geneProduct="buc_BU203"/> | |
| 21907 </fbc:geneProductAssociation> | |
| 21908 <listOfReactants> | |
| 21909 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 21910 <speciesReference constant="true" species="C00882" stoichiometry="1"/> | |
| 21911 </listOfReactants> | |
| 21912 <listOfProducts> | |
| 21913 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 21914 <speciesReference constant="true" species="C00010" stoichiometry="1"/> | |
| 21915 </listOfProducts> | |
| 21916 </reaction> | |
| 21917 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01220" metaid="c985cea3-8d8b-4fc2-ad3f-0222f64c9a43" name="5,10-methylenetetrahydrofolate:NADP+ oxidoreductase" reversible="true"> | |
| 21918 <notes> | |
| 21919 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21920 <p>SUBSYSTEM: Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || One carbon pool by folate - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21921 <p>EC_NUMBER: 1.5.1.5</p> | |
| 21922 <p>GENE_ASSOCIATION: buc_BU486</p> | |
| 21923 </body> | |
| 21924 </notes> | |
| 21925 <annotation> | |
| 21926 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21927 <rdf:Description rdf:about="#c985cea3-8d8b-4fc2-ad3f-0222f64c9a43"> | |
| 21928 <bqbiol:is> | |
| 21929 <rdf:Bag> | |
| 21930 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.5.1.5"/> | |
| 21931 </rdf:Bag> | |
| 21932 </bqbiol:is> | |
| 21933 </rdf:Description> | |
| 21934 </rdf:RDF> | |
| 21935 </annotation> | |
| 21936 <fbc:geneProductAssociation> | |
| 21937 <fbc:geneProductRef fbc:geneProduct="buc_BU486"/> | |
| 21938 </fbc:geneProductAssociation> | |
| 21939 <listOfReactants> | |
| 21940 <speciesReference constant="true" species="C00143" stoichiometry="1"/> | |
| 21941 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 21942 </listOfReactants> | |
| 21943 <listOfProducts> | |
| 21944 <speciesReference constant="true" species="C00445" stoichiometry="1"/> | |
| 21945 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 21946 </listOfProducts> | |
| 21947 </reaction> | |
| 21948 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01221" metaid="_8adeb06e-e55e-46a5-95f0-e83f2fd0bb24" name="glycine:NAD+ 2-oxidoreductase (tetrahydrofolate-methylene-adding)" reversible="true"> | |
| 21949 <notes> | |
| 21950 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21951 <p>SUBSYSTEM: Glyoxylate and dicarboxylate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21952 <p>GENE_ASSOCIATION: buc_BU207</p> | |
| 21953 </body> | |
| 21954 </notes> | |
| 21955 <fbc:geneProductAssociation> | |
| 21956 <fbc:geneProductRef fbc:geneProduct="buc_BU207"/> | |
| 21957 </fbc:geneProductAssociation> | |
| 21958 <listOfReactants> | |
| 21959 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 21960 <speciesReference constant="true" species="C00101" stoichiometry="1"/> | |
| 21961 <speciesReference constant="true" species="C00037" stoichiometry="1"/> | |
| 21962 </listOfReactants> | |
| 21963 <listOfProducts> | |
| 21964 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 21965 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 21966 <speciesReference constant="true" species="C00014" stoichiometry="1"/> | |
| 21967 <speciesReference constant="true" species="C00143" stoichiometry="1"/> | |
| 21968 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 21969 </listOfProducts> | |
| 21970 </reaction> | |
| 21971 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04970" metaid="_66809285-390c-4663-b51d-e2ad6feb0437" name="hexadecanoyl-[acp]:NADP+ trans-2-oxidoreductase" reversible="true"> | |
| 21972 <notes> | |
| 21973 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 21974 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 21975 <p>EC_NUMBER: 1.3.1.10</p> | |
| 21976 <p>GENE_ASSOCIATION: buc_BU265</p> | |
| 21977 </body> | |
| 21978 </notes> | |
| 21979 <annotation> | |
| 21980 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 21981 <rdf:Description rdf:about="#_66809285-390c-4663-b51d-e2ad6feb0437"> | |
| 21982 <bqbiol:is> | |
| 21983 <rdf:Bag> | |
| 21984 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.3.1.10"/> | |
| 21985 </rdf:Bag> | |
| 21986 </bqbiol:is> | |
| 21987 </rdf:Description> | |
| 21988 </rdf:RDF> | |
| 21989 </annotation> | |
| 21990 <fbc:geneProductAssociation> | |
| 21991 <fbc:geneProductRef fbc:geneProduct="buc_BU265"/> | |
| 21992 </fbc:geneProductAssociation> | |
| 21993 <listOfReactants> | |
| 21994 <speciesReference constant="true" species="C05764" stoichiometry="1"/> | |
| 21995 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 21996 </listOfReactants> | |
| 21997 <listOfProducts> | |
| 21998 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 21999 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 22000 <speciesReference constant="true" species="C05763" stoichiometry="1"/> | |
| 22001 </listOfProducts> | |
| 22002 </reaction> | |
| 22003 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R10046" metaid="_9844e5ef-d496-4093-9ba5-be9f48fc8922" name="nicotinate D-ribonucleoside ribohydrolase" reversible="true"> | |
| 22004 <notes> | |
| 22005 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22006 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22007 <p>GENE_ASSOCIATION: buc_BU541</p> | |
| 22008 </body> | |
| 22009 </notes> | |
| 22010 <fbc:geneProductAssociation> | |
| 22011 <fbc:geneProductRef fbc:geneProduct="buc_BU541"/> | |
| 22012 </fbc:geneProductAssociation> | |
| 22013 <listOfReactants> | |
| 22014 <speciesReference constant="true" species="C05841" stoichiometry="1"/> | |
| 22015 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 22016 </listOfReactants> | |
| 22017 <listOfProducts> | |
| 22018 <speciesReference constant="true" species="C00121" stoichiometry="1"/> | |
| 22019 <speciesReference constant="true" species="C00253" stoichiometry="1"/> | |
| 22020 </listOfProducts> | |
| 22021 </reaction> | |
| 22022 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03509" metaid="_2095d94c-ff90-48d1-9e75-e9d6f2fc5cdb" name="N-(5-Phospho-beta-D-ribosyl)anthranilate ketol-isomerase" reversible="true"> | |
| 22023 <notes> | |
| 22024 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22025 <p>SUBSYSTEM: Phenylalanine, tyrosine and tryptophan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22026 <p>EC_NUMBER: 5.3.1.24</p> | |
| 22027 <p>GENE_ASSOCIATION: buc_BU279</p> | |
| 22028 </body> | |
| 22029 </notes> | |
| 22030 <annotation> | |
| 22031 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22032 <rdf:Description rdf:about="#_2095d94c-ff90-48d1-9e75-e9d6f2fc5cdb"> | |
| 22033 <bqbiol:is> | |
| 22034 <rdf:Bag> | |
| 22035 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.3.1.24"/> | |
| 22036 </rdf:Bag> | |
| 22037 </bqbiol:is> | |
| 22038 </rdf:Description> | |
| 22039 </rdf:RDF> | |
| 22040 </annotation> | |
| 22041 <fbc:geneProductAssociation> | |
| 22042 <fbc:geneProductRef fbc:geneProduct="buc_BU279"/> | |
| 22043 </fbc:geneProductAssociation> | |
| 22044 <listOfReactants> | |
| 22045 <speciesReference constant="true" species="C04302" stoichiometry="1"/> | |
| 22046 </listOfReactants> | |
| 22047 <listOfProducts> | |
| 22048 <speciesReference constant="true" species="C01302" stoichiometry="1"/> | |
| 22049 </listOfProducts> | |
| 22050 </reaction> | |
| 22051 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03508" metaid="_6d3be02c-7526-4ad3-86aa-7349a469fe05" name="1-(2-Carboxyphenylamino)-1-deoxy-D-ribulose-5-phosphate carboxy-lyase(cyclizing)" reversible="true"> | |
| 22052 <notes> | |
| 22053 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22054 <p>SUBSYSTEM: Phenylalanine, tyrosine and tryptophan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22055 <p>EC_NUMBER: 4.1.1.48</p> | |
| 22056 <p>GENE_ASSOCIATION: buc_BU279</p> | |
| 22057 </body> | |
| 22058 </notes> | |
| 22059 <annotation> | |
| 22060 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22061 <rdf:Description rdf:about="#_6d3be02c-7526-4ad3-86aa-7349a469fe05"> | |
| 22062 <bqbiol:is> | |
| 22063 <rdf:Bag> | |
| 22064 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.1.1.48"/> | |
| 22065 </rdf:Bag> | |
| 22066 </bqbiol:is> | |
| 22067 </rdf:Description> | |
| 22068 </rdf:RDF> | |
| 22069 </annotation> | |
| 22070 <fbc:geneProductAssociation> | |
| 22071 <fbc:geneProductRef fbc:geneProduct="buc_BU279"/> | |
| 22072 </fbc:geneProductAssociation> | |
| 22073 <listOfReactants> | |
| 22074 <speciesReference constant="true" species="C01302" stoichiometry="1"/> | |
| 22075 </listOfReactants> | |
| 22076 <listOfProducts> | |
| 22077 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 22078 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 22079 <speciesReference constant="true" species="C03506" stoichiometry="1"/> | |
| 22080 </listOfProducts> | |
| 22081 </reaction> | |
| 22082 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02412" metaid="_750b5dfb-9cbb-41ed-8b06-2dbe5fdc6986" name="ATP:shikimate 3-phosphotransferase" reversible="true"> | |
| 22083 <notes> | |
| 22084 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22085 <p>SUBSYSTEM: Phenylalanine, tyrosine and tryptophan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22086 <p>EC_NUMBER: 2.7.1.71</p> | |
| 22087 <p>GENE_ASSOCIATION: buc_BU539</p> | |
| 22088 </body> | |
| 22089 </notes> | |
| 22090 <annotation> | |
| 22091 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22092 <rdf:Description rdf:about="#_750b5dfb-9cbb-41ed-8b06-2dbe5fdc6986"> | |
| 22093 <bqbiol:is> | |
| 22094 <rdf:Bag> | |
| 22095 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.71"/> | |
| 22096 </rdf:Bag> | |
| 22097 </bqbiol:is> | |
| 22098 </rdf:Description> | |
| 22099 </rdf:RDF> | |
| 22100 </annotation> | |
| 22101 <fbc:geneProductAssociation> | |
| 22102 <fbc:geneProductRef fbc:geneProduct="buc_BU539"/> | |
| 22103 </fbc:geneProductAssociation> | |
| 22104 <listOfReactants> | |
| 22105 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 22106 <speciesReference constant="true" species="C00493" stoichiometry="1"/> | |
| 22107 </listOfReactants> | |
| 22108 <listOfProducts> | |
| 22109 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 22110 <speciesReference constant="true" species="C03175" stoichiometry="1"/> | |
| 22111 </listOfProducts> | |
| 22112 </reaction> | |
| 22113 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00112" metaid="_90f0e680-21d6-4cc8-b907-5b40a1b9f370" name="NADPH:NAD+ oxidoreductase" reversible="true"> | |
| 22114 <notes> | |
| 22115 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22116 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22117 <p>GENE_ASSOCIATION: buc_BU185</p> | |
| 22118 </body> | |
| 22119 </notes> | |
| 22120 <fbc:geneProductAssociation> | |
| 22121 <fbc:geneProductRef fbc:geneProduct="buc_BU185"/> | |
| 22122 </fbc:geneProductAssociation> | |
| 22123 <listOfReactants> | |
| 22124 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 22125 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 22126 </listOfReactants> | |
| 22127 <listOfProducts> | |
| 22128 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 22129 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 22130 </listOfProducts> | |
| 22131 </reaction> | |
| 22132 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04955" metaid="_2f5d1743-e2fe-40f4-9f7c-05459433e32e" name="hexanoyl-[acp]:NAD+ trans-2-oxidoreductase" reversible="true"> | |
| 22133 <notes> | |
| 22134 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22135 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22136 <p>EC_NUMBER: 1.3.1.9</p> | |
| 22137 <p>GENE_ASSOCIATION: buc_BU265</p> | |
| 22138 </body> | |
| 22139 </notes> | |
| 22140 <annotation> | |
| 22141 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22142 <rdf:Description rdf:about="#_2f5d1743-e2fe-40f4-9f7c-05459433e32e"> | |
| 22143 <bqbiol:is> | |
| 22144 <rdf:Bag> | |
| 22145 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.3.1.9"/> | |
| 22146 </rdf:Bag> | |
| 22147 </bqbiol:is> | |
| 22148 </rdf:Description> | |
| 22149 </rdf:RDF> | |
| 22150 </annotation> | |
| 22151 <fbc:geneProductAssociation> | |
| 22152 <fbc:geneProductRef fbc:geneProduct="buc_BU265"/> | |
| 22153 </fbc:geneProductAssociation> | |
| 22154 <listOfReactants> | |
| 22155 <speciesReference constant="true" species="C05749" stoichiometry="1"/> | |
| 22156 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 22157 </listOfReactants> | |
| 22158 <listOfProducts> | |
| 22159 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 22160 <speciesReference constant="true" species="C05748" stoichiometry="1"/> | |
| 22161 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 22162 </listOfProducts> | |
| 22163 </reaction> | |
| 22164 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04952" metaid="a6330d81-c7d2-4fa7-99d0-846a431498a6" name="butyryl-[acyl-carrier protein]:malonyl-[acyl-carrier-protein] C-acyltransferase (decarboxylating)" reversible="true"> | |
| 22165 <notes> | |
| 22166 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22167 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22168 <p>EC_NUMBER: 2.3.1.41</p> | |
| 22169 <p>GENE_ASSOCIATION: buc_BU092</p> | |
| 22170 </body> | |
| 22171 </notes> | |
| 22172 <annotation> | |
| 22173 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22174 <rdf:Description rdf:about="#a6330d81-c7d2-4fa7-99d0-846a431498a6"> | |
| 22175 <bqbiol:is> | |
| 22176 <rdf:Bag> | |
| 22177 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.3.1.41"/> | |
| 22178 </rdf:Bag> | |
| 22179 </bqbiol:is> | |
| 22180 </rdf:Description> | |
| 22181 </rdf:RDF> | |
| 22182 </annotation> | |
| 22183 <fbc:geneProductAssociation> | |
| 22184 <fbc:geneProductRef fbc:geneProduct="buc_BU092"/> | |
| 22185 </fbc:geneProductAssociation> | |
| 22186 <listOfReactants> | |
| 22187 <speciesReference constant="true" species="C01209" stoichiometry="1"/> | |
| 22188 <speciesReference constant="true" species="C05745" stoichiometry="1"/> | |
| 22189 </listOfReactants> | |
| 22190 <listOfProducts> | |
| 22191 <speciesReference constant="true" species="C05746" stoichiometry="1"/> | |
| 22192 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 22193 <speciesReference constant="true" species="C00229" stoichiometry="1"/> | |
| 22194 </listOfProducts> | |
| 22195 </reaction> | |
| 22196 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02413" metaid="_59468fc6-02bb-41ad-8e33-fd9672660928" name="Shikimate:NADP+ 3-oxidoreductase" reversible="true"> | |
| 22197 <notes> | |
| 22198 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22199 <p>SUBSYSTEM: Phenylalanine, tyrosine and tryptophan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22200 <p>EC_NUMBER: 1.1.1.25</p> | |
| 22201 <p>GENE_ASSOCIATION: buc_BU493</p> | |
| 22202 </body> | |
| 22203 </notes> | |
| 22204 <annotation> | |
| 22205 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22206 <rdf:Description rdf:about="#_59468fc6-02bb-41ad-8e33-fd9672660928"> | |
| 22207 <bqbiol:is> | |
| 22208 <rdf:Bag> | |
| 22209 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.25"/> | |
| 22210 </rdf:Bag> | |
| 22211 </bqbiol:is> | |
| 22212 </rdf:Description> | |
| 22213 </rdf:RDF> | |
| 22214 </annotation> | |
| 22215 <fbc:geneProductAssociation> | |
| 22216 <fbc:geneProductRef fbc:geneProduct="buc_BU493"/> | |
| 22217 </fbc:geneProductAssociation> | |
| 22218 <listOfReactants> | |
| 22219 <speciesReference constant="true" species="C00493" stoichiometry="1"/> | |
| 22220 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 22221 </listOfReactants> | |
| 22222 <listOfProducts> | |
| 22223 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 22224 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 22225 <speciesReference constant="true" species="C02637" stoichiometry="1"/> | |
| 22226 </listOfProducts> | |
| 22227 </reaction> | |
| 22228 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04953" metaid="bdeebad2-aebe-49d8-9acf-44b3179483e2" name="(3R)-3-hydroxyhexanoyl-[acyl-carrier-protein]:NADP+ oxidoreductase" reversible="true"> | |
| 22229 <notes> | |
| 22230 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22231 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22232 <p>EC_NUMBER: 1.1.1.100</p> | |
| 22233 <p>GENE_ASSOCIATION: buc_BU351</p> | |
| 22234 </body> | |
| 22235 </notes> | |
| 22236 <annotation> | |
| 22237 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22238 <rdf:Description rdf:about="#bdeebad2-aebe-49d8-9acf-44b3179483e2"> | |
| 22239 <bqbiol:is> | |
| 22240 <rdf:Bag> | |
| 22241 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.100"/> | |
| 22242 </rdf:Bag> | |
| 22243 </bqbiol:is> | |
| 22244 </rdf:Description> | |
| 22245 </rdf:RDF> | |
| 22246 </annotation> | |
| 22247 <fbc:geneProductAssociation> | |
| 22248 <fbc:geneProductRef fbc:geneProduct="buc_BU351"/> | |
| 22249 </fbc:geneProductAssociation> | |
| 22250 <listOfReactants> | |
| 22251 <speciesReference constant="true" species="C05747" stoichiometry="1"/> | |
| 22252 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 22253 </listOfReactants> | |
| 22254 <listOfProducts> | |
| 22255 <speciesReference constant="true" species="C05746" stoichiometry="1"/> | |
| 22256 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 22257 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 22258 </listOfProducts> | |
| 22259 </reaction> | |
| 22260 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R05805" metaid="_47ba4f1c-1595-4733-b2e6-e12f7c64f404" name="ADP:D-fructose-6-phosphate 1-phosphotransferase" reversible="true"> | |
| 22261 <notes> | |
| 22262 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22263 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22264 <p>GENE_ASSOCIATION: buc_BU305</p> | |
| 22265 </body> | |
| 22266 </notes> | |
| 22267 <fbc:geneProductAssociation> | |
| 22268 <fbc:geneProductRef fbc:geneProduct="buc_BU305"/> | |
| 22269 </fbc:geneProductAssociation> | |
| 22270 <listOfReactants> | |
| 22271 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 22272 <speciesReference constant="true" species="C00085" stoichiometry="1"/> | |
| 22273 </listOfReactants> | |
| 22274 <listOfProducts> | |
| 22275 <speciesReference constant="true" species="C00354" stoichiometry="1"/> | |
| 22276 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 22277 </listOfProducts> | |
| 22278 </reaction> | |
| 22279 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04958" metaid="_2b967c3c-4776-4984-92e2-f79b0e8d7f19" name="octanoyl-[acp]:NAD+ trans-2-oxidoreductase" reversible="true"> | |
| 22280 <notes> | |
| 22281 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22282 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22283 <p>EC_NUMBER: 1.3.1.9</p> | |
| 22284 <p>GENE_ASSOCIATION: buc_BU265</p> | |
| 22285 </body> | |
| 22286 </notes> | |
| 22287 <annotation> | |
| 22288 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22289 <rdf:Description rdf:about="#_2b967c3c-4776-4984-92e2-f79b0e8d7f19"> | |
| 22290 <bqbiol:is> | |
| 22291 <rdf:Bag> | |
| 22292 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.3.1.9"/> | |
| 22293 </rdf:Bag> | |
| 22294 </bqbiol:is> | |
| 22295 </rdf:Description> | |
| 22296 </rdf:RDF> | |
| 22297 </annotation> | |
| 22298 <fbc:geneProductAssociation> | |
| 22299 <fbc:geneProductRef fbc:geneProduct="buc_BU265"/> | |
| 22300 </fbc:geneProductAssociation> | |
| 22301 <listOfReactants> | |
| 22302 <speciesReference constant="true" species="C05752" stoichiometry="1"/> | |
| 22303 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 22304 </listOfReactants> | |
| 22305 <listOfProducts> | |
| 22306 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 22307 <speciesReference constant="true" species="C05751" stoichiometry="1"/> | |
| 22308 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 22309 </listOfProducts> | |
| 22310 </reaction> | |
| 22311 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04959" metaid="_2414b702-5a74-4273-a7a7-d8389c9d4035" name="octanoyl-[acp]:NADP+ trans-2-oxidoreductase" reversible="true"> | |
| 22312 <notes> | |
| 22313 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22314 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22315 <p>EC_NUMBER: 1.3.1.10</p> | |
| 22316 <p>GENE_ASSOCIATION: buc_BU265</p> | |
| 22317 </body> | |
| 22318 </notes> | |
| 22319 <annotation> | |
| 22320 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22321 <rdf:Description rdf:about="#_2414b702-5a74-4273-a7a7-d8389c9d4035"> | |
| 22322 <bqbiol:is> | |
| 22323 <rdf:Bag> | |
| 22324 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.3.1.10"/> | |
| 22325 </rdf:Bag> | |
| 22326 </bqbiol:is> | |
| 22327 </rdf:Description> | |
| 22328 </rdf:RDF> | |
| 22329 </annotation> | |
| 22330 <fbc:geneProductAssociation> | |
| 22331 <fbc:geneProductRef fbc:geneProduct="buc_BU265"/> | |
| 22332 </fbc:geneProductAssociation> | |
| 22333 <listOfReactants> | |
| 22334 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 22335 <speciesReference constant="true" species="C05752" stoichiometry="1"/> | |
| 22336 </listOfReactants> | |
| 22337 <listOfProducts> | |
| 22338 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 22339 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 22340 <speciesReference constant="true" species="C05751" stoichiometry="1"/> | |
| 22341 </listOfProducts> | |
| 22342 </reaction> | |
| 22343 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02415" metaid="ad718078-de6c-4fcc-92b8-d4ba4f19ea36" name="Shikimate:pyrroloquinoline-quinone 3-oxidoreductase" reversible="true"> | |
| 22344 <notes> | |
| 22345 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22346 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22347 <p>GENE_ASSOCIATION: buc_BU493</p> | |
| 22348 </body> | |
| 22349 </notes> | |
| 22350 <fbc:geneProductAssociation> | |
| 22351 <fbc:geneProductRef fbc:geneProduct="buc_BU493"/> | |
| 22352 </fbc:geneProductAssociation> | |
| 22353 <listOfReactants> | |
| 22354 <speciesReference constant="true" species="C00493" stoichiometry="1"/> | |
| 22355 <speciesReference constant="true" species="C00113" stoichiometry="1"/> | |
| 22356 </listOfReactants> | |
| 22357 <listOfProducts> | |
| 22358 <speciesReference constant="true" species="C02637" stoichiometry="1"/> | |
| 22359 <speciesReference constant="true" species="C01359" stoichiometry="1"/> | |
| 22360 </listOfProducts> | |
| 22361 </reaction> | |
| 22362 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04956" metaid="b1f91e6b-1caf-4e4e-bca7-e4db24298281" name="hexanoyl-[acp]:NADP+ trans-2-oxidoreductase" reversible="true"> | |
| 22363 <notes> | |
| 22364 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22365 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22366 <p>EC_NUMBER: 1.3.1.10</p> | |
| 22367 <p>GENE_ASSOCIATION: buc_BU265</p> | |
| 22368 </body> | |
| 22369 </notes> | |
| 22370 <annotation> | |
| 22371 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22372 <rdf:Description rdf:about="#b1f91e6b-1caf-4e4e-bca7-e4db24298281"> | |
| 22373 <bqbiol:is> | |
| 22374 <rdf:Bag> | |
| 22375 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.3.1.10"/> | |
| 22376 </rdf:Bag> | |
| 22377 </bqbiol:is> | |
| 22378 </rdf:Description> | |
| 22379 </rdf:RDF> | |
| 22380 </annotation> | |
| 22381 <fbc:geneProductAssociation> | |
| 22382 <fbc:geneProductRef fbc:geneProduct="buc_BU265"/> | |
| 22383 </fbc:geneProductAssociation> | |
| 22384 <listOfReactants> | |
| 22385 <speciesReference constant="true" species="C05749" stoichiometry="1"/> | |
| 22386 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 22387 </listOfReactants> | |
| 22388 <listOfProducts> | |
| 22389 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 22390 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 22391 <speciesReference constant="true" species="C05748" stoichiometry="1"/> | |
| 22392 </listOfProducts> | |
| 22393 </reaction> | |
| 22394 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04957" metaid="_66fe23cf-be09-4759-8ab7-c3e61bab1cc6" name="hexanoyl-[acyl-carrier protein]:malonyl-[acyl-carrier-protein] C-acyltransferase (decarboxylating)" reversible="true"> | |
| 22395 <notes> | |
| 22396 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22397 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22398 <p>EC_NUMBER: 2.3.1.41</p> | |
| 22399 <p>GENE_ASSOCIATION: buc_BU092</p> | |
| 22400 </body> | |
| 22401 </notes> | |
| 22402 <annotation> | |
| 22403 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22404 <rdf:Description rdf:about="#_66fe23cf-be09-4759-8ab7-c3e61bab1cc6"> | |
| 22405 <bqbiol:is> | |
| 22406 <rdf:Bag> | |
| 22407 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.3.1.41"/> | |
| 22408 </rdf:Bag> | |
| 22409 </bqbiol:is> | |
| 22410 </rdf:Description> | |
| 22411 </rdf:RDF> | |
| 22412 </annotation> | |
| 22413 <fbc:geneProductAssociation> | |
| 22414 <fbc:geneProductRef fbc:geneProduct="buc_BU092"/> | |
| 22415 </fbc:geneProductAssociation> | |
| 22416 <listOfReactants> | |
| 22417 <speciesReference constant="true" species="C05749" stoichiometry="1"/> | |
| 22418 <speciesReference constant="true" species="C01209" stoichiometry="1"/> | |
| 22419 </listOfReactants> | |
| 22420 <listOfProducts> | |
| 22421 <speciesReference constant="true" species="C05750" stoichiometry="1"/> | |
| 22422 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 22423 <speciesReference constant="true" species="C00229" stoichiometry="1"/> | |
| 22424 </listOfProducts> | |
| 22425 </reaction> | |
| 22426 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00480" metaid="_412c4b7f-3fb2-4caa-849d-c2b22d55ffeb" name="ATP:L-aspartate 4-phosphotransferase" reversible="true"> | |
| 22427 <notes> | |
| 22428 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22429 <p>SUBSYSTEM: Lysine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Monobactam biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glycine, serine and threonine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Cysteine and methionine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22430 <p>EC_NUMBER: 2.7.2.4</p> | |
| 22431 <p>GENE_ASSOCIATION: buc_BU194</p> | |
| 22432 </body> | |
| 22433 </notes> | |
| 22434 <annotation> | |
| 22435 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22436 <rdf:Description rdf:about="#_412c4b7f-3fb2-4caa-849d-c2b22d55ffeb"> | |
| 22437 <bqbiol:is> | |
| 22438 <rdf:Bag> | |
| 22439 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.2.4"/> | |
| 22440 </rdf:Bag> | |
| 22441 </bqbiol:is> | |
| 22442 </rdf:Description> | |
| 22443 </rdf:RDF> | |
| 22444 </annotation> | |
| 22445 <fbc:geneProductAssociation> | |
| 22446 <fbc:geneProductRef fbc:geneProduct="buc_BU194"/> | |
| 22447 </fbc:geneProductAssociation> | |
| 22448 <listOfReactants> | |
| 22449 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 22450 <speciesReference constant="true" species="C00049" stoichiometry="1"/> | |
| 22451 </listOfReactants> | |
| 22452 <listOfProducts> | |
| 22453 <speciesReference constant="true" species="C03082" stoichiometry="1"/> | |
| 22454 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 22455 </listOfProducts> | |
| 22456 </reaction> | |
| 22457 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02780" metaid="_277775b1-93a7-4216-b29b-c1183aa595c1" name="R02780" reversible="false"> | |
| 22458 <notes> | |
| 22459 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22460 <p>SUBSYSTEM: Starch and sucrose metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22461 <p>GENE_ASSOCIATION: buc_BU063</p> | |
| 22462 </body> | |
| 22463 </notes> | |
| 22464 <fbc:geneProductAssociation> | |
| 22465 <fbc:geneProductRef fbc:geneProduct="buc_BU063"/> | |
| 22466 </fbc:geneProductAssociation> | |
| 22467 <listOfReactants> | |
| 22468 <speciesReference constant="true" species="C01083" stoichiometry="1"/> | |
| 22469 <speciesReference constant="true" species="C04261" stoichiometry="1"/> | |
| 22470 </listOfReactants> | |
| 22471 <listOfProducts> | |
| 22472 <speciesReference constant="true" species="C00615" stoichiometry="1"/> | |
| 22473 <speciesReference constant="true" species="C00689" stoichiometry="1"/> | |
| 22474 </listOfProducts> | |
| 22475 </reaction> | |
| 22476 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04961" metaid="_78a28ba8-224e-452b-9900-4b6a61f68f56" name="decanoyl-[acp]:NAD+ trans-2-oxidoreductase" reversible="true"> | |
| 22477 <notes> | |
| 22478 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22479 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22480 <p>EC_NUMBER: 1.3.1.9</p> | |
| 22481 <p>GENE_ASSOCIATION: buc_BU265</p> | |
| 22482 </body> | |
| 22483 </notes> | |
| 22484 <annotation> | |
| 22485 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22486 <rdf:Description rdf:about="#_78a28ba8-224e-452b-9900-4b6a61f68f56"> | |
| 22487 <bqbiol:is> | |
| 22488 <rdf:Bag> | |
| 22489 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.3.1.9"/> | |
| 22490 </rdf:Bag> | |
| 22491 </bqbiol:is> | |
| 22492 </rdf:Description> | |
| 22493 </rdf:RDF> | |
| 22494 </annotation> | |
| 22495 <fbc:geneProductAssociation> | |
| 22496 <fbc:geneProductRef fbc:geneProduct="buc_BU265"/> | |
| 22497 </fbc:geneProductAssociation> | |
| 22498 <listOfReactants> | |
| 22499 <speciesReference constant="true" species="C05755" stoichiometry="1"/> | |
| 22500 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 22501 </listOfReactants> | |
| 22502 <listOfProducts> | |
| 22503 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 22504 <speciesReference constant="true" species="C05754" stoichiometry="1"/> | |
| 22505 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 22506 </listOfProducts> | |
| 22507 </reaction> | |
| 22508 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04962" metaid="_32527a2f-3f48-4e72-968a-2b5877eed737" name="decanoyl-[acp]:NADP+ trans-2-oxidoreductase" reversible="true"> | |
| 22509 <notes> | |
| 22510 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22511 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22512 <p>EC_NUMBER: 1.3.1.10</p> | |
| 22513 <p>GENE_ASSOCIATION: buc_BU265</p> | |
| 22514 </body> | |
| 22515 </notes> | |
| 22516 <annotation> | |
| 22517 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22518 <rdf:Description rdf:about="#_32527a2f-3f48-4e72-968a-2b5877eed737"> | |
| 22519 <bqbiol:is> | |
| 22520 <rdf:Bag> | |
| 22521 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.3.1.10"/> | |
| 22522 </rdf:Bag> | |
| 22523 </bqbiol:is> | |
| 22524 </rdf:Description> | |
| 22525 </rdf:RDF> | |
| 22526 </annotation> | |
| 22527 <fbc:geneProductAssociation> | |
| 22528 <fbc:geneProductRef fbc:geneProduct="buc_BU265"/> | |
| 22529 </fbc:geneProductAssociation> | |
| 22530 <listOfReactants> | |
| 22531 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 22532 <speciesReference constant="true" species="C05755" stoichiometry="1"/> | |
| 22533 </listOfReactants> | |
| 22534 <listOfProducts> | |
| 22535 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 22536 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 22537 <speciesReference constant="true" species="C05754" stoichiometry="1"/> | |
| 22538 </listOfProducts> | |
| 22539 </reaction> | |
| 22540 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00484" metaid="d70abfd6-b0fc-4b8f-b6dc-fca536578607" name="N-Carbamoyl-L-aspartate amidohydrolase" reversible="true"> | |
| 22541 <notes> | |
| 22542 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22543 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22544 <p>GENE_ASSOCIATION: ( buc_BU369 ) OR ( buc_BU370 )</p> | |
| 22545 </body> | |
| 22546 </notes> | |
| 22547 <fbc:geneProductAssociation> | |
| 22548 <fbc:or> | |
| 22549 <fbc:geneProductRef fbc:geneProduct="buc_BU370"/> | |
| 22550 <fbc:geneProductRef fbc:geneProduct="buc_BU369"/> | |
| 22551 </fbc:or> | |
| 22552 </fbc:geneProductAssociation> | |
| 22553 <listOfReactants> | |
| 22554 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 22555 <speciesReference constant="true" species="C00438" stoichiometry="1"/> | |
| 22556 </listOfReactants> | |
| 22557 <listOfProducts> | |
| 22558 <speciesReference constant="true" species="C00049" stoichiometry="1"/> | |
| 22559 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 22560 <speciesReference constant="true" species="C00014" stoichiometry="1"/> | |
| 22561 </listOfProducts> | |
| 22562 </reaction> | |
| 22563 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02783" metaid="_05df8539-724c-4459-809a-b28a5d14f6dc" name="UDP-N-acetylmuramoyl-L-alanine:D-glutamate ligase(ADP-forming)" reversible="true"> | |
| 22564 <notes> | |
| 22565 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22566 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Peptidoglycan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || D-Amino acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22567 <p>EC_NUMBER: 6.3.2.9</p> | |
| 22568 <p>GENE_ASSOCIATION: buc_BU218</p> | |
| 22569 </body> | |
| 22570 </notes> | |
| 22571 <annotation> | |
| 22572 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22573 <rdf:Description rdf:about="#_05df8539-724c-4459-809a-b28a5d14f6dc"> | |
| 22574 <bqbiol:is> | |
| 22575 <rdf:Bag> | |
| 22576 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.3.2.9"/> | |
| 22577 </rdf:Bag> | |
| 22578 </bqbiol:is> | |
| 22579 </rdf:Description> | |
| 22580 </rdf:RDF> | |
| 22581 </annotation> | |
| 22582 <fbc:geneProductAssociation> | |
| 22583 <fbc:geneProductRef fbc:geneProduct="buc_BU218"/> | |
| 22584 </fbc:geneProductAssociation> | |
| 22585 <listOfReactants> | |
| 22586 <speciesReference constant="true" species="C00217" stoichiometry="1"/> | |
| 22587 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 22588 <speciesReference constant="true" species="C01212" stoichiometry="1"/> | |
| 22589 </listOfReactants> | |
| 22590 <listOfProducts> | |
| 22591 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 22592 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 22593 <speciesReference constant="true" species="C00692" stoichiometry="1"/> | |
| 22594 </listOfProducts> | |
| 22595 </reaction> | |
| 22596 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04960" metaid="aa3510f7-2fca-439b-862a-b6bd688fb18e" name="Octanoyl-[acyl-carrier protein]:malonyl-[acyl-carrier-protein] C-acyltransferase (decarboxylating)" reversible="true"> | |
| 22597 <notes> | |
| 22598 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22599 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22600 <p>EC_NUMBER: 2.3.1.41</p> | |
| 22601 <p>GENE_ASSOCIATION: buc_BU092</p> | |
| 22602 </body> | |
| 22603 </notes> | |
| 22604 <annotation> | |
| 22605 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22606 <rdf:Description rdf:about="#aa3510f7-2fca-439b-862a-b6bd688fb18e"> | |
| 22607 <bqbiol:is> | |
| 22608 <rdf:Bag> | |
| 22609 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.3.1.41"/> | |
| 22610 </rdf:Bag> | |
| 22611 </bqbiol:is> | |
| 22612 </rdf:Description> | |
| 22613 </rdf:RDF> | |
| 22614 </annotation> | |
| 22615 <fbc:geneProductAssociation> | |
| 22616 <fbc:geneProductRef fbc:geneProduct="buc_BU092"/> | |
| 22617 </fbc:geneProductAssociation> | |
| 22618 <listOfReactants> | |
| 22619 <speciesReference constant="true" species="C01209" stoichiometry="1"/> | |
| 22620 <speciesReference constant="true" species="C05752" stoichiometry="1"/> | |
| 22621 </listOfReactants> | |
| 22622 <listOfProducts> | |
| 22623 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 22624 <speciesReference constant="true" species="C00229" stoichiometry="1"/> | |
| 22625 <speciesReference constant="true" species="C05753" stoichiometry="1"/> | |
| 22626 </listOfProducts> | |
| 22627 </reaction> | |
| 22628 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00122" metaid="cd667d40-a322-45e3-8120-fd5d0ae13300" name="ADP phosphohydrolase" reversible="true"> | |
| 22629 <notes> | |
| 22630 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22631 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22632 <p>GENE_ASSOCIATION: buc_BU484</p> | |
| 22633 </body> | |
| 22634 </notes> | |
| 22635 <fbc:geneProductAssociation> | |
| 22636 <fbc:geneProductRef fbc:geneProduct="buc_BU484"/> | |
| 22637 </fbc:geneProductAssociation> | |
| 22638 <listOfReactants> | |
| 22639 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 22640 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 22641 </listOfReactants> | |
| 22642 <listOfProducts> | |
| 22643 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 22644 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 22645 </listOfProducts> | |
| 22646 </reaction> | |
| 22647 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03655" metaid="a8d41650-7092-4e40-9b07-911cea92a2c3" name="L-Histidine:tRNA(His) ligase (AMP-forming)" reversible="false"> | |
| 22648 <notes> | |
| 22649 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22650 <p>SUBSYSTEM: Aminoacyl-tRNA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22651 <p>EC_NUMBER: 6.1.1.21</p> | |
| 22652 <p>GENE_ASSOCIATION: buc_BU288</p> | |
| 22653 </body> | |
| 22654 </notes> | |
| 22655 <annotation> | |
| 22656 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22657 <rdf:Description rdf:about="#a8d41650-7092-4e40-9b07-911cea92a2c3"> | |
| 22658 <bqbiol:is> | |
| 22659 <rdf:Bag> | |
| 22660 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.1.1.21"/> | |
| 22661 </rdf:Bag> | |
| 22662 </bqbiol:is> | |
| 22663 </rdf:Description> | |
| 22664 </rdf:RDF> | |
| 22665 </annotation> | |
| 22666 <fbc:geneProductAssociation> | |
| 22667 <fbc:geneProductRef fbc:geneProduct="buc_BU288"/> | |
| 22668 </fbc:geneProductAssociation> | |
| 22669 <listOfReactants> | |
| 22670 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 22671 <speciesReference constant="true" species="C00135" stoichiometry="1"/> | |
| 22672 <speciesReference constant="true" species="C01643" stoichiometry="1"/> | |
| 22673 </listOfReactants> | |
| 22674 <listOfProducts> | |
| 22675 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 22676 <speciesReference constant="true" species="C02988" stoichiometry="1"/> | |
| 22677 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 22678 </listOfProducts> | |
| 22679 </reaction> | |
| 22680 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03896" metaid="e646b7a7-f83c-4076-84e7-b90906203b74" name="(R)-2-Methylmalate hydro-lyase (2-methylmaleate-forming)" reversible="true"> | |
| 22681 <notes> | |
| 22682 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22683 <p>SUBSYSTEM: C5-Branched dibasic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Valine, leucine and isoleucine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22684 <p>EC_NUMBER: 4.2.1.35</p> | |
| 22685 <p>GENE_ASSOCIATION: ( buc_BUpL06 ) OR ( buc_BUpL07 )</p> | |
| 22686 </body> | |
| 22687 </notes> | |
| 22688 <annotation> | |
| 22689 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22690 <rdf:Description rdf:about="#e646b7a7-f83c-4076-84e7-b90906203b74"> | |
| 22691 <bqbiol:is> | |
| 22692 <rdf:Bag> | |
| 22693 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.2.1.35"/> | |
| 22694 </rdf:Bag> | |
| 22695 </bqbiol:is> | |
| 22696 </rdf:Description> | |
| 22697 </rdf:RDF> | |
| 22698 </annotation> | |
| 22699 <fbc:geneProductAssociation> | |
| 22700 <fbc:or> | |
| 22701 <fbc:geneProductRef fbc:geneProduct="buc_BUpL06"/> | |
| 22702 <fbc:geneProductRef fbc:geneProduct="buc_BUpL07"/> | |
| 22703 </fbc:or> | |
| 22704 </fbc:geneProductAssociation> | |
| 22705 <listOfReactants> | |
| 22706 <speciesReference constant="true" species="C02612" stoichiometry="1"/> | |
| 22707 </listOfReactants> | |
| 22708 <listOfProducts> | |
| 22709 <speciesReference constant="true" species="C02226" stoichiometry="1"/> | |
| 22710 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 22711 </listOfProducts> | |
| 22712 </reaction> | |
| 22713 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03654" metaid="_6c97754f-5cc4-4c37-b077-0fc5a03ca8e5" name="glycine:tRNA(Gly) ligase (AMP-forming)" reversible="false"> | |
| 22714 <notes> | |
| 22715 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22716 <p>SUBSYSTEM: Aminoacyl-tRNA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22717 <p>EC_NUMBER: 6.1.1.14</p> | |
| 22718 <p>GENE_ASSOCIATION: ( buc_BU135 ) OR ( buc_BU136 )</p> | |
| 22719 </body> | |
| 22720 </notes> | |
| 22721 <annotation> | |
| 22722 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22723 <rdf:Description rdf:about="#_6c97754f-5cc4-4c37-b077-0fc5a03ca8e5"> | |
| 22724 <bqbiol:is> | |
| 22725 <rdf:Bag> | |
| 22726 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.1.1.14"/> | |
| 22727 </rdf:Bag> | |
| 22728 </bqbiol:is> | |
| 22729 </rdf:Description> | |
| 22730 </rdf:RDF> | |
| 22731 </annotation> | |
| 22732 <fbc:geneProductAssociation> | |
| 22733 <fbc:or> | |
| 22734 <fbc:geneProductRef fbc:geneProduct="buc_BU136"/> | |
| 22735 <fbc:geneProductRef fbc:geneProduct="buc_BU135"/> | |
| 22736 </fbc:or> | |
| 22737 </fbc:geneProductAssociation> | |
| 22738 <listOfReactants> | |
| 22739 <speciesReference constant="true" species="C01642" stoichiometry="1"/> | |
| 22740 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 22741 <speciesReference constant="true" species="C00037" stoichiometry="1"/> | |
| 22742 </listOfReactants> | |
| 22743 <listOfProducts> | |
| 22744 <speciesReference constant="true" species="C02412" stoichiometry="1"/> | |
| 22745 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 22746 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 22747 </listOfProducts> | |
| 22748 </reaction> | |
| 22749 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02568" metaid="_82a6158a-8cad-4429-9f18-375761bcbae6" name="D-fructose 1-phosphate D-glyceraldehyde-3-phosphate-lyase" reversible="true"> | |
| 22750 <notes> | |
| 22751 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22752 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fructose and mannose metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22753 <p>EC_NUMBER: 4.1.2.13</p> | |
| 22754 <p>GENE_ASSOCIATION: buc_BU451</p> | |
| 22755 </body> | |
| 22756 </notes> | |
| 22757 <annotation> | |
| 22758 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22759 <rdf:Description rdf:about="#_82a6158a-8cad-4429-9f18-375761bcbae6"> | |
| 22760 <bqbiol:is> | |
| 22761 <rdf:Bag> | |
| 22762 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.1.2.13"/> | |
| 22763 </rdf:Bag> | |
| 22764 </bqbiol:is> | |
| 22765 </rdf:Description> | |
| 22766 </rdf:RDF> | |
| 22767 </annotation> | |
| 22768 <fbc:geneProductAssociation> | |
| 22769 <fbc:geneProductRef fbc:geneProduct="buc_BU451"/> | |
| 22770 </fbc:geneProductAssociation> | |
| 22771 <listOfReactants> | |
| 22772 <speciesReference constant="true" species="C01094" stoichiometry="1"/> | |
| 22773 </listOfReactants> | |
| 22774 <listOfProducts> | |
| 22775 <speciesReference constant="true" species="C00577" stoichiometry="1"/> | |
| 22776 <speciesReference constant="true" species="C00111" stoichiometry="1"/> | |
| 22777 </listOfProducts> | |
| 22778 </reaction> | |
| 22779 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03657" metaid="_7680f773-6bf2-4616-8f2f-251f29c8c47a" name="L-Leucine:tRNA(Leu) ligase (AMP-forming)" reversible="false"> | |
| 22780 <notes> | |
| 22781 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22782 <p>SUBSYSTEM: Aminoacyl-tRNA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22783 <p>EC_NUMBER: 6.1.1.4</p> | |
| 22784 <p>GENE_ASSOCIATION: buc_BU444</p> | |
| 22785 </body> | |
| 22786 </notes> | |
| 22787 <annotation> | |
| 22788 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22789 <rdf:Description rdf:about="#_7680f773-6bf2-4616-8f2f-251f29c8c47a"> | |
| 22790 <bqbiol:is> | |
| 22791 <rdf:Bag> | |
| 22792 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.1.1.4"/> | |
| 22793 </rdf:Bag> | |
| 22794 </bqbiol:is> | |
| 22795 </rdf:Description> | |
| 22796 </rdf:RDF> | |
| 22797 </annotation> | |
| 22798 <fbc:geneProductAssociation> | |
| 22799 <fbc:geneProductRef fbc:geneProduct="buc_BU444"/> | |
| 22800 </fbc:geneProductAssociation> | |
| 22801 <listOfReactants> | |
| 22802 <speciesReference constant="true" species="C01645" stoichiometry="1"/> | |
| 22803 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 22804 <speciesReference constant="true" species="C00123" stoichiometry="1"/> | |
| 22805 </listOfReactants> | |
| 22806 <listOfProducts> | |
| 22807 <speciesReference constant="true" species="C02047" stoichiometry="1"/> | |
| 22808 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 22809 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 22810 </listOfProducts> | |
| 22811 </reaction> | |
| 22812 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03898" metaid="bbb46322-2169-43e5-a305-79dd28ac34d8" name="2-methylmaleate hydratase" reversible="true"> | |
| 22813 <notes> | |
| 22814 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22815 <p>SUBSYSTEM: C5-Branched dibasic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Valine, leucine and isoleucine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22816 <p>EC_NUMBER: 4.2.1.35</p> | |
| 22817 <p>GENE_ASSOCIATION: ( buc_BUpL06 ) OR ( buc_BUpL07 )</p> | |
| 22818 </body> | |
| 22819 </notes> | |
| 22820 <annotation> | |
| 22821 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22822 <rdf:Description rdf:about="#bbb46322-2169-43e5-a305-79dd28ac34d8"> | |
| 22823 <bqbiol:is> | |
| 22824 <rdf:Bag> | |
| 22825 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.2.1.35"/> | |
| 22826 </rdf:Bag> | |
| 22827 </bqbiol:is> | |
| 22828 </rdf:Description> | |
| 22829 </rdf:RDF> | |
| 22830 </annotation> | |
| 22831 <fbc:geneProductAssociation> | |
| 22832 <fbc:or> | |
| 22833 <fbc:geneProductRef fbc:geneProduct="buc_BUpL06"/> | |
| 22834 <fbc:geneProductRef fbc:geneProduct="buc_BUpL07"/> | |
| 22835 </fbc:or> | |
| 22836 </fbc:geneProductAssociation> | |
| 22837 <listOfReactants> | |
| 22838 <speciesReference constant="true" species="C02226" stoichiometry="1"/> | |
| 22839 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 22840 </listOfReactants> | |
| 22841 <listOfProducts> | |
| 22842 <speciesReference constant="true" species="C06032" stoichiometry="1"/> | |
| 22843 </listOfProducts> | |
| 22844 </reaction> | |
| 22845 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02325" metaid="a2e98bd0-ecf8-43fd-a4a6-0814fc9e43fd" name="dCTP aminohydrolase" reversible="true"> | |
| 22846 <notes> | |
| 22847 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22848 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pyrimidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22849 <p>EC_NUMBER: 3.5.4.13</p> | |
| 22850 <p>GENE_ASSOCIATION: buc_BU108</p> | |
| 22851 </body> | |
| 22852 </notes> | |
| 22853 <annotation> | |
| 22854 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22855 <rdf:Description rdf:about="#a2e98bd0-ecf8-43fd-a4a6-0814fc9e43fd"> | |
| 22856 <bqbiol:is> | |
| 22857 <rdf:Bag> | |
| 22858 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.5.4.13"/> | |
| 22859 </rdf:Bag> | |
| 22860 </bqbiol:is> | |
| 22861 </rdf:Description> | |
| 22862 </rdf:RDF> | |
| 22863 </annotation> | |
| 22864 <fbc:geneProductAssociation> | |
| 22865 <fbc:geneProductRef fbc:geneProduct="buc_BU108"/> | |
| 22866 </fbc:geneProductAssociation> | |
| 22867 <listOfReactants> | |
| 22868 <speciesReference constant="true" species="C00458" stoichiometry="1"/> | |
| 22869 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 22870 </listOfReactants> | |
| 22871 <listOfProducts> | |
| 22872 <speciesReference constant="true" species="C00460" stoichiometry="1"/> | |
| 22873 <speciesReference constant="true" species="C00014" stoichiometry="1"/> | |
| 22874 </listOfProducts> | |
| 22875 </reaction> | |
| 22876 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03656" metaid="_08264d14-c9c4-4f97-b236-cab2db76fe2f" name="L-Isoleucine:tRNA(Ile) ligase (AMP-forming)" reversible="false"> | |
| 22877 <notes> | |
| 22878 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22879 <p>SUBSYSTEM: Aminoacyl-tRNA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22880 <p>EC_NUMBER: 6.1.1.5</p> | |
| 22881 <p>GENE_ASSOCIATION: buc_BU149</p> | |
| 22882 </body> | |
| 22883 </notes> | |
| 22884 <annotation> | |
| 22885 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22886 <rdf:Description rdf:about="#_08264d14-c9c4-4f97-b236-cab2db76fe2f"> | |
| 22887 <bqbiol:is> | |
| 22888 <rdf:Bag> | |
| 22889 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.1.1.5"/> | |
| 22890 </rdf:Bag> | |
| 22891 </bqbiol:is> | |
| 22892 </rdf:Description> | |
| 22893 </rdf:RDF> | |
| 22894 </annotation> | |
| 22895 <fbc:geneProductAssociation> | |
| 22896 <fbc:geneProductRef fbc:geneProduct="buc_BU149"/> | |
| 22897 </fbc:geneProductAssociation> | |
| 22898 <listOfReactants> | |
| 22899 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 22900 <speciesReference constant="true" species="C00407" stoichiometry="1"/> | |
| 22901 <speciesReference constant="true" species="C01644" stoichiometry="1"/> | |
| 22902 </listOfReactants> | |
| 22903 <listOfProducts> | |
| 22904 <speciesReference constant="true" species="C03127" stoichiometry="1"/> | |
| 22905 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 22906 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 22907 </listOfProducts> | |
| 22908 </reaction> | |
| 22909 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03659" metaid="_95844853-74df-42b5-a178-70862919e5ec" name="L-Methionine:tRNAMet ligase (AMP-forming)" reversible="false"> | |
| 22910 <notes> | |
| 22911 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22912 <p>SUBSYSTEM: Aminoacyl-tRNA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22913 <p>EC_NUMBER: 6.1.1.10</p> | |
| 22914 <p>GENE_ASSOCIATION: buc_BU109</p> | |
| 22915 </body> | |
| 22916 </notes> | |
| 22917 <annotation> | |
| 22918 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22919 <rdf:Description rdf:about="#_95844853-74df-42b5-a178-70862919e5ec"> | |
| 22920 <bqbiol:is> | |
| 22921 <rdf:Bag> | |
| 22922 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.1.1.10"/> | |
| 22923 </rdf:Bag> | |
| 22924 </bqbiol:is> | |
| 22925 </rdf:Description> | |
| 22926 </rdf:RDF> | |
| 22927 </annotation> | |
| 22928 <fbc:geneProductAssociation> | |
| 22929 <fbc:geneProductRef fbc:geneProduct="buc_BU109"/> | |
| 22930 </fbc:geneProductAssociation> | |
| 22931 <listOfReactants> | |
| 22932 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 22933 <speciesReference constant="true" species="C01647" stoichiometry="1"/> | |
| 22934 <speciesReference constant="true" species="C00073" stoichiometry="1"/> | |
| 22935 </listOfReactants> | |
| 22936 <listOfProducts> | |
| 22937 <speciesReference constant="true" species="C02430" stoichiometry="1"/> | |
| 22938 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 22939 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 22940 </listOfProducts> | |
| 22941 </reaction> | |
| 22942 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02569" metaid="c6a2daf6-7d60-47e1-a64f-7d41ea914267" name="acetyl-CoA:enzyme N6-(dihydrolipoyl)lysine S-acetyltransferase" reversible="true"> | |
| 22943 <notes> | |
| 22944 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22945 <p>SUBSYSTEM: Pyruvate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Citrate cycle (TCA cycle) - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glycolysis / Gluconeogenesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22946 <p>EC_NUMBER: 2.3.1.12</p> | |
| 22947 <p>GENE_ASSOCIATION: buc_BU206</p> | |
| 22948 </body> | |
| 22949 </notes> | |
| 22950 <annotation> | |
| 22951 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22952 <rdf:Description rdf:about="#c6a2daf6-7d60-47e1-a64f-7d41ea914267"> | |
| 22953 <bqbiol:is> | |
| 22954 <rdf:Bag> | |
| 22955 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.3.1.12"/> | |
| 22956 </rdf:Bag> | |
| 22957 </bqbiol:is> | |
| 22958 </rdf:Description> | |
| 22959 </rdf:RDF> | |
| 22960 </annotation> | |
| 22961 <fbc:geneProductAssociation> | |
| 22962 <fbc:geneProductRef fbc:geneProduct="buc_BU206"/> | |
| 22963 </fbc:geneProductAssociation> | |
| 22964 <listOfReactants> | |
| 22965 <speciesReference constant="true" species="C00024" stoichiometry="1"/> | |
| 22966 <speciesReference constant="true" species="C15973" stoichiometry="1"/> | |
| 22967 </listOfReactants> | |
| 22968 <listOfProducts> | |
| 22969 <speciesReference constant="true" species="C16255" stoichiometry="1"/> | |
| 22970 <speciesReference constant="true" species="C00010" stoichiometry="1"/> | |
| 22971 </listOfProducts> | |
| 22972 </reaction> | |
| 22973 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03658" metaid="dce0e15c-5985-42b1-aa2d-6dad65c246ce" name="L-lysine:tRNALys ligase (AMP-forming)" reversible="false"> | |
| 22974 <notes> | |
| 22975 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 22976 <p>SUBSYSTEM: Aminoacyl-tRNA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 22977 <p>EC_NUMBER: 6.1.1.6</p> | |
| 22978 <p>GENE_ASSOCIATION: buc_BU437</p> | |
| 22979 </body> | |
| 22980 </notes> | |
| 22981 <annotation> | |
| 22982 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 22983 <rdf:Description rdf:about="#dce0e15c-5985-42b1-aa2d-6dad65c246ce"> | |
| 22984 <bqbiol:is> | |
| 22985 <rdf:Bag> | |
| 22986 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.1.1.6"/> | |
| 22987 </rdf:Bag> | |
| 22988 </bqbiol:is> | |
| 22989 </rdf:Description> | |
| 22990 </rdf:RDF> | |
| 22991 </annotation> | |
| 22992 <fbc:geneProductAssociation> | |
| 22993 <fbc:geneProductRef fbc:geneProduct="buc_BU437"/> | |
| 22994 </fbc:geneProductAssociation> | |
| 22995 <listOfReactants> | |
| 22996 <speciesReference constant="true" species="C01646" stoichiometry="1"/> | |
| 22997 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 22998 <speciesReference constant="true" species="C00047" stoichiometry="1"/> | |
| 22999 </listOfReactants> | |
| 23000 <listOfProducts> | |
| 23001 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 23002 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 23003 <speciesReference constant="true" species="C01931" stoichiometry="1"/> | |
| 23004 </listOfProducts> | |
| 23005 </reaction> | |
| 23006 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03660" metaid="fc7a9882-2f75-469a-a210-33f5551a83eb" name="L-Phenylalanine:tRNA(Ala) ligase (AMP-forming)" reversible="false"> | |
| 23007 <notes> | |
| 23008 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23009 <p>SUBSYSTEM: Aminoacyl-tRNA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23010 <p>EC_NUMBER: 6.1.1.20</p> | |
| 23011 <p>GENE_ASSOCIATION: ( buc_BU129 ) OR ( buc_BU130 )</p> | |
| 23012 </body> | |
| 23013 </notes> | |
| 23014 <annotation> | |
| 23015 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23016 <rdf:Description rdf:about="#fc7a9882-2f75-469a-a210-33f5551a83eb"> | |
| 23017 <bqbiol:is> | |
| 23018 <rdf:Bag> | |
| 23019 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.1.1.20"/> | |
| 23020 </rdf:Bag> | |
| 23021 </bqbiol:is> | |
| 23022 </rdf:Description> | |
| 23023 </rdf:RDF> | |
| 23024 </annotation> | |
| 23025 <fbc:geneProductAssociation> | |
| 23026 <fbc:or> | |
| 23027 <fbc:geneProductRef fbc:geneProduct="buc_BU129"/> | |
| 23028 <fbc:geneProductRef fbc:geneProduct="buc_BU130"/> | |
| 23029 </fbc:or> | |
| 23030 </fbc:geneProductAssociation> | |
| 23031 <listOfReactants> | |
| 23032 <speciesReference constant="true" species="C00079" stoichiometry="1"/> | |
| 23033 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 23034 <speciesReference constant="true" species="C01648" stoichiometry="1"/> | |
| 23035 </listOfReactants> | |
| 23036 <listOfProducts> | |
| 23037 <speciesReference constant="true" species="C03511" stoichiometry="1"/> | |
| 23038 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 23039 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 23040 </listOfProducts> | |
| 23041 </reaction> | |
| 23042 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02570" metaid="_739779d4-1363-4505-8fe1-19ccb0d17105" name="succinyl-CoA:enzyme N6-(dihydrolipoyl)lysine S-succinyltransferase" reversible="true"> | |
| 23043 <notes> | |
| 23044 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23045 <p>SUBSYSTEM: Citrate cycle (TCA cycle) - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23046 <p>EC_NUMBER: 2.3.1.61</p> | |
| 23047 <p>GENE_ASSOCIATION: buc_BU303</p> | |
| 23048 </body> | |
| 23049 </notes> | |
| 23050 <annotation> | |
| 23051 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23052 <rdf:Description rdf:about="#_739779d4-1363-4505-8fe1-19ccb0d17105"> | |
| 23053 <bqbiol:is> | |
| 23054 <rdf:Bag> | |
| 23055 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.3.1.61"/> | |
| 23056 </rdf:Bag> | |
| 23057 </bqbiol:is> | |
| 23058 </rdf:Description> | |
| 23059 </rdf:RDF> | |
| 23060 </annotation> | |
| 23061 <fbc:geneProductAssociation> | |
| 23062 <fbc:geneProductRef fbc:geneProduct="buc_BU303"/> | |
| 23063 </fbc:geneProductAssociation> | |
| 23064 <listOfReactants> | |
| 23065 <speciesReference constant="true" species="C00091" stoichiometry="1"/> | |
| 23066 <speciesReference constant="true" species="C15973" stoichiometry="1"/> | |
| 23067 </listOfReactants> | |
| 23068 <listOfProducts> | |
| 23069 <speciesReference constant="true" species="C16254" stoichiometry="1"/> | |
| 23070 <speciesReference constant="true" species="C00010" stoichiometry="1"/> | |
| 23071 </listOfProducts> | |
| 23072 </reaction> | |
| 23073 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03662" metaid="d91c1c62-8d00-473a-b1fa-b8dc843f05c5" name="L-Serine:tRNA(Ser) ligase (AMP-forming)" reversible="false"> | |
| 23074 <notes> | |
| 23075 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23076 <p>SUBSYSTEM: Aminoacyl-tRNA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23077 <p>EC_NUMBER: 6.1.1.11</p> | |
| 23078 <p>GENE_ASSOCIATION: buc_BU313</p> | |
| 23079 </body> | |
| 23080 </notes> | |
| 23081 <annotation> | |
| 23082 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23083 <rdf:Description rdf:about="#d91c1c62-8d00-473a-b1fa-b8dc843f05c5"> | |
| 23084 <bqbiol:is> | |
| 23085 <rdf:Bag> | |
| 23086 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.1.1.11"/> | |
| 23087 </rdf:Bag> | |
| 23088 </bqbiol:is> | |
| 23089 </rdf:Description> | |
| 23090 </rdf:RDF> | |
| 23091 </annotation> | |
| 23092 <fbc:geneProductAssociation> | |
| 23093 <fbc:geneProductRef fbc:geneProduct="buc_BU313"/> | |
| 23094 </fbc:geneProductAssociation> | |
| 23095 <listOfReactants> | |
| 23096 <speciesReference constant="true" species="C01650" stoichiometry="1"/> | |
| 23097 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 23098 <speciesReference constant="true" species="C00065" stoichiometry="1"/> | |
| 23099 </listOfReactants> | |
| 23100 <listOfProducts> | |
| 23101 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 23102 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 23103 <speciesReference constant="true" species="C02553" stoichiometry="1"/> | |
| 23104 </listOfProducts> | |
| 23105 </reaction> | |
| 23106 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03661" metaid="c38ab8f1-8bff-4207-bfb5-a1356a8aeffc" name="L-proline:tRNA(Pro) ligase (AMP-forming)" reversible="false"> | |
| 23107 <notes> | |
| 23108 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23109 <p>SUBSYSTEM: Aminoacyl-tRNA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23110 <p>EC_NUMBER: 6.1.1.15</p> | |
| 23111 <p>GENE_ASSOCIATION: buc_BU239</p> | |
| 23112 </body> | |
| 23113 </notes> | |
| 23114 <annotation> | |
| 23115 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23116 <rdf:Description rdf:about="#c38ab8f1-8bff-4207-bfb5-a1356a8aeffc"> | |
| 23117 <bqbiol:is> | |
| 23118 <rdf:Bag> | |
| 23119 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.1.1.15"/> | |
| 23120 </rdf:Bag> | |
| 23121 </bqbiol:is> | |
| 23122 </rdf:Description> | |
| 23123 </rdf:RDF> | |
| 23124 </annotation> | |
| 23125 <fbc:geneProductAssociation> | |
| 23126 <fbc:geneProductRef fbc:geneProduct="buc_BU239"/> | |
| 23127 </fbc:geneProductAssociation> | |
| 23128 <listOfReactants> | |
| 23129 <speciesReference constant="true" species="C01649" stoichiometry="1"/> | |
| 23130 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 23131 <speciesReference constant="true" species="C00148" stoichiometry="1"/> | |
| 23132 </listOfReactants> | |
| 23133 <listOfProducts> | |
| 23134 <speciesReference constant="true" species="C02702" stoichiometry="1"/> | |
| 23135 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 23136 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 23137 </listOfProducts> | |
| 23138 </reaction> | |
| 23139 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01122" metaid="_3798811c-efba-41f3-82df-e8974f9296d1" name="delta2-isopentenyl-diphosphate:tRNA isopentenyltransferase" reversible="true"> | |
| 23140 <notes> | |
| 23141 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23142 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23143 <p>EC_NUMBER: 2.5.1.75</p> | |
| 23144 <p>GENE_ASSOCIATION: buc_BU569</p> | |
| 23145 </body> | |
| 23146 </notes> | |
| 23147 <annotation> | |
| 23148 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23149 <rdf:Description rdf:about="#_3798811c-efba-41f3-82df-e8974f9296d1"> | |
| 23150 <bqbiol:is> | |
| 23151 <rdf:Bag> | |
| 23152 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.5.1.75"/> | |
| 23153 </rdf:Bag> | |
| 23154 </bqbiol:is> | |
| 23155 </rdf:Description> | |
| 23156 </rdf:RDF> | |
| 23157 </annotation> | |
| 23158 <fbc:geneProductAssociation> | |
| 23159 <fbc:geneProductRef fbc:geneProduct="buc_BU569"/> | |
| 23160 </fbc:geneProductAssociation> | |
| 23161 <listOfReactants> | |
| 23162 <speciesReference constant="true" species="C00235" stoichiometry="1"/> | |
| 23163 <speciesReference constant="true" species="C17324" stoichiometry="1"/> | |
| 23164 </listOfReactants> | |
| 23165 <listOfProducts> | |
| 23166 <speciesReference constant="true" species="C04432" stoichiometry="1"/> | |
| 23167 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 23168 </listOfProducts> | |
| 23169 </reaction> | |
| 23170 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03664" metaid="_2ffedb84-93a8-48c7-b738-5091516cf1b4" name="L-Tryptophan -tRNA(Trp) ligase (AMP-forming)" reversible="false"> | |
| 23171 <notes> | |
| 23172 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23173 <p>SUBSYSTEM: Aminoacyl-tRNA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23174 <p>EC_NUMBER: 6.1.1.2</p> | |
| 23175 <p>GENE_ASSOCIATION: buc_BU536</p> | |
| 23176 </body> | |
| 23177 </notes> | |
| 23178 <annotation> | |
| 23179 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23180 <rdf:Description rdf:about="#_2ffedb84-93a8-48c7-b738-5091516cf1b4"> | |
| 23181 <bqbiol:is> | |
| 23182 <rdf:Bag> | |
| 23183 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.1.1.2"/> | |
| 23184 </rdf:Bag> | |
| 23185 </bqbiol:is> | |
| 23186 </rdf:Description> | |
| 23187 </rdf:RDF> | |
| 23188 </annotation> | |
| 23189 <fbc:geneProductAssociation> | |
| 23190 <fbc:geneProductRef fbc:geneProduct="buc_BU536"/> | |
| 23191 </fbc:geneProductAssociation> | |
| 23192 <listOfReactants> | |
| 23193 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 23194 <speciesReference constant="true" species="C01652" stoichiometry="1"/> | |
| 23195 <speciesReference constant="true" species="C00078" stoichiometry="1"/> | |
| 23196 </listOfReactants> | |
| 23197 <listOfProducts> | |
| 23198 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 23199 <speciesReference constant="true" species="C03512" stoichiometry="1"/> | |
| 23200 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 23201 </listOfProducts> | |
| 23202 </reaction> | |
| 23203 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03663" metaid="_07152367-50f0-429f-81f1-98fa1258170d" name="L-Threonine:tRNA(Thr) ligase (AMP-forming)" reversible="false"> | |
| 23204 <notes> | |
| 23205 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23206 <p>SUBSYSTEM: Aminoacyl-tRNA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23207 <p>EC_NUMBER: 6.1.1.3</p> | |
| 23208 <p>GENE_ASSOCIATION: buc_BU125</p> | |
| 23209 </body> | |
| 23210 </notes> | |
| 23211 <annotation> | |
| 23212 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23213 <rdf:Description rdf:about="#_07152367-50f0-429f-81f1-98fa1258170d"> | |
| 23214 <bqbiol:is> | |
| 23215 <rdf:Bag> | |
| 23216 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.1.1.3"/> | |
| 23217 </rdf:Bag> | |
| 23218 </bqbiol:is> | |
| 23219 </rdf:Description> | |
| 23220 </rdf:RDF> | |
| 23221 </annotation> | |
| 23222 <fbc:geneProductAssociation> | |
| 23223 <fbc:geneProductRef fbc:geneProduct="buc_BU125"/> | |
| 23224 </fbc:geneProductAssociation> | |
| 23225 <listOfReactants> | |
| 23226 <speciesReference constant="true" species="C01651" stoichiometry="1"/> | |
| 23227 <speciesReference constant="true" species="C00188" stoichiometry="1"/> | |
| 23228 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 23229 </listOfReactants> | |
| 23230 <listOfProducts> | |
| 23231 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 23232 <speciesReference constant="true" species="C02992" stoichiometry="1"/> | |
| 23233 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 23234 </listOfProducts> | |
| 23235 </reaction> | |
| 23236 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00155" metaid="_21aff22d-6a7a-409a-9d41-c5a6bec94c49" name="UDP phosphohydrolase" reversible="true"> | |
| 23237 <notes> | |
| 23238 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23239 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23240 <p>GENE_ASSOCIATION: buc_BU233</p> | |
| 23241 </body> | |
| 23242 </notes> | |
| 23243 <fbc:geneProductAssociation> | |
| 23244 <fbc:geneProductRef fbc:geneProduct="buc_BU233"/> | |
| 23245 </fbc:geneProductAssociation> | |
| 23246 <listOfReactants> | |
| 23247 <speciesReference constant="true" species="C00015" stoichiometry="1"/> | |
| 23248 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 23249 </listOfReactants> | |
| 23250 <listOfProducts> | |
| 23251 <speciesReference constant="true" species="C00105" stoichiometry="1"/> | |
| 23252 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 23253 </listOfProducts> | |
| 23254 </reaction> | |
| 23255 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R09084" metaid="_055e69d5-7360-428f-849d-65ec46fc1372" name="ADP:D-fructose-6-phosphate 1-phosphotransferase" reversible="true"> | |
| 23256 <notes> | |
| 23257 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23258 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23259 <p>GENE_ASSOCIATION: buc_BU305</p> | |
| 23260 </body> | |
| 23261 </notes> | |
| 23262 <fbc:geneProductAssociation> | |
| 23263 <fbc:geneProductRef fbc:geneProduct="buc_BU305"/> | |
| 23264 </fbc:geneProductAssociation> | |
| 23265 <listOfReactants> | |
| 23266 <speciesReference constant="true" species="C05345" stoichiometry="1"/> | |
| 23267 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 23268 </listOfReactants> | |
| 23269 <listOfProducts> | |
| 23270 <speciesReference constant="true" species="C05378" stoichiometry="1"/> | |
| 23271 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 23272 </listOfProducts> | |
| 23273 </reaction> | |
| 23274 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00497" metaid="e7056e67-720d-4915-96cd-2c35a103b3d7" name="gamma-L-glutamyl-L-cysteine:glycine ligase (ADP-forming)" reversible="true"> | |
| 23275 <notes> | |
| 23276 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23277 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glutathione metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23278 <p>EC_NUMBER: 6.3.2.3</p> | |
| 23279 <p>GENE_ASSOCIATION: buc_BU547</p> | |
| 23280 </body> | |
| 23281 </notes> | |
| 23282 <annotation> | |
| 23283 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23284 <rdf:Description rdf:about="#e7056e67-720d-4915-96cd-2c35a103b3d7"> | |
| 23285 <bqbiol:is> | |
| 23286 <rdf:Bag> | |
| 23287 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.3.2.3"/> | |
| 23288 </rdf:Bag> | |
| 23289 </bqbiol:is> | |
| 23290 </rdf:Description> | |
| 23291 </rdf:RDF> | |
| 23292 </annotation> | |
| 23293 <fbc:geneProductAssociation> | |
| 23294 <fbc:geneProductRef fbc:geneProduct="buc_BU547"/> | |
| 23295 </fbc:geneProductAssociation> | |
| 23296 <listOfReactants> | |
| 23297 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 23298 <speciesReference constant="true" species="C00669" stoichiometry="1"/> | |
| 23299 <speciesReference constant="true" species="C00037" stoichiometry="1"/> | |
| 23300 </listOfReactants> | |
| 23301 <listOfProducts> | |
| 23302 <speciesReference constant="true" species="C00051" stoichiometry="1"/> | |
| 23303 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 23304 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 23305 </listOfProducts> | |
| 23306 </reaction> | |
| 23307 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01224" metaid="_39a40585-1538-4454-b008-edcd788a6818" name="5-methyltetrahydrofolate:NADP+ oxidoreductase" reversible="true"> | |
| 23308 <notes> | |
| 23309 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23310 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23311 <p>GENE_ASSOCIATION: buc_BU046</p> | |
| 23312 </body> | |
| 23313 </notes> | |
| 23314 <fbc:geneProductAssociation> | |
| 23315 <fbc:geneProductRef fbc:geneProduct="buc_BU046"/> | |
| 23316 </fbc:geneProductAssociation> | |
| 23317 <listOfReactants> | |
| 23318 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 23319 <speciesReference constant="true" species="C00440" stoichiometry="1"/> | |
| 23320 </listOfReactants> | |
| 23321 <listOfProducts> | |
| 23322 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 23323 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 23324 <speciesReference constant="true" species="C00143" stoichiometry="1"/> | |
| 23325 </listOfProducts> | |
| 23326 </reaction> | |
| 23327 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01466" metaid="fb3592ad-44d6-4ce4-9e38-4574b30d53c3" name="O-phospho-L-homoserine phosphate-lyase (adding waterL-threonine-forming)" reversible="true"> | |
| 23328 <notes> | |
| 23329 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23330 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glycine, serine and threonine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23331 <p>EC_NUMBER: 4.2.3.1</p> | |
| 23332 <p>GENE_ASSOCIATION: buc_BU192</p> | |
| 23333 </body> | |
| 23334 </notes> | |
| 23335 <annotation> | |
| 23336 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23337 <rdf:Description rdf:about="#fb3592ad-44d6-4ce4-9e38-4574b30d53c3"> | |
| 23338 <bqbiol:is> | |
| 23339 <rdf:Bag> | |
| 23340 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.2.3.1"/> | |
| 23341 </rdf:Bag> | |
| 23342 </bqbiol:is> | |
| 23343 </rdf:Description> | |
| 23344 </rdf:RDF> | |
| 23345 </annotation> | |
| 23346 <fbc:geneProductAssociation> | |
| 23347 <fbc:geneProductRef fbc:geneProduct="buc_BU192"/> | |
| 23348 </fbc:geneProductAssociation> | |
| 23349 <listOfReactants> | |
| 23350 <speciesReference constant="true" species="C01102" stoichiometry="1"/> | |
| 23351 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 23352 </listOfReactants> | |
| 23353 <listOfProducts> | |
| 23354 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 23355 <speciesReference constant="true" species="C00188" stoichiometry="1"/> | |
| 23356 </listOfProducts> | |
| 23357 </reaction> | |
| 23358 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00014" metaid="e5eeb457-8f40-421d-87aa-99b8b4cc92ea" name="pyruvate:thiamin diphosphate acetaldehydetransferase (decarboxylating)" reversible="false"> | |
| 23359 <notes> | |
| 23360 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23361 <p>SUBSYSTEM: Pyruvate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Citrate cycle (TCA cycle) - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glycolysis / Gluconeogenesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23362 <p>EC_NUMBER: 1.2.4.1 / 2.2.1.6</p> | |
| 23363 <p>GENE_ASSOCIATION: buc_BU205</p> | |
| 23364 </body> | |
| 23365 </notes> | |
| 23366 <annotation> | |
| 23367 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23368 <rdf:Description rdf:about="#e5eeb457-8f40-421d-87aa-99b8b4cc92ea"> | |
| 23369 <bqbiol:is> | |
| 23370 <rdf:Bag> | |
| 23371 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.2.4.1 / 2.2.1.6"/> | |
| 23372 </rdf:Bag> | |
| 23373 </bqbiol:is> | |
| 23374 </rdf:Description> | |
| 23375 </rdf:RDF> | |
| 23376 </annotation> | |
| 23377 <fbc:geneProductAssociation> | |
| 23378 <fbc:geneProductRef fbc:geneProduct="buc_BU205"/> | |
| 23379 </fbc:geneProductAssociation> | |
| 23380 <listOfReactants> | |
| 23381 <speciesReference constant="true" species="C00068" stoichiometry="1"/> | |
| 23382 <speciesReference constant="true" species="C00022" stoichiometry="1"/> | |
| 23383 </listOfReactants> | |
| 23384 <listOfProducts> | |
| 23385 <speciesReference constant="true" species="C05125" stoichiometry="1"/> | |
| 23386 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 23387 </listOfProducts> | |
| 23388 </reaction> | |
| 23389 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02557" metaid="_9caa3e20-4d8d-4eee-be28-475242583b34" name="Deoxyadenosine:orthophosphate ribosyltransferase" reversible="true"> | |
| 23390 <notes> | |
| 23391 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23392 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23393 <p>EC_NUMBER: 2.4.2.1</p> | |
| 23394 <p>GENE_ASSOCIATION: buc_BU541</p> | |
| 23395 </body> | |
| 23396 </notes> | |
| 23397 <annotation> | |
| 23398 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23399 <rdf:Description rdf:about="#_9caa3e20-4d8d-4eee-be28-475242583b34"> | |
| 23400 <bqbiol:is> | |
| 23401 <rdf:Bag> | |
| 23402 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.4.2.1"/> | |
| 23403 </rdf:Bag> | |
| 23404 </bqbiol:is> | |
| 23405 </rdf:Description> | |
| 23406 </rdf:RDF> | |
| 23407 </annotation> | |
| 23408 <fbc:geneProductAssociation> | |
| 23409 <fbc:geneProductRef fbc:geneProduct="buc_BU541"/> | |
| 23410 </fbc:geneProductAssociation> | |
| 23411 <listOfReactants> | |
| 23412 <speciesReference constant="true" species="C00559" stoichiometry="1"/> | |
| 23413 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 23414 </listOfReactants> | |
| 23415 <listOfProducts> | |
| 23416 <speciesReference constant="true" species="C00672" stoichiometry="1"/> | |
| 23417 <speciesReference constant="true" species="C00147" stoichiometry="1"/> | |
| 23418 </listOfProducts> | |
| 23419 </reaction> | |
| 23420 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00257" metaid="aeeb6f26-aeb1-4f23-b92d-5896ced21d1f" name="Deamido-NAD+:L-glutamine amido-ligase (AMP-forming)" reversible="true"> | |
| 23421 <notes> | |
| 23422 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23423 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23424 <p>GENE_ASSOCIATION: buc_BU174</p> | |
| 23425 </body> | |
| 23426 </notes> | |
| 23427 <fbc:geneProductAssociation> | |
| 23428 <fbc:geneProductRef fbc:geneProduct="buc_BU174"/> | |
| 23429 </fbc:geneProductAssociation> | |
| 23430 <listOfReactants> | |
| 23431 <speciesReference constant="true" species="C00064" stoichiometry="1"/> | |
| 23432 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 23433 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 23434 <speciesReference constant="true" species="C00857" stoichiometry="1"/> | |
| 23435 </listOfReactants> | |
| 23436 <listOfProducts> | |
| 23437 <speciesReference constant="true" species="C00025" stoichiometry="1"/> | |
| 23438 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 23439 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 23440 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 23441 </listOfProducts> | |
| 23442 </reaction> | |
| 23443 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03646" metaid="cf76a2ac-3fd0-4f8a-abad-54db0a7349f9" name="L-Arginine:tRNA(Arg) ligase (AMP-forming)" reversible="false"> | |
| 23444 <notes> | |
| 23445 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23446 <p>SUBSYSTEM: Aminoacyl-tRNA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23447 <p>EC_NUMBER: 6.1.1.19</p> | |
| 23448 <p>GENE_ASSOCIATION: buc_BU242</p> | |
| 23449 </body> | |
| 23450 </notes> | |
| 23451 <annotation> | |
| 23452 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23453 <rdf:Description rdf:about="#cf76a2ac-3fd0-4f8a-abad-54db0a7349f9"> | |
| 23454 <bqbiol:is> | |
| 23455 <rdf:Bag> | |
| 23456 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.1.1.19"/> | |
| 23457 </rdf:Bag> | |
| 23458 </bqbiol:is> | |
| 23459 </rdf:Description> | |
| 23460 </rdf:RDF> | |
| 23461 </annotation> | |
| 23462 <fbc:geneProductAssociation> | |
| 23463 <fbc:geneProductRef fbc:geneProduct="buc_BU242"/> | |
| 23464 </fbc:geneProductAssociation> | |
| 23465 <listOfReactants> | |
| 23466 <speciesReference constant="true" species="C01636" stoichiometry="1"/> | |
| 23467 <speciesReference constant="true" species="C00062" stoichiometry="1"/> | |
| 23468 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 23469 </listOfReactants> | |
| 23470 <listOfProducts> | |
| 23471 <speciesReference constant="true" species="C02163" stoichiometry="1"/> | |
| 23472 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 23473 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 23474 </listOfProducts> | |
| 23475 </reaction> | |
| 23476 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01225" metaid="da274c1f-fea2-4491-b11b-a530324ea410" name="5,10-Methylenetetrahydrofolate:D-alanine 2-hydroxymethyltransferase" reversible="true"> | |
| 23477 <notes> | |
| 23478 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23479 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23480 <p>GENE_ASSOCIATION: buc_BU289</p> | |
| 23481 </body> | |
| 23482 </notes> | |
| 23483 <fbc:geneProductAssociation> | |
| 23484 <fbc:geneProductRef fbc:geneProduct="buc_BU289"/> | |
| 23485 </fbc:geneProductAssociation> | |
| 23486 <listOfReactants> | |
| 23487 <speciesReference constant="true" species="C00133" stoichiometry="1"/> | |
| 23488 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 23489 <speciesReference constant="true" species="C00143" stoichiometry="1"/> | |
| 23490 </listOfReactants> | |
| 23491 <listOfProducts> | |
| 23492 <speciesReference constant="true" species="C00101" stoichiometry="1"/> | |
| 23493 <speciesReference constant="true" species="C02115" stoichiometry="1"/> | |
| 23494 </listOfProducts> | |
| 23495 </reaction> | |
| 23496 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01226" metaid="fee84961-2aec-409e-b3e5-bf153ac7db3f" name="5,10-Methylenetetrahydrofolate:3-methyl-2-oxobutanoate hydroxymethyltransferase" reversible="true"> | |
| 23497 <notes> | |
| 23498 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23499 <p>SUBSYSTEM: Pantothenate and CoA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23500 <p>EC_NUMBER: 2.1.2.11</p> | |
| 23501 <p>GENE_ASSOCIATION: buc_BU197</p> | |
| 23502 </body> | |
| 23503 </notes> | |
| 23504 <annotation> | |
| 23505 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23506 <rdf:Description rdf:about="#fee84961-2aec-409e-b3e5-bf153ac7db3f"> | |
| 23507 <bqbiol:is> | |
| 23508 <rdf:Bag> | |
| 23509 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.1.2.11"/> | |
| 23510 </rdf:Bag> | |
| 23511 </bqbiol:is> | |
| 23512 </rdf:Description> | |
| 23513 </rdf:RDF> | |
| 23514 </annotation> | |
| 23515 <fbc:geneProductAssociation> | |
| 23516 <fbc:geneProductRef fbc:geneProduct="buc_BU197"/> | |
| 23517 </fbc:geneProductAssociation> | |
| 23518 <listOfReactants> | |
| 23519 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 23520 <speciesReference constant="true" species="C00143" stoichiometry="1"/> | |
| 23521 <speciesReference constant="true" species="C00141" stoichiometry="1"/> | |
| 23522 </listOfReactants> | |
| 23523 <listOfProducts> | |
| 23524 <speciesReference constant="true" species="C00101" stoichiometry="1"/> | |
| 23525 <speciesReference constant="true" species="C00966" stoichiometry="1"/> | |
| 23526 </listOfProducts> | |
| 23527 </reaction> | |
| 23528 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00137" metaid="_866314c7-49de-4cf5-b1c3-d3448060b288" name="ATP:nicotinamide-nucleotide adenylyltransferase" reversible="true"> | |
| 23529 <notes> | |
| 23530 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23531 <p>SUBSYSTEM: Nicotinate and nicotinamide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23532 <p>EC_NUMBER: 2.7.7.18</p> | |
| 23533 <p>GENE_ASSOCIATION: buc_BU446</p> | |
| 23534 </body> | |
| 23535 </notes> | |
| 23536 <annotation> | |
| 23537 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23538 <rdf:Description rdf:about="#_866314c7-49de-4cf5-b1c3-d3448060b288"> | |
| 23539 <bqbiol:is> | |
| 23540 <rdf:Bag> | |
| 23541 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.7.18"/> | |
| 23542 </rdf:Bag> | |
| 23543 </bqbiol:is> | |
| 23544 </rdf:Description> | |
| 23545 </rdf:RDF> | |
| 23546 </annotation> | |
| 23547 <fbc:geneProductAssociation> | |
| 23548 <fbc:geneProductRef fbc:geneProduct="buc_BU446"/> | |
| 23549 </fbc:geneProductAssociation> | |
| 23550 <listOfReactants> | |
| 23551 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 23552 <speciesReference constant="true" species="C00455" stoichiometry="1"/> | |
| 23553 </listOfReactants> | |
| 23554 <listOfProducts> | |
| 23555 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 23556 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 23557 </listOfProducts> | |
| 23558 </reaction> | |
| 23559 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04617" metaid="ebec018a-fa84-49f9-92db-c7867d3ecfae" name="UDP-N-acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate:D-alanyl-D-alanine ligase(ADP-forming)" reversible="true"> | |
| 23560 <notes> | |
| 23561 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23562 <p>SUBSYSTEM: Lysine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Peptidoglycan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23563 <p>EC_NUMBER: 6.3.2.10</p> | |
| 23564 <p>GENE_ASSOCIATION: buc_BU220</p> | |
| 23565 </body> | |
| 23566 </notes> | |
| 23567 <annotation> | |
| 23568 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23569 <rdf:Description rdf:about="#ebec018a-fa84-49f9-92db-c7867d3ecfae"> | |
| 23570 <bqbiol:is> | |
| 23571 <rdf:Bag> | |
| 23572 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.3.2.10"/> | |
| 23573 </rdf:Bag> | |
| 23574 </bqbiol:is> | |
| 23575 </rdf:Description> | |
| 23576 </rdf:RDF> | |
| 23577 </annotation> | |
| 23578 <fbc:geneProductAssociation> | |
| 23579 <fbc:geneProductRef fbc:geneProduct="buc_BU220"/> | |
| 23580 </fbc:geneProductAssociation> | |
| 23581 <listOfReactants> | |
| 23582 <speciesReference constant="true" species="C00993" stoichiometry="1"/> | |
| 23583 <speciesReference constant="true" species="C04877" stoichiometry="1"/> | |
| 23584 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 23585 </listOfReactants> | |
| 23586 <listOfProducts> | |
| 23587 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 23588 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 23589 <speciesReference constant="true" species="C04882" stoichiometry="1"/> | |
| 23590 </listOfProducts> | |
| 23591 </reaction> | |
| 23592 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00259" metaid="bf32d603-2780-4bff-9ab6-d72d11ff4c6e" name="acetyl-CoA:L-glutamate N-acetyltransferase" reversible="true"> | |
| 23593 <notes> | |
| 23594 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23595 <p>SUBSYSTEM: Arginine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23596 <p>EC_NUMBER: 2.3.1.1</p> | |
| 23597 <p>GENE_ASSOCIATION: buc_BU456</p> | |
| 23598 </body> | |
| 23599 </notes> | |
| 23600 <annotation> | |
| 23601 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23602 <rdf:Description rdf:about="#bf32d603-2780-4bff-9ab6-d72d11ff4c6e"> | |
| 23603 <bqbiol:is> | |
| 23604 <rdf:Bag> | |
| 23605 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.3.1.1"/> | |
| 23606 </rdf:Bag> | |
| 23607 </bqbiol:is> | |
| 23608 </rdf:Description> | |
| 23609 </rdf:RDF> | |
| 23610 </annotation> | |
| 23611 <fbc:geneProductAssociation> | |
| 23612 <fbc:geneProductRef fbc:geneProduct="buc_BU456"/> | |
| 23613 </fbc:geneProductAssociation> | |
| 23614 <listOfReactants> | |
| 23615 <speciesReference constant="true" species="C00025" stoichiometry="1"/> | |
| 23616 <speciesReference constant="true" species="C00024" stoichiometry="1"/> | |
| 23617 </listOfReactants> | |
| 23618 <listOfProducts> | |
| 23619 <speciesReference constant="true" species="C00624" stoichiometry="1"/> | |
| 23620 <speciesReference constant="true" species="C00010" stoichiometry="1"/> | |
| 23621 </listOfProducts> | |
| 23622 </reaction> | |
| 23623 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03648" metaid="_08d59e09-0a2b-440d-816b-1bb44ad3d310" name="L-Asparagine:tRNA(Asn) ligase (AMP-forming)" reversible="false"> | |
| 23624 <notes> | |
| 23625 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23626 <p>SUBSYSTEM: Aminoacyl-tRNA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23627 <p>EC_NUMBER: 6.1.1.22</p> | |
| 23628 <p>GENE_ASSOCIATION: buc_BU360</p> | |
| 23629 </body> | |
| 23630 </notes> | |
| 23631 <annotation> | |
| 23632 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23633 <rdf:Description rdf:about="#_08d59e09-0a2b-440d-816b-1bb44ad3d310"> | |
| 23634 <bqbiol:is> | |
| 23635 <rdf:Bag> | |
| 23636 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.1.1.22"/> | |
| 23637 </rdf:Bag> | |
| 23638 </bqbiol:is> | |
| 23639 </rdf:Description> | |
| 23640 </rdf:RDF> | |
| 23641 </annotation> | |
| 23642 <fbc:geneProductAssociation> | |
| 23643 <fbc:geneProductRef fbc:geneProduct="buc_BU360"/> | |
| 23644 </fbc:geneProductAssociation> | |
| 23645 <listOfReactants> | |
| 23646 <speciesReference constant="true" species="C01637" stoichiometry="1"/> | |
| 23647 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 23648 <speciesReference constant="true" species="C00152" stoichiometry="1"/> | |
| 23649 </listOfReactants> | |
| 23650 <listOfProducts> | |
| 23651 <speciesReference constant="true" species="C03402" stoichiometry="1"/> | |
| 23652 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 23653 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 23654 </listOfProducts> | |
| 23655 </reaction> | |
| 23656 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01229" metaid="_0ef9c1f1-1d0d-4a37-a5a2-bf1ad31432be" name="GMP:diphosphate 5-phospho-alpha-D-ribosyltransferase" reversible="true"> | |
| 23657 <notes> | |
| 23658 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23659 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23660 <p>EC_NUMBER: 2.4.2.8 / 2.4.2.22</p> | |
| 23661 <p>GENE_ASSOCIATION: buc_BU251</p> | |
| 23662 </body> | |
| 23663 </notes> | |
| 23664 <annotation> | |
| 23665 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23666 <rdf:Description rdf:about="#_0ef9c1f1-1d0d-4a37-a5a2-bf1ad31432be"> | |
| 23667 <bqbiol:is> | |
| 23668 <rdf:Bag> | |
| 23669 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.4.2.8 / 2.4.2.22"/> | |
| 23670 </rdf:Bag> | |
| 23671 </bqbiol:is> | |
| 23672 </rdf:Description> | |
| 23673 </rdf:RDF> | |
| 23674 </annotation> | |
| 23675 <fbc:geneProductAssociation> | |
| 23676 <fbc:geneProductRef fbc:geneProduct="buc_BU251"/> | |
| 23677 </fbc:geneProductAssociation> | |
| 23678 <listOfReactants> | |
| 23679 <speciesReference constant="true" species="C00144" stoichiometry="1"/> | |
| 23680 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 23681 </listOfReactants> | |
| 23682 <listOfProducts> | |
| 23683 <speciesReference constant="true" species="C00119" stoichiometry="1"/> | |
| 23684 <speciesReference constant="true" species="C00242" stoichiometry="1"/> | |
| 23685 </listOfProducts> | |
| 23686 </reaction> | |
| 23687 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00260" metaid="_9dab1151-366d-4c68-8511-5823cb858556" name="glutamate racemase" reversible="true"> | |
| 23688 <notes> | |
| 23689 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23690 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || D-Amino acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23691 <p>EC_NUMBER: 5.1.1.3</p> | |
| 23692 <p>GENE_ASSOCIATION: buc_BU554</p> | |
| 23693 </body> | |
| 23694 </notes> | |
| 23695 <annotation> | |
| 23696 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23697 <rdf:Description rdf:about="#_9dab1151-366d-4c68-8511-5823cb858556"> | |
| 23698 <bqbiol:is> | |
| 23699 <rdf:Bag> | |
| 23700 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.1.1.3"/> | |
| 23701 </rdf:Bag> | |
| 23702 </bqbiol:is> | |
| 23703 </rdf:Description> | |
| 23704 </rdf:RDF> | |
| 23705 </annotation> | |
| 23706 <fbc:geneProductAssociation> | |
| 23707 <fbc:geneProductRef fbc:geneProduct="buc_BU554"/> | |
| 23708 </fbc:geneProductAssociation> | |
| 23709 <listOfReactants> | |
| 23710 <speciesReference constant="true" species="C00025" stoichiometry="1"/> | |
| 23711 </listOfReactants> | |
| 23712 <listOfProducts> | |
| 23713 <speciesReference constant="true" species="C00217" stoichiometry="1"/> | |
| 23714 </listOfProducts> | |
| 23715 </reaction> | |
| 23716 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02320" metaid="_29aef70b-7bf3-4fac-8043-b6cef2d6512c" name="NTP:pyruvate O2-phosphotransferase" reversible="true"> | |
| 23717 <notes> | |
| 23718 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23719 <p>SUBSYSTEM: Pyruvate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23720 <p>EC_NUMBER: 2.7.1.40</p> | |
| 23721 <p>GENE_ASSOCIATION: buc_BU319</p> | |
| 23722 </body> | |
| 23723 </notes> | |
| 23724 <annotation> | |
| 23725 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23726 <rdf:Description rdf:about="#_29aef70b-7bf3-4fac-8043-b6cef2d6512c"> | |
| 23727 <bqbiol:is> | |
| 23728 <rdf:Bag> | |
| 23729 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.40"/> | |
| 23730 </rdf:Bag> | |
| 23731 </bqbiol:is> | |
| 23732 </rdf:Description> | |
| 23733 </rdf:RDF> | |
| 23734 </annotation> | |
| 23735 <fbc:geneProductAssociation> | |
| 23736 <fbc:geneProductRef fbc:geneProduct="buc_BU319"/> | |
| 23737 </fbc:geneProductAssociation> | |
| 23738 <listOfReactants> | |
| 23739 <speciesReference constant="true" species="C00201" stoichiometry="1"/> | |
| 23740 <speciesReference constant="true" species="C00022" stoichiometry="1"/> | |
| 23741 </listOfReactants> | |
| 23742 <listOfProducts> | |
| 23743 <speciesReference constant="true" species="C00074" stoichiometry="1"/> | |
| 23744 <speciesReference constant="true" species="C00454" stoichiometry="1"/> | |
| 23745 </listOfProducts> | |
| 23746 </reaction> | |
| 23747 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03650" metaid="_2b1ef2b3-d61f-4699-b3bb-7321b8d9ab9e" name="L-Cysteine:tRNA(Cys) ligase (AMP-forming)" reversible="false"> | |
| 23748 <notes> | |
| 23749 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23750 <p>SUBSYSTEM: Aminoacyl-tRNA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23751 <p>EC_NUMBER: 6.1.1.16</p> | |
| 23752 <p>GENE_ASSOCIATION: buc_BU487</p> | |
| 23753 </body> | |
| 23754 </notes> | |
| 23755 <annotation> | |
| 23756 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23757 <rdf:Description rdf:about="#_2b1ef2b3-d61f-4699-b3bb-7321b8d9ab9e"> | |
| 23758 <bqbiol:is> | |
| 23759 <rdf:Bag> | |
| 23760 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.1.1.16"/> | |
| 23761 </rdf:Bag> | |
| 23762 </bqbiol:is> | |
| 23763 </rdf:Description> | |
| 23764 </rdf:RDF> | |
| 23765 </annotation> | |
| 23766 <fbc:geneProductAssociation> | |
| 23767 <fbc:geneProductRef fbc:geneProduct="buc_BU487"/> | |
| 23768 </fbc:geneProductAssociation> | |
| 23769 <listOfReactants> | |
| 23770 <speciesReference constant="true" species="C00097" stoichiometry="1"/> | |
| 23771 <speciesReference constant="true" species="C01639" stoichiometry="1"/> | |
| 23772 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 23773 </listOfReactants> | |
| 23774 <listOfProducts> | |
| 23775 <speciesReference constant="true" species="C03125" stoichiometry="1"/> | |
| 23776 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 23777 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 23778 </listOfProducts> | |
| 23779 </reaction> | |
| 23780 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01353" metaid="_1719db04-e41a-41f9-92e1-ce5d52472bb7" name="ATP:propanoate phosphotransferase" reversible="true"> | |
| 23781 <notes> | |
| 23782 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23783 <p>SUBSYSTEM: Propanoate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23784 <p>EC_NUMBER: 2.7.2.1</p> | |
| 23785 <p>GENE_ASSOCIATION: buc_BU175</p> | |
| 23786 </body> | |
| 23787 </notes> | |
| 23788 <annotation> | |
| 23789 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23790 <rdf:Description rdf:about="#_1719db04-e41a-41f9-92e1-ce5d52472bb7"> | |
| 23791 <bqbiol:is> | |
| 23792 <rdf:Bag> | |
| 23793 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.2.1"/> | |
| 23794 </rdf:Bag> | |
| 23795 </bqbiol:is> | |
| 23796 </rdf:Description> | |
| 23797 </rdf:RDF> | |
| 23798 </annotation> | |
| 23799 <fbc:geneProductAssociation> | |
| 23800 <fbc:geneProductRef fbc:geneProduct="buc_BU175"/> | |
| 23801 </fbc:geneProductAssociation> | |
| 23802 <listOfReactants> | |
| 23803 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 23804 <speciesReference constant="true" species="C00163" stoichiometry="1"/> | |
| 23805 </listOfReactants> | |
| 23806 <listOfProducts> | |
| 23807 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 23808 <speciesReference constant="true" species="C02876" stoichiometry="1"/> | |
| 23809 </listOfProducts> | |
| 23810 </reaction> | |
| 23811 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03652" metaid="ead26c3b-3d7e-428e-be2f-c01dfd166fb2" name="L-Glutamine:tRNA(Gln) ligase (AMP-forming)" reversible="true"> | |
| 23812 <notes> | |
| 23813 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23814 <p>SUBSYSTEM: Aminoacyl-tRNA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23815 <p>EC_NUMBER: 6.1.1.18</p> | |
| 23816 <p>GENE_ASSOCIATION: buc_BU415</p> | |
| 23817 </body> | |
| 23818 </notes> | |
| 23819 <annotation> | |
| 23820 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23821 <rdf:Description rdf:about="#ead26c3b-3d7e-428e-be2f-c01dfd166fb2"> | |
| 23822 <bqbiol:is> | |
| 23823 <rdf:Bag> | |
| 23824 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.1.1.18"/> | |
| 23825 </rdf:Bag> | |
| 23826 </bqbiol:is> | |
| 23827 </rdf:Description> | |
| 23828 </rdf:RDF> | |
| 23829 </annotation> | |
| 23830 <fbc:geneProductAssociation> | |
| 23831 <fbc:geneProductRef fbc:geneProduct="buc_BU415"/> | |
| 23832 </fbc:geneProductAssociation> | |
| 23833 <listOfReactants> | |
| 23834 <speciesReference constant="true" species="C00064" stoichiometry="1"/> | |
| 23835 <speciesReference constant="true" species="C01640" stoichiometry="1"/> | |
| 23836 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 23837 </listOfReactants> | |
| 23838 <listOfProducts> | |
| 23839 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 23840 <speciesReference constant="true" species="C02282" stoichiometry="1"/> | |
| 23841 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 23842 </listOfProducts> | |
| 23843 </reaction> | |
| 23844 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03038" metaid="_04b48919-6f2c-4b54-86e7-1737b4a7a2dc" name="L-Alanine:tRNA(Ala) ligase (AMP-forming)" reversible="false"> | |
| 23845 <notes> | |
| 23846 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23847 <p>SUBSYSTEM: Aminoacyl-tRNA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23848 <p>EC_NUMBER: 6.1.1.7</p> | |
| 23849 <p>GENE_ASSOCIATION: buc_BU403</p> | |
| 23850 </body> | |
| 23851 </notes> | |
| 23852 <annotation> | |
| 23853 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23854 <rdf:Description rdf:about="#_04b48919-6f2c-4b54-86e7-1737b4a7a2dc"> | |
| 23855 <bqbiol:is> | |
| 23856 <rdf:Bag> | |
| 23857 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.1.1.7"/> | |
| 23858 </rdf:Bag> | |
| 23859 </bqbiol:is> | |
| 23860 </rdf:Description> | |
| 23861 </rdf:RDF> | |
| 23862 </annotation> | |
| 23863 <fbc:geneProductAssociation> | |
| 23864 <fbc:geneProductRef fbc:geneProduct="buc_BU403"/> | |
| 23865 </fbc:geneProductAssociation> | |
| 23866 <listOfReactants> | |
| 23867 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 23868 <speciesReference constant="true" species="C01635" stoichiometry="1"/> | |
| 23869 <speciesReference constant="true" species="C00041" stoichiometry="1"/> | |
| 23870 </listOfReactants> | |
| 23871 <listOfProducts> | |
| 23872 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 23873 <speciesReference constant="true" species="C00886" stoichiometry="1"/> | |
| 23874 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 23875 </listOfProducts> | |
| 23876 </reaction> | |
| 23877 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R07763" metaid="_15757fb2-228b-4e39-b87b-58beb5ed0cb3" name="R07763" reversible="true"> | |
| 23878 <notes> | |
| 23879 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23880 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23881 <p>EC_NUMBER: 1.1.1.100</p> | |
| 23882 <p>GENE_ASSOCIATION: buc_BU351</p> | |
| 23883 </body> | |
| 23884 </notes> | |
| 23885 <annotation> | |
| 23886 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23887 <rdf:Description rdf:about="#_15757fb2-228b-4e39-b87b-58beb5ed0cb3"> | |
| 23888 <bqbiol:is> | |
| 23889 <rdf:Bag> | |
| 23890 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.100"/> | |
| 23891 </rdf:Bag> | |
| 23892 </bqbiol:is> | |
| 23893 </rdf:Description> | |
| 23894 </rdf:RDF> | |
| 23895 </annotation> | |
| 23896 <fbc:geneProductAssociation> | |
| 23897 <fbc:geneProductRef fbc:geneProduct="buc_BU351"/> | |
| 23898 </fbc:geneProductAssociation> | |
| 23899 <listOfReactants> | |
| 23900 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 23901 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 23902 <speciesReference constant="true" species="C16219" stoichiometry="1"/> | |
| 23903 </listOfReactants> | |
| 23904 <listOfProducts> | |
| 23905 <speciesReference constant="true" species="C16220" stoichiometry="1"/> | |
| 23906 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 23907 </listOfProducts> | |
| 23908 </reaction> | |
| 23909 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02073" metaid="_17574f6b-23d9-496a-af64-436c8c52c085" name="diphosphate:beta-D-fructose-6-phosphate 1-phosphotransferase" reversible="true"> | |
| 23910 <notes> | |
| 23911 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23912 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23913 <p>GENE_ASSOCIATION: buc_BU305</p> | |
| 23914 </body> | |
| 23915 </notes> | |
| 23916 <fbc:geneProductAssociation> | |
| 23917 <fbc:geneProductRef fbc:geneProduct="buc_BU305"/> | |
| 23918 </fbc:geneProductAssociation> | |
| 23919 <listOfReactants> | |
| 23920 <speciesReference constant="true" species="C05345" stoichiometry="1"/> | |
| 23921 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 23922 </listOfReactants> | |
| 23923 <listOfProducts> | |
| 23924 <speciesReference constant="true" species="C05378" stoichiometry="1"/> | |
| 23925 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 23926 </listOfProducts> | |
| 23927 </reaction> | |
| 23928 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R07762" metaid="f50358fd-09de-4d7d-9e2c-c75328e2479d" name="R07762" reversible="true"> | |
| 23929 <notes> | |
| 23930 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23931 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23932 <p>EC_NUMBER: 2.3.1.41</p> | |
| 23933 <p>GENE_ASSOCIATION: buc_BU092</p> | |
| 23934 </body> | |
| 23935 </notes> | |
| 23936 <annotation> | |
| 23937 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23938 <rdf:Description rdf:about="#f50358fd-09de-4d7d-9e2c-c75328e2479d"> | |
| 23939 <bqbiol:is> | |
| 23940 <rdf:Bag> | |
| 23941 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.3.1.41"/> | |
| 23942 </rdf:Bag> | |
| 23943 </bqbiol:is> | |
| 23944 </rdf:Description> | |
| 23945 </rdf:RDF> | |
| 23946 </annotation> | |
| 23947 <fbc:geneProductAssociation> | |
| 23948 <fbc:geneProductRef fbc:geneProduct="buc_BU092"/> | |
| 23949 </fbc:geneProductAssociation> | |
| 23950 <listOfReactants> | |
| 23951 <speciesReference constant="true" species="C05764" stoichiometry="1"/> | |
| 23952 <speciesReference constant="true" species="C01209" stoichiometry="1"/> | |
| 23953 </listOfReactants> | |
| 23954 <listOfProducts> | |
| 23955 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 23956 <speciesReference constant="true" species="C16219" stoichiometry="1"/> | |
| 23957 <speciesReference constant="true" species="C00229" stoichiometry="1"/> | |
| 23958 </listOfProducts> | |
| 23959 </reaction> | |
| 23960 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R07765" metaid="_2b3bdb19-205d-4d0d-883c-dcc03bc658fd" name="octadecanoyl-[acp]:NAD+ trans-2-oxidoreductase" reversible="true"> | |
| 23961 <notes> | |
| 23962 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23963 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23964 <p>EC_NUMBER: 1.3.1.9</p> | |
| 23965 <p>GENE_ASSOCIATION: buc_BU265</p> | |
| 23966 </body> | |
| 23967 </notes> | |
| 23968 <annotation> | |
| 23969 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 23970 <rdf:Description rdf:about="#_2b3bdb19-205d-4d0d-883c-dcc03bc658fd"> | |
| 23971 <bqbiol:is> | |
| 23972 <rdf:Bag> | |
| 23973 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.3.1.9"/> | |
| 23974 </rdf:Bag> | |
| 23975 </bqbiol:is> | |
| 23976 </rdf:Description> | |
| 23977 </rdf:RDF> | |
| 23978 </annotation> | |
| 23979 <fbc:geneProductAssociation> | |
| 23980 <fbc:geneProductRef fbc:geneProduct="buc_BU265"/> | |
| 23981 </fbc:geneProductAssociation> | |
| 23982 <listOfReactants> | |
| 23983 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 23984 <speciesReference constant="true" species="C16221" stoichiometry="1"/> | |
| 23985 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 23986 </listOfReactants> | |
| 23987 <listOfProducts> | |
| 23988 <speciesReference constant="true" species="C04088" stoichiometry="1"/> | |
| 23989 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 23990 </listOfProducts> | |
| 23991 </reaction> | |
| 23992 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R05332" metaid="_273f4f30-f63a-46b0-9a38-e15b0bce1def" name="Acetyl-CoA:D-glucosamine-1-phosphate N-acetyltransferase" reversible="true"> | |
| 23993 <notes> | |
| 23994 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 23995 <p>SUBSYSTEM: Amino sugar and nucleotide sugar metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of nucleotide sugars - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 23996 <p>EC_NUMBER: 2.3.1.157</p> | |
| 23997 <p>GENE_ASSOCIATION: buc_BU027</p> | |
| 23998 </body> | |
| 23999 </notes> | |
| 24000 <annotation> | |
| 24001 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 24002 <rdf:Description rdf:about="#_273f4f30-f63a-46b0-9a38-e15b0bce1def"> | |
| 24003 <bqbiol:is> | |
| 24004 <rdf:Bag> | |
| 24005 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.3.1.157"/> | |
| 24006 </rdf:Bag> | |
| 24007 </bqbiol:is> | |
| 24008 </rdf:Description> | |
| 24009 </rdf:RDF> | |
| 24010 </annotation> | |
| 24011 <fbc:geneProductAssociation> | |
| 24012 <fbc:geneProductRef fbc:geneProduct="buc_BU027"/> | |
| 24013 </fbc:geneProductAssociation> | |
| 24014 <listOfReactants> | |
| 24015 <speciesReference constant="true" species="C00024" stoichiometry="1"/> | |
| 24016 <speciesReference constant="true" species="C06156" stoichiometry="1"/> | |
| 24017 </listOfReactants> | |
| 24018 <listOfProducts> | |
| 24019 <speciesReference constant="true" species="C04501" stoichiometry="1"/> | |
| 24020 <speciesReference constant="true" species="C00010" stoichiometry="1"/> | |
| 24021 </listOfProducts> | |
| 24022 </reaction> | |
| 24023 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04001" metaid="_1b816962-c10d-4adb-9d99-5d27660451b8" name="3-Isopropylmalate hydro-lyase" reversible="true"> | |
| 24024 <notes> | |
| 24025 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24026 <p>SUBSYSTEM: 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Valine, leucine and isoleucine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24027 <p>EC_NUMBER: 4.2.1.33</p> | |
| 24028 <p>GENE_ASSOCIATION: ( buc_BUpL06 ) OR ( buc_BUpL07 )</p> | |
| 24029 </body> | |
| 24030 </notes> | |
| 24031 <annotation> | |
| 24032 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 24033 <rdf:Description rdf:about="#_1b816962-c10d-4adb-9d99-5d27660451b8"> | |
| 24034 <bqbiol:is> | |
| 24035 <rdf:Bag> | |
| 24036 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.2.1.33"/> | |
| 24037 </rdf:Bag> | |
| 24038 </bqbiol:is> | |
| 24039 </rdf:Description> | |
| 24040 </rdf:RDF> | |
| 24041 </annotation> | |
| 24042 <fbc:geneProductAssociation> | |
| 24043 <fbc:or> | |
| 24044 <fbc:geneProductRef fbc:geneProduct="buc_BUpL06"/> | |
| 24045 <fbc:geneProductRef fbc:geneProduct="buc_BUpL07"/> | |
| 24046 </fbc:or> | |
| 24047 </fbc:geneProductAssociation> | |
| 24048 <listOfReactants> | |
| 24049 <speciesReference constant="true" species="C04411" stoichiometry="1"/> | |
| 24050 </listOfReactants> | |
| 24051 <listOfProducts> | |
| 24052 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 24053 <speciesReference constant="true" species="C02631" stoichiometry="1"/> | |
| 24054 </listOfProducts> | |
| 24055 </reaction> | |
| 24056 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04241" metaid="_6aa20b5b-e7c8-4a2e-9d04-4d23f3d473c2" name="tetrahydropteroyl-gamma-polyglutamate:L-glutamate gamma-ligase (ADP-forming)" reversible="true"> | |
| 24057 <notes> | |
| 24058 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24059 <p>SUBSYSTEM: Folate biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24060 <p>EC_NUMBER: 6.3.2.17</p> | |
| 24061 <p>GENE_ASSOCIATION: buc_BU167</p> | |
| 24062 </body> | |
| 24063 </notes> | |
| 24064 <annotation> | |
| 24065 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 24066 <rdf:Description rdf:about="#_6aa20b5b-e7c8-4a2e-9d04-4d23f3d473c2"> | |
| 24067 <bqbiol:is> | |
| 24068 <rdf:Bag> | |
| 24069 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.3.2.17"/> | |
| 24070 </rdf:Bag> | |
| 24071 </bqbiol:is> | |
| 24072 </rdf:Description> | |
| 24073 </rdf:RDF> | |
| 24074 </annotation> | |
| 24075 <fbc:geneProductAssociation> | |
| 24076 <fbc:geneProductRef fbc:geneProduct="buc_BU167"/> | |
| 24077 </fbc:geneProductAssociation> | |
| 24078 <listOfReactants> | |
| 24079 <speciesReference constant="true" species="C00025" stoichiometry="1"/> | |
| 24080 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 24081 <speciesReference constant="true" species="C03541" stoichiometry="1"/> | |
| 24082 </listOfReactants> | |
| 24083 <listOfProducts> | |
| 24084 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 24085 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 24086 <speciesReference constant="true" species="C03541" stoichiometry="1"/> | |
| 24087 </listOfProducts> | |
| 24088 </reaction> | |
| 24089 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03035" metaid="_1e36731a-2156-4508-a83b-9aaeb5176b25" name="ATP:pantetheine-4'-phosphate adenylyltransferase" reversible="true"> | |
| 24090 <notes> | |
| 24091 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24092 <p>SUBSYSTEM: Pantothenate and CoA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24093 <p>EC_NUMBER: 2.7.7.3</p> | |
| 24094 <p>GENE_ASSOCIATION: buc_BU583</p> | |
| 24095 </body> | |
| 24096 </notes> | |
| 24097 <annotation> | |
| 24098 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 24099 <rdf:Description rdf:about="#_1e36731a-2156-4508-a83b-9aaeb5176b25"> | |
| 24100 <bqbiol:is> | |
| 24101 <rdf:Bag> | |
| 24102 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.7.3"/> | |
| 24103 </rdf:Bag> | |
| 24104 </bqbiol:is> | |
| 24105 </rdf:Description> | |
| 24106 </rdf:RDF> | |
| 24107 </annotation> | |
| 24108 <fbc:geneProductAssociation> | |
| 24109 <fbc:geneProductRef fbc:geneProduct="buc_BU583"/> | |
| 24110 </fbc:geneProductAssociation> | |
| 24111 <listOfReactants> | |
| 24112 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 24113 <speciesReference constant="true" species="C01134" stoichiometry="1"/> | |
| 24114 </listOfReactants> | |
| 24115 <listOfProducts> | |
| 24116 <speciesReference constant="true" species="C00882" stoichiometry="1"/> | |
| 24117 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 24118 </listOfProducts> | |
| 24119 </reaction> | |
| 24120 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R05577" metaid="_323f25c5-87c1-49be-a961-25d25dec3f6a" name="L-Aspartate:tRNA(Asp) ligase (AMP-forming)" reversible="false"> | |
| 24121 <notes> | |
| 24122 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24123 <p>SUBSYSTEM: Aminoacyl-tRNA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24124 <p>EC_NUMBER: 6.1.1.12</p> | |
| 24125 <p>GENE_ASSOCIATION: buc_BU316</p> | |
| 24126 </body> | |
| 24127 </notes> | |
| 24128 <annotation> | |
| 24129 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 24130 <rdf:Description rdf:about="#_323f25c5-87c1-49be-a961-25d25dec3f6a"> | |
| 24131 <bqbiol:is> | |
| 24132 <rdf:Bag> | |
| 24133 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.1.1.12"/> | |
| 24134 </rdf:Bag> | |
| 24135 </bqbiol:is> | |
| 24136 </rdf:Description> | |
| 24137 </rdf:RDF> | |
| 24138 </annotation> | |
| 24139 <fbc:geneProductAssociation> | |
| 24140 <fbc:geneProductRef fbc:geneProduct="buc_BU316"/> | |
| 24141 </fbc:geneProductAssociation> | |
| 24142 <listOfReactants> | |
| 24143 <speciesReference constant="true" species="C00049" stoichiometry="1"/> | |
| 24144 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 24145 <speciesReference constant="true" species="C01638" stoichiometry="1"/> | |
| 24146 </listOfReactants> | |
| 24147 <listOfProducts> | |
| 24148 <speciesReference constant="true" species="C02984" stoichiometry="1"/> | |
| 24149 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 24150 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 24151 </listOfProducts> | |
| 24152 </reaction> | |
| 24153 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04125" metaid="d57ba379-98db-4b51-8197-7d986be5f93e" name="[protein]-S8-aminomethyldihydrolipoyllysine:tetrahydrofolate aminomethyltransferase (ammonia-forming)" reversible="true"> | |
| 24154 <notes> | |
| 24155 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24156 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24157 <p>GENE_ASSOCIATION: buc_BU289</p> | |
| 24158 </body> | |
| 24159 </notes> | |
| 24160 <fbc:geneProductAssociation> | |
| 24161 <fbc:geneProductRef fbc:geneProduct="buc_BU289"/> | |
| 24162 </fbc:geneProductAssociation> | |
| 24163 <listOfReactants> | |
| 24164 <speciesReference constant="true" species="C01242" stoichiometry="1"/> | |
| 24165 <speciesReference constant="true" species="C00101" stoichiometry="1"/> | |
| 24166 </listOfReactants> | |
| 24167 <listOfProducts> | |
| 24168 <speciesReference constant="true" species="C00014" stoichiometry="1"/> | |
| 24169 <speciesReference constant="true" species="C00143" stoichiometry="1"/> | |
| 24170 <speciesReference constant="true" species="C02972" stoichiometry="1"/> | |
| 24171 </listOfProducts> | |
| 24172 </reaction> | |
| 24173 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R05578" metaid="_6ee10a26-0813-4305-b825-a4debfe8a962" name="L-glutamate:tRNA(Glu) ligase (AMP-forming)" reversible="true"> | |
| 24174 <notes> | |
| 24175 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24176 <p>SUBSYSTEM: Porphyrin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Aminoacyl-tRNA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24177 <p>EC_NUMBER: 6.1.1.17</p> | |
| 24178 <p>GENE_ASSOCIATION: buc_BU070</p> | |
| 24179 </body> | |
| 24180 </notes> | |
| 24181 <annotation> | |
| 24182 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 24183 <rdf:Description rdf:about="#_6ee10a26-0813-4305-b825-a4debfe8a962"> | |
| 24184 <bqbiol:is> | |
| 24185 <rdf:Bag> | |
| 24186 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.1.1.17"/> | |
| 24187 </rdf:Bag> | |
| 24188 </bqbiol:is> | |
| 24189 </rdf:Description> | |
| 24190 </rdf:RDF> | |
| 24191 </annotation> | |
| 24192 <fbc:geneProductAssociation> | |
| 24193 <fbc:geneProductRef fbc:geneProduct="buc_BU070"/> | |
| 24194 </fbc:geneProductAssociation> | |
| 24195 <listOfReactants> | |
| 24196 <speciesReference constant="true" species="C00025" stoichiometry="1"/> | |
| 24197 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 24198 <speciesReference constant="true" species="C01641" stoichiometry="1"/> | |
| 24199 </listOfReactants> | |
| 24200 <listOfProducts> | |
| 24201 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 24202 <speciesReference constant="true" species="C02987" stoichiometry="1"/> | |
| 24203 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 24204 </listOfProducts> | |
| 24205 </reaction> | |
| 24206 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04365" metaid="c41c6285-310c-4f20-9894-7e8020c12dc1" name="Succinyl-CoA:2,3,4,5-tetrahydropyridine-2,6-dicarboxylate N-succinyltransferase" reversible="true"> | |
| 24207 <notes> | |
| 24208 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24209 <p>SUBSYSTEM: Lysine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24210 <p>EC_NUMBER: 2.3.1.117</p> | |
| 24211 <p>GENE_ASSOCIATION: buc_BU229</p> | |
| 24212 </body> | |
| 24213 </notes> | |
| 24214 <annotation> | |
| 24215 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 24216 <rdf:Description rdf:about="#c41c6285-310c-4f20-9894-7e8020c12dc1"> | |
| 24217 <bqbiol:is> | |
| 24218 <rdf:Bag> | |
| 24219 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.3.1.117"/> | |
| 24220 </rdf:Bag> | |
| 24221 </bqbiol:is> | |
| 24222 </rdf:Description> | |
| 24223 </rdf:RDF> | |
| 24224 </annotation> | |
| 24225 <fbc:geneProductAssociation> | |
| 24226 <fbc:geneProductRef fbc:geneProduct="buc_BU229"/> | |
| 24227 </fbc:geneProductAssociation> | |
| 24228 <listOfReactants> | |
| 24229 <speciesReference constant="true" species="C03972" stoichiometry="1"/> | |
| 24230 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 24231 <speciesReference constant="true" species="C00091" stoichiometry="1"/> | |
| 24232 </listOfReactants> | |
| 24233 <listOfProducts> | |
| 24234 <speciesReference constant="true" species="C04462" stoichiometry="1"/> | |
| 24235 <speciesReference constant="true" species="C00010" stoichiometry="1"/> | |
| 24236 </listOfProducts> | |
| 24237 </reaction> | |
| 24238 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03036" metaid="_2e38b322-f95c-4606-9764-26b62d88ac0f" name="Dephospho-CoA nucleotidohydrolase" reversible="true"> | |
| 24239 <notes> | |
| 24240 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24241 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24242 <p>GENE_ASSOCIATION: buc_BU583</p> | |
| 24243 </body> | |
| 24244 </notes> | |
| 24245 <fbc:geneProductAssociation> | |
| 24246 <fbc:geneProductRef fbc:geneProduct="buc_BU583"/> | |
| 24247 </fbc:geneProductAssociation> | |
| 24248 <listOfReactants> | |
| 24249 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 24250 <speciesReference constant="true" species="C00882" stoichiometry="1"/> | |
| 24251 </listOfReactants> | |
| 24252 <listOfProducts> | |
| 24253 <speciesReference constant="true" species="C01134" stoichiometry="1"/> | |
| 24254 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 24255 </listOfProducts> | |
| 24256 </reaction> | |
| 24257 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03270" metaid="a31e2a65-4bcb-49fe-9cec-f592efe770f4" name="R03270" reversible="false"> | |
| 24258 <notes> | |
| 24259 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24260 <p>SUBSYSTEM: Pyruvate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Citrate cycle (TCA cycle) - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glycolysis / Gluconeogenesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24261 <p>EC_NUMBER: 1.2.4.1</p> | |
| 24262 <p>GENE_ASSOCIATION: buc_BU205</p> | |
| 24263 </body> | |
| 24264 </notes> | |
| 24265 <annotation> | |
| 24266 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 24267 <rdf:Description rdf:about="#a31e2a65-4bcb-49fe-9cec-f592efe770f4"> | |
| 24268 <bqbiol:is> | |
| 24269 <rdf:Bag> | |
| 24270 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.2.4.1"/> | |
| 24271 </rdf:Bag> | |
| 24272 </bqbiol:is> | |
| 24273 </rdf:Description> | |
| 24274 </rdf:RDF> | |
| 24275 </annotation> | |
| 24276 <fbc:geneProductAssociation> | |
| 24277 <fbc:geneProductRef fbc:geneProduct="buc_BU205"/> | |
| 24278 </fbc:geneProductAssociation> | |
| 24279 <listOfReactants> | |
| 24280 <speciesReference constant="true" species="C05125" stoichiometry="1"/> | |
| 24281 <speciesReference constant="true" species="C15972" stoichiometry="1"/> | |
| 24282 </listOfReactants> | |
| 24283 <listOfProducts> | |
| 24284 <speciesReference constant="true" species="C00068" stoichiometry="1"/> | |
| 24285 <speciesReference constant="true" species="C16255" stoichiometry="1"/> | |
| 24286 </listOfProducts> | |
| 24287 </reaction> | |
| 24288 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02060" metaid="a6be0df8-9521-49eb-a79a-681f78ee3c0c" name="D-Glucosamine 1-phosphate 1,6-phosphomutase" reversible="true"> | |
| 24289 <notes> | |
| 24290 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24291 <p>SUBSYSTEM: Amino sugar and nucleotide sugar metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of nucleotide sugars - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24292 <p>EC_NUMBER: 5.4.2.10</p> | |
| 24293 <p>GENE_ASSOCIATION: buc_BU381</p> | |
| 24294 </body> | |
| 24295 </notes> | |
| 24296 <annotation> | |
| 24297 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 24298 <rdf:Description rdf:about="#a6be0df8-9521-49eb-a79a-681f78ee3c0c"> | |
| 24299 <bqbiol:is> | |
| 24300 <rdf:Bag> | |
| 24301 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.4.2.10"/> | |
| 24302 </rdf:Bag> | |
| 24303 </bqbiol:is> | |
| 24304 </rdf:Description> | |
| 24305 </rdf:RDF> | |
| 24306 </annotation> | |
| 24307 <fbc:geneProductAssociation> | |
| 24308 <fbc:geneProductRef fbc:geneProduct="buc_BU381"/> | |
| 24309 </fbc:geneProductAssociation> | |
| 24310 <listOfReactants> | |
| 24311 <speciesReference constant="true" species="C06156" stoichiometry="1"/> | |
| 24312 </listOfReactants> | |
| 24313 <listOfProducts> | |
| 24314 <speciesReference constant="true" species="C00352" stoichiometry="1"/> | |
| 24315 </listOfProducts> | |
| 24316 </reaction> | |
| 24317 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R08628" metaid="_50352665-574f-4171-af31-b08e3b83e2b3" name="2-(3'-methylthio)butylmalate hydroxymutase" reversible="false"> | |
| 24318 <notes> | |
| 24319 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24320 <p>SUBSYSTEM: 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24321 <p>GENE_ASSOCIATION: buc_BUpL06</p> | |
| 24322 </body> | |
| 24323 </notes> | |
| 24324 <fbc:geneProductAssociation> | |
| 24325 <fbc:geneProductRef fbc:geneProduct="buc_BUpL06"/> | |
| 24326 </fbc:geneProductAssociation> | |
| 24327 <listOfReactants> | |
| 24328 <speciesReference constant="true" species="C17218" stoichiometry="1"/> | |
| 24329 </listOfReactants> | |
| 24330 <listOfProducts> | |
| 24331 <speciesReference constant="true" species="C17219" stoichiometry="1"/> | |
| 24332 </listOfProducts> | |
| 24333 </reaction> | |
| 24334 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R08634" metaid="f2beb3df-6682-49ad-b3a5-ebe93c487385" name="2-(3'-methylthio)pentylmalate hydroxymutase" reversible="false"> | |
| 24335 <notes> | |
| 24336 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24337 <p>SUBSYSTEM: 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24338 <p>GENE_ASSOCIATION: buc_BUpL06</p> | |
| 24339 </body> | |
| 24340 </notes> | |
| 24341 <fbc:geneProductAssociation> | |
| 24342 <fbc:geneProductRef fbc:geneProduct="buc_BUpL06"/> | |
| 24343 </fbc:geneProductAssociation> | |
| 24344 <listOfReactants> | |
| 24345 <speciesReference constant="true" species="C17222" stoichiometry="1"/> | |
| 24346 </listOfReactants> | |
| 24347 <listOfProducts> | |
| 24348 <speciesReference constant="true" species="C17223" stoichiometry="1"/> | |
| 24349 </listOfProducts> | |
| 24350 </reaction> | |
| 24351 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02098" metaid="_74a231f1-f462-4283-b7c4-a1176e057156" name="ATP:dUMP phosphotransferase" reversible="true"> | |
| 24352 <notes> | |
| 24353 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24354 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pyrimidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24355 <p>EC_NUMBER: 2.7.4.9</p> | |
| 24356 <p>GENE_ASSOCIATION: buc_BU353</p> | |
| 24357 </body> | |
| 24358 </notes> | |
| 24359 <annotation> | |
| 24360 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 24361 <rdf:Description rdf:about="#_74a231f1-f462-4283-b7c4-a1176e057156"> | |
| 24362 <bqbiol:is> | |
| 24363 <rdf:Bag> | |
| 24364 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.4.9"/> | |
| 24365 </rdf:Bag> | |
| 24366 </bqbiol:is> | |
| 24367 </rdf:Description> | |
| 24368 </rdf:RDF> | |
| 24369 </annotation> | |
| 24370 <fbc:geneProductAssociation> | |
| 24371 <fbc:geneProductRef fbc:geneProduct="buc_BU353"/> | |
| 24372 </fbc:geneProductAssociation> | |
| 24373 <listOfReactants> | |
| 24374 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 24375 <speciesReference constant="true" species="C00365" stoichiometry="1"/> | |
| 24376 </listOfReactants> | |
| 24377 <listOfProducts> | |
| 24378 <speciesReference constant="true" species="C01346" stoichiometry="1"/> | |
| 24379 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 24380 </listOfProducts> | |
| 24381 </reaction> | |
| 24382 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04394" metaid="_169cd5bc-0bee-4906-9ac5-4826cc902391" name="protein-N(pi)-phosphohistidine:salicin 6-phosphotransferase" reversible="false"> | |
| 24383 <notes> | |
| 24384 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24385 <p>SUBSYSTEM: Glycolysis / Gluconeogenesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24386 <p>GENE_ASSOCIATION: buc_BU063</p> | |
| 24387 </body> | |
| 24388 </notes> | |
| 24389 <fbc:geneProductAssociation> | |
| 24390 <fbc:geneProductRef fbc:geneProduct="buc_BU063"/> | |
| 24391 </fbc:geneProductAssociation> | |
| 24392 <listOfReactants> | |
| 24393 <speciesReference constant="true" species="C04261" stoichiometry="1"/> | |
| 24394 <speciesReference constant="true" species="C01451" stoichiometry="1"/> | |
| 24395 </listOfReactants> | |
| 24396 <listOfProducts> | |
| 24397 <speciesReference constant="true" species="C06188" stoichiometry="1"/> | |
| 24398 <speciesReference constant="true" species="C00615" stoichiometry="1"/> | |
| 24399 </listOfProducts> | |
| 24400 </reaction> | |
| 24401 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04037" metaid="_2bd0dbf3-a052-4fb8-8f7f-d176500f7918" name="1-(5-phospho-D-ribosyl)-AMP 1,6-hydrolase" reversible="true"> | |
| 24402 <notes> | |
| 24403 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24404 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Histidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24405 <p>EC_NUMBER: 3.5.4.19</p> | |
| 24406 <p>GENE_ASSOCIATION: buc_BU106</p> | |
| 24407 </body> | |
| 24408 </notes> | |
| 24409 <annotation> | |
| 24410 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 24411 <rdf:Description rdf:about="#_2bd0dbf3-a052-4fb8-8f7f-d176500f7918"> | |
| 24412 <bqbiol:is> | |
| 24413 <rdf:Bag> | |
| 24414 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.5.4.19"/> | |
| 24415 </rdf:Bag> | |
| 24416 </bqbiol:is> | |
| 24417 </rdf:Description> | |
| 24418 </rdf:RDF> | |
| 24419 </annotation> | |
| 24420 <fbc:geneProductAssociation> | |
| 24421 <fbc:geneProductRef fbc:geneProduct="buc_BU106"/> | |
| 24422 </fbc:geneProductAssociation> | |
| 24423 <listOfReactants> | |
| 24424 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 24425 <speciesReference constant="true" species="C02741" stoichiometry="1"/> | |
| 24426 </listOfReactants> | |
| 24427 <listOfProducts> | |
| 24428 <speciesReference constant="true" species="C04896" stoichiometry="1"/> | |
| 24429 </listOfProducts> | |
| 24430 </reaction> | |
| 24431 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04035" metaid="_738b8870-1670-442c-9950-ade5021365e9" name="Phosphoribosyl-ATP pyrophosphohydrolase" reversible="true"> | |
| 24432 <notes> | |
| 24433 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24434 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Histidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24435 <p>EC_NUMBER: 3.6.1.31</p> | |
| 24436 <p>GENE_ASSOCIATION: buc_BU106</p> | |
| 24437 </body> | |
| 24438 </notes> | |
| 24439 <annotation> | |
| 24440 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 24441 <rdf:Description rdf:about="#_738b8870-1670-442c-9950-ade5021365e9"> | |
| 24442 <bqbiol:is> | |
| 24443 <rdf:Bag> | |
| 24444 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.6.1.31"/> | |
| 24445 </rdf:Bag> | |
| 24446 </bqbiol:is> | |
| 24447 </rdf:Description> | |
| 24448 </rdf:RDF> | |
| 24449 </annotation> | |
| 24450 <fbc:geneProductAssociation> | |
| 24451 <fbc:geneProductRef fbc:geneProduct="buc_BU106"/> | |
| 24452 </fbc:geneProductAssociation> | |
| 24453 <listOfReactants> | |
| 24454 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 24455 <speciesReference constant="true" species="C02739" stoichiometry="1"/> | |
| 24456 </listOfReactants> | |
| 24457 <listOfProducts> | |
| 24458 <speciesReference constant="true" species="C02741" stoichiometry="1"/> | |
| 24459 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 24460 </listOfProducts> | |
| 24461 </reaction> | |
| 24462 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02090" metaid="_71002754-65d6-4565-80df-19780b0e4c0f" name="ATP:dGMP phosphotransferase" reversible="true"> | |
| 24463 <notes> | |
| 24464 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24465 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24466 <p>EC_NUMBER: 2.7.4.8</p> | |
| 24467 <p>GENE_ASSOCIATION: buc_BU434</p> | |
| 24468 </body> | |
| 24469 </notes> | |
| 24470 <annotation> | |
| 24471 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 24472 <rdf:Description rdf:about="#_71002754-65d6-4565-80df-19780b0e4c0f"> | |
| 24473 <bqbiol:is> | |
| 24474 <rdf:Bag> | |
| 24475 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.4.8"/> | |
| 24476 </rdf:Bag> | |
| 24477 </bqbiol:is> | |
| 24478 </rdf:Description> | |
| 24479 </rdf:RDF> | |
| 24480 </annotation> | |
| 24481 <fbc:geneProductAssociation> | |
| 24482 <fbc:geneProductRef fbc:geneProduct="buc_BU434"/> | |
| 24483 </fbc:geneProductAssociation> | |
| 24484 <listOfReactants> | |
| 24485 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 24486 <speciesReference constant="true" species="C00362" stoichiometry="1"/> | |
| 24487 </listOfReactants> | |
| 24488 <listOfProducts> | |
| 24489 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 24490 <speciesReference constant="true" species="C00361" stoichiometry="1"/> | |
| 24491 </listOfProducts> | |
| 24492 </reaction> | |
| 24493 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02092" metaid="a4edadef-0028-4e32-a4b4-71116be278d3" name="dTDP phosphohydrolase" reversible="true"> | |
| 24494 <notes> | |
| 24495 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24496 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24497 <p>GENE_ASSOCIATION: buc_BU353</p> | |
| 24498 </body> | |
| 24499 </notes> | |
| 24500 <fbc:geneProductAssociation> | |
| 24501 <fbc:geneProductRef fbc:geneProduct="buc_BU353"/> | |
| 24502 </fbc:geneProductAssociation> | |
| 24503 <listOfReactants> | |
| 24504 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 24505 <speciesReference constant="true" species="C00363" stoichiometry="1"/> | |
| 24506 </listOfReactants> | |
| 24507 <listOfProducts> | |
| 24508 <speciesReference constant="true" species="C00364" stoichiometry="1"/> | |
| 24509 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 24510 </listOfProducts> | |
| 24511 </reaction> | |
| 24512 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02094" metaid="f8f8cff9-988d-45b9-a5fb-9e85955a5a1b" name="ATP:dTMP phosphotransferase" reversible="true"> | |
| 24513 <notes> | |
| 24514 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24515 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pyrimidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24516 <p>EC_NUMBER: 2.7.4.9</p> | |
| 24517 <p>GENE_ASSOCIATION: buc_BU353</p> | |
| 24518 </body> | |
| 24519 </notes> | |
| 24520 <annotation> | |
| 24521 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 24522 <rdf:Description rdf:about="#f8f8cff9-988d-45b9-a5fb-9e85955a5a1b"> | |
| 24523 <bqbiol:is> | |
| 24524 <rdf:Bag> | |
| 24525 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.4.9"/> | |
| 24526 </rdf:Bag> | |
| 24527 </bqbiol:is> | |
| 24528 </rdf:Description> | |
| 24529 </rdf:RDF> | |
| 24530 </annotation> | |
| 24531 <fbc:geneProductAssociation> | |
| 24532 <fbc:geneProductRef fbc:geneProduct="buc_BU353"/> | |
| 24533 </fbc:geneProductAssociation> | |
| 24534 <listOfReactants> | |
| 24535 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 24536 <speciesReference constant="true" species="C00364" stoichiometry="1"/> | |
| 24537 </listOfReactants> | |
| 24538 <listOfProducts> | |
| 24539 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 24540 <speciesReference constant="true" species="C00363" stoichiometry="1"/> | |
| 24541 </listOfProducts> | |
| 24542 </reaction> | |
| 24543 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03182" metaid="e883c1e3-14d0-4040-9698-a8641bc39cfc" name="7,8-Diaminononanoate:carbon-dioxide cyclo-ligase" reversible="true"> | |
| 24544 <notes> | |
| 24545 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24546 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biotin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24547 <p>EC_NUMBER: 6.3.3.3</p> | |
| 24548 <p>GENE_ASSOCIATION: buc_BU290</p> | |
| 24549 </body> | |
| 24550 </notes> | |
| 24551 <annotation> | |
| 24552 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 24553 <rdf:Description rdf:about="#e883c1e3-14d0-4040-9698-a8641bc39cfc"> | |
| 24554 <bqbiol:is> | |
| 24555 <rdf:Bag> | |
| 24556 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.3.3.3"/> | |
| 24557 </rdf:Bag> | |
| 24558 </bqbiol:is> | |
| 24559 </rdf:Description> | |
| 24560 </rdf:RDF> | |
| 24561 </annotation> | |
| 24562 <fbc:geneProductAssociation> | |
| 24563 <fbc:geneProductRef fbc:geneProduct="buc_BU290"/> | |
| 24564 </fbc:geneProductAssociation> | |
| 24565 <listOfReactants> | |
| 24566 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 24567 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 24568 <speciesReference constant="true" species="C01037" stoichiometry="1"/> | |
| 24569 </listOfReactants> | |
| 24570 <listOfProducts> | |
| 24571 <speciesReference constant="true" species="C01909" stoichiometry="1"/> | |
| 24572 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 24573 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 24574 </listOfProducts> | |
| 24575 </reaction> | |
| 24576 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R07411" metaid="fe8b7ed8-42a4-4d45-aae7-0da4820d0ac6" name="(2E,6E)-farnesyl-diphosphate:protoheme IX farnesyltranstransferase" reversible="true"> | |
| 24577 <notes> | |
| 24578 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24579 <p>SUBSYSTEM: Porphyrin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24580 <p>EC_NUMBER: 2.5.1.141</p> | |
| 24581 <p>GENE_ASSOCIATION: buc_BU468</p> | |
| 24582 </body> | |
| 24583 </notes> | |
| 24584 <annotation> | |
| 24585 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 24586 <rdf:Description rdf:about="#fe8b7ed8-42a4-4d45-aae7-0da4820d0ac6"> | |
| 24587 <bqbiol:is> | |
| 24588 <rdf:Bag> | |
| 24589 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.5.1.141"/> | |
| 24590 </rdf:Bag> | |
| 24591 </bqbiol:is> | |
| 24592 </rdf:Description> | |
| 24593 </rdf:RDF> | |
| 24594 </annotation> | |
| 24595 <fbc:geneProductAssociation> | |
| 24596 <fbc:geneProductRef fbc:geneProduct="buc_BU468"/> | |
| 24597 </fbc:geneProductAssociation> | |
| 24598 <listOfReactants> | |
| 24599 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 24600 <speciesReference constant="true" species="C00032" stoichiometry="1"/> | |
| 24601 <speciesReference constant="true" species="C00448" stoichiometry="1"/> | |
| 24602 </listOfReactants> | |
| 24603 <listOfProducts> | |
| 24604 <speciesReference constant="true" species="C15672" stoichiometry="1"/> | |
| 24605 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 24606 </listOfProducts> | |
| 24607 </reaction> | |
| 24608 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R08624" metaid="f6a67f12-e602-424b-aec6-1942553e2a6d" name="2-(3'-methylthio)propylmalate hydroxymutase" reversible="false"> | |
| 24609 <notes> | |
| 24610 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24611 <p>SUBSYSTEM: 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24612 <p>GENE_ASSOCIATION: buc_BUpL06</p> | |
| 24613 </body> | |
| 24614 </notes> | |
| 24615 <fbc:geneProductAssociation> | |
| 24616 <fbc:geneProductRef fbc:geneProduct="buc_BUpL06"/> | |
| 24617 </fbc:geneProductAssociation> | |
| 24618 <listOfReactants> | |
| 24619 <speciesReference constant="true" species="C17214" stoichiometry="1"/> | |
| 24620 </listOfReactants> | |
| 24621 <listOfProducts> | |
| 24622 <speciesReference constant="true" species="C17215" stoichiometry="1"/> | |
| 24623 </listOfProducts> | |
| 24624 </reaction> | |
| 24625 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R06447" metaid="_40ea1a7b-06db-4df1-a661-87239a228e57" name="(2E,6E)-farnesyl-diphosphate:isopentenyl-diphosphate cistransferase (adding 8 isopentenyl units)" reversible="true"> | |
| 24626 <notes> | |
| 24627 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24628 <p>SUBSYSTEM: Peptidoglycan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Terpenoid backbone biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24629 <p>EC_NUMBER: 2.5.1.31</p> | |
| 24630 <p>GENE_ASSOCIATION: buc_BU236</p> | |
| 24631 </body> | |
| 24632 </notes> | |
| 24633 <annotation> | |
| 24634 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 24635 <rdf:Description rdf:about="#_40ea1a7b-06db-4df1-a661-87239a228e57"> | |
| 24636 <bqbiol:is> | |
| 24637 <rdf:Bag> | |
| 24638 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.5.1.31"/> | |
| 24639 </rdf:Bag> | |
| 24640 </bqbiol:is> | |
| 24641 </rdf:Description> | |
| 24642 </rdf:RDF> | |
| 24643 </annotation> | |
| 24644 <fbc:geneProductAssociation> | |
| 24645 <fbc:geneProductRef fbc:geneProduct="buc_BU236"/> | |
| 24646 </fbc:geneProductAssociation> | |
| 24647 <listOfReactants> | |
| 24648 <speciesReference constant="true" species="C00448" stoichiometry="1"/> | |
| 24649 <speciesReference constant="true" species="C00129" stoichiometry="8"/> | |
| 24650 </listOfReactants> | |
| 24651 <listOfProducts> | |
| 24652 <speciesReference constant="true" species="C00013" stoichiometry="8"/> | |
| 24653 <speciesReference constant="true" species="C04574" stoichiometry="1"/> | |
| 24654 </listOfProducts> | |
| 24655 </reaction> | |
| 24656 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R08620" metaid="_36eea690-ff5d-4cc3-9c72-3a439d384fad" name="2-(2'-methylthio)ethylmalate hydroxymutase" reversible="true"> | |
| 24657 <notes> | |
| 24658 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24659 <p>SUBSYSTEM: 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24660 <p>GENE_ASSOCIATION: buc_BUpL06</p> | |
| 24661 </body> | |
| 24662 </notes> | |
| 24663 <fbc:geneProductAssociation> | |
| 24664 <fbc:geneProductRef fbc:geneProduct="buc_BUpL06"/> | |
| 24665 </fbc:geneProductAssociation> | |
| 24666 <listOfReactants> | |
| 24667 <speciesReference constant="true" species="C17210" stoichiometry="1"/> | |
| 24668 </listOfReactants> | |
| 24669 <listOfProducts> | |
| 24670 <speciesReference constant="true" species="C17212" stoichiometry="1"/> | |
| 24671 </listOfProducts> | |
| 24672 </reaction> | |
| 24673 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R09830" metaid="d8035b53-5a4f-4c95-bd27-453b10dee09c" name="L-Tyrosine:NAD+ oxidoreductase (deaminating)" reversible="true"> | |
| 24674 <notes> | |
| 24675 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24676 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24677 <p>GENE_ASSOCIATION: buc_BU101</p> | |
| 24678 </body> | |
| 24679 </notes> | |
| 24680 <fbc:geneProductAssociation> | |
| 24681 <fbc:geneProductRef fbc:geneProduct="buc_BU101"/> | |
| 24682 </fbc:geneProductAssociation> | |
| 24683 <listOfReactants> | |
| 24684 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 24685 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 24686 <speciesReference constant="true" species="C00082" stoichiometry="1"/> | |
| 24687 </listOfReactants> | |
| 24688 <listOfProducts> | |
| 24689 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 24690 <speciesReference constant="true" species="C00014" stoichiometry="1"/> | |
| 24691 <speciesReference constant="true" species="C01179" stoichiometry="1"/> | |
| 24692 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 24693 </listOfProducts> | |
| 24694 </reaction> | |
| 24695 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03237" metaid="a75183ef-b2fc-47ed-bb11-0bcab167ae58" name="CTP:D-tagatose 6-phosphate 1-phosphotransferase" reversible="true"> | |
| 24696 <notes> | |
| 24697 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24698 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24699 <p>EC_NUMBER: 2.7.1.11</p> | |
| 24700 <p>GENE_ASSOCIATION: buc_BU305</p> | |
| 24701 </body> | |
| 24702 </notes> | |
| 24703 <annotation> | |
| 24704 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 24705 <rdf:Description rdf:about="#a75183ef-b2fc-47ed-bb11-0bcab167ae58"> | |
| 24706 <bqbiol:is> | |
| 24707 <rdf:Bag> | |
| 24708 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.11"/> | |
| 24709 </rdf:Bag> | |
| 24710 </bqbiol:is> | |
| 24711 </rdf:Description> | |
| 24712 </rdf:RDF> | |
| 24713 </annotation> | |
| 24714 <fbc:geneProductAssociation> | |
| 24715 <fbc:geneProductRef fbc:geneProduct="buc_BU305"/> | |
| 24716 </fbc:geneProductAssociation> | |
| 24717 <listOfReactants> | |
| 24718 <speciesReference constant="true" species="C00063" stoichiometry="1"/> | |
| 24719 <speciesReference constant="true" species="C01097" stoichiometry="1"/> | |
| 24720 </listOfReactants> | |
| 24721 <listOfProducts> | |
| 24722 <speciesReference constant="true" species="C00112" stoichiometry="1"/> | |
| 24723 <speciesReference constant="true" species="C03785" stoichiometry="1"/> | |
| 24724 </listOfProducts> | |
| 24725 </reaction> | |
| 24726 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02147" metaid="_15adfbfc-0328-4f19-a76d-614a71af6d13" name="guanosine:phosphate alpha-D-ribosyltransferase" reversible="true"> | |
| 24727 <notes> | |
| 24728 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24729 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24730 <p>EC_NUMBER: 2.4.2.1</p> | |
| 24731 <p>GENE_ASSOCIATION: buc_BU541</p> | |
| 24732 </body> | |
| 24733 </notes> | |
| 24734 <annotation> | |
| 24735 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 24736 <rdf:Description rdf:about="#_15adfbfc-0328-4f19-a76d-614a71af6d13"> | |
| 24737 <bqbiol:is> | |
| 24738 <rdf:Bag> | |
| 24739 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.4.2.1"/> | |
| 24740 </rdf:Bag> | |
| 24741 </bqbiol:is> | |
| 24742 </rdf:Description> | |
| 24743 </rdf:RDF> | |
| 24744 </annotation> | |
| 24745 <fbc:geneProductAssociation> | |
| 24746 <fbc:geneProductRef fbc:geneProduct="buc_BU541"/> | |
| 24747 </fbc:geneProductAssociation> | |
| 24748 <listOfReactants> | |
| 24749 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 24750 <speciesReference constant="true" species="C00387" stoichiometry="1"/> | |
| 24751 </listOfReactants> | |
| 24752 <listOfProducts> | |
| 24753 <speciesReference constant="true" species="C00620" stoichiometry="1"/> | |
| 24754 <speciesReference constant="true" species="C00242" stoichiometry="1"/> | |
| 24755 </listOfProducts> | |
| 24756 </reaction> | |
| 24757 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03236" metaid="e7da83aa-f95e-4961-985f-ded3d32c9ada" name="ATP:D-tagatose-6-phosphate 1-phosphotransferase" reversible="true"> | |
| 24758 <notes> | |
| 24759 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24760 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24761 <p>EC_NUMBER: 2.7.1.11</p> | |
| 24762 <p>GENE_ASSOCIATION: buc_BU305</p> | |
| 24763 </body> | |
| 24764 </notes> | |
| 24765 <annotation> | |
| 24766 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 24767 <rdf:Description rdf:about="#e7da83aa-f95e-4961-985f-ded3d32c9ada"> | |
| 24768 <bqbiol:is> | |
| 24769 <rdf:Bag> | |
| 24770 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.11"/> | |
| 24771 </rdf:Bag> | |
| 24772 </bqbiol:is> | |
| 24773 </rdf:Description> | |
| 24774 </rdf:RDF> | |
| 24775 </annotation> | |
| 24776 <fbc:geneProductAssociation> | |
| 24777 <fbc:geneProductRef fbc:geneProduct="buc_BU305"/> | |
| 24778 </fbc:geneProductAssociation> | |
| 24779 <listOfReactants> | |
| 24780 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 24781 <speciesReference constant="true" species="C01097" stoichiometry="1"/> | |
| 24782 </listOfReactants> | |
| 24783 <listOfProducts> | |
| 24784 <speciesReference constant="true" species="C03785" stoichiometry="1"/> | |
| 24785 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 24786 </listOfProducts> | |
| 24787 </reaction> | |
| 24788 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04325" metaid="_3d369ccb-bd1b-450d-9905-b5ee6924fd3a" name="10-formyltetrahydrofolate:5'-phosphoribosylglycinamide formyltransferase" reversible="true"> | |
| 24789 <notes> | |
| 24790 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24791 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24792 <p>GENE_ASSOCIATION: ( buc_BU031 ) OR ( buc_BU497 )</p> | |
| 24793 </body> | |
| 24794 </notes> | |
| 24795 <fbc:geneProductAssociation> | |
| 24796 <fbc:or> | |
| 24797 <fbc:geneProductRef fbc:geneProduct="buc_BU031"/> | |
| 24798 <fbc:geneProductRef fbc:geneProduct="buc_BU497"/> | |
| 24799 </fbc:or> | |
| 24800 </fbc:geneProductAssociation> | |
| 24801 <listOfReactants> | |
| 24802 <speciesReference constant="true" species="C03838" stoichiometry="1"/> | |
| 24803 <speciesReference constant="true" species="C00234" stoichiometry="1"/> | |
| 24804 </listOfReactants> | |
| 24805 <listOfProducts> | |
| 24806 <speciesReference constant="true" species="C04376" stoichiometry="1"/> | |
| 24807 <speciesReference constant="true" species="C00101" stoichiometry="1"/> | |
| 24808 </listOfProducts> | |
| 24809 </reaction> | |
| 24810 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03239" metaid="ff35837d-d4ee-4ab4-b259-85195accbfcf" name="ITP:D-tagatose 6-phosphate 1-phosphotransferase" reversible="true"> | |
| 24811 <notes> | |
| 24812 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24813 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24814 <p>EC_NUMBER: 2.7.1.11</p> | |
| 24815 <p>GENE_ASSOCIATION: buc_BU305</p> | |
| 24816 </body> | |
| 24817 </notes> | |
| 24818 <annotation> | |
| 24819 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 24820 <rdf:Description rdf:about="#ff35837d-d4ee-4ab4-b259-85195accbfcf"> | |
| 24821 <bqbiol:is> | |
| 24822 <rdf:Bag> | |
| 24823 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.11"/> | |
| 24824 </rdf:Bag> | |
| 24825 </bqbiol:is> | |
| 24826 </rdf:Description> | |
| 24827 </rdf:RDF> | |
| 24828 </annotation> | |
| 24829 <fbc:geneProductAssociation> | |
| 24830 <fbc:geneProductRef fbc:geneProduct="buc_BU305"/> | |
| 24831 </fbc:geneProductAssociation> | |
| 24832 <listOfReactants> | |
| 24833 <speciesReference constant="true" species="C00081" stoichiometry="1"/> | |
| 24834 <speciesReference constant="true" species="C01097" stoichiometry="1"/> | |
| 24835 </listOfReactants> | |
| 24836 <listOfProducts> | |
| 24837 <speciesReference constant="true" species="C03785" stoichiometry="1"/> | |
| 24838 <speciesReference constant="true" species="C00104" stoichiometry="1"/> | |
| 24839 </listOfProducts> | |
| 24840 </reaction> | |
| 24841 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03238" metaid="b264623f-e084-4001-a34b-24f5d32463da" name="UTP:D-tagatose 6-phosphate 1-phosphotransferase" reversible="true"> | |
| 24842 <notes> | |
| 24843 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24844 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24845 <p>EC_NUMBER: 2.7.1.11</p> | |
| 24846 <p>GENE_ASSOCIATION: buc_BU305</p> | |
| 24847 </body> | |
| 24848 </notes> | |
| 24849 <annotation> | |
| 24850 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 24851 <rdf:Description rdf:about="#b264623f-e084-4001-a34b-24f5d32463da"> | |
| 24852 <bqbiol:is> | |
| 24853 <rdf:Bag> | |
| 24854 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.11"/> | |
| 24855 </rdf:Bag> | |
| 24856 </bqbiol:is> | |
| 24857 </rdf:Description> | |
| 24858 </rdf:RDF> | |
| 24859 </annotation> | |
| 24860 <fbc:geneProductAssociation> | |
| 24861 <fbc:geneProductRef fbc:geneProduct="buc_BU305"/> | |
| 24862 </fbc:geneProductAssociation> | |
| 24863 <listOfReactants> | |
| 24864 <speciesReference constant="true" species="C00075" stoichiometry="1"/> | |
| 24865 <speciesReference constant="true" species="C01097" stoichiometry="1"/> | |
| 24866 </listOfReactants> | |
| 24867 <listOfProducts> | |
| 24868 <speciesReference constant="true" species="C03785" stoichiometry="1"/> | |
| 24869 <speciesReference constant="true" species="C00015" stoichiometry="1"/> | |
| 24870 </listOfProducts> | |
| 24871 </reaction> | |
| 24872 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01061" metaid="_0f15a449-02b9-423d-825a-b1196cb89018" name="D-glyceraldehyde-3-phosphate:NAD+ oxidoreductase (phosphorylating)" reversible="true"> | |
| 24873 <notes> | |
| 24874 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24875 <p>SUBSYSTEM: Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glycolysis / Gluconeogenesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24876 <p>EC_NUMBER: 1.2.1.12</p> | |
| 24877 <p>GENE_ASSOCIATION: buc_BU298</p> | |
| 24878 </body> | |
| 24879 </notes> | |
| 24880 <annotation> | |
| 24881 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 24882 <rdf:Description rdf:about="#_0f15a449-02b9-423d-825a-b1196cb89018"> | |
| 24883 <bqbiol:is> | |
| 24884 <rdf:Bag> | |
| 24885 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.2.1.12"/> | |
| 24886 </rdf:Bag> | |
| 24887 </bqbiol:is> | |
| 24888 </rdf:Description> | |
| 24889 </rdf:RDF> | |
| 24890 </annotation> | |
| 24891 <fbc:geneProductAssociation> | |
| 24892 <fbc:geneProductRef fbc:geneProduct="buc_BU298"/> | |
| 24893 </fbc:geneProductAssociation> | |
| 24894 <listOfReactants> | |
| 24895 <speciesReference constant="true" species="C00118" stoichiometry="1"/> | |
| 24896 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 24897 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 24898 </listOfReactants> | |
| 24899 <listOfProducts> | |
| 24900 <speciesReference constant="true" species="C00236" stoichiometry="1"/> | |
| 24901 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 24902 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 24903 </listOfProducts> | |
| 24904 </reaction> | |
| 24905 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R05662" metaid="ef24eb21-9018-46ae-8aee-6edc522eefaf" name="UDP-N-acetyl-D-glucosamine:N-acetyl-alpha-D-muramyl(oyl-L-Ala-gamma-D-Glu-L-Lys-D-Ala-D-Ala)-diphosphoundecaprenol 4-beta-N-acetylglucosaminlytransferase" reversible="true"> | |
| 24906 <notes> | |
| 24907 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24908 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Peptidoglycan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24909 <p>EC_NUMBER: 2.4.1.227</p> | |
| 24910 <p>GENE_ASSOCIATION: buc_BU216</p> | |
| 24911 </body> | |
| 24912 </notes> | |
| 24913 <annotation> | |
| 24914 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 24915 <rdf:Description rdf:about="#ef24eb21-9018-46ae-8aee-6edc522eefaf"> | |
| 24916 <bqbiol:is> | |
| 24917 <rdf:Bag> | |
| 24918 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.4.1.227"/> | |
| 24919 </rdf:Bag> | |
| 24920 </bqbiol:is> | |
| 24921 </rdf:Description> | |
| 24922 </rdf:RDF> | |
| 24923 </annotation> | |
| 24924 <fbc:geneProductAssociation> | |
| 24925 <fbc:geneProductRef fbc:geneProduct="buc_BU216"/> | |
| 24926 </fbc:geneProductAssociation> | |
| 24927 <listOfReactants> | |
| 24928 <speciesReference constant="true" species="C04851" stoichiometry="1"/> | |
| 24929 <speciesReference constant="true" species="C00043" stoichiometry="1"/> | |
| 24930 </listOfReactants> | |
| 24931 <listOfProducts> | |
| 24932 <speciesReference constant="true" species="C00015" stoichiometry="1"/> | |
| 24933 <speciesReference constant="true" species="C05893" stoichiometry="1"/> | |
| 24934 </listOfProducts> | |
| 24935 </reaction> | |
| 24936 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04573" metaid="_9e482842-96e3-44b4-b1d0-697acbc0e646" name="UDP-N-acetylmuramoyl-L-alanyl-D-glutamyl-L-lysine:alanyl-D-alanine ligase (ADP-forming)" reversible="true"> | |
| 24937 <notes> | |
| 24938 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24939 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Peptidoglycan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24940 <p>EC_NUMBER: 6.3.2.10</p> | |
| 24941 <p>GENE_ASSOCIATION: buc_BU220</p> | |
| 24942 </body> | |
| 24943 </notes> | |
| 24944 <annotation> | |
| 24945 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 24946 <rdf:Description rdf:about="#_9e482842-96e3-44b4-b1d0-697acbc0e646"> | |
| 24947 <bqbiol:is> | |
| 24948 <rdf:Bag> | |
| 24949 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.3.2.10"/> | |
| 24950 </rdf:Bag> | |
| 24951 </bqbiol:is> | |
| 24952 </rdf:Description> | |
| 24953 </rdf:RDF> | |
| 24954 </annotation> | |
| 24955 <fbc:geneProductAssociation> | |
| 24956 <fbc:geneProductRef fbc:geneProduct="buc_BU220"/> | |
| 24957 </fbc:geneProductAssociation> | |
| 24958 <listOfReactants> | |
| 24959 <speciesReference constant="true" species="C00993" stoichiometry="1"/> | |
| 24960 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 24961 <speciesReference constant="true" species="C05892" stoichiometry="1"/> | |
| 24962 </listOfReactants> | |
| 24963 <listOfProducts> | |
| 24964 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 24965 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 24966 <speciesReference constant="true" species="C04702" stoichiometry="1"/> | |
| 24967 </listOfProducts> | |
| 24968 </reaction> | |
| 24969 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01063" metaid="f422bd23-f733-4249-8537-54e9da9268ca" name="D-glyceraldehyde-3-phosphate:NADP+ oxidoreductase (phosphorylating)" reversible="true"> | |
| 24970 <notes> | |
| 24971 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24972 <p>SUBSYSTEM: Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24973 <p>GENE_ASSOCIATION: buc_BU298</p> | |
| 24974 </body> | |
| 24975 </notes> | |
| 24976 <fbc:geneProductAssociation> | |
| 24977 <fbc:geneProductRef fbc:geneProduct="buc_BU298"/> | |
| 24978 </fbc:geneProductAssociation> | |
| 24979 <listOfReactants> | |
| 24980 <speciesReference constant="true" species="C00118" stoichiometry="1"/> | |
| 24981 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 24982 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 24983 </listOfReactants> | |
| 24984 <listOfProducts> | |
| 24985 <speciesReference constant="true" species="C00236" stoichiometry="1"/> | |
| 24986 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 24987 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 24988 </listOfProducts> | |
| 24989 </reaction> | |
| 24990 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01185" metaid="de2dc886-7bb1-4915-ba2b-6fc070612d0c" name="1D-myo-inositol 1-phosphate phosphohydrolase" reversible="true"> | |
| 24991 <notes> | |
| 24992 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 24993 <p>SUBSYSTEM: Inositol phosphate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 24994 <p>EC_NUMBER: 3.1.3.25</p> | |
| 24995 <p>GENE_ASSOCIATION: buc_BU285</p> | |
| 24996 </body> | |
| 24997 </notes> | |
| 24998 <annotation> | |
| 24999 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25000 <rdf:Description rdf:about="#de2dc886-7bb1-4915-ba2b-6fc070612d0c"> | |
| 25001 <bqbiol:is> | |
| 25002 <rdf:Bag> | |
| 25003 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.1.3.25"/> | |
| 25004 </rdf:Bag> | |
| 25005 </bqbiol:is> | |
| 25006 </rdf:Description> | |
| 25007 </rdf:RDF> | |
| 25008 </annotation> | |
| 25009 <fbc:geneProductAssociation> | |
| 25010 <fbc:geneProductRef fbc:geneProduct="buc_BU285"/> | |
| 25011 </fbc:geneProductAssociation> | |
| 25012 <listOfReactants> | |
| 25013 <speciesReference constant="true" species="C01177" stoichiometry="1"/> | |
| 25014 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 25015 </listOfReactants> | |
| 25016 <listOfProducts> | |
| 25017 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 25018 <speciesReference constant="true" species="C00137" stoichiometry="1"/> | |
| 25019 </listOfProducts> | |
| 25020 </reaction> | |
| 25021 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01186" metaid="_1ae89167-745b-4c67-9b7c-6e95c8b92ae4" name="1D-myo-inositol 4-phosphate phosphohydrolase" reversible="true"> | |
| 25022 <notes> | |
| 25023 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25024 <p>SUBSYSTEM: Inositol phosphate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25025 <p>EC_NUMBER: 3.1.3.25</p> | |
| 25026 <p>GENE_ASSOCIATION: buc_BU285</p> | |
| 25027 </body> | |
| 25028 </notes> | |
| 25029 <annotation> | |
| 25030 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25031 <rdf:Description rdf:about="#_1ae89167-745b-4c67-9b7c-6e95c8b92ae4"> | |
| 25032 <bqbiol:is> | |
| 25033 <rdf:Bag> | |
| 25034 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.1.3.25"/> | |
| 25035 </rdf:Bag> | |
| 25036 </bqbiol:is> | |
| 25037 </rdf:Description> | |
| 25038 </rdf:RDF> | |
| 25039 </annotation> | |
| 25040 <fbc:geneProductAssociation> | |
| 25041 <fbc:geneProductRef fbc:geneProduct="buc_BU285"/> | |
| 25042 </fbc:geneProductAssociation> | |
| 25043 <listOfReactants> | |
| 25044 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 25045 <speciesReference constant="true" species="C03546" stoichiometry="1"/> | |
| 25046 </listOfReactants> | |
| 25047 <listOfProducts> | |
| 25048 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 25049 <speciesReference constant="true" species="C00137" stoichiometry="1"/> | |
| 25050 </listOfProducts> | |
| 25051 </reaction> | |
| 25052 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01187" metaid="acefa705-587e-40d0-a2b6-920fb3b51df7" name="1D-myo-inositol 3-phosphate phosphohydrolase" reversible="true"> | |
| 25053 <notes> | |
| 25054 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25055 <p>SUBSYSTEM: Inositol phosphate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25056 <p>EC_NUMBER: 3.1.3.25</p> | |
| 25057 <p>GENE_ASSOCIATION: buc_BU285</p> | |
| 25058 </body> | |
| 25059 </notes> | |
| 25060 <annotation> | |
| 25061 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25062 <rdf:Description rdf:about="#acefa705-587e-40d0-a2b6-920fb3b51df7"> | |
| 25063 <bqbiol:is> | |
| 25064 <rdf:Bag> | |
| 25065 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.1.3.25"/> | |
| 25066 </rdf:Bag> | |
| 25067 </bqbiol:is> | |
| 25068 </rdf:Description> | |
| 25069 </rdf:RDF> | |
| 25070 </annotation> | |
| 25071 <fbc:geneProductAssociation> | |
| 25072 <fbc:geneProductRef fbc:geneProduct="buc_BU285"/> | |
| 25073 </fbc:geneProductAssociation> | |
| 25074 <listOfReactants> | |
| 25075 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 25076 <speciesReference constant="true" species="C04006" stoichiometry="1"/> | |
| 25077 </listOfReactants> | |
| 25078 <listOfProducts> | |
| 25079 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 25080 <speciesReference constant="true" species="C00137" stoichiometry="1"/> | |
| 25081 </listOfProducts> | |
| 25082 </reaction> | |
| 25083 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03243" metaid="_44eebad5-3771-4dbd-9b78-cb7fb53bdf2c" name="5-Amino-2-oxopentanoate:2-oxoglutarate aminotransferase" reversible="true"> | |
| 25084 <notes> | |
| 25085 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25086 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Histidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25087 <p>EC_NUMBER: 2.6.1.9</p> | |
| 25088 <p>GENE_ASSOCIATION: buc_BU101</p> | |
| 25089 </body> | |
| 25090 </notes> | |
| 25091 <annotation> | |
| 25092 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25093 <rdf:Description rdf:about="#_44eebad5-3771-4dbd-9b78-cb7fb53bdf2c"> | |
| 25094 <bqbiol:is> | |
| 25095 <rdf:Bag> | |
| 25096 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.6.1.9"/> | |
| 25097 </rdf:Bag> | |
| 25098 </bqbiol:is> | |
| 25099 </rdf:Description> | |
| 25100 </rdf:RDF> | |
| 25101 </annotation> | |
| 25102 <fbc:geneProductAssociation> | |
| 25103 <fbc:geneProductRef fbc:geneProduct="buc_BU101"/> | |
| 25104 </fbc:geneProductAssociation> | |
| 25105 <listOfReactants> | |
| 25106 <speciesReference constant="true" species="C00026" stoichiometry="1"/> | |
| 25107 <speciesReference constant="true" species="C01100" stoichiometry="1"/> | |
| 25108 </listOfReactants> | |
| 25109 <listOfProducts> | |
| 25110 <speciesReference constant="true" species="C00025" stoichiometry="1"/> | |
| 25111 <speciesReference constant="true" species="C01267" stoichiometry="1"/> | |
| 25112 </listOfProducts> | |
| 25113 </reaction> | |
| 25114 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01067" metaid="_68fb9bf1-7405-44ee-98e2-2530770aef30" name="D-Fructose 6-phosphate:D-glyceraldehyde-3-phosphate glycolaldehyde transferase" reversible="true"> | |
| 25115 <notes> | |
| 25116 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25117 <p>SUBSYSTEM: Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25118 <p>EC_NUMBER: 2.2.1.1</p> | |
| 25119 <p>GENE_ASSOCIATION: buc_BU094</p> | |
| 25120 </body> | |
| 25121 </notes> | |
| 25122 <annotation> | |
| 25123 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25124 <rdf:Description rdf:about="#_68fb9bf1-7405-44ee-98e2-2530770aef30"> | |
| 25125 <bqbiol:is> | |
| 25126 <rdf:Bag> | |
| 25127 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.2.1.1"/> | |
| 25128 </rdf:Bag> | |
| 25129 </bqbiol:is> | |
| 25130 </rdf:Description> | |
| 25131 </rdf:RDF> | |
| 25132 </annotation> | |
| 25133 <fbc:geneProductAssociation> | |
| 25134 <fbc:geneProductRef fbc:geneProduct="buc_BU094"/> | |
| 25135 </fbc:geneProductAssociation> | |
| 25136 <listOfReactants> | |
| 25137 <speciesReference constant="true" species="C00085" stoichiometry="1"/> | |
| 25138 <speciesReference constant="true" species="C00118" stoichiometry="1"/> | |
| 25139 </listOfReactants> | |
| 25140 <listOfProducts> | |
| 25141 <speciesReference constant="true" species="C00231" stoichiometry="1"/> | |
| 25142 <speciesReference constant="true" species="C00279" stoichiometry="1"/> | |
| 25143 </listOfProducts> | |
| 25144 </reaction> | |
| 25145 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03004" metaid="b4a7edc5-32d3-40b1-8a51-e0c773b04928" name="Deamino-NAD+ nucleotidohydrolase" reversible="true"> | |
| 25146 <notes> | |
| 25147 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25148 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25149 <p>GENE_ASSOCIATION: buc_BU446</p> | |
| 25150 </body> | |
| 25151 </notes> | |
| 25152 <fbc:geneProductAssociation> | |
| 25153 <fbc:geneProductRef fbc:geneProduct="buc_BU446"/> | |
| 25154 </fbc:geneProductAssociation> | |
| 25155 <listOfReactants> | |
| 25156 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 25157 <speciesReference constant="true" species="C00857" stoichiometry="1"/> | |
| 25158 </listOfReactants> | |
| 25159 <listOfProducts> | |
| 25160 <speciesReference constant="true" species="C01185" stoichiometry="1"/> | |
| 25161 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 25162 </listOfProducts> | |
| 25163 </reaction> | |
| 25164 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02035" metaid="_2cbd17ee-23ce-45c7-af42-ccbd673a21b6" name="6-Phospho-D-glucono-1,5-lactone lactonohydrolase" reversible="true"> | |
| 25165 <notes> | |
| 25166 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25167 <p>SUBSYSTEM: Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pentose phosphate pathway - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25168 <p>EC_NUMBER: 3.1.1.31</p> | |
| 25169 <p>GENE_ASSOCIATION: buc_BU293</p> | |
| 25170 </body> | |
| 25171 </notes> | |
| 25172 <annotation> | |
| 25173 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25174 <rdf:Description rdf:about="#_2cbd17ee-23ce-45c7-af42-ccbd673a21b6"> | |
| 25175 <bqbiol:is> | |
| 25176 <rdf:Bag> | |
| 25177 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.1.1.31"/> | |
| 25178 </rdf:Bag> | |
| 25179 </bqbiol:is> | |
| 25180 </rdf:Description> | |
| 25181 </rdf:RDF> | |
| 25182 </annotation> | |
| 25183 <fbc:geneProductAssociation> | |
| 25184 <fbc:geneProductRef fbc:geneProduct="buc_BU293"/> | |
| 25185 </fbc:geneProductAssociation> | |
| 25186 <listOfReactants> | |
| 25187 <speciesReference constant="true" species="C01236" stoichiometry="1"/> | |
| 25188 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 25189 </listOfReactants> | |
| 25190 <listOfProducts> | |
| 25191 <speciesReference constant="true" species="C00345" stoichiometry="1"/> | |
| 25192 </listOfProducts> | |
| 25193 </reaction> | |
| 25194 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01068" metaid="b3962df4-c010-49fd-83ca-4cd5034ab81c" name="D-fructose-1,6-bisphosphate D-glyceraldehyde-3-phosphate-lyase (glycerone-phosphate-forming)" reversible="true"> | |
| 25195 <notes> | |
| 25196 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25197 <p>SUBSYSTEM: Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Methane metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25198 <p>EC_NUMBER: 4.1.2.13</p> | |
| 25199 <p>GENE_ASSOCIATION: buc_BU451</p> | |
| 25200 </body> | |
| 25201 </notes> | |
| 25202 <annotation> | |
| 25203 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25204 <rdf:Description rdf:about="#b3962df4-c010-49fd-83ca-4cd5034ab81c"> | |
| 25205 <bqbiol:is> | |
| 25206 <rdf:Bag> | |
| 25207 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.1.2.13"/> | |
| 25208 </rdf:Bag> | |
| 25209 </bqbiol:is> | |
| 25210 </rdf:Description> | |
| 25211 </rdf:RDF> | |
| 25212 </annotation> | |
| 25213 <fbc:geneProductAssociation> | |
| 25214 <fbc:geneProductRef fbc:geneProduct="buc_BU451"/> | |
| 25215 </fbc:geneProductAssociation> | |
| 25216 <listOfReactants> | |
| 25217 <speciesReference constant="true" species="C00354" stoichiometry="1"/> | |
| 25218 </listOfReactants> | |
| 25219 <listOfProducts> | |
| 25220 <speciesReference constant="true" species="C00111" stoichiometry="1"/> | |
| 25221 <speciesReference constant="true" species="C00118" stoichiometry="1"/> | |
| 25222 </listOfProducts> | |
| 25223 </reaction> | |
| 25224 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04558" metaid="f33d55f6-cf91-4450-8d39-1bb0a05983ec" name="5-[(5-phospho-1-deoxy-D-ribulos-1-ylamino)methylideneamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide D-erythro-1-(imidazol-4-yl)glycerol 3-phosphate-lyase (L-glutamine-hydrolysing 5-amino-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide-forming)" reversible="true"> | |
| 25225 <notes> | |
| 25226 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25227 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Histidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25228 <p>EC_NUMBER: 4.3.2.10</p> | |
| 25229 <p>GENE_ASSOCIATION: ( buc_BU103 ) OR ( buc_BU105 )</p> | |
| 25230 </body> | |
| 25231 </notes> | |
| 25232 <annotation> | |
| 25233 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25234 <rdf:Description rdf:about="#f33d55f6-cf91-4450-8d39-1bb0a05983ec"> | |
| 25235 <bqbiol:is> | |
| 25236 <rdf:Bag> | |
| 25237 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.3.2.10"/> | |
| 25238 </rdf:Bag> | |
| 25239 </bqbiol:is> | |
| 25240 </rdf:Description> | |
| 25241 </rdf:RDF> | |
| 25242 </annotation> | |
| 25243 <fbc:geneProductAssociation> | |
| 25244 <fbc:or> | |
| 25245 <fbc:geneProductRef fbc:geneProduct="buc_BU103"/> | |
| 25246 <fbc:geneProductRef fbc:geneProduct="buc_BU105"/> | |
| 25247 </fbc:or> | |
| 25248 </fbc:geneProductAssociation> | |
| 25249 <listOfReactants> | |
| 25250 <speciesReference constant="true" species="C04916" stoichiometry="1"/> | |
| 25251 <speciesReference constant="true" species="C00064" stoichiometry="1"/> | |
| 25252 </listOfReactants> | |
| 25253 <listOfProducts> | |
| 25254 <speciesReference constant="true" species="C04666" stoichiometry="1"/> | |
| 25255 <speciesReference constant="true" species="C00025" stoichiometry="1"/> | |
| 25256 <speciesReference constant="true" species="C04677" stoichiometry="1"/> | |
| 25257 </listOfProducts> | |
| 25258 </reaction> | |
| 25259 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04559" metaid="_27585989-9a30-49ab-83e4-4c2d5b41a2b6" name="1-(5'-Phosphoribosyl)-5-amino-4-(N-succinocarboxamide)-imidazole AMP-lyase" reversible="true"> | |
| 25260 <notes> | |
| 25261 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25262 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25263 <p>EC_NUMBER: 4.3.2.2</p> | |
| 25264 <p>GENE_ASSOCIATION: buc_BU263</p> | |
| 25265 </body> | |
| 25266 </notes> | |
| 25267 <annotation> | |
| 25268 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25269 <rdf:Description rdf:about="#_27585989-9a30-49ab-83e4-4c2d5b41a2b6"> | |
| 25270 <bqbiol:is> | |
| 25271 <rdf:Bag> | |
| 25272 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.3.2.2"/> | |
| 25273 </rdf:Bag> | |
| 25274 </bqbiol:is> | |
| 25275 </rdf:Description> | |
| 25276 </rdf:RDF> | |
| 25277 </annotation> | |
| 25278 <fbc:geneProductAssociation> | |
| 25279 <fbc:geneProductRef fbc:geneProduct="buc_BU263"/> | |
| 25280 </fbc:geneProductAssociation> | |
| 25281 <listOfReactants> | |
| 25282 <speciesReference constant="true" species="C04823" stoichiometry="1"/> | |
| 25283 </listOfReactants> | |
| 25284 <listOfProducts> | |
| 25285 <speciesReference constant="true" species="C00122" stoichiometry="1"/> | |
| 25286 <speciesReference constant="true" species="C04677" stoichiometry="1"/> | |
| 25287 </listOfProducts> | |
| 25288 </reaction> | |
| 25289 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01049" metaid="bb971c11-8289-44ba-b99a-dfbe1538169f" name="ATP:D-ribose-5-phosphate diphosphotransferase" reversible="true"> | |
| 25290 <notes> | |
| 25291 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25292 <p>SUBSYSTEM: Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pentose phosphate pathway - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25293 <p>EC_NUMBER: 2.7.6.1</p> | |
| 25294 <p>GENE_ASSOCIATION: buc_BU169</p> | |
| 25295 </body> | |
| 25296 </notes> | |
| 25297 <annotation> | |
| 25298 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25299 <rdf:Description rdf:about="#bb971c11-8289-44ba-b99a-dfbe1538169f"> | |
| 25300 <bqbiol:is> | |
| 25301 <rdf:Bag> | |
| 25302 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.6.1"/> | |
| 25303 </rdf:Bag> | |
| 25304 </bqbiol:is> | |
| 25305 </rdf:Description> | |
| 25306 </rdf:RDF> | |
| 25307 </annotation> | |
| 25308 <fbc:geneProductAssociation> | |
| 25309 <fbc:geneProductRef fbc:geneProduct="buc_BU169"/> | |
| 25310 </fbc:geneProductAssociation> | |
| 25311 <listOfReactants> | |
| 25312 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 25313 <speciesReference constant="true" species="C00117" stoichiometry="1"/> | |
| 25314 </listOfReactants> | |
| 25315 <listOfProducts> | |
| 25316 <speciesReference constant="true" species="C00119" stoichiometry="1"/> | |
| 25317 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 25318 </listOfProducts> | |
| 25319 </reaction> | |
| 25320 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R05645" metaid="_09df0986-afdf-4112-b858-e43472a60f04" name="D-glycero-beta-D-manno-heptose-7-phosphate aldose-ketose-isomerase" reversible="true"> | |
| 25321 <notes> | |
| 25322 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25323 <p>SUBSYSTEM: Lipopolysaccharide biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of nucleotide sugars - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25324 <p>EC_NUMBER: 5.3.1.28</p> | |
| 25325 <p>GENE_ASSOCIATION: buc_BU250</p> | |
| 25326 </body> | |
| 25327 </notes> | |
| 25328 <annotation> | |
| 25329 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25330 <rdf:Description rdf:about="#_09df0986-afdf-4112-b858-e43472a60f04"> | |
| 25331 <bqbiol:is> | |
| 25332 <rdf:Bag> | |
| 25333 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.3.1.28"/> | |
| 25334 </rdf:Bag> | |
| 25335 </bqbiol:is> | |
| 25336 </rdf:Description> | |
| 25337 </rdf:RDF> | |
| 25338 </annotation> | |
| 25339 <fbc:geneProductAssociation> | |
| 25340 <fbc:geneProductRef fbc:geneProduct="buc_BU250"/> | |
| 25341 </fbc:geneProductAssociation> | |
| 25342 <listOfReactants> | |
| 25343 <speciesReference constant="true" species="C05382" stoichiometry="1"/> | |
| 25344 </listOfReactants> | |
| 25345 <listOfProducts> | |
| 25346 <speciesReference constant="true" species="C07836" stoichiometry="1"/> | |
| 25347 </listOfProducts> | |
| 25348 </reaction> | |
| 25349 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02018" metaid="_7de68fda-c15f-4cc2-b54c-9363becb94f7" name="2'-deoxyuridine 5'-diphosphate:oxidized-thioredoxin 2'-oxidoreductase" reversible="true"> | |
| 25350 <notes> | |
| 25351 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25352 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pyrimidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25353 <p>EC_NUMBER: 1.17.4.1</p> | |
| 25354 <p>GENE_ASSOCIATION: ( buc_BU178 ) OR ( buc_BU179 )</p> | |
| 25355 </body> | |
| 25356 </notes> | |
| 25357 <annotation> | |
| 25358 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25359 <rdf:Description rdf:about="#_7de68fda-c15f-4cc2-b54c-9363becb94f7"> | |
| 25360 <bqbiol:is> | |
| 25361 <rdf:Bag> | |
| 25362 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.17.4.1"/> | |
| 25363 </rdf:Bag> | |
| 25364 </bqbiol:is> | |
| 25365 </rdf:Description> | |
| 25366 </rdf:RDF> | |
| 25367 </annotation> | |
| 25368 <fbc:geneProductAssociation> | |
| 25369 <fbc:or> | |
| 25370 <fbc:geneProductRef fbc:geneProduct="buc_BU178"/> | |
| 25371 <fbc:geneProductRef fbc:geneProduct="buc_BU179"/> | |
| 25372 </fbc:or> | |
| 25373 </fbc:geneProductAssociation> | |
| 25374 <listOfReactants> | |
| 25375 <speciesReference constant="true" species="C01346" stoichiometry="1"/> | |
| 25376 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 25377 <speciesReference constant="true" species="C00343" stoichiometry="1"/> | |
| 25378 </listOfReactants> | |
| 25379 <listOfProducts> | |
| 25380 <speciesReference constant="true" species="C00342" stoichiometry="1"/> | |
| 25381 <speciesReference constant="true" species="C00015" stoichiometry="1"/> | |
| 25382 </listOfProducts> | |
| 25383 </reaction> | |
| 25384 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02017" metaid="_0e68a8de-7064-45b7-84f8-b1d2c60cfda9" name="2'-deoxyadenosine 5'-diphosphate:oxidized-thioredoxin 2'-oxidoreductase" reversible="true"> | |
| 25385 <notes> | |
| 25386 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25387 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25388 <p>EC_NUMBER: 1.17.4.1</p> | |
| 25389 <p>GENE_ASSOCIATION: ( buc_BU178 ) OR ( buc_BU179 )</p> | |
| 25390 </body> | |
| 25391 </notes> | |
| 25392 <annotation> | |
| 25393 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25394 <rdf:Description rdf:about="#_0e68a8de-7064-45b7-84f8-b1d2c60cfda9"> | |
| 25395 <bqbiol:is> | |
| 25396 <rdf:Bag> | |
| 25397 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.17.4.1"/> | |
| 25398 </rdf:Bag> | |
| 25399 </bqbiol:is> | |
| 25400 </rdf:Description> | |
| 25401 </rdf:RDF> | |
| 25402 </annotation> | |
| 25403 <fbc:geneProductAssociation> | |
| 25404 <fbc:or> | |
| 25405 <fbc:geneProductRef fbc:geneProduct="buc_BU178"/> | |
| 25406 <fbc:geneProductRef fbc:geneProduct="buc_BU179"/> | |
| 25407 </fbc:or> | |
| 25408 </fbc:geneProductAssociation> | |
| 25409 <listOfReactants> | |
| 25410 <speciesReference constant="true" species="C00206" stoichiometry="1"/> | |
| 25411 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 25412 <speciesReference constant="true" species="C00343" stoichiometry="1"/> | |
| 25413 </listOfReactants> | |
| 25414 <listOfProducts> | |
| 25415 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 25416 <speciesReference constant="true" species="C00342" stoichiometry="1"/> | |
| 25417 </listOfProducts> | |
| 25418 </reaction> | |
| 25419 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R06613" metaid="a00d58bb-0708-4b83-a025-342eeee4fbe9" name="5,10-methylenetetrahydrofolate,NADPH:dUMP C-methyltransferase" reversible="true"> | |
| 25420 <notes> | |
| 25421 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25422 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25423 <p>GENE_ASSOCIATION: buc_BU440</p> | |
| 25424 </body> | |
| 25425 </notes> | |
| 25426 <fbc:geneProductAssociation> | |
| 25427 <fbc:geneProductRef fbc:geneProduct="buc_BU440"/> | |
| 25428 </fbc:geneProductAssociation> | |
| 25429 <listOfReactants> | |
| 25430 <speciesReference constant="true" species="C00365" stoichiometry="1"/> | |
| 25431 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 25432 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 25433 <speciesReference constant="true" species="C00143" stoichiometry="1"/> | |
| 25434 </listOfReactants> | |
| 25435 <listOfProducts> | |
| 25436 <speciesReference constant="true" species="C00101" stoichiometry="1"/> | |
| 25437 <speciesReference constant="true" species="C00364" stoichiometry="1"/> | |
| 25438 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 25439 </listOfProducts> | |
| 25440 </reaction> | |
| 25441 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02019" metaid="_065f196a-2152-4eea-840e-5e72945e3b3b" name="2'-deoxyguanosine 5'-diphosphate:oxidized-thioredoxin 2'-oxidoreductase" reversible="true"> | |
| 25442 <notes> | |
| 25443 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25444 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25445 <p>EC_NUMBER: 1.17.4.1</p> | |
| 25446 <p>GENE_ASSOCIATION: ( buc_BU178 ) OR ( buc_BU179 )</p> | |
| 25447 </body> | |
| 25448 </notes> | |
| 25449 <annotation> | |
| 25450 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25451 <rdf:Description rdf:about="#_065f196a-2152-4eea-840e-5e72945e3b3b"> | |
| 25452 <bqbiol:is> | |
| 25453 <rdf:Bag> | |
| 25454 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.17.4.1"/> | |
| 25455 </rdf:Bag> | |
| 25456 </bqbiol:is> | |
| 25457 </rdf:Description> | |
| 25458 </rdf:RDF> | |
| 25459 </annotation> | |
| 25460 <fbc:geneProductAssociation> | |
| 25461 <fbc:or> | |
| 25462 <fbc:geneProductRef fbc:geneProduct="buc_BU178"/> | |
| 25463 <fbc:geneProductRef fbc:geneProduct="buc_BU179"/> | |
| 25464 </fbc:or> | |
| 25465 </fbc:geneProductAssociation> | |
| 25466 <listOfReactants> | |
| 25467 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 25468 <speciesReference constant="true" species="C00361" stoichiometry="1"/> | |
| 25469 <speciesReference constant="true" species="C00343" stoichiometry="1"/> | |
| 25470 </listOfReactants> | |
| 25471 <listOfProducts> | |
| 25472 <speciesReference constant="true" species="C00035" stoichiometry="1"/> | |
| 25473 <speciesReference constant="true" species="C00342" stoichiometry="1"/> | |
| 25474 </listOfProducts> | |
| 25475 </reaction> | |
| 25476 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04439" metaid="_97cddb2b-bc39-4a65-8673-f0086e7639d9" name="(R)-2,3-dihydroxy-3-methylbutanoate:NADP+ oxidoreductase (isomerizing)" reversible="false"> | |
| 25477 <notes> | |
| 25478 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25479 <p>SUBSYSTEM: Pantothenate and CoA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25480 <p>EC_NUMBER: 1.1.1.86</p> | |
| 25481 <p>GENE_ASSOCIATION: buc_BU599</p> | |
| 25482 </body> | |
| 25483 </notes> | |
| 25484 <annotation> | |
| 25485 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25486 <rdf:Description rdf:about="#_97cddb2b-bc39-4a65-8673-f0086e7639d9"> | |
| 25487 <bqbiol:is> | |
| 25488 <rdf:Bag> | |
| 25489 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.86"/> | |
| 25490 </rdf:Bag> | |
| 25491 </bqbiol:is> | |
| 25492 </rdf:Description> | |
| 25493 </rdf:RDF> | |
| 25494 </annotation> | |
| 25495 <fbc:geneProductAssociation> | |
| 25496 <fbc:geneProductRef fbc:geneProduct="buc_BU599"/> | |
| 25497 </fbc:geneProductAssociation> | |
| 25498 <listOfReactants> | |
| 25499 <speciesReference constant="true" species="C04272" stoichiometry="1"/> | |
| 25500 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 25501 </listOfReactants> | |
| 25502 <listOfProducts> | |
| 25503 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 25504 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 25505 <speciesReference constant="true" species="C06010" stoichiometry="1"/> | |
| 25506 </listOfProducts> | |
| 25507 </reaction> | |
| 25508 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04440" metaid="_9a20887b-7f09-418f-9a27-f5dd65ff3fc4" name="(R)-2,3-Dihydroxy-3-methylbutanoate:NADP+ oxidoreductase (isomerizing)" reversible="true"> | |
| 25509 <notes> | |
| 25510 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25511 <p>SUBSYSTEM: 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Valine, leucine and isoleucine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25512 <p>EC_NUMBER: 1.1.1.86</p> | |
| 25513 <p>GENE_ASSOCIATION: buc_BU599</p> | |
| 25514 </body> | |
| 25515 </notes> | |
| 25516 <annotation> | |
| 25517 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25518 <rdf:Description rdf:about="#_9a20887b-7f09-418f-9a27-f5dd65ff3fc4"> | |
| 25519 <bqbiol:is> | |
| 25520 <rdf:Bag> | |
| 25521 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.86"/> | |
| 25522 </rdf:Bag> | |
| 25523 </bqbiol:is> | |
| 25524 </rdf:Description> | |
| 25525 </rdf:RDF> | |
| 25526 </annotation> | |
| 25527 <fbc:geneProductAssociation> | |
| 25528 <fbc:geneProductRef fbc:geneProduct="buc_BU599"/> | |
| 25529 </fbc:geneProductAssociation> | |
| 25530 <listOfReactants> | |
| 25531 <speciesReference constant="true" species="C04272" stoichiometry="1"/> | |
| 25532 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 25533 </listOfReactants> | |
| 25534 <listOfProducts> | |
| 25535 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 25536 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 25537 <speciesReference constant="true" species="C04181" stoichiometry="1"/> | |
| 25538 </listOfProducts> | |
| 25539 </reaction> | |
| 25540 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04441" metaid="_4d5bedbe-69b3-4c5d-82d2-919eac138557" name="(R)-2,3-Dihydroxy-3-methylbutanoate hydro-lyase" reversible="true"> | |
| 25541 <notes> | |
| 25542 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25543 <p>SUBSYSTEM: Pantothenate and CoA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Valine, leucine and isoleucine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25544 <p>EC_NUMBER: 4.2.1.9</p> | |
| 25545 <p>GENE_ASSOCIATION: buc_BU600</p> | |
| 25546 </body> | |
| 25547 </notes> | |
| 25548 <annotation> | |
| 25549 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25550 <rdf:Description rdf:about="#_4d5bedbe-69b3-4c5d-82d2-919eac138557"> | |
| 25551 <bqbiol:is> | |
| 25552 <rdf:Bag> | |
| 25553 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.2.1.9"/> | |
| 25554 </rdf:Bag> | |
| 25555 </bqbiol:is> | |
| 25556 </rdf:Description> | |
| 25557 </rdf:RDF> | |
| 25558 </annotation> | |
| 25559 <fbc:geneProductAssociation> | |
| 25560 <fbc:geneProductRef fbc:geneProduct="buc_BU600"/> | |
| 25561 </fbc:geneProductAssociation> | |
| 25562 <listOfReactants> | |
| 25563 <speciesReference constant="true" species="C04272" stoichiometry="1"/> | |
| 25564 </listOfReactants> | |
| 25565 <listOfProducts> | |
| 25566 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 25567 <speciesReference constant="true" species="C00141" stoichiometry="1"/> | |
| 25568 </listOfProducts> | |
| 25569 </reaction> | |
| 25570 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02142" metaid="_090dbd61-22b3-486c-b471-2fa8d8da82e1" name="XMP:pyrophosphate phosphoribosyltransferase" reversible="true"> | |
| 25571 <notes> | |
| 25572 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25573 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25574 <p>EC_NUMBER: 2.4.2.8 / 2.4.2.22</p> | |
| 25575 <p>GENE_ASSOCIATION: buc_BU251</p> | |
| 25576 </body> | |
| 25577 </notes> | |
| 25578 <annotation> | |
| 25579 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25580 <rdf:Description rdf:about="#_090dbd61-22b3-486c-b471-2fa8d8da82e1"> | |
| 25581 <bqbiol:is> | |
| 25582 <rdf:Bag> | |
| 25583 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.4.2.8 / 2.4.2.22"/> | |
| 25584 </rdf:Bag> | |
| 25585 </bqbiol:is> | |
| 25586 </rdf:Description> | |
| 25587 </rdf:RDF> | |
| 25588 </annotation> | |
| 25589 <fbc:geneProductAssociation> | |
| 25590 <fbc:geneProductRef fbc:geneProduct="buc_BU251"/> | |
| 25591 </fbc:geneProductAssociation> | |
| 25592 <listOfReactants> | |
| 25593 <speciesReference constant="true" species="C00655" stoichiometry="1"/> | |
| 25594 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 25595 </listOfReactants> | |
| 25596 <listOfProducts> | |
| 25597 <speciesReference constant="true" species="C00119" stoichiometry="1"/> | |
| 25598 <speciesReference constant="true" species="C00385" stoichiometry="1"/> | |
| 25599 </listOfProducts> | |
| 25600 </reaction> | |
| 25601 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02021" metaid="_5ac00fb6-ee89-48a8-b3c6-bfe6d96dc0a6" name="adenosine 3',5'-bisphosphate,sulfite:oxidized-thioredoxin oxidoreductase (3'-phosphoadenosine-5'-phosphosulfate -forming)" reversible="true"> | |
| 25602 <notes> | |
| 25603 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25604 <p>SUBSYSTEM: Sulfur metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25605 <p>EC_NUMBER: 1.8.4.8</p> | |
| 25606 <p>GENE_ASSOCIATION: buc_BU426</p> | |
| 25607 </body> | |
| 25608 </notes> | |
| 25609 <annotation> | |
| 25610 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25611 <rdf:Description rdf:about="#_5ac00fb6-ee89-48a8-b3c6-bfe6d96dc0a6"> | |
| 25612 <bqbiol:is> | |
| 25613 <rdf:Bag> | |
| 25614 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.8.4.8"/> | |
| 25615 </rdf:Bag> | |
| 25616 </bqbiol:is> | |
| 25617 </rdf:Description> | |
| 25618 </rdf:RDF> | |
| 25619 </annotation> | |
| 25620 <fbc:geneProductAssociation> | |
| 25621 <fbc:geneProductRef fbc:geneProduct="buc_BU426"/> | |
| 25622 </fbc:geneProductAssociation> | |
| 25623 <listOfReactants> | |
| 25624 <speciesReference constant="true" species="C00342" stoichiometry="1"/> | |
| 25625 <speciesReference constant="true" species="C00053" stoichiometry="1"/> | |
| 25626 </listOfReactants> | |
| 25627 <listOfProducts> | |
| 25628 <speciesReference constant="true" species="C00054" stoichiometry="1"/> | |
| 25629 <speciesReference constant="true" species="C00343" stoichiometry="1"/> | |
| 25630 <speciesReference constant="true" species="C00094" stoichiometry="1"/> | |
| 25631 </listOfProducts> | |
| 25632 </reaction> | |
| 25633 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00084" metaid="cab80945-b273-462a-88a5-c4b7813143cb" name="porphobilinogen:(4-[2-carboxyethyl]-3-[carboxymethyl]pyrrol-2-yl)methyltransferase (hydrolysing)" reversible="true"> | |
| 25634 <notes> | |
| 25635 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25636 <p>SUBSYSTEM: Porphyrin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25637 <p>EC_NUMBER: 2.5.1.61</p> | |
| 25638 <p>GENE_ASSOCIATION: buc_BU591</p> | |
| 25639 </body> | |
| 25640 </notes> | |
| 25641 <annotation> | |
| 25642 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25643 <rdf:Description rdf:about="#cab80945-b273-462a-88a5-c4b7813143cb"> | |
| 25644 <bqbiol:is> | |
| 25645 <rdf:Bag> | |
| 25646 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.5.1.61"/> | |
| 25647 </rdf:Bag> | |
| 25648 </bqbiol:is> | |
| 25649 </rdf:Description> | |
| 25650 </rdf:RDF> | |
| 25651 </annotation> | |
| 25652 <fbc:geneProductAssociation> | |
| 25653 <fbc:geneProductRef fbc:geneProduct="buc_BU591"/> | |
| 25654 </fbc:geneProductAssociation> | |
| 25655 <listOfReactants> | |
| 25656 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 25657 <speciesReference constant="true" species="C00931" stoichiometry="4"/> | |
| 25658 </listOfReactants> | |
| 25659 <listOfProducts> | |
| 25660 <speciesReference constant="true" species="C00014" stoichiometry="4"/> | |
| 25661 <speciesReference constant="true" species="C01024" stoichiometry="1"/> | |
| 25662 </listOfProducts> | |
| 25663 </reaction> | |
| 25664 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03231" metaid="_0bd7b714-267f-4337-8629-f961a1590095" name="S-Adenosyl-L-methionine:8-amino-7-oxononanoate aminotransferase" reversible="true"> | |
| 25665 <notes> | |
| 25666 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25667 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biotin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25668 <p>EC_NUMBER: 2.6.1.62</p> | |
| 25669 <p>GENE_ASSOCIATION: buc_BU292</p> | |
| 25670 </body> | |
| 25671 </notes> | |
| 25672 <annotation> | |
| 25673 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25674 <rdf:Description rdf:about="#_0bd7b714-267f-4337-8629-f961a1590095"> | |
| 25675 <bqbiol:is> | |
| 25676 <rdf:Bag> | |
| 25677 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.6.1.62"/> | |
| 25678 </rdf:Bag> | |
| 25679 </bqbiol:is> | |
| 25680 </rdf:Description> | |
| 25681 </rdf:RDF> | |
| 25682 </annotation> | |
| 25683 <fbc:geneProductAssociation> | |
| 25684 <fbc:geneProductRef fbc:geneProduct="buc_BU292"/> | |
| 25685 </fbc:geneProductAssociation> | |
| 25686 <listOfReactants> | |
| 25687 <speciesReference constant="true" species="C00019" stoichiometry="1"/> | |
| 25688 <speciesReference constant="true" species="C01092" stoichiometry="1"/> | |
| 25689 </listOfReactants> | |
| 25690 <listOfProducts> | |
| 25691 <speciesReference constant="true" species="C04425" stoichiometry="1"/> | |
| 25692 <speciesReference constant="true" species="C01037" stoichiometry="1"/> | |
| 25693 </listOfProducts> | |
| 25694 </reaction> | |
| 25695 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04560" metaid="_4e5ec5ae-6224-436d-9ab1-4bb989d60e81" name="10-Formyltetrahydrofolate:5'-phosphoribosyl-5-amino-4-imidazolecarboxamide formyltransferase" reversible="true"> | |
| 25696 <notes> | |
| 25697 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25698 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || One carbon pool by folate - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25699 <p>EC_NUMBER: 2.1.2.3</p> | |
| 25700 <p>GENE_ASSOCIATION: buc_BU031</p> | |
| 25701 </body> | |
| 25702 </notes> | |
| 25703 <annotation> | |
| 25704 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25705 <rdf:Description rdf:about="#_4e5ec5ae-6224-436d-9ab1-4bb989d60e81"> | |
| 25706 <bqbiol:is> | |
| 25707 <rdf:Bag> | |
| 25708 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.1.2.3"/> | |
| 25709 </rdf:Bag> | |
| 25710 </bqbiol:is> | |
| 25711 </rdf:Description> | |
| 25712 </rdf:RDF> | |
| 25713 </annotation> | |
| 25714 <fbc:geneProductAssociation> | |
| 25715 <fbc:geneProductRef fbc:geneProduct="buc_BU031"/> | |
| 25716 </fbc:geneProductAssociation> | |
| 25717 <listOfReactants> | |
| 25718 <speciesReference constant="true" species="C00234" stoichiometry="1"/> | |
| 25719 <speciesReference constant="true" species="C04677" stoichiometry="1"/> | |
| 25720 </listOfReactants> | |
| 25721 <listOfProducts> | |
| 25722 <speciesReference constant="true" species="C00101" stoichiometry="1"/> | |
| 25723 <speciesReference constant="true" species="C04734" stoichiometry="1"/> | |
| 25724 </listOfProducts> | |
| 25725 </reaction> | |
| 25726 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03596" metaid="eb1513ab-b132-47d8-828e-7df3c4dd0d08" name="hydrogen selenide:NADP+ oxidoreductase" reversible="false"> | |
| 25727 <notes> | |
| 25728 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25729 <p>SUBSYSTEM: Selenocompound metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25730 <p>EC_NUMBER: 1.8.1.9</p> | |
| 25731 <p>GENE_ASSOCIATION: buc_BU314</p> | |
| 25732 </body> | |
| 25733 </notes> | |
| 25734 <annotation> | |
| 25735 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25736 <rdf:Description rdf:about="#eb1513ab-b132-47d8-828e-7df3c4dd0d08"> | |
| 25737 <bqbiol:is> | |
| 25738 <rdf:Bag> | |
| 25739 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.8.1.9"/> | |
| 25740 </rdf:Bag> | |
| 25741 </bqbiol:is> | |
| 25742 </rdf:Description> | |
| 25743 </rdf:RDF> | |
| 25744 </annotation> | |
| 25745 <fbc:geneProductAssociation> | |
| 25746 <fbc:geneProductRef fbc:geneProduct="buc_BU314"/> | |
| 25747 </fbc:geneProductAssociation> | |
| 25748 <listOfReactants> | |
| 25749 <speciesReference constant="true" species="C01528" stoichiometry="1"/> | |
| 25750 <speciesReference constant="true" species="C00001" stoichiometry="3"/> | |
| 25751 <speciesReference constant="true" species="C00006" stoichiometry="3"/> | |
| 25752 </listOfReactants> | |
| 25753 <listOfProducts> | |
| 25754 <speciesReference constant="true" species="C00005" stoichiometry="3"/> | |
| 25755 <speciesReference constant="true" species="C05684" stoichiometry="1"/> | |
| 25756 <speciesReference constant="true" species="C00080" stoichiometry="5"/> | |
| 25757 </listOfProducts> | |
| 25758 </reaction> | |
| 25759 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04566" metaid="d383f5c8-50e3-4e00-a03c-db05865f7ae4" name="(3R)-3-hydroxytetradecanoyl-[acyl-carrier-protein]:NADP+ oxidoreductase" reversible="true"> | |
| 25760 <notes> | |
| 25761 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25762 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25763 <p>EC_NUMBER: 1.1.1.100</p> | |
| 25764 <p>GENE_ASSOCIATION: buc_BU351</p> | |
| 25765 </body> | |
| 25766 </notes> | |
| 25767 <annotation> | |
| 25768 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25769 <rdf:Description rdf:about="#d383f5c8-50e3-4e00-a03c-db05865f7ae4"> | |
| 25770 <bqbiol:is> | |
| 25771 <rdf:Bag> | |
| 25772 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.100"/> | |
| 25773 </rdf:Bag> | |
| 25774 </bqbiol:is> | |
| 25775 </rdf:Description> | |
| 25776 </rdf:RDF> | |
| 25777 </annotation> | |
| 25778 <fbc:geneProductAssociation> | |
| 25779 <fbc:geneProductRef fbc:geneProduct="buc_BU351"/> | |
| 25780 </fbc:geneProductAssociation> | |
| 25781 <listOfReactants> | |
| 25782 <speciesReference constant="true" species="C04688" stoichiometry="1"/> | |
| 25783 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 25784 </listOfReactants> | |
| 25785 <listOfProducts> | |
| 25786 <speciesReference constant="true" species="C05759" stoichiometry="1"/> | |
| 25787 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 25788 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 25789 </listOfProducts> | |
| 25790 </reaction> | |
| 25791 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02143" metaid="cb9d3498-a490-4e83-b8a8-08b114b564d3" name="Xanthosine ribohydrolase" reversible="true"> | |
| 25792 <notes> | |
| 25793 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25794 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25795 <p>GENE_ASSOCIATION: buc_BU541</p> | |
| 25796 </body> | |
| 25797 </notes> | |
| 25798 <fbc:geneProductAssociation> | |
| 25799 <fbc:geneProductRef fbc:geneProduct="buc_BU541"/> | |
| 25800 </fbc:geneProductAssociation> | |
| 25801 <listOfReactants> | |
| 25802 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 25803 <speciesReference constant="true" species="C01762" stoichiometry="1"/> | |
| 25804 </listOfReactants> | |
| 25805 <listOfProducts> | |
| 25806 <speciesReference constant="true" species="C00121" stoichiometry="1"/> | |
| 25807 <speciesReference constant="true" species="C00385" stoichiometry="1"/> | |
| 25808 </listOfProducts> | |
| 25809 </reaction> | |
| 25810 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01056" metaid="_92cfa3c9-be92-4f42-9c09-247769fb18ef" name="D-ribose-5-phosphate aldose-ketose-isomerase" reversible="true"> | |
| 25811 <notes> | |
| 25812 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25813 <p>SUBSYSTEM: Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pentose phosphate pathway - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25814 <p>EC_NUMBER: 5.3.1.6</p> | |
| 25815 <p>GENE_ASSOCIATION: buc_BU411</p> | |
| 25816 </body> | |
| 25817 </notes> | |
| 25818 <annotation> | |
| 25819 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25820 <rdf:Description rdf:about="#_92cfa3c9-be92-4f42-9c09-247769fb18ef"> | |
| 25821 <bqbiol:is> | |
| 25822 <rdf:Bag> | |
| 25823 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.3.1.6"/> | |
| 25824 </rdf:Bag> | |
| 25825 </bqbiol:is> | |
| 25826 </rdf:Description> | |
| 25827 </rdf:RDF> | |
| 25828 </annotation> | |
| 25829 <fbc:geneProductAssociation> | |
| 25830 <fbc:geneProductRef fbc:geneProduct="buc_BU411"/> | |
| 25831 </fbc:geneProductAssociation> | |
| 25832 <listOfReactants> | |
| 25833 <speciesReference constant="true" species="C00117" stoichiometry="1"/> | |
| 25834 </listOfReactants> | |
| 25835 <listOfProducts> | |
| 25836 <speciesReference constant="true" species="C00199" stoichiometry="1"/> | |
| 25837 </listOfProducts> | |
| 25838 </reaction> | |
| 25839 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01057" metaid="e7fcb7b0-b2c7-4bd2-a55c-8a7d18dde393" name="D-Ribose 1,5-phosphomutase" reversible="true"> | |
| 25840 <notes> | |
| 25841 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25842 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pentose phosphate pathway - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25843 <p>EC_NUMBER: 5.4.2.7</p> | |
| 25844 <p>GENE_ASSOCIATION: buc_BU542</p> | |
| 25845 </body> | |
| 25846 </notes> | |
| 25847 <annotation> | |
| 25848 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25849 <rdf:Description rdf:about="#e7fcb7b0-b2c7-4bd2-a55c-8a7d18dde393"> | |
| 25850 <bqbiol:is> | |
| 25851 <rdf:Bag> | |
| 25852 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.4.2.7"/> | |
| 25853 </rdf:Bag> | |
| 25854 </bqbiol:is> | |
| 25855 </rdf:Description> | |
| 25856 </rdf:RDF> | |
| 25857 </annotation> | |
| 25858 <fbc:geneProductAssociation> | |
| 25859 <fbc:geneProductRef fbc:geneProduct="buc_BU542"/> | |
| 25860 </fbc:geneProductAssociation> | |
| 25861 <listOfReactants> | |
| 25862 <speciesReference constant="true" species="C00620" stoichiometry="1"/> | |
| 25863 </listOfReactants> | |
| 25864 <listOfProducts> | |
| 25865 <speciesReference constant="true" species="C00117" stoichiometry="1"/> | |
| 25866 </listOfProducts> | |
| 25867 </reaction> | |
| 25868 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02024" metaid="_664315db-39b2-4b29-893a-cebd522efb0c" name="2'-deoxycytidine diphosphate:oxidized-thioredoxin 2'-oxidoreductase" reversible="true"> | |
| 25869 <notes> | |
| 25870 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25871 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pyrimidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25872 <p>EC_NUMBER: 1.17.4.1</p> | |
| 25873 <p>GENE_ASSOCIATION: ( buc_BU178 ) OR ( buc_BU179 )</p> | |
| 25874 </body> | |
| 25875 </notes> | |
| 25876 <annotation> | |
| 25877 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25878 <rdf:Description rdf:about="#_664315db-39b2-4b29-893a-cebd522efb0c"> | |
| 25879 <bqbiol:is> | |
| 25880 <rdf:Bag> | |
| 25881 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.17.4.1"/> | |
| 25882 </rdf:Bag> | |
| 25883 </bqbiol:is> | |
| 25884 </rdf:Description> | |
| 25885 </rdf:RDF> | |
| 25886 </annotation> | |
| 25887 <fbc:geneProductAssociation> | |
| 25888 <fbc:or> | |
| 25889 <fbc:geneProductRef fbc:geneProduct="buc_BU178"/> | |
| 25890 <fbc:geneProductRef fbc:geneProduct="buc_BU179"/> | |
| 25891 </fbc:or> | |
| 25892 </fbc:geneProductAssociation> | |
| 25893 <listOfReactants> | |
| 25894 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 25895 <speciesReference constant="true" species="C00705" stoichiometry="1"/> | |
| 25896 <speciesReference constant="true" species="C00343" stoichiometry="1"/> | |
| 25897 </listOfReactants> | |
| 25898 <listOfProducts> | |
| 25899 <speciesReference constant="true" species="C00112" stoichiometry="1"/> | |
| 25900 <speciesReference constant="true" species="C00342" stoichiometry="1"/> | |
| 25901 </listOfProducts> | |
| 25902 </reaction> | |
| 25903 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R07618" metaid="f48cdd0e-2c68-44e4-88ef-444dacaac097" name="enzyme N6-(dihydrolipoyl)lysine:NAD+ oxidoreductase" reversible="true"> | |
| 25904 <notes> | |
| 25905 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25906 <p>SUBSYSTEM: Pyruvate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Propanoate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Citrate cycle (TCA cycle) - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glycolysis / Gluconeogenesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum) || Valine, leucine and isoleucine degradation - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25907 <p>EC_NUMBER: 1.8.1.4</p> | |
| 25908 <p>GENE_ASSOCIATION: buc_BU207</p> | |
| 25909 </body> | |
| 25910 </notes> | |
| 25911 <annotation> | |
| 25912 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25913 <rdf:Description rdf:about="#f48cdd0e-2c68-44e4-88ef-444dacaac097"> | |
| 25914 <bqbiol:is> | |
| 25915 <rdf:Bag> | |
| 25916 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.8.1.4"/> | |
| 25917 </rdf:Bag> | |
| 25918 </bqbiol:is> | |
| 25919 </rdf:Description> | |
| 25920 </rdf:RDF> | |
| 25921 </annotation> | |
| 25922 <fbc:geneProductAssociation> | |
| 25923 <fbc:geneProductRef fbc:geneProduct="buc_BU207"/> | |
| 25924 </fbc:geneProductAssociation> | |
| 25925 <listOfReactants> | |
| 25926 <speciesReference constant="true" species="C15973" stoichiometry="1"/> | |
| 25927 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 25928 </listOfReactants> | |
| 25929 <listOfProducts> | |
| 25930 <speciesReference constant="true" species="C15972" stoichiometry="1"/> | |
| 25931 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 25932 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 25933 </listOfProducts> | |
| 25934 </reaction> | |
| 25935 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01083" metaid="_39944541-fcd9-4423-9d2f-bf61e76606bf" name="N6-(1,2-dicarboxyethyl)AMP AMP-lyase (fumarate-forming)" reversible="true"> | |
| 25936 <notes> | |
| 25937 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25938 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Alanine, aspartate and glutamate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25939 <p>EC_NUMBER: 4.3.2.2</p> | |
| 25940 <p>GENE_ASSOCIATION: buc_BU263</p> | |
| 25941 </body> | |
| 25942 </notes> | |
| 25943 <annotation> | |
| 25944 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25945 <rdf:Description rdf:about="#_39944541-fcd9-4423-9d2f-bf61e76606bf"> | |
| 25946 <bqbiol:is> | |
| 25947 <rdf:Bag> | |
| 25948 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.3.2.2"/> | |
| 25949 </rdf:Bag> | |
| 25950 </bqbiol:is> | |
| 25951 </rdf:Description> | |
| 25952 </rdf:RDF> | |
| 25953 </annotation> | |
| 25954 <fbc:geneProductAssociation> | |
| 25955 <fbc:geneProductRef fbc:geneProduct="buc_BU263"/> | |
| 25956 </fbc:geneProductAssociation> | |
| 25957 <listOfReactants> | |
| 25958 <speciesReference constant="true" species="C03794" stoichiometry="1"/> | |
| 25959 </listOfReactants> | |
| 25960 <listOfProducts> | |
| 25961 <speciesReference constant="true" species="C00122" stoichiometry="1"/> | |
| 25962 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 25963 </listOfProducts> | |
| 25964 </reaction> | |
| 25965 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02294" metaid="_64ea88c3-ec6a-4fe5-b30b-a615280f8ade" name="N-Ribosylnicotinamide:orthophosphate ribosyltransferase" reversible="true"> | |
| 25966 <notes> | |
| 25967 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25968 <p>SUBSYSTEM: Nicotinate and nicotinamide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 25969 <p>EC_NUMBER: 2.4.2.1</p> | |
| 25970 <p>GENE_ASSOCIATION: buc_BU541</p> | |
| 25971 </body> | |
| 25972 </notes> | |
| 25973 <annotation> | |
| 25974 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 25975 <rdf:Description rdf:about="#_64ea88c3-ec6a-4fe5-b30b-a615280f8ade"> | |
| 25976 <bqbiol:is> | |
| 25977 <rdf:Bag> | |
| 25978 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.4.2.1"/> | |
| 25979 </rdf:Bag> | |
| 25980 </bqbiol:is> | |
| 25981 </rdf:Description> | |
| 25982 </rdf:RDF> | |
| 25983 </annotation> | |
| 25984 <fbc:geneProductAssociation> | |
| 25985 <fbc:geneProductRef fbc:geneProduct="buc_BU541"/> | |
| 25986 </fbc:geneProductAssociation> | |
| 25987 <listOfReactants> | |
| 25988 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 25989 <speciesReference constant="true" species="C03150" stoichiometry="1"/> | |
| 25990 </listOfReactants> | |
| 25991 <listOfProducts> | |
| 25992 <speciesReference constant="true" species="C00153" stoichiometry="1"/> | |
| 25993 <speciesReference constant="true" species="C00620" stoichiometry="1"/> | |
| 25994 </listOfProducts> | |
| 25995 </reaction> | |
| 25996 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04111" metaid="_4b451016-4167-4ae5-9eff-44e1d2e3fe4b" name="protein-N(pi)-phosphohistidine:maltose 6'-phosphotransferase" reversible="false"> | |
| 25997 <notes> | |
| 25998 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 25999 <p>SUBSYSTEM: Starch and sucrose metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26000 <p>GENE_ASSOCIATION: buc_BU063</p> | |
| 26001 </body> | |
| 26002 </notes> | |
| 26003 <fbc:geneProductAssociation> | |
| 26004 <fbc:geneProductRef fbc:geneProduct="buc_BU063"/> | |
| 26005 </fbc:geneProductAssociation> | |
| 26006 <listOfReactants> | |
| 26007 <speciesReference constant="true" species="C04261" stoichiometry="1"/> | |
| 26008 <speciesReference constant="true" species="C00208" stoichiometry="1"/> | |
| 26009 </listOfReactants> | |
| 26010 <listOfProducts> | |
| 26011 <speciesReference constant="true" species="C00615" stoichiometry="1"/> | |
| 26012 <speciesReference constant="true" species="C02995" stoichiometry="1"/> | |
| 26013 </listOfProducts> | |
| 26014 </reaction> | |
| 26015 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01086" metaid="eba5b04e-4587-4d83-bf8c-d3da4334e181" name="2-(Nomega-L-arginino)succinate arginine-lyase (fumarate-forming)" reversible="true"> | |
| 26016 <notes> | |
| 26017 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26018 <p>SUBSYSTEM: Arginine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Alanine, aspartate and glutamate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26019 <p>EC_NUMBER: 4.3.2.1</p> | |
| 26020 <p>GENE_ASSOCIATION: buc_BU051</p> | |
| 26021 </body> | |
| 26022 </notes> | |
| 26023 <annotation> | |
| 26024 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26025 <rdf:Description rdf:about="#eba5b04e-4587-4d83-bf8c-d3da4334e181"> | |
| 26026 <bqbiol:is> | |
| 26027 <rdf:Bag> | |
| 26028 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.3.2.1"/> | |
| 26029 </rdf:Bag> | |
| 26030 </bqbiol:is> | |
| 26031 </rdf:Description> | |
| 26032 </rdf:RDF> | |
| 26033 </annotation> | |
| 26034 <fbc:geneProductAssociation> | |
| 26035 <fbc:geneProductRef fbc:geneProduct="buc_BU051"/> | |
| 26036 </fbc:geneProductAssociation> | |
| 26037 <listOfReactants> | |
| 26038 <speciesReference constant="true" species="C03406" stoichiometry="1"/> | |
| 26039 </listOfReactants> | |
| 26040 <listOfProducts> | |
| 26041 <speciesReference constant="true" species="C00062" stoichiometry="1"/> | |
| 26042 <speciesReference constant="true" species="C00122" stoichiometry="1"/> | |
| 26043 </listOfProducts> | |
| 26044 </reaction> | |
| 26045 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02295" metaid="e1dbc085-9260-4808-8074-8f8515b5e8f1" name="Nicotinate D-ribonucleoside:orthophosphate ribosyltransferase" reversible="true"> | |
| 26046 <notes> | |
| 26047 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26048 <p>SUBSYSTEM: Nicotinate and nicotinamide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26049 <p>EC_NUMBER: 2.4.2.1</p> | |
| 26050 <p>GENE_ASSOCIATION: buc_BU541</p> | |
| 26051 </body> | |
| 26052 </notes> | |
| 26053 <annotation> | |
| 26054 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26055 <rdf:Description rdf:about="#e1dbc085-9260-4808-8074-8f8515b5e8f1"> | |
| 26056 <bqbiol:is> | |
| 26057 <rdf:Bag> | |
| 26058 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.4.2.1"/> | |
| 26059 </rdf:Bag> | |
| 26060 </bqbiol:is> | |
| 26061 </rdf:Description> | |
| 26062 </rdf:RDF> | |
| 26063 </annotation> | |
| 26064 <fbc:geneProductAssociation> | |
| 26065 <fbc:geneProductRef fbc:geneProduct="buc_BU541"/> | |
| 26066 </fbc:geneProductAssociation> | |
| 26067 <listOfReactants> | |
| 26068 <speciesReference constant="true" species="C05841" stoichiometry="1"/> | |
| 26069 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 26070 </listOfReactants> | |
| 26071 <listOfProducts> | |
| 26072 <speciesReference constant="true" species="C00253" stoichiometry="1"/> | |
| 26073 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 26074 <speciesReference constant="true" species="C00620" stoichiometry="1"/> | |
| 26075 </listOfProducts> | |
| 26076 </reaction> | |
| 26077 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02297" metaid="_3f913402-36b9-462c-ac2c-9667a29565fa" name="xanthosine:orthophosphate ribosyltransferase" reversible="true"> | |
| 26078 <notes> | |
| 26079 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26080 <p>SUBSYSTEM: Nucleotide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26081 <p>EC_NUMBER: 2.4.2.1</p> | |
| 26082 <p>GENE_ASSOCIATION: buc_BU541</p> | |
| 26083 </body> | |
| 26084 </notes> | |
| 26085 <annotation> | |
| 26086 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26087 <rdf:Description rdf:about="#_3f913402-36b9-462c-ac2c-9667a29565fa"> | |
| 26088 <bqbiol:is> | |
| 26089 <rdf:Bag> | |
| 26090 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.4.2.1"/> | |
| 26091 </rdf:Bag> | |
| 26092 </bqbiol:is> | |
| 26093 </rdf:Description> | |
| 26094 </rdf:RDF> | |
| 26095 </annotation> | |
| 26096 <fbc:geneProductAssociation> | |
| 26097 <fbc:geneProductRef fbc:geneProduct="buc_BU541"/> | |
| 26098 </fbc:geneProductAssociation> | |
| 26099 <listOfReactants> | |
| 26100 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 26101 <speciesReference constant="true" species="C01762" stoichiometry="1"/> | |
| 26102 </listOfReactants> | |
| 26103 <listOfProducts> | |
| 26104 <speciesReference constant="true" species="C00620" stoichiometry="1"/> | |
| 26105 <speciesReference constant="true" species="C00385" stoichiometry="1"/> | |
| 26106 </listOfProducts> | |
| 26107 </reaction> | |
| 26108 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R05688" metaid="bb1c4422-7772-4765-b9e0-3e2ed5cea128" name="1-Deoxy-D-xylulose-5-phosphate isomeroreductase" reversible="true"> | |
| 26109 <notes> | |
| 26110 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26111 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Terpenoid backbone biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26112 <p>EC_NUMBER: 1.1.1.267</p> | |
| 26113 <p>GENE_ASSOCIATION: buc_BU235</p> | |
| 26114 </body> | |
| 26115 </notes> | |
| 26116 <annotation> | |
| 26117 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26118 <rdf:Description rdf:about="#bb1c4422-7772-4765-b9e0-3e2ed5cea128"> | |
| 26119 <bqbiol:is> | |
| 26120 <rdf:Bag> | |
| 26121 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.267"/> | |
| 26122 </rdf:Bag> | |
| 26123 </bqbiol:is> | |
| 26124 </rdf:Description> | |
| 26125 </rdf:RDF> | |
| 26126 </annotation> | |
| 26127 <fbc:geneProductAssociation> | |
| 26128 <fbc:geneProductRef fbc:geneProduct="buc_BU235"/> | |
| 26129 </fbc:geneProductAssociation> | |
| 26130 <listOfReactants> | |
| 26131 <speciesReference constant="true" species="C11434" stoichiometry="1"/> | |
| 26132 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 26133 </listOfReactants> | |
| 26134 <listOfProducts> | |
| 26135 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 26136 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 26137 <speciesReference constant="true" species="C11437" stoichiometry="1"/> | |
| 26138 </listOfProducts> | |
| 26139 </reaction> | |
| 26140 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04475" metaid="dd253c34-bc19-46b1-95b2-f2276158205e" name="N-Succinyl-L-2,6-diaminoheptanedioate:2-oxoglutarate amino-transferase" reversible="true"> | |
| 26141 <notes> | |
| 26142 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26143 <p>SUBSYSTEM: Lysine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26144 <p>EC_NUMBER: 2.6.1.17</p> | |
| 26145 <p>GENE_ASSOCIATION: buc_BU534</p> | |
| 26146 </body> | |
| 26147 </notes> | |
| 26148 <annotation> | |
| 26149 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26150 <rdf:Description rdf:about="#dd253c34-bc19-46b1-95b2-f2276158205e"> | |
| 26151 <bqbiol:is> | |
| 26152 <rdf:Bag> | |
| 26153 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.6.1.17"/> | |
| 26154 </rdf:Bag> | |
| 26155 </bqbiol:is> | |
| 26156 </rdf:Description> | |
| 26157 </rdf:RDF> | |
| 26158 </annotation> | |
| 26159 <fbc:geneProductAssociation> | |
| 26160 <fbc:geneProductRef fbc:geneProduct="buc_BU534"/> | |
| 26161 </fbc:geneProductAssociation> | |
| 26162 <listOfReactants> | |
| 26163 <speciesReference constant="true" species="C00026" stoichiometry="1"/> | |
| 26164 <speciesReference constant="true" species="C04421" stoichiometry="1"/> | |
| 26165 </listOfReactants> | |
| 26166 <listOfProducts> | |
| 26167 <speciesReference constant="true" species="C04462" stoichiometry="1"/> | |
| 26168 <speciesReference constant="true" species="C00025" stoichiometry="1"/> | |
| 26169 </listOfProducts> | |
| 26170 </reaction> | |
| 26171 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04355" metaid="_5c646963-3978-43eb-9860-9a977b132072" name="Acyl-[acyl-carrier-protein]:malonyl-[acyl-carrier-protein] C-acyltransferase (decarboxylating)" reversible="true"> | |
| 26172 <notes> | |
| 26173 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26174 <p>SUBSYSTEM: Fatty acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fatty acid biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26175 <p>EC_NUMBER: 2.3.1.41</p> | |
| 26176 <p>GENE_ASSOCIATION: buc_BU092</p> | |
| 26177 </body> | |
| 26178 </notes> | |
| 26179 <annotation> | |
| 26180 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26181 <rdf:Description rdf:about="#_5c646963-3978-43eb-9860-9a977b132072"> | |
| 26182 <bqbiol:is> | |
| 26183 <rdf:Bag> | |
| 26184 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.3.1.41"/> | |
| 26185 </rdf:Bag> | |
| 26186 </bqbiol:is> | |
| 26187 </rdf:Description> | |
| 26188 </rdf:RDF> | |
| 26189 </annotation> | |
| 26190 <fbc:geneProductAssociation> | |
| 26191 <fbc:geneProductRef fbc:geneProduct="buc_BU092"/> | |
| 26192 </fbc:geneProductAssociation> | |
| 26193 <listOfReactants> | |
| 26194 <speciesReference constant="true" species="C03939" stoichiometry="1"/> | |
| 26195 <speciesReference constant="true" species="C01209" stoichiometry="1"/> | |
| 26196 </listOfReactants> | |
| 26197 <listOfProducts> | |
| 26198 <speciesReference constant="true" species="C05744" stoichiometry="1"/> | |
| 26199 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 26200 <speciesReference constant="true" species="C00229" stoichiometry="1"/> | |
| 26201 </listOfProducts> | |
| 26202 </reaction> | |
| 26203 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R10907" metaid="_045e2ed0-96f3-4307-8499-fc7c4ca4ec5e" name="beta-D-glucose-6-phosphate:NAD+ 1-oxidoreductase" reversible="true"> | |
| 26204 <notes> | |
| 26205 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26206 <p>SUBSYSTEM: Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pentose phosphate pathway - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26207 <p>EC_NUMBER: 1.1.1.363</p> | |
| 26208 <p>GENE_ASSOCIATION: buc_BU320</p> | |
| 26209 </body> | |
| 26210 </notes> | |
| 26211 <annotation> | |
| 26212 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26213 <rdf:Description rdf:about="#_045e2ed0-96f3-4307-8499-fc7c4ca4ec5e"> | |
| 26214 <bqbiol:is> | |
| 26215 <rdf:Bag> | |
| 26216 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.363"/> | |
| 26217 </rdf:Bag> | |
| 26218 </bqbiol:is> | |
| 26219 </rdf:Description> | |
| 26220 </rdf:RDF> | |
| 26221 </annotation> | |
| 26222 <fbc:geneProductAssociation> | |
| 26223 <fbc:geneProductRef fbc:geneProduct="buc_BU320"/> | |
| 26224 </fbc:geneProductAssociation> | |
| 26225 <listOfReactants> | |
| 26226 <speciesReference constant="true" species="C01172" stoichiometry="1"/> | |
| 26227 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 26228 </listOfReactants> | |
| 26229 <listOfProducts> | |
| 26230 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 26231 <speciesReference constant="true" species="C01236" stoichiometry="1"/> | |
| 26232 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 26233 </listOfProducts> | |
| 26234 </reaction> | |
| 26235 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02291" metaid="abf4720e-213f-4c3d-9a97-d6ddc5a956e7" name="L-Aspartate-4-semialdehyde:NADP+ oxidoreductase (phosphorylating)" reversible="true"> | |
| 26236 <notes> | |
| 26237 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26238 <p>SUBSYSTEM: Lysine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glycine, serine and threonine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Cysteine and methionine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26239 <p>EC_NUMBER: 1.2.1.11</p> | |
| 26240 <p>GENE_ASSOCIATION: buc_BU448</p> | |
| 26241 </body> | |
| 26242 </notes> | |
| 26243 <annotation> | |
| 26244 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26245 <rdf:Description rdf:about="#abf4720e-213f-4c3d-9a97-d6ddc5a956e7"> | |
| 26246 <bqbiol:is> | |
| 26247 <rdf:Bag> | |
| 26248 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.2.1.11"/> | |
| 26249 </rdf:Bag> | |
| 26250 </bqbiol:is> | |
| 26251 </rdf:Description> | |
| 26252 </rdf:RDF> | |
| 26253 </annotation> | |
| 26254 <fbc:geneProductAssociation> | |
| 26255 <fbc:geneProductRef fbc:geneProduct="buc_BU448"/> | |
| 26256 </fbc:geneProductAssociation> | |
| 26257 <listOfReactants> | |
| 26258 <speciesReference constant="true" species="C00441" stoichiometry="1"/> | |
| 26259 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 26260 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 26261 </listOfReactants> | |
| 26262 <listOfProducts> | |
| 26263 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 26264 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 26265 <speciesReference constant="true" species="C03082" stoichiometry="1"/> | |
| 26266 </listOfProducts> | |
| 26267 </reaction> | |
| 26268 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03005" metaid="_41d3e65b-7faa-4d01-b6d9-e5b9ac95ddd4" name="ATP:nicotinamide-nucleotide adenylyltransferase" reversible="true"> | |
| 26269 <notes> | |
| 26270 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26271 <p>SUBSYSTEM: Nicotinate and nicotinamide metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26272 <p>EC_NUMBER: 2.7.7.18</p> | |
| 26273 <p>GENE_ASSOCIATION: buc_BU446</p> | |
| 26274 </body> | |
| 26275 </notes> | |
| 26276 <annotation> | |
| 26277 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26278 <rdf:Description rdf:about="#_41d3e65b-7faa-4d01-b6d9-e5b9ac95ddd4"> | |
| 26279 <bqbiol:is> | |
| 26280 <rdf:Bag> | |
| 26281 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.7.18"/> | |
| 26282 </rdf:Bag> | |
| 26283 </bqbiol:is> | |
| 26284 </rdf:Description> | |
| 26285 </rdf:RDF> | |
| 26286 </annotation> | |
| 26287 <fbc:geneProductAssociation> | |
| 26288 <fbc:geneProductRef fbc:geneProduct="buc_BU446"/> | |
| 26289 </fbc:geneProductAssociation> | |
| 26290 <listOfReactants> | |
| 26291 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 26292 <speciesReference constant="true" species="C01185" stoichiometry="1"/> | |
| 26293 </listOfReactants> | |
| 26294 <listOfProducts> | |
| 26295 <speciesReference constant="true" species="C00857" stoichiometry="1"/> | |
| 26296 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 26297 </listOfProducts> | |
| 26298 </reaction> | |
| 26299 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04457" metaid="e53a3569-0b7a-4f5d-a9e5-8fd8036b88fe" name="5-amino-6-(D-ribitylamino)uracil butanedionetransferase" reversible="true"> | |
| 26300 <notes> | |
| 26301 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26302 <p>SUBSYSTEM: Riboflavin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26303 <p>EC_NUMBER: 2.5.1.78</p> | |
| 26304 <p>GENE_ASSOCIATION: buc_BU459</p> | |
| 26305 </body> | |
| 26306 </notes> | |
| 26307 <annotation> | |
| 26308 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26309 <rdf:Description rdf:about="#e53a3569-0b7a-4f5d-a9e5-8fd8036b88fe"> | |
| 26310 <bqbiol:is> | |
| 26311 <rdf:Bag> | |
| 26312 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.5.1.78"/> | |
| 26313 </rdf:Bag> | |
| 26314 </bqbiol:is> | |
| 26315 </rdf:Description> | |
| 26316 </rdf:RDF> | |
| 26317 </annotation> | |
| 26318 <fbc:geneProductAssociation> | |
| 26319 <fbc:geneProductRef fbc:geneProduct="buc_BU459"/> | |
| 26320 </fbc:geneProductAssociation> | |
| 26321 <listOfReactants> | |
| 26322 <speciesReference constant="true" species="C15556" stoichiometry="1"/> | |
| 26323 <speciesReference constant="true" species="C04732" stoichiometry="1"/> | |
| 26324 </listOfReactants> | |
| 26325 <listOfProducts> | |
| 26326 <speciesReference constant="true" species="C00001" stoichiometry="2"/> | |
| 26327 <speciesReference constant="true" species="C04332" stoichiometry="1"/> | |
| 26328 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 26329 </listOfProducts> | |
| 26330 </reaction> | |
| 26331 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02283" metaid="_56d96af9-4314-49e3-af8e-d2c985c2400c" name="N2-Acetyl-L-ornithine:2-oxoglutarate aminotransferase" reversible="true"> | |
| 26332 <notes> | |
| 26333 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26334 <p>SUBSYSTEM: Arginine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26335 <p>EC_NUMBER: 2.6.1.11</p> | |
| 26336 <p>GENE_ASSOCIATION: buc_BU534</p> | |
| 26337 </body> | |
| 26338 </notes> | |
| 26339 <annotation> | |
| 26340 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26341 <rdf:Description rdf:about="#_56d96af9-4314-49e3-af8e-d2c985c2400c"> | |
| 26342 <bqbiol:is> | |
| 26343 <rdf:Bag> | |
| 26344 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.6.1.11"/> | |
| 26345 </rdf:Bag> | |
| 26346 </bqbiol:is> | |
| 26347 </rdf:Description> | |
| 26348 </rdf:RDF> | |
| 26349 </annotation> | |
| 26350 <fbc:geneProductAssociation> | |
| 26351 <fbc:geneProductRef fbc:geneProduct="buc_BU534"/> | |
| 26352 </fbc:geneProductAssociation> | |
| 26353 <listOfReactants> | |
| 26354 <speciesReference constant="true" species="C00026" stoichiometry="1"/> | |
| 26355 <speciesReference constant="true" species="C00437" stoichiometry="1"/> | |
| 26356 </listOfReactants> | |
| 26357 <listOfProducts> | |
| 26358 <speciesReference constant="true" species="C00025" stoichiometry="1"/> | |
| 26359 <speciesReference constant="true" species="C01250" stoichiometry="1"/> | |
| 26360 </listOfProducts> | |
| 26361 </reaction> | |
| 26362 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01073" metaid="_5496f66b-c0df-4276-b1ee-bb121c268c81" name="N-(5-Phospho-D-ribosyl)anthranilate:pyrophosphate phosphoribosyl-transferase" reversible="true"> | |
| 26363 <notes> | |
| 26364 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26365 <p>SUBSYSTEM: Phenylalanine, tyrosine and tryptophan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26366 <p>EC_NUMBER: 2.4.2.18</p> | |
| 26367 <p>GENE_ASSOCIATION: buc_BU280</p> | |
| 26368 </body> | |
| 26369 </notes> | |
| 26370 <annotation> | |
| 26371 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26372 <rdf:Description rdf:about="#_5496f66b-c0df-4276-b1ee-bb121c268c81"> | |
| 26373 <bqbiol:is> | |
| 26374 <rdf:Bag> | |
| 26375 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.4.2.18"/> | |
| 26376 </rdf:Bag> | |
| 26377 </bqbiol:is> | |
| 26378 </rdf:Description> | |
| 26379 </rdf:RDF> | |
| 26380 </annotation> | |
| 26381 <fbc:geneProductAssociation> | |
| 26382 <fbc:geneProductRef fbc:geneProduct="buc_BU280"/> | |
| 26383 </fbc:geneProductAssociation> | |
| 26384 <listOfReactants> | |
| 26385 <speciesReference constant="true" species="C04302" stoichiometry="1"/> | |
| 26386 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 26387 </listOfReactants> | |
| 26388 <listOfProducts> | |
| 26389 <speciesReference constant="true" species="C00108" stoichiometry="1"/> | |
| 26390 <speciesReference constant="true" species="C00119" stoichiometry="1"/> | |
| 26391 </listOfProducts> | |
| 26392 </reaction> | |
| 26393 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02282" metaid="_4ac1058f-9a07-4bb4-9d2a-5c9b6c778b2f" name="N2-Acetyl-L-ornithine:L-glutamate N-acetyltransferase" reversible="true"> | |
| 26394 <notes> | |
| 26395 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26396 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26397 <p>GENE_ASSOCIATION: buc_BU047</p> | |
| 26398 </body> | |
| 26399 </notes> | |
| 26400 <fbc:geneProductAssociation> | |
| 26401 <fbc:geneProductRef fbc:geneProduct="buc_BU047"/> | |
| 26402 </fbc:geneProductAssociation> | |
| 26403 <listOfReactants> | |
| 26404 <speciesReference constant="true" species="C00437" stoichiometry="1"/> | |
| 26405 <speciesReference constant="true" species="C00025" stoichiometry="1"/> | |
| 26406 </listOfReactants> | |
| 26407 <listOfProducts> | |
| 26408 <speciesReference constant="true" species="C00077" stoichiometry="1"/> | |
| 26409 <speciesReference constant="true" species="C00624" stoichiometry="1"/> | |
| 26410 </listOfProducts> | |
| 26411 </reaction> | |
| 26412 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01196" metaid="adae65c4-fa60-45c7-98bd-3f6568b4eeef" name="pyruvate:ferredoxin 2-oxidoreductase (CoA-acetylating)" reversible="true"> | |
| 26413 <notes> | |
| 26414 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26415 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26416 <p>GENE_ASSOCIATION: ( buc_BU205 ) OR ( buc_BU206 ) OR ( buc_BU207 )</p> | |
| 26417 </body> | |
| 26418 </notes> | |
| 26419 <fbc:geneProductAssociation> | |
| 26420 <fbc:or> | |
| 26421 <fbc:geneProductRef fbc:geneProduct="buc_BU206"/> | |
| 26422 <fbc:geneProductRef fbc:geneProduct="buc_BU207"/> | |
| 26423 <fbc:geneProductRef fbc:geneProduct="buc_BU205"/> | |
| 26424 </fbc:or> | |
| 26425 </fbc:geneProductAssociation> | |
| 26426 <listOfReactants> | |
| 26427 <speciesReference constant="true" species="C00080" stoichiometry="2"/> | |
| 26428 <speciesReference constant="true" species="C00024" stoichiometry="1"/> | |
| 26429 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 26430 <speciesReference constant="true" species="C00138" stoichiometry="2"/> | |
| 26431 </listOfReactants> | |
| 26432 <listOfProducts> | |
| 26433 <speciesReference constant="true" species="C00139" stoichiometry="2"/> | |
| 26434 <speciesReference constant="true" species="C00022" stoichiometry="1"/> | |
| 26435 <speciesReference constant="true" species="C00010" stoichiometry="1"/> | |
| 26436 </listOfProducts> | |
| 26437 </reaction> | |
| 26438 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01197" metaid="bf1cb97c-52ec-4bef-92c0-09d3a844e642" name="2-oxoglutarate:ferredoxin oxidoreductase (decarboxylating)" reversible="true"> | |
| 26439 <notes> | |
| 26440 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26441 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26442 <p>GENE_ASSOCIATION: ( buc_BU207 ) OR ( buc_BU302 ) OR ( buc_BU303 )</p> | |
| 26443 </body> | |
| 26444 </notes> | |
| 26445 <fbc:geneProductAssociation> | |
| 26446 <fbc:or> | |
| 26447 <fbc:geneProductRef fbc:geneProduct="buc_BU302"/> | |
| 26448 <fbc:geneProductRef fbc:geneProduct="buc_BU207"/> | |
| 26449 <fbc:geneProductRef fbc:geneProduct="buc_BU303"/> | |
| 26450 </fbc:or> | |
| 26451 </fbc:geneProductAssociation> | |
| 26452 <listOfReactants> | |
| 26453 <speciesReference constant="true" species="C00080" stoichiometry="2"/> | |
| 26454 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 26455 <speciesReference constant="true" species="C00091" stoichiometry="1"/> | |
| 26456 <speciesReference constant="true" species="C00138" stoichiometry="2"/> | |
| 26457 </listOfReactants> | |
| 26458 <listOfProducts> | |
| 26459 <speciesReference constant="true" species="C00139" stoichiometry="2"/> | |
| 26460 <speciesReference constant="true" species="C00026" stoichiometry="1"/> | |
| 26461 <speciesReference constant="true" species="C00010" stoichiometry="1"/> | |
| 26462 </listOfProducts> | |
| 26463 </reaction> | |
| 26464 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03013" metaid="c4e80b5c-3603-476e-8b9c-54ba32b99b61" name="L-histidinol-phosphate phosphohydrolase" reversible="true"> | |
| 26465 <notes> | |
| 26466 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26467 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Histidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26468 <p>EC_NUMBER: 3.1.3.15</p> | |
| 26469 <p>GENE_ASSOCIATION: buc_BU102</p> | |
| 26470 </body> | |
| 26471 </notes> | |
| 26472 <annotation> | |
| 26473 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26474 <rdf:Description rdf:about="#c4e80b5c-3603-476e-8b9c-54ba32b99b61"> | |
| 26475 <bqbiol:is> | |
| 26476 <rdf:Bag> | |
| 26477 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.1.3.15"/> | |
| 26478 </rdf:Bag> | |
| 26479 </bqbiol:is> | |
| 26480 </rdf:Description> | |
| 26481 </rdf:RDF> | |
| 26482 </annotation> | |
| 26483 <fbc:geneProductAssociation> | |
| 26484 <fbc:geneProductRef fbc:geneProduct="buc_BU102"/> | |
| 26485 </fbc:geneProductAssociation> | |
| 26486 <listOfReactants> | |
| 26487 <speciesReference constant="true" species="C01100" stoichiometry="1"/> | |
| 26488 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 26489 </listOfReactants> | |
| 26490 <listOfProducts> | |
| 26491 <speciesReference constant="true" species="C00860" stoichiometry="1"/> | |
| 26492 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 26493 </listOfProducts> | |
| 26494 </reaction> | |
| 26495 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03012" metaid="_49a6c632-e912-48d4-af8e-23947bda1342" name="L-Histidinol:NAD+ oxidoreductase" reversible="true"> | |
| 26496 <notes> | |
| 26497 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26498 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Histidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26499 <p>EC_NUMBER: 1.1.1.23</p> | |
| 26500 <p>GENE_ASSOCIATION: buc_BU100</p> | |
| 26501 </body> | |
| 26502 </notes> | |
| 26503 <annotation> | |
| 26504 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26505 <rdf:Description rdf:about="#_49a6c632-e912-48d4-af8e-23947bda1342"> | |
| 26506 <bqbiol:is> | |
| 26507 <rdf:Bag> | |
| 26508 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.23"/> | |
| 26509 </rdf:Bag> | |
| 26510 </bqbiol:is> | |
| 26511 </rdf:Description> | |
| 26512 </rdf:RDF> | |
| 26513 </annotation> | |
| 26514 <fbc:geneProductAssociation> | |
| 26515 <fbc:geneProductRef fbc:geneProduct="buc_BU100"/> | |
| 26516 </fbc:geneProductAssociation> | |
| 26517 <listOfReactants> | |
| 26518 <speciesReference constant="true" species="C00860" stoichiometry="1"/> | |
| 26519 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 26520 </listOfReactants> | |
| 26521 <listOfProducts> | |
| 26522 <speciesReference constant="true" species="C01929" stoichiometry="1"/> | |
| 26523 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 26524 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 26525 </listOfProducts> | |
| 26526 </reaction> | |
| 26527 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01078" metaid="_751d6bba-9687-457f-9698-c34b30f0c464" name="dethiobiotin:sulfur sulfurtransferase" reversible="true"> | |
| 26528 <notes> | |
| 26529 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26530 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biotin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26531 <p>EC_NUMBER: 2.8.1.6</p> | |
| 26532 <p>GENE_ASSOCIATION: buc_BU291</p> | |
| 26533 </body> | |
| 26534 </notes> | |
| 26535 <annotation> | |
| 26536 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26537 <rdf:Description rdf:about="#_751d6bba-9687-457f-9698-c34b30f0c464"> | |
| 26538 <bqbiol:is> | |
| 26539 <rdf:Bag> | |
| 26540 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.8.1.6"/> | |
| 26541 </rdf:Bag> | |
| 26542 </bqbiol:is> | |
| 26543 </rdf:Description> | |
| 26544 </rdf:RDF> | |
| 26545 </annotation> | |
| 26546 <fbc:geneProductAssociation> | |
| 26547 <fbc:geneProductRef fbc:geneProduct="buc_BU291"/> | |
| 26548 </fbc:geneProductAssociation> | |
| 26549 <listOfReactants> | |
| 26550 <speciesReference constant="true" species="C01909" stoichiometry="1"/> | |
| 26551 <speciesReference constant="true" species="C00080" stoichiometry="2"/> | |
| 26552 <speciesReference constant="true" species="C17023" stoichiometry="1"/> | |
| 26553 <speciesReference constant="true" species="C05359" stoichiometry="2"/> | |
| 26554 <speciesReference constant="true" species="C00019" stoichiometry="2"/> | |
| 26555 </listOfReactants> | |
| 26556 <listOfProducts> | |
| 26557 <speciesReference constant="true" species="C00120" stoichiometry="1"/> | |
| 26558 <speciesReference constant="true" species="C00073" stoichiometry="2"/> | |
| 26559 <speciesReference constant="true" species="C05198" stoichiometry="2"/> | |
| 26560 </listOfProducts> | |
| 26561 </reaction> | |
| 26562 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02167" metaid="_03877e56-506f-4ab2-a721-c5711020ffd2" name="D-Mannitol-1-phosphate phosphohydrolase" reversible="true"> | |
| 26563 <notes> | |
| 26564 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26565 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26566 <p>GENE_ASSOCIATION: buc_BU572</p> | |
| 26567 </body> | |
| 26568 </notes> | |
| 26569 <fbc:geneProductAssociation> | |
| 26570 <fbc:geneProductRef fbc:geneProduct="buc_BU572"/> | |
| 26571 </fbc:geneProductAssociation> | |
| 26572 <listOfReactants> | |
| 26573 <speciesReference constant="true" species="C00644" stoichiometry="1"/> | |
| 26574 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 26575 </listOfReactants> | |
| 26576 <listOfProducts> | |
| 26577 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 26578 <speciesReference constant="true" species="C00392" stoichiometry="1"/> | |
| 26579 </listOfProducts> | |
| 26580 </reaction> | |
| 26581 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01070" metaid="_4beea5d6-90a5-4266-83ad-00c6ed4c226b" name="beta-D-fructose-1,6-bisphosphate D-glyceraldehyde-3-phosphate-lyase (glycerone-phosphate-forming)" reversible="true"> | |
| 26582 <notes> | |
| 26583 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26584 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glycolysis / Gluconeogenesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Fructose and mannose metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pentose phosphate pathway - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26585 <p>EC_NUMBER: 4.1.2.13</p> | |
| 26586 <p>GENE_ASSOCIATION: buc_BU451</p> | |
| 26587 </body> | |
| 26588 </notes> | |
| 26589 <annotation> | |
| 26590 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26591 <rdf:Description rdf:about="#_4beea5d6-90a5-4266-83ad-00c6ed4c226b"> | |
| 26592 <bqbiol:is> | |
| 26593 <rdf:Bag> | |
| 26594 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.1.2.13"/> | |
| 26595 </rdf:Bag> | |
| 26596 </bqbiol:is> | |
| 26597 </rdf:Description> | |
| 26598 </rdf:RDF> | |
| 26599 </annotation> | |
| 26600 <fbc:geneProductAssociation> | |
| 26601 <fbc:geneProductRef fbc:geneProduct="buc_BU451"/> | |
| 26602 </fbc:geneProductAssociation> | |
| 26603 <listOfReactants> | |
| 26604 <speciesReference constant="true" species="C05378" stoichiometry="1"/> | |
| 26605 </listOfReactants> | |
| 26606 <listOfProducts> | |
| 26607 <speciesReference constant="true" species="C00111" stoichiometry="1"/> | |
| 26608 <speciesReference constant="true" species="C00118" stoichiometry="1"/> | |
| 26609 </listOfProducts> | |
| 26610 </reaction> | |
| 26611 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01071" metaid="ad445ba8-4016-4a9d-bb04-0e97d895a699" name="1-(5-phospho-D-ribosyl)-ATP:diphosphate phospho-alpha-D-ribosyl-transferase" reversible="true"> | |
| 26612 <notes> | |
| 26613 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26614 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Histidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26615 <p>EC_NUMBER: 2.4.2.17</p> | |
| 26616 <p>GENE_ASSOCIATION: buc_BU099</p> | |
| 26617 </body> | |
| 26618 </notes> | |
| 26619 <annotation> | |
| 26620 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26621 <rdf:Description rdf:about="#ad445ba8-4016-4a9d-bb04-0e97d895a699"> | |
| 26622 <bqbiol:is> | |
| 26623 <rdf:Bag> | |
| 26624 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.4.2.17"/> | |
| 26625 </rdf:Bag> | |
| 26626 </bqbiol:is> | |
| 26627 </rdf:Description> | |
| 26628 </rdf:RDF> | |
| 26629 </annotation> | |
| 26630 <fbc:geneProductAssociation> | |
| 26631 <fbc:geneProductRef fbc:geneProduct="buc_BU099"/> | |
| 26632 </fbc:geneProductAssociation> | |
| 26633 <listOfReactants> | |
| 26634 <speciesReference constant="true" species="C02739" stoichiometry="1"/> | |
| 26635 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 26636 </listOfReactants> | |
| 26637 <listOfProducts> | |
| 26638 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 26639 <speciesReference constant="true" species="C00119" stoichiometry="1"/> | |
| 26640 </listOfProducts> | |
| 26641 </reaction> | |
| 26642 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00729" metaid="ad8542a9-c5a1-445a-9cb4-69f5f8eaa225" name="L-Tyrosine:oxygen oxidoreductase (deaminating)" reversible="true"> | |
| 26643 <notes> | |
| 26644 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26645 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26646 <p>GENE_ASSOCIATION: buc_BU101</p> | |
| 26647 </body> | |
| 26648 </notes> | |
| 26649 <fbc:geneProductAssociation> | |
| 26650 <fbc:geneProductRef fbc:geneProduct="buc_BU101"/> | |
| 26651 </fbc:geneProductAssociation> | |
| 26652 <listOfReactants> | |
| 26653 <speciesReference constant="true" species="C00007" stoichiometry="1"/> | |
| 26654 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 26655 <speciesReference constant="true" species="C00082" stoichiometry="1"/> | |
| 26656 </listOfReactants> | |
| 26657 <listOfProducts> | |
| 26658 <speciesReference constant="true" species="C00014" stoichiometry="1"/> | |
| 26659 <speciesReference constant="true" species="C00027" stoichiometry="1"/> | |
| 26660 <speciesReference constant="true" species="C01179" stoichiometry="1"/> | |
| 26661 </listOfProducts> | |
| 26662 </reaction> | |
| 26663 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00965" metaid="a84a79af-c294-4208-901e-ed2f0709b585" name="orotidine-5'-phosphate carboxy-lyase (UMP-forming)" reversible="true"> | |
| 26664 <notes> | |
| 26665 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26666 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pyrimidine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26667 <p>EC_NUMBER: 4.1.1.23</p> | |
| 26668 <p>GENE_ASSOCIATION: buc_BU270</p> | |
| 26669 </body> | |
| 26670 </notes> | |
| 26671 <annotation> | |
| 26672 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26673 <rdf:Description rdf:about="#a84a79af-c294-4208-901e-ed2f0709b585"> | |
| 26674 <bqbiol:is> | |
| 26675 <rdf:Bag> | |
| 26676 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.1.1.23"/> | |
| 26677 </rdf:Bag> | |
| 26678 </bqbiol:is> | |
| 26679 </rdf:Description> | |
| 26680 </rdf:RDF> | |
| 26681 </annotation> | |
| 26682 <fbc:geneProductAssociation> | |
| 26683 <fbc:geneProductRef fbc:geneProduct="buc_BU270"/> | |
| 26684 </fbc:geneProductAssociation> | |
| 26685 <listOfReactants> | |
| 26686 <speciesReference constant="true" species="C01103" stoichiometry="1"/> | |
| 26687 </listOfReactants> | |
| 26688 <listOfProducts> | |
| 26689 <speciesReference constant="true" species="C00105" stoichiometry="1"/> | |
| 26690 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 26691 </listOfProducts> | |
| 26692 </reaction> | |
| 26693 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01933" metaid="_8c2aa476-bcda-463e-8996-51b1487df9d7" name="2-oxoadipate dehydrogenase complex" reversible="true"> | |
| 26694 <notes> | |
| 26695 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26696 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26697 <p>EC_NUMBER: 1.2.4.2 / 1.8.1.4 / 2.3.1.61</p> | |
| 26698 <p>GENE_ASSOCIATION: ( buc_BU207 ) OR ( buc_BU303 )</p> | |
| 26699 </body> | |
| 26700 </notes> | |
| 26701 <annotation> | |
| 26702 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26703 <rdf:Description rdf:about="#_8c2aa476-bcda-463e-8996-51b1487df9d7"> | |
| 26704 <bqbiol:is> | |
| 26705 <rdf:Bag> | |
| 26706 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.2.4.2 / 1.8.1.4 / 2.3.1.61"/> | |
| 26707 </rdf:Bag> | |
| 26708 </bqbiol:is> | |
| 26709 </rdf:Description> | |
| 26710 </rdf:RDF> | |
| 26711 </annotation> | |
| 26712 <fbc:geneProductAssociation> | |
| 26713 <fbc:or> | |
| 26714 <fbc:geneProductRef fbc:geneProduct="buc_BU207"/> | |
| 26715 <fbc:geneProductRef fbc:geneProduct="buc_BU303"/> | |
| 26716 </fbc:or> | |
| 26717 </fbc:geneProductAssociation> | |
| 26718 <listOfReactants> | |
| 26719 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 26720 <speciesReference constant="true" species="C00322" stoichiometry="1"/> | |
| 26721 <speciesReference constant="true" species="C00010" stoichiometry="1"/> | |
| 26722 </listOfReactants> | |
| 26723 <listOfProducts> | |
| 26724 <speciesReference constant="true" species="C00527" stoichiometry="1"/> | |
| 26725 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 26726 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 26727 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 26728 </listOfProducts> | |
| 26729 </reaction> | |
| 26730 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R05068" metaid="d1d83d41-e12f-40f2-979c-46a8dab50286" name="(R)-2,3-Dihydroxy-3-methylpentanoate:NADP+ oxidoreductase (isomerizing)" reversible="true"> | |
| 26731 <notes> | |
| 26732 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26733 <p>SUBSYSTEM: 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Valine, leucine and isoleucine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26734 <p>EC_NUMBER: 1.1.1.86</p> | |
| 26735 <p>GENE_ASSOCIATION: buc_BU599</p> | |
| 26736 </body> | |
| 26737 </notes> | |
| 26738 <annotation> | |
| 26739 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26740 <rdf:Description rdf:about="#d1d83d41-e12f-40f2-979c-46a8dab50286"> | |
| 26741 <bqbiol:is> | |
| 26742 <rdf:Bag> | |
| 26743 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.86"/> | |
| 26744 </rdf:Bag> | |
| 26745 </bqbiol:is> | |
| 26746 </rdf:Description> | |
| 26747 </rdf:RDF> | |
| 26748 </annotation> | |
| 26749 <fbc:geneProductAssociation> | |
| 26750 <fbc:geneProductRef fbc:geneProduct="buc_BU599"/> | |
| 26751 </fbc:geneProductAssociation> | |
| 26752 <listOfReactants> | |
| 26753 <speciesReference constant="true" species="C06007" stoichiometry="1"/> | |
| 26754 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 26755 </listOfReactants> | |
| 26756 <listOfProducts> | |
| 26757 <speciesReference constant="true" species="C14463" stoichiometry="1"/> | |
| 26758 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 26759 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 26760 </listOfProducts> | |
| 26761 </reaction> | |
| 26762 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R08218" metaid="_8fe6effa-9f37-45ba-98fb-4dac368dd13d" name="L-serine:tRNASec ligase (AMP-forming)" reversible="false"> | |
| 26763 <notes> | |
| 26764 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26765 <p>SUBSYSTEM: Aminoacyl-tRNA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26766 <p>EC_NUMBER: 6.1.1.11</p> | |
| 26767 <p>GENE_ASSOCIATION: buc_BU313</p> | |
| 26768 </body> | |
| 26769 </notes> | |
| 26770 <annotation> | |
| 26771 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26772 <rdf:Description rdf:about="#_8fe6effa-9f37-45ba-98fb-4dac368dd13d"> | |
| 26773 <bqbiol:is> | |
| 26774 <rdf:Bag> | |
| 26775 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.1.1.11"/> | |
| 26776 </rdf:Bag> | |
| 26777 </bqbiol:is> | |
| 26778 </rdf:Description> | |
| 26779 </rdf:RDF> | |
| 26780 </annotation> | |
| 26781 <fbc:geneProductAssociation> | |
| 26782 <fbc:geneProductRef fbc:geneProduct="buc_BU313"/> | |
| 26783 </fbc:geneProductAssociation> | |
| 26784 <listOfReactants> | |
| 26785 <speciesReference constant="true" species="C16636" stoichiometry="1"/> | |
| 26786 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 26787 <speciesReference constant="true" species="C00065" stoichiometry="1"/> | |
| 26788 </listOfReactants> | |
| 26789 <listOfProducts> | |
| 26790 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 26791 <speciesReference constant="true" species="C06481" stoichiometry="1"/> | |
| 26792 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 26793 </listOfProducts> | |
| 26794 </reaction> | |
| 26795 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R08574" metaid="_6fd0a7d5-d272-4350-b23b-482172629a06" name="CTP:riboflavin 5'-phosphotransferase" reversible="true"> | |
| 26796 <notes> | |
| 26797 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26798 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26799 <p>GENE_ASSOCIATION: buc_BU150</p> | |
| 26800 </body> | |
| 26801 </notes> | |
| 26802 <fbc:geneProductAssociation> | |
| 26803 <fbc:geneProductRef fbc:geneProduct="buc_BU150"/> | |
| 26804 </fbc:geneProductAssociation> | |
| 26805 <listOfReactants> | |
| 26806 <speciesReference constant="true" species="C00255" stoichiometry="1"/> | |
| 26807 <speciesReference constant="true" species="C00063" stoichiometry="1"/> | |
| 26808 </listOfReactants> | |
| 26809 <listOfProducts> | |
| 26810 <speciesReference constant="true" species="C00112" stoichiometry="1"/> | |
| 26811 <speciesReference constant="true" species="C00061" stoichiometry="1"/> | |
| 26812 </listOfProducts> | |
| 26813 </reaction> | |
| 26814 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R05069" metaid="_1733262e-ad9c-4f88-b35c-f964ae39ac43" name="(S)-2-Aceto-2-hydroxybutanoate:NADP+ oxidoreductase (isomerizing)" reversible="true"> | |
| 26815 <notes> | |
| 26816 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26817 <p>SUBSYSTEM: 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Valine, leucine and isoleucine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26818 <p>EC_NUMBER: 1.1.1.86</p> | |
| 26819 <p>GENE_ASSOCIATION: buc_BU599</p> | |
| 26820 </body> | |
| 26821 </notes> | |
| 26822 <annotation> | |
| 26823 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26824 <rdf:Description rdf:about="#_1733262e-ad9c-4f88-b35c-f964ae39ac43"> | |
| 26825 <bqbiol:is> | |
| 26826 <rdf:Bag> | |
| 26827 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.86"/> | |
| 26828 </rdf:Bag> | |
| 26829 </bqbiol:is> | |
| 26830 </rdf:Description> | |
| 26831 </rdf:RDF> | |
| 26832 </annotation> | |
| 26833 <fbc:geneProductAssociation> | |
| 26834 <fbc:geneProductRef fbc:geneProduct="buc_BU599"/> | |
| 26835 </fbc:geneProductAssociation> | |
| 26836 <listOfReactants> | |
| 26837 <speciesReference constant="true" species="C06006" stoichiometry="1"/> | |
| 26838 </listOfReactants> | |
| 26839 <listOfProducts> | |
| 26840 <speciesReference constant="true" species="C14463" stoichiometry="1"/> | |
| 26841 </listOfProducts> | |
| 26842 </reaction> | |
| 26843 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R08210" metaid="fdcb5655-132b-4936-a773-e90b6ec5854c" name="dimethylallyl diphosphate:ferredoxin oxidoreductase" reversible="true"> | |
| 26844 <notes> | |
| 26845 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26846 <p>SUBSYSTEM: Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Terpenoid backbone biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26847 <p>EC_NUMBER: 1.17.7.4</p> | |
| 26848 <p>GENE_ASSOCIATION: buc_BU147</p> | |
| 26849 </body> | |
| 26850 </notes> | |
| 26851 <annotation> | |
| 26852 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26853 <rdf:Description rdf:about="#fdcb5655-132b-4936-a773-e90b6ec5854c"> | |
| 26854 <bqbiol:is> | |
| 26855 <rdf:Bag> | |
| 26856 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.17.7.4"/> | |
| 26857 </rdf:Bag> | |
| 26858 </bqbiol:is> | |
| 26859 </rdf:Description> | |
| 26860 </rdf:RDF> | |
| 26861 </annotation> | |
| 26862 <fbc:geneProductAssociation> | |
| 26863 <fbc:geneProductRef fbc:geneProduct="buc_BU147"/> | |
| 26864 </fbc:geneProductAssociation> | |
| 26865 <listOfReactants> | |
| 26866 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 26867 <speciesReference constant="true" species="C00235" stoichiometry="1"/> | |
| 26868 <speciesReference constant="true" species="C00139" stoichiometry="2"/> | |
| 26869 </listOfReactants> | |
| 26870 <listOfProducts> | |
| 26871 <speciesReference constant="true" species="C11811" stoichiometry="1"/> | |
| 26872 <speciesReference constant="true" species="C00080" stoichiometry="2"/> | |
| 26873 <speciesReference constant="true" species="C00138" stoichiometry="2"/> | |
| 26874 </listOfProducts> | |
| 26875 </reaction> | |
| 26876 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01920" metaid="_73ff08a0-267b-4862-94c8-2a1870f9b8ad" name="S-adenosylmethioninamine:putrescine 3-aminopropyltransferase" reversible="true"> | |
| 26877 <notes> | |
| 26878 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26879 <p>SUBSYSTEM: Arginine and proline metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glutathione metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Cysteine and methionine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26880 <p>EC_NUMBER: 2.5.1.16</p> | |
| 26881 <p>GENE_ASSOCIATION: buc_BU209</p> | |
| 26882 </body> | |
| 26883 </notes> | |
| 26884 <annotation> | |
| 26885 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26886 <rdf:Description rdf:about="#_73ff08a0-267b-4862-94c8-2a1870f9b8ad"> | |
| 26887 <bqbiol:is> | |
| 26888 <rdf:Bag> | |
| 26889 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.5.1.16"/> | |
| 26890 </rdf:Bag> | |
| 26891 </bqbiol:is> | |
| 26892 </rdf:Description> | |
| 26893 </rdf:RDF> | |
| 26894 </annotation> | |
| 26895 <fbc:geneProductAssociation> | |
| 26896 <fbc:geneProductRef fbc:geneProduct="buc_BU209"/> | |
| 26897 </fbc:geneProductAssociation> | |
| 26898 <listOfReactants> | |
| 26899 <speciesReference constant="true" species="C00134" stoichiometry="1"/> | |
| 26900 <speciesReference constant="true" species="C01137" stoichiometry="1"/> | |
| 26901 </listOfReactants> | |
| 26902 <listOfProducts> | |
| 26903 <speciesReference constant="true" species="C00170" stoichiometry="1"/> | |
| 26904 <speciesReference constant="true" species="C00315" stoichiometry="1"/> | |
| 26905 </listOfProducts> | |
| 26906 </reaction> | |
| 26907 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R12934" metaid="ff02ed7f-7959-444f-a066-86306ea93d91" name="R12934" reversible="true"> | |
| 26908 <notes> | |
| 26909 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26910 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biotin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26911 <p>EC_NUMBER: 6.3.3.3</p> | |
| 26912 <p>GENE_ASSOCIATION: buc_BU290</p> | |
| 26913 </body> | |
| 26914 </notes> | |
| 26915 <annotation> | |
| 26916 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26917 <rdf:Description rdf:about="#ff02ed7f-7959-444f-a066-86306ea93d91"> | |
| 26918 <bqbiol:is> | |
| 26919 <rdf:Bag> | |
| 26920 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.3.3.3"/> | |
| 26921 </rdf:Bag> | |
| 26922 </bqbiol:is> | |
| 26923 </rdf:Description> | |
| 26924 </rdf:RDF> | |
| 26925 </annotation> | |
| 26926 <fbc:geneProductAssociation> | |
| 26927 <fbc:geneProductRef fbc:geneProduct="buc_BU290"/> | |
| 26928 </fbc:geneProductAssociation> | |
| 26929 <listOfReactants> | |
| 26930 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 26931 <speciesReference constant="true" species="C22458" stoichiometry="1"/> | |
| 26932 </listOfReactants> | |
| 26933 <listOfProducts> | |
| 26934 <speciesReference constant="true" species="C01909" stoichiometry="1"/> | |
| 26935 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 26936 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 26937 </listOfProducts> | |
| 26938 </reaction> | |
| 26939 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R08689" metaid="_88a30b3c-6690-432d-94d0-ff1e23d7eb89" name="(E)-4-hydroxy-3-methylbut-2-en-1-yl-diphosphate:oxidized ferredoxin oxidoreductase (hydrating)" reversible="true"> | |
| 26940 <notes> | |
| 26941 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26942 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Terpenoid backbone biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26943 <p>EC_NUMBER: 1.17.7.1</p> | |
| 26944 <p>GENE_ASSOCIATION: buc_BU287</p> | |
| 26945 </body> | |
| 26946 </notes> | |
| 26947 <annotation> | |
| 26948 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26949 <rdf:Description rdf:about="#_88a30b3c-6690-432d-94d0-ff1e23d7eb89"> | |
| 26950 <bqbiol:is> | |
| 26951 <rdf:Bag> | |
| 26952 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.17.7.1"/> | |
| 26953 </rdf:Bag> | |
| 26954 </bqbiol:is> | |
| 26955 </rdf:Description> | |
| 26956 </rdf:RDF> | |
| 26957 </annotation> | |
| 26958 <fbc:geneProductAssociation> | |
| 26959 <fbc:geneProductRef fbc:geneProduct="buc_BU287"/> | |
| 26960 </fbc:geneProductAssociation> | |
| 26961 <listOfReactants> | |
| 26962 <speciesReference constant="true" species="C11453" stoichiometry="1"/> | |
| 26963 <speciesReference constant="true" species="C00138" stoichiometry="2"/> | |
| 26964 </listOfReactants> | |
| 26965 <listOfProducts> | |
| 26966 <speciesReference constant="true" species="C11811" stoichiometry="1"/> | |
| 26967 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 26968 <speciesReference constant="true" species="C00139" stoichiometry="2"/> | |
| 26969 </listOfProducts> | |
| 26970 </reaction> | |
| 26971 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R12933" metaid="_244bbdb6-f0f1-44ca-87f9-e8463be176af" name="R12933" reversible="true"> | |
| 26972 <notes> | |
| 26973 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 26974 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 26975 <p>EC_NUMBER: 6.3.3.3</p> | |
| 26976 <p>GENE_ASSOCIATION: buc_BU290</p> | |
| 26977 </body> | |
| 26978 </notes> | |
| 26979 <annotation> | |
| 26980 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 26981 <rdf:Description rdf:about="#_244bbdb6-f0f1-44ca-87f9-e8463be176af"> | |
| 26982 <bqbiol:is> | |
| 26983 <rdf:Bag> | |
| 26984 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.3.3.3"/> | |
| 26985 </rdf:Bag> | |
| 26986 </bqbiol:is> | |
| 26987 </rdf:Description> | |
| 26988 </rdf:RDF> | |
| 26989 </annotation> | |
| 26990 <fbc:geneProductAssociation> | |
| 26991 <fbc:geneProductRef fbc:geneProduct="buc_BU290"/> | |
| 26992 </fbc:geneProductAssociation> | |
| 26993 <listOfReactants> | |
| 26994 <speciesReference constant="true" species="C01037" stoichiometry="1"/> | |
| 26995 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 26996 </listOfReactants> | |
| 26997 <listOfProducts> | |
| 26998 <speciesReference constant="true" species="C22458" stoichiometry="1"/> | |
| 26999 </listOfProducts> | |
| 27000 </reaction> | |
| 27001 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R10993" metaid="_75d6ad46-030a-4efe-95f9-15cbf6c07033" name="L-glutamate:2-aminobutanoate gamma-ligase (ADP-forming)" reversible="true"> | |
| 27002 <notes> | |
| 27003 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27004 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Cysteine and methionine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27005 <p>EC_NUMBER: 6.3.2.2</p> | |
| 27006 <p>GENE_ASSOCIATION: buc_BU407</p> | |
| 27007 </body> | |
| 27008 </notes> | |
| 27009 <annotation> | |
| 27010 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27011 <rdf:Description rdf:about="#_75d6ad46-030a-4efe-95f9-15cbf6c07033"> | |
| 27012 <bqbiol:is> | |
| 27013 <rdf:Bag> | |
| 27014 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.3.2.2"/> | |
| 27015 </rdf:Bag> | |
| 27016 </bqbiol:is> | |
| 27017 </rdf:Description> | |
| 27018 </rdf:RDF> | |
| 27019 </annotation> | |
| 27020 <fbc:geneProductAssociation> | |
| 27021 <fbc:geneProductRef fbc:geneProduct="buc_BU407"/> | |
| 27022 </fbc:geneProductAssociation> | |
| 27023 <listOfReactants> | |
| 27024 <speciesReference constant="true" species="C00025" stoichiometry="1"/> | |
| 27025 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 27026 <speciesReference constant="true" species="C02356" stoichiometry="1"/> | |
| 27027 </listOfReactants> | |
| 27028 <listOfProducts> | |
| 27029 <speciesReference constant="true" species="C21015" stoichiometry="1"/> | |
| 27030 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 27031 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 27032 </listOfProducts> | |
| 27033 </reaction> | |
| 27034 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R10994" metaid="_8709d1bd-b814-490f-b99f-e430ac3e696b" name="gamma-L-glutamyl-L-2-aminobutyrate:glycine ligase (ADP-forming)" reversible="true"> | |
| 27035 <notes> | |
| 27036 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27037 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Cysteine and methionine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27038 <p>EC_NUMBER: 6.3.2.3</p> | |
| 27039 <p>GENE_ASSOCIATION: buc_BU547</p> | |
| 27040 </body> | |
| 27041 </notes> | |
| 27042 <annotation> | |
| 27043 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27044 <rdf:Description rdf:about="#_8709d1bd-b814-490f-b99f-e430ac3e696b"> | |
| 27045 <bqbiol:is> | |
| 27046 <rdf:Bag> | |
| 27047 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.3.2.3"/> | |
| 27048 </rdf:Bag> | |
| 27049 </bqbiol:is> | |
| 27050 </rdf:Description> | |
| 27051 </rdf:RDF> | |
| 27052 </annotation> | |
| 27053 <fbc:geneProductAssociation> | |
| 27054 <fbc:geneProductRef fbc:geneProduct="buc_BU547"/> | |
| 27055 </fbc:geneProductAssociation> | |
| 27056 <listOfReactants> | |
| 27057 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 27058 <speciesReference constant="true" species="C21015" stoichiometry="1"/> | |
| 27059 <speciesReference constant="true" species="C00037" stoichiometry="1"/> | |
| 27060 </listOfReactants> | |
| 27061 <listOfProducts> | |
| 27062 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 27063 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 27064 <speciesReference constant="true" species="C21016" stoichiometry="1"/> | |
| 27065 </listOfProducts> | |
| 27066 </reaction> | |
| 27067 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01715" metaid="abde61fd-4b9d-4d8f-ab8d-ed8ee39c88b8" name="Chorismate pyruvatemutase" reversible="true"> | |
| 27068 <notes> | |
| 27069 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27070 <p>SUBSYSTEM: Phenylalanine, tyrosine and tryptophan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27071 <p>EC_NUMBER: 5.4.99.5</p> | |
| 27072 <p>GENE_ASSOCIATION: buc_BU392</p> | |
| 27073 </body> | |
| 27074 </notes> | |
| 27075 <annotation> | |
| 27076 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27077 <rdf:Description rdf:about="#abde61fd-4b9d-4d8f-ab8d-ed8ee39c88b8"> | |
| 27078 <bqbiol:is> | |
| 27079 <rdf:Bag> | |
| 27080 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.4.99.5"/> | |
| 27081 </rdf:Bag> | |
| 27082 </bqbiol:is> | |
| 27083 </rdf:Description> | |
| 27084 </rdf:RDF> | |
| 27085 </annotation> | |
| 27086 <fbc:geneProductAssociation> | |
| 27087 <fbc:geneProductRef fbc:geneProduct="buc_BU392"/> | |
| 27088 </fbc:geneProductAssociation> | |
| 27089 <listOfReactants> | |
| 27090 <speciesReference constant="true" species="C00251" stoichiometry="1"/> | |
| 27091 </listOfReactants> | |
| 27092 <listOfProducts> | |
| 27093 <speciesReference constant="true" species="C00254" stoichiometry="1"/> | |
| 27094 </listOfProducts> | |
| 27095 </reaction> | |
| 27096 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00508" metaid="_697a869d-b318-461b-9b5c-cee7178f60ad" name="3'-phospho-5'-adenylyl sulfate 3'-phosphohydrolase" reversible="true"> | |
| 27097 <notes> | |
| 27098 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27099 <p>SUBSYSTEM: Sulfur metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27100 <p>EC_NUMBER: 3.1.3.7</p> | |
| 27101 <p>GENE_ASSOCIATION: ( buc_BU422 ) OR ( buc_BU561 )</p> | |
| 27102 </body> | |
| 27103 </notes> | |
| 27104 <annotation> | |
| 27105 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27106 <rdf:Description rdf:about="#_697a869d-b318-461b-9b5c-cee7178f60ad"> | |
| 27107 <bqbiol:is> | |
| 27108 <rdf:Bag> | |
| 27109 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.1.3.7"/> | |
| 27110 </rdf:Bag> | |
| 27111 </bqbiol:is> | |
| 27112 </rdf:Description> | |
| 27113 </rdf:RDF> | |
| 27114 </annotation> | |
| 27115 <fbc:geneProductAssociation> | |
| 27116 <fbc:or> | |
| 27117 <fbc:geneProductRef fbc:geneProduct="buc_BU561"/> | |
| 27118 <fbc:geneProductRef fbc:geneProduct="buc_BU422"/> | |
| 27119 </fbc:or> | |
| 27120 </fbc:geneProductAssociation> | |
| 27121 <listOfReactants> | |
| 27122 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 27123 <speciesReference constant="true" species="C00053" stoichiometry="1"/> | |
| 27124 </listOfReactants> | |
| 27125 <listOfProducts> | |
| 27126 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 27127 <speciesReference constant="true" species="C00224" stoichiometry="1"/> | |
| 27128 </listOfProducts> | |
| 27129 </reaction> | |
| 27130 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00509" metaid="_814849a6-6123-4647-8d03-783a37479399" name="ATP:adenylylsulfate 3'-phosphotransferase" reversible="true"> | |
| 27131 <notes> | |
| 27132 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27133 <p>SUBSYSTEM: Sulfur metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Purine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27134 <p>EC_NUMBER: 2.7.1.25</p> | |
| 27135 <p>GENE_ASSOCIATION: buc_BU422</p> | |
| 27136 </body> | |
| 27137 </notes> | |
| 27138 <annotation> | |
| 27139 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27140 <rdf:Description rdf:about="#_814849a6-6123-4647-8d03-783a37479399"> | |
| 27141 <bqbiol:is> | |
| 27142 <rdf:Bag> | |
| 27143 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.25"/> | |
| 27144 </rdf:Bag> | |
| 27145 </bqbiol:is> | |
| 27146 </rdf:Description> | |
| 27147 </rdf:RDF> | |
| 27148 </annotation> | |
| 27149 <fbc:geneProductAssociation> | |
| 27150 <fbc:geneProductRef fbc:geneProduct="buc_BU422"/> | |
| 27151 </fbc:geneProductAssociation> | |
| 27152 <listOfReactants> | |
| 27153 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 27154 <speciesReference constant="true" species="C00224" stoichiometry="1"/> | |
| 27155 </listOfReactants> | |
| 27156 <listOfProducts> | |
| 27157 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 27158 <speciesReference constant="true" species="C00053" stoichiometry="1"/> | |
| 27159 </listOfProducts> | |
| 27160 </reaction> | |
| 27161 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00861" metaid="_5d3b7029-6795-44a5-adef-36e4a702c95a" name="hydrogen-sulfide:[DsrC sulfur-carrier protein],acceptor oxidoreductase" reversible="true"> | |
| 27162 <notes> | |
| 27163 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27164 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27165 <p>GENE_ASSOCIATION: ( buc_BU427 ) OR ( buc_BU428 )</p> | |
| 27166 </body> | |
| 27167 </notes> | |
| 27168 <fbc:geneProductAssociation> | |
| 27169 <fbc:or> | |
| 27170 <fbc:geneProductRef fbc:geneProduct="buc_BU427"/> | |
| 27171 <fbc:geneProductRef fbc:geneProduct="buc_BU428"/> | |
| 27172 </fbc:or> | |
| 27173 </fbc:geneProductAssociation> | |
| 27174 <listOfReactants> | |
| 27175 <speciesReference constant="true" species="C00028" stoichiometry="2"/> | |
| 27176 <speciesReference constant="true" species="C00001" stoichiometry="3"/> | |
| 27177 <speciesReference constant="true" species="C02582" stoichiometry="1"/> | |
| 27178 <speciesReference constant="true" species="C00283" stoichiometry="1"/> | |
| 27179 </listOfReactants> | |
| 27180 <listOfProducts> | |
| 27181 <speciesReference constant="true" species="C00080" stoichiometry="2"/> | |
| 27182 <speciesReference constant="true" species="C00030" stoichiometry="2"/> | |
| 27183 <speciesReference constant="true" species="C00094" stoichiometry="1"/> | |
| 27184 <speciesReference constant="true" species="C02315" stoichiometry="1"/> | |
| 27185 </listOfProducts> | |
| 27186 </reaction> | |
| 27187 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01830" metaid="_53926fd3-a477-4baa-86a1-81eee7fe737c" name="beta-D-Fructose 6-phosphate:D-glyceraldehyde-3-phosphate glycolaldehyde transferase" reversible="true"> | |
| 27188 <notes> | |
| 27189 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27190 <p>SUBSYSTEM: Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pentose phosphate pathway - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27191 <p>EC_NUMBER: 2.2.1.1</p> | |
| 27192 <p>GENE_ASSOCIATION: buc_BU094</p> | |
| 27193 </body> | |
| 27194 </notes> | |
| 27195 <annotation> | |
| 27196 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27197 <rdf:Description rdf:about="#_53926fd3-a477-4baa-86a1-81eee7fe737c"> | |
| 27198 <bqbiol:is> | |
| 27199 <rdf:Bag> | |
| 27200 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.2.1.1"/> | |
| 27201 </rdf:Bag> | |
| 27202 </bqbiol:is> | |
| 27203 </rdf:Description> | |
| 27204 </rdf:RDF> | |
| 27205 </annotation> | |
| 27206 <fbc:geneProductAssociation> | |
| 27207 <fbc:geneProductRef fbc:geneProduct="buc_BU094"/> | |
| 27208 </fbc:geneProductAssociation> | |
| 27209 <listOfReactants> | |
| 27210 <speciesReference constant="true" species="C05345" stoichiometry="1"/> | |
| 27211 <speciesReference constant="true" species="C00118" stoichiometry="1"/> | |
| 27212 </listOfReactants> | |
| 27213 <listOfProducts> | |
| 27214 <speciesReference constant="true" species="C00231" stoichiometry="1"/> | |
| 27215 <speciesReference constant="true" species="C00279" stoichiometry="1"/> | |
| 27216 </listOfProducts> | |
| 27217 </reaction> | |
| 27218 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00621" metaid="d6e9ac54-f056-464a-9384-17e18a473a16" name="R00621" reversible="false"> | |
| 27219 <notes> | |
| 27220 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27221 <p>SUBSYSTEM: Citrate cycle (TCA cycle) - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27222 <p>EC_NUMBER: 1.2.4.2</p> | |
| 27223 <p>GENE_ASSOCIATION: buc_BU302</p> | |
| 27224 </body> | |
| 27225 </notes> | |
| 27226 <annotation> | |
| 27227 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27228 <rdf:Description rdf:about="#d6e9ac54-f056-464a-9384-17e18a473a16"> | |
| 27229 <bqbiol:is> | |
| 27230 <rdf:Bag> | |
| 27231 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.2.4.2"/> | |
| 27232 </rdf:Bag> | |
| 27233 </bqbiol:is> | |
| 27234 </rdf:Description> | |
| 27235 </rdf:RDF> | |
| 27236 </annotation> | |
| 27237 <fbc:geneProductAssociation> | |
| 27238 <fbc:geneProductRef fbc:geneProduct="buc_BU302"/> | |
| 27239 </fbc:geneProductAssociation> | |
| 27240 <listOfReactants> | |
| 27241 <speciesReference constant="true" species="C00026" stoichiometry="1"/> | |
| 27242 <speciesReference constant="true" species="C00068" stoichiometry="1"/> | |
| 27243 </listOfReactants> | |
| 27244 <listOfProducts> | |
| 27245 <speciesReference constant="true" species="C05381" stoichiometry="1"/> | |
| 27246 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 27247 </listOfProducts> | |
| 27248 </reaction> | |
| 27249 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00985" metaid="a4260ecf-c1ce-4e28-a028-5c168d0d17d6" name="chorismate pyruvate-lyase (amino-accepting anthranilate-forming)" reversible="true"> | |
| 27250 <notes> | |
| 27251 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27252 <p>SUBSYSTEM: Phenylalanine, tyrosine and tryptophan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27253 <p>EC_NUMBER: 4.1.3.27</p> | |
| 27254 <p>GENE_ASSOCIATION: ( buc_BUpT01 ) OR ( buc_BUpT02 ) OR ( buc_BUpT04 )</p> | |
| 27255 </body> | |
| 27256 </notes> | |
| 27257 <annotation> | |
| 27258 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27259 <rdf:Description rdf:about="#a4260ecf-c1ce-4e28-a028-5c168d0d17d6"> | |
| 27260 <bqbiol:is> | |
| 27261 <rdf:Bag> | |
| 27262 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.1.3.27"/> | |
| 27263 </rdf:Bag> | |
| 27264 </bqbiol:is> | |
| 27265 </rdf:Description> | |
| 27266 </rdf:RDF> | |
| 27267 </annotation> | |
| 27268 <fbc:geneProductAssociation> | |
| 27269 <fbc:or> | |
| 27270 <fbc:geneProductRef fbc:geneProduct="buc_BUpT04"/> | |
| 27271 <fbc:geneProductRef fbc:geneProduct="buc_BUpT02"/> | |
| 27272 <fbc:geneProductRef fbc:geneProduct="buc_BUpT01"/> | |
| 27273 </fbc:or> | |
| 27274 </fbc:geneProductAssociation> | |
| 27275 <listOfReactants> | |
| 27276 <speciesReference constant="true" species="C00014" stoichiometry="1"/> | |
| 27277 <speciesReference constant="true" species="C00251" stoichiometry="1"/> | |
| 27278 </listOfReactants> | |
| 27279 <listOfProducts> | |
| 27280 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 27281 <speciesReference constant="true" species="C00108" stoichiometry="1"/> | |
| 27282 <speciesReference constant="true" species="C00022" stoichiometry="1"/> | |
| 27283 </listOfProducts> | |
| 27284 </reaction> | |
| 27285 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01954" metaid="_1a0abf4f-5ebe-4cdf-bee1-c7ff411bcd61" name="L-Citrulline:L-aspartate ligase (AMP-forming)" reversible="true"> | |
| 27286 <notes> | |
| 27287 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27288 <p>SUBSYSTEM: Arginine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Alanine, aspartate and glutamate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27289 <p>EC_NUMBER: 6.3.4.5</p> | |
| 27290 <p>GENE_ASSOCIATION: buc_BU050</p> | |
| 27291 </body> | |
| 27292 </notes> | |
| 27293 <annotation> | |
| 27294 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27295 <rdf:Description rdf:about="#_1a0abf4f-5ebe-4cdf-bee1-c7ff411bcd61"> | |
| 27296 <bqbiol:is> | |
| 27297 <rdf:Bag> | |
| 27298 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.3.4.5"/> | |
| 27299 </rdf:Bag> | |
| 27300 </bqbiol:is> | |
| 27301 </rdf:Description> | |
| 27302 </rdf:RDF> | |
| 27303 </annotation> | |
| 27304 <fbc:geneProductAssociation> | |
| 27305 <fbc:geneProductRef fbc:geneProduct="buc_BU050"/> | |
| 27306 </fbc:geneProductAssociation> | |
| 27307 <listOfReactants> | |
| 27308 <speciesReference constant="true" species="C00049" stoichiometry="1"/> | |
| 27309 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 27310 <speciesReference constant="true" species="C00327" stoichiometry="1"/> | |
| 27311 </listOfReactants> | |
| 27312 <listOfProducts> | |
| 27313 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 27314 <speciesReference constant="true" species="C03406" stoichiometry="1"/> | |
| 27315 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 27316 </listOfProducts> | |
| 27317 </reaction> | |
| 27318 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00986" metaid="_86dbab6d-067c-4d0f-bb57-5e5300580de6" name="Chorismate pyruvate-lyase (amino-accepting)" reversible="true"> | |
| 27319 <notes> | |
| 27320 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27321 <p>SUBSYSTEM: Phenylalanine, tyrosine and tryptophan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27322 <p>EC_NUMBER: 4.1.3.27</p> | |
| 27323 <p>GENE_ASSOCIATION: ( buc_BUpT01 ) OR ( buc_BUpT02 ) OR ( buc_BUpT04 )</p> | |
| 27324 </body> | |
| 27325 </notes> | |
| 27326 <annotation> | |
| 27327 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27328 <rdf:Description rdf:about="#_86dbab6d-067c-4d0f-bb57-5e5300580de6"> | |
| 27329 <bqbiol:is> | |
| 27330 <rdf:Bag> | |
| 27331 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.1.3.27"/> | |
| 27332 </rdf:Bag> | |
| 27333 </bqbiol:is> | |
| 27334 </rdf:Description> | |
| 27335 </rdf:RDF> | |
| 27336 </annotation> | |
| 27337 <fbc:geneProductAssociation> | |
| 27338 <fbc:or> | |
| 27339 <fbc:geneProductRef fbc:geneProduct="buc_BUpT04"/> | |
| 27340 <fbc:geneProductRef fbc:geneProduct="buc_BUpT02"/> | |
| 27341 <fbc:geneProductRef fbc:geneProduct="buc_BUpT01"/> | |
| 27342 </fbc:or> | |
| 27343 </fbc:geneProductAssociation> | |
| 27344 <listOfReactants> | |
| 27345 <speciesReference constant="true" species="C00251" stoichiometry="1"/> | |
| 27346 <speciesReference constant="true" species="C00064" stoichiometry="1"/> | |
| 27347 </listOfReactants> | |
| 27348 <listOfProducts> | |
| 27349 <speciesReference constant="true" species="C00025" stoichiometry="1"/> | |
| 27350 <speciesReference constant="true" species="C00108" stoichiometry="1"/> | |
| 27351 <speciesReference constant="true" species="C00022" stoichiometry="1"/> | |
| 27352 </listOfProducts> | |
| 27353 </reaction> | |
| 27354 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01714" metaid="_3eebfb25-24ef-4bbd-96d6-2451d3ae5d94" name="5-O-(1-Carboxyvinyl)-3-phosphoshikimate phosphate-lyase (chorismate-forming)" reversible="true"> | |
| 27355 <notes> | |
| 27356 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27357 <p>SUBSYSTEM: Phenylalanine, tyrosine and tryptophan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27358 <p>EC_NUMBER: 4.2.3.5</p> | |
| 27359 <p>GENE_ASSOCIATION: buc_BU097</p> | |
| 27360 </body> | |
| 27361 </notes> | |
| 27362 <annotation> | |
| 27363 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27364 <rdf:Description rdf:about="#_3eebfb25-24ef-4bbd-96d6-2451d3ae5d94"> | |
| 27365 <bqbiol:is> | |
| 27366 <rdf:Bag> | |
| 27367 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.2.3.5"/> | |
| 27368 </rdf:Bag> | |
| 27369 </bqbiol:is> | |
| 27370 </rdf:Description> | |
| 27371 </rdf:RDF> | |
| 27372 </annotation> | |
| 27373 <fbc:geneProductAssociation> | |
| 27374 <fbc:geneProductRef fbc:geneProduct="buc_BU097"/> | |
| 27375 </fbc:geneProductAssociation> | |
| 27376 <listOfReactants> | |
| 27377 <speciesReference constant="true" species="C01269" stoichiometry="1"/> | |
| 27378 </listOfReactants> | |
| 27379 <listOfProducts> | |
| 27380 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 27381 <speciesReference constant="true" species="C00251" stoichiometry="1"/> | |
| 27382 </listOfProducts> | |
| 27383 </reaction> | |
| 27384 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R08359" metaid="_5fd8100b-b731-4fb4-bfeb-459bfea2325e" name="S-adenosylmethioninamine:cadaverine 3-aminopropyltransferase" reversible="false"> | |
| 27385 <notes> | |
| 27386 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27387 <p>SUBSYSTEM: Glutathione metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27388 <p>EC_NUMBER: 2.5.1.16</p> | |
| 27389 <p>GENE_ASSOCIATION: buc_BU209</p> | |
| 27390 </body> | |
| 27391 </notes> | |
| 27392 <annotation> | |
| 27393 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27394 <rdf:Description rdf:about="#_5fd8100b-b731-4fb4-bfeb-459bfea2325e"> | |
| 27395 <bqbiol:is> | |
| 27396 <rdf:Bag> | |
| 27397 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.5.1.16"/> | |
| 27398 </rdf:Bag> | |
| 27399 </bqbiol:is> | |
| 27400 </rdf:Description> | |
| 27401 </rdf:RDF> | |
| 27402 </annotation> | |
| 27403 <fbc:geneProductAssociation> | |
| 27404 <fbc:geneProductRef fbc:geneProduct="buc_BU209"/> | |
| 27405 </fbc:geneProductAssociation> | |
| 27406 <listOfReactants> | |
| 27407 <speciesReference constant="true" species="C01672" stoichiometry="1"/> | |
| 27408 <speciesReference constant="true" species="C01137" stoichiometry="1"/> | |
| 27409 </listOfReactants> | |
| 27410 <listOfProducts> | |
| 27411 <speciesReference constant="true" species="C16565" stoichiometry="1"/> | |
| 27412 <speciesReference constant="true" species="C00170" stoichiometry="1"/> | |
| 27413 </listOfProducts> | |
| 27414 </reaction> | |
| 27415 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R05085" metaid="c920518e-9882-4a74-8079-b2f064ccd80b" name="O-Phospho-4-hydroxy-L-threonine:2-oxoglutarate aminotransferase" reversible="true"> | |
| 27416 <notes> | |
| 27417 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27418 <p>SUBSYSTEM: Vitamin B6 metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27419 <p>EC_NUMBER: 2.6.1.52</p> | |
| 27420 <p>GENE_ASSOCIATION: buc_BU312</p> | |
| 27421 </body> | |
| 27422 </notes> | |
| 27423 <annotation> | |
| 27424 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27425 <rdf:Description rdf:about="#c920518e-9882-4a74-8079-b2f064ccd80b"> | |
| 27426 <bqbiol:is> | |
| 27427 <rdf:Bag> | |
| 27428 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.6.1.52"/> | |
| 27429 </rdf:Bag> | |
| 27430 </bqbiol:is> | |
| 27431 </rdf:Description> | |
| 27432 </rdf:RDF> | |
| 27433 </annotation> | |
| 27434 <fbc:geneProductAssociation> | |
| 27435 <fbc:geneProductRef fbc:geneProduct="buc_BU312"/> | |
| 27436 </fbc:geneProductAssociation> | |
| 27437 <listOfReactants> | |
| 27438 <speciesReference constant="true" species="C00026" stoichiometry="1"/> | |
| 27439 <speciesReference constant="true" species="C06055" stoichiometry="1"/> | |
| 27440 </listOfReactants> | |
| 27441 <listOfProducts> | |
| 27442 <speciesReference constant="true" species="C06054" stoichiometry="1"/> | |
| 27443 <speciesReference constant="true" species="C00025" stoichiometry="1"/> | |
| 27444 </listOfProducts> | |
| 27445 </reaction> | |
| 27446 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R12608" metaid="dcf9cb3f-3c5e-441f-a1f6-324b633166bc" name="GTP:3'-dephospho-CoA 3'-phosphotransferase" reversible="true"> | |
| 27447 <notes> | |
| 27448 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27449 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27450 <p>GENE_ASSOCIATION: buc_BU203</p> | |
| 27451 </body> | |
| 27452 </notes> | |
| 27453 <fbc:geneProductAssociation> | |
| 27454 <fbc:geneProductRef fbc:geneProduct="buc_BU203"/> | |
| 27455 </fbc:geneProductAssociation> | |
| 27456 <listOfReactants> | |
| 27457 <speciesReference constant="true" species="C00882" stoichiometry="1"/> | |
| 27458 <speciesReference constant="true" species="C00044" stoichiometry="1"/> | |
| 27459 </listOfReactants> | |
| 27460 <listOfProducts> | |
| 27461 <speciesReference constant="true" species="C00035" stoichiometry="1"/> | |
| 27462 <speciesReference constant="true" species="C00010" stoichiometry="1"/> | |
| 27463 </listOfProducts> | |
| 27464 </reaction> | |
| 27465 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R05086" metaid="_71c097da-2898-442a-b16d-87a0fee60cfa" name="O-Phospho-4-hydroxy-L-threonine phospho-lyase (adding water)" reversible="false"> | |
| 27466 <notes> | |
| 27467 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27468 <p>SUBSYSTEM: Vitamin B6 metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27469 <p>EC_NUMBER: 4.2.3.1</p> | |
| 27470 <p>GENE_ASSOCIATION: buc_BU192</p> | |
| 27471 </body> | |
| 27472 </notes> | |
| 27473 <annotation> | |
| 27474 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27475 <rdf:Description rdf:about="#_71c097da-2898-442a-b16d-87a0fee60cfa"> | |
| 27476 <bqbiol:is> | |
| 27477 <rdf:Bag> | |
| 27478 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.2.3.1"/> | |
| 27479 </rdf:Bag> | |
| 27480 </bqbiol:is> | |
| 27481 </rdf:Description> | |
| 27482 </rdf:RDF> | |
| 27483 </annotation> | |
| 27484 <fbc:geneProductAssociation> | |
| 27485 <fbc:geneProductRef fbc:geneProduct="buc_BU192"/> | |
| 27486 </fbc:geneProductAssociation> | |
| 27487 <listOfReactants> | |
| 27488 <speciesReference constant="true" species="C06055" stoichiometry="1"/> | |
| 27489 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 27490 </listOfReactants> | |
| 27491 <listOfProducts> | |
| 27492 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 27493 <speciesReference constant="true" species="C06056" stoichiometry="1"/> | |
| 27494 </listOfProducts> | |
| 27495 </reaction> | |
| 27496 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00615" metaid="b343eca8-3d3f-4eec-b29d-e4f36fac1495" name="Thiamin diphosphate phosphohydrolase" reversible="true"> | |
| 27497 <notes> | |
| 27498 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27499 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27500 <p>GENE_ASSOCIATION: buc_BU460</p> | |
| 27501 </body> | |
| 27502 </notes> | |
| 27503 <fbc:geneProductAssociation> | |
| 27504 <fbc:geneProductRef fbc:geneProduct="buc_BU460"/> | |
| 27505 </fbc:geneProductAssociation> | |
| 27506 <listOfReactants> | |
| 27507 <speciesReference constant="true" species="C00068" stoichiometry="1"/> | |
| 27508 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 27509 </listOfReactants> | |
| 27510 <listOfProducts> | |
| 27511 <speciesReference constant="true" species="C01081" stoichiometry="1"/> | |
| 27512 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 27513 </listOfProducts> | |
| 27514 </reaction> | |
| 27515 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00858" metaid="_2e43fed3-8716-4e61-ae5d-dfb2f951ca74" name="hydrogen-sulfide:NADP+ oxidoreductase" reversible="true"> | |
| 27516 <notes> | |
| 27517 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27518 <p>SUBSYSTEM: Sulfur metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27519 <p>EC_NUMBER: 1.8.1.2</p> | |
| 27520 <p>GENE_ASSOCIATION: ( buc_BU427 ) OR ( buc_BU428 )</p> | |
| 27521 </body> | |
| 27522 </notes> | |
| 27523 <annotation> | |
| 27524 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27525 <rdf:Description rdf:about="#_2e43fed3-8716-4e61-ae5d-dfb2f951ca74"> | |
| 27526 <bqbiol:is> | |
| 27527 <rdf:Bag> | |
| 27528 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.8.1.2"/> | |
| 27529 </rdf:Bag> | |
| 27530 </bqbiol:is> | |
| 27531 </rdf:Description> | |
| 27532 </rdf:RDF> | |
| 27533 </annotation> | |
| 27534 <fbc:geneProductAssociation> | |
| 27535 <fbc:or> | |
| 27536 <fbc:geneProductRef fbc:geneProduct="buc_BU427"/> | |
| 27537 <fbc:geneProductRef fbc:geneProduct="buc_BU428"/> | |
| 27538 </fbc:or> | |
| 27539 </fbc:geneProductAssociation> | |
| 27540 <listOfReactants> | |
| 27541 <speciesReference constant="true" species="C00001" stoichiometry="3"/> | |
| 27542 <speciesReference constant="true" species="C00006" stoichiometry="3"/> | |
| 27543 <speciesReference constant="true" species="C00283" stoichiometry="1"/> | |
| 27544 </listOfReactants> | |
| 27545 <listOfProducts> | |
| 27546 <speciesReference constant="true" species="C00005" stoichiometry="3"/> | |
| 27547 <speciesReference constant="true" species="C00080" stoichiometry="3"/> | |
| 27548 <speciesReference constant="true" species="C00094" stoichiometry="1"/> | |
| 27549 </listOfProducts> | |
| 27550 </reaction> | |
| 27551 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01826" metaid="a43906ce-20d8-4a72-8b86-0203adeb7d39" name="Phosphoenolpyruvate:D-erythrose-4-phosphate C-(1-carboxyvinyl)transferase (phosphate hydrolysing, 2-carboxy-2-oxoethyl-forming)" reversible="true"> | |
| 27552 <notes> | |
| 27553 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27554 <p>SUBSYSTEM: Phenylalanine, tyrosine and tryptophan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27555 <p>EC_NUMBER: 2.5.1.54</p> | |
| 27556 <p>GENE_ASSOCIATION: buc_BU124</p> | |
| 27557 </body> | |
| 27558 </notes> | |
| 27559 <annotation> | |
| 27560 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27561 <rdf:Description rdf:about="#a43906ce-20d8-4a72-8b86-0203adeb7d39"> | |
| 27562 <bqbiol:is> | |
| 27563 <rdf:Bag> | |
| 27564 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.5.1.54"/> | |
| 27565 </rdf:Bag> | |
| 27566 </bqbiol:is> | |
| 27567 </rdf:Description> | |
| 27568 </rdf:RDF> | |
| 27569 </annotation> | |
| 27570 <fbc:geneProductAssociation> | |
| 27571 <fbc:geneProductRef fbc:geneProduct="buc_BU124"/> | |
| 27572 </fbc:geneProductAssociation> | |
| 27573 <listOfReactants> | |
| 27574 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 27575 <speciesReference constant="true" species="C00074" stoichiometry="1"/> | |
| 27576 <speciesReference constant="true" species="C00279" stoichiometry="1"/> | |
| 27577 </listOfReactants> | |
| 27578 <listOfProducts> | |
| 27579 <speciesReference constant="true" species="C04691" stoichiometry="1"/> | |
| 27580 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 27581 </listOfProducts> | |
| 27582 </reaction> | |
| 27583 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00616" metaid="_09f9582c-3fab-4edc-bf84-ceed5a32278e" name="ATP:thiamine-diphosphate phosphotransferase" reversible="true"> | |
| 27584 <notes> | |
| 27585 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27586 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27587 <p>GENE_ASSOCIATION: buc_BU484</p> | |
| 27588 </body> | |
| 27589 </notes> | |
| 27590 <fbc:geneProductAssociation> | |
| 27591 <fbc:geneProductRef fbc:geneProduct="buc_BU484"/> | |
| 27592 </fbc:geneProductAssociation> | |
| 27593 <listOfReactants> | |
| 27594 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 27595 <speciesReference constant="true" species="C00068" stoichiometry="1"/> | |
| 27596 </listOfReactants> | |
| 27597 <listOfProducts> | |
| 27598 <speciesReference constant="true" species="C03028" stoichiometry="1"/> | |
| 27599 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 27600 </listOfProducts> | |
| 27601 </reaction> | |
| 27602 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01827" metaid="_35744342-9ed0-463f-b50a-c2a556dae26b" name="sedoheptulose-7-phosphate:D-glyceraldehyde-3-phosphate glyceronetransferase" reversible="true"> | |
| 27603 <notes> | |
| 27604 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27605 <p>SUBSYSTEM: Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Pentose phosphate pathway - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27606 <p>EC_NUMBER: 2.2.1.2</p> | |
| 27607 <p>GENE_ASSOCIATION: buc_BU093</p> | |
| 27608 </body> | |
| 27609 </notes> | |
| 27610 <annotation> | |
| 27611 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27612 <rdf:Description rdf:about="#_35744342-9ed0-463f-b50a-c2a556dae26b"> | |
| 27613 <bqbiol:is> | |
| 27614 <rdf:Bag> | |
| 27615 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.2.1.2"/> | |
| 27616 </rdf:Bag> | |
| 27617 </bqbiol:is> | |
| 27618 </rdf:Description> | |
| 27619 </rdf:RDF> | |
| 27620 </annotation> | |
| 27621 <fbc:geneProductAssociation> | |
| 27622 <fbc:geneProductRef fbc:geneProduct="buc_BU093"/> | |
| 27623 </fbc:geneProductAssociation> | |
| 27624 <listOfReactants> | |
| 27625 <speciesReference constant="true" species="C05382" stoichiometry="1"/> | |
| 27626 <speciesReference constant="true" species="C00118" stoichiometry="1"/> | |
| 27627 </listOfReactants> | |
| 27628 <listOfProducts> | |
| 27629 <speciesReference constant="true" species="C05345" stoichiometry="1"/> | |
| 27630 <speciesReference constant="true" species="C00279" stoichiometry="1"/> | |
| 27631 </listOfProducts> | |
| 27632 </reaction> | |
| 27633 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00859" metaid="bcaa8ea5-9e9d-4478-bbfc-6677b0dd190f" name="Hydrogen-sulfide:ferredoxin oxidoreductase" reversible="true"> | |
| 27634 <notes> | |
| 27635 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27636 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27637 <p>GENE_ASSOCIATION: ( buc_BU427 ) OR ( buc_BU428 )</p> | |
| 27638 </body> | |
| 27639 </notes> | |
| 27640 <fbc:geneProductAssociation> | |
| 27641 <fbc:or> | |
| 27642 <fbc:geneProductRef fbc:geneProduct="buc_BU427"/> | |
| 27643 <fbc:geneProductRef fbc:geneProduct="buc_BU428"/> | |
| 27644 </fbc:or> | |
| 27645 </fbc:geneProductAssociation> | |
| 27646 <listOfReactants> | |
| 27647 <speciesReference constant="true" species="C00001" stoichiometry="3"/> | |
| 27648 <speciesReference constant="true" species="C00139" stoichiometry="6"/> | |
| 27649 <speciesReference constant="true" species="C00283" stoichiometry="1"/> | |
| 27650 </listOfReactants> | |
| 27651 <listOfProducts> | |
| 27652 <speciesReference constant="true" species="C00138" stoichiometry="6"/> | |
| 27653 <speciesReference constant="true" species="C00080" stoichiometry="6"/> | |
| 27654 <speciesReference constant="true" species="C00094" stoichiometry="1"/> | |
| 27655 </listOfProducts> | |
| 27656 </reaction> | |
| 27657 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00617" metaid="_5b2e4666-ea6e-400c-955a-fabc78aebd49" name="ATP:thiamin-phosphate phosphotransferase" reversible="true"> | |
| 27658 <notes> | |
| 27659 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27660 <p>SUBSYSTEM: Thiamine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27661 <p>EC_NUMBER: 2.7.4.16</p> | |
| 27662 <p>GENE_ASSOCIATION: buc_BU460</p> | |
| 27663 </body> | |
| 27664 </notes> | |
| 27665 <annotation> | |
| 27666 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27667 <rdf:Description rdf:about="#_5b2e4666-ea6e-400c-955a-fabc78aebd49"> | |
| 27668 <bqbiol:is> | |
| 27669 <rdf:Bag> | |
| 27670 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.4.16"/> | |
| 27671 </rdf:Bag> | |
| 27672 </bqbiol:is> | |
| 27673 </rdf:Description> | |
| 27674 </rdf:RDF> | |
| 27675 </annotation> | |
| 27676 <fbc:geneProductAssociation> | |
| 27677 <fbc:geneProductRef fbc:geneProduct="buc_BU460"/> | |
| 27678 </fbc:geneProductAssociation> | |
| 27679 <listOfReactants> | |
| 27680 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 27681 <speciesReference constant="true" species="C01081" stoichiometry="1"/> | |
| 27682 </listOfReactants> | |
| 27683 <listOfProducts> | |
| 27684 <speciesReference constant="true" species="C00068" stoichiometry="1"/> | |
| 27685 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 27686 </listOfProducts> | |
| 27687 </reaction> | |
| 27688 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00618" metaid="_4a4ebb49-4cff-4739-8964-83955499d500" name="Thiamin-triphosphate phosphohydrolase" reversible="true"> | |
| 27689 <notes> | |
| 27690 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27691 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27692 <p>GENE_ASSOCIATION: buc_BU484</p> | |
| 27693 </body> | |
| 27694 </notes> | |
| 27695 <fbc:geneProductAssociation> | |
| 27696 <fbc:geneProductRef fbc:geneProduct="buc_BU484"/> | |
| 27697 </fbc:geneProductAssociation> | |
| 27698 <listOfReactants> | |
| 27699 <speciesReference constant="true" species="C03028" stoichiometry="1"/> | |
| 27700 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 27701 </listOfReactants> | |
| 27702 <listOfProducts> | |
| 27703 <speciesReference constant="true" species="C00068" stoichiometry="1"/> | |
| 27704 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 27705 </listOfProducts> | |
| 27706 </reaction> | |
| 27707 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R01829" metaid="ae2b0fad-a87b-4705-98d1-66acb580d07e" name="sedoheptulose 1,7-bisphosphate D-glyceraldehyde-3-phosphate-lyase" reversible="true"> | |
| 27708 <notes> | |
| 27709 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27710 <p>SUBSYSTEM: Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27711 <p>EC_NUMBER: 4.1.2.13</p> | |
| 27712 <p>GENE_ASSOCIATION: buc_BU451</p> | |
| 27713 </body> | |
| 27714 </notes> | |
| 27715 <annotation> | |
| 27716 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27717 <rdf:Description rdf:about="#ae2b0fad-a87b-4705-98d1-66acb580d07e"> | |
| 27718 <bqbiol:is> | |
| 27719 <rdf:Bag> | |
| 27720 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.1.2.13"/> | |
| 27721 </rdf:Bag> | |
| 27722 </bqbiol:is> | |
| 27723 </rdf:Description> | |
| 27724 </rdf:RDF> | |
| 27725 </annotation> | |
| 27726 <fbc:geneProductAssociation> | |
| 27727 <fbc:geneProductRef fbc:geneProduct="buc_BU451"/> | |
| 27728 </fbc:geneProductAssociation> | |
| 27729 <listOfReactants> | |
| 27730 <speciesReference constant="true" species="C00447" stoichiometry="1"/> | |
| 27731 </listOfReactants> | |
| 27732 <listOfProducts> | |
| 27733 <speciesReference constant="true" species="C00279" stoichiometry="1"/> | |
| 27734 <speciesReference constant="true" species="C00111" stoichiometry="1"/> | |
| 27735 </listOfProducts> | |
| 27736 </reaction> | |
| 27737 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R02918" metaid="_3f65e7ea-790a-41bd-9f03-659babee9605" name="L-Tyrosine:tRNA(Tyr) ligase (AMP-forming)" reversible="false"> | |
| 27738 <notes> | |
| 27739 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27740 <p>SUBSYSTEM: Aminoacyl-tRNA biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27741 <p>EC_NUMBER: 6.1.1.1</p> | |
| 27742 <p>GENE_ASSOCIATION: buc_BU121</p> | |
| 27743 </body> | |
| 27744 </notes> | |
| 27745 <annotation> | |
| 27746 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27747 <rdf:Description rdf:about="#_3f65e7ea-790a-41bd-9f03-659babee9605"> | |
| 27748 <bqbiol:is> | |
| 27749 <rdf:Bag> | |
| 27750 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.1.1.1"/> | |
| 27751 </rdf:Bag> | |
| 27752 </bqbiol:is> | |
| 27753 </rdf:Description> | |
| 27754 </rdf:RDF> | |
| 27755 </annotation> | |
| 27756 <fbc:geneProductAssociation> | |
| 27757 <fbc:geneProductRef fbc:geneProduct="buc_BU121"/> | |
| 27758 </fbc:geneProductAssociation> | |
| 27759 <listOfReactants> | |
| 27760 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 27761 <speciesReference constant="true" species="C00082" stoichiometry="1"/> | |
| 27762 <speciesReference constant="true" species="C00787" stoichiometry="1"/> | |
| 27763 </listOfReactants> | |
| 27764 <listOfProducts> | |
| 27765 <speciesReference constant="true" species="C00013" stoichiometry="1"/> | |
| 27766 <speciesReference constant="true" species="C02839" stoichiometry="1"/> | |
| 27767 <speciesReference constant="true" species="C00020" stoichiometry="1"/> | |
| 27768 </listOfProducts> | |
| 27769 </reaction> | |
| 27770 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00734" metaid="_7d20c94f-eb94-42b3-b823-02693199e73f" name="L-tyrosine:2-oxoglutarate aminotransferase" reversible="true"> | |
| 27771 <notes> | |
| 27772 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27773 <p>SUBSYSTEM: Phenylalanine, tyrosine and tryptophan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27774 <p>EC_NUMBER: 2.6.1.9</p> | |
| 27775 <p>GENE_ASSOCIATION: buc_BU101</p> | |
| 27776 </body> | |
| 27777 </notes> | |
| 27778 <annotation> | |
| 27779 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27780 <rdf:Description rdf:about="#_7d20c94f-eb94-42b3-b823-02693199e73f"> | |
| 27781 <bqbiol:is> | |
| 27782 <rdf:Bag> | |
| 27783 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.6.1.9"/> | |
| 27784 </rdf:Bag> | |
| 27785 </bqbiol:is> | |
| 27786 </rdf:Description> | |
| 27787 </rdf:RDF> | |
| 27788 </annotation> | |
| 27789 <fbc:geneProductAssociation> | |
| 27790 <fbc:geneProductRef fbc:geneProduct="buc_BU101"/> | |
| 27791 </fbc:geneProductAssociation> | |
| 27792 <listOfReactants> | |
| 27793 <speciesReference constant="true" species="C00026" stoichiometry="1"/> | |
| 27794 <speciesReference constant="true" species="C00082" stoichiometry="1"/> | |
| 27795 </listOfReactants> | |
| 27796 <listOfProducts> | |
| 27797 <speciesReference constant="true" species="C00025" stoichiometry="1"/> | |
| 27798 <speciesReference constant="true" species="C01179" stoichiometry="1"/> | |
| 27799 </listOfProducts> | |
| 27800 </reaction> | |
| 27801 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R05199" metaid="_483a2e54-8c26-4b90-85e0-4bbd4ef251a3" name="protein-N(pi)-phosphohistidine:N-acetyl-D-glucosamine 6-phosphotransferase" reversible="false"> | |
| 27802 <notes> | |
| 27803 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27804 <p>SUBSYSTEM: Amino sugar and nucleotide sugar metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27805 <p>GENE_ASSOCIATION: buc_BU063</p> | |
| 27806 </body> | |
| 27807 </notes> | |
| 27808 <fbc:geneProductAssociation> | |
| 27809 <fbc:geneProductRef fbc:geneProduct="buc_BU063"/> | |
| 27810 </fbc:geneProductAssociation> | |
| 27811 <listOfReactants> | |
| 27812 <speciesReference constant="true" species="C04261" stoichiometry="1"/> | |
| 27813 <speciesReference constant="true" species="C00140" stoichiometry="1"/> | |
| 27814 </listOfReactants> | |
| 27815 <listOfProducts> | |
| 27816 <speciesReference constant="true" species="C00615" stoichiometry="1"/> | |
| 27817 <speciesReference constant="true" species="C00357" stoichiometry="1"/> | |
| 27818 </listOfProducts> | |
| 27819 </reaction> | |
| 27820 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R05070" metaid="_800288a6-c67f-4070-b59e-71f734110f98" name="(R)-2,3-Dihydroxy-3-methylpentanoate hydro-lyase" reversible="true"> | |
| 27821 <notes> | |
| 27822 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27823 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Valine, leucine and isoleucine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27824 <p>EC_NUMBER: 4.2.1.9</p> | |
| 27825 <p>GENE_ASSOCIATION: buc_BU600</p> | |
| 27826 </body> | |
| 27827 </notes> | |
| 27828 <annotation> | |
| 27829 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27830 <rdf:Description rdf:about="#_800288a6-c67f-4070-b59e-71f734110f98"> | |
| 27831 <bqbiol:is> | |
| 27832 <rdf:Bag> | |
| 27833 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.2.1.9"/> | |
| 27834 </rdf:Bag> | |
| 27835 </bqbiol:is> | |
| 27836 </rdf:Description> | |
| 27837 </rdf:RDF> | |
| 27838 </annotation> | |
| 27839 <fbc:geneProductAssociation> | |
| 27840 <fbc:geneProductRef fbc:geneProduct="buc_BU600"/> | |
| 27841 </fbc:geneProductAssociation> | |
| 27842 <listOfReactants> | |
| 27843 <speciesReference constant="true" species="C06007" stoichiometry="1"/> | |
| 27844 </listOfReactants> | |
| 27845 <listOfProducts> | |
| 27846 <speciesReference constant="true" species="C00671" stoichiometry="1"/> | |
| 27847 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 27848 </listOfProducts> | |
| 27849 </reaction> | |
| 27850 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R05071" metaid="ed11e357-4d26-47a3-8759-be698cec1ea7" name="(S)-2-Acetolactate methylmutase" reversible="true"> | |
| 27851 <notes> | |
| 27852 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27853 <p>SUBSYSTEM: 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Valine, leucine and isoleucine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27854 <p>EC_NUMBER: 1.1.1.86</p> | |
| 27855 <p>GENE_ASSOCIATION: buc_BU599</p> | |
| 27856 </body> | |
| 27857 </notes> | |
| 27858 <annotation> | |
| 27859 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27860 <rdf:Description rdf:about="#ed11e357-4d26-47a3-8759-be698cec1ea7"> | |
| 27861 <bqbiol:is> | |
| 27862 <rdf:Bag> | |
| 27863 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.86"/> | |
| 27864 </rdf:Bag> | |
| 27865 </bqbiol:is> | |
| 27866 </rdf:Description> | |
| 27867 </rdf:RDF> | |
| 27868 </annotation> | |
| 27869 <fbc:geneProductAssociation> | |
| 27870 <fbc:geneProductRef fbc:geneProduct="buc_BU599"/> | |
| 27871 </fbc:geneProductAssociation> | |
| 27872 <listOfReactants> | |
| 27873 <speciesReference constant="true" species="C06010" stoichiometry="1"/> | |
| 27874 </listOfReactants> | |
| 27875 <listOfProducts> | |
| 27876 <speciesReference constant="true" species="C04181" stoichiometry="1"/> | |
| 27877 </listOfProducts> | |
| 27878 </reaction> | |
| 27879 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R08648" metaid="_86cda564-6859-4be1-a3a2-883e2a915e88" name="pyruvate:2-oxobutanoate acetaldehydetransferase (decarboxylating)" reversible="true"> | |
| 27880 <notes> | |
| 27881 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27882 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Valine, leucine and isoleucine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27883 <p>EC_NUMBER: 2.2.1.6</p> | |
| 27884 <p>GENE_ASSOCIATION: ( buc_BU225 ) OR ( buc_BU226 )</p> | |
| 27885 </body> | |
| 27886 </notes> | |
| 27887 <annotation> | |
| 27888 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27889 <rdf:Description rdf:about="#_86cda564-6859-4be1-a3a2-883e2a915e88"> | |
| 27890 <bqbiol:is> | |
| 27891 <rdf:Bag> | |
| 27892 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.2.1.6"/> | |
| 27893 </rdf:Bag> | |
| 27894 </bqbiol:is> | |
| 27895 </rdf:Description> | |
| 27896 </rdf:RDF> | |
| 27897 </annotation> | |
| 27898 <fbc:geneProductAssociation> | |
| 27899 <fbc:or> | |
| 27900 <fbc:geneProductRef fbc:geneProduct="buc_BU225"/> | |
| 27901 <fbc:geneProductRef fbc:geneProduct="buc_BU226"/> | |
| 27902 </fbc:or> | |
| 27903 </fbc:geneProductAssociation> | |
| 27904 <listOfReactants> | |
| 27905 <speciesReference constant="true" species="C00022" stoichiometry="1"/> | |
| 27906 <speciesReference constant="true" species="C00109" stoichiometry="1"/> | |
| 27907 </listOfReactants> | |
| 27908 <listOfProducts> | |
| 27909 <speciesReference constant="true" species="C06006" stoichiometry="1"/> | |
| 27910 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 27911 </listOfProducts> | |
| 27912 </reaction> | |
| 27913 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00921" metaid="_54cc9e0f-1e3b-47e9-8f3f-edbdd07b67a6" name="propanoyl-CoA:phosphate propanoyltransferase" reversible="true"> | |
| 27914 <notes> | |
| 27915 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27916 <p>SUBSYSTEM: Propanoate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27917 <p>EC_NUMBER: 2.3.1.8</p> | |
| 27918 <p>GENE_ASSOCIATION: buc_BU176</p> | |
| 27919 </body> | |
| 27920 </notes> | |
| 27921 <annotation> | |
| 27922 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27923 <rdf:Description rdf:about="#_54cc9e0f-1e3b-47e9-8f3f-edbdd07b67a6"> | |
| 27924 <bqbiol:is> | |
| 27925 <rdf:Bag> | |
| 27926 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.3.1.8"/> | |
| 27927 </rdf:Bag> | |
| 27928 </bqbiol:is> | |
| 27929 </rdf:Description> | |
| 27930 </rdf:RDF> | |
| 27931 </annotation> | |
| 27932 <fbc:geneProductAssociation> | |
| 27933 <fbc:geneProductRef fbc:geneProduct="buc_BU176"/> | |
| 27934 </fbc:geneProductAssociation> | |
| 27935 <listOfReactants> | |
| 27936 <speciesReference constant="true" species="C00100" stoichiometry="1"/> | |
| 27937 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 27938 </listOfReactants> | |
| 27939 <listOfProducts> | |
| 27940 <speciesReference constant="true" species="C00010" stoichiometry="1"/> | |
| 27941 <speciesReference constant="true" species="C02876" stoichiometry="1"/> | |
| 27942 </listOfProducts> | |
| 27943 </reaction> | |
| 27944 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04173" metaid="f0fddbb2-14f9-4f22-84e2-9cc5b54395f8" name="3-Phosphoserine:2-oxoglutarate aminotransferase" reversible="true"> | |
| 27945 <notes> | |
| 27946 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27947 <p>SUBSYSTEM: Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Methane metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glycine, serine and threonine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Cysteine and methionine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27948 <p>EC_NUMBER: 2.6.1.52</p> | |
| 27949 <p>GENE_ASSOCIATION: buc_BU312</p> | |
| 27950 </body> | |
| 27951 </notes> | |
| 27952 <annotation> | |
| 27953 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27954 <rdf:Description rdf:about="#f0fddbb2-14f9-4f22-84e2-9cc5b54395f8"> | |
| 27955 <bqbiol:is> | |
| 27956 <rdf:Bag> | |
| 27957 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.6.1.52"/> | |
| 27958 </rdf:Bag> | |
| 27959 </bqbiol:is> | |
| 27960 </rdf:Description> | |
| 27961 </rdf:RDF> | |
| 27962 </annotation> | |
| 27963 <fbc:geneProductAssociation> | |
| 27964 <fbc:geneProductRef fbc:geneProduct="buc_BU312"/> | |
| 27965 </fbc:geneProductAssociation> | |
| 27966 <listOfReactants> | |
| 27967 <speciesReference constant="true" species="C00026" stoichiometry="1"/> | |
| 27968 <speciesReference constant="true" species="C01005" stoichiometry="1"/> | |
| 27969 </listOfReactants> | |
| 27970 <listOfProducts> | |
| 27971 <speciesReference constant="true" species="C03232" stoichiometry="1"/> | |
| 27972 <speciesReference constant="true" species="C00025" stoichiometry="1"/> | |
| 27973 </listOfProducts> | |
| 27974 </reaction> | |
| 27975 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03084" metaid="dbd46e6c-16d0-48b0-8c7f-22a16933fb29" name="3-Dehydroquinate hydro-lyase" reversible="true"> | |
| 27976 <notes> | |
| 27977 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 27978 <p>SUBSYSTEM: Phenylalanine, tyrosine and tryptophan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 27979 <p>EC_NUMBER: 4.2.1.10</p> | |
| 27980 <p>GENE_ASSOCIATION: buc_BU399</p> | |
| 27981 </body> | |
| 27982 </notes> | |
| 27983 <annotation> | |
| 27984 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 27985 <rdf:Description rdf:about="#dbd46e6c-16d0-48b0-8c7f-22a16933fb29"> | |
| 27986 <bqbiol:is> | |
| 27987 <rdf:Bag> | |
| 27988 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.2.1.10"/> | |
| 27989 </rdf:Bag> | |
| 27990 </bqbiol:is> | |
| 27991 </rdf:Description> | |
| 27992 </rdf:RDF> | |
| 27993 </annotation> | |
| 27994 <fbc:geneProductAssociation> | |
| 27995 <fbc:geneProductRef fbc:geneProduct="buc_BU399"/> | |
| 27996 </fbc:geneProductAssociation> | |
| 27997 <listOfReactants> | |
| 27998 <speciesReference constant="true" species="C00944" stoichiometry="1"/> | |
| 27999 </listOfReactants> | |
| 28000 <listOfProducts> | |
| 28001 <speciesReference constant="true" species="C02637" stoichiometry="1"/> | |
| 28002 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 28003 </listOfProducts> | |
| 28004 </reaction> | |
| 28005 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03083" metaid="_0e7a8bca-6aeb-41aa-ac5f-64dbc233cb5a" name="2-Dehydro-3-deoxy-D-arabino-heptonate 7-phosphate phosphate-lyase (cyclyzing)" reversible="true"> | |
| 28006 <notes> | |
| 28007 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28008 <p>SUBSYSTEM: Phenylalanine, tyrosine and tryptophan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28009 <p>EC_NUMBER: 4.2.3.4</p> | |
| 28010 <p>GENE_ASSOCIATION: buc_BU538</p> | |
| 28011 </body> | |
| 28012 </notes> | |
| 28013 <annotation> | |
| 28014 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 28015 <rdf:Description rdf:about="#_0e7a8bca-6aeb-41aa-ac5f-64dbc233cb5a"> | |
| 28016 <bqbiol:is> | |
| 28017 <rdf:Bag> | |
| 28018 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.2.3.4"/> | |
| 28019 </rdf:Bag> | |
| 28020 </bqbiol:is> | |
| 28021 </rdf:Description> | |
| 28022 </rdf:RDF> | |
| 28023 </annotation> | |
| 28024 <fbc:geneProductAssociation> | |
| 28025 <fbc:geneProductRef fbc:geneProduct="buc_BU538"/> | |
| 28026 </fbc:geneProductAssociation> | |
| 28027 <listOfReactants> | |
| 28028 <speciesReference constant="true" species="C04691" stoichiometry="1"/> | |
| 28029 </listOfReactants> | |
| 28030 <listOfProducts> | |
| 28031 <speciesReference constant="true" species="C00944" stoichiometry="1"/> | |
| 28032 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 28033 </listOfProducts> | |
| 28034 </reaction> | |
| 28035 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R06590" metaid="cf1353e9-d7da-4e66-aa3e-6a1f1fe89cdb" name="sedoheptulose-7-phosphate:D-glyceraldehyde-3-phosphate glycolaldehydetransferase" reversible="true"> | |
| 28036 <notes> | |
| 28037 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28038 <p>SUBSYSTEM: Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28039 <p>EC_NUMBER: 2.2.1.1</p> | |
| 28040 <p>GENE_ASSOCIATION: buc_BU094</p> | |
| 28041 </body> | |
| 28042 </notes> | |
| 28043 <annotation> | |
| 28044 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 28045 <rdf:Description rdf:about="#cf1353e9-d7da-4e66-aa3e-6a1f1fe89cdb"> | |
| 28046 <bqbiol:is> | |
| 28047 <rdf:Bag> | |
| 28048 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.2.1.1"/> | |
| 28049 </rdf:Bag> | |
| 28050 </bqbiol:is> | |
| 28051 </rdf:Description> | |
| 28052 </rdf:RDF> | |
| 28053 </annotation> | |
| 28054 <fbc:geneProductAssociation> | |
| 28055 <fbc:geneProductRef fbc:geneProduct="buc_BU094"/> | |
| 28056 </fbc:geneProductAssociation> | |
| 28057 <listOfReactants> | |
| 28058 <speciesReference constant="true" species="C00117" stoichiometry="1"/> | |
| 28059 <speciesReference constant="true" species="C12214" stoichiometry="1"/> | |
| 28060 </listOfReactants> | |
| 28061 <listOfProducts> | |
| 28062 <speciesReference constant="true" species="C05382" stoichiometry="1"/> | |
| 28063 <speciesReference constant="true" species="C12215" stoichiometry="1"/> | |
| 28064 </listOfProducts> | |
| 28065 </reaction> | |
| 28066 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R08645" metaid="b87a33c5-2012-44b8-a6b8-787fad0bf609" name="2-(3'-methylthio)heptylmalate hydroxymutase" reversible="false"> | |
| 28067 <notes> | |
| 28068 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28069 <p>SUBSYSTEM: 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28070 <p>GENE_ASSOCIATION: buc_BUpL06</p> | |
| 28071 </body> | |
| 28072 </notes> | |
| 28073 <fbc:geneProductAssociation> | |
| 28074 <fbc:geneProductRef fbc:geneProduct="buc_BUpL06"/> | |
| 28075 </fbc:geneProductAssociation> | |
| 28076 <listOfReactants> | |
| 28077 <speciesReference constant="true" species="C17230" stoichiometry="1"/> | |
| 28078 </listOfReactants> | |
| 28079 <listOfProducts> | |
| 28080 <speciesReference constant="true" species="C17231" stoichiometry="1"/> | |
| 28081 </listOfProducts> | |
| 28082 </reaction> | |
| 28083 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R05132" metaid="f707c473-5abe-42a7-b759-f47db06f1efc" name="protein-N(pi)-phosphohistidine:arbutin 6-phosphotransferase" reversible="false"> | |
| 28084 <notes> | |
| 28085 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28086 <p>SUBSYSTEM: Glycolysis / Gluconeogenesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28087 <p>GENE_ASSOCIATION: buc_BU063</p> | |
| 28088 </body> | |
| 28089 </notes> | |
| 28090 <fbc:geneProductAssociation> | |
| 28091 <fbc:geneProductRef fbc:geneProduct="buc_BU063"/> | |
| 28092 </fbc:geneProductAssociation> | |
| 28093 <listOfReactants> | |
| 28094 <speciesReference constant="true" species="C04261" stoichiometry="1"/> | |
| 28095 <speciesReference constant="true" species="C06186" stoichiometry="1"/> | |
| 28096 </listOfReactants> | |
| 28097 <listOfProducts> | |
| 28098 <speciesReference constant="true" species="C00615" stoichiometry="1"/> | |
| 28099 <speciesReference constant="true" species="C06187" stoichiometry="1"/> | |
| 28100 </listOfProducts> | |
| 28101 </reaction> | |
| 28102 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R08641" metaid="a3798973-a630-4f6b-82ae-a7b6d338b87a" name="2-(3'-methylthio)hexylmalate hydroxymutase" reversible="false"> | |
| 28103 <notes> | |
| 28104 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28105 <p>SUBSYSTEM: 2-Oxocarboxylic acid metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28106 <p>GENE_ASSOCIATION: buc_BUpL06</p> | |
| 28107 </body> | |
| 28108 </notes> | |
| 28109 <fbc:geneProductAssociation> | |
| 28110 <fbc:geneProductRef fbc:geneProduct="buc_BUpL06"/> | |
| 28111 </fbc:geneProductAssociation> | |
| 28112 <listOfReactants> | |
| 28113 <speciesReference constant="true" species="C17226" stoichiometry="1"/> | |
| 28114 </listOfReactants> | |
| 28115 <listOfProducts> | |
| 28116 <speciesReference constant="true" species="C17227" stoichiometry="1"/> | |
| 28117 </listOfProducts> | |
| 28118 </reaction> | |
| 28119 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03192" metaid="_887b9ed7-0247-4f07-b9f1-610243623b31" name="UDP-N-acetylmuramate:NADP+ oxidoreductase" reversible="true"> | |
| 28120 <notes> | |
| 28121 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28122 <p>SUBSYSTEM: Amino sugar and nucleotide sugar metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Peptidoglycan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of nucleotide sugars - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28123 <p>EC_NUMBER: 1.3.1.98</p> | |
| 28124 <p>GENE_ASSOCIATION: buc_BU045</p> | |
| 28125 </body> | |
| 28126 </notes> | |
| 28127 <annotation> | |
| 28128 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 28129 <rdf:Description rdf:about="#_887b9ed7-0247-4f07-b9f1-610243623b31"> | |
| 28130 <bqbiol:is> | |
| 28131 <rdf:Bag> | |
| 28132 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.3.1.98"/> | |
| 28133 </rdf:Bag> | |
| 28134 </bqbiol:is> | |
| 28135 </rdf:Description> | |
| 28136 </rdf:RDF> | |
| 28137 </annotation> | |
| 28138 <fbc:geneProductAssociation> | |
| 28139 <fbc:geneProductRef fbc:geneProduct="buc_BU045"/> | |
| 28140 </fbc:geneProductAssociation> | |
| 28141 <listOfReactants> | |
| 28142 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 28143 <speciesReference constant="true" species="C01050" stoichiometry="1"/> | |
| 28144 </listOfReactants> | |
| 28145 <listOfProducts> | |
| 28146 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 28147 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 28148 <speciesReference constant="true" species="C04631" stoichiometry="1"/> | |
| 28149 </listOfProducts> | |
| 28150 </reaction> | |
| 28151 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03191" metaid="b1d18ebf-c9d3-42aa-ad33-04050706fd9a" name="UDP-N-acetylmuramate:NADP+ oxidoreductase" reversible="true"> | |
| 28152 <notes> | |
| 28153 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28154 <p>SUBSYSTEM: Amino sugar and nucleotide sugar metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Peptidoglycan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28155 <p>EC_NUMBER: 1.3.1.98</p> | |
| 28156 <p>GENE_ASSOCIATION: buc_BU045</p> | |
| 28157 </body> | |
| 28158 </notes> | |
| 28159 <annotation> | |
| 28160 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 28161 <rdf:Description rdf:about="#b1d18ebf-c9d3-42aa-ad33-04050706fd9a"> | |
| 28162 <bqbiol:is> | |
| 28163 <rdf:Bag> | |
| 28164 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.3.1.98"/> | |
| 28165 </rdf:Bag> | |
| 28166 </bqbiol:is> | |
| 28167 </rdf:Description> | |
| 28168 </rdf:RDF> | |
| 28169 </annotation> | |
| 28170 <fbc:geneProductAssociation> | |
| 28171 <fbc:geneProductRef fbc:geneProduct="buc_BU045"/> | |
| 28172 </fbc:geneProductAssociation> | |
| 28173 <listOfReactants> | |
| 28174 <speciesReference constant="true" species="C01050" stoichiometry="1"/> | |
| 28175 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 28176 </listOfReactants> | |
| 28177 <listOfProducts> | |
| 28178 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 28179 <speciesReference constant="true" species="C04631" stoichiometry="1"/> | |
| 28180 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 28181 </listOfProducts> | |
| 28182 </reaction> | |
| 28183 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03194" metaid="bb04886a-b95c-4969-92e3-fbbbfba4e8d4" name="S-adenosyl-L-methionine:uroporphyrinogen-III C-methyltransferase" reversible="true"> | |
| 28184 <notes> | |
| 28185 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28186 <p>SUBSYSTEM: Porphyrin metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28187 <p>EC_NUMBER: 2.1.1.107</p> | |
| 28188 <p>GENE_ASSOCIATION: buc_BU425</p> | |
| 28189 </body> | |
| 28190 </notes> | |
| 28191 <annotation> | |
| 28192 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 28193 <rdf:Description rdf:about="#bb04886a-b95c-4969-92e3-fbbbfba4e8d4"> | |
| 28194 <bqbiol:is> | |
| 28195 <rdf:Bag> | |
| 28196 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.1.1.107"/> | |
| 28197 </rdf:Bag> | |
| 28198 </bqbiol:is> | |
| 28199 </rdf:Description> | |
| 28200 </rdf:RDF> | |
| 28201 </annotation> | |
| 28202 <fbc:geneProductAssociation> | |
| 28203 <fbc:geneProductRef fbc:geneProduct="buc_BU425"/> | |
| 28204 </fbc:geneProductAssociation> | |
| 28205 <listOfReactants> | |
| 28206 <speciesReference constant="true" species="C00019" stoichiometry="2"/> | |
| 28207 <speciesReference constant="true" species="C01051" stoichiometry="1"/> | |
| 28208 </listOfReactants> | |
| 28209 <listOfProducts> | |
| 28210 <speciesReference constant="true" species="C02463" stoichiometry="1"/> | |
| 28211 <speciesReference constant="true" species="C00021" stoichiometry="2"/> | |
| 28212 </listOfProducts> | |
| 28213 </reaction> | |
| 28214 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R03193" metaid="_5215bd08-0660-4284-852e-5d8c8b199ea2" name="UDP-N-acetylmuramate:L-alanine ligase (ADP-forming)" reversible="true"> | |
| 28215 <notes> | |
| 28216 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28217 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Peptidoglycan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28218 <p>EC_NUMBER: 6.3.2.8</p> | |
| 28219 <p>GENE_ASSOCIATION: buc_BU215</p> | |
| 28220 </body> | |
| 28221 </notes> | |
| 28222 <annotation> | |
| 28223 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 28224 <rdf:Description rdf:about="#_5215bd08-0660-4284-852e-5d8c8b199ea2"> | |
| 28225 <bqbiol:is> | |
| 28226 <rdf:Bag> | |
| 28227 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.3.2.8"/> | |
| 28228 </rdf:Bag> | |
| 28229 </bqbiol:is> | |
| 28230 </rdf:Description> | |
| 28231 </rdf:RDF> | |
| 28232 </annotation> | |
| 28233 <fbc:geneProductAssociation> | |
| 28234 <fbc:geneProductRef fbc:geneProduct="buc_BU215"/> | |
| 28235 </fbc:geneProductAssociation> | |
| 28236 <listOfReactants> | |
| 28237 <speciesReference constant="true" species="C01050" stoichiometry="1"/> | |
| 28238 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 28239 <speciesReference constant="true" species="C00041" stoichiometry="1"/> | |
| 28240 </listOfReactants> | |
| 28241 <listOfProducts> | |
| 28242 <speciesReference constant="true" species="C01212" stoichiometry="1"/> | |
| 28243 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 28244 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 28245 </listOfProducts> | |
| 28246 </reaction> | |
| 28247 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00945" metaid="cce27c55-c4ac-4d70-8b34-6d9a8de3956a" name="5,10-Methylenetetrahydrofolate:glycine hydroxymethyltransferase" reversible="true"> | |
| 28248 <notes> | |
| 28249 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28250 <p>SUBSYSTEM: Glyoxylate and dicarboxylate metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || One carbon pool by folate - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Methane metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum) || Glycine, serine and threonine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28251 <p>EC_NUMBER: 2.1.2.1</p> | |
| 28252 <p>GENE_ASSOCIATION: buc_BU289</p> | |
| 28253 </body> | |
| 28254 </notes> | |
| 28255 <annotation> | |
| 28256 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 28257 <rdf:Description rdf:about="#cce27c55-c4ac-4d70-8b34-6d9a8de3956a"> | |
| 28258 <bqbiol:is> | |
| 28259 <rdf:Bag> | |
| 28260 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.1.2.1"/> | |
| 28261 </rdf:Bag> | |
| 28262 </bqbiol:is> | |
| 28263 </rdf:Description> | |
| 28264 </rdf:RDF> | |
| 28265 </annotation> | |
| 28266 <fbc:geneProductAssociation> | |
| 28267 <fbc:geneProductRef fbc:geneProduct="buc_BU289"/> | |
| 28268 </fbc:geneProductAssociation> | |
| 28269 <listOfReactants> | |
| 28270 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 28271 <speciesReference constant="true" species="C00143" stoichiometry="1"/> | |
| 28272 <speciesReference constant="true" species="C00037" stoichiometry="1"/> | |
| 28273 </listOfReactants> | |
| 28274 <listOfProducts> | |
| 28275 <speciesReference constant="true" species="C00101" stoichiometry="1"/> | |
| 28276 <speciesReference constant="true" species="C00065" stoichiometry="1"/> | |
| 28277 </listOfProducts> | |
| 28278 </reaction> | |
| 28279 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00946" metaid="cbb95b23-e137-49d9-9e5f-f3ff73e5375c" name="5-methyltetrahydrofolate:L-homocysteine S-methyltransferase" reversible="true"> | |
| 28280 <notes> | |
| 28281 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28282 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28283 <p>GENE_ASSOCIATION: buc_BU030</p> | |
| 28284 </body> | |
| 28285 </notes> | |
| 28286 <fbc:geneProductAssociation> | |
| 28287 <fbc:geneProductRef fbc:geneProduct="buc_BU030"/> | |
| 28288 </fbc:geneProductAssociation> | |
| 28289 <listOfReactants> | |
| 28290 <speciesReference constant="true" species="C00440" stoichiometry="1"/> | |
| 28291 <speciesReference constant="true" species="C00155" stoichiometry="1"/> | |
| 28292 </listOfReactants> | |
| 28293 <listOfProducts> | |
| 28294 <speciesReference constant="true" species="C00101" stoichiometry="1"/> | |
| 28295 <speciesReference constant="true" species="C00073" stoichiometry="1"/> | |
| 28296 </listOfProducts> | |
| 28297 </reaction> | |
| 28298 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00940" metaid="a95083f3-a79e-4466-9313-45ba78030e40" name="5,6,7,8-tetrahydrofolate:NADP+ oxidoreductase" reversible="true"> | |
| 28299 <notes> | |
| 28300 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28301 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || One carbon pool by folate - Buchnera aphidicola APS (Acyrthosiphon pisum) || Folate biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28302 <p>EC_NUMBER: 1.5.1.3</p> | |
| 28303 <p>GENE_ASSOCIATION: buc_BU143</p> | |
| 28304 </body> | |
| 28305 </notes> | |
| 28306 <annotation> | |
| 28307 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 28308 <rdf:Description rdf:about="#a95083f3-a79e-4466-9313-45ba78030e40"> | |
| 28309 <bqbiol:is> | |
| 28310 <rdf:Bag> | |
| 28311 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.5.1.3"/> | |
| 28312 </rdf:Bag> | |
| 28313 </bqbiol:is> | |
| 28314 </rdf:Description> | |
| 28315 </rdf:RDF> | |
| 28316 </annotation> | |
| 28317 <fbc:geneProductAssociation> | |
| 28318 <fbc:geneProductRef fbc:geneProduct="buc_BU143"/> | |
| 28319 </fbc:geneProductAssociation> | |
| 28320 <listOfReactants> | |
| 28321 <speciesReference constant="true" species="C00101" stoichiometry="1"/> | |
| 28322 <speciesReference constant="true" species="C00006" stoichiometry="2"/> | |
| 28323 </listOfReactants> | |
| 28324 <listOfProducts> | |
| 28325 <speciesReference constant="true" species="C00080" stoichiometry="2"/> | |
| 28326 <speciesReference constant="true" species="C00005" stoichiometry="2"/> | |
| 28327 <speciesReference constant="true" species="C00504" stoichiometry="1"/> | |
| 28328 </listOfProducts> | |
| 28329 </reaction> | |
| 28330 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R08549" metaid="_9bc37b0b-d841-4bde-baeb-59e077aaf669" name="2-oxoglutarate:NAD+ 2-oxidoreductase (CoA-succinylating)" reversible="true"> | |
| 28331 <notes> | |
| 28332 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28333 <p>SUBSYSTEM: Carbon metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28334 <p>GENE_ASSOCIATION: ( buc_BU207 ) OR ( buc_BU302 ) OR ( buc_BU303 )</p> | |
| 28335 </body> | |
| 28336 </notes> | |
| 28337 <fbc:geneProductAssociation> | |
| 28338 <fbc:or> | |
| 28339 <fbc:geneProductRef fbc:geneProduct="buc_BU302"/> | |
| 28340 <fbc:geneProductRef fbc:geneProduct="buc_BU207"/> | |
| 28341 <fbc:geneProductRef fbc:geneProduct="buc_BU303"/> | |
| 28342 </fbc:or> | |
| 28343 </fbc:geneProductAssociation> | |
| 28344 <listOfReactants> | |
| 28345 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 28346 <speciesReference constant="true" species="C00026" stoichiometry="1"/> | |
| 28347 <speciesReference constant="true" species="C00010" stoichiometry="1"/> | |
| 28348 </listOfReactants> | |
| 28349 <listOfProducts> | |
| 28350 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 28351 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 28352 <speciesReference constant="true" species="C00091" stoichiometry="1"/> | |
| 28353 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 28354 </listOfProducts> | |
| 28355 </reaction> | |
| 28356 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00941" metaid="_8a3649e2-76cb-426a-8af4-2df9701ef61b" name="10-formyltetrahydrofolate:NADP+ oxidoreductase" reversible="true"> | |
| 28357 <notes> | |
| 28358 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28359 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28360 <p>GENE_ASSOCIATION: ( buc_BU031 ) OR ( buc_BU497 )</p> | |
| 28361 </body> | |
| 28362 </notes> | |
| 28363 <fbc:geneProductAssociation> | |
| 28364 <fbc:or> | |
| 28365 <fbc:geneProductRef fbc:geneProduct="buc_BU031"/> | |
| 28366 <fbc:geneProductRef fbc:geneProduct="buc_BU497"/> | |
| 28367 </fbc:or> | |
| 28368 </fbc:geneProductAssociation> | |
| 28369 <listOfReactants> | |
| 28370 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 28371 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 28372 <speciesReference constant="true" species="C00234" stoichiometry="1"/> | |
| 28373 </listOfReactants> | |
| 28374 <listOfProducts> | |
| 28375 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 28376 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 28377 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 28378 <speciesReference constant="true" species="C00101" stoichiometry="1"/> | |
| 28379 </listOfProducts> | |
| 28380 </reaction> | |
| 28381 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00942" metaid="f5099e99-f60d-4a6b-b2c5-e74ec80e6eb0" name="Tetrahydrofolate:L-glutamate gamma-ligase (ADP-forming)" reversible="true"> | |
| 28382 <notes> | |
| 28383 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28384 <p>SUBSYSTEM: Folate biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28385 <p>EC_NUMBER: 6.3.2.17</p> | |
| 28386 <p>GENE_ASSOCIATION: buc_BU167</p> | |
| 28387 </body> | |
| 28388 </notes> | |
| 28389 <annotation> | |
| 28390 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 28391 <rdf:Description rdf:about="#f5099e99-f60d-4a6b-b2c5-e74ec80e6eb0"> | |
| 28392 <bqbiol:is> | |
| 28393 <rdf:Bag> | |
| 28394 <rdf:li rdf:resource="https://identifiers.org/ec-code/6.3.2.17"/> | |
| 28395 </rdf:Bag> | |
| 28396 </bqbiol:is> | |
| 28397 </rdf:Description> | |
| 28398 </rdf:RDF> | |
| 28399 </annotation> | |
| 28400 <fbc:geneProductAssociation> | |
| 28401 <fbc:geneProductRef fbc:geneProduct="buc_BU167"/> | |
| 28402 </fbc:geneProductAssociation> | |
| 28403 <listOfReactants> | |
| 28404 <speciesReference constant="true" species="C00025" stoichiometry="1"/> | |
| 28405 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 28406 <speciesReference constant="true" species="C00101" stoichiometry="1"/> | |
| 28407 </listOfReactants> | |
| 28408 <listOfProducts> | |
| 28409 <speciesReference constant="true" species="C09332" stoichiometry="1"/> | |
| 28410 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 28411 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 28412 </listOfProducts> | |
| 28413 </reaction> | |
| 28414 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00943" metaid="_7b586e40-3e9f-49da-b2fa-83eaeb780816" name="Formate:tetrahydrofolate ligase (ADP-forming)" reversible="true"> | |
| 28415 <notes> | |
| 28416 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28417 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28418 <p>GENE_ASSOCIATION: ( buc_BU031 ) OR ( buc_BU497 )</p> | |
| 28419 </body> | |
| 28420 </notes> | |
| 28421 <fbc:geneProductAssociation> | |
| 28422 <fbc:or> | |
| 28423 <fbc:geneProductRef fbc:geneProduct="buc_BU031"/> | |
| 28424 <fbc:geneProductRef fbc:geneProduct="buc_BU497"/> | |
| 28425 </fbc:or> | |
| 28426 </fbc:geneProductAssociation> | |
| 28427 <listOfReactants> | |
| 28428 <speciesReference constant="true" species="C00058" stoichiometry="1"/> | |
| 28429 <speciesReference constant="true" species="C00002" stoichiometry="1"/> | |
| 28430 <speciesReference constant="true" species="C00101" stoichiometry="1"/> | |
| 28431 </listOfReactants> | |
| 28432 <listOfProducts> | |
| 28433 <speciesReference constant="true" species="C00008" stoichiometry="1"/> | |
| 28434 <speciesReference constant="true" species="C00009" stoichiometry="1"/> | |
| 28435 <speciesReference constant="true" species="C00234" stoichiometry="1"/> | |
| 28436 </listOfProducts> | |
| 28437 </reaction> | |
| 28438 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00944" metaid="_7ee64ec6-928b-4ca8-97d5-4b793a721622" name="10-Formyltetrahydrofolate amidohydrolase" reversible="true"> | |
| 28439 <notes> | |
| 28440 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28441 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28442 <p>GENE_ASSOCIATION: ( buc_BU031 ) OR ( buc_BU497 )</p> | |
| 28443 </body> | |
| 28444 </notes> | |
| 28445 <fbc:geneProductAssociation> | |
| 28446 <fbc:or> | |
| 28447 <fbc:geneProductRef fbc:geneProduct="buc_BU031"/> | |
| 28448 <fbc:geneProductRef fbc:geneProduct="buc_BU497"/> | |
| 28449 </fbc:or> | |
| 28450 </fbc:geneProductAssociation> | |
| 28451 <listOfReactants> | |
| 28452 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 28453 <speciesReference constant="true" species="C00234" stoichiometry="1"/> | |
| 28454 </listOfReactants> | |
| 28455 <listOfProducts> | |
| 28456 <speciesReference constant="true" species="C00101" stoichiometry="1"/> | |
| 28457 <speciesReference constant="true" species="C00058" stoichiometry="1"/> | |
| 28458 </listOfProducts> | |
| 28459 </reaction> | |
| 28460 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04198" metaid="ef218711-7532-43f9-b060-609efaf09e2f" name="2,3,4,5-tetrahydrodipicolinate:NAD+ 4-oxidoreductase" reversible="true"> | |
| 28461 <notes> | |
| 28462 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28463 <p>SUBSYSTEM: Lysine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Monobactam biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28464 <p>EC_NUMBER: 1.17.1.8</p> | |
| 28465 <p>GENE_ASSOCIATION: buc_BU146</p> | |
| 28466 </body> | |
| 28467 </notes> | |
| 28468 <annotation> | |
| 28469 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 28470 <rdf:Description rdf:about="#ef218711-7532-43f9-b060-609efaf09e2f"> | |
| 28471 <bqbiol:is> | |
| 28472 <rdf:Bag> | |
| 28473 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.17.1.8"/> | |
| 28474 </rdf:Bag> | |
| 28475 </bqbiol:is> | |
| 28476 </rdf:Description> | |
| 28477 </rdf:RDF> | |
| 28478 </annotation> | |
| 28479 <fbc:geneProductAssociation> | |
| 28480 <fbc:geneProductRef fbc:geneProduct="buc_BU146"/> | |
| 28481 </fbc:geneProductAssociation> | |
| 28482 <listOfReactants> | |
| 28483 <speciesReference constant="true" species="C03972" stoichiometry="1"/> | |
| 28484 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 28485 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 28486 </listOfReactants> | |
| 28487 <listOfProducts> | |
| 28488 <speciesReference constant="true" species="C20258" stoichiometry="1"/> | |
| 28489 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 28490 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 28491 </listOfProducts> | |
| 28492 </reaction> | |
| 28493 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R10866" metaid="_66f0dbdf-d7ad-47e9-b240-facc4f38fc8f" name="pyruvate:flavodoxin 2-oxidoreductase (CoA-acetylating)" reversible="true"> | |
| 28494 <notes> | |
| 28495 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28496 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28497 <p>GENE_ASSOCIATION: ( buc_BU205 ) OR ( buc_BU206 ) OR ( buc_BU207 )</p> | |
| 28498 </body> | |
| 28499 </notes> | |
| 28500 <fbc:geneProductAssociation> | |
| 28501 <fbc:or> | |
| 28502 <fbc:geneProductRef fbc:geneProduct="buc_BU206"/> | |
| 28503 <fbc:geneProductRef fbc:geneProduct="buc_BU207"/> | |
| 28504 <fbc:geneProductRef fbc:geneProduct="buc_BU205"/> | |
| 28505 </fbc:or> | |
| 28506 </fbc:geneProductAssociation> | |
| 28507 <listOfReactants> | |
| 28508 <speciesReference constant="true" species="C02869" stoichiometry="1"/> | |
| 28509 <speciesReference constant="true" species="C00022" stoichiometry="1"/> | |
| 28510 <speciesReference constant="true" species="C00010" stoichiometry="1"/> | |
| 28511 </listOfReactants> | |
| 28512 <listOfProducts> | |
| 28513 <speciesReference constant="true" species="C00024" stoichiometry="1"/> | |
| 28514 <speciesReference constant="true" species="C00011" stoichiometry="1"/> | |
| 28515 <speciesReference constant="true" species="C02745" stoichiometry="1"/> | |
| 28516 </listOfProducts> | |
| 28517 </reaction> | |
| 28518 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R04199" metaid="fdeacab6-a3d1-4e8b-a7cc-f8cce793500c" name="2,3,4,5-tetrahydrodipicolinate:NADP+ 4-oxidoreductase" reversible="true"> | |
| 28519 <notes> | |
| 28520 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28521 <p>SUBSYSTEM: Lysine biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of secondary metabolites - Buchnera aphidicola APS (Acyrthosiphon pisum) || Microbial metabolism in diverse environments - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of amino acids - Buchnera aphidicola APS (Acyrthosiphon pisum) || Monobactam biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28522 <p>EC_NUMBER: 1.17.1.8</p> | |
| 28523 <p>GENE_ASSOCIATION: buc_BU146</p> | |
| 28524 </body> | |
| 28525 </notes> | |
| 28526 <annotation> | |
| 28527 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 28528 <rdf:Description rdf:about="#fdeacab6-a3d1-4e8b-a7cc-f8cce793500c"> | |
| 28529 <bqbiol:is> | |
| 28530 <rdf:Bag> | |
| 28531 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.17.1.8"/> | |
| 28532 </rdf:Bag> | |
| 28533 </bqbiol:is> | |
| 28534 </rdf:Description> | |
| 28535 </rdf:RDF> | |
| 28536 </annotation> | |
| 28537 <fbc:geneProductAssociation> | |
| 28538 <fbc:geneProductRef fbc:geneProduct="buc_BU146"/> | |
| 28539 </fbc:geneProductAssociation> | |
| 28540 <listOfReactants> | |
| 28541 <speciesReference constant="true" species="C03972" stoichiometry="1"/> | |
| 28542 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 28543 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 28544 </listOfReactants> | |
| 28545 <listOfProducts> | |
| 28546 <speciesReference constant="true" species="C20258" stoichiometry="1"/> | |
| 28547 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 28548 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 28549 </listOfProducts> | |
| 28550 </reaction> | |
| 28551 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R09769" metaid="_503fc668-66ac-4b42-ac82-07ecc6687259" name="D-glycero-alpha-D-manno-heptose 7-phosphate aldose-ketose-isomerase" reversible="true"> | |
| 28552 <notes> | |
| 28553 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28554 <p>SUBSYSTEM: Lipopolysaccharide biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of nucleotide sugars - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28555 <p>EC_NUMBER: 5.3.1.28</p> | |
| 28556 <p>GENE_ASSOCIATION: buc_BU250</p> | |
| 28557 </body> | |
| 28558 </notes> | |
| 28559 <annotation> | |
| 28560 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 28561 <rdf:Description rdf:about="#_503fc668-66ac-4b42-ac82-07ecc6687259"> | |
| 28562 <bqbiol:is> | |
| 28563 <rdf:Bag> | |
| 28564 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.3.1.28"/> | |
| 28565 </rdf:Bag> | |
| 28566 </bqbiol:is> | |
| 28567 </rdf:Description> | |
| 28568 </rdf:RDF> | |
| 28569 </annotation> | |
| 28570 <fbc:geneProductAssociation> | |
| 28571 <fbc:geneProductRef fbc:geneProduct="buc_BU250"/> | |
| 28572 </fbc:geneProductAssociation> | |
| 28573 <listOfReactants> | |
| 28574 <speciesReference constant="true" species="C05382" stoichiometry="1"/> | |
| 28575 </listOfReactants> | |
| 28576 <listOfProducts> | |
| 28577 <speciesReference constant="true" species="C19878" stoichiometry="1"/> | |
| 28578 </listOfProducts> | |
| 28579 </reaction> | |
| 28580 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R08559" metaid="_5eff31f9-b7b0-41be-adb2-5f0eab9844b4" name="protein-N(pi)-phosphohistidine:N-acetylmuramate 6-phosphotransferase" reversible="false"> | |
| 28581 <notes> | |
| 28582 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28583 <p>SUBSYSTEM: Amino sugar and nucleotide sugar metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28584 <p>GENE_ASSOCIATION: buc_BU063</p> | |
| 28585 </body> | |
| 28586 </notes> | |
| 28587 <fbc:geneProductAssociation> | |
| 28588 <fbc:geneProductRef fbc:geneProduct="buc_BU063"/> | |
| 28589 </fbc:geneProductAssociation> | |
| 28590 <listOfReactants> | |
| 28591 <speciesReference constant="true" species="C04261" stoichiometry="1"/> | |
| 28592 <speciesReference constant="true" species="C02713" stoichiometry="1"/> | |
| 28593 </listOfReactants> | |
| 28594 <listOfProducts> | |
| 28595 <speciesReference constant="true" species="C16698" stoichiometry="1"/> | |
| 28596 <speciesReference constant="true" species="C00615" stoichiometry="1"/> | |
| 28597 </listOfProducts> | |
| 28598 </reaction> | |
| 28599 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R07460" metaid="_15cebad5-93b2-4c11-998c-062c80f0b481" name="L-cysteine:[enzyme]-cysteine sulfurtransferase" reversible="true"> | |
| 28600 <notes> | |
| 28601 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28602 <p>SUBSYSTEM: Thiamine metabolism - Buchnera aphidicola APS (Acyrthosiphon pisum) || Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28603 <p>EC_NUMBER: 2.8.1.7</p> | |
| 28604 <p>GENE_ASSOCIATION: buc_BU602</p> | |
| 28605 </body> | |
| 28606 </notes> | |
| 28607 <annotation> | |
| 28608 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 28609 <rdf:Description rdf:about="#_15cebad5-93b2-4c11-998c-062c80f0b481"> | |
| 28610 <bqbiol:is> | |
| 28611 <rdf:Bag> | |
| 28612 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.8.1.7"/> | |
| 28613 </rdf:Bag> | |
| 28614 </bqbiol:is> | |
| 28615 </rdf:Description> | |
| 28616 </rdf:RDF> | |
| 28617 </annotation> | |
| 28618 <fbc:geneProductAssociation> | |
| 28619 <fbc:geneProductRef fbc:geneProduct="buc_BU602"/> | |
| 28620 </fbc:geneProductAssociation> | |
| 28621 <listOfReactants> | |
| 28622 <speciesReference constant="true" species="C15811" stoichiometry="1"/> | |
| 28623 <speciesReference constant="true" species="C00097" stoichiometry="1"/> | |
| 28624 </listOfReactants> | |
| 28625 <listOfProducts> | |
| 28626 <speciesReference constant="true" species="C00041" stoichiometry="1"/> | |
| 28627 <speciesReference constant="true" species="C15812" stoichiometry="1"/> | |
| 28628 </listOfProducts> | |
| 28629 </reaction> | |
| 28630 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00936" metaid="_723ab612-cb0c-4bed-ad02-369d1df4e42e" name="5,6,7,8-tetrahydrofolate:NAD+ oxidoreductase" reversible="true"> | |
| 28631 <notes> | |
| 28632 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28633 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || One carbon pool by folate - Buchnera aphidicola APS (Acyrthosiphon pisum) || Folate biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28634 <p>EC_NUMBER: 1.5.1.3</p> | |
| 28635 <p>GENE_ASSOCIATION: buc_BU143</p> | |
| 28636 </body> | |
| 28637 </notes> | |
| 28638 <annotation> | |
| 28639 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 28640 <rdf:Description rdf:about="#_723ab612-cb0c-4bed-ad02-369d1df4e42e"> | |
| 28641 <bqbiol:is> | |
| 28642 <rdf:Bag> | |
| 28643 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.5.1.3"/> | |
| 28644 </rdf:Bag> | |
| 28645 </bqbiol:is> | |
| 28646 </rdf:Description> | |
| 28647 </rdf:RDF> | |
| 28648 </annotation> | |
| 28649 <fbc:geneProductAssociation> | |
| 28650 <fbc:geneProductRef fbc:geneProduct="buc_BU143"/> | |
| 28651 </fbc:geneProductAssociation> | |
| 28652 <listOfReactants> | |
| 28653 <speciesReference constant="true" species="C00101" stoichiometry="1"/> | |
| 28654 <speciesReference constant="true" species="C00003" stoichiometry="1"/> | |
| 28655 </listOfReactants> | |
| 28656 <listOfProducts> | |
| 28657 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 28658 <speciesReference constant="true" species="C00415" stoichiometry="1"/> | |
| 28659 <speciesReference constant="true" species="C00004" stoichiometry="1"/> | |
| 28660 </listOfProducts> | |
| 28661 </reaction> | |
| 28662 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00937" metaid="_62675de1-6210-493f-9cd2-cd48edcd41e0" name="5,6,7,8-tetrahydrofolate:NAD+ oxidoreductase" reversible="true"> | |
| 28663 <notes> | |
| 28664 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28665 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || One carbon pool by folate - Buchnera aphidicola APS (Acyrthosiphon pisum) || Folate biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28666 <p>EC_NUMBER: 1.5.1.3</p> | |
| 28667 <p>GENE_ASSOCIATION: buc_BU143</p> | |
| 28668 </body> | |
| 28669 </notes> | |
| 28670 <annotation> | |
| 28671 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 28672 <rdf:Description rdf:about="#_62675de1-6210-493f-9cd2-cd48edcd41e0"> | |
| 28673 <bqbiol:is> | |
| 28674 <rdf:Bag> | |
| 28675 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.5.1.3"/> | |
| 28676 </rdf:Bag> | |
| 28677 </bqbiol:is> | |
| 28678 </rdf:Description> | |
| 28679 </rdf:RDF> | |
| 28680 </annotation> | |
| 28681 <fbc:geneProductAssociation> | |
| 28682 <fbc:geneProductRef fbc:geneProduct="buc_BU143"/> | |
| 28683 </fbc:geneProductAssociation> | |
| 28684 <listOfReactants> | |
| 28685 <speciesReference constant="true" species="C00101" stoichiometry="1"/> | |
| 28686 <speciesReference constant="true" species="C00003" stoichiometry="2"/> | |
| 28687 </listOfReactants> | |
| 28688 <listOfProducts> | |
| 28689 <speciesReference constant="true" species="C00080" stoichiometry="2"/> | |
| 28690 <speciesReference constant="true" species="C00004" stoichiometry="2"/> | |
| 28691 <speciesReference constant="true" species="C00504" stoichiometry="1"/> | |
| 28692 </listOfProducts> | |
| 28693 </reaction> | |
| 28694 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R00939" metaid="_99af3a12-d284-4617-87b8-1c33eefe15f4" name="5,6,7,8-tetrahydrofolate:NADP+ oxidoreductase" reversible="true"> | |
| 28695 <notes> | |
| 28696 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28697 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || One carbon pool by folate - Buchnera aphidicola APS (Acyrthosiphon pisum) || Folate biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum) || Biosynthesis of cofactors - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28698 <p>EC_NUMBER: 1.5.1.3</p> | |
| 28699 <p>GENE_ASSOCIATION: buc_BU143</p> | |
| 28700 </body> | |
| 28701 </notes> | |
| 28702 <annotation> | |
| 28703 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 28704 <rdf:Description rdf:about="#_99af3a12-d284-4617-87b8-1c33eefe15f4"> | |
| 28705 <bqbiol:is> | |
| 28706 <rdf:Bag> | |
| 28707 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.5.1.3"/> | |
| 28708 </rdf:Bag> | |
| 28709 </bqbiol:is> | |
| 28710 </rdf:Description> | |
| 28711 </rdf:RDF> | |
| 28712 </annotation> | |
| 28713 <fbc:geneProductAssociation> | |
| 28714 <fbc:geneProductRef fbc:geneProduct="buc_BU143"/> | |
| 28715 </fbc:geneProductAssociation> | |
| 28716 <listOfReactants> | |
| 28717 <speciesReference constant="true" species="C00101" stoichiometry="1"/> | |
| 28718 <speciesReference constant="true" species="C00006" stoichiometry="1"/> | |
| 28719 </listOfReactants> | |
| 28720 <listOfProducts> | |
| 28721 <speciesReference constant="true" species="C00080" stoichiometry="1"/> | |
| 28722 <speciesReference constant="true" species="C00005" stoichiometry="1"/> | |
| 28723 <speciesReference constant="true" species="C00415" stoichiometry="1"/> | |
| 28724 </listOfProducts> | |
| 28725 </reaction> | |
| 28726 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R05032" metaid="e1c5ab23-36d5-427b-8f55-220d74146e1e" name="UDP-N-acetyl-D-glucosamine:undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-gamma-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine 4-beta-N-acetylglucosaminlytransferase" reversible="true"> | |
| 28727 <notes> | |
| 28728 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28729 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Peptidoglycan biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28730 <p>EC_NUMBER: 2.4.1.227</p> | |
| 28731 <p>GENE_ASSOCIATION: buc_BU216</p> | |
| 28732 </body> | |
| 28733 </notes> | |
| 28734 <annotation> | |
| 28735 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 28736 <rdf:Description rdf:about="#e1c5ab23-36d5-427b-8f55-220d74146e1e"> | |
| 28737 <bqbiol:is> | |
| 28738 <rdf:Bag> | |
| 28739 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.4.1.227"/> | |
| 28740 </rdf:Bag> | |
| 28741 </bqbiol:is> | |
| 28742 </rdf:Description> | |
| 28743 </rdf:RDF> | |
| 28744 </annotation> | |
| 28745 <fbc:geneProductAssociation> | |
| 28746 <fbc:geneProductRef fbc:geneProduct="buc_BU216"/> | |
| 28747 </fbc:geneProductAssociation> | |
| 28748 <listOfReactants> | |
| 28749 <speciesReference constant="true" species="C00043" stoichiometry="1"/> | |
| 28750 <speciesReference constant="true" species="C05897" stoichiometry="1"/> | |
| 28751 </listOfReactants> | |
| 28752 <listOfProducts> | |
| 28753 <speciesReference constant="true" species="C00015" stoichiometry="1"/> | |
| 28754 <speciesReference constant="true" species="C05898" stoichiometry="1"/> | |
| 28755 </listOfProducts> | |
| 28756 </reaction> | |
| 28757 <reaction fbc:lowerFluxBound="LOWER_BOUND_99999_0" fbc:upperFluxBound="UPPER_BOUND_99999_0" id="R10859" metaid="a2dbda09-1883-4324-822d-a0f2a574c50a" name="(E)-4-hydroxy-3-methylbut-2-en-1-yl-diphosphate:oxidized flavodoxin oxidoreductase" reversible="true"> | |
| 28758 <notes> | |
| 28759 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 28760 <p>SUBSYSTEM: Metabolic pathways - Buchnera aphidicola APS (Acyrthosiphon pisum) || Terpenoid backbone biosynthesis - Buchnera aphidicola APS (Acyrthosiphon pisum)</p> | |
| 28761 <p>EC_NUMBER: 1.17.7.3</p> | |
| 28762 <p>GENE_ASSOCIATION: buc_BU287</p> | |
| 28763 </body> | |
| 28764 </notes> | |
| 28765 <annotation> | |
| 28766 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 28767 <rdf:Description rdf:about="#a2dbda09-1883-4324-822d-a0f2a574c50a"> | |
| 28768 <bqbiol:is> | |
| 28769 <rdf:Bag> | |
| 28770 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.17.7.3"/> | |
| 28771 </rdf:Bag> | |
| 28772 </bqbiol:is> | |
| 28773 </rdf:Description> | |
| 28774 </rdf:RDF> | |
| 28775 </annotation> | |
| 28776 <fbc:geneProductAssociation> | |
| 28777 <fbc:geneProductRef fbc:geneProduct="buc_BU287"/> | |
| 28778 </fbc:geneProductAssociation> | |
| 28779 <listOfReactants> | |
| 28780 <speciesReference constant="true" species="C11811" stoichiometry="1"/> | |
| 28781 <speciesReference constant="true" species="C00001" stoichiometry="1"/> | |
| 28782 <speciesReference constant="true" species="C02869" stoichiometry="1"/> | |
| 28783 </listOfReactants> | |
| 28784 <listOfProducts> | |
| 28785 <speciesReference constant="true" species="C02745" stoichiometry="1"/> | |
| 28786 <speciesReference constant="true" species="C11453" stoichiometry="1"/> | |
| 28787 </listOfProducts> | |
| 28788 </reaction> | |
| 28789 </listOfReactions> | |
| 28790 </model> | |
| 28791 </sbml> |