--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/retropath2.xml	Mon Dec 20 15:24:52 2021 +0000
@@ -0,0 +1,135 @@
+<tool id="retropath2" name="RetroPath2.0" version="2.0.5">
+    <description>Build a reaction network from a set of source compounds to a set of sink compounds</description>
+    <requirements>
+        <requirement type="package" version="2.0.5">retropath2_wrapper</requirement>
+    </requirements>
+    <stdio>
+        <exit_code range="1" level="fatal"   description="Source has been found in the sink"                          />
+        <exit_code range="2" level="fatal"   description="Cannot find source-in-sink file"                            />
+        <exit_code range="3" level="fatal"   description="Running the RetroPath2.0 Knime program produced an OSError" />
+        <exit_code range="4" level="warning" description="RetroPath2.0 has found no solution"                         />
+        <exit_code range="5" level="warning" description="Time limit reached"                                         />
+	</stdio>
+    <command detect_errors="exit_code"><![CDATA[
+        python -m retropath2_wrapper
+            '$sinkfile'
+            '$rulesfile'
+            out
+            --source_inchi '$source_inchi'
+            #if $source_name:
+                --source_name '$source_name'
+            #end if
+            --max_steps '$adv.max_steps'
+            --topx '$adv.topx'
+            --dmin '$adv.dmin'
+            --dmax '$adv.dmax'
+            --mwmax_source '$adv.mwmax_source'
+            --mwmax_cof '$adv.mwmax_cof'
+            --timeout '$adv.timeout';
+        if compgen -G 'out/*_scope.csv' > /dev/null; then
+            cp out/*_scope.csv '$Reaction_Network';
+        else
+            cp out/results.csv '$Reaction_Network';
+        fi
+    ]]></command>
+    <inputs>
+        <param name="rulesfile"    type="data" format="csv" label="Rules File"             />
+        <param name="sinkfile"     type="data" format="csv" label="Sink File"              />
+        <param name="source_inchi" type="text"       label="Source InChI"     optional="false"    >
+            <validator type="empty_field" message="You must provide the InChI key" />
+        </param>
+        <param name="source_name"  type="text" value="target" optional="true" label="Source name"         />
+        <section name="adv" title="Advanced Options" expanded="false">
+            <param name="max_steps"    type="integer" value="3" label="Maximal Pathway length" />
+            <param name="topx"         type="integer" value="100"  label="TopX"                                  />
+            <param name="dmin"         type="integer" value="0"    label="Minimum rule diameter"                 />
+            <param name="dmax"         type="integer" value="1000" label="Maximum rule diameter"                 />
+            <param name="mwmax_source" type="integer" value="1000" label="Molecular weight of source (Da)"       />
+            <param name="mwmax_cof"    type="integer" value="1000" label="Molecular weight of cofactors (Da)" />
+            <param name="timeout"      type="integer" value="60"   label="Timeout (min)"                         />
+        </section>
+    </inputs>
+    <outputs>
+	    <data name="Reaction_Network" format="csv" label="${tool.name}" />
+    </outputs>
+    <tests>
+        <test>
+        <!-- test 1: check if identical outputs are produced with default parameters  -->
+            <param name="rulesfile" value="rules.csv.gz" />
+            <param name="sinkfile" value="sink.csv" />
+            <param name="source_inchi" value="InChI=1S/C6H6O4/c7-5(8)3-1-2-4-6(9)10/h1-4H,(H,7,8)(H,9,10)/p-2" />
+            <output name="Reaction_Network" file="results_retropath2.csv" ftype="csv" compare="diff"/>
+        </test>
+    </tests>
+    <help><![CDATA[
+Retropath2.0 wrapper
+====================
+
+
+Perform retrosynthesis search of possible metabolic routes between a source molecule and a collection of sink molecules. Docker implementation of the KNIME retropath2.0 workflow. Takes for input the minimal (dmin) and maximal (dmax) diameter for the reaction rules and the maximal path length (maxSteps). The docker mounts a local folder and expects the following files: rules.csv, sink.csv and source.csv. We only support a single source molecule at this time.
+
+Input
+-----
+
+Required:
+
+
+* **-sinkfile**\ : (string) Path to the sink file
+* **-sourcefile**\ : (string) Path to the source file
+* **-max_steps**\ : (integer) Maximal number of steps
+* **-rulesfile**\ : (string) Path to the rules file
+* **-rulesfile_format**\ : (string) Valid Options: tar, csv. Format of the rules file
+
+Advanced options:
+
+
+* **-topx**\ : (integer, default: 100) For each iteration, number of rules
+* **-dmin**\ : (integer, default: 0)
+* **-dmax**\ : (integer, default: 1000)
+* **-mwmax_source**\ : (integer, default: 1000)
+* **-mwmax_cof**\ : (integer, default: 1000)
+* **-timeout**\ : (integer, default: 30) Timeout in minutes
+
+Output
+------
+
+
+* **-scope_csv**\ : (string) Path to the output scope csv file
+
+Version
+-------
+
+v2.0.4
+
+Authors
+-------
+
+
+* **Melchior du Lac**
+* Joan Hérisson
+
+License
+-------
+
+This project is licensed under the MIT License.
+
+Acknowledgments
+---------------
+
+
+* Thomas Duigou
+
+    ]]></help>
+    <citations>
+        <citation type="bibtex">
+@article{delepine2018retropath2,
+  title={RetroPath2. 0: a retrosynthesis workflow for metabolic engineers},
+  author={Del{\'e}pine, Baudoin and Duigou, Thomas and Carbonell, Pablo and Faulon, Jean-Loup},
+  journal={Metabolic engineering},
+  volume={45},
+  pages={158--170},
+  year={2018},
+  publisher={Elsevier}}
+        </citation>
+    </citations>
+</tool>
\ No newline at end of file